drupal-7.41/0000755000000000000000000000000012611767501011440 5ustar rootrootdrupal-7.41/robots.txt0000644000000000000000000000270712611765734013525 0ustar rootroot# # robots.txt # # This file is to prevent the crawling and indexing of certain parts # of your site by web crawlers and spiders run by sites like Yahoo! # and Google. By telling these "robots" where not to go on your site, # you save bandwidth and server resources. # # This file will be ignored unless it is at the root of your host: # Used: http://example.com/robots.txt # Ignored: http://example.com/site/robots.txt # # For more information about the robots.txt standard, see: # http://www.robotstxt.org/robotstxt.html User-agent: * Crawl-delay: 10 # Directories Disallow: /includes/ Disallow: /misc/ Disallow: /modules/ Disallow: /profiles/ Disallow: /scripts/ Disallow: /themes/ # Files Disallow: /CHANGELOG.txt Disallow: /cron.php Disallow: /INSTALL.mysql.txt Disallow: /INSTALL.pgsql.txt Disallow: /INSTALL.sqlite.txt Disallow: /install.php Disallow: /INSTALL.txt Disallow: /LICENSE.txt Disallow: /MAINTAINERS.txt Disallow: /update.php Disallow: /UPGRADE.txt Disallow: /xmlrpc.php # Paths (clean URLs) Disallow: /admin/ Disallow: /comment/reply/ Disallow: /filter/tips/ Disallow: /node/add/ Disallow: /search/ Disallow: /user/register/ Disallow: /user/password/ Disallow: /user/login/ Disallow: /user/logout/ # Paths (no clean URLs) Disallow: /?q=admin/ Disallow: /?q=comment/reply/ Disallow: /?q=filter/tips/ Disallow: /?q=node/add/ Disallow: /?q=search/ Disallow: /?q=user/password/ Disallow: /?q=user/register/ Disallow: /?q=user/login/ Disallow: /?q=user/logout/ drupal-7.41/update.php0000644000000000000000000004702212611765734013446 0ustar rootroot TRUE, '#type' => 'fieldset', '#collapsed' => TRUE, '#collapsible' => TRUE, ); // Ensure system.module's updates appear first. $form['start']['system'] = array(); $updates = update_get_update_list(); $starting_updates = array(); $incompatible_updates_exist = FALSE; foreach ($updates as $module => $update) { if (!isset($update['start'])) { $form['start'][$module] = array( '#type' => 'item', '#title' => $module . ' module', '#markup' => $update['warning'], '#prefix' => '
', '#suffix' => '
', ); $incompatible_updates_exist = TRUE; continue; } if (!empty($update['pending'])) { $starting_updates[$module] = $update['start']; $form['start'][$module] = array( '#type' => 'hidden', '#value' => $update['start'], ); $form['start'][$module . '_updates'] = array( '#theme' => 'item_list', '#items' => $update['pending'], '#title' => $module . ' module', ); } if (isset($update['pending'])) { $count = $count + count($update['pending']); } } // Find and label any incompatible updates. foreach (update_resolve_dependencies($starting_updates) as $function => $data) { if (!$data['allowed']) { $incompatible_updates_exist = TRUE; $incompatible_count++; $module_update_key = $data['module'] . '_updates'; if (isset($form['start'][$module_update_key]['#items'][$data['number']])) { $text = $data['missing_dependencies'] ? 'This update will been skipped due to the following missing dependencies: ' . implode(', ', $data['missing_dependencies']) . '' : "This update will be skipped due to an error in the module's code."; $form['start'][$module_update_key]['#items'][$data['number']] .= '
' . $text . '
'; } // Move the module containing this update to the top of the list. $form['start'] = array($module_update_key => $form['start'][$module_update_key]) + $form['start']; } } // Warn the user if any updates were incompatible. if ($incompatible_updates_exist) { drupal_set_message('Some of the pending updates cannot be applied because their dependencies were not met.', 'warning'); } if (empty($count)) { drupal_set_message(t('No pending updates.')); unset($form); $form['links'] = array( '#markup' => theme('item_list', array('items' => update_helpful_links())), ); // No updates to run, so caches won't get flushed later. Clear them now. drupal_flush_all_caches(); } else { $form['help'] = array( '#markup' => '

The version of Drupal you are updating from has been automatically detected.

', '#weight' => -5, ); if ($incompatible_count) { $form['start']['#title'] = format_plural( $count, '1 pending update (@number_applied to be applied, @number_incompatible skipped)', '@count pending updates (@number_applied to be applied, @number_incompatible skipped)', array('@number_applied' => $count - $incompatible_count, '@number_incompatible' => $incompatible_count) ); } else { $form['start']['#title'] = format_plural($count, '1 pending update', '@count pending updates'); } $form['has_js'] = array( '#type' => 'hidden', '#default_value' => FALSE, ); $form['actions'] = array('#type' => 'actions'); $form['actions']['submit'] = array( '#type' => 'submit', '#value' => 'Apply pending updates', ); } return $form; } /** * Provides links to the homepage and administration pages. */ function update_helpful_links() { $links[] = 'Front page'; if (user_access('access administration pages')) { $links[] = 'Administration pages'; } return $links; } /** * Displays results of the update script with any accompanying errors. */ function update_results_page() { drupal_set_title('Drupal database update'); $links = update_helpful_links(); update_task_list(); // Report end result. if (module_exists('dblog') && user_access('access site reports')) { $log_message = ' All errors have been logged.'; } else { $log_message = ' All errors have been logged.'; } if ($_SESSION['update_success']) { $output = '

Updates were attempted. If you see no failures below, you may proceed happily back to your site. Otherwise, you may need to update your database manually.' . $log_message . '

'; } else { $updates_remaining = reset($_SESSION['updates_remaining']); list($module, $version) = array_pop($updates_remaining); $output = '

The update process was aborted prematurely while running update #' . $version . ' in ' . $module . '.module.' . $log_message; if (module_exists('dblog')) { $output .= ' You may need to check the watchdog database table manually.'; } $output .= '

'; } if (!empty($GLOBALS['update_free_access'])) { $output .= "

Reminder: don't forget to set the \$update_free_access value in your settings.php file back to FALSE.

"; } $output .= theme('item_list', array('items' => $links)); // Output a list of queries executed. if (!empty($_SESSION['update_results'])) { $all_messages = ''; foreach ($_SESSION['update_results'] as $module => $updates) { if ($module != '#abort') { $module_has_message = FALSE; $query_messages = ''; foreach ($updates as $number => $queries) { $messages = array(); foreach ($queries as $query) { // If there is no message for this update, don't show anything. if (empty($query['query'])) { continue; } if ($query['success']) { $messages[] = '
  • ' . $query['query'] . '
    • '; } else { $messages[] = '
  • Failed: ' . $query['query'] . '
    • '; } } if ($messages) { $module_has_message = TRUE; $query_messages .= '

    Update #' . $number . "

    \n"; $query_messages .= '\n"; } } // If there were any messages in the queries then prefix them with the // module name and add it to the global message list. if ($module_has_message) { $all_messages .= '

    ' . $module . " module

    \n" . $query_messages; } } } if ($all_messages) { $output .= '

    The following updates returned messages

    '; $output .= $all_messages; $output .= '
    '; } } unset($_SESSION['update_results']); unset($_SESSION['update_success']); return $output; } /** * Provides an overview of the Drupal database update. * * This page provides cautionary suggestions that should happen before * proceeding with the update to ensure data integrity. * * @return * Rendered HTML form. */ function update_info_page() { // Change query-strings on css/js files to enforce reload for all users. _drupal_flush_css_js(); // Flush the cache of all data for the update status module. if (db_table_exists('cache_update')) { cache_clear_all('*', 'cache_update', TRUE); } update_task_list('info'); drupal_set_title('Drupal database update'); $token = drupal_get_token('update'); $output = '

    Use this utility to update your database whenever a new release of Drupal or a module is installed.

    For more detailed information, see the upgrading handbook. If you are unsure what these terms mean you should probably contact your hosting provider.

    '; $output .= "
      \n"; $output .= "
    1. Back up your database. This process will change your database values and in case of emergency you may need to revert to a backup.
      2. \n"; $output .= "
    2. Back up your code. Hint: when backing up module code, do not leave that backup in the 'modules' or 'sites/*/modules' directories as this may confuse Drupal's auto-discovery mechanism.
      3. \n"; $output .= '
    3. Put your site into maintenance mode.
      4. ' . "\n"; $output .= "
    4. Install your new files in the appropriate location, as described in the handbook.
      5. \n"; $output .= "
    \n"; $output .= "

    When you have performed the steps above, you may proceed.

    \n"; $form_action = check_url(drupal_current_script_url(array('op' => 'selection', 'token' => $token))); $output .= '

    '; $output .= "\n"; return $output; } /** * Renders a 403 access denied page for update.php. * * @return * Rendered HTML warning with 403 status. */ function update_access_denied_page() { drupal_add_http_header('Status', '403 Forbidden'); watchdog('access denied', 'update.php', NULL, WATCHDOG_WARNING); drupal_set_title('Access denied'); return '

    Access denied. You are not authorized to access this page. Log in using either an account with the administer software updates permission or the site maintenance account (the account you created during installation). If you cannot log in, you will have to edit settings.php to bypass this access check. To do this:

    1. With a text editor find the settings.php file on your system. From the main Drupal directory that you installed all the files into, go to sites/your_site_name if such directory exists, or else to sites/default which applies otherwise.
    2. There is a line inside your settings.php file that says $update_free_access = FALSE;. Change it to $update_free_access = TRUE;.
    3. As soon as the update.php script is done, you must change the settings.php file back to its original form with $update_free_access = FALSE;.
    4. To avoid having this problem in the future, remember to log in to your website using either an account with the administer software updates permission or the site maintenance account (the account you created during installation) before you backup your database at the beginning of the update process.
    '; } /** * Determines if the current user is allowed to run update.php. * * @return * TRUE if the current user should be granted access, or FALSE otherwise. */ function update_access_allowed() { global $update_free_access, $user; // Allow the global variable in settings.php to override the access check. if (!empty($update_free_access)) { return TRUE; } // Calls to user_access() might fail during the Drupal 6 to 7 update process, // so we fall back on requiring that the user be logged in as user #1. try { require_once DRUPAL_ROOT . '/' . drupal_get_path('module', 'user') . '/user.module'; return user_access('administer software updates'); } catch (Exception $e) { return ($user->uid == 1); } } /** * Adds the update task list to the current page. */ function update_task_list($active = NULL) { // Default list of tasks. $tasks = array( 'requirements' => 'Verify requirements', 'info' => 'Overview', 'select' => 'Review updates', 'run' => 'Run updates', 'finished' => 'Review log', ); drupal_add_region_content('sidebar_first', theme('task_list', array('items' => $tasks, 'active' => $active))); } /** * Returns and stores extra requirements that apply during the update process. */ function update_extra_requirements($requirements = NULL) { static $extra_requirements = array(); if (isset($requirements)) { $extra_requirements += $requirements; } return $extra_requirements; } /** * Checks update requirements and reports errors and (optionally) warnings. * * @param $skip_warnings * (optional) If set to TRUE, requirement warnings will be ignored, and a * report will only be issued if there are requirement errors. Defaults to * FALSE. */ function update_check_requirements($skip_warnings = FALSE) { // Check requirements of all loaded modules. $requirements = module_invoke_all('requirements', 'update'); $requirements += update_extra_requirements(); $severity = drupal_requirements_severity($requirements); // If there are errors, always display them. If there are only warnings, skip // them if the caller has indicated they should be skipped. if ($severity == REQUIREMENT_ERROR || ($severity == REQUIREMENT_WARNING && !$skip_warnings)) { update_task_list('requirements'); drupal_set_title('Requirements problem'); $status_report = theme('status_report', array('requirements' => $requirements)); $status_report .= 'Check the error messages and try again.'; print theme('update_page', array('content' => $status_report)); exit(); } } // Some unavoidable errors happen because the database is not yet up-to-date. // Our custom error handler is not yet installed, so we just suppress them. ini_set('display_errors', FALSE); // We prepare a minimal bootstrap for the update requirements check to avoid // reaching the PHP memory limit. require_once DRUPAL_ROOT . '/includes/bootstrap.inc'; require_once DRUPAL_ROOT . '/includes/update.inc'; require_once DRUPAL_ROOT . '/includes/common.inc'; require_once DRUPAL_ROOT . '/includes/file.inc'; require_once DRUPAL_ROOT . '/includes/entity.inc'; require_once DRUPAL_ROOT . '/includes/unicode.inc'; update_prepare_d7_bootstrap(); // Temporarily disable configurable timezones so the upgrade process uses the // site-wide timezone. This prevents a PHP notice during session initlization // and before offsets have been converted in user_update_7002(). $configurable_timezones = variable_get('configurable_timezones', 1); $conf['configurable_timezones'] = 0; // Determine if the current user has access to run update.php. drupal_bootstrap(DRUPAL_BOOTSTRAP_SESSION); // Reset configurable timezones. $conf['configurable_timezones'] = $configurable_timezones; // Only allow the requirements check to proceed if the current user has access // to run updates (since it may expose sensitive information about the site's // configuration). $op = isset($_REQUEST['op']) ? $_REQUEST['op'] : ''; if (empty($op) && update_access_allowed()) { require_once DRUPAL_ROOT . '/includes/install.inc'; require_once DRUPAL_ROOT . '/modules/system/system.install'; // Load module basics. include_once DRUPAL_ROOT . '/includes/module.inc'; $module_list['system']['filename'] = 'modules/system/system.module'; module_list(TRUE, FALSE, FALSE, $module_list); drupal_load('module', 'system'); // Reset the module_implements() cache so that any new hook implementations // in updated code are picked up. module_implements('', FALSE, TRUE); // Set up $language, since the installer components require it. drupal_language_initialize(); // Set up theme system for the maintenance page. drupal_maintenance_theme(); // Check the update requirements for Drupal. Only report on errors at this // stage, since the real requirements check happens further down. update_check_requirements(TRUE); // Redirect to the update information page if all requirements were met. install_goto('update.php?op=info'); } // update_fix_d7_requirements() needs to run before bootstrapping beyond path. // So bootstrap to DRUPAL_BOOTSTRAP_LANGUAGE then include unicode.inc. drupal_bootstrap(DRUPAL_BOOTSTRAP_LANGUAGE); include_once DRUPAL_ROOT . '/includes/unicode.inc'; update_fix_d7_requirements(); // Now proceed with a full bootstrap. drupal_bootstrap(DRUPAL_BOOTSTRAP_FULL); drupal_maintenance_theme(); // Turn error reporting back on. From now on, only fatal errors (which are // not passed through the error handler) will cause a message to be printed. ini_set('display_errors', TRUE); // Only proceed with updates if the user is allowed to run them. if (update_access_allowed()) { include_once DRUPAL_ROOT . '/includes/install.inc'; include_once DRUPAL_ROOT . '/includes/batch.inc'; drupal_load_updates(); update_fix_compatibility(); // Check the update requirements for all modules. If there are warnings, but // no errors, skip reporting them if the user has provided a URL parameter // acknowledging the warnings and indicating a desire to continue anyway. See // drupal_requirements_url(). $skip_warnings = !empty($_GET['continue']); update_check_requirements($skip_warnings); $op = isset($_REQUEST['op']) ? $_REQUEST['op'] : ''; switch ($op) { // update.php ops. case 'selection': if (isset($_GET['token']) && drupal_valid_token($_GET['token'], 'update')) { $output = update_selection_page(); break; } case 'Apply pending updates': if (isset($_GET['token']) && drupal_valid_token($_GET['token'], 'update')) { // Generate absolute URLs for the batch processing (using $base_root), // since the batch API will pass them to url() which does not handle // update.php correctly by default. $batch_url = $base_root . drupal_current_script_url(); $redirect_url = $base_root . drupal_current_script_url(array('op' => 'results')); update_batch($_POST['start'], $redirect_url, $batch_url); break; } case 'info': $output = update_info_page(); break; case 'results': $output = update_results_page(); break; // Regular batch ops : defer to batch processing API. default: update_task_list('run'); $output = _batch_page(); break; } } else { $output = update_access_denied_page(); } if (isset($output) && $output) { // Explicitly start a session so that the update.php token will be accepted. drupal_session_start(); // We defer the display of messages until all updates are done. $progress_page = ($batch = batch_get()) && isset($batch['running']); print theme('update_page', array('content' => $output, 'show_messages' => !$progress_page)); } drupal-7.41/INSTALL.sqlite.txt0000644000000000000000000000242212611765734014615 0ustar rootroot SQLITE REQUIREMENTS ------------------- To use SQLite with your Drupal installation, the following requirements must be met: Server has PHP 5.2 or later with PDO, and the PDO SQLite driver must be enabled. SQLITE DATABASE CREATION ------------------------ The Drupal installer will create the SQLite database for you. The only requirement is that the installer must have write permissions to the directory where the database file resides. This directory (not just the database file) also has to remain writeable by the web server going forward for SQLite to continue to be able to operate. On the "Database configuration" form in the "Database file" field, you must supply the exact path to where you wish your database file to reside. It is strongly suggested that you choose a path that is outside of the webroot, yet ensure that the directory is writeable by the web server. If you must place your database file in your webroot, you could try using the following in your "Database file" field: sites/default/files/.ht.sqlite Note: The .ht in the name will tell Apache to prevent the database from being downloaded. Please check that the file is, indeed, protected by your webserver. If not, please consult the documentation of your webserver on how to protect a file from downloading. drupal-7.41/INSTALL.pgsql.txt0000644000000000000000000000352212611765734014444 0ustar rootroot CREATE THE PostgreSQL DATABASE ------------------------------ Note that the database must be created with UTF-8 (Unicode) encoding. 1. CREATE DATABASE USER This step is only necessary if you don't already have a user set up (e.g., by your host), or want to create a new user for use with Drupal only. The following command creates a new user named 'username' and asks for a password for that user: createuser --pwprompt --encrypted --no-createrole --no-createdb username If there are no errors, then the command was successful. 2. CREATE DRUPAL DATABASE This step is only necessary if you don't already have a database set up (e.g., by your host) or want to create a new database for use with Drupal only. The following command creates a new database named 'databasename', which is owned by the previously created 'username': createdb --encoding=UTF8 --owner=username databasename If there are no errors, then the command was successful. 3. CREATE SCHEMA OR SCHEMAS (Optional advanced step) Drupal will run across different schemas within your database if you so wish. By default, Drupal runs inside the 'public' schema but you can use $db_prefix inside settings.php to define a schema for Drupal to run inside of, or specify tables that are shared inside of a separate schema. Drupal will not create schemas for you. In fact, the user that Drupal runs as should not be allowed to do this. You'll need to execute the SQL below as a superuser, replace 'username' with the username that Drupal uses to connect to PostgreSQL, and replace 'schema_name' with a schema name you wish to use, such as 'shared': CREATE SCHEMA schema_name AUTHORIZATION username; Do this for as many schemas as you need. See default.settings.php for instructions on how to set which tables use which schemas. drupal-7.41/install.php0000644000000000000000000000127712611765734013634 0ustar rootrootsystem requirements page for more information.'; exit; } // Start the installer. require_once DRUPAL_ROOT . '/includes/install.core.inc'; install_drupal(); drupal-7.41/COPYRIGHT.txt0000644000000000000000000000271112611765734013560 0ustar rootrootAll Drupal code is Copyright 2001 - 2013 by the original authors. This program is free software; you can redistribute it and/or modify it under the terms of the GNU General Public License as published by the Free Software Foundation; either version 2 of the License, or (at your option) any later version. This program is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details. You should have received a copy of the GNU General Public License along with this program as the file LICENSE.txt; if not, please see http://www.gnu.org/licenses/old-licenses/gpl-2.0.txt. Drupal is a registered trademark of Dries Buytaert. Drupal includes works under other copyright notices and distributed according to the terms of the GNU General Public License or a compatible license, including: Javascript Farbtastic - Copyright (c) 2010 Matt Farina jQuery - Copyright (c) 2010 John Resig jQuery BBQ - Copyright (c) 2010 "Cowboy" Ben Alman jQuery Cookie - Copyright (c) 2006 Klaus Hartl jQuery Form - Copyright (c) 2010 Mike Alsup jQuery Once - Copyright (c) 2009 Konstantin K�fer jQuery UI - Copyright (c) 2010 by the original authors (http://jqueryui.com/about) Sizzle.js - Copyright (c) 2010 The Dojo Foundation (http://sizzlejs.com/) PHP ArchiveTar - Copyright (c) 1997 - 2008 Vincent Blavet drupal-7.41/themes/0000755000000000000000000000000012611765734012733 5ustar rootrootdrupal-7.41/themes/README.txt0000644000000000000000000000067412611765734014440 0ustar rootroot This directory is reserved for core theme files. Custom or contributed themes should be placed in their own subdirectory of the sites/all/themes directory. For multisite installations, they can also be placed in a subdirectory under /sites/{sitename}/themes/, where {sitename} is the name of your site (e.g., www.example.com). This will allow you to more easily update Drupal core files. For more details, see: http://drupal.org/node/176043 drupal-7.41/themes/stark/0000755000000000000000000000000012611765734014057 5ustar rootrootdrupal-7.41/themes/stark/README.txt0000644000000000000000000000175412611765734015564 0ustar rootroot ABOUT STARK ----------- The Stark theme is provided for demonstration purposes; it uses Drupal's default HTML markup and CSS styles. It can be used as a troubleshooting tool to determine whether module-related CSS and JavaScript are interfering with a more complex theme, and can be used by designers interested in studying Drupal's default markup without the interference of changes commonly made by more complex themes. To avoid obscuring CSS added to the page by Drupal or a contrib module, the Stark theme itself has no styling, except just enough CSS to arrange the page in a traditional "Header, sidebars, content, and footer" layout. See the layout.css file for more information. ABOUT DRUPAL THEMING -------------------- To learn how to build your own custom theme and override Drupal's default code, see the Theming Guide: http://drupal.org/theme-guide See the sites/all/themes/README.txt for more information on where to place your custom themes to ensure easy maintenance and upgrades. drupal-7.41/themes/stark/layout.css0000644000000000000000000000226412611765734016112 0ustar rootroot /** * @file * Stark layout method * * To avoid obscuring CSS added to the page by Drupal or a contrib module, the * Stark theme itself has no styling, except just enough CSS to arrange the page * in a traditional "Header, sidebars, content, and footer" layout. * * This layout method works reasonably well, but shouldn't be used on a * production site because it can break. For example, if an over-large image * (one that is wider than 20% of the viewport) is in the left sidebar, the * image will overlap with the #content to the right. The exception to this * is IE6 which will just hide the navigation block completely in these * instances due to a positioning bug. */ #content, #sidebar-first, #sidebar-second { float: left; display: inline; position: relative; } #content { width: 100%; } body.sidebar-first #content { width: 80%; left: 20%; /* LTR */ } body.sidebar-second #content { width: 80%; } body.two-sidebars #content { width: 60%; left: 20%; } #sidebar-first { width: 20%; left: -80%; /* LTR */ } body.two-sidebars #sidebar-first { left: -60%; /* LTR */ } #sidebar-second { float: right; /* LTR */ width: 20%; } .section { margin: 10px; } drupal-7.41/themes/stark/stark.info0000644000000000000000000000067012611767501016055 0ustar rootrootname = Stark description = This theme demonstrates Drupal's default HTML markup and CSS styles. To learn how to build your own theme and override Drupal's default code, see the Theming Guide. package = Core version = VERSION core = 7.x stylesheets[all][] = layout.css ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/themes/stark/logo.png0000644000000000000000000000442612611765734015533 0ustar rootrootPNG  IHDRAIȭtEXtSoftwareAdobe ImageReadyqe<IDAThkpTj[Z:S;SVrm%k$@ {9r\ ,B5`AmRBYS bUHT() $~سgs6 ${N\vfAOzp~X^EpGZxs/"T7!^O3 KT5syL~M>gG) $$2* 8_(+ѳEAE!A騵皻Vo7'iQPPQQû:;7.8GF:B@=q2vf$1}e==0О&Y s#J[?ʿrI%D4"*%A#{C}Yb*Ȧ$tJB- \@m\)Vk:L66*Ijmr?廍9R)Ap̎U}1jNuԔ٫ 2  P&jdamˆJ@ҟĩւ~ sub9lڊsDVB 4HY3MľSGdֆ8PbR =!QC%I%Lle?!v'n׀hUΏ^#4\6QYQv LހQj=Nưg7?EU9%s~P+h "L`!><p,AM0sQK綏 3fӽBl+M 䈍vlgYM(2cD‹E̹Fܧ.^L;F0j[Lʼnl4Ml;-s7S; )M gk>eotWZW(-Z& Z鞝8:lK,:'2z>gwt0ۡ#ii["$g潧c1@ SsFy}u״& ,b?c]Q6&zC'csY\(Y;8rEyjxq7Ax;Pvzɤdb\z_ʋ-4kI^G&"Mza62iz0@١M}DU:seY^>W$t )ΔULE/*MYLb\MǰfHbz(t:Wb\,W*LJ~&dtH8,fbQbdj%-2\edO"ANEvAŹ{um ݰB$el#gMMYM:YU-LHtMMEH$oЙr+6^LL%?+ȄL1'"}$ #L(,]PxeW(LV\Jri UdRy$7m~?I6Iք*2$ݣݑ-"lwK. ;"7ە] ^˩T dd`Dڟӎ|A獫wV_ &bdLj0][VXY je_ܬ-ӋoZq[K>{ګ0uX!aܘL?{ IUQE0hںcxnVE֟~s̲Uʳ7=Og,ZQ(5kok˗5MZIXۊ*qgDZ{%oh['+هWvln8Z!ԍ[N I`lFiɪ4x5o> UG @co Z}xyX|O&|ZKd:ak?8/wf{[?9iI;Qٺ+@7wmg8Q[YR?|3PQ?"ByͬQ<̜Xę Ăb>\ai<^4*H<[]_4q#xQ(]_PL\.dEs.Ȣq8J 51r$DNC/+ȄLȤy{Ti (Yzdzn_ =zT-,Y< vʄ? o  ^>|dA3t1L9sLȄL"F31lcy Q̘ @c;\bbjمuq|F%M1Kv̍5C)z3L87EAꅹ9CP3ep HhҦdY O$vGcgMGbHnFT$iw {_t _;YM7c刔)'{m-Yi&ڜר9^U~5i̭JIÒ[j&`Z==ǀ:?T~07AЧhziGa3EUÒʤS^b4~;CijN]|}GN_:* r:E =a9840'Hr܌O'b=Uxӈۄ.E+!1W'%D=Va:Xi?]\ݿx]?|rL()La<ŔV8Sj5MT1 s L>|PRU(Ĩ*xosd1I ֆ%Owi6IH)sQew .rnپl灡߸l[)9G__<"!Z$n 8 pN^=}"gr&sl}ө 7īf؇ lH\AD M JۃYgpEr} vŮT٢-dۯ%ްj!gx^0A`y8r85샓b 0Q23;ZI° D@8kJߺ 33#zF~3F01F'Ahd g/Esk3c/>QfNy7)ϦFsiq'wbV+!tlL`&w4 h_x E{L ,&i)ƍaQ\ĮGB4)l]u6ݵ 16}@η~Sn7knjk.3yge&gݘ:ƭ$c8&i lT?]˚) - OڭU銗_~>_"ؑIN٭J*&2^ppoҷk 墷OɂLyCD T͜\d:=|F"d| #&Cc$BLۦEz\I00k/h]tar8OAaD"DTРC) DBLobbbVʓE c*jaHhᘶ Ǡ$MDW>Ӷi10%Ǵm8!fI{Ji4hA04IV36bG֜Wlm<e%Yti},SV{V[z1\t-:MbHcZU|a#Zdz*)VK5<ċN!PkvHj=g m s:J>K@4 E.ɕ( 5طZ~kkgϞ՘_C(FG'gd2:zƐLA.ia5Ӳs2E[8dPHٽ!@nbX:fuc&DR%&8Fՙh2J4ǔ5cC+:S*ULm4v?3)KgR RAf-TQ!qWmH[3"Q&J-e܆`3Lk7њY92D$RfLg=ܙN>XEIQ;WTQ4g:M-lcLl^Oz+7e ټZ.?L[UcD`e^Y@ }i}L.Tv71l6*4׀rW8y<+.[}n} tWْ?ˀ%(jXʆPNK`x䯺46 ǕUMEP1xڠt]{zcܺU j莐vt)Q:hݕ40HD| @H'$A>0}Rt+Z. j* )gDHݞRcs&{kk='yXUb w3 x/c%qus9[mn.^HڍnۗfN]I>rʣ0֩_jnvnD!ƖN6kQD7kOBz_!}1<^.MzYKЛG<~Y +\}@a 5EG֣hPW4;\]Q>ض?ڢ=GG\3Fמ$78mxjAmh. .7;'L\m*W'1HȳD;n{<s%]|{o̠< :EN5zA[{D)OfSN`s )G-qw\]*<:oݘY얻/*U'3JڇN]YKx|Ád7@d]ʳ45=i#x{Z .yq\"%gx9J(<.Q\GU-1Yi }sk}O7wƁe&L˛s60- ~Rn;v=3v5b/w^Ω.ˊs|ZUB5uⓃNj'I(gEVT{'?:[EJ`rkJJ*[th\<.H\Fk+<\9UJAв ^^;qsp{+2F_+t@Hxfug3n}'ǿ={sȹJij%t`b吮wxV҄"iMI{MD`?$au?hq:%-@@lջڝ Rim@'+w;38}%r;A>^ZM=r&|Tӭnjoꥑ߾LeVv |$h߁Ai*+I,#<6X/M/z+ȄB%|I0OuWF'4>P$+E r\A&o"7Z:r^ÚT@sȒlz'; Z>qɢ+ݳG#{>x. gݭO2 w(#6KM+&AF6%lԩuzRQ/E:8t !ab=|qC巨 [Z&j 2<>cюqdG"g0x[fY?1ƟQ;g>#шEQE]]"J;Ce??rpVTxű#`{OEGMQp!ku?/?3vRφ>`Օ,ɨK`̡٧ Dd"4jeE3 Fu 㹌r+=v1tIsmˌ; XR(|=`M{J $H"M$TP{a&If'>>^qg|T_~}{v;UW?>rXqپK֫U:`]Fi[&Fs]NTɭ ѱ|э5`++ͤ[WN ?S";K3U*33$Nٙ>zN|YER͵6eFȺ*]S IƾuƝr.Eu?y LaV),cbLp9rsjwՑ#>/:U|s/.:rБsW*:[|F)jIXTU#^[ ױeuؖl 9*yp)*2Xlc!&b&}}ݯƖMD5uS iM!Sƌ;z Ǽ7逿WoZ:Ip)nF |]W`$5GgY۸Í9(#96O &AC;Z% l>18P k?aq8|=[$)-j!'Mnl@k0S A4*d9Z0fbAۙ!Q/Z1V:i *!sB '}pz}gH`lihgË4ݧg7%:q\qIқ2..}35)Z4v+6rU7b.7YyjѽMnTa#r gAhdQhTDQ|wh2&>bz]EUIPe')8\n7{2GңggX<5GO'ka?cl_9 )$)hآiG/ HNgUj!EãE !э:J qfk:7hhSq[4uknHl}Ag .?>u/f! ҠAvz95F]hli"R>)ߕgOW޵]%쑓'~Y%\[֓sMEۧ޳{_;6=ɦ*xR[)!&~C r>xM}eT5c\`bS xbC^Z4?s;GKY, ˿>a{ɐ-wZfiN. NCYxK-1n[V:^[< Z RWސu>0m/ǻ;h`"UpS1$HYՃK-`Ss3cO<:ʈ^k,,iiF7GLu^K4x$ŕdWߔʺ@Ud?.;jԋ즃Y+iݐTH㽗J*CD+Yim}=@߭tzR#j7Ys`Ny !rg)a'/qii(I- 1m5Cl643*[g2H =vg&}48+ aqpￂB'lxx|1Sd{27Nk0m{:rZԦzlK'TcnHhFvW^.%*J$% ?*gM&y0*,U|lUqUɑse8qS!y[$h s47TctV<8"d3}C+~ڿp91juCu} #v-3-4][nt:N]gZ Qb>Hpl+3p LbȚ!{n`MPT^\L7t}~[O+Ă녱^G0.gLw]Gپ2 L:Lt:h;e,ݧWUQrđ/nc;&ˋ=Vu~˰wD[ޠ-~^N8\qe8WTVRVxCٞ\eIo fY| 3#N`г-`q _1/k,>L&FOGz-t >L=kªa 5g&_O( 5Qƃ43Ե&Hdzz;AH' 70 %V>93{?=t䙓{gB[X!9iB*KB{|7 y~_.B]5*m KS $ ny#*D0ct+Wb|P眎GqX89DՀ`PCTR=6.Q#g8I0 ^E&\]>(k1 nUd=TYF)TfsnkewVv߶,0:{vyGqȲO(l,+vPh"K41O܃,v'o4BkĕJX!Jz@~W婄R/+-aioiLTCT2}[f/4%մ2`#Z{$)Q5^(Ut?ng_^G2M)% ]`򵚷;y`}{=@Ѿoj[$9<>']i6ŘkkP)j&5óJY)$$i;|8!gEdVw?fhY,C7wdž)aDCAWSkz6 g~òڍ> YeMڀ,XĨ),`@Bl5B:A B%4!IR*MTPvPhi'D6{դȡӴ.}`Y%#\/&E5`BmCֆyE5`Y%}V.Ua=Zkh."[`r0b^TxǴ/seLo| O"K zgIENDB`drupal-7.41/themes/garland/0000755000000000000000000000000012611765734014343 5ustar rootrootdrupal-7.41/themes/garland/fix-ie.css0000644000000000000000000000245012611765734016237 0ustar rootroot body { /* Center layout */ text-align: center; } #header-region, #wrapper #container { /* Reset text alignment */ text-align: left; /* LTR */ } #wrapper #container #center { /* Reduce amount of damage done by extremely wide content */ overflow: hidden; } #wrapper #container #center .right-corner .left-corner { /* Because of the lack of min-height, we use height as an alternative */ height: 400px; } fieldset { /* Don't draw backgrounds on fieldsets in IE, as they look really bad. */ background: none; } div.vertical-tabs ul.vertical-tabs-list li.first { background-image: none; } ul.primary { /* Fix missing top margin */ position: relative; /* LTR */ /* top: 0.5em; */ } /* Prevent fieldsets from shifting when changing collapsed state. */ html.js fieldset.collapsible { top: -1em; } html.js fieldset.collapsed { top: 0; margin-bottom: 1em; } tr.menu-disabled { /* Use filter to emulate CSS3 opacity */ filter: alpha(opacity=50); } #header-region { /* Because of the lack of min-height, we use height as an alternative */ height: 1em; } tr.taxonomy-term-preview { filter: alpha(opacity=50); } #attach-hide label, #uploadprogress div.message { /* Fading elements in IE causes the text to bleed unless they have a background. */ background-color: #ffffff; } drupal-7.41/themes/garland/maintenance-page.tpl.php0000644000000000000000000000527512611765734021057 0ustar rootroot <?php print $head_title ?>

    drupal-7.41/themes/garland/theme-settings.php0000644000000000000000000000136112611765734020015 0ustar rootroot 'radios', '#title' => t('Content width'), '#options' => array( 'fluid' => t('Fluid width'), 'fixed' => t('Fixed width'), ), '#default_value' => theme_get_setting('garland_width'), '#description' => t('Specify whether the content will wrap to a fixed width or will fluidly expand to the width of the browser window.'), // Place this above the color scheme options. '#weight' => -2, ); } drupal-7.41/themes/garland/comment.tpl.php0000644000000000000000000000145612611765734017322 0ustar rootroot
    >
    >
    >
    —
    drupal-7.41/themes/garland/color/0000755000000000000000000000000012611765734015461 5ustar rootrootdrupal-7.41/themes/garland/color/base.png0000644000000000000000000005063612611765734017113 0ustar rootrootPNG  IHDR8ʝWQeIDATx^ 0Dbť 3x~,Oە#W6> ;I`> ||@>`>|@~,|@,> @p&䥙w?xحcAb@_ev1ڋxDXgVf~Z{o80Kà q 7oHfSw$!K~S~;-SJsn7%Ƹщ 2t&ysޛ>8~=rT|vVA0ZZM6Su%d\s.ú:uuQ_m3S::TT8piw<\Wk&E>}anLܶm*,ˊs6a9ŋZUUBjjjwM r,X&u&rmnan"[o6ܘ}agSw6ޚeeeB#y+Wz%y#l#5d oΝ{g&Mj7o|dϞ=%M۶mۯw} !*XwK,XyLqXYYNnrg M8s>629iuo3i6%|tJĎ\ȧ:Neٹ|m1iu~h8щL!k\.ۈ\=7((((fz$8 > 2{bh fˍ=1/SL[@w?$oL?ͪ4'VQ'z2lC1 >(NLe$ZR`fOX@^_[:m){BA)mGiw_%Xhs^޼)@0O[%KIV?n/|`Iy+HO8=ݨW8dR($ {'nѬ M_Bɧe`ۚliYZtNЖZIi?fYhb[#^R؏9o|v֗l$K~ٓHIRgޖ6>ݨOZ{a[\qRM] {alCw(&?ӕطxљ)C?lP6US3W[xneI. Hs>_*^q> |X5Vɛ;L my.7WI#ND.-Ron{;%|}AS+X$&6:۠^.sKұӺ^P6m>(ٮČQk+J<LK Lo,.\֣5,!c,WǼ??_+w:St(H/kr?7]w;pG=dZ ʙX-4"SݱM^jG'j^,"ߤ䊓.SٙSNvr/YIƼkwnZ[ei߮Tk)/mKᐔy_ ީI: P(*(.U٢o?0:K]aW^?qsJ~N]i;_ ed+)}d䃂KSd?2>u :qEۏ{uZz6[-?ر xޙGUe}k: aI$%QTFtTPwG7qʅQT\>Qa&NMH’uΫխ[ &aIN5_wE+*6&1[&ꆠ*{,r4ƚ}^SRwdI-egZ"qްM C D36[3{6aaq*+ *]!5jt*,=_45:C,Cagu__Zv{Hl;5uQIu.-ְ*>c? C{|Bכv:ץKNP6mnea:i1q>0_h)ݞHEѮ*t{??xQo>:u[Xr@_הÇ7:rӮ_yN="T fΝ;D8^zuMr;CyV{~j|ޔ(+++֕6W10 ð=ŭMʂ hU(B݁8=HH?W>qwԨQOC! ռLPx-h Qzb&$hZ]WnDʸ͈"U_Z&4Hʺ%h* $R薰הsz#z E~*a9IHoV6uSVGqp8]&uKhM |{nݺ' ʋ$PEQMP4W>"}DonKMlݺ I7UҸJKK7/\3f5\r2o2bĈ4-r7z*iH{nR&8D4(O>YfX0 1v-*2hѸvڍ֢JׯsP!o4B!-[p8Z0 ðw{;BIh6|1`#7agjrNVV(l9ST*ybc;dxs׮]&VͿ#A=Xr~2o{3gt:,|ڥP*o\"W۶m/PKa_lP q$fea=z^zJ:W G I6??ϛGQ1\ga CP+~>!8y[g=GF'^zͨ3FVzn~c!X GlgL< P t)/;мhtq\ K,qȐ! nnH?(|[lO>ס("`a);qZ 3$ò pN]:PrAy3vgh39KHI@t֒e!!RF[[[iZ;}ܹD=9vFQ6ϟ?wPd'@G^-p]w,Ya<_} QUB?j=z~B6mKHyK;g@xleaU4iӆ>7.\vSM::v@J@Dp9ϙR0҄pE>,(njèM"g.C={vX;_|DaaF{:СC>Qr.`ի }1];&3yн v} ;⦛nOjy iG!!zD8ƌFFίoX,^ȑ#G :1jaaFaǩ`P"hd>)ևd nGҥal̯Ģ׶# `oZN$\'5B@15:@~IN)bHsH† r|}05_[ v,O?EjyEɦG;'o߾SOm"(DqwTџcmto{ 0 ؠGJE_ht<3;:G4R|nL6 ïx{!D賈s|ZN_繏Y葑)W_1{׍@_n؃^PNp*ކ&GAa9ҸJ_= H./>o›o bKׯ%[5i QxwfyE3n}Qe$ٳIن vZr/g}PؚDxԀlMηv.JlNГeC&0 0 =-pݫ3/n8[sfa\TLr7-tAD44[n jTN^ʴmSLY Zl"SFۨ37*(*z~uꚜܿ1y}GP8~~j_tEn(('i4Zyo6mT JD Mؙ|aal6ÀC>(}#ܥ'_YPi7PLх _O6*sѵCr/0jqalݢb(#0u/&ӹWO(]BXsiP _Qm;vSO]vm䙷ӄT(,*%q_KxӠByhl^?SWӡ@uD>n3u&>蛀]R$ aa:97&ch)WSO xK18='>~*9^pZ=MI/{ yQm0`{wٜ9sr$qo>ۻws!QRROv:I|.3kP[[[)sÞI@G$Cm@c2$P:Sш >lc[}b0 0!] O @qR6\+gxq p(+-gn~x޼y+`I̢yH/=LII验,-=KL|~ݻw}I5&v'E;U9T1|Vfʵ%IB’*"˾CG`#(rHg_EG,74nrΝ;Af|>5N޸q}d/VB @D.*2 3_}K.裏Ύ~ƂݐGQZ-ú4NK﯐N! ji>8>j]D#F@"56^d?-ːSaQm;clv8q.;exոyz}\)Ajd6ڰnN']lŌCё vT.䷾xQhC}Xs60IآO) >EEʕ+ZA֞,Xu!(2V S 5RjFyQclUqTឯ|`;s{E_EݿۥP(---I0 0 |]]kP~ µ'm)bՎ| }|}k9*@p9N'˵0bB.r?vt7{I ]X~3flJ41f+NΝǚNw,_8_}Pxuao v_?E#0{("SPUKyB^>/ d&]cP4*g|dgg/Yf1٣Aaڴi,O aQ5l޷A<8U)--ŰgbͮÀ"@DϦzfE)sCEu-J羉"M|Շ_+fʗϟ??x:_PezZ6|oůz7dzȑ h^t1akcǎr] >5J$uʣ2搴BfuD$ZًҠ0uMBVj%o#ftbdm*'I >0 0|҃IWJ~_m;}eh !L_M| ) :`FҘ}fl9sV @0 <~ܿP\^竰@v}7zNfF(=U#l0*aCQ#"`k%R$ 5.JSuhV簸Ox 8q^.֪9ŽW@oc*D"+'&ciS[B?v 0 %k.E.a>R: 8̋UVȠW+GdoTU7$!R$_zDڐXo]cU║aw&AgҵZCRU qnHZH<\*ﺔ!m`_/0 0A_PvvZ6昀:W,3w1id? `DC%<,q'ҟriV7LW\_߃חnĶå"H1qX_<=RL-\S)aB\"yѯs j"+`㶽X˖,po\K܋EIE%omTC"H=R"%( :/y#0s *ׅT{2Iaz]a1db?̡rgA׀@T`tx{&5>[t&S\k%qn@),YvGulG}A\CqGⰕC]ڧڛ]Url/ \T?-F.3{,˸0 rD1?>HTE_%c| `⃠(W],^fw^UJuNY٢i~:g7gΜ1Dl!ֻOd+jua|Nv?9k !(&p*T_^ݷ{sɞgRCu ֟MQ[2jF%Rw:B)HR߶9]m<Ԋ_/۠45:tͤʯkN_Pg̡S{p_7f# nTeTe29KWM5ݸqw6_A;-Znl^rAW]t淬W+ ͉N^։kwzNNzZK?׿ޥg[%'܃@w7_m;wj])qzmPjG"HI*uV[J_}O'^WLiPb c M>F>Myby.[IyZEX@.#ER+?I]utz+3@ \0rB~e؎]e֎\A_\]QVaR.M02YU;a-wzбԱtkP~]u giF Γ+CJM9a>6{?ܻ%+ 2cw]. D0P i%(:AOIR_ AwSVL9Ŷ G?Svxbý-[l nOo\m|ej@`\ܮ|iKT4 jȲ=ãDw?fD"2ܷmAsNpZr S\A߿;v|.9cLBn7J[v<عqFOwC^=iFvJs?!+/ͯ=ס>׼3tסoI}_c.Hs Ƿ3eI8|= w3)!N=~O^wPs縚c}Fch?l}}۷&NτS|[l\vH2fsK[n>6u$V"$Eo ԤqƘ~ǒwt }0CX&iRg [ @~P7NAX/OӴS$[i4Os a^0ΰF!@buzg6_e& Aݮ pS0mufp i҉=={:Xd95}F fiz_@> oƘ9y:g:c.{RЃ5fx@OybM|zznjAP;ny^1qqt`=@1!:cҌe];&tN{  S|{A}EA-muukU4uj?pC LJ -=չ6ޟKa8QAЙ`JjIjKe_Q$U.ȻM}mOSal@ǧ0HR/? v~,iM>i8I|`x gTAywukL=mEVE6IJQ{ QqA/}]уzX`@7<޷uO>K]y?o $IҿMoWoN;4gu e!0f{𽡽.{ @o!yn:FovE:Iiuدc@f$4;,pv#QI-=&|x]emyuUU( ovH{ f>{/ag77V _tuʚܧlOU /C&:@ԜcW sUMK`/5~nwn\zbjJaT7ۚt?}*5vW)@##{= E've2o{˾~k:&_:bdؿU Wk7|j(WʇȣG`m6@DVuӗ}eɀ}ȸ1W.SǏS>]a;,XVMѧ>vyy)۷Kk6wqaZ/0@?i9q3F; MTU\| yjbr}}>~zmN󹜞el}K_ٍ<| 4h+P&Nq˯/=C U5&u]{ KUv`?M}9[/ hUVUll'zgc˥~#"ժ{nZiyW_mn󯊢SkI7͘6䶷}vGXlvs;X{:~gz6VsO_W:$Ņh'kާ:ݑ1ޱ4l =f*%ru~OeO>ifYצ_gwsf:lݤ:_նY;;; O<ُ:w bz}d&%mCzkUM˗/}3keX.Eqmk=~^|@nR_y@_YZOhktt}4)7-wꪪz_~Iu@uttLl/ຮKJ-5'"rW"Z}7ζA[z MORֽxpYO_R` W.mYZk{c{c ֳ7kS- _ʫx.~Qȧ@_U8j}./nnnʛSU͹6Ua*ZkPw=~5Tkh}7slRrVle<  8kb2{+l;vcԧG KgVWo޼OSp{>|/. ?Q8>iP`$3Na?is=֝qi:qy.?M'ӑ:Srb5yr־+%Ce`瓉N7__}z\{իW^iRնĚZ)>:KyK-GV7b}laxs 9+rsr+KQ{%d漷ͯ+ t?&v eA-Rt"ls6{譩ˌ1z0/"a.8WUɶZl~.Mk7suh9O-P]Ro~'|xk}ZprrLKmCGF x@V⼂y|ei3fpZ-{1KeZo~_פka| w@ŋ\|*czS]#vq/5sc=ĚH~@ժ夋қ^Yg6yl۷R׵赥?`3v ,˛3jBQr}޽{׾~XS9s̿n-, ʲ` ?Xo~TW[N?~N?6?Ϳ_ozڐL>'?OF,#a:x\M_N#^Fw'ˀ2-K:[Y'42Ȅ)#בǵNMW~;kg)ϫֺ k_,h#ضK&k.s|G}A~ NF?pg|uA~إ u-KcgİIJl-UTӞ ڔ}߫ش:mR| 6 $9"EyUZzm1W-׵gϞ֪k{}Gty&M-/M7d;T5 ):U©2_s3w>vJ:6#7YCYW^nǟL~e?ls*mkb Ѓb>}+Կ::w$ E ҍVU)~D}݌[:cN*]-4 S-{c{k}ɥ(Kw~||,eh=/_l^ʲ =WN>|,-Y}e3+Y7UwlϟWހ<*N@-sЃ?DUS.ķT24eJ1c? z^9TRzm~-㏕tyi9[{=|Oձi EŃρ{>y:MHzOS:-4ɠq7 E&UsDGUS,yZizl#ݖ̚i Ykemc~sے%n/L2۔~4|n~e?_=9ϣ'ӿr'>e~[ƞl'sm>:ɿoMFn/N~7=N| Tajϩj:EQxLsI0o%3mUio_ҁ4?3=xoy<,;ݲeƄcst9nx-ӯ~vooʟۖ7hGmsX%ubUUZe ci+־6[ 59qr;jttv`w4bZw}W2v@Z^ Zi):TciX?ߖɶykz׻iW˱aY6ܭG\y/C[zbޝ4KonvJyϥw7!ƨւ7s?zzsl&[+xஉ5A[ G֍p :S?{iոWkA?j:$ȗn˶$\zY/_wy g7?^N?,g0rG}c4o439ɼOyv~=O57#wn2/9\Ӄ:켞#7?=_-o|\w4%'GzmzVhֺnE3D.02d()C7d3O?F2}CGp,<2=On|]Vv~L:##ύߟyMƞu;2ʴ?|n @W1P Ô,Kߎv>ɶ:;;+=ރt36^Ӱu#V/^MoXp (j^r+Zu5` Ǐ-[AYֵ/5U ;152=rxx(M>J9}]~??dļfgmc@~oɼI/&|.'c7Jfɼ>hߙcFϠk&Èk;|#w^r^fɀs0ˬ;td9ܼ>{ȿ/9Փ_vMt.֏SOa׿_Jd]^%'|)]~0ڴӮ-/l]^^mp?z: kK,=C@E[ 2׾(5CUU>|k=7?ʷKpZIרiK݃zJ[7=݀cL̓|{kXbsĴ q=_U{0ꫪ7n4Jjv&[HN< [ϭ55˓OzN_̣K: Fy-@Rt֗Fmc4b=߃6oRZC\̌X[/ܘ[X̏/j|tp%05 ):w$[>;Wvě ޺J:@FZϯע(rNzG?Ҙbfj۲:a$@ou\ cci?{|Д {OignbכkoH}^5/}c?O=:6e2M9@ǚgV=0F[[/1R-M~uT52eYʸ2ouh_[(>=z~I888hP _2ʲ԰=GOC8>>R`ߧj+YZ~e5Qkɶ[OL4Х-fAUgKcUma(~[J퇁Ŗ/bRnĦREkKL{Rv|槚rYojoy*|-[~{===&Zs3_>ɔt6vh`|UX訴|2ޓAjAZ0/x0{{ڒ Wkт*O=/21TSUyo;Hh`Z5*6|hbʍ,L\>Ek;,FVމ^K2S3bX7)' eŧ&7 EGmu_yScj^.ӦTo7ٖ:@mKswWUFmFU R} >ٳgEj&[1WIo\b|~pmo^^^JJO~wmPni58izW+ٖ mLQy\IҶ UVUU9mj禮|{qE$[/~xG(@jj Q*3;I%)S@~~~-Z1ZCa%5UD.[.4󿔞#a1c {EUM[/~mϟ?kT'mw ;u=жSo|+)1FSɉu]~e;ܖ|O [MtF-]2:৴U2jkxxxⷣڦ  ׯ=o+hX?߂h5EUS/~U &\}~7oViSFSÚ]/b>ş~Iwymiw[|Ex}ut߆_ x]ɓzmxʇ`=B 7=mXO V_,P/&~ڃuo 49 rbu {Xgޏ,iHjFDtyjbsy.mS~;U]_oX/N{tћ֊cA^e%0osA aՠ>#ۿf;NK4oALҾvf.L7ٞn[p~q[t7Ճ `Ik_|TUfQg'`~g<HGtzLM)#7ٮ4_U`My=㙙L/`>؃4ϗhG?t@_h_E(g5h $7{@qGh&'h4n A3#:6ޱGt@B @Ley\xf:8-iz ٮGhjehE-34hLm^Po^ ||@#vKn3rf?ؑ #O {`fv[ > Otv _첫K+*k|v=Tt.' `nffY> > 0A|@f:3 ߳jm@o'O{w6 qo,zgi`W&.tL+{%7Vo~˫@/t 5> ݁-[4[_ |@lP|=f:|Zgt>  &[Z,t> @[xӀMXt 8'hyK_~@EW ݉_|=NAe3> @EWct#od |/-|+L|@6ٮZl|LjF0A o)`,P{> 'd &[Lj|@UxX&@{^_k|O) k/|'? @N>|l>0%)Y+=.Or[?~@{?@{G~Ƌ~} ?/Y4}K|L- |> >0g}>|@|W: >|@? -:~dP5pϜ| G |Ny>N|>[6  |@> |7rIENDB`drupal-7.41/themes/garland/color/preview.png0000644000000000000000000002335512611765734017660 0ustar rootrootPNG  IHDRTsR_&IDATx^ܱur\4 "T)E"vZ6h#6ZD(HR BFbax]\λ^!e+[_ae"aO$C%IJ $C%IJz${$UH$C%PI$C%ɿ'"l% E2JMYmj5I 2*T%222K]"w$CQTKTԥ*uN$)6jٿxwo}bxiiu(?0vBzlF=sErxm\g3 I ib,r돞sl?KΐfvL懳 I Fc[9̑__XcM[i;!Is,p#?a?Xga6[Iхdɀ?GÕ7"[n% WQh]fm$*`|y2JR$]n+IO$WK2Td$PI2Td$*I2Td$*I2Td$*I2T $*I2T $*I2T $*IJ $*IJ $c"zyȼOiݓk&,5B 2SO B!FOdfރ*89{v7$K7 RZ0vZEK\thҋbEjPJZaI"r^lv3g& ؙsfcg7810QpƧ#Img?|pIS}SSM)$IӍ`l]UsG0`\DY{%MA%3P~S{Y3u %'Edw7U&t)?!k JtsfXɴD ʷ'MAe .,r * u¼ Cm'Xg ӂAz4T^L U(Srz |DDb09#X fAK ti: +(z:\ ӥ@ĮjFL0-ANҔ魟c*\^Qn׳]7=spO3rSӨdԑm~ DݛG隦29ٸ $q$ZLobCEȧ7`}(c$e\r1 +oNKU"c5$fӏ#ŋr+q*Z ?1GFKsA>(GiÑfR8R * .mGZ)ld-Hd頒mS矛!xa$Aҋ?[{Ν}!ݵ``'v6rօndS`PoR?:zG0#_?t)7c,'$W.@_BuI}_ mo>4IF+drrF烱1 iX8恥lVw&ljfW!^mc/}(]M|яfUHZXuu BEӵ4ToBҷh"BV{X |'qթf|E D^*?%ؿbU˜Q_&Wc 6iڬ&fzĔK4T240i?A .&{,[I-_pDlth> .xۓ隦;*WbNl Od',\r=%9{?W#! *7` klEs;ŗM7?'@n3Ddz><.xv/7~;* bZshS%)B^g(/)kºo"E M+y~\.Pq1񯹢Z(&&vv>"\>ccˀ/x* Ty HWN W݉Ke.ED Wܽ8IL, R\|WZ/Dm-1ڰ4$XtAm9M$M"$)RyA }9%Dj/.FBwoMDiyy"଑Z㮾ud%~<*hN@vm,m$But4M!z)𧙋罻q"M`&N8i8x&S$部|~ZO|DjM3-w),шwȪց4kALl5XXCp9\;!F?NV6bN X歩C3X""\ |}3ӊ\4QIi@\y~l,\$hD,>ւay( U*\E϶[D F"8qj8b6d2>#}:c8Jz_w~!Ev'bM& 6&.yEPA}!hnK"ТE=]lj4j 9TF)0{"؃j4J4T!E۫v.,BQprWp~s 삨: c`]U]p;i`t[)^-Xy 䍞W֤󝟦*Iڽ]}p3wN~Oݓ*\^8FĬG1 F"L~ļy"~BJuZKԔ"_3#WJLwqh;_X; } !x´pixYS0Cym``eu<]3 -B|~6֪̩Cڽp-_z_T?R/4Mo/bN[}PNϢ-X(9fԓ; AKg#/qDX O=c*,ғr]\R$yjǝ)ZVM3-ėWo-xkղJR.F4애r7\x3hyyURBY2_/*{^w0hY7ީ | <%Qo1"q +aH[,wi-WYwT/D,~*sdڳy+tg'ә8V>Kbn*cH0(vqW`YӉ 8 8Pz贖+:aq8ƩU'CQqI|6߰L !r7pj{ԀAUȑ;9ёڅ!K5J-vl+g)j ]8D]%fM j3#>Ⱦu21-Za=W3()8TyDd Xn3*!$TgQW1!9 ЌJ!4}AJLdkx_g 'sTBVܺE._sBv1p ۚPlnT7ڗcq.#V_ќF uA V}BHqokg>|ja8_B_#(Q-#˞ESgxD8ao"T#x=Zdn 70"l-"}K!ÚdY˚527P {& cę/|4{|ajq07{I #Vqp0̕>mΠ% O8 VUpm{w#}U{f$KZ 9Dyn`Z2CV] F-і-M?B!U,Uu_UURI]oYoF_)t5ObdzU̩BT?)4UƜBR/C$g!PSMX$~fNř!3%]?}RU0_y1(%nyB)?xTU6[O.%CB?BXz " 'б';B}e!}!hBPd45KEe}Yk}rd?$)5ۭ+j;+\M~ndfYKSM9^#Xɕ0Ԧ_h~KW{}?wU{_ۻ-=`StST{Jwy] H![JяT*i``Ѣp!h2]JFoaA*P)g;%c7Tyl2mHBvT5fVHU'_Ģb6ճ^RIz+ 1jN٤oAw}MChn?XqJv޶ O^uZ*]O2ٴ%n~wn}=*#9dG(,ONҗ[h|tUf! !u8>|Cܧ,J=+CSţ*o=4mRb/y+1>F2wfL DBϏ] T %WuPDJ !4fz˳E1eڃ7df|sxFBh"4JqUEٗ}}ԭQju6_azLLnRO8p>xKG/>Ujj4?ZWI_@IJJX#y!H $N0=Em zR1B' s̼Uzt2t0F~>upxJkFjfӫVic%IY7ul}o7%_X_m3*k[ԞONu0ƮTUD ̟x0bMit _UҴ{tZ/ Z9{=l%Cu{~Z"{|p}GJ+)Qu>|B6§H 83*Q30Q.OdB,- -ttB!:&DQ;{|cC:3-: _Aw ǣxSd*u7Jl|]˫  -SwQ[n։'Fdc*w/ B4=Xޓ^93B H$MuU T~!3|.Ҡ,HdzFo/}UK}۫YbLhs>8EzJBz.32@aC q ,Ϥc[k-n>?+|S?PFSkPYwT:ANACkIя )"@G.{%^'4鋻.oDgD!34&jNduP -`TSh(PM73=DDBᓬIIy3qRPw/;&h !I7^&3 $K}'BgTqF#_u[1(.2Cl‰~G~*PʲHTzCA(qWuLb_?._qG{6G|Cm6NE[ԦZno֛ru}ۚg%PޖC+iԔ{r-E~M#M)V!ZZ;|mF[y=^)lto~ԟ}ubޱ,kN%m! !~uݹ8~<*4NojLOL[Q98ϨZ\uCw]dz <+ShAA"qdƕ;fҐƳgd ڦaB1jom]ksd\A/^C&nq+0bY썣.q^eqQzDٯ҅Q6yN9B OPO/ T*m& w$PBB,N7<*U*Lu!cw'F, +#MB \06IJB:ytc0& 3BB;ZAH';Ч^@B*g+]ee27V!_;̆Me`aiBB$$@ܫBv\:hǵRt^#JL<!'NpѪSeZ`[!cCQB12]Wixz8W'B]?nB5xˆM,*'Bhu&n̔n/S%[_b#BH>Y/kIy1sǔmվ<_HY/%z ~1?:Y@IgIڷ q*!=J |L+[%q"!h\ z~Ɉ;TL BdUTG~K=B ^Q G8 !@2BIQ{'~Qsaz0B8zCe:3= 2m9BtZ^屻f2=Ȁг ̄/t?^/Qg>i;.dڪ+֘/wT*fvKh!7Te{T4;3c ^!crB:ICeJN t# ސcO؏47JD̓DA,@y!Bc1t[' 5JPY 9 !oQc3v 1@T+ﻫ7f\5sFdsATVJT^"tAAA*A A  |QQ**dHtQ@VrIENDB`drupal-7.41/themes/garland/color/color.inc0000644000000000000000000001350712611765734017300 0ustar rootroot array( 'base' => t('Base color'), 'link' => t('Link color'), 'top' => t('Header top'), 'bottom' => t('Header bottom'), 'text' => t('Text color'), ), // Pre-defined color schemes. 'schemes' => array( 'default' => array( 'title' => t('Blue Lagoon (Default)'), 'colors' => array( 'base' => '#0072b9', 'link' => '#027ac6', 'top' => '#2385c2', 'bottom' => '#5ab5ee', 'text' => '#494949', ), ), 'ash' => array( 'title' => t('Ash'), 'colors' => array( 'base' => '#464849', 'link' => '#2f416f', 'top' => '#2a2b2d', 'bottom' => '#5d6779', ), ), 'aquamarine' => array( 'title' => t('Aquamarine'), 'colors' => array( 'base' => '#55c0e2', 'link' => '#000000', 'text' => '#696969', 'top' => '#085360', 'bottom' => '#007e94', ), ), 'chocolate' => array( 'title' => t('Belgian Chocolate'), 'colors' => array( 'base' => '#d5b048', 'link' => '#6c420e', 'top' => '#331900', 'bottom' => '#971702', ), ), 'bluemarine' => array( 'title' => t('Bluemarine'), 'colors' => array( 'base' => '#3f3f3f', 'link' => '#336699', 'text' => '#000000', 'top' => '#6598cb', 'bottom' => '#6598cb', ), ), 'citrus' => array( 'title' => t('Citrus Blast'), 'colors' => array( 'base' => '#d0cb9a', 'link' => '#917803', 'top' => '#efde01', 'bottom' => '#e6fb2d', ), ), 'cold' => array( 'title' => t('Cold Day'), 'colors' => array( 'base' => '#0f005c', 'link' => '#434f8c', 'text' => '#000000', 'top' => '#4d91ff', 'bottom' => '#1a1575', ), ), 'greenbeam' => array( 'title' => t('Greenbeam'), 'colors' => array( 'base' => '#c9c497', 'link' => '#0c7a00', 'top' => '#03961e', 'bottom' => '#7be000', ), ), 'mediterrano' => array( 'title' => t('Mediterrano'), 'colors' => array( 'base' => '#ffe23d', 'link' => '#a9290a', 'top' => '#fc6d1d', 'bottom' => '#a30f42', ), ), 'mercury' => array( 'title' => t('Mercury'), 'colors' => array( 'base' => '#788597', 'link' => '#3f728d', 'top' => '#a9adbc', 'bottom' => '#d4d4d4', 'text' => '#707070', ), ), 'nocturnal' => array( 'title' => t('Nocturnal'), 'colors' => array( 'base' => '#5b5fa9', 'link' => '#5b5faa', 'top' => '#0a2352', 'bottom' => '#9fa8d5', ), ), 'olivia' => array( 'title' => t('Olivia'), 'colors' => array( 'base' => '#7db323', 'link' => '#6a9915', 'top' => '#b5d52a', 'bottom' => '#7db323', 'text' => '#191a19', ), ), 'pink_plastic' => array( 'title' => t('Pink Plastic'), 'colors' => array( 'base' => '#12020b', 'link' => '#1b1a13', 'top' => '#f391c6', 'bottom' => '#f41063', 'text' => '#898080', ), ), 'shiny_tomato' => array( 'title' => t('Shiny Tomato'), 'colors' => array( 'base' => '#b7a0ba', 'link' => '#c70000', 'top' => '#a1443a', 'bottom' => '#f21107', 'text' => '#515d52', ), ), 'teal_top' => array( 'title' => t('Teal Top'), 'colors' => array( 'base' => '#18583d', 'link' => '#1b5f42', 'top' => '#34775a', 'bottom' => '#52bf90', 'text' => '#2d2d2d', ), ), ), // Images to copy over. 'copy' => array( 'images/menu-collapsed.gif', 'images/menu-collapsed-rtl.gif', 'images/menu-expanded.gif', 'images/menu-leaf.gif', ), // CSS files (excluding @import) to rewrite with new color scheme. 'css' => array( 'style.css', ), // Gradient definitions. 'gradients' => array( array( // (x, y, width, height). 'dimension' => array(0, 38, 760, 121), // Direction of gradient ('vertical' or 'horizontal'). 'direction' => 'vertical', // Keys of colors to use for the gradient. 'colors' => array('top', 'bottom'), ), ), // Color areas to fill (x, y, width, height). 'fill' => array( 'base' => array(0, 0, 760, 568), 'link' => array(107, 533, 41, 23), ), // Coordinates of all the theme slices (x, y, width, height) // with their filename as used in the stylesheet. 'slices' => array( 'images/body.png' => array(0, 37, 1, 280), 'images/bg-bar.png' => array(202, 530, 76, 14), 'images/bg-bar-white.png' => array(202, 506, 76, 14), 'images/bg-tab.png' => array(107, 533, 41, 23), 'images/bg-navigation.png' => array(0, 0, 7, 37), 'images/bg-content-left.png' => array(40, 117, 50, 352), 'images/bg-content-right.png' => array(510, 117, 50, 352), 'images/bg-content.png' => array(299, 117, 7, 200), 'images/bg-navigation-item.png' => array(32, 37, 17, 12), 'images/bg-navigation-item-hover.png' => array(54, 37, 17, 12), 'images/gradient-inner.png' => array(646, 307, 112, 42), 'logo.png' => array(622, 51, 64, 73), 'screenshot.png' => array(0, 37, 400, 240), ), // Reference color used for blending. Matches the base.png's colors. 'blend_target' => '#ffffff', // Preview files. 'preview_image' => 'color/preview.png', 'preview_css' => 'color/preview.css', // Base file for image generation. 'base_image' => 'color/base.png', ); drupal-7.41/themes/garland/color/preview.css0000644000000000000000000000163212611765734017656 0ustar rootroot /* Positioning */ #preview { overflow: hidden; max-width: 100%; } #preview, #preview #img { width: 600px; height: 371px; } #preview #gradient-0 { position: absolute; left: 0; right: 0; top: 19px; height: 120px; z-index: 2; } #preview #text { position: absolute; left: 80px; width: 436px; top: 160px; height: 120px; z-index: 4; } #preview #img { position: relative; z-index: 3; background-image: url(preview.png); } #preview #gradient-0 .gradient-line { height: 10px; overflow: hidden; } /* Basic styles to match */ #preview { font: 12px/170% Verdana; } #preview h2 { margin: 0; padding: 0; font-weight: normal; font-family: Helvetica, Arial, sans-serif; font-size: 160%; line-height: 130%; } #preview p { margin: .5em 0; } #preview a:link, #preview a:visited { text-decoration: none; font-weight: normal; } #preview a:hover { text-decoration: underline; } drupal-7.41/themes/garland/node.tpl.php0000644000000000000000000000174012611765734016601 0ustar rootroot
    > >
    >
    drupal-7.41/themes/garland/style-rtl.css0000644000000000000000000001154712611765734017024 0ustar rootroot html { direction: rtl; } /** * Generic elements */ body { direction: rtl; } ul, .block ul, ol { padding: 0 1.5em 0 0; } ul.menu, .item-list ul { margin: 0.35em -0.5em 0 0; } ol li, ul li, ul.menu li, .item-list ul li, li.leaf { margin: 0.15em .5em 0.15em 0; } ul li.collapsed { list-style-image: url(images/menu-collapsed-rtl.gif); } ul.inline li { padding: 0 0 0 1em; } ol.task-list { margin-left: 0; margin-right: 0; } ol.task-list li { padding: 0.5em 2em 0.5em 1em; } ol.task-list li.active { background: transparent url(images/task-list.png) no-repeat 97px 50%; } ol.task-list li.done { background: transparent url(../../misc/watchdog-ok.png) no-repeat 100% 50%; } ol.task-list li.active { margin-right: 0; margin-left: 1em; } dl { margin: 0.5em 1.5em 1em 0; } dl dt { } dl dd { margin: 0 1.5em .5em 0; } .messages li { padding: 0 1.3 0 0; } .form-button, .form-submit { margin: 0 0 0 0.5em; } .region-header h2 { margin: 0 0 0 1em; } #wrapper { background: #edf5fa url("images/body.png") repeat-x 50% 0; } #branding img { padding-right: 0; padding-left: 20px; float: right; } #wrapper #container #center { float: right; } body.sidebar-first #center { margin-left: 0; margin-right: -210px; } body.sidebar-second #center { margin-left: -210px; margin-right: 0; } /* And add blanks left and right for the sidebars to fill */ body.sidebar-first #squeeze { margin-left: 0; margin-right: 210px; } body.sidebar-second #squeeze { margin-left: 210px; margin-right: 0; } #wrapper #container .sidebar { float: right; } #sidebar-first .block { padding: 0 0 0 15px; } #sidebar-second .block { padding: 0 15px 0 0; } #sidebar-first .block-region { margin: 0 0 0 15px; } #sidebar-second .block-region { margin: 0 15px 0px 0; } /* Now we add the backgrounds for the main content shading */ #wrapper #container #center #squeeze { background: #fff url("images/bg-content.png") repeat-x 50% 0; } #wrapper #container .breadcrumb { position: absolute; top: 15px; left: 0; right: 35px; z-index: 3; } /** * Primary navigation */ ul.main-menu { float: left; width:70%; } ul.main-menu li { float: right; } /** * Secondary navigation */ ul.secondary-menu { float: left; clear: left; margin-left: 16em; } ul.secondary-menu li { float: right; } ul.primary { float: right; } ul.secondary { clear: both; text-align: right; } h1.with-tabs { float: right; margin: 0 0 0 2em; } ul.primary li a, ul.primary li.active a, ul.primary li a:hover, ul.primary li a:visited, ul.secondary li a, ul.secondary li.active a, ul.secondary li a:hover, ul.secondary li a:visited { margin: 0 1px 0 0; } ul.primary li a:after { /* Fix Firefox 2 RTL bug. */ content: " "; } ul.links li, ul.inline li { padding-left: 1em; padding-right: 0; } .node .links, .comment .links { text-align: right; padding-right: 0; } .user-picture, .comment .submitted { padding-left: 0; float: left; clear: left; padding-right: 1em; } .new { float: left; } .indented { margin-left: 0; margin-right: 25px; } html.js fieldset.collapsible .fieldset-legend { padding-left: 0; padding-right: 2em; background: url("images/menu-expanded.gif") no-repeat 100% 50%; } html.js fieldset.collapsed .fieldset-legend { background: url("images/menu-collapsed-rtl.gif") no-repeat 100% 50%; } /** * Vertical tabs. */ div.vertical-tabs { margin-left: 5%; margin-right: 15em; } /** * Syndication Block */ #block-node-syndicate h2 { float: right; padding-right: 0; padding-left: 20px; } #block-node-syndicate img { float: left; } #block-node-syndicate .content { clear: left; } /** * Login Block */ #user-login-form ul { text-align: right; } #user-login-form .openid-links { padding-left: 0; padding-right: 0.5em; } #user-login-form .openid-links li.user-link { padding-left: 0; padding-right: 1em; } div.admin .left { float: right; } div.admin .right { float: left; } /* Fix Opera, IE6 and IE7 header width */ #wrapper #container #header { position: relative; width: 100%; } #wrapper #container #header #logo-floater { width: 100%; left: 0; top:0; } /** * Fixes for IE7 - Does not break other browsers */ /* Position:relative on these breaks IE7. */ ul.primary li a, ul.primary li.active a, ul.primary li a:hover, ul.primary li a:visited, ul.secondary li a, ul.secondary li.active a, ul.secondary li a:hover, ul.secondary li a:visited { position: static; } /* Fix right and left cloumns position breaking on window resize */ #container { position: relative; } #center { position: relative; } #sidebar-second { position: absolute; right: 0; } /** * Apply hasLayout to elements in IE7, using standard property "min-height" * (see http://www.satzansatz.de/cssd/onhavinglayout.html) */ /* Fix background bleed in center column. */ #squeeze, #squeeze .right-corner { min-height: 1%; } drupal-7.41/themes/garland/garland.info0000644000000000000000000000063112611767501016622 0ustar rootrootname = Garland description = A multi-column theme which can be configured to modify colors and switch between fixed and fluid width layouts. package = Core version = VERSION core = 7.x stylesheets[all][] = style.css stylesheets[print][] = print.css settings[garland_width] = fluid ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/themes/garland/images/0000755000000000000000000000000012611765734015610 5ustar rootrootdrupal-7.41/themes/garland/images/bg-tab.png0000644000000000000000000000016312611765734017452 0ustar rootrootPNG  IHDR*EJ:IDATHcYv9{QG~z:[lklP* v!IIENDB`drupal-7.41/themes/garland/images/bg-content-right.png0000644000000000000000000000540312611765734021473 0ustar rootrootPNG  IHDR2`vl IDATx^X=lI >b6@ c1l $$vA4 ވa>T]zzB ۪v*]} u b(b"ml(F!)$0+ohH&PMR[Y+Y"Շw_IJ+${1` 5xL|(/'PZdSfѱ$9J^<h@ H FtW3uiCP2(A% M!ԲDpB[K@HI|b;dIdkA ?_}K[H ^q>I$"<Gpc߾]$;z;W䋆 p 3 OE$K)BR<&1Pk6b_lP8d;!R T[a H=|gTVc\An?}!pv`kBuxͰX nh+gk6]A+k Z*l!_~"5ECɦX+=L[MtR \G6-Ļͱ%7{b9]]Zi6nE^C֨7:ث ;$*N,"q;'XEIu\K 5Ĵ-X@]B v^:ä> b i 35qtcw[sꬹe*HXM Y8 ^ X9-.ck<'r"̰ov!+Yb%:6+f ӽ|wDLhV\ͅT Vmcp!ف^$('o7DSvmd]fs^oڼ>9>! !? 1W=ڬOh)-Gl;mX;5jBjVɅaҀrM.W~Rmz6QwaMSjiա٫U8o_M9KSoS?ðHM:Grx|s)hPA%cqIe<ُ{Wg@x@PJ}8ɣ|08qq2EoKWD*23?&/oWG *ZeV֌~d̠*) 섒pyN|o_CH)\_(bydr@]n+7 GMn]Lѧl0: AF@@p &\5$sd)8H:g^ Ēq巃#F~ ٥F: s?!cP]߈AbpA.r dDLMѵVSZ]&;t[|wb\ZFFlFf^Al1}3gs xժfd]U[cSyuB5f1t*r1M̈́͸ ΜY@Inm籚n]ˈ[-qW<`f ،;0o1;gfؘ.JE(PA)5dH }mĥF)۹ca r]DTޯRHY!Ik_oS.mupAjp`VbuÀXze0V j',g48f/I\QîWOeFu$bNU} V]s ,XW͎]wXuDE=y/3VĻDXR|GтUK \DX'y-X5+Z+fIÂ˃CI⍥JJLVIENDB`drupal-7.41/themes/garland/images/menu-leaf.gif0000644000000000000000000000025612611765734020153 0ustar rootrootGIF89a 귷赶Ƽǽ!, @+ %dIäBx88+ բB$(bPM ш1 C;drupal-7.41/themes/garland/images/bg-bar-white.png0000644000000000000000000000014712611765734020570 0ustar rootrootPNG  IHDRL em.IDATH  Q_]!Ia]@ h]@@x1H>~}IENDB`drupal-7.41/themes/garland/images/gradient-inner.png0000644000000000000000000000027412611765734021227 0ustar rootrootPNG  IHDRp*HIDATh0()ӄCK|ij#1#ՎG<#=v4vvGD#1#1 xv4vĴ#qD#ψjwD48"ӈjψjvĴIENDB`drupal-7.41/themes/garland/images/menu-collapsed-rtl.gif0000644000000000000000000000026012611765734022004 0ustar rootrootGIF89a ɶ!, -%hNKP05*!Tx ˖×5j(Gt;drupal-7.41/themes/garland/images/bg-navigation-item-hover.png0000644000000000000000000000067112611765734023124 0ustar rootrootPNG  IHDR  GIDAT(+Q=~;FD6 ea'$"jD#IR>B 㹯XsOt=K5w;f[ ?im/;Гdrg)>OӫQ|Ϋ7 IIENDB`drupal-7.41/themes/garland/images/menu-collapsed.gif0000644000000000000000000000026012611765734021205 0ustar rootrootGIF89a ɶ!, -%NbYBU11n%RU! {DcWfUC;drupal-7.41/themes/garland/images/bg-content-left.png0000644000000000000000000000551112611765734021310 0ustar rootrootPNG  IHDR2`vl IDATx^WA,t5 NXq ` g,w$͛t+퐭jՊVe;i_Dp)EAԣ\2 ` CQ0`49mt#ˆ@Hd7?FoH9bA#`#2yq f s t|5s҈bj#ķ?/ h-g|0^JL.4p: ww\^l2l@d#h+@"xC@tNHQFeK Bq3e)LIm ":w e&$UL ]$i۴ 8su.nPҊR ڄ`i4N;w_{ߑD2X-751rd۾1׾VR`zHգ [^k#l{C DJHO?y[Jt]C7` }xu#~hP0-M7iNN^ΌjMتT`ju*_aՔ $ +odQmBD[״]5{KFP8' Mj/M k'ED̃~4 ͓! nQ籣% `Q븆rj r X ) iꓙ]r\uܨ2~>4, D?&;5F+ZW1wu[U}ie(-xMd=SnOqKqy))J2)I8 ˌ` Pm!S:>$]B׸O-P,~0۱.L%|m bqaX]-] }jص\'XAVO:wkR+!FyOSFHAWiS ˆj!ya^jY}Fkh$sOESzCG!r+nvĺۜ6nwnor>2z wVSK@@-E8@eow7i~uns8ܦMwzyRrWQ;ѠհLP͛Y H˧i'f۫?ηӹ}wlcv\ @x./ӠDfy4g۟67nF5cg?dYts@9`yL>bd__v2#ϗ>9t}+m9OJxRoM՚nȡtG,olhP"U;]2U6GqL,z梮gGnydM}nvjCk6)z{\ m俵Ouݴ*='{A챱|%6tۓM!!QeS or1fx$; 8gs2X^KԊ=+EmACP4q; F&"r ZNFR[%(Ծp8+vm $˫LuWK3a-OsǓFaMD/j'/KI5gOx1pyWSskOK 2)fksQH)CS%x$(f_PqͷHA}|~fC^>zWoU}%b/^v\0ZϷ4vJH^rFXJ٣wF|tP:^"o$67FG_i>]ܱ'gYU/W|dNaL%~E`_.!)m?q\+RjO.@@D{I+tnނ@3Dۻ ! Nԫ N+@/SB >q?N5xgb;V>x7cHy #}ܿ$~v%n -~v$&zUi "F `vfN!ޠ)g ݝ:ؼ!?.H>fF4 Ngl Z[>uՙ&A USMmQ'hML[LK$P"/H'oi^ 6NllL3cv I[.?a1,mh@B@ȇ*[Y `|qgA*@45Yvϵi $wT>D-ODhCF4?7`q6.ԁ/Rd*7C!rD۷a܈o$~&Eոӓ\=Gb!{ \kbCvUQԩ Z#X;[ T˛@n[kaҩc&`=J F-[Qc~nŗ`VS #oUkӼ`5n V[ VW |yjXu@CvK-Md_ VðgRzn Ga>o?ZaAn-SFR4`EߎAMՂ[ڨ 9݆ IENDB`drupal-7.41/themes/garland/images/body.png0000644000000000000000000000125012611765734017251 0ustar rootrootPNG  IHDR2CoIDATx^1Ak E=zS LL E[}K|,twQ5ͪoq;ë/=y$%ZW%P !5P@$W2"8%e6xF =((%hj a v?oPfLBYhlPB~MfzA;FŶttO rp?zh ?~5 PĮG#zbթ!X{Y2u,"O:g?j>+)GT);_z5+ qev6~ 2xKBKe(}>5FLQqcFwW0UKlq|@ѿx}OaĝIR V`zآ׆qA@KjD7(mSQS֫C[e(t[t7_Q@O^굚f}aݮuςOi%_[;s܌,8^\veZ;}{{NW|~&;g2>ş_?Yx}{z` TއEZQ5l&i4H]-k;~4{;oViZ(>+/W8]- nY |bdVI3P0],ަ{ݴe7͢b{XuSYW*Ů뺒ԭQ4>wPRbVƩn:M=޳^膺iۧю,6xsvD=G0x 6IENDB`drupal-7.41/themes/garland/images/bg-navigation-item.png0000644000000000000000000000076312611765734022005 0ustar rootrootPNG  IHDR  GIDAT(=hSa=|M-t N 䠃. ] :IAwHE:CPNf6:is ?'VdZo^A`"1;|gaٹk_7/MIH"o[;_t!>p*i`0 Ձ2 r3&4~JFP`&\ˠ0 &3O?=ydX W GIMRaBJI }w rfwr߮V5MU&ggfn\}ύv(1(T(`pSGKeʠT; w@SI- T" }N!(.)$!0 $NB d+r(cIENDB`drupal-7.41/themes/garland/images/task-list.png0000644000000000000000000000020012611765734020221 0ustar rootrootPNG  IHDR GIDAT(c?>s3 ](Qdat TPVGv8K07%P (uɎIENDB`drupal-7.41/themes/garland/print.css0000644000000000000000000000202712611765734016212 0ustar rootroot body, input, textarea, select { color: #000; background: none; font-family: Verdana, sans-serif; font-size: 11pt; } ul.main-menu, ul.secondary-menu, #header-region, .sidebar { display: none; } body.two-sidebars, body.sidebar-first, body.sidebar-second, body { width: 640px; } body.sidebar-first #center, body.sidebar-second #center, body.two-sidebars #center, body.sidebar-first #squeeze, body.sidebar-second #squeeze, body.two-sidebars #squeeze { margin: 0; } #wrapper, #wrapper #container .breadcrumb, #wrapper #container #center, #wrapper #container #center .right-corner, #wrapper #container #center .right-corner .left-corner, #wrapper #container #footer, #wrapper #container #center #squeeze { position: static; left: 0; padding: 0; margin: 0; width: auto; float: none; clear: both; background: none; } #wrapper #container #header { height: 130px; } #wrapper #container #header h1, #wrapper #container #header h1 a:link, #wrapper #container #header h1 a:visited { text-shadow: none; color: #000; } drupal-7.41/themes/garland/style.css0000644000000000000000000005046212611765734016224 0ustar rootroot /** * Generic elements */ body { margin: 0; padding: 0; background: #edf5fa; font: 76%/170% Verdana, sans-serif; color: #494949; } input { font: 1em/100% Verdana, sans-serif; color: #494949; } textarea, select { font: 1em/160% Verdana, sans-serif; color: #494949; } h1, h2, h3, h4, h5, h6 { margin: 0; padding: 0; font-weight: normal; font-family: Helvetica, Arial, sans-serif; } h1 { font-size: 170%; } h2, #center h1 { font-size: 160%; line-height: 130%; } h3 { font-size: 140%; } h4 { font-size: 130%; } h5 { font-size: 120%; } h6 { font-size: 110%; } quote, code, fieldset { margin: .5em 0; } code, pre, kbd { font-size: 115%; } p { margin: 0.6em 0 1.2em; padding: 0; } a:link, a:visited { color: #027AC6; text-decoration: none; } a:hover { color: #0062A0; text-decoration: underline; } a:active, a.active { color: #5895be; } hr { margin: 0; padding: 0; border: none; height: 1px; background: #5294c1; } ul, .block ul, ol { margin: 0.5em 0 1em; padding: 0 0 0 1.5em; /* LTR */ } /* Default to menu leaf bullet for unordered list items. "ul" used here so it can cascade to list items and "li.leaf" to override the system leaf image. */ ul, ul li.leaf { list-style-image: url(images/menu-leaf.gif); } /* This is used to cancel the list style image when an ordered list is embedded in an unordered list. */ ol { list-style-image: none; } ul.menu, .item-list ul { margin: 0.35em 0 0 -0.5em; /* LTR */ } ol li, ul li, ul.menu li, .item-list ul li, li.leaf { margin: 0.15em 0 0.15em .5em; /* LTR */ padding-bottom: .1em; } ul li.expanded { list-style-image: url(images/menu-expanded.gif); } ul li.collapsed { list-style-image: url(images/menu-collapsed.gif); /* LTR */ } ul li.leaf a, ul li.expanded a, ul li.collapsed a { display: block; } ul.inline li { background: none; margin: 0; padding: 0 1em 0 0; /* LTR */ } ol.task-list { margin-left: 0; /* LTR */ list-style-type: none; list-style-image: none; } ol.task-list li { padding: 0.5em 1em 0.5em 2em; /* LTR */ } ol.task-list li.active { background: transparent url(images/task-list.png) no-repeat 3px 50%; /* LTR */ } ol.task-list li.done { color: #393; background: transparent url(../../misc/watchdog-ok.png) no-repeat 0px 50%; /* LTR */ } ol.task-list li.active { margin-right: 1em; /* LTR */ } fieldset ul.clearfix li { margin: 0; padding: 0; background-image: none; } dl { margin: 0.5em 0 1em 1.5em; /* LTR */ } dl dt { } dl dd { margin: 0 0 .5em 1.5em; /* LTR */ } img, a img { border: none; } table { margin: 1em 0; width: 100%; } thead th { border-bottom: 2px solid #d3e7f4; color: #494949; font-weight: bold; } th a:link, th a:visited { color: #6f9dbd; } td, th { padding: .3em .5em; } tr.even, tr.odd, tbody th { border: solid #d3e7f4; border-width: 1px 0; } tr.odd, tr.info { background-color: #edf5fa; } tr.even { background-color: #fff; } tr.drag { background-color: #ffb; } tr.drag-previous { background-color: #ffd; } tr.odd td.active { background-color: #ddecf5; } tr.even td.active { background-color: #e6f1f7; } td.region-title, td.module, td.container, td.category { border-top: 1.5em solid #fff; border-bottom: 1px solid #b4d7f0; background-color: #d4e7f3; color: #455067; font-weight: bold; } tr:first-child td.region-title, tr:first-child td.module, tr:first-child td.container, tr:first-child td.category { border-top-width: 0; } span.form-required { color: #ffae00; } .submitted, .description, .vertical-tab-button .summary { font-size: 0.92em; color: #898989; } .description .more-help-link { font-size: 0.92em; } .description { line-height: 150%; margin-bottom: 0.75em; color: #898989; } .preview { margin: .75em 0 .75em; padding: .5em 1em; } .form-checkboxes, .form-radios, .form-checkboxes .form-item, .form-radios .form-item { margin: 0.25em 0; } #center form { margin-bottom: 2em; } .form-actions { margin: 2em 0 1em; } .form-button, .form-submit { margin: 0 0.5em 0 0; /* LTR */ } /** * Skip link */ #skip-link { left: 50%; margin-left: -5.25em; margin-top: 0; position: absolute; width: auto; z-index: 1000; } #skip-link a, #skip-link a:link, #skip-link a:visited { background: #444; background: rgba(0, 0, 0, 0.6); color: #fff; display: block; font-size: 0.94em; line-height: 1.7; margin-top: 1px; padding: 2px 10px; text-decoration: none; -khtml-border-radius: 0 0 2px 2px; -moz-border-radius: 0 0 2px 2px; -webkit-border-bottom-left-radius: 2px; -webkit-border-bottom-right-radius: 2px; -webkit-border-top-left-radius: 0; -webkit-border-top-right-radius: 0; border-radius: 0 0 2px 2px; } #skip-link a:hover, #skip-link a:active, #skip-link a:focus { outline: 0; } /** * Layout */ .region-header { min-height: 1em; background: #d2e6f3 url(images/bg-navigation.png) repeat-x 50% 100%; } .region-header .block { display: block; margin: 0 1em; } .region-header .block-region { display: block; margin: 0 0.5em 1em; padding: 0.5em; position: relative; top: 0.5em; } .region-header * { display: inline; line-height: 1.5em; margin-top: 0; margin-bottom: 0; } /* Prevent the previous directive from showing the content of script elements in Mozilla browsers. */ .region-header script { display: none; } .region-header p, .region-header img { margin-top: 0.5em; } .region-header h2 { margin: 0 1em 0 0; /* LTR */ } .region-header h3, .region-header label, .region-header li { margin: 0 1em; padding: 0; background: none; } #wrapper { background: #edf5fa url(images/body.png) repeat-x 50% 0; } /* Set container widths when we are using the "fixed width" option. */ #wrapper #container { width: 560px; margin: 0 auto; padding: 0 20px; } body.one-sidebar #wrapper #container { width: 770px; } body.two-sidebars #wrapper #container { width: 980px; } /* Unset container width when we are using the "fluid width" option. */ body.fluid-width #wrapper #container { width: auto; max-width: 1270px; } #wrapper #container #header { height: 80px; } #wrapper #container #header #logo-floater { position: absolute; } #branding, #branding a:link, #branding a:visited { line-height: 120px; position: relative; z-index: 2; white-space: nowrap; } #branding span { font-weight: bold; } #branding img { padding-top: 14px; padding-right: 20px; /* LTR */ float: left; /* LTR */ } /* With 3 columns, require a minimum width of 1000px to ensure there is enough horizontal space. */ body.two-sidebars { min-width: 980px; } /* With 2 columns, require a minimum width of 800px. */ body.sidebar-first, body.sidebar-second { min-width: 780px; } /* We must define 100% width to avoid the body being too narrow for near-empty pages */ #wrapper #container #center { float: left; /* LTR */ width: 100%; } /* So we move the #center container over the sidebars to compensate */ body.sidebar-first #center { margin-left: -210px; /* LTR */ } body.sidebar-second #center { margin-right: -210px; /* LTR */ } body.two-sidebars #center { margin: 0 -210px; } /* And add blanks left and right for the sidebars to fill */ body.sidebar-first #squeeze { margin-left: 210px; /* LTR */ } body.sidebar-second #squeeze { margin-right: 210px; /* LTR */ } body.two-sidebars #squeeze { margin: 0 210px; } /* We ensure the sidebars are still clickable using z-index */ #wrapper #container .sidebar { margin: 60px 0 5em; width: 210px; float: left; /* LTR */ z-index: 2; position: relative; } #wrapper #container .sidebar .block { margin: 0 0 1.5em 0; } #sidebar-first .block { padding: 0 15px 0 0; /* LTR */ } #sidebar-second .block { padding: 0 0 0 15px; /* LTR */ } .block .content { margin: 0.5em 0; } #sidebar-first .block-region { margin: 0 15px 0 0px; /* LTR */ } #sidebar-second .block-region { margin: 0 0px 0 15px; /* LTR */ } .block-region { padding: 1em; background: transparent; border: 2px dashed #b4d7f0; text-align: center; font-size: 1.3em; } /* Now we add the backgrounds for the main content shading */ #wrapper #container #center #squeeze { background: #fff url(images/bg-content.png) repeat-x 50% 0; position: relative; } #wrapper #container #center .right-corner { background: transparent url(images/bg-content-right.png) no-repeat 100% 0; position: relative; left: 10px; } #wrapper #container #center .right-corner .left-corner { padding: 60px 25px 5em 35px; background: transparent url(images/bg-content-left.png) no-repeat 0 0; margin-left: -10px; position: relative; left: -10px; min-height: 400px; } #wrapper #container .region-footer { float: none; clear: both; text-align: center; margin: 4em 0 -3em; color: #898989; } #wrapper #container .breadcrumb { position: absolute; top: 15px; left: 35px; /* LTR */ z-index: 3; } body.sidebar-first .region-footer { margin-left: -210px; } body.sidebar-second .region-footer { margin-right: -210px; } body.two-sidebars .region-footer { margin: 0 -210px; } /** * Header */ div#branding { font-family: Helvetica,Arial,sans-serif; } div#branding strong { font-weight: normal; } #branding, #branding a:link, #branding a:visited { color: #fff; text-shadow: #1659ac 0px 1px 3px; font-size: 1.5em; } #branding a:hover { text-decoration: none; } #wrapper #container .breadcrumb { font-size: 0.92em; } #wrapper #container .breadcrumb, #wrapper #container .breadcrumb a { color: #529ad6; } #highlighted { padding: 1em; background-color: #fff; border: 1px solid #e0e5fb; margin-bottom: 2em; } /** * Overlay */ #overlay #overlay-tabs li a { background: #d9eaf5; color: #000; } #overlay #overlay-tabs li a:hover, #overlay #overlay-tabs li a:focus { background: #fff; } #overlay #overlay-tabs li.active a { background: url("images/body.png") repeat-x scroll 50% -58px #edf5fa; color: #fff; } #overlay-content { padding: 1px; } #overlay-content #header { display: none; } #overlay-content #wrapper { background-position: 50% -80px; } /** * Primary navigation */ ul.main-menu { margin: 0; padding: 0; float: right; /* LTR */ position: relative; z-index: 4; } ul.main-menu li { margin: 0; padding: 0; float: left; /* LTR */ background-image: none; } ul.main-menu li a, ul.main-menu li a:link, ul.main-menu li a:visited { display: block; margin: 0 1em; padding: .75em 0 0; color: #fff; background: transparent url(images/bg-navigation-item.png) no-repeat 50% 0; } ul.main-menu li a:hover, ul.main-menu li a.active { color: #fff; background: transparent url(images/bg-navigation-item-hover.png) no-repeat 50% 0; } /** * Secondary navigation */ ul.secondary-menu { margin: 0; padding: 18px 0 0; float: right; /* LTR */ clear: right; /* LTR */ position: relative; z-index: 4; } ul.secondary-menu li { margin: 0; padding: 0; float: left; /* LTR */ background-image: none; } ul.secondary-menu li a, ul.secondary-menu li a:link, ul.secondary-menu li a:visited { display: block; margin: 0 1em; padding: .75em 0 0; color: #cde3f1; background: transparent; } ul.secondary-menu li a:hover, ul.secondary-menu li a.active { color: #cde3f1; background: transparent; } /** * Local tasks */ ul.primary, ul.primary li, ul.secondary, ul.secondary li { border: 0; background: none; margin: 0; padding: 0; } #tabs-wrapper { margin: 0 -26px 1em; padding: 0 26px; border-bottom: 1px solid #e9eff3; position: relative; } ul.primary { padding: 0.5em 0 10px; float: left; /* LTR */ } ul.secondary { clear: both; text-align: left; /* LTR */ border-bottom: 1px solid #e9eff3; margin: -0.2em -26px 1em; padding: 0 26px 0.6em; } h1.with-tabs { float: left; /* LTR */ margin: 0 2em 0 0; /* LTR */ padding: 0; } ul.primary li a, ul.primary li.active a, ul.primary li a:hover, ul.primary li a:visited, ul.secondary li a, ul.secondary li.active a, ul.secondary li a:hover, ul.secondary li a:visited { border: 0; background: transparent; padding: 4px 1em; margin: 0 0 0 1px; /* LTR */ height: auto; text-decoration: none; position: relative; top: -1px; display: inline-block; } ul.primary li.active a, ul.primary li.active a:link, ul.primary li.active a:visited, ul.primary li a:hover, ul.secondary li.active a, ul.secondary li.active a:link, ul.secondary li.active a:visited, ul.secondary li a:hover { background: url(images/bg-tab.png) repeat-x 0 50%; color: #fff; } ul.primary li.active a, ul.secondary li.active a { font-weight: bold; } /** * Nodes & comments */ .node { border-bottom: 1px solid #e9eff3; margin: 0 -16px 1.5em; padding: 1.5em 16px; } ul.links li, ul.inline li { margin-left: 0; margin-right: 0; padding-left: 0; /* LTR */ padding-right: 1em; /* LTR */ background-image: none; } .node .links, .comment .links { text-align: left; /* LTR */ padding-left: 0; /* LTR */ } .user-picture, .comment .submitted { float: right; /* LTR */ clear: right; /* LTR */ padding-left: 1em; /* LTR */ } .new { color: #ffae00; font-size: 0.92em; font-weight: bold; float: right; /* LTR */ } .preview .node, .preview .comment, .node-sticky { margin: 0; padding: 0.5em 0; border: 0; background: 0; } .node-sticky { padding: 1em; background-color: #fff; border: 1px solid #e0e5fb; margin-bottom: 2em; } #comments { position: relative; top: -1px; border-bottom: 1px solid #e9eff3; margin: 1.5em -25px 0; padding: 0 25px; } #comments h2.comments { margin: 0 -25px; padding: .5em 25px; background: #fff url(images/gradient-inner.png) repeat-x 0 0; } .comment { margin: 0 -25px; padding: 1.5em 25px 1.5em; border-top: 1px solid #e9eff3; } .indented { margin-left: 25px; /* LTR */ } .comment h3 a.active { color: #494949; } .node .content, .comment .content { margin: 0.6em 0; } /** * Aggregator.module */ #aggregator { margin-top: 1em; } #aggregator .feed-item-title { font-size: 160%; line-height: 130%; } #aggregator .feed-item { border-bottom: 1px solid #e9eff3; margin: -1.5em -31px 1.75em; padding: 1.5em 31px; } #aggregator .feed-item-categories { font-size: 0.92em; } #aggregator .feed-item-meta { font-size: 0.92em; color: #898989; } /** * Color.module */ #palette .form-item { border: 1px solid #fff; } #palette .item-selected { background: #fff url(images/gradient-inner.png) repeat-x 0 0; border: 1px solid #d9eaf5; } /** * Menu.module */ tr.odd td.menu-disabled { background-color: #edf5fa; } tr.even td.menu-disabled { background-color: #fff; } /** * Poll.module */ .poll .bar { background: #fff url(images/bg-bar-white.png) repeat-x 0 0; border: solid #f0f0f0; border-width: 0 1px 1px; } .poll .bar .foreground { background: #71a7cc url(images/bg-bar.png) repeat-x 0 100%; } .poll .percent { font-size: .9em; } /** * Autocomplete. */ #autocomplete li { cursor: default; padding: 2px; margin: 0; } /** * Collapsible fieldsets */ fieldset { margin: 1em 0; padding: 1em; border: 1px solid #d9eaf5; background: #fff url(images/gradient-inner.png) repeat-x 0 0; } /* Targets IE 7. Fixes background image in field sets. */ *:first-child+html fieldset { padding: 0 1em 1em; background-position: 0 .75em; background-color: transparent; } *:first-child+html .text-format-wrapper .filter-wrapper { padding: 1.5em 0 1.5em; background-position: 0 0; } /* Keep the background position at 0 for filters and vertical tabs. */ *:first-child+html fieldset.filter-wrapper, *:first-child+html fieldset.vertical-tabs-pane { background-position: 0 0; } *:first-child+html fieldset .fieldset-wrapper .fieldset-description { padding-top: 1em; } html.js fieldset.collapsed { background: transparent; padding-top: 0; padding-bottom: .6em; } html.js fieldset.collapsible .fieldset-legend { padding-left: 2em; /* LTR */ background: url(images/menu-expanded.gif) no-repeat 0% 50%; /* LTR */ } html.js fieldset.collapsed .fieldset-legend { background: url(images/menu-collapsed.gif) no-repeat 0% 50%; /* LTR */ } .fieldset-legend span.summary { color: #898989; } /** * Vertical tabs. */ div.vertical-tabs { border-color: #d9eaf5; } div.vertical-tabs .vertical-tabs-panes fieldset.vertical-tabs-pane { padding: 0.5em 1em; } div.vertical-tabs ul.vertical-tabs-list { border-color: #d9eaf5; } div.vertical-tabs ul.vertical-tabs-list li { background-color: #edf5fa; border-color: #d9eaf5; } div.vertical-tabs ul.vertical-tabs-list li strong { font-weight: normal; } div.vertical-tabs ul.vertical-tabs-list li.selected strong { font-weight: bold; } div.vertical-tabs ul.vertical-tabs-list li.selected small { color: #898989; } div.vertical-tabs ul.vertical-tabs-list li.selected { background: #fff repeat-x 0 0; } div.vertical-tabs ul.vertical-tabs-list li.selected.first { background-image: url(images/gradient-inner.png); } div.vertical-tabs ul.vertical-tabs-list li.selected a strong { color: #494949; } /** * Syndication icons and block */ #block-node-syndicate h2 { float: left; /* LTR */ padding-right: 20px; /* LTR */ } #block-node-syndicate img, .feed-icon { float: right; /* LTR */ padding-top: 4px; } #block-node-syndicate .content { clear: right; /* LTR */ } /** * Login Block */ #user-login-form { text-align: center; } #user-login-form ul { text-align: left; /* LTR */ } #user-login .openid-links { padding: 0; } #user-login-form .openid-links { padding-left: 0.5em; /* LTR */ } #user-login-form .openid-links li.user-link { padding-left: 1em; /* LTR */ } /** * User profiles. */ .profile { margin-top: 1.5em; } .profile h3 { border-bottom: 0; margin-bottom: 1em; } .profile dl { margin: 0; } .profile dt { font-weight: normal; color: #898989; font-size: 0.92em; line-height: 1.3em; margin-top: 1.4em; margin-bottom: 0.45em; } .profile dd { margin-bottom: 1.6em; } /** * Admin Styles */ div.admin-panel, div.admin-panel .description, div.admin-panel .body, div.admin, div.admin .left, div.admin .right, div.admin .expert-link, div.item-list, .menu { margin: 0; padding: 0; } div.admin .left { float: left; /* LTR */ width: 48%; } div.admin .right { float: right; /* LTR */ width: 48%; } div.admin-panel { background: #fff url(images/gradient-inner.png) repeat-x 0 0; padding: 1em 1em 1.5em; } div.admin-panel .description { margin-bottom: 1.5em; } div.admin-panel dl { margin: 0; } div.admin-panel dd { color: #898989; font-size: 0.92em; line-height: 1.3em; margin-top: -.2em; margin-bottom: .65em; } table.system-status-report th { border-color: #d3e7f4; } #autocomplete li.selected, tr.selected td, tr.selected td.active { background: #027ac6; color: #fff; } tr.selected td a:link, tr.selected td a:visited, tr.selected td a:active { color: #d3e7f4; } tr.taxonomy-term-preview { opacity: 0.5; } tr.taxonomy-term-divider-top { border-bottom: none; } tr.taxonomy-term-divider-bottom { border-top: 1px dotted #CCC; } .theme-selector h3 { margin: 10px 0; } .theme-selector .operations li { list-style-image: none; } /** * CSS support */ /******************************************************************* * Color Module: Don't touch * *******************************************************************/ /** * Generic elements. */ .preview { background-color: #fcfce8; border: 1px solid #e5e58f; } .form-item input.error, .form-item textarea.error { border: 1px solid #c52020; color: #363636; } /** * dblog.module */ tr.dblog-user { background-color: #fcf9e5; } tr.dblog-user td.active { background-color: #fbf5cf; } tr.dblog-content { background-color: #fefefe; } tr.dblog-content td.active { background-color: #f5f5f5; } tr.dblog-warning { background-color: #fdf5e6; } tr.dblog-warning td.active { background-color: #fdf2de; } tr.dblog-error { background-color: #fbe4e4; } tr.dblog-error td.active { background-color: #fbdbdb; } tr.dblog-page-not-found, tr.dblog-access-denied { background: #d7ffd7; } tr.dblog-page-not-found td.active, tr.dblog-access-denied td.active { background: #c7eec7; } /** * Status report colors. */ table.system-status-report tr.error, table.system-status-report tr.error th { background-color: #fcc; border-color: #ebb; color: #200; } table.system-status-report tr.warning, table.system-status-report tr.warning th { background-color: #ffd; border-color: #eeb; } table.system-status-report tr.ok, table.system-status-report tr.ok th { background-color: #dfd; border-color: #beb; } drupal-7.41/themes/garland/page.tpl.php0000644000000000000000000000554212611765734016574 0ustar rootroot drupal-7.41/themes/garland/template.php0000644000000000000000000001107212611765734016670 0ustar rootroot' . t('You are here') . ''; $output .= '
    ' . implode(' › ', $breadcrumb) . '
    '; return $output; } } /** * Override or insert variables into the maintenance page template. */ function garland_preprocess_maintenance_page(&$variables) { // While markup for normal pages is split into page.tpl.php and html.tpl.php, // the markup for the maintenance page is all in the single // maintenance-page.tpl.php template. So, to have what's done in // garland_preprocess_html() also happen on the maintenance page, it has to be // called here. garland_preprocess_html($variables); } /** * Override or insert variables into the html template. */ function garland_preprocess_html(&$variables) { // Toggle fixed or fluid width. if (theme_get_setting('garland_width') == 'fluid') { $variables['classes_array'][] = 'fluid-width'; } // Add conditional CSS for IE6. drupal_add_css(path_to_theme() . '/fix-ie.css', array('group' => CSS_THEME, 'browsers' => array('IE' => 'lt IE 7', '!IE' => FALSE), 'preprocess' => FALSE)); } /** * Override or insert variables into the html template. */ function garland_process_html(&$variables) { // Hook into color.module if (module_exists('color')) { _color_html_alter($variables); } } /** * Override or insert variables into the page template. */ function garland_preprocess_page(&$variables) { // Move secondary tabs into a separate variable. $variables['tabs2'] = array( '#theme' => 'menu_local_tasks', '#secondary' => $variables['tabs']['#secondary'], ); unset($variables['tabs']['#secondary']); if (isset($variables['main_menu'])) { $variables['primary_nav'] = theme('links__system_main_menu', array( 'links' => $variables['main_menu'], 'attributes' => array( 'class' => array('links', 'inline', 'main-menu'), ), 'heading' => array( 'text' => t('Main menu'), 'level' => 'h2', 'class' => array('element-invisible'), ) )); } else { $variables['primary_nav'] = FALSE; } if (isset($variables['secondary_menu'])) { $variables['secondary_nav'] = theme('links__system_secondary_menu', array( 'links' => $variables['secondary_menu'], 'attributes' => array( 'class' => array('links', 'inline', 'secondary-menu'), ), 'heading' => array( 'text' => t('Secondary menu'), 'level' => 'h2', 'class' => array('element-invisible'), ) )); } else { $variables['secondary_nav'] = FALSE; } // Prepare header. $site_fields = array(); if (!empty($variables['site_name'])) { $site_fields[] = $variables['site_name']; } if (!empty($variables['site_slogan'])) { $site_fields[] = $variables['site_slogan']; } $variables['site_title'] = implode(' ', $site_fields); if (!empty($site_fields)) { $site_fields[0] = '' . $site_fields[0] . ''; } $variables['site_html'] = implode(' ', $site_fields); // Set a variable for the site name title and logo alt attributes text. $slogan_text = $variables['site_slogan']; $site_name_text = $variables['site_name']; $variables['site_name_and_slogan'] = $site_name_text . ' ' . $slogan_text; } /** * Override or insert variables into the node template. */ function garland_preprocess_node(&$variables) { $variables['submitted'] = $variables['date'] . ' — ' . $variables['name']; } /** * Override or insert variables into the comment template. */ function garland_preprocess_comment(&$variables) { $variables['submitted'] = $variables['created'] . ' — ' . $variables['author']; } /** * Override or insert variables into the block template. */ function garland_preprocess_block(&$variables) { $variables['title_attributes_array']['class'][] = 'title'; $variables['classes_array'][] = 'clearfix'; } /** * Override or insert variables into the page template. */ function garland_process_page(&$variables) { // Hook into color.module if (module_exists('color')) { _color_page_alter($variables); } } /** * Override or insert variables into the region template. */ function garland_preprocess_region(&$variables) { if ($variables['region'] == 'header') { $variables['classes_array'][] = 'clearfix'; } } drupal-7.41/themes/garland/fix-ie-rtl.css0000644000000000000000000000221212611765734017032 0ustar rootroot body { /* Center layout */ text-align: center; } #squeeze { zoom: 1; direction: ltr; } #squeeze .left-corner { direction: rtl } #header-region, #wrapper #container { /* Reset text alignment */ text-align: right; } #wrapper #container #center { /* Reduce amount of damage done by extremely wide content */ overflow: hidden; } #wrapper #container #center .right-corner .left-corner { /* Because of the lack of min-height, we use height as an alternative */ height: 400px; } fieldset { /* Don't draw backgrounds on fieldsets in IE, as they look really bad. */ background: none; } /* Prevent fieldsets from shifting when changing collapsed state. */ html.js fieldset.collapsible { top: -1em; } html.js fieldset.collapsed { top: 0; margin-bottom: 1em; } tr.menu-disabled { /* Use filter to emulate CSS3 opacity */ filter: alpha(opacity=50); } #header-region { /* Because of the lack of min-height, we use height as an alternative */ height: 1em; } #attach-hide label, #uploadprogress div.message { /* Fading elements in IE causes the text to bleed unless they have a background. */ background-color: #ffffff; } drupal-7.41/themes/garland/logo.png0000644000000000000000000001177412611765734016023 0ustar rootrootPNG  IHDR@IAIDATx^[ |yfv!=݇eY2Ȳsc &Ýnh!r4фHCi% \!?ؒlK${һݝ;;f=d$}3fo'E@ť,N!N'A H fATzTBoDd J%)gR(M"ωDB>F#z;!(Hlz*@<$ȏDSL +^K 'ɿdM>'/5z t|-eNjeGpKEDQ)`@/6Jɋb< X, .d.UX {BEH &7+cȼ7-V1F'?PV(.6PY/}S4+%E&AӔ !b JxV)}l*[>YY20;QE*d|NcR_RT]ח< J],TTR2VF%^ Xa(hdSbiUckd`8qnTDWT}Te+M=f: +1:(Dx,eUǬxN8uqHU Y*v`qN;="z\@F3SI@K#NT+G~bI-35A~{t7m+ MZo|*.mI'nlBeC@l l5%! z#*prҚ+BA?>g"kl xUiVu 7>ius Eє7/RH_.k[ԃo"#tf"Kb!:RCrM/T$^Z+բ*< .  u_RBor{nh.oc2*B-Zs(2xHpPW-`@$-ygI2H(:|PL×L 3ھ kމ:$'sg,}D6}PBWhN;5phuCfßV{ur7~k' "FECgl*JA/ucyqvPbw"عsIyD-2.0=Tɰs"xo՗]x${;oX82 īhONlо.NPO)##HZ,ƓF2g:{Ïm菤 R(& S5ESR=VM뫝cc=Cgv?ZϿoLr< I!vA9 ̦2&̪7/Gr2DdSMHt jUjcScCfE05}j0r`< ɡF1 92tUr"q@Vp,0KRZS{L bM'Q^- #XV˟BĘ@=|&'>r LHl:AJ dsmi"NI!h>y|OZ_ƥMp"Sr_3WecrF5loykk(.=c uw]P @"bX?'EK[*_Er_>9 <9I͍`YZy*$H)4H Eyv>8Y)=/Y֛/z+Э^}UՄj:"z!TG|Bc4AhMg6p"EjͰ"[4+ [l$ț'0PFdETP%GG.囉: (?N~M/=oK;{ 2H]}4D1 N`Gd fpd2Wv]~}X|h*Ǥúٳ))u ᫗C?~yll,jՒg7ClJΟ/y)~ơwtM Ϧ TT>Oe `Bdf>Nfi\f~Cf`E&йJl'뛈yj95KݶϽͧ^KGaXy^ @x˚N[sBݔBCbE%i b !['Cn 3ea${oBٌ>͙+FAJ7U/hymg7ԚVkCc8M*)^ 0n $W=ه0DdȈXL4ɱ}JNlXX(1#؀,YgdȞ}T!X~1 34Nc5,ؗOJo~dYTO3pdع> eUXPozi!W&ݳG9<4Bœb+`+پ%_ǝ=ٵ/c}OlP"ʐvn۬]sɍ-kfvxѢYTm={OmN@$:!8)݀ Hܽu*`%Xpb-uq٧wc53>]k.oXhGќdA$#Uj{ʽx,0nÎw}jeYC`1|ރPwF2 [W5b](c7#1Hʴmm>mAG-C1kǒh"a߆LlK Dda3J c`߁p8lR@uq&҉M&bȽfmkF<л۱$m[== w&*j r20aeөё#LQ4>8U aY sZk啔 ȱNkK ̼e{7DL3dF> G&x.P`1 D$kUUU M|5.eDT񊄎F@wAΡ?v*TpO2dBc K)O*]4]zr&"z$ DLPwTA nN@\!9Yguq€J\Ջ.2 Xh՟"?JyJR/H ٬ڋ TJB䕓`[m򮰰.͛ _eigbV稽%GC=ʌ(l~zqI*0$l{}𪨬l#s0:53J74:C$6WN|DbZ&g1vf4x^}h㝿*n1,t-tڟ()W'IDATx^Ԍ70 uT m5 ÈL[95Jfml&&D]&}-bx2c)=g E9u_AWRgY++ cqx"ny@kBg(w 20ʹkP ef%'Pak?k@C9 Pu1Fk-\[p̜C*LX4$H*CjZtcC^~^xQQy— }Mg M z߬[TtHiV4ASsҺY5p]"3=S Q1kHM^In‹as|{;x! o%>DC# C0 ԕ  V-JºmRauƉ386RW8f2 271Vs,lepi"D_:=ԛӮÜ,f0Qe觥JZo)2AHl+G&@&]Q$(8tl,_kϡo{6sMer2j7MJeEMw9Z%dA8ZF™IH X|TS<˚>j"0pKƿA(^Z?i_:.qͿ g"0F_^ő#ӎvpCGTZAޡQԝl0˰R`ayvjJ%l!eըm7GS{C3vn݃h/f6LP!Ia\F*ʗ_$󝫆41&BH*jdNiBJ Ae'1.m/i;o4z3<$U ?16BtQZJW:f6 !L)T4Eh -QbL@VwGQp̣!^]-ޘOmp3(ɎBpW]6o>-K2۷ɢv<:P~ze;yeC}n.\#\z&YMѣ0Hv7mH$0Ęx|5Tq5&.Ɖj6X9)t }ruWVjպ_e%<_)L; 2n+\q]r]. M:UeHV tLBػnT&g}jkw7.?N~EG~@8Zp?|A8Y7&Ryj8 <p4:A> }9L6f?71qD/rT>NE$(nNtPp$c:a0JlWP1@6EװdAAEPQ VN us}XӲFM&sJGHtG IL0zwVj*8dKiL!}ca TAHQfqAqWt)K Y)d `f"x-hHDy Ko$% o%B钏gs1 M05ژW=`B3&ƕZ*RE1*#YS iV[/:Bn:c9`i$4]7cևݿwК̑N ˴-HfY.`%2% M]LdLz, !AJnL+:|-׺GLȎ)4n k{x?η}amp|4J._=^?l&\IGld`"2* A?c zťB[O" Kjuz+@x߼}|x?ךJXLh4_vV~46fx>Ļ_;40w h0l4/D'$UdN )^#`P5텊AN6>M{-b2RT-Ed-"rQи^ E*e/MmU<8I5Z74Ip3.kڳښlMY^/ɜecQaQoS BU>y*M, $ߨD3ӊ+nzi!%B$y`Wk1!D=Th3ejNt &Ԫ'M$MwU&t.;}/aگJ Hf&2jɲL0'z"sI隑{Pуó:L=?Mo)755Hv~Lh)=v|h4zl*漫0%+y i=8_~sfza596<='Y-bn FY}if~]p\,(P( jF߭3\$Sㇱg'Oյ{ɑ 6*2LNCs7ʮI;sa m#ҪA8VT,]jfce$DcAV e{Jb)w m!T_zaB@(;iB#6<(&\WN:t:t]=9q=u6Lu/>`j֩qp >VY ax=m(;1 g#n?In5w&G}@ L㍗\^[1s"4k)H? 8QUOtХQ5QU#@:@VMƐb(&u2&liJƚͩ6vIfyҧdʩ{)uæ/v0$i1 M/2Uٙ/Gic5HHS;Z8B1A 0+"CU(ނ\1إ `MRJesa[WŠ՜}k+xZe\: áE+Al D"ʻ犲A2$04_S"1mZX|z1 #ۄ`ĊhсNiWڎɎpoXď;U01=J"8,Dy D)l tJR՜YvgǝF 1L,!rLV^ l5,9ۡy{,m$&PA0TbݼpE?Aۤ"OD!*k-6ӯz+G,dWޢVʵ쪝%RvÅS"f8E?&[N CL[ (~S@nj9uh8mf{K^eXz4i+lz `~j ?-8F~g0VL\t?59ǫK$(??~șf_ӭ/#0r[Eo&EX$Tfj&l`#")TY!MBiqCUalJôj2OLj4@ܶ6ՁÁ"4 >' x栩%qcOE`R)ކ5.MmhSW}4\m6GRg A9@b>ƔtVYG’ەOd+kMuFCt%"ʅ"t~kZf*,dK,e5 "CU+ND;Ř  Uxv#hDȎrK SB]h+.q[ezD%F "Uq]WX{5k30z-kDz\Lyg%ٶ"T%˙ˆ>v]dPѼDB|G:#Ov1?Xb^b1"b$֥hXE)"3N2㋵B]2l킅ee6Ҕ m#lXȚ`LPM{U>מ/H'6DHje a1'v1"-D;Ԑ|`>m>}2РF-#ݍd5|W׎-uZZm s--2쭃2mO|Jvj0m80'*߉L8کvH_*LkD7fdťlsrbzԒH‰M[>H^+mV~*kf,b}So?}nܹl>q듣+^y6,d.pm"pٖYXĆo>RjiGu3Ч1@K,*C0&.Fyۯ Ys '\p`X1*[)a# Ab,>''w/}惓;O.oNW>< Y]߼|w9? #5FVHgR%Xp>JUN+W,Pb,a=.t[_Ɇe?" pg^m˜)h 5Lp ':^W(q|;1}/;rS ĚLM#P̱6'7o .t~~yώn~Sz_}4ա: (N:M-%ha@-d ӆ#6h @5 #$UMCG<$b`#! r@Y5tx5'<]xOdQ~/Û_^˓̷NoYɭ0=n;Skx4C\>emf[Iⓧ|ׯCoV{qKs"XM V8eフuV uY·S ʖP kN%bPJb28)VWBkcJۖ܍QzrVlV|&(y  ՗Zt[76GǮ?|Λymʅ\͵˗ҝ7\y٤}zx,h5N}WUZj #~3::٫a2JK4$hB!HET{,ɘN^Jن|`ЛKN1QaZj>G'S4(ݤuXiU rv!饶a25u0uz pK2^wk >^br{14.uleՃ$E>Gݢ# O/ O'|jc}[zfh]=mci3F޼ ~g@B_x9-}ϛ/oqf`%_("H EQɈ: U\*PE{V镠dCyƖ`J,AE:gcILmYd[J{ / 8"xp-8^pތgxTF!]SP I7lwU,= ,r!7 d1]8R[.ZsmKba@~9>(ToJFmXY'EAW%]8*۳]T1f Td%Nx*];y?/L}0:'~?F<۷'ч{xOטE{NtB^jnf}әh3L^q6h M;}#o|4@Tޔoh g4D .gmִ:N|2`V"SutKW5ƚ8>n*҃b1a΀1 ц=W?0g1-eGGIgAO,_|wߺtd W.֥?\ h7|ra-w. s7TB#/:l?[uڇg<ūtξ>2 ;>ϭs ݋曐s~r_Ɵ!L60qNmI+ѳ'y_,|\.=|Q/7џLڑ0-HtOJ(WZ ӋT#.6MhPnnnC25ϖHPXM|h+*̼l5Ysՙ*H å`zem21 t>%yk@LM)(m+l\ `*E^G{`jVSVEK$rTsį~9IH66*:0 u}%S7PZհVc`@IHA+^ɭpgA2!lW V5Db (p,Ű8b{oWdRDˇnF/ }f);mw:Pt'P";7j?.MO.p*lƏPӔs2cSj٤D^K^Q"FQ4GI1)]:L*SQUtQ!؉h#stbG8_\.Eó5V&޲/܂3_=BJ?&&xDi~:p<:o=BG+ڧ#WWSoR4 :L <{v&0 Lbb1hS'u3rY>f*ST[GiD2Z}o|i~qt=:L!ƭj_=Cm"Zũ9Ԓ9ϐK@=c:)5z`2+qAU|`n{jj+je 3$tI]iL{&'O|ɛ]Lp--GY6CN=s欰~"Yrw$~m8 o)s3N0 L`x?0C݄nT_&0 L`&0 L`ND"ב3P`,v͔fٲ㽃Iڕ\債Qq#VMSRR)whqk#ڽ)B_)NY$rDH)͞gIk7aTÖuSkHoT&T:IENDB`drupal-7.41/themes/engines/0000755000000000000000000000000012611765734014363 5ustar rootrootdrupal-7.41/themes/engines/phptemplate/0000755000000000000000000000000012611765734016706 5ustar rootrootdrupal-7.41/themes/engines/phptemplate/phptemplate.engine0000644000000000000000000000107412611765734022422 0ustar rootrootfilename) . '/template.php'; if (file_exists($file)) { include_once DRUPAL_ROOT . '/' . $file; } } /** * Implements hook_theme(). */ function phptemplate_theme($existing, $type, $theme, $path) { $templates = drupal_find_theme_functions($existing, array($theme)); $templates += drupal_find_theme_templates($existing, '.tpl.php', $path); return $templates; } drupal-7.41/themes/seven/0000755000000000000000000000000012611765734014053 5ustar rootrootdrupal-7.41/themes/seven/maintenance-page.tpl.php0000644000000000000000000000243612611765734020563 0ustar rootroot <?php print $head_title; ?>

    drupal-7.41/themes/seven/ie6.css0000644000000000000000000000041412611765734015247 0ustar rootroot ul.menu li, ul.menu li a, ul.links li, ul.links li a, .action-links, #page { height: 1%; } #block-system-main ul.admin-list li a { height: 1px; position: relative; display: block; } #block-system-main ul.admin-list li div.description a { display: inline; } drupal-7.41/themes/seven/vertical-tabs.css0000644000000000000000000000455512611765734017336 0ustar rootroot /** * Override of misc/vertical-tabs.css. */ div.vertical-tabs { background: #fff url(images/fc.png) repeat-y 0 0; /* LTR */ border: 1px solid #ccc; margin: 10px 0; position: relative; } fieldset.vertical-tabs-pane { border: 0; padding: 0; margin: 0; } div.vertical-tabs .vertical-tabs-list { border-bottom: 1px solid #ccc; float: left; /* LTR */ font-size: 1em; line-height: 1; margin: 0 -100% -1px 0; /* LTR */ padding: 0; width: 240px; } div.vertical-tabs ul li.vertical-tab-button { list-style: none; list-style-image: none; margin: 0; } div.vertical-tabs ul li.vertical-tab-button a { border-top: 1px solid #ccc; display: block; padding: 10px; } div.vertical-tabs ul li.first a { border-top: 0; } div.vertical-tabs ul li.vertical-tab-button strong { font-size: 0.923em; } div.vertical-tabs ul li.vertical-tab-button .summary { color: #666; display: block; font-size: 0.846em; padding-top: 0.4em; } div.vertical-tabs ul li.vertical-tab-button a:hover, div.vertical-tabs ul li.vertical-tab-button a:focus { background: #d5d5d5; text-decoration: none; outline: 0; } div.vertical-tabs ul li.selected a, div.vertical-tabs ul li.selected a:hover, div.vertical-tabs ul li.selected a:focus, div.vertical-tabs ul li.selected a:active { background: #fff; border-right-color: #fff; /* LTR */ border-top: 1px solid #ccc; } div.vertical-tabs ul li.first.selected a, div.vertical-tabs ul li.first.selected a:hover { border-top: 0; } div.vertical-tabs ul li.selected a:focus strong { text-decoration: underline; } div.vertical-tabs .vertical-tabs-panes { margin: 0 0 0 265px; /* LTR */ padding: 10px 15px 10px 0; /* LTR */ } fieldset.vertical-tabs-pane legend { display: none; } fieldset.vertical-tabs-pane fieldset legend { display: block; } .vertical-tabs-pane .fieldset-wrapper > div:first-child { padding-top: 5px; } /** * Prevent text inputs from overflowing when container is too narrow. "width" is * applied to override hardcoded cols or size attributes and used in conjunction * with "box-sizing" to prevent box model issues from occurring in most browsers. */ .vertical-tabs .form-type-textfield input { width: 100%; -moz-box-sizing: border-box; -webkit-box-sizing: border-box; box-sizing: border-box; } * html .vertical-tabs .form-type-textfield, * html .vertical-tabs .form-textarea-wrapper { width: 95%; /* IE6 */ } drupal-7.41/themes/seven/ie7.css0000644000000000000000000000056012611765734015252 0ustar rootroot ul.tabs.primary { padding: 0; } ul.primary li, ul.primary li a, ul.primary li.active a { float: none !important; display: inline; } ul.primary li, ul.primary li a, ul.primary li a.active, ul.primary li a:active, ul.primary li a:visited, ul.primary li a:hover, ul.primary li.active a { zoom: 1; position: relative; } ul.admin-list li { position: static; } drupal-7.41/themes/seven/vertical-tabs-rtl.css0000644000000000000000000000077212611765734020132 0ustar rootroot /** * Override of misc/vertical-tabs-rtl.css. */ div.vertical-tabs { background: #fff url(images/fc-rtl.png) repeat-y right 0; } div.vertical-tabs .vertical-tabs-list { float: right; margin: 0 0 -1px -100%; } div.vertical-tabs ul li.selected a, div.vertical-tabs ul li.selected a:hover, div.vertical-tabs ul li.selected a:focus, div.vertical-tabs ul li.selected a:active { border-left-color: #fff; } div.vertical-tabs .vertical-tabs-panes { margin: 0 265px 0 0; padding: 10px 0 10px 15px; } drupal-7.41/themes/seven/style-rtl.css0000644000000000000000000000726212611765734016533 0ustar rootroot /** * Generic elements. */ dl dd, dl dl { margin-right: 20px; } ul, .block ul, .item-list ul { margin: 0.25em 1.5em 0.25em 0; } ol { margin: 0.25em 2em 0.25em 0; } /** * Skip link. */ #skip-link { right: 50%; margin-right: -5.25em; } #skip-link a, #skip-link a:link, #skip-link a:visited { padding: 1px 10px 2px 10px; } /** * Branding. */ #branding { padding: 20px 20px 0 20px; } #branding div.block { float: left; padding-left: 0; padding-right: 10px; } #branding div.block form div.form-item { float: right; } #branding div.block form input.form-text { margin-left: 10px; margin-right: 0; } /** * Help. */ #help div.more-help-link { text-align: left; } /** * Page title. */ #branding h1.page-title { float: right; } /** * Tabs. */ ul.primary li, ul.primary li a:link, ul.primary li a.active { float: right; } ul.primary, ul.secondary { float: left; } ul.secondary li { float: none; } ul.primary { padding-top: 0; } /** * Page layout. */ #page { padding: 20px 0 40px 0; margin-left: 40px; margin-right: 40px; } #secondary-links ul.links li { padding: 0 0 10px 10px; } ul.links li, ul.inline li { padding-left: 1em; padding-right: 0; } ul.admin-list li { padding: 9px 30px 0 0; margin-right: 0; background: url(images/list-item-rtl.png) no-repeat right 11px; } ul.admin-list li a { margin-right: -30px; margin-left: 0; padding: 0 30px 4px 0; } ul.admin-list.compact li a { margin-right: 0; } ul.admin-list li div.description a { margin-right: 0; } /** * Tables. */ table th.active a { padding: 0 0 0 25px; } table th.active img { left: 3px; right: auto; } /** * Exception for webkit bug with the right border of the last cell * in some tables, since it's webkit only, we can use :last-child */ tr td:last-child { border-left: 1px solid #bebfb9; border-right: none; } /** * Fieldsets. */ fieldset { padding: 2.5em 0 0 0; } fieldset .fieldset-legend { padding-right: 15px; right: 0; } fieldset .fieldset-wrapper { padding: 0 15px 13px 13px; } /* Filter */ .filter-wrapper .form-item, .filter-wrapper .filter-guidelines, .filter-wrapper .filter-help { padding: 2px 0 0 0; } ul.tips li { margin: 0.25em 1.5em 0.25em 0; } body div.form-type-radio div.description, body div.form-type-checkbox div.description { margin-left: 0; margin-right: 1.5em; } input.form-submit, a.button { margin-left: 1em; margin-right: 0; } ul.action-links li { float: right; margin: 0 0 0 1em; } ul.action-links a { padding-left: 0; padding-right: 15px; background-position: right center; } /* Update options. */ div.admin-options label, div.admin-options div.form-item { margin-left: 10px; margin-right: 0; float: right; } /* Maintenance theming */ body.in-maintenance #sidebar-first { float: right; } body.in-maintenance #content { float: left; padding-left: 20px; padding-right: 0; } ol.task-list { margin-right: 0; } ol.task-list li { padding: 0.5em 20px 0.5em 1em; } ol.task-list li.active { background: transparent url(images/task-item-rtl.png) no-repeat right 50%; padding: 0.5em 20px 0.5em 1em; } /* Overlay theming */ .overlay #branding div.breadcrumb { float: right; } .overlay ul.secondary { margin: -1.4em 0 0.3em 0; } /* Shortcut theming */ div.add-or-remove-shortcuts { float: none; padding-left: 0; padding-right: 6px; } /* Dashboard */ #dashboard div.block div.content { padding: 10px 5px 5px 5px; } #dashboard div.block div.content ul.menu { margin-right: 20px; } /* Recent content block */ #block-node-recent .more-link { padding: 0 0 5px 5px; } /* User login block */ #user-login-form .openid-links { margin-right: 0; } #user-login-form .openid-links .user-link { margin-right: 1.5em; } drupal-7.41/themes/seven/reset.css0000644000000000000000000000560312611765734015713 0ustar rootroot /** * Reset CSS styles. * * Based on Eric Meyer's "Reset CSS 1.0" tool from * http://meyerweb.com/eric/tools/css/reset */ html, body, div, span, applet, object, iframe, h1, h2, h3, h4, h5, h6, p, blockquote, pre, a, abbr, acronym, address, big, cite, code, del, dfn, em, font, img, ins, kbd, q, s, samp, small, strike, strong, sub, sup, tt, var, b, u, i, center, dl, dt, dd, ol, ul, li, fieldset, form, input, select, textarea, label, legend, table, caption, tbody, tfoot, thead, tr, th, td, /* Drupal: system-menus.css */ td.menu-disabled, ul.links, ul.links.inline, ul.links li, .block ul, /* Drupal: admin.css */ div.admin, /* Drupal: system.css */ tr.even, tr.odd, tr.drag, tbody, tbody th, thead th, .breadcrumb, .item-list .icon, .item-list .title, .item-list ul, .item-list ul li, ol.task-list li.active, .form-item, tr.odd .form-item, tr.even .form-item, .form-item .description, .form-item label, .form-item label.option, .form-checkboxes, .form-radios, .form-checkboxes .form-item, .form-radios .form-item, .marker, .form-required, .more-link, .more-help-link, .item-list .pager, .item-list .pager li, .pager-current, .tips, ul.primary, ul.primary li, ul.primary li a, ul.primary li.active a, ul.primary li a:hover, ul.secondary, ul.secondary li, ul.secondary a, ul.secondary a.active, .resizable-textarea { margin: 0; padding: 0; border: 0; vertical-align: baseline; } /* Drupal: system-menus.css */ ul.links, ul.links.inline, ul.links li, .block ul, ol, ul, .item-list ul, .item-list ul li { list-style: none; } blockquote, q { quotes: none; } blockquote:before, blockquote:after, q:before, q:after { content: ''; content: none; } /* Remember to highlight inserts somehow! */ ins { text-decoration: none; } del { text-decoration: line-through; } /* Tables still need 'cellspacing="0"' in the markup. */ table { border-collapse: collapse; border-spacing: 0; } /** * Font reset. * * Specifically targets form elements which browsers often times give * special treatment. */ input, select, textarea { font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; } textarea { font-size: 1em; line-height: 1.538em; } /** * Markup free clearing. * * Consider adding your own selectors to this instead of finding ways * to sneak the clearfix class into Drupal's markup. * From http://perishablepress.com/press/2009/12/06/new-clearfix-hack */ ul.links:after, div.admin-panel .body:after, .clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } /* Exclude inline links from clearfix behavior */ ul.inline:after { content: ""; display: none; clear: none; } /* IE6 */ * html .form-item, * html ul.links, * html div.admin-panel .body, * html .clearfix { height: 1%; } /* IE7 */ *:first-child + html .form-item, *:first-child + html ul.links, *:first-child + html div.admin-panel .body, *:first-child + html .clearfix { min-height: 1%; } drupal-7.41/themes/seven/images/0000755000000000000000000000000012611765734015320 5ustar rootrootdrupal-7.41/themes/seven/images/ui-icons-ffffff-256x240.png0000644000000000000000000000716612611765734021737 0ustar rootrootPNG  IHDRIJPLTENtRNS2P."Tp@f` <BHJZ&0R,4j8D|($ blߝF>n~hhH IDATx^0 E8 av߄44z,͗lKV'4MQ_?u9(RP1 `2/@A:d @sxX.^@кR]B<ñToCT|", 5;vc_iiM"T}@BP(6'7j<< P!_1ݍ+҈R>e*Mw~;k@?iiy\j0xI8׿>X}6ݱ: Y㗈XArb?nqN 8@vffsvU~18Ét!C`\СC˾UEx~L6M4M\Y*\@/fjd#IPi!n0]H&-VTL@u @bw)EPA; c=Po50BJN {eawn:s ?aO$-i"(в$!N1/r+Iߑΰ50#v>JW,~LHȘ`)˜6@ĔdT_Y "K_aCxB0`z+6(} d` @S&TȲ|>JXN db~HU9$4{b 5Imn@ETxpFf9 @,8g =ʲLVǕ0Eh4Fbf9nR7x zWڍ@OP'2ɴB-1A <~dYϼAxT3*XŒbe~tfqYAL: IMTrY?$49' )`\@z8=eg 2LM q@}Uf8 ONi@O{)5L۳ɅKY=SHUU&[ 8,rl3=zWmz#,=EQ\AK J8SM1G:?P-?XīÉAW7L*Pe{ *uSS+N9 IjLZ<.w Etu羭vԸHSQ9{$0)]x]:}/׬zVi:`_PW|"wA O& qs|#`ڛq_2I+B;ty\ LY^/ 4_>?7k=cBme[t,LWTq_@rNB U> zDZ?q۩4EN{1%npgXHź2eu%~yOsߊoIP@J C}7v:r_&[#oSkU y*H~M *KVl|jq?)V96!λ;E ݆WvG nK+^ ߰,ׯׯH. * Xڡ1O`rvJWd4{jw{H_d5:{2vA:b,tbQ*)1^E=5Sxә^.69 yrrɡ4\q п,V5VGs{{{A{~qa>dX.gY_b=,n~hhH IDATx^0 E8 av߄44z,͗lKV'4MQ_?u9(RP1 `2/@A:d @sxX.^@кR]B<ñToCT|", 5;vc_iiM"T}@BP(6'7j<< P!_1ݍ+҈R>e*Mw~;k@?iiy\j0xI8׿>X}6ݱ: Y㗈XArb?nqN 8@vffsvU~18Ét!C`\СC˾UEx~L6M4M\Y*\@/fjd#IPi!n0]H&-VTL@u @bw)EPA; c=Po50BJN {eawn:s ?aO$-i"(в$!N1/r+Iߑΰ50#v>JW,~LHȘ`)˜6@ĔdT_Y "K_aCxB0`z+6(} d` @S&TȲ|>JXN db~HU9$4{b 5Imn@ETxpFf9 @,8g =ʲLVǕ0Eh4Fbf9nR7x zWڍ@OP'2ɴB-1A <~dYϼAxT3*XŒbe~tfqYAL: IMTrY?$49' )`\@z8=eg 2LM q@}Uf8 ONi@O{)5L۳ɅKY=SHUU&[ 8,rl3=zWmz#,=EQ\AK J8SM1G:?P-?XīÉAW7L*Pe{ *uSS+N9 IjLZ<.w Etu羭vԸHSQ9{$0)]x]:}/׬zVi:`_PW|"wA O& qs|#`ڛq_2I+B;ty\ LY^/ 4_>?7k=cBme[t,LWTq_@rNB U> zDZ?q۩4EN{1%npgXHź2eu%~yOsߊoIP@J C}7v:r_&[#oSkU y*H~M *KVl|jq?)V96!λ;E ݆WvG nK+^ ߰,ׯׯH. * Xڡ1O`rvJWd4{jw{H_d5:{2vA:b,tbQ*)1^E=5Sxә^.69 yrrɡ4\q п,V5VGs{{{A{~qa>dX.gY_b=,n~hhH IDATx^0 E8 av߄44z,͗lKV'4MQ_?u9(RP1 `2/@A:d @sxX.^@кR]B<ñToCT|", 5;vc_iiM"T}@BP(6'7j<< P!_1ݍ+҈R>e*Mw~;k@?iiy\j0xI8׿>X}6ݱ: Y㗈XArb?nqN 8@vffsvU~18Ét!C`\СC˾UEx~L6M4M\Y*\@/fjd#IPi!n0]H&-VTL@u @bw)EPA; c=Po50BJN {eawn:s ?aO$-i"(в$!N1/r+Iߑΰ50#v>JW,~LHȘ`)˜6@ĔdT_Y "K_aCxB0`z+6(} d` @S&TȲ|>JXN db~HU9$4{b 5Imn@ETxpFf9 @,8g =ʲLVǕ0Eh4Fbf9nR7x zWڍ@OP'2ɴB-1A <~dYϼAxT3*XŒbe~tfqYAL: IMTrY?$49' )`\@z8=eg 2LM q@}Uf8 ONi@O{)5L۳ɅKY=SHUU&[ 8,rl3=zWmz#,=EQ\AK J8SM1G:?P-?XīÉAW7L*Pe{ *uSS+N9 IjLZ<.w Etu羭vԸHSQ9{$0)]x]:}/׬zVi:`_PW|"wA O& qs|#`ڛq_2I+B;ty\ LY^/ 4_>?7k=cBme[t,LWTq_@rNB U> zDZ?q۩4EN{1%npgXHź2eu%~yOsߊoIP@J C}7v:r_&[#oSkU y*H~M *KVl|jq?)V96!λ;E ݆WvG nK+^ ߰,ׯׯH. * Xڡ1O`rvJWd4{jw{H_d5:{2vA:b,tbQ*)1^E=5Sxә^.69 yrrɡ4\q п,V5VGs{{{A{~qa>dX.gY_b=,gAMA!PLTEptRNS:yx8WIDATc`uZLإVUP `c.fЂ11 œg3gt˜+;faa")@ֆd $H64w8QKIENDB`drupal-7.41/themes/seven/images/ui-icons-800000-256x240.png0000644000000000000000000000716612611765734021243 0ustar rootrootPNG  IHDRIJPLTEj>NtRNS2P."Tp@f` <BHJZ&0R,4j8D|($ blߝF>n~hhH IDATx^0 E8 av߄44z,͗lKV'4MQ_?u9(RP1 `2/@A:d @sxX.^@кR]B<ñToCT|", 5;vc_iiM"T}@BP(6'7j<< P!_1ݍ+҈R>e*Mw~;k@?iiy\j0xI8׿>X}6ݱ: Y㗈XArb?nqN 8@vffsvU~18Ét!C`\СC˾UEx~L6M4M\Y*\@/fjd#IPi!n0]H&-VTL@u @bw)EPA; c=Po50BJN {eawn:s ?aO$-i"(в$!N1/r+Iߑΰ50#v>JW,~LHȘ`)˜6@ĔdT_Y "K_aCxB0`z+6(} d` @S&TȲ|>JXN db~HU9$4{b 5Imn@ETxpFf9 @,8g =ʲLVǕ0Eh4Fbf9nR7x zWڍ@OP'2ɴB-1A <~dYϼAxT3*XŒbe~tfqYAL: IMTrY?$49' )`\@z8=eg 2LM q@}Uf8 ONi@O{)5L۳ɅKY=SHUU&[ 8,rl3=zWmz#,=EQ\AK J8SM1G:?P-?XīÉAW7L*Pe{ *uSS+N9 IjLZ<.w Etu羭vԸHSQ9{$0)]x]:}/׬zVi:`_PW|"wA O& qs|#`ڛq_2I+B;ty\ LY^/ 4_>?7k=cBme[t,LWTq_@rNB U> zDZ?q۩4EN{1%npgXHź2eu%~yOsߊoIP@J C}7v:r_&[#oSkU y*H~M *KVl|jq?)V96!λ;E ݆WvG nK+^ ߰,ׯׯH. * Xڡ1O`rvJWd4{jw{H_d5:{2vA:b,tbQ*)1^E=5Sxә^.69 yrrɡ4\q п,V5VGs{{{A{~qa>dX.gY_b=,zpp]^K{==Dwq]\t^^=C >ۻ┥;e);ks }5 se_!d㪷q&'PX1Kon~hhH IDATx^0 E8 av߄44z,͗lKV'4MQ_?u9(RP1 `2/@A:d @sxX.^@кR]B<ñToCT|", 5;vc_iiM"T}@BP(6'7j<< P!_1ݍ+҈R>e*Mw~;k@?iiy\j0xI8׿>X}6ݱ: Y㗈XArb?nqN 8@vffsvU~18Ét!C`\СC˾UEx~L6M4M\Y*\@/fjd#IPi!n0]H&-VTL@u @bw)EPA; c=Po50BJN {eawn:s ?aO$-i"(в$!N1/r+Iߑΰ50#v>JW,~LHȘ`)˜6@ĔdT_Y "K_aCxB0`z+6(} d` @S&TȲ|>JXN db~HU9$4{b 5Imn@ETxpFf9 @,8g =ʲLVǕ0Eh4Fbf9nR7x zWڍ@OP'2ɴB-1A <~dYϼAxT3*XŒbe~tfqYAL: IMTrY?$49' )`\@z8=eg 2LM q@}Uf8 ONi@O{)5L۳ɅKY=SHUU&[ 8,rl3=zWmz#,=EQ\AK J8SM1G:?P-?XīÉAW7L*Pe{ *uSS+N9 IjLZ<.w Etu羭vԸHSQ9{$0)]x]:}/׬zVi:`_PW|"wA O& qs|#`ڛq_2I+B;ty\ LY^/ 4_>?7k=cBme[t,LWTq_@rNB U> zDZ?q۩4EN{1%npgXHź2eu%~yOsߊoIP@J C}7v:r_&[#oSkU y*H~M *KVl|jq?)V96!λ;E ݆WvG nK+^ ߰,ׯׯH. * Xڡ1O`rvJWd4{jw{H_d5:{2vA:b,tbQ*)1^E=5Sxә^.69 yrrɡ4\q п,V5VGs{{{A{~qa>dX.gY_b=,

    drupal-7.41/themes/seven/ie.css0000644000000000000000000000046012611765734015162 0ustar rootroot /* IE7 renders legends in nested fieldsets without a width. */ fieldset legend { height: 1%; } /* IE renders absolute positioned legend where fieldset content starts. */ fieldset .fieldset-legend { left: 0; top: 0; } /* IE renders monospace font too big. */ code, pre, kbd { font-size: 1em; } drupal-7.41/themes/seven/seven.info0000644000000000000000000000105012611767501016036 0ustar rootrootname = Seven description = A simple one-column, tableless, fluid width administration theme. package = Core version = VERSION core = 7.x stylesheets[screen][] = reset.css stylesheets[screen][] = style.css settings[shortcut_module_link] = 1 regions[content] = Content regions[help] = Help regions[page_top] = Page top regions[page_bottom] = Page bottom regions[sidebar_first] = First sidebar regions_hidden[] = sidebar_first ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/themes/seven/jquery.ui.theme.css0000644000000000000000000003560212611765734017627 0ustar rootroot/** * @file * Seven styles for jQuery UI. * Overrides /misc/ui/ui.theme.css. */ /** * Component containers */ .ui-widget { background: #fff; } .ui-widget-content { border: solid 1px #ccc; } /** * Interaction states */ .ui-state-default, .ui-state-hover, .ui-state-focus, .ui-state-active { outline: 0; } .ui-state-active { font-weight: bold; } /** * Interaction cues */ .ui-state-highlight, .ui-widget-content .ui-state-highlight { color: #840; background: #fe6; border: solid 1px #ed5; } .ui-state-error, .ui-widget-content .ui-state-error { color: #fff; background: #e63; border-color: #d52; } .ui-state-disabled, .ui-widget-content .ui-state-disabled { opacity: .35; filter: Alpha(Opacity=35); } .ui-priority-secondary, .ui-widget-content .ui-priority-secondary { opacity: .7; filter: Alpha(Opacity=70); } /** * Icons */ /* states and images */ .ui-icon { display: block; text-indent: -99999px; width: 16px; height: 16px; overflow: hidden; background-repeat: no-repeat; background-image: url(images/ui-icons-222222-256x240.png); } .ui-widget-content .ui-icon, .ui-widget-header .ui-icon { background-image: url(images/ui-icons-222222-256x240.png); } .ui-state-default .ui-icon { background-image: url(images/ui-icons-888888-256x240.png); } .ui-state-hover .ui-icon, .ui-state-focus .ui-icon, .ui-state-active .ui-icon { background-image: url(images/ui-icons-454545-256x240.png); } .ui-state-highlight .ui-icon { background-image: url(images/ui-icons-800000-256x240.png); } .ui-state-error .ui-icon, .ui-state-error-text .ui-icon { background-image: url(images/ui-icons-ffffff-256x240.png); } .ui-widget p .ui-icon { margin: 2px 3px 0 0; } /* positioning */ .ui-icon-carat-1-ne { background-position: -16px 0; } .ui-icon-carat-1-e { background-position: -32px 0; } .ui-icon-carat-1-se { background-position: -48px 0; } .ui-icon-carat-1-s { background-position: -64px 0; } .ui-icon-carat-1-sw { background-position: -80px 0; } .ui-icon-carat-1-w { background-position: -96px 0; } .ui-icon-carat-1-nw { background-position: -112px 0; } .ui-icon-carat-2-n-s { background-position: -128px 0; } .ui-icon-carat-2-e-w { background-position: -144px 0; } .ui-icon-triangle-1-n { background-position: 0 -16px; } .ui-icon-triangle-1-ne { background-position: -16px -16px; } .ui-icon-triangle-1-e { background-position: -32px -16px; } .ui-icon-triangle-1-se { background-position: -48px -16px; } .ui-icon-triangle-1-s { background-position: -64px -16px; } .ui-icon-triangle-1-sw { background-position: -80px -16px; } .ui-icon-triangle-1-w { background-position: -96px -16px; } .ui-icon-triangle-1-nw { background-position: -112px -16px; } .ui-icon-triangle-2-n-s { background-position: -128px -16px; } .ui-icon-triangle-2-e-w { background-position: -144px -16px; } .ui-icon-arrow-1-n { background-position: 0 -32px; } .ui-icon-arrow-1-ne { background-position: -16px -32px; } .ui-icon-arrow-1-e { background-position: -32px -32px; } .ui-icon-arrow-1-se { background-position: -48px -32px; } .ui-icon-arrow-1-s { background-position: -64px -32px; } .ui-icon-arrow-1-sw { background-position: -80px -32px; } .ui-icon-arrow-1-w { background-position: -96px -32px; } .ui-icon-arrow-1-nw { background-position: -112px -32px; } .ui-icon-arrow-2-n-s { background-position: -128px -32px; } .ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } .ui-icon-arrow-2-e-w { background-position: -160px -32px; } .ui-icon-arrow-2-se-nw { background-position: -176px -32px; } .ui-icon-arrowstop-1-n { background-position: -192px -32px; } .ui-icon-arrowstop-1-e { background-position: -208px -32px; } .ui-icon-arrowstop-1-s { background-position: -224px -32px; } .ui-icon-arrowstop-1-w { background-position: -240px -32px; } .ui-icon-arrowthick-1-n { background-position: 0 -48px; } .ui-icon-arrowthick-1-ne { background-position: -16px -48px; } .ui-icon-arrowthick-1-e { background-position: -32px -48px; } .ui-icon-arrowthick-1-se { background-position: -48px -48px; } .ui-icon-arrowthick-1-s { background-position: -64px -48px; } .ui-icon-arrowthick-1-sw { background-position: -80px -48px; } .ui-icon-arrowthick-1-w { background-position: -96px -48px; } .ui-icon-arrowthick-1-nw { background-position: -112px -48px; } .ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } .ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } .ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } .ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } .ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } .ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } .ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } .ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } .ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } .ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } .ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } .ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } .ui-icon-arrowreturn-1-w { background-position: -64px -64px; } .ui-icon-arrowreturn-1-n { background-position: -80px -64px; } .ui-icon-arrowreturn-1-e { background-position: -96px -64px; } .ui-icon-arrowreturn-1-s { background-position: -112px -64px; } .ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } .ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } .ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } .ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } .ui-icon-arrow-4 { background-position: 0 -80px; } .ui-icon-arrow-4-diag { background-position: -16px -80px; } .ui-icon-extlink { background-position: -32px -80px; } .ui-icon-newwin { background-position: -48px -80px; } .ui-icon-refresh { background-position: -64px -80px; } .ui-icon-shuffle { background-position: -80px -80px; } .ui-icon-transfer-e-w { background-position: -96px -80px; } .ui-icon-transferthick-e-w { background-position: -112px -80px; } .ui-icon-folder-collapsed { background-position: 0 -96px; } .ui-icon-folder-open { background-position: -16px -96px; } .ui-icon-document { background-position: -32px -96px; } .ui-icon-document-b { background-position: -48px -96px; } .ui-icon-note { background-position: -64px -96px; } .ui-icon-mail-closed { background-position: -80px -96px; } .ui-icon-mail-open { background-position: -96px -96px; } .ui-icon-suitcase { background-position: -112px -96px; } .ui-icon-comment { background-position: -128px -96px; } .ui-icon-person { background-position: -144px -96px; } .ui-icon-print { background-position: -160px -96px; } .ui-icon-trash { background-position: -176px -96px; } .ui-icon-locked { background-position: -192px -96px; } .ui-icon-unlocked { background-position: -208px -96px; } .ui-icon-bookmark { background-position: -224px -96px; } .ui-icon-tag { background-position: -240px -96px; } .ui-icon-home { background-position: 0 -112px; } .ui-icon-flag { background-position: -16px -112px; } .ui-icon-calendar { background-position: -32px -112px; } .ui-icon-cart { background-position: -48px -112px; } .ui-icon-pencil { background-position: -64px -112px; } .ui-icon-clock { background-position: -80px -112px; } .ui-icon-disk { background-position: -96px -112px; } .ui-icon-calculator { background-position: -112px -112px; } .ui-icon-zoomin { background-position: -128px -112px; } .ui-icon-zoomout { background-position: -144px -112px; } .ui-icon-search { background-position: -160px -112px; } .ui-icon-wrench { background-position: -176px -112px; } .ui-icon-gear { background-position: -192px -112px; } .ui-icon-heart { background-position: -208px -112px; } .ui-icon-star { background-position: -224px -112px; } .ui-icon-link { background-position: -240px -112px; } .ui-icon-cancel { background-position: 0 -128px; } .ui-icon-plus { background-position: -16px -128px; } .ui-icon-plusthick { background-position: -32px -128px; } .ui-icon-minus { background-position: -48px -128px; } .ui-icon-minusthick { background-position: -64px -128px; } .ui-icon-close { background-position: -80px -128px; } .ui-icon-closethick { background-position: -96px -128px; } .ui-icon-key { background-position: -112px -128px; } .ui-icon-lightbulb { background-position: -128px -128px; } .ui-icon-scissors { background-position: -144px -128px; } .ui-icon-clipboard { background-position: -160px -128px; } .ui-icon-copy { background-position: -176px -128px; } .ui-icon-contact { background-position: -192px -128px; } .ui-icon-image { background-position: -208px -128px; } .ui-icon-video { background-position: -224px -128px; } .ui-icon-script { background-position: -240px -128px; } .ui-icon-alert { background-position: 0 -144px; } .ui-icon-info { background-position: -16px -144px; } .ui-icon-notice { background-position: -32px -144px; } .ui-icon-help { background-position: -48px -144px; } .ui-icon-check { background-position: -64px -144px; } .ui-icon-bullet { background-position: -80px -144px; } .ui-icon-radio-off { background-position: -96px -144px; } .ui-icon-radio-on { background-position: -112px -144px; } .ui-icon-pin-w { background-position: -128px -144px; } .ui-icon-pin-s { background-position: -144px -144px; } .ui-icon-play { background-position: 0 -160px; } .ui-icon-pause { background-position: -16px -160px; } .ui-icon-seek-next { background-position: -32px -160px; } .ui-icon-seek-prev { background-position: -48px -160px; } .ui-icon-seek-end { background-position: -64px -160px; } .ui-icon-seek-first { background-position: -80px -160px; } .ui-icon-stop { background-position: -96px -160px; } .ui-icon-eject { background-position: -112px -160px; } .ui-icon-volume-off { background-position: -128px -160px; } .ui-icon-volume-on { background-position: -144px -160px; } .ui-icon-power { background-position: 0 -176px; } .ui-icon-signal-diag { background-position: -16px -176px; } .ui-icon-signal { background-position: -32px -176px; } .ui-icon-battery-0 { background-position: -48px -176px; } .ui-icon-battery-1 { background-position: -64px -176px; } .ui-icon-battery-2 { background-position: -80px -176px; } .ui-icon-battery-3 { background-position: -96px -176px; } .ui-icon-circle-plus { background-position: 0 -192px; } .ui-icon-circle-minus { background-position: -16px -192px; } .ui-icon-circle-close { background-position: -32px -192px; } .ui-icon-circle-triangle-e { background-position: -48px -192px; } .ui-icon-circle-triangle-s { background-position: -64px -192px; } .ui-icon-circle-triangle-w { background-position: -80px -192px; } .ui-icon-circle-triangle-n { background-position: -96px -192px; } .ui-icon-circle-arrow-e { background-position: -112px -192px; } .ui-icon-circle-arrow-s { background-position: -128px -192px; } .ui-icon-circle-arrow-w { background-position: -144px -192px; } .ui-icon-circle-arrow-n { background-position: -160px -192px; } .ui-icon-circle-zoomin { background-position: -176px -192px; } .ui-icon-circle-zoomout { background-position: -192px -192px; } .ui-icon-circle-check { background-position: -208px -192px; } .ui-icon-circlesmall-plus { background-position: 0 -208px; } .ui-icon-circlesmall-minus { background-position: -16px -208px; } .ui-icon-circlesmall-close { background-position: -32px -208px; } .ui-icon-squaresmall-plus { background-position: -48px -208px; } .ui-icon-squaresmall-minus { background-position: -64px -208px; } .ui-icon-squaresmall-close { background-position: -80px -208px; } .ui-icon-grip-dotted-vertical { background-position: 0 -224px; } .ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } .ui-icon-grip-solid-vertical { background-position: -32px -224px; } .ui-icon-grip-solid-horizontal { background-position: -48px -224px; } .ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } .ui-icon-grip-diagonal-se { background-position: -80px -224px; } .ui-icon-carat-1-n { background-position: 0 0; } /** * Accordion */ .ui-accordion { border: none; } .ui-accordion .ui-accordion-header { border: solid 1px #ccc; text-transform: uppercase; } .ui-accordion h3.ui-accordion-header, #block-system-main h3.ui-accordion-header { font-size: 1.1em; margin: 10px 0; } #block-system-main .ui-accordion h3.ui-state-active, .ui-accordion h3.ui-state-active { margin-bottom: 0; } .ui-accordion .ui-accordion-header a { display: block; } .ui-accordion .ui-accordion-content { padding: 1em 2.2em; border: solid 1px #ccc; border-top: 0; } /** * Tabs */ .ui-tabs { padding: 0; } .ui-tabs .ui-tabs-nav { padding: 5px 10px 4px; margin: 0; line-height: 20px; border-bottom: solid 1px #ccc; -moz-border-radius-bottomleft: 0; -webkit-border-bottom-left-radius: 0; border-bottom-left-radius: 0; -moz-border-radius-bottomright: 0; -webkit-border-bottom-right-radius: 0; border-bottom-right-radius: 0; } .ui-tabs .ui-tabs-nav li { padding: 0 1em 0 10px; margin: 0; list-style: none; } .ui-tabs .ui-tabs-nav li a { float: none; padding: 0 10px; -moz-border-radius: 10px; -webkit-border-radius: 10px; border-radius: 10px; } .ui-tabs .ui-tabs-nav li.ui-tabs-selected a { color: #fff; background: #666; font-weight: normal; } /** * Overlays */ .ui-widget-overlay { background: #000; opacity: .70; filter: Alpha(Opacity=70); } /** * Dialogs */ .ui-dialog { background: #fff; border: solid 1px #ccc; padding: 0; } .ui-dialog .ui-dialog-titlebar { font-weight: bold; background: #e1e2dc; } .ui-dialog .ui-dialog-buttonpane { border-width: 0; } .ui-dialog .ui-dialog-buttonpane button { cursor: pointer; padding: 4px 17px; color: #5a5a5a; text-align: center; font-family: "Lucida Grande", Verdana, sans-serif; font-weight: normal; font-size: 1em; border: 1px solid #e4e4e4; border-bottom: 1px solid #b4b4b4; border-left-color: #D2D2D2; border-right-color: #D2D2D2; background: url(images/buttons.png) 0 0 repeat-x; -moz-border-radius: 20px; -webkit-border-radius: 20px; border-radius: 20px; } .ui-dialog .ui-dialog-buttonpane button:active { background: #666; color: #fff; border-color: #555; text-shadow: #222 0px -1px 0px; } .overlay { padding-right: 26px; } .overlay .ui-dialog-titlebar { background: transparent; } /** * Slider */ .ui-slider { border: solid 1px #ccc; } .ui-slider .ui-slider-range { background: #e4e4e4; } .ui-slider .ui-slider-handle { border: 1px solid #e4e4e4; border-bottom: 1px solid #b4b4b4; border-left-color: #D2D2D2; border-right-color: #D2D2D2; background: url(images/buttons.png) 0 0 repeat-x; -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; } .ui-slider a.ui-state-active, .ui-slider .ui-slider-handle:active { background: #666; color: #fff; border: solid 1px #555; } /** * Progress Bar */ .ui-progressbar { background: #e4e4e4; height: 1.4em; } .ui-progressbar .ui-progressbar-value { background: #0072b9 url(../../misc/progress.gif); height: 1.5em; } /** * Date Picker */ .ui-datepicker { border: none; } .ui-datepicker td span, .ui-datepicker td a { text-align: center; } .ui-datepicker .ui-state-highlight { background: #E4E4E4; border-color: #D2D2D2; color: #000; } drupal-7.41/themes/seven/template.php0000644000000000000000000001114212611765734016376 0ustar rootroot CSS_THEME, 'browsers' => array('IE' => 'lte IE 8', '!IE' => FALSE), 'weight' => 999, 'preprocess' => FALSE)); // Add conditional CSS for IE7 and below. drupal_add_css(path_to_theme() . '/ie7.css', array('group' => CSS_THEME, 'browsers' => array('IE' => 'lte IE 7', '!IE' => FALSE), 'weight' => 999, 'preprocess' => FALSE)); // Add conditional CSS for IE6. drupal_add_css(path_to_theme() . '/ie6.css', array('group' => CSS_THEME, 'browsers' => array('IE' => 'lte IE 6', '!IE' => FALSE), 'weight' => 999, 'preprocess' => FALSE)); } /** * Override or insert variables into the page template. */ function seven_preprocess_page(&$vars) { $vars['primary_local_tasks'] = $vars['tabs']; unset($vars['primary_local_tasks']['#secondary']); $vars['secondary_local_tasks'] = array( '#theme' => 'menu_local_tasks', '#secondary' => $vars['tabs']['#secondary'], ); } /** * Display the list of available node types for node creation. */ function seven_node_add_list($variables) { $content = $variables['content']; $output = ''; if ($content) { $output = '
      '; foreach ($content as $item) { $output .= '
    • '; $output .= '' . l($item['title'], $item['href'], $item['localized_options']) . ''; $output .= '
      ' . filter_xss_admin($item['description']) . '
      '; $output .= '
      • '; } $output .= '
    '; } else { $output = '

    ' . t('You have not created any content types yet. Go to the content type creation page to add a new content type.', array('@create-content' => url('admin/structure/types/add'))) . '

    '; } return $output; } /** * Overrides theme_admin_block_content(). * * Use unordered list markup in both compact and extended mode. */ function seven_admin_block_content($variables) { $content = $variables['content']; $output = ''; if (!empty($content)) { $output = system_admin_compact_mode() ? '
      ' : '
        '; foreach ($content as $item) { $output .= '
      • '; $output .= l($item['title'], $item['href'], $item['localized_options']); if (isset($item['description']) && !system_admin_compact_mode()) { $output .= '
        ' . filter_xss_admin($item['description']) . '
        '; } $output .= '
        • '; } $output .= '
      '; } return $output; } /** * Override of theme_tablesort_indicator(). * * Use our own image versions, so they show up as black and not gray on gray. */ function seven_tablesort_indicator($variables) { $style = $variables['style']; $theme_path = drupal_get_path('theme', 'seven'); if ($style == 'asc') { return theme('image', array('path' => $theme_path . '/images/arrow-asc.png', 'alt' => t('sort ascending'), 'width' => 13, 'height' => 13, 'title' => t('sort ascending'))); } else { return theme('image', array('path' => $theme_path . '/images/arrow-desc.png', 'alt' => t('sort descending'), 'width' => 13, 'height' => 13, 'title' => t('sort descending'))); } } /** * Implements hook_css_alter(). */ function seven_css_alter(&$css) { // Use Seven's vertical tabs style instead of the default one. if (isset($css['misc/vertical-tabs.css'])) { $css['misc/vertical-tabs.css']['data'] = drupal_get_path('theme', 'seven') . '/vertical-tabs.css'; $css['misc/vertical-tabs.css']['type'] = 'file'; } if (isset($css['misc/vertical-tabs-rtl.css'])) { $css['misc/vertical-tabs-rtl.css']['data'] = drupal_get_path('theme', 'seven') . '/vertical-tabs-rtl.css'; $css['misc/vertical-tabs-rtl.css']['type'] = 'file'; } // Use Seven's jQuery UI theme style instead of the default one. if (isset($css['misc/ui/jquery.ui.theme.css'])) { $css['misc/ui/jquery.ui.theme.css']['data'] = drupal_get_path('theme', 'seven') . '/jquery.ui.theme.css'; $css['misc/ui/jquery.ui.theme.css']['type'] = 'file'; } } drupal-7.41/themes/seven/logo.png0000644000000000000000000000750112611765734015524 0ustar rootrootPNG  IHDRXd-IDATx] PTW}FͦĤTe2L*$:LM1jԸwA6*;"H@\AEAQDE]dߡY/{74O-}{}0t$>ʁMѵo!'w";W{]ue3? ݲ1bM)#4SD@GkQM3$V?!< c/o"BAzPd\7Bm(x=[~ ṍ,{S8Jg׉0vh# BNy=ywxN*.RǖFѱbWudd AB1ڡOG.gOҔTӌR`<o Z8H$do*[L+ZDQr?Tshq X m,0[qNT2b:BKG4.Ȋ K9rW˂1\W<.OBRާ$ ^A,% +Jj[ ()"³YĠz6ןzs5JƸA$3k= #+r*X#`w:z ۯtE a=iqF&4C\fSbѦDbx]JLՕ) O vJWR|qe˙"eŸ^ǡMm,km8^97M|ֻ|\nFE ؊6,?4Lz{CCngD4-dŻ>,={B+JZ k^-̈!]Sȏ'AiV\rPkSTOk+?["͗#J~ _)F6c'ډ7Df7/Hg_ u-])qgKb:4m/6p^XVip;?<.PYC&nf:;ž =F o9J޴=+XO$ξ xݖ9L*ЋzoJlv>6r\d0zԇ݋mizn#bI^L}T3&m9K/7u%x+NxmxP8>Ex,#M˚J/t`}lBbz,d,]"}LKQ|Gz/&YJ2`}G*=.!ڶ<>NDJ5{69a,'K&Ʉ;z!"y<L#]c_=\}B"ߗ0<73 `l^,s:AM9K "lYlr:m LDU1\+M8ZV ~SG; +[C"}قJ|f% b'\2:1ER-SАdv! %Nr"CHۑ`lkep +K`q>4AFpi Aop/z14JڀV6ćW6, 67 Dp +CAJA qn,;y O mw5> PnUăuִ-2pWۯ*Ȍ_vH$kZ4IYYq SB"luVԇ>'qM#Wz\G%%8q\v%( K\"MZM;JwkN!#Y'sCbx2n3̋g <+{E]6AAP% 0/mC ͒6*i 1эx=HNp#Z`K#3Ws8i xlR`4PUCRfz$(( Z0&vL%7\.юCKQ"BI'L4Â"Tf9vXG\oI'LDy UjH F}_O.hm8T iyevM:gx}?G>\ Pȃ//,hFZ[:P>olE&w`20˝w#v0sߩTZŬ,9D`Ły\<f z+el`Zޙ8@^$c CMӢ{tH(B^y-YLR(6L}mdEV/2zT*Y~#`qG!*V%IcqϘz+ N̡[Cdu-9 3Ngr3=9;Nr!W:.DF&g5.{A FS̜1r#2CӲl_rv Y 7=n! 4~lY¿P0(si+1G{KHr;NzMY]ye4M|}Ex\$ɱ #/ H2 GXH #3b%W <؟Ѭ GKD^Tbf!u0{E{n7툥)*)\cRgf'>S( [=`XfJDfAfj-Enà `K}tXz>v,eGZw;("dub?ԑ|ѓ}! T>>9fz(ŭ*GX3{?t2c QfܣjqDiвzq"쯃 '60EZ`ur[' zeM. >Q AJy}ǚFfIe4-d2$3>o>*[ք!Q>X3RrJ= Ёhv9ӐBf'A 6ߝWyܮ0_^ޟ0LK2$\jHAeIT?ϲٮBZ(9$eojXbfm(a-L5 4M{H'0=+p5 E3˽&H%%Ǯg {kO %oQuz7 BI!<ߎ>pO'#*'ɰxԱ@J4'B_uÿz鬖QPܤO%΍y,^W;Ǫa%Dځ83C,hMx{WɈ,/P>b&͊liD^_ann+ˋ Xu24mQȶBJKڐ% 7"@")C``TK2ZhC:ܖ {=G`+LRt-t= 6Q0> WM$E{תQ/\00=?t^_#"y!{Ǔi+iߙw~^l-j &6-X7i]i'g%qպAIb\XհTÁsF ^Ocx8gdp˳6M-"Yd@()'M}!Xi&ʮOϖ{%6!{Sp_Md/0 < :y _I{5v;g;|׿7LZFha⢽;8E;9/s}`Zp6&^UCv/;2ǐ/\M0zZa \*8HE%Ɩ V(!)*ED3mX&1YŠK 0UP*MD7X%`BH*"KB*OJBT~C0_lIGrNpe 酘 jpcÕ[=;.P/Ku;>Ge}[6Dv_"<ۆ]Wb|Do!8Qao;/ 1^bb띆 {%.`YZ[Նs{ W|i; ~UuUB }w2_`_wԍ&'ib ƸK`T]wa2XsϞkui[}]4}^woH#g~IX#gNovUZu; -rpLCV})8,sqXdٲ;_MTjW+b L@?օ-iv!wP+2x yz.};Aҙy~~aX 2!B1,bRimgx p 5B9!R0ِVZbuͰZ0"D6<d]2O)deEoZ#K1ᡩ`KT9򂗐pn!Yۧ7D$V8S#)g Ǒ耜*J&4dWiG{Qhoix٠j0[ҘhMQ*2ͺPostS^Mܫ{oHEa|]:omnNK&+^jmk6 ̎]<45BvZ7L+ 믝 I;^,m {af[%.zt_Dvv7v޻T f׵wE]:Qj1B3gv4٭)G&ϮTpaShwo#_3ihAoA+|e\Ĉ   4-.QP$$ ,2R V.,ˈ,X똑K vQ Q9 xBŐ "P#^!D}\V'W:aڱjsss!N!Bz]ozd]2deWa#-[E$a*eIRM `ha$L1\D&11quAA Dɹҁ㜍>yy5-Ncw0LI*RDv@zl100_>3gkռu'z⬱6n R.}AARJJIA_ &zK2lSF^R TRYΪYXB~~WZc{]\`vѸ'jаͫ>ܧRZ(;yuؠ#>FuyfǾ5sL0VuyY ;מ xnsk6ł⛴x|ˀy`\'5bf^ipX_Vgn:y6;\f2scz kqq% r$ dbrϺkZ9:ib=qdS1湾=_틑5 z.-t6]g Q]dEޣ{ 9SJ!&Wh=8PYr #/C0dBPO1ãz:! Y}F(]T@Hld}fݹZ;ŢŢŢŢ#_sնXTZ:e,ZEUN))})\LBT0aϛW9jE8n^t9eZSEp%tāNJ0!lsz0 BTRB >绀!ŴmEh}t„ֲpf*X$s$"rZYdRL@{䦀!YRSXAjHEy "H P"I*yV@Y^$8{4#/nj<ʕ*$0F|R}[ [{,hݗT{T`Aխ*O:ַk羭Go4_}Coox y UO~oV_nԗ|?fv#g4=&..n8SӪjC+А2j" eA:HX.r)VQ  Ir)Cr1B+2A@ HgPr &<T%EZ-Gr-`*1o$BMӗPY95o!gyq.-d[̃: ;n^3lS&x_g hO>mLCO,C wkQX^s@ @ PYwDGIWC,O `$uRd* f-#f+iy#?τGƞJyz;K^8rh-~P=[M %6m:qt"=z*UvP@LqM~xDzuW AdN\}}5j\_I)Fz2iy_4 [݆ne'kcb7vcIU]$1_e!p]KXW@X2\ݯ8Dfpt^;h47զ5`n7}Tm1tJyЖZCqwEξ5UƉacWf]o 1h1X,&p\]\u0_25 7/Uu3LㆦκC]UO}Ah/ 7D;ݸNQ).td8h׎~Gi:4o3fK }1EmC×<?So_h&}[wL' E<́CUn&}߻=l\WSsʹvK 91ɜƴctÅ۱~Im9;cGr7n;*VOuT^mq&D*hh_bzF"d>#r$R\ 2Tk;rh !j\&!BH o-bob9_GYhWiI @xJw/AS, [IH Ux $CXzįaIVUBq% bX4$<- @u!Q?%$֯YP-BppNZ#-j|KnIļe7^WE*f?a/5fC<=d2oҲ͆Ɇc8xMc}@nj|OH^wu7Ig2ͺ /x6P n~~lѻΗ&- 9^~dWҧ ɉ!2~~L旊Ƒ7?Y$eP,P MFMh˨?j[p*-k,cOGTl+6{!h~[dsm<µv7@aZh@P GI@-„\.Zq"LT)Qb2hZL=nh>fK@eLę%.{\F)[b*ュKw*$}qwPׅD^y?X@`9b>x(A<3z6_d0b$FFIQC! ӸB $0_q TdP#Ba`!}ЖзB%Қqr>5<}>.L5w,w ߛ-5Í;^?l:W="D;^;fkN41U1b_(h+R(,s6G, FEJRIh`Y0H$YR0T)KVEu\eHUBA$#UW `NhG[~1NONgv%+~}v_tg~lm;ysFJGY{[|:zBq2ϣ*Oeb}^}*O<+;sC@|XV}fl*5g37a=>wyv핥Ngȕ >ˣb~ 26oZнa{𛝭wM՝Κ/um}z[mK9|kzeࣁ߾'WmnljWYn kg-{:s7]o3wW{k ]KŢ3:!, M07Hܹ||I i07pnv<*2W>Bl,p{]7Rye\(:Dǩ27Oˡll7Z Yllie]G^KC] XtV񘁮77dR}d]]S9|teВ))(LJnò{џ^raIʲ?rqA3 >0#t`Rzn@e3(Tg("'Ph2x%W}Y-D ;R*腧Tz"æ@b b bXJ1x%,bhJ"6O*UP V:L-P)WI]q`%rCfJ44nx<%M/tW7H*Iq{?M 8u?)/*+QSȟ^JˉtM=S FG+b7ҍm7OʶJxR;p|ƥ''%!8#A #RV ")N׌0,T0*)*j4ZmUѲ3ʺ11'2_a]`j0yFt6K-RQs*C<#€igCg:k긵CafӱЪ#DbFvƞ3L1i+jXxhkG`|L'._)+Lgw:͎!N+O\r.<Ss*~l։zuü(ߒ -/{z:v@zN@j2(rugB~ gTj\_I}$wpXB%]ʂ>B "=@ R"lبL; sLhP1@@! (O[ 4OimBi(p{G5g? 3&/ã:GJe+B5$KD"%ҢBEiTpKIXRNS5 +OD{XI+` a*WO0J]#c=|<%yn퍭$YIWó})Yƴ)ٳnČ0,ig^XSW2gέ:|F=p*=2Lj1ykl5Zl;,fayXz\w.NZgj7^5L7[, ApL N0fu5EwDuĘfsUu!:O Xբ0r:/ҦZg6YL͝4i4t.i@ghf5,fq73g,3ƺgLVoilϦ}F.턩3~qh'%HPH=QF nj.ChKݮ@P,yU=WQH $OfPɱ/˹r:3B ,&8Tc˒$UFj w-& BA#[w>d}~sJR?WaVwz[wk0[ Ȯ9U\G a"/Ccώ|{Mf]_E/DU-vHqY[oB]Mmᓱ^8Ӽ'^b 7b)V YH Yd!,d@[7$%G˰FJJʙ -PU p_<]s y[ džU-$$9_[87| a!.z@iU-К, CɰJ,O1ŰtKJWYw*-JdV 05=y0$JؿzXA0PfJh611ƆnQ̸̡֡1KLү?&) tC5vWfDq?f & a5U-ۨ >+q? LhK|z6]ɞ=>zX}δʉ~[dOC>| 썌O~M@h,'"YR Hev^M, !T3*@j,[d)-!Iʵ֦*,:w>!mdqcIbc0 4tLw 4`A 5ASv=u&jhB`mO.x+4vۊSW(hc&EZz(=I^ |N_iߐѺ<9&2taЦ6]I8x*Nh>-|Exj^bed2_|Hb`b@x j#ʢBZK$&1'EE=g b%j[6 0 0`XZ1o,QQ5#'#:7\dm*V""S0I" ) Sz8tqs$ðF4@OͯٯS*fFdTjB s%>0Z5 )74؆ 3^)CQV`0Pi<[J@x~;.UZ! V}eY(r ER`XQ6?g{ @0=vGuXS1:k`FOu[4x&8^SUW]dy`Ą3% *Z5KfB_v 9fgL?0)^?"z)n.7/ۖ C!o7jn(cn%.mD i|g0 L2b3Pt7󱃽(w)ÛjFC3;16s .gb$$2={ci}?K1-\^5rOS?KMuZS{Sc?=d2 ]V9oNqn41r*1})O#-GIENDB`drupal-7.41/themes/bartik/0000755000000000000000000000000012611765734014207 5ustar rootrootdrupal-7.41/themes/bartik/color/0000755000000000000000000000000012611765734015325 5ustar rootrootdrupal-7.41/themes/bartik/color/preview.html0000644000000000000000000000415312611765734017677 0ustar rootroot

      Etiam est risus

      Maecenas id porttitor Ut enim ad minim veniam, quis nostrudfelis. Laboris nisi ut aliquip ex ea.

      Lorem ipsum dolor

      Sit amet, consectetur adipisicing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat. Maecenas id porttitor Ut enim ad minim veniam, quis nostr udfelis.
      drupal-7.41/themes/bartik/color/base.png0000644000000000000000000000015212611765734016743 0ustar rootrootPNG  IHDRՈPLTE"IDATx^n01\IENDB`drupal-7.41/themes/bartik/color/preview.png0000644000000000000000000000015212611765734017512 0ustar rootrootPNG  IHDRՈPLTE"IDATx^n01\IENDB`drupal-7.41/themes/bartik/color/color.inc0000644000000000000000000000677512611765734017155 0ustar rootroot array('logo' => theme_get_setting('logo', 'bartik'))), 'setting'); $info = array( // Available colors and color labels used in theme. 'fields' => array( 'top' => t('Header top'), 'bottom' => t('Header bottom'), 'bg' => t('Main background'), 'sidebar' => t('Sidebar background'), 'sidebarborders' => t('Sidebar borders'), 'footer' => t('Footer background'), 'titleslogan' => t('Title and slogan'), 'text' => t('Text color'), 'link' => t('Link color'), ), // Pre-defined color schemes. 'schemes' => array( 'default' => array( 'title' => t('Blue Lagoon (default)'), 'colors' => array( 'top' => '#0779bf', 'bottom' => '#48a9e4', 'bg' => '#ffffff', 'sidebar' => '#f6f6f2', 'sidebarborders' => '#f9f9f9', 'footer' => '#292929', 'titleslogan' => '#fffeff', 'text' => '#3b3b3b', 'link' => '#0071B3', ), ), 'firehouse' => array( 'title' => t('Firehouse'), 'colors' => array( 'top' => '#cd2d2d', 'bottom' => '#cf3535', 'bg' => '#ffffff', 'sidebar' => '#f1f4f0', 'sidebarborders' => '#ededed', 'footer' => '#1f1d1c', 'titleslogan' => '#fffeff', 'text' => '#3b3b3b', 'link' => '#d6121f', ), ), 'ice' => array( 'title' => t('Ice'), 'colors' => array( 'top' => '#d0d0d0', 'bottom' => '#c2c4c5', 'bg' => '#ffffff', 'sidebar' => '#ffffff', 'sidebarborders' => '#cccccc', 'footer' => '#24272c', 'titleslogan' => '#000000', 'text' => '#4a4a4a', 'link' => '#019dbf', ), ), 'plum' => array( 'title' => t('Plum'), 'colors' => array( 'top' => '#4c1c58', 'bottom' => '#593662', 'bg' => '#fffdf7', 'sidebar' => '#edede7', 'sidebarborders' => '#e7e7e7', 'footer' => '#2c2c28', 'titleslogan' => '#ffffff', 'text' => '#301313', 'link' => '#9d408d', ), ), 'slate' => array( 'title' => t('Slate'), 'colors' => array( 'top' => '#4a4a4a', 'bottom' => '#4e4e4e', 'bg' => '#ffffff', 'sidebar' => '#ffffff', 'sidebarborders' => '#d0d0d0', 'footer' => '#161617', 'titleslogan' => '#ffffff', 'text' => '#3b3b3b', 'link' => '#0073b6', ), ), ), // CSS files (excluding @import) to rewrite with new color scheme. 'css' => array( 'css/colors.css', ), // Files to copy. 'copy' => array( 'logo.png', ), // Gradient definitions. 'gradients' => array( array( // (x, y, width, height). 'dimension' => array(0, 0, 0, 0), // Direction of gradient ('vertical' or 'horizontal'). 'direction' => 'vertical', // Keys of colors to use for the gradient. 'colors' => array('top', 'bottom'), ), ), // Color areas to fill (x, y, width, height). 'fill' => array(), // Coordinates of all the theme slices (x, y, width, height) // with their filename as used in the stylesheet. 'slices' => array(), // Reference color used for blending. Matches the base.png's colors. 'blend_target' => '#ffffff', // Preview files. 'preview_css' => 'color/preview.css', 'preview_js' => 'color/preview.js', 'preview_html' => 'color/preview.html', // Base file for image generation. 'base_image' => 'color/base.png', ); drupal-7.41/themes/bartik/color/preview.css0000644000000000000000000001042312611765734017520 0ustar rootroot /* ---------- Color form ----------- */ #color_scheme_form #palette .form-item { width: 25em; } #color_scheme_form #palette .form-item label { width: 15em; } /* ---------- Preview Styles ----------- */ html.js #preview { clear: both; float: none !important; } #preview { background-color: #fff; font-family: Georgia, "Times New Roman", Times, serif; font-size: 14px; line-height: 1.5; overflow: hidden; word-wrap: break-word; margin-bottom: 10px; } #preview-header { font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; position: relative; } #preview-logo { float: left; padding: 15px 15px 15px 10px; } #preview-site-name { color: #686868; font-weight: normal; font-size: 1.821em; line-height: 1; margin-bottom: 30px; margin-left: 15px; padding-top: 34px; } #preview-main-menu { clear: both; padding: 0 15px 3px; } #preview-main-menu-links a { color: #d9d9d9; padding: 0.6em 1em 0.4em; } #preview-main-menu-links { font-size: 0.929em; margin: 0; padding: 0; } #preview-main-menu-links a { color: #333; background: #ccc; background: rgba(255, 255, 255, 0.7); text-shadow: 0 1px #eee; -khtml-border-radius-topleft: 8px; -moz-border-radius-topleft: 8px; -webkit-border-top-left-radius: 8px; border-top-left-radius: 8px; -khtml-border-radius-topright: 8px; -moz-border-radius-topright: 8px; -webkit-border-top-right-radius: 8px; border-top-right-radius: 8px; } #preview-main-menu-links a:hover, #preview-main-menu-links a:focus { background: #fff; background: rgba(255, 255, 255, 0.95); } #preview-main-menu-links a:active { background: #b3b3b3; background: rgba(255, 255, 255, 1); } #preview-main-menu-links li a.active { border-bottom: none; } #preview-main-menu-links li { display: inline; list-style-type: none; padding: 0.6em 0 0.4em; } #preview-sidebar, #preview-content { display: inline; float: left; position: relative; } #preview-sidebar { margin-left: 15px; width: 210px; } #preview-content { margin-left: 30px; width: 26.5em; } #preview-sidebar .preview-block { border: 1px solid; margin: 20px 0; padding: 15px 20px; } #preview-sidebar h2 { border-bottom: 1px solid #d6d6d6; font-size: 1.071em; font-weight: normal; line-height: 1.2; margin: 0 0 0.5em; padding-bottom: 5px; text-shadow: 0 1px 0 #fff; } #preview .preview-block .preview-content { margin-top: 1em; } #preview .preview-block-menu .preview-content, #preview .preview-block-menu .preview-content ul { margin-top: 0; } #preview-main { margin-bottom: 40px; margin-top: 20px; } #preview-page-title { font-size: 2em; font-weight: normal; line-height: 1; margin: 1em 0 0.5em; } #preview-footer-wrapper { color: #c0c0c0; color: rgba(255, 255, 255, 0.65); display: block !important; font-size: 0.857em; padding: 20px 20px 25px; } #preview-footer-wrapper a { color: #fcfcfc; color: rgba(255, 255, 255, 0.8); } #preview-footer-wrapper a:hover, #preview-footer-wrapper a:focus { color: #fefefe; color: rgba(255, 255, 255, 0.95); text-decoration: underline; } #preview-footer-wrapper .preview-footer-column { display: inline; float: left; padding: 0 10px; position: relative; width: 220px; } #preview-footer-wrapper .preview-block { border: 1px solid #444; border-color: rgba(255, 255, 255, 0.1); margin: 20px 0; padding: 10px; } #preview-footer-columns .preview-block-menu { border: none; margin: 0; padding: 0; } #preview-footer-columns h2 { border-bottom: 1px solid #555; border-color: rgba(255, 255, 255, 0.15); font-size: 1em; margin-bottom: 0; padding-bottom: 3px; text-transform: uppercase; } #preview-footer-columns .preview-content { margin-top: 0; } #preview-footer-columns .preview-content ul { margin-left: 0; padding-left: 0; } #preview-footer-columns .preview-content li { list-style: none; list-style-image: none; margin: 0; padding: 0; } #preview-footer-columns .preview-content li a { border-bottom: 1px solid #555; border-color: rgba(255, 255, 255, 0.15); display: block; line-height: 1.2; padding: 0.8em 2px 0.8em 20px; text-indent: -15px; } #preview-footer-columns .preview-content li a:hover, #preview-footer-columns .preview-content li a:focus { background-color: #1f1f21; background-color: rgba(255, 255, 255, 0.05); text-decoration: none; } drupal-7.41/themes/bartik/color/preview.js0000644000000000000000000000374212611765734017352 0ustar rootroot (function ($) { Drupal.color = { logoChanged: false, callback: function(context, settings, form, farb, height, width) { // Change the logo to be the real one. if (!this.logoChanged) { $('#preview #preview-logo img').attr('src', Drupal.settings.color.logo); this.logoChanged = true; } // Remove the logo if the setting is toggled off. if (Drupal.settings.color.logo == null) { $('div').remove('#preview-logo'); } // Solid background. $('#preview', form).css('backgroundColor', $('#palette input[name="palette[bg]"]', form).val()); // Text preview. $('#preview #preview-main h2, #preview .preview-content', form).css('color', $('#palette input[name="palette[text]"]', form).val()); $('#preview #preview-content a', form).css('color', $('#palette input[name="palette[link]"]', form).val()); // Sidebar block. $('#preview #preview-sidebar #preview-block', form).css('background-color', $('#palette input[name="palette[sidebar]"]', form).val()); $('#preview #preview-sidebar #preview-block', form).css('border-color', $('#palette input[name="palette[sidebarborders]"]', form).val()); // Footer wrapper background. $('#preview #preview-footer-wrapper', form).css('background-color', $('#palette input[name="palette[footer]"]', form).val()); // CSS3 Gradients. var gradient_start = $('#palette input[name="palette[top]"]', form).val(); var gradient_end = $('#palette input[name="palette[bottom]"]', form).val(); $('#preview #preview-header', form).attr('style', "background-color: " + gradient_start + "; background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, from(" + gradient_start + "), to(" + gradient_end + ")); background-image: -moz-linear-gradient(-90deg, " + gradient_start + ", " + gradient_end + ");"); $('#preview #preview-site-name', form).css('color', $('#palette input[name="palette[titleslogan]"]', form).val()); } }; })(jQuery); drupal-7.41/themes/bartik/images/0000755000000000000000000000000012611765734015454 5ustar rootrootdrupal-7.41/themes/bartik/images/add.png0000644000000000000000000000013612611765734016712 0ustar rootrootPNG  IHDR _SPLTEffflIDAT[cyA& # IENDB`drupal-7.41/themes/bartik/images/search-button.png0000644000000000000000000000132512611765734020741 0ustar rootrootPNG  IHDR"0Q2IDAT8O}KAoK*ƈ) Z-$%^BŃ`P[= "t]v6,fΛ7%WUAމ* HJd&ӒK$DKX1@D{kkm1-Ebp-U*sKG,'ss{w~W_l(ڙg77NJAղs0D,X)Q|ZZ ,|,p;(}"E$ (NfzV:?_-?x=HR vxy5C1o XBF*'`RݟF;nS=u_D}/8;>Q<]r]ELn⪀]$ud&ӒK8XuR@DC[͖"68wg&&gviNtyxجLxdbHmo^߰U)P<ѹN f@6Q+ꚦjW-h[uRDLӴLxmbZ19D.ޛ(.Xa8ekO&W/nAxdzA0JYrEs:wݺ6z,M>!:ωt:Z^(qvhTl4Y#IENDB`drupal-7.41/themes/bartik/images/comment-arrow.gif0000644000000000000000000000014112611765734020731 0ustar rootrootGIF89a(!,(8"mwkVvx)yz <?php print $head_title; ?> >

      drupal-7.41/themes/bartik/templates/comment.tpl.php0000644000000000000000000000764412611765734021171 0ustar rootrootcreated variable. * - $changed: Formatted date and time for when the comment was last changed. * Preprocess functions can reformat it by calling format_date() with the * desired parameters on the $comment->changed variable. * - $new: New comment marker. * - $permalink: Comment permalink. * - $submitted: Submission information created from $author and $created during * template_preprocess_comment(). * - $picture: Authors picture. * - $signature: Authors signature. * - $status: Comment status. Possible values are: * comment-unpublished, comment-published or comment-preview. * - $title: Linked title. * - $classes: String of classes that can be used to style contextually through * CSS. It can be manipulated through the variable $classes_array from * preprocess functions. The default values can be one or more of the following: * - comment: The current template type, i.e., "theming hook". * - comment-by-anonymous: Comment by an unregistered user. * - comment-by-node-author: Comment by the author of the parent node. * - comment-preview: When previewing a new or edited comment. * The following applies only to viewers who are registered users: * - comment-unpublished: An unpublished comment visible only to administrators. * - comment-by-viewer: Comment by the user currently viewing the page. * - comment-new: New comment since last the visit. * - $title_prefix (array): An array containing additional output populated by * modules, intended to be displayed in front of the main title tag that * appears in the template. * - $title_suffix (array): An array containing additional output populated by * modules, intended to be displayed after the main title tag that appears in * the template. * * These two variables are provided for context: * - $comment: Full comment object. * - $node: Node object the comments are attached to. * * Other variables: * - $classes_array: Array of html class attribute values. It is flattened * into a string within the variable $classes. * * @see template_preprocess() * @see template_preprocess_comment() * @see template_process() * @see theme_comment() */ ?>
      >

      >
      >
      drupal-7.41/themes/bartik/templates/node.tpl.php0000644000000000000000000001243412611765734020445 0ustar rootrootbody becomes $body. When needing to * access a field's raw values, developers/themers are strongly encouraged to * use these variables. Otherwise they will have to explicitly specify the * desired field language; for example, $node->body['en'], thus overriding any * language negotiation rule that was previously applied. * * @see template_preprocess() * @see template_preprocess_node() * @see template_process() */ ?>
      > >
      >
      drupal-7.41/themes/bartik/templates/comment-wrapper.tpl.php0000644000000000000000000000372212611765734022640 0ustar rootroot
      > type != 'forum'): ?>

      drupal-7.41/themes/bartik/templates/page.tpl.php0000644000000000000000000002376612611765734020446 0ustar rootroot

      drupal-7.41/themes/bartik/bartik.info0000644000000000000000000000205512611767501016334 0ustar rootroot name = Bartik description = A flexible, recolorable theme with many regions. package = Core version = VERSION core = 7.x stylesheets[all][] = css/layout.css stylesheets[all][] = css/style.css stylesheets[all][] = css/colors.css stylesheets[print][] = css/print.css regions[header] = Header regions[help] = Help regions[page_top] = Page top regions[page_bottom] = Page bottom regions[highlighted] = Highlighted regions[featured] = Featured regions[content] = Content regions[sidebar_first] = Sidebar first regions[sidebar_second] = Sidebar second regions[triptych_first] = Triptych first regions[triptych_middle] = Triptych middle regions[triptych_last] = Triptych last regions[footer_firstcolumn] = Footer first column regions[footer_secondcolumn] = Footer second column regions[footer_thirdcolumn] = Footer third column regions[footer_fourthcolumn] = Footer fourth column regions[footer] = Footer settings[shortcut_module_link] = 0 ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/themes/bartik/template.php0000644000000000000000000001343512611765734016541 0ustar rootroot CSS_THEME, 'browsers' => array('IE' => 'lte IE 7', '!IE' => FALSE), 'preprocess' => FALSE)); drupal_add_css(path_to_theme() . '/css/ie6.css', array('group' => CSS_THEME, 'browsers' => array('IE' => 'IE 6', '!IE' => FALSE), 'preprocess' => FALSE)); } /** * Override or insert variables into the page template for HTML output. */ function bartik_process_html(&$variables) { // Hook into color.module. if (module_exists('color')) { _color_html_alter($variables); } } /** * Override or insert variables into the page template. */ function bartik_process_page(&$variables) { // Hook into color.module. if (module_exists('color')) { _color_page_alter($variables); } // Always print the site name and slogan, but if they are toggled off, we'll // just hide them visually. $variables['hide_site_name'] = theme_get_setting('toggle_name') ? FALSE : TRUE; $variables['hide_site_slogan'] = theme_get_setting('toggle_slogan') ? FALSE : TRUE; if ($variables['hide_site_name']) { // If toggle_name is FALSE, the site_name will be empty, so we rebuild it. $variables['site_name'] = filter_xss_admin(variable_get('site_name', 'Drupal')); } if ($variables['hide_site_slogan']) { // If toggle_site_slogan is FALSE, the site_slogan will be empty, so we rebuild it. $variables['site_slogan'] = filter_xss_admin(variable_get('site_slogan', '')); } // Since the title and the shortcut link are both block level elements, // positioning them next to each other is much simpler with a wrapper div. if (!empty($variables['title_suffix']['add_or_remove_shortcut']) && $variables['title']) { // Add a wrapper div using the title_prefix and title_suffix render elements. $variables['title_prefix']['shortcut_wrapper'] = array( '#markup' => '
      ', '#weight' => 100, ); $variables['title_suffix']['shortcut_wrapper'] = array( '#markup' => '
      ', '#weight' => -99, ); // Make sure the shortcut link is the first item in title_suffix. $variables['title_suffix']['add_or_remove_shortcut']['#weight'] = -100; } } /** * Implements hook_preprocess_maintenance_page(). */ function bartik_preprocess_maintenance_page(&$variables) { // By default, site_name is set to Drupal if no db connection is available // or during site installation. Setting site_name to an empty string makes // the site and update pages look cleaner. // @see template_preprocess_maintenance_page if (!$variables['db_is_active']) { $variables['site_name'] = ''; } drupal_add_css(drupal_get_path('theme', 'bartik') . '/css/maintenance-page.css'); } /** * Override or insert variables into the maintenance page template. */ function bartik_process_maintenance_page(&$variables) { // Always print the site name and slogan, but if they are toggled off, we'll // just hide them visually. $variables['hide_site_name'] = theme_get_setting('toggle_name') ? FALSE : TRUE; $variables['hide_site_slogan'] = theme_get_setting('toggle_slogan') ? FALSE : TRUE; if ($variables['hide_site_name']) { // If toggle_name is FALSE, the site_name will be empty, so we rebuild it. $variables['site_name'] = filter_xss_admin(variable_get('site_name', 'Drupal')); } if ($variables['hide_site_slogan']) { // If toggle_site_slogan is FALSE, the site_slogan will be empty, so we rebuild it. $variables['site_slogan'] = filter_xss_admin(variable_get('site_slogan', '')); } } /** * Override or insert variables into the node template. */ function bartik_preprocess_node(&$variables) { if ($variables['view_mode'] == 'full' && node_is_page($variables['node'])) { $variables['classes_array'][] = 'node-full'; } } /** * Override or insert variables into the block template. */ function bartik_preprocess_block(&$variables) { // In the header region visually hide block titles. if ($variables['block']->region == 'header') { $variables['title_attributes_array']['class'][] = 'element-invisible'; } } /** * Implements theme_menu_tree(). */ function bartik_menu_tree($variables) { return '
        ' . $variables['tree'] . '
      '; } /** * Implements theme_field__field_type(). */ function bartik_field__taxonomy_term_reference($variables) { $output = ''; // Render the label, if it's not hidden. if (!$variables['label_hidden']) { $output .= '

      ' . $variables['label'] . ':

      '; } // Render the items. $output .= ($variables['element']['#label_display'] == 'inline') ? '
        ' : '
          '; foreach ($variables['items'] as $delta => $item) { $output .= '
        • ' . drupal_render($item) . '
          • '; } $output .= '
        '; // Render the top-level DIV. $output = '
        ' . $output . '
        '; return $output; } drupal-7.41/themes/bartik/css/0000755000000000000000000000000012611765734014777 5ustar rootrootdrupal-7.41/themes/bartik/css/colors.css0000644000000000000000000000244012611765734017012 0ustar rootroot /* ---------- Color Module Styles ----------- */ body, body.overlay { color: #3b3b3b; } .comment .comment-arrow { border-color: #ffffff; } #page, #main-wrapper, #main-menu-links li a.active, #main-menu-links li.active-trail a { background: #ffffff; } .tabs ul.primary li a.active { background-color: #ffffff; } .tabs ul.primary li.active a { background-color: #ffffff; border-bottom: 1px solid #ffffff; } #header { background-color: #48a9e4; background-image: -moz-linear-gradient(top, #0779bf 0%, #48a9e4 100%); background-image: -ms-linear-gradient(top, #0779bf 0%, #48a9e4 100%); background-image: -o-linear-gradient(top, #0779bf 0%, #48a9e4 100%); background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #0779bf), color-stop(1, #48a9e4)); background-image: -webkit-linear-gradient(top, #0779bf 0%, #48a9e4 100%); background-image: linear-gradient(top, #0779bf 0%, #48a9e4 100%); } a { color: #0071B3; } a:hover, a:focus { color: #018fe2; } a:active { color: #23aeff; } .sidebar .block { background-color: #f6f6f2; border-color: #f9f9f9; } #page-wrapper, #footer-wrapper { background: #292929; } .region-header, .region-header a, .region-header li a.active, #name-and-slogan, #name-and-slogan a, #secondary-menu-links li a { color: #fffeff; } drupal-7.41/themes/bartik/css/ie6.css0000644000000000000000000000045112611765734016174 0ustar rootroot #content { overflow: hidden; } .form-item-search-block-form { width: 50%; } .tabs ul.primary, .region-header .block-menu li a, .comment-form .form-item { zoom: 1; } #block-search-form .form-item-search-block-form input { width: 67%; } .node-teaser { border-bottom: 1px solid #d3d7d9; } drupal-7.41/themes/bartik/css/layout.css0000644000000000000000000000314212611765734017026 0ustar rootroot /* ---------- Basic Layout Styles ----------- */ html, body, #page { height: 100%; } #page-wrapper { min-height: 100%; min-width: 960px; } #header div.section, #featured div.section, #messages div.section, #main, #triptych, #footer-columns, #footer { width: 960px; margin-left: auto; margin-right: auto; } #header div.section { position: relative; } .region-header { float: right; /* LTR */ margin: 0 5px 10px; } .with-secondary-menu .region-header { margin-top: 3em; } .without-secondary-menu .region-header { margin-top: 15px; } #secondary-menu { position: absolute; right: 0; /* LTR */ top: 0; width: 480px; } #content, #sidebar-first, #sidebar-second, .region-triptych-first, .region-triptych-middle, .region-triptych-last, .region-footer-firstcolumn, .region-footer-secondcolumn, .region-footer-thirdcolumn, .region-footer-fourthcolumn { display: inline; float: left; /* LTR */ position: relative; } .one-sidebar #content { width: 720px; } .two-sidebars #content { width: 480px; } .no-sidebars #content { width: 960px; float: none; } #sidebar-first, #sidebar-second { width: 240px; } #main-wrapper { min-height: 300px; } #content .section, .sidebar .section { padding: 0 15px; } #breadcrumb { margin: 0 15px; } .region-triptych-first, .region-triptych-middle, .region-triptych-last { margin: 20px 20px 30px; width: 280px; } #footer-wrapper { padding: 35px 5px 30px; } .region-footer-firstcolumn, .region-footer-secondcolumn, .region-footer-thirdcolumn, .region-footer-fourthcolumn { padding: 0 10px; width: 220px; } #footer { width: 940px; min-width: 920px; } drupal-7.41/themes/bartik/css/style-rtl.css0000644000000000000000000001140312611765734017447 0ustar rootroot /* ------------------ Reset Styles ------------------ */ caption, th, td { text-align: right; } blockquote { border-left: none; border-right: 4px solid #afafaf; } blockquote:before { content: "\201D"; } blockquote:after { content: "\201C"; } tr td, tr th { text-align: right; } /* ------------------ List Styles ------------------ */ .region-content ul, .region-content ol { padding: 2.5em 0 0.25em 0; } .item-list ul li { padding: 0.2em 0 0 0.5em; } ul.tips { padding: 0 1.25em 0 0; } .block ol, .block ul { padding: 0 1em 0.25em 0; } /* ------------------ Header ------------------ */ #logo { padding: 15px 10px 15px 15px; } #logo, #name-and-slogan, .region-header .block, .region-header #block-user-login .form-item, .region-header #block-user-login .item-list li { float: right; } #name-and-slogan { margin: 0 15px 30px 0; } .region-header .form-text { margin-left: 2px; margin-right: 0; } .region-header #block-user-login .item-list li.last { padding-left: 0; padding-right: 0.5em; } .region-header #block-user-login ul.openid-links li.last { padding-right: 0; } .region-header #user-login-form li.openid-link a, .region-header #user-login li.openid-link a { background-position: right -3px; padding-left: 0; padding-right: 20px; } /* --------------- Main Menu ------------ */ #main-menu ul.links li, #main-menu ul.links li a { float: right; } /* --------------- Secondary Menu ------------ */ #secondary-menu-links { float: left; } /* ----------------- Content ------------------ */ .submitted .user-picture img { float: right; margin-left: 5px; margin-right: 0; } .field-type-taxonomy-term-reference .field-label { padding-left: 5px; padding-right: 0; } .field-type-taxonomy-term-reference ul.links li { padding: 0 0 0 1em; float: right; } .link-wrapper { text-align: left; margin-right: 236px; margin-left: 0; } /* ----------------- Comments ----------------- */ .comment .user-picture img { margin-right: 0; } .comment .attribution { float: right; padding: 0 0 0 30px; } .comment .comment-arrow { background-image: url(../images/comment-arrow-rtl.gif); margin-left: 0; margin-right: -47px; } .comment .indented { margin-right: 40px; margin-left: 0; } .comment ul.links li { padding: 0 0 0.5em; } .comment-unpublished { margin-left: 5px; margin-right: 0; padding: 5px 5px 5px 2px; } /* -------------- Password Meter ------------- */ #password-strength { left: auto; margin-top: 2em; right: 16em; } #password-strength-text { margin-top: 0; float: left; } .form-item-pass-pass2 label { clear: right; } /* ----------------- Buttons ------------------ */ input.form-submit, a.button { margin-right: 0; margin-left: 0.6em; } /* --------------- Search Form ---------------- */ #search-form input#edit-keys, #block-search-form .form-item-search-block-form input { float: right; margin-left: 5px; margin-right: 0; } /* ------------------ Footer ------------------ */ #footer-columns ul { padding-right: 0; } #footer-columns li a { padding: 0.8em 20px 0.8em 2px; } #footer li a { float: right; border-left: 1px solid #555; border-color: rgba(255, 255, 255, 0.15); border-right: none; } #footer li.first a { padding-right: 0; padding-left: 12px; } #footer li.last a { padding-left: 0; padding-right: 12px; border-left: none; } /* --------------- System Tabs --------------- */ .tabs ul.primary li { margin: 0 0 0 5px; float: right; zoom: 1; } .tabs ul.secondary li { float: right; } .tabs ul.secondary li:first-child { padding-right: 0; } .tabs ul.secondary li:last-child { border-left: none; } ul.action-links li a { background-position: right center; padding-left: 0; padding-right: 15px; } /* -------------- Form Elements ------------- */ .fieldset-legend span.summary { margin-left: 0; } #user-profile-form input#edit-submit { margin-left: 0; } .password-suggestions ul li { margin-right: 1.2em; margin-left: 0; } /* Animated throbber */ html.js input.form-autocomplete { background-position: 1% center; } html.js input.throbbing { background-position: 1% center; } /* Comment form */ .comment-form label { float: right; } .comment-form .form-type-checkbox, .comment-form .form-radios, .comment-form .form-item .description { margin-left: 0; margin-right: 120px; } #edit-actions input { margin-left: 0.6em; margin-right: 0; } /* -------------- Shortcut Links ------------- */ .shortcut-wrapper h1#page-title { float: right; } /* ---------- Poll ----------- */ .poll .vote-form { text-align: right; } .poll .total { text-align: left; } /* ---------- Color Form ----------- */ .color-form #palette { margin-left: 0; margin-right: 20px; } .color-form .form-item label { float: right; } .color-form #palette .lock { right: -20px; left: 0; } drupal-7.41/themes/bartik/css/print.css0000644000000000000000000000122012611765734016640 0ustar rootroot /* ---------- General Layout ---------- */ body, input, textarea, select { color: #000; background: none; } body.two-sidebars, body.sidebar-first, body.sidebar-second, body { width: 640px; } #sidebar-first, #sidebar-second, .navigation, #toolbar, #footer-wrapper, .tabs, .add-or-remove-shortcuts { display: none; } .one-sidebar #content, .two-sidebars #content { width: 100%; } #triptych-wrapper { width: 960px; margin: 0; padding: 0; border: none; } #triptych-first, #triptych-middle, #triptych-last { width: 250px; } /* ---------- Node Pages ---------- */ #comments .title, #comments form, .comment_forbidden { display: none; } drupal-7.41/themes/bartik/css/ie-rtl.css0000644000000000000000000000152112611765734016704 0ustar rootroot fieldset legend { left: 6px; } ul.action-links li a, #user-login-form li.openid-link a, #user-login li.openid-link a { zoom: 1; } .comment .attribution { float: right; } .comment .comment-arrow { position: absolute; right: 25px; } .region-header .block, .region-header #block-user-login .form-item { float: none; display: inline; vertical-align: top; } .region-header #block-user-login .item-list li { float: none; } .region-header #block-user-login .item-list li.last { padding-right: 0; } #user-login-form li.openid-link a, #user-login li.openid-link a { background-position: right -3px; padding-right: 20px; zoom: 1; } #main-menu ul.links li { margin: 0; } #main-menu ul.links li, #main-menu ul.links li a { display: inline; float: none; margin: 0; zoom: 1; } #footer li { display: inline; float: none; } drupal-7.41/themes/bartik/css/style.css0000644000000000000000000007767612611765734016700 0ustar rootroot /* ---------- Overall Specifications ---------- */ body { line-height: 1.5; font-size: 87.5%; word-wrap: break-word; margin: 0; padding: 0; border: 0; outline: 0; } a:link, a:visited { text-decoration: none; } a:hover, a:active, a:focus { text-decoration: underline; } h1, h2, h3, h4, h5, h6 { margin: 1.0em 0 0.5em; font-weight: inherit; } h1 { font-size: 1.357em; color: #000; } h2 { font-size: 1.143em; } p { margin: 0 0 1.2em; } del { text-decoration: line-through; } tr.odd { background-color: #dddddd; } img { outline: 0; } code, pre, kbd, samp, var { padding: 0 0.4em; font-size: 0.857em; font-family: Menlo, Consolas, "Andale Mono", "Lucida Console", "Nimbus Mono L", "DejaVu Sans Mono", monospace, "Courier New"; } code { background-color: #f2f2f2; background-color: rgba(40, 40, 0, 0.06); } pre code, pre kbd, pre samp, pre var, kbd kbd, kbd samp, code var { font-size: 100%; background-color: transparent; } pre code, pre samp, pre var { padding: 0; } .description code { font-size: 1em; } kbd { background-color: #f2f2f2; border: 1px outset #575757; margin: 0 3px; color: #666; display: inline-block; padding: 0 6px; -khtml-border-radius: 5px; -moz-border-radius: 5px; -webkit-border-radius: 5px; border-radius: 5px; } pre { background-color: #f2f2f2; background-color: rgba(40, 40, 0, 0.06); margin: 10px 0; overflow: hidden; padding: 15px; white-space: pre-wrap; } /* ------------------ Fonts ------------------ */ body, #site-slogan, .ui-widget, .comment-form label { font-family: Georgia, "Times New Roman", Times, serif; } #header, #footer-wrapper, #skip-link, ul.contextual-links, ul.links, ul.primary, .item-list .pager, div.field-type-taxonomy-term-reference, div.messages, div.meta, p.comment-time, table, .breadcrumb { font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; } input, textarea, select, a.button { font-family: "Lucida Grande", "Lucida Sans Unicode", Verdana, sans-serif; } /* ------------------ Reset Styles ------------------ */ caption { text-align: left; /* LTR */ font-weight: normal; } blockquote { background: #f7f7f7; border-left: 1px solid #bbb; font-style: italic; margin: 1.5em 10px; padding: 0.5em 10px; } blockquote:before { color: #bbb; content: "\201C"; font-size: 3em; line-height: 0.1em; margin-right: 0.2em; vertical-align: -.4em; } blockquote:after { color: #bbb; content: "\201D"; font-size: 3em; line-height: 0.1em; vertical-align: -.45em; } blockquote > p:first-child { display: inline; } a.feed-icon { display: inline-block; padding: 15px 0 0 0; } /* ------------------ Table Styles ------------------ */ table { border: 0; border-spacing: 0; font-size: 0.857em; margin: 10px 0; width: 100%; } table table { font-size: 1em; } #footer-wrapper table { font-size: 1em; } table tr th { background: #757575; background: rgba(0, 0, 0, 0.51); border-bottom-style: none; } table tr th, table tr th a, table tr th a:hover { color: #FFF; font-weight: bold; } table tbody tr th { vertical-align: top; } tr td, tr th { padding: 4px 9px; border: 1px solid #fff; text-align: left; /* LTR */ } #footer-wrapper tr td, #footer-wrapper tr th { border-color: #555; border-color: rgba(255, 255, 255, 0.18); } tr.odd { background: #e4e4e4; background: rgba(0, 0, 0, 0.105); } tr, tr.even { background: #efefef; background: rgba(0, 0, 0, 0.063); } table ul.links { margin: 0; padding: 0; font-size: 1em; } table ul.links li { padding: 0 1em 0 0; } /* ------------------ List Styles ------------------ */ .block ol, .block ul { margin: 0; padding: 0 0 0.25em 1em; /* LTR */ } .contextual-links-wrapper { font-size: small !important; } ul.contextual-links { font-size: 0.923em; } .contextual-links-wrapper a { text-shadow: 0 0 0 !important; } .item-list .pager { font-size: 0.929em; } ul.menu li { margin: 0; } .region-content ul, .region-content ol { margin: 1em 0; padding: 0 0 0.25em 2.5em; /* LTR */ } .item-list ul li { margin: 0; padding: 0.2em 0.5em 0 0; /* LTR */ } ul.tips { padding: 0 0 0 1.25em; /* LTR */ } /* ------------------ Header ------------------ */ #skip-link { left: 50%; margin-left: -5.25em; margin-top: 0; position: absolute; width: auto; z-index: 50; } #skip-link a, #skip-link a:link, #skip-link a:visited { background: #444; background: rgba(0, 0, 0, 0.6); color: #fff; display: block; font-size: 0.94em; line-height: 1.7; padding: 1px 10px 2px 10px; text-decoration: none; -khtml-border-radius: 0 0 10px 10px; -moz-border-radius: 0 0 10px 10px; -webkit-border-top-left-radius: 0; -webkit-border-top-right-radius: 0; -webkit-border-bottom-left-radius: 10px; -webkit-border-bottom-right-radius: 10px; border-radius: 0 0 10px 10px; } #skip-link a:hover, #skip-link a:active, #skip-link a:focus { outline: 0; } #logo { float: left; /* LTR */ padding: 15px 15px 15px 10px; /* LTR */ } #name-and-slogan { float: left; /* LTR */ padding-top: 34px; margin: 0 0 30px 15px; /* LTR */ } #site-name { font-size: 1.821em; color: #686868; line-height: 1; } h1#site-name { margin: 0; } #site-name a { font-weight: normal; } #site-slogan { font-size: 0.929em; margin-top: 7px; word-spacing: 0.1em; font-style: italic; } /* Region header blocks. */ .region-header .block { font-size: 0.857em; float: left; /* LTR */ margin: 0 10px; padding: 0; } .region-header .block .content { margin: 0; padding: 0; } .region-header .block ul { margin: 0; padding: 0; } .region-header .block li { list-style: none; list-style-image: none; padding: 0; } .region-header .form-text { background: #fefefe; background: rgba(255, 255, 255, 0.7); border-color: #ccc; border-color: rgba(255, 255, 255, 0.3); margin-right: 2px; /* LTR */ width: 120px; } .region-header .form-text:hover, .region-header .form-text:focus, .region-header .form-text:active { background: #fff; background: rgba(255, 255, 255, 0.8); } .region-header .form-required { color: #eee; color: rgba(255, 255, 255, 0.7); } /* Region header block menus. */ .region-header .block-menu { border: 1px solid; border-color: #eee; border-color: rgba(255, 255, 255, 0.2); padding: 0; width: 208px; } .region-header .block-menu li a { display: block; border-bottom: 1px solid; border-bottom-color: #eee; border-bottom-color: rgba(255, 255, 255, 0.2); padding: 3px 7px; } .region-header .block-menu li a:hover, .region-header .block-menu li a:focus, .region-header .block-menu li a:active { text-decoration: none; background: rgba(255, 255, 255, 0.15); } .region-header .block-menu li.last a { border-bottom: 0; } /* User Login block in the header region */ .region-header #block-user-login { width: auto; } .region-header #block-user-login .content { margin-top: 2px; } .region-header #block-user-login .form-item { float: left; /* LTR */ margin: 0; padding: 0; } .region-header #block-user-login div.item-list, .region-header #block-user-login div.description { font-size: 0.916em; margin: 0; } .region-header #block-user-login div.item-list { clear: both; } .region-header #block-user-login div.description { display: inline; } .region-header #block-user-login .item-list ul { padding: 0; line-height: 1; } .region-header #block-user-login .item-list li { list-style: none; float: left; /* LTR */ padding: 3px 0 1px; } .region-header #block-user-login .item-list li.last { padding-left: 0.5em; /* LTR */ } .region-header #block-user-login ul.openid-links li.last { padding-left: 0; /* LTR */ } .region-header #user-login-form li.openid-link a, .region-header #user-login li.openid-link a { padding-left: 20px; /* LTR */ } .region-header #block-user-login .form-actions { margin: 4px 0 0; padding: 0; clear: both; } .region-header #block-user-login input.form-submit { border: 1px solid; border-color: #ccc; border-color: rgba(255, 255, 255, 0.5); background: #eee; background: rgba(255, 255, 255, 0.7); margin: 4px 0; padding: 3px 8px; } .region-header #block-user-login input.form-submit:hover, .region-header #block-user-login input.form-submit:focus { background: #fff; background: rgba(255, 255, 255, 0.9); } /* Search block in region header. */ .region-header #block-search-form { width: 208px; } .region-header #block-search-form .form-text { width: 154px; } /* Language switcher block in region header. */ .region-header .block-locale ul li { display: inline; padding: 0 0.5em; } /* --------------- Main Menu ------------ */ #main-menu { clear: both; } #main-menu-links { font-size: 0.929em; margin: 0; padding: 0 15px; } #main-menu-links li { float: left; /* LTR */ list-style: none; padding: 0 1px; margin: 0 1px; } #main-menu-links a { color: #333; background: #ccc; background: rgba(255, 255, 255, 0.7); float: left; /* LTR */ height: 2.4em; line-height: 2.4em; padding: 0 0.8em; text-decoration: none; text-shadow: 0 1px #eee; -khtml-border-radius-topleft: 8px; -khtml-border-radius-topright: 8px; -moz-border-radius-topleft: 8px; -moz-border-radius-topright: 8px; -webkit-border-top-left-radius: 8px; -webkit-border-top-right-radius: 8px; border-top-left-radius: 8px; border-top-right-radius: 8px; } #main-menu-links a:hover, #main-menu-links a:focus { background: #f6f6f2; background: rgba(255, 255, 255, 0.95); } #main-menu-links a:active { background: #b3b3b3; background: rgba(255, 255, 255, 1); } #main-menu-links li a.active { border-bottom: none; } .featured #main-menu-links li a:active, .featured #main-menu-links li a.active { background: #f0f0f0; background: rgba(240, 240, 240, 1.0); } /* --------------- Secondary Menu ------------ */ #secondary-menu-links { float: right; /* LTR */ font-size: 0.929em; margin: 10px 10px 0; } #secondary-menu-links a:hover, #secondary-menu-links a:focus { text-decoration: underline; } /* ------------------- Main ------------------- */ #main { margin-top: 20px; margin-bottom: 40px; } /* ----------------- Featured ----------------- */ #featured { text-align: center; font-size: 1.643em; font-weight: normal; line-height: 1.4; padding: 20px 0 45px; margin: 0; background: #f0f0f0; background: rgba(30, 50, 10, 0.08); border-bottom: 1px solid #e7e7e7; text-shadow: 1px 1px #fff; } #featured h2 { font-size: 1.174em; line-height: 1; } #featured p { margin: 0; padding: 0; } /* --------------- Highlighted ---------------- */ #highlighted { border-bottom: 1px solid #d3d7d9; font-size: 120%; } /* ------------------- Help ------------------- */ .region-help { border: 1px solid #d3d7d9; padding: 0 1.5em; margin-bottom: 30px; } /* ----------------- Content ------------------ */ .content { margin-top: 10px; } h1#page-title { font-size: 2em; line-height: 1; } #content h2 { margin-bottom: 2px; font-size: 1.429em; line-height: 1.4; } .node .content { font-size: 1.071em; } .node-teaser .content { font-size: 1em; } .node-teaser h2 { margin-top: 0; padding-top: 0.5em; } .node-teaser h2 a { color: #181818; } .node-teaser { border-bottom: 1px solid #d3d7d9; margin-bottom: 30px; padding-bottom: 15px; } .node-sticky { background: #f9f9f9; background: rgba(0, 0, 0, 0.024); border: 1px solid #d3d7d9; padding: 0 15px 15px; } .node-full { background: none; border: none; padding: 0; } .node-teaser .content { clear: none; line-height: 1.6; } .meta { font-size: 0.857em; color: #68696b; margin-bottom: -5px; } .submitted .user-picture img { float: left; /* LTR */ height: 20px; margin: 1px 5px 0 0; /* LTR */ } .field-type-taxonomy-term-reference { margin: 0 0 1.2em; } .field-type-taxonomy-term-reference .field-label { font-weight: normal; margin: 0; padding-right: 5px; /* LTR */ } .field-type-taxonomy-term-reference .field-label, .field-type-taxonomy-term-reference ul.links { font-size: 0.8em; } .node-teaser .field-type-taxonomy-term-reference .field-label, .node-teaser .field-type-taxonomy-term-reference ul.links { font-size: 0.821em; } .field-type-taxonomy-term-reference ul.links { padding: 0; margin: 0; list-style: none; } .field-type-taxonomy-term-reference ul.links li { float: left; /* LTR */ padding: 0 1em 0 0; /* LTR */ white-space: nowrap; } .link-wrapper { text-align: right; } .field-type-image img, .user-picture img { margin: 0 0 1em; } ul.links { color: #68696b; font-size: 0.821em; } .node-unpublished { margin: -20px -15px 0; padding: 20px 15px 0; } .node-unpublished .comment-text .comment-arrow { border-left: 1px solid #fff4f4; border-right: 1px solid #fff4f4; } /* ----------------- Comments ----------------- */ .comment h2.title { margin-bottom: 1em; } .comment div.user-picture img { margin-left: 0; /* LTR */ } .comment { margin-bottom: 20px; display: table; vertical-align: top; } .comment .attribution { display: table-cell; padding: 0 30px 0 0; /* LTR */ vertical-align: top; overflow: hidden; } .comment .attribution img { margin: 0; border: 1px solid #d3d7d9; } .comment .attribution .username { white-space: nowrap; } .comment .submitted p { margin: 4px 0; font-size: 1.071em; line-height: 1.2; } .comment .submitted .comment-time { font-size: 0.786em; color: #68696b; } .comment .submitted .comment-permalink { font-size: 0.786em; } .comment .content { font-size: 0.929em; line-height: 1.6; } .comment .comment-arrow { background: url(../images/comment-arrow.gif) no-repeat 0 center transparent; /* LTR */ border-left: 1px solid; border-right: 1px solid; height: 40px; margin-left: -47px; /* LTR */ margin-top: 10px; position: absolute; width: 20px; } .comment .comment-text { padding: 10px 25px; border: 1px solid #d3d7d9; display: table-cell; vertical-align: top; position: relative; width: 100%; } .comment .indented { margin-left: 40px; /* LTR */ } .comment ul.links { padding: 0 0 0.25em 0; } .comment ul.links li { padding: 0 0.5em 0 0; /* LTR */ } .comment-unpublished { margin-right: 5px; /* LTR */ padding: 5px 2px 5px 5px; /* LTR */ } .comment-unpublished .comment-text .comment-arrow { border-left: 1px solid #fff4f4; border-right: 1px solid #fff4f4; } /* ------------------ Sidebar ----------------- */ .sidebar .section { padding-top: 10px; } .sidebar .block { border: 1px solid; padding: 15px 20px; margin: 0 0 20px; } .sidebar h2 { margin: 0 0 0.5em; border-bottom: 1px solid #d6d6d6; padding-bottom: 5px; text-shadow: 0 1px 0 #fff; font-size: 1.071em; line-height: 1.2; } .sidebar .block .content { font-size: 0.914em; line-height: 1.4; } .sidebar tbody { border: none; } .sidebar tr.even, .sidebar tr.odd { background: none; border-bottom: 1px solid #d6d6d6; } /* ----------------- Triptych ----------------- */ #triptych-wrapper { background-color: #f0f0f0; background: rgba(30, 50, 10, 0.08); border-top: 1px solid #e7e7e7; } #triptych h2 { color: #000; font-size: 1.714em; margin-bottom: 0.8em; text-shadow: 0 1px 0 #fff; text-align: center; line-height: 1; } #triptych .block { margin-bottom: 2em; padding-bottom: 2em; border-bottom: 1px solid #dfdfdf; line-height: 1.3; } #triptych .block.last { border-bottom: none; } #triptych .block ul li, #triptych .block ol li { list-style: none; } #triptych .block ul, #triptych .block ol { padding-left: 0; } #triptych #block-user-login .form-text { width: 185px; } #triptych #block-user-online p { margin-bottom: 0; } #triptych #block-node-syndicate h2 { overflow: hidden; width: 0; height: 0; } #triptych-last #block-node-syndicate { text-align: right; } #triptych #block-search-form .form-type-textfield input { width: 185px; } #triptych-middle #block-system-powered-by { text-align: center; } #triptych-last #block-system-powered-by { text-align: right; } /* ------------------ Footer ------------------ */ #footer-wrapper { color: #c0c0c0; color: rgba(255, 255, 255, 0.65); font-size: 0.857em; } #footer-wrapper a { color: #fcfcfc; color: rgba(255, 255, 255, 0.8); } #footer-wrapper a:hover, #footer-wrapper a:focus { color: #fefefe; color: rgba(255, 255, 255, 0.95); text-decoration: underline; } #footer-wrapper .block { margin: 20px 0; border: 1px solid #444; border-color: rgba(255, 255, 255, 0.1); padding: 10px; } #footer-columns .block-menu, #footer .block { margin: 0; padding: 0; border: none; } #footer .block { margin: 0.5em 0; } #footer .block .content { padding: 0.5em 0; margin-top: 0; } #footer .block h2 { margin: 0; } #footer-columns h2 { border-bottom: 1px solid #555; border-color: rgba(255, 255, 255, 0.15); font-size: 1em; margin-bottom: 0; padding-bottom: 3px; text-transform: uppercase; } #footer-columns .content { margin-top: 0; } #footer-columns p { margin-top: 1em; } #footer-columns .content ul { list-style: none; padding-left: 0; /* LTR */ margin-left: 0; } #footer-columns .content li { list-style: none; margin: 0; padding: 0; } #footer-columns .content li a { display: block; border-bottom: 1px solid #555; border-color: rgba(255, 255, 255, 0.15); line-height: 1.2; padding: 0.8em 2px 0.8em 20px; /* LTR */ text-indent: -15px; } #footer-columns .content li a:hover, #footer-columns .content li a:focus { background-color: #1f1f21; background-color: rgba(255, 255, 255, 0.05); text-decoration: none; } #footer { letter-spacing: 0.2px; margin-top: 30px; border-top: 1px solid #555; border-color: rgba(255, 255, 255, 0.15); } #footer .region { margin-top: 20px; } #footer .block { clear: both; } #footer ul, #footer li { list-style: none; margin: 0; padding: 0; } #footer li a { float: left; /* LTR */ padding: 0 12px; display: block; border-right: 1px solid #555; /* LTR */ border-color: rgba(255, 255, 255, 0.15); } #footer li.first a { padding-left: 0; /* LTR */ } #footer li.last a { padding-right: 0; /* LTR */ border-right: none; /* LTR */ } #footer-wrapper tr.odd { background-color: transparent; } #footer-wrapper tr.even { background-color: #2c2c2c; background-color: rgba(0, 0, 0, 0.15); } /* --------------- System Tabs --------------- */ .tabs { font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; margin-bottom: 20px; } .tabs ul.primary { padding: 0 3px; margin: 0; overflow: hidden; border: none; background: transparent url(../images/tabs-border.png) repeat-x left bottom; } .tabs ul.primary li { display: block; float: left; /* LTR */ vertical-align: bottom; margin: 0 5px 0 0; /* LTR */ } .tabs ul.primary li.active a { border-bottom: 1px solid #ffffff; } .tabs ul.primary li a { color: #000; background-color: #ededed; height: 1.8em; line-height: 1.9; display: block; font-size: 0.929em; float: left; /* not LTR */ padding: 0 10px 3px; margin: 0; text-shadow: 0 1px 0 #fff; -khtml-border-radius-topleft: 6px; -moz-border-radius-topleft: 6px; -webkit-border-top-left-radius: 6px; border-top-left-radius: 6px; -khtml-border-radius-topright: 6px; -moz-border-radius-topright: 6px; -webkit-border-top-right-radius: 6px; border-top-right-radius: 6px; } .tabs ul.primary li.active a { background-color: #ffffff; } .tabs ul.secondary { border-bottom: none; padding: 0.5em 0; } .tabs ul.secondary li { display: block; float: left; /* LTR */ } .tabs ul.secondary li:last-child { border-right: none; /* LTR */ } .tabs ul.secondary li:first-child { padding-left: 0; /* LTR */ } .tabs ul.secondary li a { padding: 0.25em 0.5em; } .tabs ul.secondary li a.active { background: #f2f2f2; border-bottom: none; -moz-border-radius: 5px; -webkit-border-radius: 5px; -khtml-border-radius: 5px; border-radius: 5px; } ul.action-links { list-style: none; margin: 5px; padding: 0.5em 1em; } ul.action-links li { display: inline-block; margin-left: 10px; } ul.action-links li a { padding-left: 15px; background: url(../images/add.png) no-repeat left center; margin: 0 10px 0 0; } /* ---------------- Messages ----------------- */ #messages { padding: 20px 0 5px; margin: 0 auto; } .featured #messages { background: #f0f0f0; background: rgba(30, 50, 10, 0.08); } div.messages { margin: 8px 15px; } /* -------------- Breadcrumbs -------------- */ .breadcrumb { font-size: 0.929em; } /* -------------- User Profile -------------- */ .profile .user-picture { float: none; } /* -------------- Password Meter ------------- */ .confirm-parent, .password-parent { width: 34em; } .password-parent, div.form-item div.password-suggestions { position: relative; } .password-strength-text, .password-strength-title, div.password-confirm { font-size: 0.82em; } .password-strength-text { margin-top: 0.2em; } div.password-confirm { margin-top: 2.2em; width: 20.73em; } /* ---------------- Buttons ---------------- */ input.form-submit, a.button { background: #fff url(../images/buttons.png) 0 0 repeat-x; border: 1px solid #e4e4e4; border-bottom: 1px solid #b4b4b4; border-left-color: #d2d2d2; border-right-color: #d2d2d2; color: #3a3a3a; cursor: pointer; font-size: 0.929em; font-weight: normal; text-align: center; margin-bottom: 1em; margin-right: 0.6em; /* LTR */ padding: 4px 17px; -khtml-border-radius: 15px; -moz-border-radius: 20px; -webkit-border-radius: 15px; border-radius: 15px; } a.button:link, a.button:visited, a.button:hover, a.button:focus, a.button:active { text-decoration: none; color: #5a5a5a; } /* -------------- Form Elements ------------- */ fieldset { background: #ffffff; border: 1px solid #cccccc; margin-top: 10px; margin-bottom: 32px; padding: 0 0 10px; position: relative; top: 12px; /* Offsets the negative margin of legends */ -khtml-border-radius: 4px; -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; } .fieldset-wrapper { margin-top: 25px; } .node-form .vertical-tabs .fieldset-wrapper { margin-top: 0; } .filter-wrapper { top: 0; padding: 1em 0 0.2em; -khtml-border-radius-topright: 0; -khtml-border-radius-topleft: 0; -moz-border-radius-topright: 0; -moz-border-radius-topleft: 0; -webkit-border-top-left-radius: 0; -webkit-border-top-right-radius: 0; border-top-left-radius: 0; border-top-right-radius: 0; } .filter-help a { font-size: 0.857em; padding: 2px 20px 0; } .filter-wrapper .form-item label { margin-right: 10px; } .filter-wrapper .form-item { padding: 0 0 0.5em 0.5em; } .filter-guidelines { padding: 0 1.5em 0 0.5em; } fieldset.collapsed { background: transparent; -khtml-border-radius: 0; -moz-border-radius: 0; -webkit-border-radius: 0; border-radius: 0; } fieldset legend { background: #dbdbdb; border: 1px solid #ccc; border-bottom: none; color: #3b3b3b; display: block; height: 2em; left: -1px; /* LTR */ font-family: "Lucida Grande", "Lucida Sans Unicode", Verdana, sans-serif; line-height: 2; padding: 0; position: absolute; text-indent: 10px; text-shadow: 0 1px 0 #fff; top: -12px; width: 100%; -khtml-border-radius-topleft: 4px; -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -khtml-border-radius-topright: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; } fieldset.collapsed legend { -khtml-border-radius: 4px; -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; } fieldset legend a { color: #3b3b3b; } fieldset legend a:hover, fieldset legend a:focus, fieldset legend a:active { color: #000; } fieldset .fieldset-wrapper { padding: 0 10px; } fieldset .fieldset-description { margin-top: 5px; margin-bottom: 1em; line-height: 1.4; color: #3c3c3c; font-style: italic; } input { margin: 2px 0; padding: 4px; } input, textarea { font-size: 0.929em; } textarea { line-height: 1.5; } textarea.form-textarea, select.form-select { padding: 4px; } input.form-text, textarea.form-textarea, select.form-select { border: 1px solid #ccc; } input.form-submit:hover, input.form-submit:focus { background: #dedede; } .password-suggestions ul li { margin-left: 1.2em; /* LTR */ } .form-item { margin-bottom: 1em; margin-top: 2px; } .form-item label { font-size: 0.929em; } .form-type-radio label, .form-type-checkbox label { margin-left: 4px; } .form-type-radio .description, .form-type-checkbox .description { margin-left: 2px; } .form-actions { padding-top: 10px; } /* Contact Form */ .contact-form #edit-name { width: 75%; -khtml-border-radius: 4px; -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; } .contact-form #edit-mail { width: 75%; -khtml-border-radius: 4px; -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; } .contact-form #edit-subject { width: 75%; -khtml-border-radius: 4px; -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; } .contact-form #edit-message { width: 76.3%; -khtml-border-top-left-radius: 4px; -khtml-border-top-right-radius: 4px; -moz-border-radius-topleft: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-left-radius: 4px; -webkit-border-top-right-radius: 4px; border-top-left-radius: 4px; border-top-right-radius: 4px; } .contact-form .resizable-textarea .grippie { width: 76%; -khtml-border-bottom-left-radius: 4px; -khtml-border-bottom-right-radius: 4px; -moz-border-radius-bottomleft: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-left-radius: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-left-radius: 4px; border-bottom-right-radius: 4px; } /* Disabled form elements */ input.form-button-disabled, input.form-button-disabled:hover, input.form-button-disabled:focus, input.form-button-disabled:active, .form-disabled input, .form-disabled select, .form-disabled textarea { background: #ededed; border-color: #bbb; color: #717171; } .form-disabled .grippie { background-color: #ededed; border-color: #bbb; } .form-disabled label { color: #717171; } /* Comment form */ .comment-form label { float: left; /* LTR */ font-size: 0.929em; width: 120px; } .comment-form input, .comment-form .form-select { margin: 0; -khtml-border-radius: 4px; -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; } .comment-form .form-type-textarea label { float: none; } .comment-form .form-item, .comment-form .form-radios, .comment-form .form-type-checkbox, .comment-form .form-select { margin-bottom: 10px; overflow: hidden; } .comment-form .form-type-checkbox, .comment-form .form-radios { margin-left: 120px; /* LTR */ } .comment-form .form-type-checkbox label, .comment-form .form-radios label { float: none; margin-top: 0; } .comment-form input.form-file { width: auto; } .no-sidebars .comment-form .form-text { width: 800px; } .one-sidebar .comment-form .form-text { width: 500px; } .two-sidebars .comment-form .form-text { width: 320px; } .comment-form .form-item .description { font-size: 0.786em; line-height: 1.2; margin-left: 120px; /* LTR */ } #content h2.comment-form { margin-bottom: 0.5em; } .comment-form .form-textarea { -khtml-border-radius-topleft: 4px; -khtml-border-radius-topright: 4px; -moz-border-radius-topleft: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-left-radius: 4px; -webkit-border-top-right-radius: 4px; border-top-left-radius: 4px; border-top-right-radius: 4px; } .comment-form fieldset.filter-wrapper .fieldset-wrapper, .comment-form .text-format-wrapper .form-item { margin-top: 0; margin-bottom: 0; } .filter-wrapper label { width: auto; float: none; } .filter-wrapper .form-select { min-width: 120px; } .comment-form fieldset.filter-wrapper .tips { font-size: 0.786em; } #comment-body-add-more-wrapper .form-type-textarea label { margin-bottom: 0.4em; } #edit-actions input { margin-right: 0.6em; /* LTR */ } /* -------------- Other Overrides ------------- */ div.password-suggestions { border: 0; } .ui-widget-overlay { background: #222222; opacity: 0.7; } div.vertical-tabs .vertical-tabs-panes fieldset.vertical-tabs-pane { padding: 1em; } #forum .name { font-size: 1.083em; } #forum .description { font-size: 1em; } /* --------------- Search Form ---------------- */ #block-search-form { padding-bottom: 7px; } #block-search-form .content { margin-top: 0; } #search-form input#edit-keys, #block-search-form .form-item-search-block-form input { float: left; /* LTR */ font-size: 1em; height: 1.143em; margin-right: 5px; width: 9em; } #search-block-form input.form-submit, #search-form input.form-submit { margin-left: 0; margin-right: 0; height: 25px; width: 34px; padding: 0; cursor: pointer; text-indent: -9999px; border-color: #e4e4e4 #d2d2d2 #b4b4b4; background: url(../images/search-button.png) no-repeat center top; overflow: hidden; } #search-block-form input.form-submit:hover, #search-block-form input.form-submit:focus, #search-form input.form-submit:hover, #search-form input.form-submit:focus { background-position: center bottom; } #search-form .form-item-keys label { display: block; } /* --------------- Search Results ---------------- */ ol.search-results { padding-left: 0; } .search-results li { border-bottom: 1px solid #d3d7d9; padding-bottom: 0.4285em; margin-bottom: 0.5em; } .search-results li:last-child { border-bottom: none; padding-bottom: 0; margin-bottom: 1em; } .search-results .search-snippet-info { padding-left: 0; } /* -------------- Shortcut Links -------------- */ .shortcut-wrapper { margin: 2.2em 0 1.1em 0; /* Same as usual h1#page-title margin. */ } .shortcut-wrapper h1#page-title { float: left; /* LTR */ margin: 0; } div.add-or-remove-shortcuts { padding-top: 0.9em; } .overlay div.add-or-remove-shortcuts { padding-top: 0.8em; } /* ---------- Admin-specific Theming ---------- */ .page-admin #content img { margin-right: 15px; /* LTR */ } .page-admin #content .simpletest-image img { margin: 0; } .page-admin-structure-block-demo .block-region { background: #ffff66; border: 1px dotted #9f9e00; color: #000; font: 90% "Lucida Grande", "Lucida Sans Unicode", sans-serif; margin: 5px; padding: 5px; text-align: center; text-shadow: none; } .page-admin-structure-block-demo #featured .block-region { font-size: 0.55em; } .page-admin-structure-block-demo #header .block-region { width: 500px; } .page-admin #admin-dblog img { margin: 0 5px; } /* Fix spacing when Seven is used in the overlay. */ #system-theme-settings fieldset { padding: 0; } #system-theme-settings fieldset .fieldset-legend { margin-top: 0; } /* Configuration. */ div.admin .right, div.admin .left { width: 49%; margin: 0; } div.admin-panel { background: #fbfbfb; border: 1px solid #ccc; margin: 10px 0; padding: 0 5px 5px; } div.admin-panel h3 { margin: 16px 7px; } div.admin-panel dt { border-top: 1px solid #ccc; padding: 7px 0 0; } div.admin-panel dd { margin: 0 0 10px; } div.admin-panel .description { margin: 0 0 14px 7px; } /* ---------- Overlay layout styles ----------- */ .overlay #main, .overlay #content { width: auto; float: none; } .overlay #page { padding: 0 2em; } .overlay .region-page-top, .overlay #header, .overlay #page-title, .overlay #featured, .overlay #sidebar-first, .overlay #triptych-wrapper, .overlay #footer-wrapper { display: none; } .overlay-processed .field-type-image { display: block; float: none; } .overlay #messages { width: auto; } /* ---------- Poll ----------- */ .node .poll { margin: 2em 0; } .node .poll #edit-choice { margin: 0 0 1.5em; } .poll .vote-form { text-align: left; /* LTR */ } .poll .vote-form .choices { margin: 0; } .poll .percent { font-size: 0.857em; font-style: italic; margin-bottom: 3em; margin-top: -3.2em; float: right; text-align: right; } .poll .text { clear: right; margin-right: 2.25em; } .poll .total { font-size: 0.929em; font-style: italic; text-align: right; /* LTR */ clear: both; } .node .poll { margin: 1.8em 0 0; } .node .poll .text { margin-right: 6.75em; } .node .poll #edit-choice { margin: 0 0 1.2em; } .poll .bar .foreground { background-color: #666; } #footer-wrapper .poll .bar { background-color: #666; } #footer-wrapper .poll .bar .foreground { background-color: #ddd; } drupal-7.41/themes/bartik/css/ie.css0000644000000000000000000000213712611765734016111 0ustar rootroot .block { zoom: 1; } #password-strength-text { margin-top: 0; } fieldset legend { left: -8px; padding: 0; } #footer-wrapper #footer .block { height: 100%; } .comment .attribution { display: inline-block; position: relative; float: left; /* LTR */ overflow: hidden; } .comment .comment-text { display: inline-block; width: auto; } #search-block-form input.form-submit, #search-form input.form-submit { text-transform: capitalize; /* Trigger text indent. */ height: 26px; } .meta { margin-bottom: 10px; } .region-header .form-required { color: #eee; } #search-block-form input.form-submit:hover, #search-block-form input.form-submit:focus, #search-form input.form-submit:hover, #search-form input.form-submit:focus { background-position: center -25px; } .contact-form #edit-message { width: 75%; } .contact-form .resizable-textarea .grippie { width: 76.3%; } #footer li { float: left; /* LTR */ } #footer-wrapper { color: #c0c0c0; } #footer-wrapper a { color: #fcfcfc; } #footer-wrapper a:hover, #footer-wrapper a:focus { color: #fefefe; } .node-teaser { margin-top: 10px; } drupal-7.41/themes/bartik/css/layout-rtl.css0000644000000000000000000000057712611765734017636 0ustar rootroot /* ---------- Basic Layout RTL Styles ----------- */ #content, #sidebar-first, #sidebar-second, .region-triptych-first, .region-triptych-middle, .region-triptych-last, .region-footer-firstcolumn, .region-footer-secondcolumn, .region-footer-thirdcolumn, .region-footer-fourthcolumn { float: right; } .region-header { float: left; } #secondary-menu { left: 0; right: auto; } drupal-7.41/themes/bartik/css/maintenance-page.css0000644000000000000000000000244112611765734020706 0ustar rootroot body.maintenance-page { background-color: #fff; color: #000; } .maintenance-page #page-wrapper { background: #fff; margin-left: auto; margin-right: auto; min-width: 0; min-height: 0; width: 800px; border: 1px solid #ddd; margin-top: 40px; } .maintenance-page #page { margin: 20px 40px 40px; } .maintenance-page #main-wrapper { min-height: inherit; } .maintenance-page #header, .maintenance-page #messages, .maintenance-page #main { width: auto; } .maintenance-page #header div.section, .maintenance-page #main { width: 700px; } .maintenance-page #main { margin: 0; } .maintenance-page #content .section { padding: 0 0 0 10px; } .maintenance-page #header { background-color: #fff; background-image: none; } .maintenance-page #name-and-slogan { margin-bottom: 50px; margin-left: 0; padding-top: 20px; font-size: 90%; } .maintenance-page #name-and-slogan, .maintenance-page #name-and-slogan a, .maintenance-page #name-and-slogan a:hover, .maintenance-page #name-and-slogan a:hover { color: #777; } .maintenance-page h1#page-title { line-height: 1em; margin-top: 0; } .maintenance-page #messages { padding: 0; margin-top: 30px; } .maintenance-page #messages div.messages { margin: 0; } .maintenance-page #messages div.section { padding: 0; width: auto; } drupal-7.41/themes/bartik/logo.png0000644000000000000000000000662712611765734015670 0ustar rootrootPNG  IHDRAIȭ ^IDATx^mtUՙ{orI /b7#ʛPL)VTZQ]˙YkI;Ѷtl;cQk]/TQ#`$0+$794D@mផuVz~ù[֭ħ|뾄Opu<|L>2(P/l|:)Mwo7/I#@8EVWݻfױߤ-)k쫉7)rޫ7[9 -xϭ&/4i芞vgU=?I WzoX0 IA$H& vq>'?Qgtydśށ,OŒ@Fhi$K!xUݺīJ~" +W, َƶ݃Q(pVB+#IHS7o P8_qWڍ枪Q!<, $$(-'7-ŕo|~Jcpʕ.Pj-ՖV2A &_җFj+,{fqG#VƮ0D JJ+ #8MbqŞ}E%!idM)?–@#lgMYFA #S./ZBv{[VK[,[8lD "A0U|tIڎNaufzr{kǶbK!P PJl6` =[NٿwO*rڝ7 h8mgZ#tD `P@ #A4$bc/6'P~ IHvUw 'hC &Z@doQB06ȴWl>p_;ӧoљ>rwb~ " #; ]Myhщֵ#@^Lmwg8 d%(hl"ciBNB ;@{ݻ&eK`0x@1KK60 2VIk%GTX3}C>HoC?Hh--Mh ֠@N`Y yYtGP([tݟ9"uQln!V{#A I@@BFv:r\ Θ%*cxA{Ŕ,JI+P0)8'juitClr``a PGUU[2>ypgOe_y“ICS Vn*;fEaO\ ~iIOFsV p.WD%XC L|Y1!"\Fp4A #P 93xdGzKaXMIN 2a oq@ႄ!Lh rS^%1ntLXZ *̚E|l`aEj4@ʈ_sH= 13ଆCC/l؇KL(|4`u`r}Ov%†">I"m#CiH~^ M̬ \ه i0 q8$li8jd8mqGY 0A~PMτcp!X%ic2)Iz3V[HS# |DyX iP sGh4U:M3i(@M^jj9C+(i(j$40Xn7#Ǯ<_̊Xr NT(w솹 V\m~9's/EEZa!^W@~dqvmy&FB$cB F0n~aUw]!(5gۗ;_{"f"$dq@(_eJK7ۏŽaz_ڡZvf`hP|Ά˾3܇zǧR$DnPߋ7`D*=f\|f֨eI90КF@ڼ7um 02^}?YL <) X t"gsRHw .yvNi5"{ > K ʊXi ,'fKVY6Ny?Z^ gݿ'#HaKN Cs%QC 4pfY8iΘ7^|8Fa$:ڇ㚿iQ&K&ii{{Ga|MFn16 #uTVqm8zyX&4$ &K$iEGi]ݝ0 /'atJZje Swhb'^a0Su}oFli R;cn!IH{o'N/쉧:srHE=$%GTlNϐ%%Zpt~# HM5h#W%C4`6Ù0wWbw7n#yzJL̞uKuԾ@G7>o_(/,_v=gnnMEn~%c,FҺ֊~WB!@w-Ͼ %|g/L`־TB9(uK1[Uo|'T&ٗLj Ҝ2)9ظ_,ޞ#-H@?x'CBm0敍ţ.;m -1Kymg$ŧ}pt'G JdA`5c~Ik[dJp LJJ#̃-e֓}TLZ0y&Cz`q@D.oEZ7֧N=ff̗H! $(\/rnJfQHaK[~d`bG˖dOIj^K M& ڒ@'n\.:.ٜt\p?}8pWPq}[{H10^40_xf}2`KvkYeﾦtWpAtbɟ:i,nT|lo4S71Gψ]`> 4i] C;OsPmZ1_L)pfI=-t``s,=0%PdRdݱ='-Iy?CY< 2PXp,cŔўL^m gOIV ._>FfTȴ4Sp*' D _e(NqTkG3>=<_IENDB`drupal-7.41/themes/bartik/screenshot.png0000644000000000000000000004631212611765734017100 0ustar rootrootPNG  IHDR&a̛PLTE4'''䴴C⼼̬@甔 [[[|||RRRqqqccckkkú-JJJ:::BBBʚ짣333lþӶ=޳"8i͓0أֻZW&쨮(lsǖ<㼺𬦢ê咎zb˚.ٜ@NVtjgʞ4z߲*I]jϩ𬥫Ck๸2Ǔ-'ilwĿׄCJTlptc[U𐐐8oaZ|,SMJ3߈2vriȎaim9;O#mebIC>ZQK~IR[2e]a)hhh-s|adofffzr-tttC;=/MMM===-0+2"(:JEAwww666nnn8сYVS>87GGG...888Y___swwRQ`WWWYVb_]X?BO11= | vJχIIDATx^A 0CI*T(7y͇" OfL=̓/Qg`GZbF v- E[BAt APKK!]Z>dy|K&rqrvӺJ`g1F)0p3@WȞG8a} "MwQd̈́ݭ꾒&A.y,j3%K+㨕=ď\2vm¸ J)d^# A=8 1_ӂfέnmVi5 tlpcxPSlO:qa{I#0 ߶ɱ9_$75y*IW*tiNB+=O'ꇝmRMP"7y;<׾@AvL3?xe3c1hD@)J{vqk@0b#/B@R@!JK;1slh)+>ݮd\@wHBB .!^q)\AKgXi?ٯ÷u^S,JDyyHsԘD_[nإa DPPk@DLp ]!]:xp`CAdk,ΞNÂԏཏ{xgH3lq"7tPJ@$%J9RHXu79G={N{r0͍WY jA&I|J@ K8|wĭE\}'|Nsu_~`ᱛD&W_\T\Fݧ< ShF9+,BW:ܰ쳷*BO|3' 0FvyN rB>ڑ`%v!P!%A/o]rӫF{-c6 &NW͢NWK 03`MewHGF"KNw9q 1DD!!UvA NXh&|]0 BA:XX$M*op.d,8_tk(\H ƍ41K4 :dWNt l x+GiDg,2ڬ|*ɭJԗ:fm86Z^S -tq'kb`PCC9 i!ns[E:xw1)}"%8OGhǝzЪ̝u:x /p:AkϝFoYk7 OпjD@ֈ0.YW3CO~_? OȐ1SW0i$gX*\<`(ΐ#I0gwNtd?]ϿDwJ? {ˏ3WWwxX"ъ"Zw(Ya2\P"$~"@!$!XK[N~习cr d1:|Ʃ<'P (x>6))c_/^l۷czT1e `2ETDOO'򁠌 ֧ͅ xq݊nL$QXYx4@d)P.-i Z+ =@4-oKl2X7ٚyozd짻ϭ>d,\?hnR߱ ? Mioہbc `u  ǒU^"I+ Q=雯WҁO?δ.JXsV KT9/y'@q𙗯t{u5owzOsGoL\5KG?s ,>JH遙aIb0鄥ĝg~iX;?͟TmF[WgOWtzW{/7\Pll{ĵr 5KĦ|=G=sK- moNv{k,f*:Of'&Cxes?0?Uo~};m'ƫ?wrT)X+Ԅy boL؏+p4ҭ(na}L4P H @ Q K`*@(X EHA'@'d$MW.T2cSbZ~82Q՜y! d/Rc&C EJѐinN)L TG Ā<#(=*O7( |zJShݪ1AVd{J5S\K+*b|瓲rڗCzԫXh0F9Ǹ9n6 S}`1Mw@g:-Z8|Z=vƄnǿݽg“;9yQ;;(JL2wfddI0 %,0J0 |qkm0v23g(~=,Ov)#fv2IӦȴ#bYf(JgFYmZ"X*EQeY*(Y0 gvD,7s^"ӌl /UV^cd^6@$6JȆkbQh0RB KyL8;)^foJMd8O-7hkR,<5T9 XϰL jUcEZ}a:<:|zrx@ R]S$+2Aˌd EBp f.VU%6̴D  9L_guI޽{ݟwӛ8jHnEz F "y[1ux(b!*| f&I\tBމ(J|nXט6p?ugx7&vy"7+NcgX,q$Xij)Izu ERHgFTS {Ow@s?pfAw5O)Q_yU BuD,n8EbԐT9AQ o7*OzD~Дނ_ zOsuI<9ۼi.Un IJH:h+]ՋLW+I> @h_ T5uR|S"dWRt[ou~t֏և+~ӚES^m]cgY"Y@AߨZ~o7J YXNSY qg'4; ؖ/oabe8%WOij7QLV$DHF@MNa.$Ȫ* &BD%Z*N4MGj_k//SoV0eL!*p6&T Ii)Myi>x< 45}IU4Y\sY*_)S8S kxL In2 &dB 2~,XLHp90rDz-e kynVe?[rDŶmr\cLk1&UgYGX^u5`"LR,)a|cnhEyrj BpNr*mw|_ ?{t/:<o|L#(-۶P >L[C`ZĀ"ȾWn% l40 :4O*x(P|PTBYZa*UXy7MTp轳ۯ)J?J,T%2Z =?Tԍ{L'e 3Lr\(h뜃KN`wLZ~svȤLЕy!VWR_ i *hg)0MI8@ ix\LI7OxpUr顙S/F3)*n_B Xf]*dW)ɨth'rP"z޺vn_1#X\ ҔtGu`Mltq@LϹ΢,(23/Kˁ`bGIģwkFԃ:.Qd{\`h<#4*5-9!dЗ1;fJbYv ^Oнξli͒2\08 Eǚ*h'Iqehڭ\I;iǵQaاX8p^?IQȘ8˅Xi+R:i1ĽMynԫbDE-V\`Ze)v['5tͨ]zP?X'pؤ0lqƣxĸDk:9wbde% GeuӣDng}qx2jˉ&`0"R髪fII] hz4wa&v]^,z:0On\wvgnn6/u ܖ 1+dY}]}>=z -$ð,E~~~; hdݮ8ڃ4x zs^1FJ:doc=Q,"Qr([H*˜' +?q{ՅQ0*7w:~{{^mw1ZAcL6mn/qs4݉g:a&I zn \Fo8bWe>cwxB *q•$ϚeIJfY xVڛ7>Ãwo}}{ݻۧo'޾wwoӈ!a3VQxMhaR8d D21MzzmJ$ʛXia-0٦6 'O.KڢC]U9tl{Otߺwo#Go'yƛ[޽&^fZ鶆V6׵2ۊ]ˆ3BJ j EtB Z0mɩCIЩAs}ҕ NhQܑJdv`0D^ѣw~GƝ[ozwOToGxLkڕ}-/y\1 ZHH%y*ĝrNSi$nap4[3/Bk&oLӞ<9`b9~1?<}+ ΰ7HPG_|v z.8"VLlWlS!1f<<~\d+l|2m"uQ.pYN`+[yl]>>bővE%,8g%Zߛ=|HZ.qD^~;G ӃFwd$ДBʷs]S9ur 46 g,MKRf+x?AEp~2 l4e%Դުnuse) lF4K4\kr>iș-fu@e I{x5ĻҒXxk Z1s({oBc,c>ggg_5޾{KB(^!TmH/\rmdÚbN;Mi*lrE&-e3Mﯙag14(Jiw&պ=6Jq3 z^)Ol8ۥ=}qΎ>=,stx @g8>~;& \6<8ȩj#Xɹnu=m۩ں4cG& ,'6v f?˓hkf1P+w-/aB9!|ꋃ~z峇_T ^sdR,VU^( Uu=fT+&YIҋ 3lb`xr:ʂ wqt-5@ٯ˅b2OkQd%ۈ䕿)bAi 2^h4`JmaQL3lkAHJp&ftEֹ&K9IAnʦ/%sv 0~r cɺt3EA_M0TXhT!=}ORE@ipt>Iw̬5nqBt7-_ok̴M„^џ>(iX,CY'R"կUA%hZ*v_tYH2)V҈u'JTy12Lbʻ="N.ji3,D]hA*V uɥs,Ht !0sAk0WA;+!;ę0"]6(f < t 3#A_GI"nPf::炵f\n BRYx.7jVؒdaCƖ.&w%N_i;Ӯ͕$s2FK1>oX{o`R{eL.)XD0QŎ GHBhm .? kQy|뺘KeI0&2WnH.*A5V"T6t`ߎӃ,~'{?oi:w7%x_b2J%̪(RWԍ+y<%7BMtŗlS(/a]yG.Ɛ,{w .?M}O_ .B3WlIxP6`CI$QQUHQ ,:$NuJ4r}* !kLq2إv5s7uYY5`* av^?_P%VKsjm)Sw"&D pUu_ݔbkHjTA.Qef'I~md/Q#d% ,;? b<5@̯1A#AD?VY@'4Tj!%q,EHg+e]ŠD"pUgf8=gլxSypٗ䠠(JȽ @Jv`V!2 TUBDMꗄAol^‹Ѭ''K%w6/ }05h[MYjR!#RR6Z9;ٝQ)27AU/KO'!l M~ E`%PFh!aF(Y"Lӈ$'$(4b3dΎBN1# qBv7(U ʅɎWVۭ]C~I"L,Fp-ݩgqe} ^LEX V0*?E Q=UeI*2k`a- ]3^L*夽6bhRՏF_?ۃ~)V2ܨg`?"FzuRӃt.*6slJ%+]*Uwh~v?1>dBcj+! ÒEۃ` Ig`6^ ܺ~5ĠV-A(e1ZY()iZEIPQ]"_kT&z(9L*X6H ͕DBId9CgZԗaXq¯}G7S4d Z[N@KM94MT&4)]WUXHqe*#"еhᬐE_(6-5$uAхHA~ ̼3x 1?R]nJJJ}HPu]#:&j_i+5ϦL$U|>TɊ ښS녉J{SEeWuQaߝƙk!smm++qOI#Deu'>cYbu:)Me+0&Ae{lsfɲl7]j&2*P@YN3$lZnׅ .Ng\rl+`i”B&V_yL:>{3R5l'ؚ l: [94y1yTIctºSUMul׏=65śbzb!yneX8n$1vct\s-X$gH%~}OlMx5fc[,Al8p#f gPdQ*P&#'$%&vDJLJW e E71 ޽wM/js_PwWs-'׏L_$s~眫R,* q37:sT*}ɞMnx`!F $9Z q<Ć͏]BQj_Wjcm APy\ahBJQenb̗_qtYx3y~bTXJ]@jäkLbSZBN3MŒHmc-tyu6O.19I6VtG M =TknY2kt5;]V/IX,S>Xfl4ݧ+P,C$ΞWW3Oy*Fh篐ږ"'1$m'4Ne#w'' _k1y̞Mv3A] ,3f:II;<cF*u,<%uÜI)ՍWȻPF_Gٛ9&ɻSG6Q u!ij&K-i5>Ҟ z hHtU"fFNrĠ R{k$+MH7ܛĆ Jq6sD%b"{(v%Ո5U3@K}jFT)[deݕ8ٳ_#,UcO\|af8-SZRZ玴AR tm8 BXtY (#^T!:""M=IR,X8Ex(*ZE))нtj3(áh#Ų#.ڊhEXx(gj (jEPJA:vb[1#:Q] @:b( ȺMo> ΀1ɇb_*Ov+ n>﫝7$Nک..nj{d2Y/3ko(w=Y-UGy7=#}?{lXn=]: SO^.n.O[޿2JOpy0㢎`<~OPߵwɓw[ bi\iNKϊ5f"v'\xUfRdlňnp k?E<A,RQ*dWGn[6܀A6V{wENjl9&hVo]3OߧҚ׶t:ɼ:zBiJP|$fse_Pc }s5-CKle f(viyT7T,4_t6&VJ V$a\6643!ilw:4 .stC(Ub[\aYl9JklX:ơ;Cr2k]'wW&-xP(-},_K@7JP( v uWPJHdeK } p]FU *0V;ePAlI hW5( z7tzpV;8GH,ՐP(PAuﲼBG" A ,\ݒ*i bx?kX pooQqg'"YDNeA5ltcߌhg74Adφ7˛"JOK8܃h1$W)%Bn;}~/o>mJ;JO.3`(xqoegiݵ>2/R9HSr[ -?}$YwZtJ];Ew{tW_c|/;& YD<@ 2`_۸6rܥܒ/ĘZ#-~U3j8ϯh:4.~gt}/݂9HƴV/KzD??\9@]|PhP;'8zSL4Cyr~idףc2^,K&Rxn#o1sc ҅`*rV!mbp rrݙe؎u\ vůmU!SKA GXE 0A[vAʺbCQ` TtgZPDH+HP}mR"@e0m`[S(Q{E\ E<".nu!]M]m6`/.[h[:mWU@mWQ}Y [kWJh]t}ĠG\ g-uAE^']!WAu Zj m|E4D z_RK@J-S©Emvv^ &AhBˁ&Ec\CcRn6iw'"YtjG3N6ئv-]Z_zRxOp3ɝF {~ Ls,TM|5heqTjD8\KՌn#Su;}?3ulz?$~w|`/保HQ҆N[}h ͽ~iHmĢ+(w9 K\TPXmɍplN~an$wKDKj_PA/i)J+l|АJFW=~:i| δ`,^Q88L&[]cQ3Z(jԘ&0j3 L:SX76y&?@KL]<˾e׳- }f@iL0xe.>8c^3*Eһ,0gcCQybtON+_#, O[@mď}Sc< M{RC wΑ NŁ}WoP7XMo?yh7A` , *Y6 `CkNIZCDBYPmd]G`I@x8pTX8bv!hp  !.v]t#^$)h.;.\VPxg0'yIG: : .W\!|YDlEDPrcK`5 рvkpЈERqTINjEtezY{Q95>vyi܆5z7FqHy(lP7}N/:}OT YM/!3<aC?5MĽZMt )pLoqa*v糡[%>OO@ԤiƭJ>.6V$JRH$XJm$b |.&kW K| O2lR Pq|&`ZL6t490_T.Pn}Yͯ.yn NSdĊlK5 lQ[6"\CAh@͜5u0Sj9ZSMk_Wfp_H cS̄uQS*"THj24:E}lO\B)5*a-lVf4DkteisHt/'iglc2$lVb=xNgWU^!$ ZBTEZ,`*Nm_U'ܠ*b~mU-Zg_[ *@ZcxT-Ѫ[}D*V*56ބh&-D? x6X,tq;|oޚF c^pVN}Wqv[ DwpG "e: iCKKЍCA?wc#xb<W;HQUmwy>ONbq I;A6?&kqW1'eү0gTQ-K|#9=_Lz*'KEO٫NKg\mEX\|>_/+I)^2v{:g Y!8 $=Z O_EtLa+$3 7RM0Tzdǯ;_@]k%L hݕn(M_5[2U6RQ܎Î `C2Os\as}xVM^LE.͍8>yJqo?}ڌ'*-#v7Zl=ǣG_ֲty EJI 51)I7#yNKeYn&Ђ11IqrqI?o4)5wð-tS5^={fpЀmt Ҝ"i<Z&I6}5bRB>jz秹.on<+Gb]% (5% ɒm"NDmtҖLz8!K%#`WXoH~XzD@Tgpʐ\V$iciB늗qB BNUy_8w/xT_*;,^lV'-D1Nx,CD|Du* )tVk'=#8[8R>B95oQݾzm`"{SۆZuCqݶӉPE&BpFH :tponNlhc@5 "sx`} ") NBwoa^m$ܾ$%9 @IENDB`drupal-7.41/misc/0000755000000000000000000000000012611765734012401 5ustar rootrootdrupal-7.41/misc/menu-expanded.png0000644000000000000000000000015212611765734015637 0ustar rootrootPNG  IHDRŐPLTEU~tRNS@fIDATxcP` IENDB`drupal-7.41/misc/powered-gray-88x31.png0000644000000000000000000000366012611765734016312 0ustar rootrootPNG  IHDRXTPLTE~~~yyyvvv|||jjjYrrrppptttֶ.JmmmWJYb;_"OjLi?cDZfKfv1Wo Bd7KXciLbpv}_q|.VnRZ_EWb|{\o{FcuKh:]3HTu\v8y,nIDATx^c$K/ncsm۶.m۶m۶m۶'vzwz'b7b9sGQU?f>HOϿieY}jERA_Zf[/Ͱo?j-;*+I DV} (b(]+O-F?݂NUQ*C| @ |6hJۺ&Rxq TKPUULqͥk.a$"6tiyoT K$!A4 h?Z{_yuNM4htg_XuD t3-te477s zfqI9 e߽z$Qxؕ=DZtRNPq;ˇhvđT8JaDaAdPZ" [mhA#v #Y=RqkPlp ukHCO+>>0~j3ŗi5'oFqǑg̩E:SE-csBR ɔ$^ PlfxANm[6DBl רQU4[!ِB1cV{Sϙ0n|%3X`Jr1&c!t1M EgeYzH*L(ؖ mfo;sր_=O K*QQ zE: mɦNa>EхxҲ8D<}F3^J8J"9# gz{zv;^p^8cϟit3AMq~XbZ8x2IENDB`drupal-7.41/misc/progress.gif0000644000000000000000000001336012611765734014737 0ustar rootrootGIF89a(hgfedca`^][`Z`__X^^]V]\U\[SYRYQXXPVVOU[ZZNUYYSSXXWQVWQPPUTTNNSMRMQPKKJJONIINHMGGLFKFJIHGFFEEDCBAAA@@! NETSCAPE2.0!d,( (&(& +'+'0,0,1/1/34349898=:=:?  ABBAB"#"1B$G&D"A !(ɒPEG-ZXldI)5Ȩ RHBfMnй 5GaU\ WejWY @dHYDh 6[.F812n"\pɻ%(<8I.+_|쥲d&Od0c> (S2EL1~%Ŕ͝=Mz̏Dl&>9`/\tIVK[aǖ=KWZ DkӧB5tR@ϙ&J-aFyH"-B =Dq>@tO>#|:@9t c7߈c 6d4020  cL1 ",b .1"J(DP)HB%h !d,(d d&('+dd,0d/1d43d89d:=d??d#ABdȚGHd %%KMd --PRd 22TTd77UVd<>YЈH[ШHH](IM_ȄhĄ&/dH4zD1)M)H$M njYqb".LdPSiʷ/=MӔnTp%2MD"EVZe͐%kDX`%xj+-[bEbQHL5 ӧK"葦I!d,( dd (+0d139=? #B"%H* M. -R5 2T67V;ZCD\FE]JI_L!LcN$tҔNb6ɾN%o^#x5RW\#r5m[#lӪ5왱FȔ5biX1`zeV.ZbreiU+TJeSM0ijT $FY !d,(( dd +0d139=? #B"%H* -M. R5 2T67V;ZCD\FE]JI_L!LcN$\%E)4F#~ *o#x9RW#r9m#lӪ9v4E.%[LѰb.ҭ\.ŚҪV.:%ҧP8EDɑH+E)!d,(d( dd +0d139=? #B"%H* -M. 2R5 T67V;ZCD\FE]JI_L!LcN$&=$&JISIO_A'O O-ZgrAl][,4ieRlLČM[ خLt$֫L\d $RBqiJ25zI@!d,(dd( +0d139=? #B"%H* -M. 2R5 7T6V;ZCD\FE]JI_L!LcN$&=$&JISO?PRZCD\FE]JI_L!LcN$&=$&JISO?yr/t֙B.Tqim5Mְ-r E4)cH&b "[pHWZ ҌQ4q ԤJ e$I!d,(dd( +0d13d9=? #B"%H* -M. 2R5 7T6X@ZCD\FE]JI_L!LcN$&=$&JISO?ys:u$my[DM5li&m2Mʘ-E4Ȗ&\4UE9P 5&N TL=$iP !d,(d( +0d139d=? #B"%H* -M. 2R5 7T6X@DZC\FE]JI_L!LcN$&=$&JISO?yijRIԕ5n8MXe۶c5Mְ-r E4)cH&b آ[rZKSWXJ(RLM I.A4#H!d,(d( +0d139= d?#B"%H* -M. 2R5 7T6X@DZCE\F]JI_L!LcN$&=$&JISO?MA7uЩ+IoMҦ ilLr E4)cH&bkע[~Ђ$+HNd*Ԩx8yjRK2Mj$2!d,(dd( +dd0139=? "#dB %H*-M. 2R5 7T6X@DZCE\FI]J_L!LcN$"=$&JHSH)>F"ѳ;x(SW8r(q׵H(QYcɖ1FXD( ׬ZdzňթTLԦNYHS$GM !d,(d( +dd0139=? B"#* %dH -M.2R5 7T6X@DZCE\FI]JL_L!đcN$"=$&JHS( h`$}Qg/%wQB%qQ-%kئ1F(-F 0FrbkV-FZbT*FBbjS'F(Y/#H!d,(d( +dd0139=? B"#H* %. -dM 2R57T6X@DZCE\FI]JL_L!OcNH($&JHS(؏>~(ѳ;x(SW8r(q󖍒5lE֌3JƐ)k"_*z)+YjS 5Mid SIAb!d,( d( d+d0139=? B"#H* %M. -5 2dR7T6X@DZCE\FI]JL_L!OcN$My&&Jg7)>{Ճ7;uΥ#7)8ou[5i11cȞ ɮEplV-EXZE@ZIE&UH$G!d,(d d( +0139=? B"#H* %M. -R5 267dTX@DZCE\FI]JL_L!OcNH8bML6I{ًGuЩ+GI9G&uh$*Ҩ-kرd 5!"5W:ʑPɑ&J0-jD $C!d,(dd ( +0d139=? B"#H* %M. -R5 2T67;X@DZCE\FI]JL_L!OcNH8ILoߦJ:M92Wi7G*YɶM5k̜A3L0atM?b9jMV-:%P:}ZDIӥLi$P !d,(ހd ( +0139=? B"#H* %M. -R5 2T67V;<@>XDZCE\FI]JL_L!OcNH8JLo_yBUrJ9:W ˷pشqF3gЌ!SL1]|Ѳ+,Yzr UEDE8]ʴ'H!d,(ހdd ( d+0d139=? B"#H* %M. -R5 2T67V;CDZE\FI]JL_L!Oc`4()O?F,ջwȝ%xPbݷpm6ڵfϢK,ذbzu+׫X:j))Q,ZCDFE\I]JL_L!Oc`4()(}ѳdOޡwc9WcD6n=fGΠ12F ##^{d #]bͲN4#ԦNUI!G"M !d,(d ( d+0d139=? B"#H* %M. -R5 2T67V;ZCD\FEJI]!L_Oc`4()Ȩ#~ճE#x1RW#rb#oYc3h=BGˆ12/Fje),WVBe)Q@=d)&J0=rd)R@;drupal-7.41/misc/forum-icons.png0000644000000000000000000000334512611765734015355 0ustar rootrootPNG  IHDR"{?PLTEwww߯ۯדtP[tRNS  %***+,..001479=HKMX\ddhiimsvxxxxxxyy{}甐IDATx^EJiS -/R܊hqWP|d]b&圼o* mۨtw?8 eOձ]eyEY?s8~@t8A~ ?s$$sc=z9sv+OmKPl&w{O<3I}tj̠"p훼gM>0 yF?{;~mnxcKۏ f9w=uy޶y&(aa gef3)`0h^vZ䙠r5H$?.`qcW^(g!>3D4;xbIv |~QqDnQd&cVW-¥zUq-E!(Vl|0bv =8x0}@x$>G/L"WΫ~aE(4E|s<~rC&=7ݧls@!)<ɿ-ԓ|=Ŋ8sn aurQl Ls A$ʅ7ht{40O]j\E9մ0; ߭9ya0OHxY4қgg懕gx#(9yƣHsA9Ȍ΍q ÞBѫ/Ukp()CH.} P-XUO[O,f@x5LUH@){nz/TU"Kf'Bc< q~Z˟ߠɷ9遟u]<%>mEni/{TI?<'*Kޣ Y{ԏT\D:ˮ -U }"u߄{ӿb4(Hd2fIKua*[Aɫu\k}d/ݲį W=8VwRq >{IFE2gzLIENDB`drupal-7.41/misc/menu-collapsed-rtl.png0000644000000000000000000000015312611765734016615 0ustar rootrootPNG  IHDRŐPLTEU~tRNS@fIDATc``R`r` B| OIENDB`drupal-7.41/misc/tableselect.js0000644000000000000000000000753512611765734015240 0ustar rootroot(function ($) { Drupal.behaviors.tableSelect = { attach: function (context, settings) { // Select the inner-most table in case of nested tables. $('th.select-all', context).closest('table').once('table-select', Drupal.tableSelect); } }; Drupal.tableSelect = function () { // Do not add a "Select all" checkbox if there are no rows with checkboxes in the table if ($('td input:checkbox', this).length == 0) { return; } // Keep track of the table, which checkbox is checked and alias the settings. var table = this, checkboxes, lastChecked; var strings = { 'selectAll': Drupal.t('Select all rows in this table'), 'selectNone': Drupal.t('Deselect all rows in this table') }; var updateSelectAll = function (state) { // Update table's select-all checkbox (and sticky header's if available). $(table).prev('table.sticky-header').andSelf().find('th.select-all input:checkbox').each(function() { $(this).attr('title', state ? strings.selectNone : strings.selectAll); this.checked = state; }); }; // Find all with class select-all, and insert the check all checkbox. $('th.select-all', table).prepend($('').attr('title', strings.selectAll)).click(function (event) { if ($(event.target).is('input:checkbox')) { // Loop through all checkboxes and set their state to the select all checkbox' state. checkboxes.each(function () { this.checked = event.target.checked; // Either add or remove the selected class based on the state of the check all checkbox. $(this).closest('tr').toggleClass('selected', this.checked); }); // Update the title and the state of the check all box. updateSelectAll(event.target.checked); } }); // For each of the checkboxes within the table that are not disabled. checkboxes = $('td input:checkbox:enabled', table).click(function (e) { // Either add or remove the selected class based on the state of the check all checkbox. $(this).closest('tr').toggleClass('selected', this.checked); // If this is a shift click, we need to highlight everything in the range. // Also make sure that we are actually checking checkboxes over a range and // that a checkbox has been checked or unchecked before. if (e.shiftKey && lastChecked && lastChecked != e.target) { // We use the checkbox's parent TR to do our range searching. Drupal.tableSelectRange($(e.target).closest('tr')[0], $(lastChecked).closest('tr')[0], e.target.checked); } // If all checkboxes are checked, make sure the select-all one is checked too, otherwise keep unchecked. updateSelectAll((checkboxes.length == $(checkboxes).filter(':checked').length)); // Keep track of the last checked checkbox. lastChecked = e.target; }); // If all checkboxes are checked on page load, make sure the select-all one // is checked too, otherwise keep unchecked. updateSelectAll((checkboxes.length == $(checkboxes).filter(':checked').length)); }; Drupal.tableSelectRange = function (from, to, state) { // We determine the looping mode based on the order of from and to. var mode = from.rowIndex > to.rowIndex ? 'previousSibling' : 'nextSibling'; // Traverse through the sibling nodes. for (var i = from[mode]; i; i = i[mode]) { // Make sure that we're only dealing with elements. if (i.nodeType != 1) { continue; } // Either add or remove the selected class based on the state of the target checkbox. $(i).toggleClass('selected', state); $('input:checkbox', i).each(function () { this.checked = state; }); if (to.nodeType) { // If we are at the end of the range, stop. if (i == to) { break; } } // A faster alternative to doing $(i).filter(to).length. else if ($.filter(to, [i]).r.length) { break; } } }; })(jQuery); drupal-7.41/misc/watchdog-ok.png0000644000000000000000000000056712611765734015326 0ustar rootrootPNG  IHDRVΎW>IDAT8c``L?ߦԐ@a O\C,Q%ǐl!e0 &@]F!`CVd17@ P'Z b^R `C'E XTCDؐ+R Ċ@̆EnؐM"2lVLf,Hΐ,fF|]2@|,6Ib14?ܠ2o\U"+0xUI͒Ⓚ:'2@۟ -#PV^*]bP,kXIM3ܼK?KFXR%5xRpTIENDB`drupal-7.41/misc/menu-leaf.png0000644000000000000000000000017612611765734014764 0ustar rootrootPNG  IHDR6|JPLTEE<tRNS@fIDAT[c`cfe ( $b IENDB`drupal-7.41/misc/autocomplete.js0000644000000000000000000002033012611765734015436 0ustar rootroot(function ($) { /** * Attaches the autocomplete behavior to all required fields. */ Drupal.behaviors.autocomplete = { attach: function (context, settings) { var acdb = []; $('input.autocomplete', context).once('autocomplete', function () { var uri = this.value; if (!acdb[uri]) { acdb[uri] = new Drupal.ACDB(uri); } var $input = $('#' + this.id.substr(0, this.id.length - 13)) .attr('autocomplete', 'OFF') .attr('aria-autocomplete', 'list'); $($input[0].form).submit(Drupal.autocompleteSubmit); $input.parent() .attr('role', 'application') .append($('') .attr('id', $input.attr('id') + '-autocomplete-aria-live') ); new Drupal.jsAC($input, acdb[uri]); }); } }; /** * Prevents the form from submitting if the suggestions popup is open * and closes the suggestions popup when doing so. */ Drupal.autocompleteSubmit = function () { return $('#autocomplete').each(function () { this.owner.hidePopup(); }).length == 0; }; /** * An AutoComplete object. */ Drupal.jsAC = function ($input, db) { var ac = this; this.input = $input[0]; this.ariaLive = $('#' + this.input.id + '-autocomplete-aria-live'); this.db = db; $input .keydown(function (event) { return ac.onkeydown(this, event); }) .keyup(function (event) { ac.onkeyup(this, event); }) .blur(function () { ac.hidePopup(); ac.db.cancel(); }); }; /** * Handler for the "keydown" event. */ Drupal.jsAC.prototype.onkeydown = function (input, e) { if (!e) { e = window.event; } switch (e.keyCode) { case 40: // down arrow. this.selectDown(); return false; case 38: // up arrow. this.selectUp(); return false; default: // All other keys. return true; } }; /** * Handler for the "keyup" event. */ Drupal.jsAC.prototype.onkeyup = function (input, e) { if (!e) { e = window.event; } switch (e.keyCode) { case 16: // Shift. case 17: // Ctrl. case 18: // Alt. case 20: // Caps lock. case 33: // Page up. case 34: // Page down. case 35: // End. case 36: // Home. case 37: // Left arrow. case 38: // Up arrow. case 39: // Right arrow. case 40: // Down arrow. return true; case 9: // Tab. case 13: // Enter. case 27: // Esc. this.hidePopup(e.keyCode); return true; default: // All other keys. if (input.value.length > 0 && !input.readOnly) { this.populatePopup(); } else { this.hidePopup(e.keyCode); } return true; } }; /** * Puts the currently highlighted suggestion into the autocomplete field. */ Drupal.jsAC.prototype.select = function (node) { this.input.value = $(node).data('autocompleteValue'); $(this.input).trigger('autocompleteSelect', [node]); }; /** * Highlights the next suggestion. */ Drupal.jsAC.prototype.selectDown = function () { if (this.selected && this.selected.nextSibling) { this.highlight(this.selected.nextSibling); } else if (this.popup) { var lis = $('li', this.popup); if (lis.length > 0) { this.highlight(lis.get(0)); } } }; /** * Highlights the previous suggestion. */ Drupal.jsAC.prototype.selectUp = function () { if (this.selected && this.selected.previousSibling) { this.highlight(this.selected.previousSibling); } }; /** * Highlights a suggestion. */ Drupal.jsAC.prototype.highlight = function (node) { if (this.selected) { $(this.selected).removeClass('selected'); } $(node).addClass('selected'); this.selected = node; $(this.ariaLive).html($(this.selected).html()); }; /** * Unhighlights a suggestion. */ Drupal.jsAC.prototype.unhighlight = function (node) { $(node).removeClass('selected'); this.selected = false; $(this.ariaLive).empty(); }; /** * Hides the autocomplete suggestions. */ Drupal.jsAC.prototype.hidePopup = function (keycode) { // Select item if the right key or mousebutton was pressed. if (this.selected && ((keycode && keycode != 46 && keycode != 8 && keycode != 27) || !keycode)) { this.select(this.selected); } // Hide popup. var popup = this.popup; if (popup) { this.popup = null; $(popup).fadeOut('fast', function () { $(popup).remove(); }); } this.selected = false; $(this.ariaLive).empty(); }; /** * Positions the suggestions popup and starts a search. */ Drupal.jsAC.prototype.populatePopup = function () { var $input = $(this.input); var position = $input.position(); // Show popup. if (this.popup) { $(this.popup).remove(); } this.selected = false; this.popup = $('
        ')[0]; this.popup.owner = this; $(this.popup).css({ top: parseInt(position.top + this.input.offsetHeight, 10) + 'px', left: parseInt(position.left, 10) + 'px', width: $input.innerWidth() + 'px', display: 'none' }); $input.before(this.popup); // Do search. this.db.owner = this; this.db.search(this.input.value); }; /** * Fills the suggestion popup with any matches received. */ Drupal.jsAC.prototype.found = function (matches) { // If no value in the textfield, do not show the popup. if (!this.input.value.length) { return false; } // Prepare matches. var ul = $('
          '); var ac = this; for (key in matches) { $('
        • ') .html($('
          ').html(matches[key])) .mousedown(function () { ac.hidePopup(this); }) .mouseover(function () { ac.highlight(this); }) .mouseout(function () { ac.unhighlight(this); }) .data('autocompleteValue', key) .appendTo(ul); } // Show popup with matches, if any. if (this.popup) { if (ul.children().length) { $(this.popup).empty().append(ul).show(); $(this.ariaLive).html(Drupal.t('Autocomplete popup')); } else { $(this.popup).css({ visibility: 'hidden' }); this.hidePopup(); } } }; Drupal.jsAC.prototype.setStatus = function (status) { switch (status) { case 'begin': $(this.input).addClass('throbbing'); $(this.ariaLive).html(Drupal.t('Searching for matches...')); break; case 'cancel': case 'error': case 'found': $(this.input).removeClass('throbbing'); break; } }; /** * An AutoComplete DataBase object. */ Drupal.ACDB = function (uri) { this.uri = uri; this.delay = 300; this.cache = {}; }; /** * Performs a cached and delayed search. */ Drupal.ACDB.prototype.search = function (searchString) { var db = this; this.searchString = searchString; // See if this string needs to be searched for anyway. The pattern ../ is // stripped since it may be misinterpreted by the browser. searchString = searchString.replace(/^\s+|\.{2,}\/|\s+$/g, ''); // Skip empty search strings, or search strings ending with a comma, since // that is the separator between search terms. if (searchString.length <= 0 || searchString.charAt(searchString.length - 1) == ',') { return; } // See if this key has been searched for before. if (this.cache[searchString]) { return this.owner.found(this.cache[searchString]); } // Initiate delayed search. if (this.timer) { clearTimeout(this.timer); } this.timer = setTimeout(function () { db.owner.setStatus('begin'); // Ajax GET request for autocompletion. We use Drupal.encodePath instead of // encodeURIComponent to allow autocomplete search terms to contain slashes. $.ajax({ type: 'GET', url: db.uri + '/' + Drupal.encodePath(searchString), dataType: 'json', success: function (matches) { if (typeof matches.status == 'undefined' || matches.status != 0) { db.cache[searchString] = matches; // Verify if these are still the matches the user wants to see. if (db.searchString == searchString) { db.owner.found(matches); } db.owner.setStatus('found'); } }, error: function (xmlhttp) { alert(Drupal.ajaxError(xmlhttp, db.uri)); } }); }, this.delay); }; /** * Cancels the current autocomplete request. */ Drupal.ACDB.prototype.cancel = function () { if (this.owner) this.owner.setStatus('cancel'); if (this.timer) clearTimeout(this.timer); this.searchString = ''; }; })(jQuery); drupal-7.41/misc/print-rtl.css0000644000000000000000000000007012611765734015043 0ustar rootroot body { direction: rtl; } th { text-align: right; } drupal-7.41/misc/watchdog-error.png0000644000000000000000000000141412611765734016036 0ustar rootrootPNG  IHDRVΎWIDAT8˕KQ'Ѹo$ *Ĩ`=*nqyQ!"(BDEY4AZP -}:f0ӌ=pe X,ښayyd2LMM̿hccl0x?:j4ڊ.p zoaWOpWWjTT຤>GFFxpJhۋ{z[YR\B\|G=lssn |z=npU\|\!':"pV--56"PG,(@xMGDT@GGJ%'olLlnN2w/e2$%FeYIn/A&^BB׋lšƋO(>?T*ct4)+|^P jOB=~;4Kfgd49Y1-u̴<AЎ 4TR΂VL*h4vMDZLIIH mH}_vjŷjnIENDB`drupal-7.41/misc/feed.png0000644000000000000000000000122012611765734014005 0ustar rootrootPNG  IHDR(-SVPLTE]r)^*a+n/e,o/p0q0j-uEt0x1p6v1n.y1y2{2|Gt.|2}2t/3`x/3y1445U~956}15I2526c34LdAd455Bfg6gs7h7D8PiÙԾ9Diu9AERț׿9F^jÏΧӳ:R^w„ٵڵ/gZtRNSAVAIDATW%λN0sq;DL0<**CI[hS;vӏ"E̊ƷE ힹ Ul=@aF#@ѲBV*N14miDgk8K:mL oeu5acq×y;g)[zY|-yqtͿ;;1OBzu[ۏ5 !B:8!#+*]>\l[۞NJ*ZA859{FFC*>n7</JD|h TZ}pVM0vZhv_?QZR_Q㘰\,d̫^'y#@ӄ,d8͡1$t. XےU66 6AQ퀛u#VRAE16̩Cǰ]l9+; \= " 1 f2g&@7=3Uvm*bL9ī`J`EKJh{c>rrl)I3eye@P(22giӖϲ>DR ͒Q9  TL1LW2My-:Jw׷"'#h{rB @S2 4DbG R~ *EY=>2Gg]&IENDB`drupal-7.41/misc/message-24-info.png0000644000000000000000000000176312611765734015716 0ustar rootrootPNG  IHDRw=IDATx͖]L[e݌&f^of7Jzsʇcb2EvmQ` cle-J:"SD110@='=KwtE'%Oq@@5ȉ1:`~. M΁i!ch>ֽߐzoGQ;1š)䛽n B^ܖ(rJH(kA$.!< Y.7>ʃEl&mZH$bEST!y*+eىp`発i~D$ 1iXEq(*׸Fd2@x*Q/. |SPږTi| e(L8whQ 鯒Ĥml {{P[cֱٺ MLm#$0P5bkvݹgL\Ɔ$1mSE7ZďɁ2пY#jjgrt;+5:Aidyi۽p]^Y{$C6g] g=., TdJkAk|y-o{%/VX{aQk7;KbW>D3 qIENDB`drupal-7.41/misc/vertical-tabs.css0000644000000000000000000000401112611765734015647 0ustar rootroot div.vertical-tabs { margin: 1em 0 1em 15em; /* LTR */ border: 1px solid #ccc; position: relative; /* IE6/7 */ } .vertical-tabs ul.vertical-tabs-list { width: 15em; list-style: none; list-style-image: none; /* IE6 */ border-top: 1px solid #ccc; padding: 0; position: relative; /* IE6 */ margin: -1px 0 -1px -15em; /* LTR */ float: left; /* LTR */ } .vertical-tabs fieldset.vertical-tabs-pane { margin: 0 !important; padding: 0 1em; border: 0; } fieldset.vertical-tabs-pane legend { display: none; } fieldset.vertical-tabs-pane fieldset legend { display: block; } /* Layout of each tab */ .vertical-tabs ul.vertical-tabs-list li { background: #eee; border: 1px solid #ccc; border-top: 0; padding: 0; margin: 0; min-width: 0; /* IE7 */ } .vertical-tabs ul.vertical-tabs-list li a { display: block; text-decoration: none; padding: 0.5em 0.6em; } .vertical-tabs ul.vertical-tabs-list li a:focus strong, .vertical-tabs ul.vertical-tabs-list li a:active strong, .vertical-tabs ul.vertical-tabs-list li a:hover strong { text-decoration: underline; } .vertical-tabs ul.vertical-tabs-list li a:hover { outline: 1px dotted; } .vertical-tabs ul.vertical-tabs-list li.selected { background-color: #fff; border-right-width: 0; /* LTR */ } .vertical-tabs ul.vertical-tabs-list .selected strong { color: #000; } .vertical-tabs ul.vertical-tabs-list .summary { display: block; } .vertical-tabs ul.vertical-tabs ul.vertical-tabs-list .summary { line-height: normal; margin-bottom: 0; } /** * Prevent text inputs from overflowing when container is too narrow. "width" is * applied to override hardcoded cols or size attributes and used in conjunction * with "box-sizing" to prevent box model issues from occurring in most browsers. */ .vertical-tabs .form-type-textfield input { width: 100%; -moz-box-sizing: border-box; -webkit-box-sizing: border-box; box-sizing: border-box; } * html .vertical-tabs .form-type-textfield, * html .vertical-tabs .form-textarea-wrapper { width: 95%; /* IE6 */ } drupal-7.41/misc/powered-blue-88x31.png0000644000000000000000000000373112611765734016276 0ustar rootrootPNG  IHDRXTPLTEY}%+*2\)9$2+@Ep| a1n25T%iK(D9]5msfxI:~",~*$~$Dj,#yL9,Vm!sT3+22l,c +lBk*^|8pf Vx\|I$H<$Zz"fC9t-~z!nb|; hu7DSKTBk dd1xNϰL˯?liBxX#3KC ]v&z5@epRj-vKA$hEcntBr1gDvXvGxTqxl;+j;3qCH`4TkZPFa]wkTtU c3z]T<;_ :Xu'_,g:qWl<`#>oU Cen'VrIq-pCw-Jh sVu8d Ls9VEu旘PGJz.WpoM\_chc[XSRIDATx^SL/۶m[Ƕm۶mm۶m_Lfս*WO\?qp۵`?O7>򗑗/t}jO5k[ϟiKgC5] Ͽ+&da|U45'mګmA'8MHdA>$K"Ѐx[HZ47 y|BH }#.+jB@00;C.`ZdԐ5Д =k`𓽞~&?N]-ްa҅%wPZ٧Ȳ N+xwuRxk(zZoKor%7޻E(dl0Cyl9nc PR4a^v1 n7'9"FLh;o  ))Ԋ厫YUҪ^bpAtݢ.+zrTe * 0tͤZpQo+1y& B{?-?,BB0";`W!:=Pz-唖6 Mq$?1ު1X Y6&=&Ld=1NL ELݛg {i 9~7}4zTWIDATx^c+[ᬎm{l6m۶k۶m۶mTݵvw0'3_O}3סC;-}~LǎeFNAI?~o_>Sڍ8x˯^[-=, SY15~X>~a<0:Q[wA` ~vx2J |\.pQؐ#D(|$M1".nDX fqaD @5i#C-~fH18bonC҆8pх2^w-Q3٫SX_!81q@$w$|*E-j8.9m?Z?dYk{YNT]\NAK8:kR밹se*F(v"|]^vn%ì._.M/ _[ohrS`&QZ;WCY7P+02EW@WWq\-`{ң: _$CT\q5jVRfV92 jʕ&"j*hPϘ t ].sȭஂ(xV2;5vf,9EqTvwA"&LEv*wY$"K;}l΅}9@ xPn"୉RUh#lF}>3MiBKɁ̄'d(z N|3PMWpZ,Bf(}-Nry\ fb308Pn]GEY ψdMÆ Mr7>84.º%~$Bk008#QsxJqo}2rOOW=bE0O,ym¥"^X[f-@fյarlTZ!m3d`0B@ؤT*1JVB0MIBs- }ΓYiLTiCxqפ \5ηEٮp/N$#F\끱~ov!A[T TRgCiGZ%>ˡpSU蛖%$A^Dk_B]p2 -5tqS>T= u3v/0Wrq|NxFg۟ -z]\Cc)h/ 5 EYZ׶< ܝH\-Eb'[jAR~(zFC E\ٍ# "A3,{zJL<,J7ۛPۯ"!8XI1;DT˙ J=,L_qkw Mb*Pm Zz$Pc@<AR$!oVn$E$ɬ $OYBS5OS=T`R8nh^"mlk)RRĬ> ֙%=zn'P *630U "Aٙgg@c!0ǣ,[ mw(aR][liG])3HjB&GQbdycPw+}G[rKA^b V-bEȭ30'J>ؒ[gI euEޱ7e7#sHc_^0!tf UΉX; r@? ^8/.\9E'%&{˗.,3iZ)%gWןr|rc:99eΩm.w['.='y{_F/(IENDB`drupal-7.41/misc/message-24-warning.png0000644000000000000000000000136112611765734016422 0ustar rootrootPNG  IHDRw=IDATHc?-1I:gOnvΧ 2'zopFU l%J> AefvQ͂S77KymYp*LVo(܂ZiԠ؂rk77I vAD7ZߠȂjk\kO.Ī/gZ޿IMuxQ($.+x@eaaao706UչI*M= ^ʋHQۄg<'ɂ|Т4)&`hJ_IiFonnG2mGz EVo6O' ?jY  _i"hAvާİ&#0ibUf'Tgkbu=Y$b r _&PiAZηEv|y0b7ghtb, yJQ, e` Rym NsIcG) $My& cékkpUb@?c"1㋸[)Iu܂=4* Tcqh8'^)LT$TD eWIENDB`drupal-7.41/misc/machine-name.js0000644000000000000000000001177212611765734015271 0ustar rootroot(function ($) { /** * Attach the machine-readable name form element behavior. */ Drupal.behaviors.machineName = { /** * Attaches the behavior. * * @param settings.machineName * A list of elements to process, keyed by the HTML ID of the form element * containing the human-readable value. Each element is an object defining * the following properties: * - target: The HTML ID of the machine name form element. * - suffix: The HTML ID of a container to show the machine name preview in * (usually a field suffix after the human-readable name form element). * - label: The label to show for the machine name preview. * - replace_pattern: A regular expression (without modifiers) matching * disallowed characters in the machine name; e.g., '[^a-z0-9]+'. * - replace: A character to replace disallowed characters with; e.g., '_' * or '-'. * - standalone: Whether the preview should stay in its own element rather * than the suffix of the source element. * - field_prefix: The #field_prefix of the form element. * - field_suffix: The #field_suffix of the form element. */ attach: function (context, settings) { var self = this; $.each(settings.machineName, function (source_id, options) { var $source = $(source_id, context).addClass('machine-name-source'); var $target = $(options.target, context).addClass('machine-name-target'); var $suffix = $(options.suffix, context); var $wrapper = $target.closest('.form-item'); // All elements have to exist. if (!$source.length || !$target.length || !$suffix.length || !$wrapper.length) { return; } // Skip processing upon a form validation error on the machine name. if ($target.hasClass('error')) { return; } // Figure out the maximum length for the machine name. options.maxlength = $target.attr('maxlength'); // Hide the form item container of the machine name form element. $wrapper.hide(); // Determine the initial machine name value. Unless the machine name form // element is disabled or not empty, the initial default value is based on // the human-readable form element value. if ($target.is(':disabled') || $target.val() != '') { var machine = $target.val(); } else { var machine = self.transliterate($source.val(), options); } // Append the machine name preview to the source field. var $preview = $('' + options.field_prefix + Drupal.checkPlain(machine) + options.field_suffix + ''); $suffix.empty(); if (options.label) { $suffix.append(' ').append('' + options.label + ':'); } $suffix.append(' ').append($preview); // If the machine name cannot be edited, stop further processing. if ($target.is(':disabled')) { return; } // If it is editable, append an edit link. var $link = $('' + Drupal.t('Edit') + '') .click(function () { $wrapper.show(); $target.focus(); $suffix.hide(); $source.unbind('.machineName'); return false; }); $suffix.append(' ').append($link); // Preview the machine name in realtime when the human-readable name // changes, but only if there is no machine name yet; i.e., only upon // initial creation, not when editing. if ($target.val() == '') { $source.bind('keyup.machineName change.machineName input.machineName', function () { machine = self.transliterate($(this).val(), options); // Set the machine name to the transliterated value. if (machine != '') { if (machine != options.replace) { $target.val(machine); $preview.html(options.field_prefix + Drupal.checkPlain(machine) + options.field_suffix); } $suffix.show(); } else { $suffix.hide(); $target.val(machine); $preview.empty(); } }); // Initialize machine name preview. $source.keyup(); } }); }, /** * Transliterate a human-readable name to a machine name. * * @param source * A string to transliterate. * @param settings * The machine name settings for the corresponding field, containing: * - replace_pattern: A regular expression (without modifiers) matching * disallowed characters in the machine name; e.g., '[^a-z0-9]+'. * - replace: A character to replace disallowed characters with; e.g., '_' * or '-'. * - maxlength: The maximum length of the machine name. * * @return * The transliterated source string. */ transliterate: function (source, settings) { var rx = new RegExp(settings.replace_pattern, 'g'); return source.toLowerCase().replace(rx, settings.replace).substr(0, settings.maxlength); } }; })(jQuery); drupal-7.41/misc/vertical-tabs-rtl.css0000644000000000000000000000041112611765734016446 0ustar rootroot div.vertical-tabs { margin-left: 0; margin-right: 15em; } .vertical-tabs ul.vertical-tabs-list { margin-left: 0; margin-right: -15em; float: right; } .vertical-tabs ul.vertical-tabs-list li.selected { border-left-width: 0; border-right-width: 1px; } drupal-7.41/misc/powered-gray-80x15.png0000644000000000000000000000127212611765734016301 0ustar rootrootPNG  IHDRPDPLTEZ{{{ssskkkccc眜k!k)sνRZ{)ZkkZB{ZRJk!s!{!sssks{9J!k){1sZckbIDATx^@@᳼0]d(33#u'$RUd'xZfu^_C? jZC/')[LB<6,[%f_֝p҂ f >) P7Yx6#qy%a ݌\( -Q25(,g㋋HvKЃ"D2BAm4C``S:ۄPGC}08I$3}(B~gdc#d`WV{ ,2@5QmEUUfPu497@S޹Kg ŘIiyH&:q8ԺDS@0:Z+#BS⽏~>@DNFir>˼ۑSyo:[8IENDB`drupal-7.41/misc/farbtastic/0000755000000000000000000000000012611765734014523 5ustar rootrootdrupal-7.41/misc/farbtastic/farbtastic.css0000644000000000000000000000110012611765734017347 0ustar rootroot .farbtastic { position: relative; } .farbtastic * { position: absolute; cursor: crosshair; } .farbtastic, .farbtastic .wheel { width: 195px; height: 195px; } .farbtastic .color, .farbtastic .overlay { top: 47px; left: 47px; width: 101px; height: 101px; } .farbtastic .wheel { background: url(wheel.png) no-repeat; width: 195px; height: 195px; } .farbtastic .overlay { background: url(mask.png) no-repeat; } .farbtastic .marker { width: 17px; height: 17px; margin: -8px 0 0 -8px; overflow: hidden; background: url(marker.png) no-repeat; } drupal-7.41/misc/farbtastic/wheel.png0000644000000000000000000002650512611765734016345 0ustar rootrootPNG  IHDR?- IDATx^m]u}_!1+V@lQlu&bJPNN[A*`eE*%(D*DQVS׿i̜k~3Zg9'{?'{kI'~wޙz.mٚL[ܗdU*kT<M@#1z 'RO; mg j]u2[-[cfd[Ča9&b  KADʢ CX}ȲļLa3"[Fq/%Q[`p& ~CW9Nx]٦/zN)JvVLNbh_%e'_ HiB̖,mydvˤ)Dvr>l{)CUE 3e<ڔWx +2[壒G%0NK:t#-D"@q\F\ aVQDAmj몼2U'&ZeJ}Q6h RFe?zjݔq9#/nfHd QQ72bPMJYdk჆t\=kdxf|(~@:T'@*>7L5:T87sa]d|dg>tbҤ4@rn(`(hSp_a:zFd?> ]GAJ Q>!&h5S6v慖sdٹ3xGH_ڃD0 >C`]kjSXX~$e(Binjd.yQ7@@v6h_$@n ύ)+R4yV^<@~q'O_hOˆ*jY9yt ڤ&gVhnP>F<_*"N2K>>$@R7H2bj| q'`Ї2C;y7`7a>v6pKX\JS1O2 }.A+ɼ Od X#bq=a#Tʓ /0dK?<ٶJi~F)Yf]>oD'CC[hH6hi-$j>*qqSz1r$/^%9/ܼĄ#I> ƛ]9?Fl S#iM-Z h1~Zc9סK¡¾vTKsY}ʕG![1'%mxIׅ+W].ܕ9b/Q9LX(&A~BDd{g wfIG"ZZ%1}W(\t-%c01~( ̅485z- Um:C:81J/|gK~]]j[?ldZ㙼#GjlS"N嶑/%%C9^D2=@=)jҽ X{~8緞_13$'?)-v\yxeg5r)5QSH_b9<|kr#¾pe M+Vbʐ-"N!Z] Rs["]A,shgYG]k;G% %!1M,\osh[7˙:´߉dU!֟FK]׻Je*sBy(I^;a-&ZB!,C! #K ǻ;ֺJ8IB4<ɞjÛ /!F*ckTЫu50|Ib֪pP 0o9@83?ݱU boџYY# 8D'@^C|tbx7 O"qޫrdP! ~i{ ,g_(W ?Dv#u5ue.ԔI!T3#g̒!eg{&0# t5w3Ngb%*%I!l%|ƃ~7drbq-CronFw#VB 8*3?9ras0(/GQ\wFwȋdgRef{2jRNƷv8rozSz~#qiF(P Vj=5.xTy]uwp\) YfYKI0G?gxh5r[U^--,έ$NibQ#BnM ʽEt5]m*Jjڎ(90WaՔJy%EVS2KsZRN Ք%%̑DA,Us+*{lnH2dy'N!d-AIҰhrε6"" ^'fGH.U٭؈ń8SB:x+є@RX6՚X}b3ab8u.Ph HmMZmP *D>R?JnBL45DPj$iBIMkAx&"VއO/ t@\?%^%s‚*]3XH4^Vw9}Lr5·'5p6(LVN]&emJJ$U49|Ixo/H i}nTAk(a&1ˁ?]axII TB!L¹{+I: Ji}S}p3a+:P*`½|TFQ] y~RN HۄQzɀ4X_'NBh奔S| L\ByƁZ45Pt4E"v=k2cP,폶_!lT`2W,[ |5%Q?/ab+0(ڙU@Rd`v~yWRZkYVS-sy\+t`}~nhS0. g *LCœ)^NRv6i+Ec>*DamȁEϋ° [5J|锚[A2 +MFaf ` Œ@ rѬuЏ!~hiJ (p7;Io+__*n9=BՇGI_3<Jٝ# @ #h@4U2A8zJyHaw\un6yX+P}{"n럏}"GX` (WH;'X Eep\nY)/Kr_ ?.^vpy[$)lV cv[ Q`|$\ Xs7Ji늁Htp~46*D[46Ղa\ytTPz0~VMNyɧ[3ʯ"l4PXOX' FAQ9 4^ r/[ݿ`7z ~,*$ ӐiM6D[ҜK#p ,$c|h1ZZJχD`Jx ^mm9#QC#0O eUws^2=J&IF b@Nl[eC % A*{VE12wU{DBT>+X0lFX+< HlLwoy?X}8LȔDv|qkF X %"%6 NizN _ @ U}SbEHLad?њ]/R\\.Uk4RUo>8P):IsD@ F)zh|Fڱpl yH`Gɨ:[aW74k6+uR&Ȯs L3 oa, ʤm,y!w 뼼}2k0]2ʝgߪ_HkcK~V hD;Ek[ ǔ_GNA,1 `xDxEApJ&w>08Y94SX(2@\P_} ۀٱ" 갲2 7E"_2YѼktw~w![u0>'th1LJM1COE]j)7+VV^^ 7mjo4ZZe@% x6n|S4wzm?'WJ Cn|)s+. uʟƗÎ <';A2);Jq *`{gGY%yA~|ĶPC( ~ed7qWCIdU , 7AmR5Y`Coj[Ji}Mɜ3}%w~f&ik9;c|]XWZMcCm2@Ε^X4S ++`d) ոdiI`>A"W%U $>A66.׀U:`p)ΈP`glJ㔡G%Yy()HU '3z֥@_rKᥱI%(:7QI03 .D lPl62cv,GeSN^o`JCGHC{t7ƈ3TY@[Z C @GeFDIU&I=3/>l"k8G~3qcgkuIp"r VIGI*H?]ޗƿT`KsT4AeC#S`'0%=E#^ XeP*1 ߹+2gC* L@j9`e뫿)2#K#,$e/2>* tn7~zҔ1̌FS}{Glx'V[2d +!4Pwagӝgec_oeh FoP|7;fjJ葄#F"CC(\^bLĘe(s3>^iU޵$r"P2Kb=6˰_3/?*лE:gє!iFd (ٕNB+Fd_!6>2@=-C4$fϰdJk5i3G"IZ3$% *  `"m3Bp sWyb4y-?ƎP-Y2 -K# l Q3.tϰ&8Il2`B`x**W8d2! NђaW3_̑,Bct, 6q43D&3t!=Bpdd*XV@V l ?VXI./adIBbum{{V3Ig# ,3/HAed*XRAm18 t<6x7}d pZz~tl5eS'm|8{I&pR˔^0D)`C]_3I& ƫL$1`Zx+ Iցˆd2k# ĕ!mϻ_aKȗS> 'o2L&ye<`P"PYܗ0`T2!h-<x{lXfvD0p7#|TpBbo @oqe "JHdj`'C}Rjx Rg^hw3Y0_ _76[0>@^c]t!5|"N `deL a/<:k!lg 2d2gj8>eB/&w 8+'CLSC"E*1 k5"fҡ*jbrL/ְ6b.6_ ܉CK]5;)2 +DG5Lz)*z %#Xu/w=2<OEh^u P2P^ e`o-(z!pc u_u .*a=Ga)G Z ~ x0Qk \r\.'#K¼C$5F5RM¿cpn!FC6wi J|9×\(BsV(W+,]B{j9|d).KP:+ަIU=j:2`$°F#0HjISJ,v!Yʛ@Bd4o^fI  o#)i̥{sY-G;XBHdM#+L"\aWIPNXƀ9QN'# `m( 6z[=O̓\Ka8 ;gx=l&7 J%:HR naD zTsӲ*cI@Lp+ke(oA9$=uӃބ`f9_-DAe Ksh]`بz쿋 5l"QP3z nރ*;wsBnB(M"*i*H*dJ[haB-3-"JaJR(* :r@$ !IL'9g'9MwuZy>@DddzK@쭼R&! Ȱ|yL@ ̖S)B Y~R}_&]z"/!D#h/I׈%CFHR ;C\w}aؤG>%ByPT:vsR}[Ⱥ@ϫg󩖨Or &طWC=)I0, D~jbߺDMWAELrdT=7T8M2+_fiOMGKZ˦ MXQ1V=N=ɄHOrw9%_Xm#KٴJk/lB*_og? ylo=,\)IoM&Y 7e8\@ LQ ä/2Qm?i%GTEfoc~Ԝ ~Xa#/ʤ/&&ihz@xIQ3jFELQZ8$G[=IZ(h!  q; 4~J}F_=jU4`7Nө} b*,6 Jkx19e_76 4Dm%IH&Ig득Z= S} aCoҜ/}vfGdsXIHW٢$IZW%.jELɶ2IrjH#9<@aGLWx$}Ru*T,$S$tZ}os꯹fH)꧟Ŀ%.ơ~2r咨˥X ~ ٌO0YrBt6;TWRHP8Nc̭oز@R?!s炲2`Lǁ]QXbj}8,BGP=p ĭ'9ә-:݇ϛQL'gۙj'yYd('Ġ=uDqb4<HKUL|P'[ΩsV}[* .u LG(QNk:'b P3Vx278Fap#;mGDɡo>ڏ<%%[vڼXm$ [G.}H iq q;Гa{MU;o?#qݭKϋГaKDxwf_hݚv4kcH 4aqgz2HrUbD ۘ(?v:e TaWz2ӕqdDˑ-eDWk-q5b7D\pE͑|^8V6:W t:# ^_FNHL#6n.r9BETV'ڶ>b툱t7s" z2})EA&9*ǝ'F2tGNcƻ_.=v) _EO 'JJQ!E= )%(\(nf2QKw y*{*џ%*bV^F05:eW1SL*_\gyWۦ: ^%.ļ Y'C1𜜯tic6GtSy9 Y5=z 7pnsG.Lp
          ');var k=e(".farbtastic",f);a.wheel=e(".wheel",f).get(0);a.radius=84;a.square=100;a.width=194;navigator.appVersion.match(/MSIE [0-6]\./)&& e("*",k).each(function(){if(this.currentStyle.backgroundImage!="none"){var b=this.currentStyle.backgroundImage;b=this.currentStyle.backgroundImage.substring(5,b.length-2);e(this).css({backgroundImage:"none",filter:"progid:DXImageTransform.Microsoft.AlphaImageLoader(enabled=true, sizingMethod=crop, src='"+b+"')"})}});a.linkTo=function(b){typeof a.callback=="object"&&e(a.callback).unbind("keyup",a.updateValue);a.color=null;if(typeof b=="function")a.callback=b;else if(typeof b=="object"||typeof b=="string"){a.callback= e(b);a.callback.bind("keyup",a.updateValue);a.callback.get(0).value&&a.setColor(a.callback.get(0).value)}return this};a.updateValue=function(){this.value&&this.value!=a.color&&a.setColor(this.value)};a.setColor=function(b){var c=a.unpack(b);if(a.color!=b&&c){a.color=b;a.rgb=c;a.hsl=a.RGBToHSL(a.rgb);a.updateDisplay()}return this};a.setHSL=function(b){a.hsl=b;a.rgb=a.HSLToRGB(b);a.color=a.pack(a.rgb);a.updateDisplay();return this};a.widgetCoords=function(b){var c=e(a.wheel).offset();return{x:b.pageX- c.left-a.width/2,y:b.pageY-c.top-a.width/2}};a.mousedown=function(b){if(!document.dragging){e(document).bind("mousemove",a.mousemove).bind("mouseup",a.mouseup);document.dragging=true}var c=a.widgetCoords(b);a.circleDrag=Math.max(Math.abs(c.x),Math.abs(c.y))*2>a.square;a.mousemove(b);return false};a.mousemove=function(b){var c=a.widgetCoords(b);if(a.circleDrag){b=Math.atan2(c.x,-c.y)/6.28;if(b<0)b+=1;a.setHSL([b,a.hsl[1],a.hsl[2]])}else{b=Math.max(0,Math.min(1,-(c.x/a.square)+0.5));c=Math.max(0,Math.min(1, -(c.y/a.square)+0.5));a.setHSL([a.hsl[0],b,c])}return false};a.mouseup=function(){e(document).unbind("mousemove",a.mousemove);e(document).unbind("mouseup",a.mouseup);document.dragging=false};a.updateDisplay=function(){var b=a.hsl[0]*6.28;e(".h-marker",k).css({left:Math.round(Math.sin(b)*a.radius+a.width/2)+"px",top:Math.round(-Math.cos(b)*a.radius+a.width/2)+"px"});e(".sl-marker",k).css({left:Math.round(a.square*(0.5-a.hsl[1])+a.width/2)+"px",top:Math.round(a.square*(0.5-a.hsl[2])+a.width/2)+"px"}); e(".color",k).css("backgroundColor",a.pack(a.HSLToRGB([a.hsl[0],1,0.5])));if(typeof a.callback=="object"){e(a.callback).css({backgroundColor:a.color,color:a.hsl[2]>0.5?"#000":"#fff"});e(a.callback).each(function(){if(this.value&&this.value!=a.color)this.value=a.color})}else typeof a.callback=="function"&&a.callback.call(a,a.color)};a.pack=function(b){var c=Math.round(b[0]*255),d=Math.round(b[1]*255);b=Math.round(b[2]*255);return"#"+(c<16?"0":"")+c.toString(16)+(d<16?"0":"")+d.toString(16)+(b<16?"0": "")+b.toString(16)};a.unpack=function(b){if(b.length==7)return[parseInt("0x"+b.substring(1,3))/255,parseInt("0x"+b.substring(3,5))/255,parseInt("0x"+b.substring(5,7))/255];else if(b.length==4)return[parseInt("0x"+b.substring(1,2))/15,parseInt("0x"+b.substring(2,3))/15,parseInt("0x"+b.substring(3,4))/15]};a.HSLToRGB=function(b){var c,d=b[0];c=b[1];b=b[2];c=b<=0.5?b*(c+1):b+c-b*c;b=b*2-c;return[this.hueToRGB(b,c,d+0.33333),this.hueToRGB(b,c,d),this.hueToRGB(b,c,d-0.33333)]};a.hueToRGB=function(b,c, d){d=d<0?d+1:d>1?d-1:d;if(d*6<1)return b+(c-b)*d*6;if(d*2<1)return c;if(d*3<2)return b+(c-b)*(0.66666-d)*6;return b};a.RGBToHSL=function(b){var c,d,m,g,h=b[0],i=b[1],j=b[2];c=Math.min(h,Math.min(i,j));b=Math.max(h,Math.max(i,j));d=b-c;g=(c+b)/2;m=0;if(g>0&&g<1)m=d/(g<0.5?2*g:2-2*g);c=0;if(d>0){if(b==h&&b!=i)c+=(i-j)/d;if(b==i&&b!=j)c+=2+(j-h)/d;if(b==j&&b!=h)c+=4+(h-i)/d;c/=6}return[c,m,g]};e("*",k).mousedown(a.mousedown);a.setColor("#000000");l&&a.linkTo(l)}})(jQuery); drupal-7.41/misc/farbtastic/mask.png0000644000000000000000000000372112611765734016167 0ustar rootrootPNG  IHDReeT|-IDATx]R: l d8TQ7[7;}^c)qRj/4_Dw+\F]hztG;J:\F>vp cnd`±sVsɵǁD$h'=]as'BfOWdLeds(L׊GWHBרVFa ]W6Ev&xM,8O1};Bc JvY_#eTW ʴd>*Q<ZL̛q)'5Y|=iWOYXѵ؋I0G QW5ذD8F֊c(X%KIFu]ڲxZ&[Qp&NxCꚲyI%&JH#YtŖ˪'@zU%zI V%9 :'_2˂*%C',"# /a×gYVh˴d*,ߐ: YD}A8H#zr1*kwѰ%% ~T ) C cUҰJaq|#~!{hi~gxLdt#+{| ~#:̣)-QUU8VVː&A#;U=Pz241:9N\* AB#Q1q'Ò'y!'Q0_5S{NvGgWyH!'c.'Sq s2MsclV + a0N&?)o Z6`9Y٨9x*@ʎ "0~‰aPO,)(ZƮ̔ r1˛ՒC?&š#坨l9QuꬬkRS*+p)7g&P;3GH vVy htT(vme0w.xRp)V}iin S-1{'w<}m!`q| U#SS VhxA}˺Ҝ&N d7Q碝+Rޓ!k  ?=H¡URnDqq $cPAdbqP,(4"T?&;H@P(0{^^Gtg/O^1FR P%.c|B=0&7F!^6viBҚT%);QX*']OA;V|MKBN)yS)/i&—\ThBHơi4En Jݣ\^DF A، 'D wYjS!?sQJwM1} _K\~$bVr7zJjۊ3|zJb(2`J DW]ǀȮ#|]Dkg #h $X!lkgR" fWUUy?#z a!' Xi0}vegTkc>Q /2Rd^yJE<zJe+O<"|Tڲh ~LfA `w8*|])a@߱ڧn0;>K}9se5[IENDB`drupal-7.41/misc/farbtastic/marker.png0000644000000000000000000000066512611765734016521 0ustar rootrootPNG  IHDRdq pHYs."."ݒ+tEXtCreation Timevr 14 jul 2006 13:31:23 +0100Cg0IDAT(+qzzB$Vf$RppM.njR;-4r$nB]W&=OOp]DIg~#L"QJLqyf568Fskئ>;mIJ|ahִdV4/Lo ^Yrrriiimmm}}}ŽruuuyyydddR]_dX~tc@˥慅 `8}mazۉZip\hZV&j2QgFt-;,joع`= X%qbbb4$ImGsBD"W`9oY`\k#b UIDATx^U00.3/33333kMv}#e 7^_zXEeTK(+JC[U )"ٵ=NtWj h/8aI$'ؖEAp5q:li~M!Ni ɰtiOG'`sR5G/3M Y@ M&wvA3m 2 }G4)Cc rv"Nlz0َ޾{X´N0mR| uGÃDK% ,*t4}bc eM WST6ck2~u?|6e*Ez U"KYY!rX)]kGD!Ћ/F0eq9; }k,Sy.xѲ|$)%{0O  7A.i<'R_,UJCOs_ߋb0.HcSH'S!}Ƀ4B)0i]t!ÐG`#齮b0ݻnڰhǀ`&~_,׳DCS;d=P\+ !#ҳq= M \vsMNwY_ ,ǻ}b%\\eQsk"DJIj2Nh01\n>tK:n|mY &%s nL&R5iԞNp#D k̻4Fz v1{5GkȼܩR=}0qT5QCs k;<5]2H'F~_L\Vv146 0) { this.maxDepth = tableSettings[group][n].limit; } } } if (this.indentEnabled) { this.indentCount = 1; // Total width of indents, set in makeDraggable. // Find the width of indentations to measure mouse movements against. // Because the table doesn't need to start with any indentations, we // manually append 2 indentations in the first draggable row, measure // the offset, then remove. var indent = Drupal.theme('tableDragIndentation'); var testRow = $('').addClass('draggable').appendTo(table); var testCell = $('').appendTo(testRow).prepend(indent).prepend(indent); this.indentAmount = $('.indentation', testCell).get(1).offsetLeft - $('.indentation', testCell).get(0).offsetLeft; testRow.remove(); } // Make each applicable row draggable. // Match immediate children of the parent element to allow nesting. $('> tr.draggable, > tbody > tr.draggable', table).each(function () { self.makeDraggable(this); }); // Add a link before the table for users to show or hide weight columns. $(table).before($('') .attr('title', Drupal.t('Re-order rows by numerical weight instead of dragging.')) .click(function () { if ($.cookie('Drupal.tableDrag.showWeight') == 1) { self.hideColumns(); } else { self.showColumns(); } return false; }) .wrap('
          ') .parent() ); // Initialize the specified columns (for example, weight or parent columns) // to show or hide according to user preference. This aids accessibility // so that, e.g., screen reader users can choose to enter weight values and // manipulate form elements directly, rather than using drag-and-drop.. self.initColumns(); // Add mouse bindings to the document. The self variable is passed along // as event handlers do not have direct access to the tableDrag object. $(document).bind('mousemove', function (event) { return self.dragRow(event, self); }); $(document).bind('mouseup', function (event) { return self.dropRow(event, self); }); }; /** * Initialize columns containing form elements to be hidden by default, * according to the settings for this tableDrag instance. * * Identify and mark each cell with a CSS class so we can easily toggle * show/hide it. Finally, hide columns if user does not have a * 'Drupal.tableDrag.showWeight' cookie. */ Drupal.tableDrag.prototype.initColumns = function () { for (var group in this.tableSettings) { // Find the first field in this group. for (var d in this.tableSettings[group]) { var field = $('.' + this.tableSettings[group][d].target + ':first', this.table); if (field.length && this.tableSettings[group][d].hidden) { var hidden = this.tableSettings[group][d].hidden; var cell = field.closest('td'); break; } } // Mark the column containing this field so it can be hidden. if (hidden && cell[0]) { // Add 1 to our indexes. The nth-child selector is 1 based, not 0 based. // Match immediate children of the parent element to allow nesting. var columnIndex = $('> td', cell.parent()).index(cell.get(0)) + 1; $('> thead > tr, > tbody > tr, > tr', this.table).each(function () { // Get the columnIndex and adjust for any colspans in this row. var index = columnIndex; var cells = $(this).children(); cells.each(function (n) { if (n < index && this.colSpan && this.colSpan > 1) { index -= this.colSpan - 1; } }); if (index > 0) { cell = cells.filter(':nth-child(' + index + ')'); if (cell[0].colSpan && cell[0].colSpan > 1) { // If this cell has a colspan, mark it so we can reduce the colspan. cell.addClass('tabledrag-has-colspan'); } else { // Mark this cell so we can hide it. cell.addClass('tabledrag-hide'); } } }); } } // Now hide cells and reduce colspans unless cookie indicates previous choice. // Set a cookie if it is not already present. if ($.cookie('Drupal.tableDrag.showWeight') === null) { $.cookie('Drupal.tableDrag.showWeight', 0, { path: Drupal.settings.basePath, // The cookie expires in one year. expires: 365 }); this.hideColumns(); } // Check cookie value and show/hide weight columns accordingly. else { if ($.cookie('Drupal.tableDrag.showWeight') == 1) { this.showColumns(); } else { this.hideColumns(); } } }; /** * Hide the columns containing weight/parent form elements. * Undo showColumns(). */ Drupal.tableDrag.prototype.hideColumns = function () { // Hide weight/parent cells and headers. $('.tabledrag-hide', 'table.tabledrag-processed').css('display', 'none'); // Show TableDrag handles. $('.tabledrag-handle', 'table.tabledrag-processed').css('display', ''); // Reduce the colspan of any effected multi-span columns. $('.tabledrag-has-colspan', 'table.tabledrag-processed').each(function () { this.colSpan = this.colSpan - 1; }); // Change link text. $('.tabledrag-toggle-weight').text(Drupal.t('Show row weights')); // Change cookie. $.cookie('Drupal.tableDrag.showWeight', 0, { path: Drupal.settings.basePath, // The cookie expires in one year. expires: 365 }); // Trigger an event to allow other scripts to react to this display change. $('table.tabledrag-processed').trigger('columnschange', 'hide'); }; /** * Show the columns containing weight/parent form elements * Undo hideColumns(). */ Drupal.tableDrag.prototype.showColumns = function () { // Show weight/parent cells and headers. $('.tabledrag-hide', 'table.tabledrag-processed').css('display', ''); // Hide TableDrag handles. $('.tabledrag-handle', 'table.tabledrag-processed').css('display', 'none'); // Increase the colspan for any columns where it was previously reduced. $('.tabledrag-has-colspan', 'table.tabledrag-processed').each(function () { this.colSpan = this.colSpan + 1; }); // Change link text. $('.tabledrag-toggle-weight').text(Drupal.t('Hide row weights')); // Change cookie. $.cookie('Drupal.tableDrag.showWeight', 1, { path: Drupal.settings.basePath, // The cookie expires in one year. expires: 365 }); // Trigger an event to allow other scripts to react to this display change. $('table.tabledrag-processed').trigger('columnschange', 'show'); }; /** * Find the target used within a particular row and group. */ Drupal.tableDrag.prototype.rowSettings = function (group, row) { var field = $('.' + group, row); for (var delta in this.tableSettings[group]) { var targetClass = this.tableSettings[group][delta].target; if (field.is('.' + targetClass)) { // Return a copy of the row settings. var rowSettings = {}; for (var n in this.tableSettings[group][delta]) { rowSettings[n] = this.tableSettings[group][delta][n]; } return rowSettings; } } }; /** * Take an item and add event handlers to make it become draggable. */ Drupal.tableDrag.prototype.makeDraggable = function (item) { var self = this; // Create the handle. var handle = $('
           
          ').attr('title', Drupal.t('Drag to re-order')); // Insert the handle after indentations (if any). if ($('td:first .indentation:last', item).length) { $('td:first .indentation:last', item).after(handle); // Update the total width of indentation in this entire table. self.indentCount = Math.max($('.indentation', item).length, self.indentCount); } else { $('td:first', item).prepend(handle); } // Add hover action for the handle. handle.hover(function () { self.dragObject == null ? $(this).addClass('tabledrag-handle-hover') : null; }, function () { self.dragObject == null ? $(this).removeClass('tabledrag-handle-hover') : null; }); // Add the mousedown action for the handle. handle.mousedown(function (event) { // Create a new dragObject recording the event information. self.dragObject = {}; self.dragObject.initMouseOffset = self.getMouseOffset(item, event); self.dragObject.initMouseCoords = self.mouseCoords(event); if (self.indentEnabled) { self.dragObject.indentMousePos = self.dragObject.initMouseCoords; } // If there's a lingering row object from the keyboard, remove its focus. if (self.rowObject) { $('a.tabledrag-handle', self.rowObject.element).blur(); } // Create a new rowObject for manipulation of this row. self.rowObject = new self.row(item, 'mouse', self.indentEnabled, self.maxDepth, true); // Save the position of the table. self.table.topY = $(self.table).offset().top; self.table.bottomY = self.table.topY + self.table.offsetHeight; // Add classes to the handle and row. $(this).addClass('tabledrag-handle-hover'); $(item).addClass('drag'); // Set the document to use the move cursor during drag. $('body').addClass('drag'); if (self.oldRowElement) { $(self.oldRowElement).removeClass('drag-previous'); } // Hack for IE6 that flickers uncontrollably if select lists are moved. if (navigator.userAgent.indexOf('MSIE 6.') != -1) { $('select', this.table).css('display', 'none'); } // Hack for Konqueror, prevent the blur handler from firing. // Konqueror always gives links focus, even after returning false on mousedown. self.safeBlur = false; // Call optional placeholder function. self.onDrag(); return false; }); // Prevent the anchor tag from jumping us to the top of the page. handle.click(function () { return false; }); // Similar to the hover event, add a class when the handle is focused. handle.focus(function () { $(this).addClass('tabledrag-handle-hover'); self.safeBlur = true; }); // Remove the handle class on blur and fire the same function as a mouseup. handle.blur(function (event) { $(this).removeClass('tabledrag-handle-hover'); if (self.rowObject && self.safeBlur) { self.dropRow(event, self); } }); // Add arrow-key support to the handle. handle.keydown(function (event) { // If a rowObject doesn't yet exist and this isn't the tab key. if (event.keyCode != 9 && !self.rowObject) { self.rowObject = new self.row(item, 'keyboard', self.indentEnabled, self.maxDepth, true); } var keyChange = false; switch (event.keyCode) { case 37: // Left arrow. case 63234: // Safari left arrow. keyChange = true; self.rowObject.indent(-1 * self.rtl); break; case 38: // Up arrow. case 63232: // Safari up arrow. var previousRow = $(self.rowObject.element).prev('tr').get(0); while (previousRow && $(previousRow).is(':hidden')) { previousRow = $(previousRow).prev('tr').get(0); } if (previousRow) { self.safeBlur = false; // Do not allow the onBlur cleanup. self.rowObject.direction = 'up'; keyChange = true; if ($(item).is('.tabledrag-root')) { // Swap with the previous top-level row. var groupHeight = 0; while (previousRow && $('.indentation', previousRow).length) { previousRow = $(previousRow).prev('tr').get(0); groupHeight += $(previousRow).is(':hidden') ? 0 : previousRow.offsetHeight; } if (previousRow) { self.rowObject.swap('before', previousRow); // No need to check for indentation, 0 is the only valid one. window.scrollBy(0, -groupHeight); } } else if (self.table.tBodies[0].rows[0] != previousRow || $(previousRow).is('.draggable')) { // Swap with the previous row (unless previous row is the first one // and undraggable). self.rowObject.swap('before', previousRow); self.rowObject.interval = null; self.rowObject.indent(0); window.scrollBy(0, -parseInt(item.offsetHeight, 10)); } handle.get(0).focus(); // Regain focus after the DOM manipulation. } break; case 39: // Right arrow. case 63235: // Safari right arrow. keyChange = true; self.rowObject.indent(1 * self.rtl); break; case 40: // Down arrow. case 63233: // Safari down arrow. var nextRow = $(self.rowObject.group).filter(':last').next('tr').get(0); while (nextRow && $(nextRow).is(':hidden')) { nextRow = $(nextRow).next('tr').get(0); } if (nextRow) { self.safeBlur = false; // Do not allow the onBlur cleanup. self.rowObject.direction = 'down'; keyChange = true; if ($(item).is('.tabledrag-root')) { // Swap with the next group (necessarily a top-level one). var groupHeight = 0; var nextGroup = new self.row(nextRow, 'keyboard', self.indentEnabled, self.maxDepth, false); if (nextGroup) { $(nextGroup.group).each(function () { groupHeight += $(this).is(':hidden') ? 0 : this.offsetHeight; }); var nextGroupRow = $(nextGroup.group).filter(':last').get(0); self.rowObject.swap('after', nextGroupRow); // No need to check for indentation, 0 is the only valid one. window.scrollBy(0, parseInt(groupHeight, 10)); } } else { // Swap with the next row. self.rowObject.swap('after', nextRow); self.rowObject.interval = null; self.rowObject.indent(0); window.scrollBy(0, parseInt(item.offsetHeight, 10)); } handle.get(0).focus(); // Regain focus after the DOM manipulation. } break; } if (self.rowObject && self.rowObject.changed == true) { $(item).addClass('drag'); if (self.oldRowElement) { $(self.oldRowElement).removeClass('drag-previous'); } self.oldRowElement = item; self.restripeTable(); self.onDrag(); } // Returning false if we have an arrow key to prevent scrolling. if (keyChange) { return false; } }); // Compatibility addition, return false on keypress to prevent unwanted scrolling. // IE and Safari will suppress scrolling on keydown, but all other browsers // need to return false on keypress. http://www.quirksmode.org/js/keys.html handle.keypress(function (event) { switch (event.keyCode) { case 37: // Left arrow. case 38: // Up arrow. case 39: // Right arrow. case 40: // Down arrow. return false; } }); }; /** * Mousemove event handler, bound to document. */ Drupal.tableDrag.prototype.dragRow = function (event, self) { if (self.dragObject) { self.currentMouseCoords = self.mouseCoords(event); var y = self.currentMouseCoords.y - self.dragObject.initMouseOffset.y; var x = self.currentMouseCoords.x - self.dragObject.initMouseOffset.x; // Check for row swapping and vertical scrolling. if (y != self.oldY) { self.rowObject.direction = y > self.oldY ? 'down' : 'up'; self.oldY = y; // Update the old value. // Check if the window should be scrolled (and how fast). var scrollAmount = self.checkScroll(self.currentMouseCoords.y); // Stop any current scrolling. clearInterval(self.scrollInterval); // Continue scrolling if the mouse has moved in the scroll direction. if (scrollAmount > 0 && self.rowObject.direction == 'down' || scrollAmount < 0 && self.rowObject.direction == 'up') { self.setScroll(scrollAmount); } // If we have a valid target, perform the swap and restripe the table. var currentRow = self.findDropTargetRow(x, y); if (currentRow) { if (self.rowObject.direction == 'down') { self.rowObject.swap('after', currentRow, self); } else { self.rowObject.swap('before', currentRow, self); } self.restripeTable(); } } // Similar to row swapping, handle indentations. if (self.indentEnabled) { var xDiff = self.currentMouseCoords.x - self.dragObject.indentMousePos.x; // Set the number of indentations the mouse has been moved left or right. var indentDiff = Math.round(xDiff / self.indentAmount); // Indent the row with our estimated diff, which may be further // restricted according to the rows around this row. var indentChange = self.rowObject.indent(indentDiff); // Update table and mouse indentations. self.dragObject.indentMousePos.x += self.indentAmount * indentChange * self.rtl; self.indentCount = Math.max(self.indentCount, self.rowObject.indents); } return false; } }; /** * Mouseup event handler, bound to document. * Blur event handler, bound to drag handle for keyboard support. */ Drupal.tableDrag.prototype.dropRow = function (event, self) { // Drop row functionality shared between mouseup and blur events. if (self.rowObject != null) { var droppedRow = self.rowObject.element; // The row is already in the right place so we just release it. if (self.rowObject.changed == true) { // Update the fields in the dropped row. self.updateFields(droppedRow); // If a setting exists for affecting the entire group, update all the // fields in the entire dragged group. for (var group in self.tableSettings) { var rowSettings = self.rowSettings(group, droppedRow); if (rowSettings.relationship == 'group') { for (var n in self.rowObject.children) { self.updateField(self.rowObject.children[n], group); } } } self.rowObject.markChanged(); if (self.changed == false) { $(Drupal.theme('tableDragChangedWarning')).insertBefore(self.table).hide().fadeIn('slow'); self.changed = true; } } if (self.indentEnabled) { self.rowObject.removeIndentClasses(); } if (self.oldRowElement) { $(self.oldRowElement).removeClass('drag-previous'); } $(droppedRow).removeClass('drag').addClass('drag-previous'); self.oldRowElement = droppedRow; self.onDrop(); self.rowObject = null; } // Functionality specific only to mouseup event. if (self.dragObject != null) { $('.tabledrag-handle', droppedRow).removeClass('tabledrag-handle-hover'); self.dragObject = null; $('body').removeClass('drag'); clearInterval(self.scrollInterval); // Hack for IE6 that flickers uncontrollably if select lists are moved. if (navigator.userAgent.indexOf('MSIE 6.') != -1) { $('select', this.table).css('display', 'block'); } } }; /** * Get the mouse coordinates from the event (allowing for browser differences). */ Drupal.tableDrag.prototype.mouseCoords = function (event) { if (event.pageX || event.pageY) { return { x: event.pageX, y: event.pageY }; } return { x: event.clientX + document.body.scrollLeft - document.body.clientLeft, y: event.clientY + document.body.scrollTop - document.body.clientTop }; }; /** * Given a target element and a mouse event, get the mouse offset from that * element. To do this we need the element's position and the mouse position. */ Drupal.tableDrag.prototype.getMouseOffset = function (target, event) { var docPos = $(target).offset(); var mousePos = this.mouseCoords(event); return { x: mousePos.x - docPos.left, y: mousePos.y - docPos.top }; }; /** * Find the row the mouse is currently over. This row is then taken and swapped * with the one being dragged. * * @param x * The x coordinate of the mouse on the page (not the screen). * @param y * The y coordinate of the mouse on the page (not the screen). */ Drupal.tableDrag.prototype.findDropTargetRow = function (x, y) { var rows = $(this.table.tBodies[0].rows).not(':hidden'); for (var n = 0; n < rows.length; n++) { var row = rows[n]; var indentDiff = 0; var rowY = $(row).offset().top; // Because Safari does not report offsetHeight on table rows, but does on // table cells, grab the firstChild of the row and use that instead. // http://jacob.peargrove.com/blog/2006/technical/table-row-offsettop-bug-in-safari. if (row.offsetHeight == 0) { var rowHeight = parseInt(row.firstChild.offsetHeight, 10) / 2; } // Other browsers. else { var rowHeight = parseInt(row.offsetHeight, 10) / 2; } // Because we always insert before, we need to offset the height a bit. if ((y > (rowY - rowHeight)) && (y < (rowY + rowHeight))) { if (this.indentEnabled) { // Check that this row is not a child of the row being dragged. for (var n in this.rowObject.group) { if (this.rowObject.group[n] == row) { return null; } } } else { // Do not allow a row to be swapped with itself. if (row == this.rowObject.element) { return null; } } // Check that swapping with this row is allowed. if (!this.rowObject.isValidSwap(row)) { return null; } // We may have found the row the mouse just passed over, but it doesn't // take into account hidden rows. Skip backwards until we find a draggable // row. while ($(row).is(':hidden') && $(row).prev('tr').is(':hidden')) { row = $(row).prev('tr').get(0); } return row; } } return null; }; /** * After the row is dropped, update the table fields according to the settings * set for this table. * * @param changedRow * DOM object for the row that was just dropped. */ Drupal.tableDrag.prototype.updateFields = function (changedRow) { for (var group in this.tableSettings) { // Each group may have a different setting for relationship, so we find // the source rows for each separately. this.updateField(changedRow, group); } }; /** * After the row is dropped, update a single table field according to specific * settings. * * @param changedRow * DOM object for the row that was just dropped. * @param group * The settings group on which field updates will occur. */ Drupal.tableDrag.prototype.updateField = function (changedRow, group) { var rowSettings = this.rowSettings(group, changedRow); // Set the row as its own target. if (rowSettings.relationship == 'self' || rowSettings.relationship == 'group') { var sourceRow = changedRow; } // Siblings are easy, check previous and next rows. else if (rowSettings.relationship == 'sibling') { var previousRow = $(changedRow).prev('tr').get(0); var nextRow = $(changedRow).next('tr').get(0); var sourceRow = changedRow; if ($(previousRow).is('.draggable') && $('.' + group, previousRow).length) { if (this.indentEnabled) { if ($('.indentations', previousRow).length == $('.indentations', changedRow)) { sourceRow = previousRow; } } else { sourceRow = previousRow; } } else if ($(nextRow).is('.draggable') && $('.' + group, nextRow).length) { if (this.indentEnabled) { if ($('.indentations', nextRow).length == $('.indentations', changedRow)) { sourceRow = nextRow; } } else { sourceRow = nextRow; } } } // Parents, look up the tree until we find a field not in this group. // Go up as many parents as indentations in the changed row. else if (rowSettings.relationship == 'parent') { var previousRow = $(changedRow).prev('tr'); while (previousRow.length && $('.indentation', previousRow).length >= this.rowObject.indents) { previousRow = previousRow.prev('tr'); } // If we found a row. if (previousRow.length) { sourceRow = previousRow[0]; } // Otherwise we went all the way to the left of the table without finding // a parent, meaning this item has been placed at the root level. else { // Use the first row in the table as source, because it's guaranteed to // be at the root level. Find the first item, then compare this row // against it as a sibling. sourceRow = $(this.table).find('tr.draggable:first').get(0); if (sourceRow == this.rowObject.element) { sourceRow = $(this.rowObject.group[this.rowObject.group.length - 1]).next('tr.draggable').get(0); } var useSibling = true; } } // Because we may have moved the row from one category to another, // take a look at our sibling and borrow its sources and targets. this.copyDragClasses(sourceRow, changedRow, group); rowSettings = this.rowSettings(group, changedRow); // In the case that we're looking for a parent, but the row is at the top // of the tree, copy our sibling's values. if (useSibling) { rowSettings.relationship = 'sibling'; rowSettings.source = rowSettings.target; } var targetClass = '.' + rowSettings.target; var targetElement = $(targetClass, changedRow).get(0); // Check if a target element exists in this row. if (targetElement) { var sourceClass = '.' + rowSettings.source; var sourceElement = $(sourceClass, sourceRow).get(0); switch (rowSettings.action) { case 'depth': // Get the depth of the target row. targetElement.value = $('.indentation', $(sourceElement).closest('tr')).length; break; case 'match': // Update the value. targetElement.value = sourceElement.value; break; case 'order': var siblings = this.rowObject.findSiblings(rowSettings); if ($(targetElement).is('select')) { // Get a list of acceptable values. var values = []; $('option', targetElement).each(function () { values.push(this.value); }); var maxVal = values[values.length - 1]; // Populate the values in the siblings. $(targetClass, siblings).each(function () { // If there are more items than possible values, assign the maximum value to the row. if (values.length > 0) { this.value = values.shift(); } else { this.value = maxVal; } }); } else { // Assume a numeric input field. var weight = parseInt($(targetClass, siblings[0]).val(), 10) || 0; $(targetClass, siblings).each(function () { this.value = weight; weight++; }); } break; } } }; /** * Copy all special tableDrag classes from one row's form elements to a * different one, removing any special classes that the destination row * may have had. */ Drupal.tableDrag.prototype.copyDragClasses = function (sourceRow, targetRow, group) { var sourceElement = $('.' + group, sourceRow); var targetElement = $('.' + group, targetRow); if (sourceElement.length && targetElement.length) { targetElement[0].className = sourceElement[0].className; } }; Drupal.tableDrag.prototype.checkScroll = function (cursorY) { var de = document.documentElement; var b = document.body; var windowHeight = this.windowHeight = window.innerHeight || (de.clientHeight && de.clientWidth != 0 ? de.clientHeight : b.offsetHeight); var scrollY = this.scrollY = (document.all ? (!de.scrollTop ? b.scrollTop : de.scrollTop) : (window.pageYOffset ? window.pageYOffset : window.scrollY)); var trigger = this.scrollSettings.trigger; var delta = 0; // Return a scroll speed relative to the edge of the screen. if (cursorY - scrollY > windowHeight - trigger) { delta = trigger / (windowHeight + scrollY - cursorY); delta = (delta > 0 && delta < trigger) ? delta : trigger; return delta * this.scrollSettings.amount; } else if (cursorY - scrollY < trigger) { delta = trigger / (cursorY - scrollY); delta = (delta > 0 && delta < trigger) ? delta : trigger; return -delta * this.scrollSettings.amount; } }; Drupal.tableDrag.prototype.setScroll = function (scrollAmount) { var self = this; this.scrollInterval = setInterval(function () { // Update the scroll values stored in the object. self.checkScroll(self.currentMouseCoords.y); var aboveTable = self.scrollY > self.table.topY; var belowTable = self.scrollY + self.windowHeight < self.table.bottomY; if (scrollAmount > 0 && belowTable || scrollAmount < 0 && aboveTable) { window.scrollBy(0, scrollAmount); } }, this.scrollSettings.interval); }; Drupal.tableDrag.prototype.restripeTable = function () { // :even and :odd are reversed because jQuery counts from 0 and // we count from 1, so we're out of sync. // Match immediate children of the parent element to allow nesting. $('> tbody > tr.draggable:visible, > tr.draggable:visible', this.table) .removeClass('odd even') .filter(':odd').addClass('even').end() .filter(':even').addClass('odd'); }; /** * Stub function. Allows a custom handler when a row begins dragging. */ Drupal.tableDrag.prototype.onDrag = function () { return null; }; /** * Stub function. Allows a custom handler when a row is dropped. */ Drupal.tableDrag.prototype.onDrop = function () { return null; }; /** * Constructor to make a new object to manipulate a table row. * * @param tableRow * The DOM element for the table row we will be manipulating. * @param method * The method in which this row is being moved. Either 'keyboard' or 'mouse'. * @param indentEnabled * Whether the containing table uses indentations. Used for optimizations. * @param maxDepth * The maximum amount of indentations this row may contain. * @param addClasses * Whether we want to add classes to this row to indicate child relationships. */ Drupal.tableDrag.prototype.row = function (tableRow, method, indentEnabled, maxDepth, addClasses) { this.element = tableRow; this.method = method; this.group = [tableRow]; this.groupDepth = $('.indentation', tableRow).length; this.changed = false; this.table = $(tableRow).closest('table').get(0); this.indentEnabled = indentEnabled; this.maxDepth = maxDepth; this.direction = ''; // Direction the row is being moved. if (this.indentEnabled) { this.indents = $('.indentation', tableRow).length; this.children = this.findChildren(addClasses); this.group = $.merge(this.group, this.children); // Find the depth of this entire group. for (var n = 0; n < this.group.length; n++) { this.groupDepth = Math.max($('.indentation', this.group[n]).length, this.groupDepth); } } }; /** * Find all children of rowObject by indentation. * * @param addClasses * Whether we want to add classes to this row to indicate child relationships. */ Drupal.tableDrag.prototype.row.prototype.findChildren = function (addClasses) { var parentIndentation = this.indents; var currentRow = $(this.element, this.table).next('tr.draggable'); var rows = []; var child = 0; while (currentRow.length) { var rowIndentation = $('.indentation', currentRow).length; // A greater indentation indicates this is a child. if (rowIndentation > parentIndentation) { child++; rows.push(currentRow[0]); if (addClasses) { $('.indentation', currentRow).each(function (indentNum) { if (child == 1 && (indentNum == parentIndentation)) { $(this).addClass('tree-child-first'); } if (indentNum == parentIndentation) { $(this).addClass('tree-child'); } else if (indentNum > parentIndentation) { $(this).addClass('tree-child-horizontal'); } }); } } else { break; } currentRow = currentRow.next('tr.draggable'); } if (addClasses && rows.length) { $('.indentation:nth-child(' + (parentIndentation + 1) + ')', rows[rows.length - 1]).addClass('tree-child-last'); } return rows; }; /** * Ensure that two rows are allowed to be swapped. * * @param row * DOM object for the row being considered for swapping. */ Drupal.tableDrag.prototype.row.prototype.isValidSwap = function (row) { if (this.indentEnabled) { var prevRow, nextRow; if (this.direction == 'down') { prevRow = row; nextRow = $(row).next('tr').get(0); } else { prevRow = $(row).prev('tr').get(0); nextRow = row; } this.interval = this.validIndentInterval(prevRow, nextRow); // We have an invalid swap if the valid indentations interval is empty. if (this.interval.min > this.interval.max) { return false; } } // Do not let an un-draggable first row have anything put before it. if (this.table.tBodies[0].rows[0] == row && $(row).is(':not(.draggable)')) { return false; } return true; }; /** * Perform the swap between two rows. * * @param position * Whether the swap will occur 'before' or 'after' the given row. * @param row * DOM element what will be swapped with the row group. */ Drupal.tableDrag.prototype.row.prototype.swap = function (position, row) { Drupal.detachBehaviors(this.group, Drupal.settings, 'move'); $(row)[position](this.group); Drupal.attachBehaviors(this.group, Drupal.settings); this.changed = true; this.onSwap(row); }; /** * Determine the valid indentations interval for the row at a given position * in the table. * * @param prevRow * DOM object for the row before the tested position * (or null for first position in the table). * @param nextRow * DOM object for the row after the tested position * (or null for last position in the table). */ Drupal.tableDrag.prototype.row.prototype.validIndentInterval = function (prevRow, nextRow) { var minIndent, maxIndent; // Minimum indentation: // Do not orphan the next row. minIndent = nextRow ? $('.indentation', nextRow).length : 0; // Maximum indentation: if (!prevRow || $(prevRow).is(':not(.draggable)') || $(this.element).is('.tabledrag-root')) { // Do not indent: // - the first row in the table, // - rows dragged below a non-draggable row, // - 'root' rows. maxIndent = 0; } else { // Do not go deeper than as a child of the previous row. maxIndent = $('.indentation', prevRow).length + ($(prevRow).is('.tabledrag-leaf') ? 0 : 1); // Limit by the maximum allowed depth for the table. if (this.maxDepth) { maxIndent = Math.min(maxIndent, this.maxDepth - (this.groupDepth - this.indents)); } } return { 'min': minIndent, 'max': maxIndent }; }; /** * Indent a row within the legal bounds of the table. * * @param indentDiff * The number of additional indentations proposed for the row (can be * positive or negative). This number will be adjusted to nearest valid * indentation level for the row. */ Drupal.tableDrag.prototype.row.prototype.indent = function (indentDiff) { // Determine the valid indentations interval if not available yet. if (!this.interval) { var prevRow = $(this.element).prev('tr').get(0); var nextRow = $(this.group).filter(':last').next('tr').get(0); this.interval = this.validIndentInterval(prevRow, nextRow); } // Adjust to the nearest valid indentation. var indent = this.indents + indentDiff; indent = Math.max(indent, this.interval.min); indent = Math.min(indent, this.interval.max); indentDiff = indent - this.indents; for (var n = 1; n <= Math.abs(indentDiff); n++) { // Add or remove indentations. if (indentDiff < 0) { $('.indentation:first', this.group).remove(); this.indents--; } else { $('td:first', this.group).prepend(Drupal.theme('tableDragIndentation')); this.indents++; } } if (indentDiff) { // Update indentation for this row. this.changed = true; this.groupDepth += indentDiff; this.onIndent(); } return indentDiff; }; /** * Find all siblings for a row, either according to its subgroup or indentation. * Note that the passed-in row is included in the list of siblings. * * @param settings * The field settings we're using to identify what constitutes a sibling. */ Drupal.tableDrag.prototype.row.prototype.findSiblings = function (rowSettings) { var siblings = []; var directions = ['prev', 'next']; var rowIndentation = this.indents; for (var d = 0; d < directions.length; d++) { var checkRow = $(this.element)[directions[d]](); while (checkRow.length) { // Check that the sibling contains a similar target field. if ($('.' + rowSettings.target, checkRow)) { // Either add immediately if this is a flat table, or check to ensure // that this row has the same level of indentation. if (this.indentEnabled) { var checkRowIndentation = $('.indentation', checkRow).length; } if (!(this.indentEnabled) || (checkRowIndentation == rowIndentation)) { siblings.push(checkRow[0]); } else if (checkRowIndentation < rowIndentation) { // No need to keep looking for siblings when we get to a parent. break; } } else { break; } checkRow = $(checkRow)[directions[d]](); } // Since siblings are added in reverse order for previous, reverse the // completed list of previous siblings. Add the current row and continue. if (directions[d] == 'prev') { siblings.reverse(); siblings.push(this.element); } } return siblings; }; /** * Remove indentation helper classes from the current row group. */ Drupal.tableDrag.prototype.row.prototype.removeIndentClasses = function () { for (var n in this.children) { $('.indentation', this.children[n]) .removeClass('tree-child') .removeClass('tree-child-first') .removeClass('tree-child-last') .removeClass('tree-child-horizontal'); } }; /** * Add an asterisk or other marker to the changed row. */ Drupal.tableDrag.prototype.row.prototype.markChanged = function () { var marker = Drupal.theme('tableDragChangedMarker'); var cell = $('td:first', this.element); if ($('span.tabledrag-changed', cell).length == 0) { cell.append(marker); } }; /** * Stub function. Allows a custom handler when a row is indented. */ Drupal.tableDrag.prototype.row.prototype.onIndent = function () { return null; }; /** * Stub function. Allows a custom handler when a row is swapped. */ Drupal.tableDrag.prototype.row.prototype.onSwap = function (swappedRow) { return null; }; Drupal.theme.prototype.tableDragChangedMarker = function () { return '*'; }; Drupal.theme.prototype.tableDragIndentation = function () { return '
           
          '; }; Drupal.theme.prototype.tableDragChangedWarning = function () { return '
          ' + Drupal.theme('tableDragChangedMarker') + ' ' + Drupal.t('Changes made in this table will not be saved until the form is submitted.') + '
          '; }; })(jQuery); drupal-7.41/misc/message-16-warning.png0000644000000000000000000000067212611765734016427 0ustar rootrootPNG  IHDRaIDAT8Oc?%_r@aP op|W58%ɀK<7MPl,B]UvG>~ +8>Q4k˭1^.Z]k(P h@sGN cx h4Xѯ{QT0 qPk|anrp#+2oa52[|i v^ةYd=sU,0 (N{0K_]ˇ"d͇(Td-hS@Q©`.Ci܀Xr`(\?I`n1¯tT7aIQ=l0;n)[`£4gIENDB`drupal-7.41/misc/tableheader.js0000644000000000000000000001232212611765734015177 0ustar rootroot(function ($) { /** * Attaches sticky table headers. */ Drupal.behaviors.tableHeader = { attach: function (context, settings) { if (!$.support.positionFixed) { return; } $('table.sticky-enabled', context).once('tableheader', function () { $(this).data("drupal-tableheader", new Drupal.tableHeader(this)); }); } }; /** * Constructor for the tableHeader object. Provides sticky table headers. * * @param table * DOM object for the table to add a sticky header to. */ Drupal.tableHeader = function (table) { var self = this; this.originalTable = $(table); this.originalHeader = $(table).children('thead'); this.originalHeaderCells = this.originalHeader.find('> tr > th'); this.displayWeight = null; // React to columns change to avoid making checks in the scroll callback. this.originalTable.bind('columnschange', function (e, display) { // This will force header size to be calculated on scroll. self.widthCalculated = (self.displayWeight !== null && self.displayWeight === display); self.displayWeight = display; }); // Clone the table header so it inherits original jQuery properties. Hide // the table to avoid a flash of the header clone upon page load. this.stickyTable = $('') .insertBefore(this.originalTable) .css({ position: 'fixed', top: '0px' }); this.stickyHeader = this.originalHeader.clone(true) .hide() .appendTo(this.stickyTable); this.stickyHeaderCells = this.stickyHeader.find('> tr > th'); this.originalTable.addClass('sticky-table'); $(window) .bind('scroll.drupal-tableheader', $.proxy(this, 'eventhandlerRecalculateStickyHeader')) .bind('resize.drupal-tableheader', { calculateWidth: true }, $.proxy(this, 'eventhandlerRecalculateStickyHeader')) // Make sure the anchor being scrolled into view is not hidden beneath the // sticky table header. Adjust the scrollTop if it does. .bind('drupalDisplaceAnchor.drupal-tableheader', function () { window.scrollBy(0, -self.stickyTable.outerHeight()); }) // Make sure the element being focused is not hidden beneath the sticky // table header. Adjust the scrollTop if it does. .bind('drupalDisplaceFocus.drupal-tableheader', function (event) { if (self.stickyVisible && event.clientY < (self.stickyOffsetTop + self.stickyTable.outerHeight()) && event.$target.closest('sticky-header').length === 0) { window.scrollBy(0, -self.stickyTable.outerHeight()); } }) .triggerHandler('resize.drupal-tableheader'); // We hid the header to avoid it showing up erroneously on page load; // we need to unhide it now so that it will show up when expected. this.stickyHeader.show(); }; /** * Event handler: recalculates position of the sticky table header. * * @param event * Event being triggered. */ Drupal.tableHeader.prototype.eventhandlerRecalculateStickyHeader = function (event) { var self = this; var calculateWidth = event.data && event.data.calculateWidth; // Reset top position of sticky table headers to the current top offset. this.stickyOffsetTop = Drupal.settings.tableHeaderOffset ? eval(Drupal.settings.tableHeaderOffset + '()') : 0; this.stickyTable.css('top', this.stickyOffsetTop + 'px'); // Save positioning data. var viewHeight = document.documentElement.scrollHeight || document.body.scrollHeight; if (calculateWidth || this.viewHeight !== viewHeight) { this.viewHeight = viewHeight; this.vPosition = this.originalTable.offset().top - 4 - this.stickyOffsetTop; this.hPosition = this.originalTable.offset().left; this.vLength = this.originalTable[0].clientHeight - 100; calculateWidth = true; } // Track horizontal positioning relative to the viewport and set visibility. var hScroll = document.documentElement.scrollLeft || document.body.scrollLeft; var vOffset = (document.documentElement.scrollTop || document.body.scrollTop) - this.vPosition; this.stickyVisible = vOffset > 0 && vOffset < this.vLength; this.stickyTable.css({ left: (-hScroll + this.hPosition) + 'px', visibility: this.stickyVisible ? 'visible' : 'hidden' }); // Only perform expensive calculations if the sticky header is actually // visible or when forced. if (this.stickyVisible && (calculateWidth || !this.widthCalculated)) { this.widthCalculated = true; var $that = null; var $stickyCell = null; var display = null; var cellWidth = null; // Resize header and its cell widths. // Only apply width to visible table cells. This prevents the header from // displaying incorrectly when the sticky header is no longer visible. for (var i = 0, il = this.originalHeaderCells.length; i < il; i += 1) { $that = $(this.originalHeaderCells[i]); $stickyCell = this.stickyHeaderCells.eq($that.index()); display = $that.css('display'); if (display !== 'none') { cellWidth = $that.css('width'); // Exception for IE7. if (cellWidth === 'auto') { cellWidth = $that[0].clientWidth + 'px'; } $stickyCell.css({'width': cellWidth, 'display': display}); } else { $stickyCell.css('display', 'none'); } } this.stickyTable.css('width', this.originalTable.outerWidth()); } }; })(jQuery); drupal-7.41/misc/arrow-desc.png0000644000000000000000000000016612611765734015160 0ustar rootrootPNG  IHDR H%v?PLTEkR%tRNS@fIDATc`@L L LL Li|q)IENDB`drupal-7.41/misc/collapse.js0000644000000000000000000000637312611765734014552 0ustar rootroot(function ($) { /** * Toggle the visibility of a fieldset using smooth animations. */ Drupal.toggleFieldset = function (fieldset) { var $fieldset = $(fieldset); if ($fieldset.is('.collapsed')) { var $content = $('> .fieldset-wrapper', fieldset).hide(); $fieldset .removeClass('collapsed') .trigger({ type: 'collapsed', value: false }) .find('> legend span.fieldset-legend-prefix').html(Drupal.t('Hide')); $content.slideDown({ duration: 'fast', easing: 'linear', complete: function () { Drupal.collapseScrollIntoView(fieldset); fieldset.animating = false; }, step: function () { // Scroll the fieldset into view. Drupal.collapseScrollIntoView(fieldset); } }); } else { $fieldset.trigger({ type: 'collapsed', value: true }); $('> .fieldset-wrapper', fieldset).slideUp('fast', function () { $fieldset .addClass('collapsed') .find('> legend span.fieldset-legend-prefix').html(Drupal.t('Show')); fieldset.animating = false; }); } }; /** * Scroll a given fieldset into view as much as possible. */ Drupal.collapseScrollIntoView = function (node) { var h = document.documentElement.clientHeight || document.body.clientHeight || 0; var offset = document.documentElement.scrollTop || document.body.scrollTop || 0; var posY = $(node).offset().top; var fudge = 55; if (posY + node.offsetHeight + fudge > h + offset) { if (node.offsetHeight > h) { window.scrollTo(0, posY); } else { window.scrollTo(0, posY + node.offsetHeight - h + fudge); } } }; Drupal.behaviors.collapse = { attach: function (context, settings) { $('fieldset.collapsible', context).once('collapse', function () { var $fieldset = $(this); // Expand fieldset if there are errors inside, or if it contains an // element that is targeted by the URI fragment identifier. var anchor = location.hash && location.hash != '#' ? ', ' + location.hash : ''; if ($fieldset.find('.error' + anchor).length) { $fieldset.removeClass('collapsed'); } var summary = $(''); $fieldset. bind('summaryUpdated', function () { var text = $.trim($fieldset.drupalGetSummary()); summary.html(text ? ' (' + text + ')' : ''); }) .trigger('summaryUpdated'); // Turn the legend into a clickable link, but retain span.fieldset-legend // for CSS positioning. var $legend = $('> legend .fieldset-legend', this); $('') .append($fieldset.hasClass('collapsed') ? Drupal.t('Show') : Drupal.t('Hide')) .prependTo($legend) .after(' '); // .wrapInner() does not retain bound events. var $link = $('') .prepend($legend.contents()) .appendTo($legend) .click(function () { var fieldset = $fieldset.get(0); // Don't animate multiple times. if (!fieldset.animating) { fieldset.animating = true; Drupal.toggleFieldset(fieldset); } return false; }); $legend.append(summary); }); } }; })(jQuery); drupal-7.41/misc/grippie.png0000644000000000000000000000015212611765734014544 0ustar rootrootPNG  IHDRPLTEKtRNS@fIDATcQYG1BIENDB`drupal-7.41/misc/textarea.js0000644000000000000000000000163012611765734014554 0ustar rootroot(function ($) { Drupal.behaviors.textarea = { attach: function (context, settings) { $('.form-textarea-wrapper.resizable', context).once('textarea', function () { var staticOffset = null; var textarea = $(this).addClass('resizable-textarea').find('textarea'); var grippie = $('
          ').mousedown(startDrag); grippie.insertAfter(textarea); function startDrag(e) { staticOffset = textarea.height() - e.pageY; textarea.css('opacity', 0.25); $(document).mousemove(performDrag).mouseup(endDrag); return false; } function performDrag(e) { textarea.height(Math.max(32, staticOffset + e.pageY) + 'px'); return false; } function endDrag(e) { $(document).unbind('mousemove', performDrag).unbind('mouseup', endDrag); textarea.css('opacity', 1); } }); } }; })(jQuery); drupal-7.41/misc/message-16-info.png0000644000000000000000000000133512611765734015712 0ustar rootrootPNG  IHDRaIDATxmKSaPBP zv.;RѴAT:Ew&NtHc-\y,I奝3S*_ 60o|Q8;ǯs4q(sAdv^=uX ]`3XCI{C"d[BY9G8Ut>Yc{Gvr  dW :B&w_e/ۮniro -fYۍ0ʀ&ѕB{0l@V k1ec(cT&AHƇi6S͂-ѓ|r=~{1*@?Ek6O(>W0U! YC ޭu ]r f][ u0P.N%dLP~HզQ*X&-kR3nDsc1NOJ5*jX+F娜|6@~`8kMv 3"3Cs&Lwv/cF=4,Fg!9e2;X۫Rh0j@ x)Z}.ӂt:x{a8c&EBd e1AZ4׿o8ʼ 렋P7sgn@PG(s \fBЃ4Bq9$`w˿/c{@ QWжioͲY2BB!m$(Jтg=~N3I>D!S$x~tyax}-7ηgoς_af Epd!H ߯! LNj Mp7<ǃpl2LIlo#6; a!vp˅r4 u RpNE>yHnlG.RWR B?%a<a2#=4}DrOu_ TWXTPjmA(`%xZZjKjFUtNjX'';GWXCW83p~zo$B{;rtAjX) |!uwsֆhx-=2ةQ-riIMQ(r?6{L~_ͧGIENDB`drupal-7.41/misc/print.css0000644000000000000000000000044312611765734014250 0ustar rootroot body { margin: 1em; background-color: #fff; } th { text-align: left; /* LTR */ color: #006; border-bottom: 1px solid #ccc; } tr.odd { background-color: #ddd; } tr.even { background-color: #fff; } td { padding: 5px; } #menu { visibility: hidden; } #main { margin: 1em; } drupal-7.41/misc/powered-black-135x42.png0000644000000000000000000000521312611765734016473 0ustar rootrootPNG  IHDR*PLTE,DDk99c22[**U!+T1Z>k /Z!J""K##R++[J B = 7;GGr.XEu 'TSnƅwgQ(s (V$$[@m=4{"O??r5aٚҊ˲+w3cވjU ^DO#.]\ Q/))b!] Keez̳OOY髫6uu33H))8CUUc{{pZ}''-Tr!XWWW}nI{#%d\WWvz 1c__vfX(+j See膰)a V77pZVVѶZ৩(1mPbb[[‰"(fVY`ޣ"c` YO [?Cy&(_Wz-;X#[(8v(q%q ?8} 5]$+jKNoa_U4Ȏ>;mnǀd u48XV~GPu?m_o%mG52n:TF2fv9*RLj .WܲTu>}X s)/8X)xaXu8v8SY1r3,ub |1ctLKcc찋4Gxd@P LNk~o َmyä/:%|K=Axŕ&vȁj IuX;jG{BZ㼉YmY&0C v1.b,,]Hh ҅سX;jKvZkb4mo4ZM u%(;!(̢nܸzezr ̇0t,&7b whqe҅8t99Ьk׃E!Na4X񉤕q3cQC%U˷hŖ/RѢF@'qb]'QD &@_{sV le5qY0?5uO0@`SUt(r/nDl1kft٪po Y !:R@ۦ~63ANޭC[S\j"mXUB]1k{e'롯- ^oM8TqpQ] ¡AEs@ȘϦBzyjb>$hI{  &pD}#ӫf ;,bU 6lR*֬4Zo1lWgjrZCKE>yxvgqv'NaʱOasmsｼ};Z)6ׅxSuvC1#PO{w1D) Izg)g~{iƵLO5}VƂ\Jur,ate ñZ(,`T&Þ_ЈSNSNǜs'Psda8D 糘u$O il'l%*ya U0J)qԋMFf+Q" xс@2 &`>%DBtz?נ\u%u\K$;Q|o6ۇBNmsk,`o_R 3:(C񁤗qVBcG|c ?8Pqs&#mHG8?GR3 1) { // Initial checked value of radios is undefined, so we return false. return this.filter(':checked').val() || false; } return this.val(); }, 'change': function () { // Radio buttons share the same :input[name="key"] selector. if (this.length > 1) { // Initial checked value of radios is undefined, so we return false. return this.filter(':checked').val() || false; } return this.val(); } }, collapsed: { 'collapsed': function(e) { return (typeof e !== 'undefined' && 'value' in e) ? e.value : this.is('.collapsed'); } } }; /** * A state object is used for describing the state and performing aliasing. */ states.State = function(state) { // We may need the original unresolved name later. this.pristine = this.name = state; // Normalize the state name. while (true) { // Iteratively remove exclamation marks and invert the value. while (this.name.charAt(0) == '!') { this.name = this.name.substring(1); this.invert = !this.invert; } // Replace the state with its normalized name. if (this.name in states.State.aliases) { this.name = states.State.aliases[this.name]; } else { break; } } }; /** * Creates a new State object by sanitizing the passed value. */ states.State.sanitize = function (state) { if (state instanceof states.State) { return state; } else { return new states.State(state); } }; /** * This list of aliases is used to normalize states and associates negated names * with their respective inverse state. */ states.State.aliases = { 'enabled': '!disabled', 'invisible': '!visible', 'invalid': '!valid', 'untouched': '!touched', 'optional': '!required', 'filled': '!empty', 'unchecked': '!checked', 'irrelevant': '!relevant', 'expanded': '!collapsed', 'readwrite': '!readonly' }; states.State.prototype = { invert: false, /** * Ensures that just using the state object returns the name. */ toString: function() { return this.name; } }; /** * Global state change handlers. These are bound to "document" to cover all * elements whose state changes. Events sent to elements within the page * bubble up to these handlers. We use this system so that themes and modules * can override these state change handlers for particular parts of a page. */ $(document).bind('state:disabled', function(e) { // Only act when this change was triggered by a dependency and not by the // element monitoring itself. if (e.trigger) { $(e.target) .attr('disabled', e.value) .closest('.form-item, .form-submit, .form-wrapper').toggleClass('form-disabled', e.value) .find('select, input, textarea').attr('disabled', e.value); // Note: WebKit nightlies don't reflect that change correctly. // See https://bugs.webkit.org/show_bug.cgi?id=23789 } }); $(document).bind('state:required', function(e) { if (e.trigger) { if (e.value) { var $label = $(e.target).closest('.form-item, .form-wrapper').find('label'); // Avoids duplicate required markers on initialization. if (!$label.find('.form-required').length) { $label.append('*'); } } else { $(e.target).closest('.form-item, .form-wrapper').find('label .form-required').remove(); } } }); $(document).bind('state:visible', function(e) { if (e.trigger) { $(e.target).closest('.form-item, .form-submit, .form-wrapper').toggle(e.value); } }); $(document).bind('state:checked', function(e) { if (e.trigger) { $(e.target).attr('checked', e.value); } }); $(document).bind('state:collapsed', function(e) { if (e.trigger) { if ($(e.target).is('.collapsed') !== e.value) { $('> legend a', e.target).click(); } } }); /** * These are helper functions implementing addition "operators" and don't * implement any logic that is particular to states. */ // Bitwise AND with a third undefined state. function ternary (a, b) { return typeof a === 'undefined' ? b : (typeof b === 'undefined' ? a : a && b); } // Inverts a (if it's not undefined) when invert is true. function invert (a, invert) { return (invert && typeof a !== 'undefined') ? !a : a; } // Compares two values while ignoring undefined values. function compare (a, b) { return (a === b) ? (typeof a === 'undefined' ? a : true) : (typeof a === 'undefined' || typeof b === 'undefined'); } })(jQuery); drupal-7.41/misc/message-16-help.png0000644000000000000000000000123412611765734015705 0ustar rootrootPNG  IHDRacIDATxڥKSQNj( "|;ܩY'fzkOnnZaS IP&ڋfskE0 I귻-8|8p~gm6<(%BZc];?2_r]M]%c1zP`􁩛UaiE r/օ3:PPDyL`)${ ],B٭0w c}}kxPPu.:[R}]1\l L L'&"~(An YY)AAu>ʉȯsY78_uUC vEUwkZև&nC(:0=qE$:ءa6s㐭|㰢=&d!P! J\3`K T;}9B@%(o'PYd)Aoo 3fC0Gis4D6aG@[Qi2ZSTč<(O-1 YQBlM7H{DAncҖ7XH]Bnk{QWum~+ ich`.9a[_iwtOWʫm5$k¶ qaTbnIENDB`drupal-7.41/misc/tree.png0000644000000000000000000000020212611765734014040 0ustar rootrootPNG  IHDRPQ8#ɛ PLTEU6tRNS@f'IDAT8OcX040`QQQAhTpTr 9 I"IENDB`drupal-7.41/misc/timezone.js0000644000000000000000000000477612611765734014607 0ustar rootroot(function ($) { /** * Set the client's system time zone as default values of form fields. */ Drupal.behaviors.setTimezone = { attach: function (context, settings) { $('select.timezone-detect', context).once('timezone', function () { var dateString = Date(); // In some client environments, date strings include a time zone // abbreviation, between 3 and 5 letters enclosed in parentheses, // which can be interpreted by PHP. var matches = dateString.match(/\(([A-Z]{3,5})\)/); var abbreviation = matches ? matches[1] : 0; // For all other client environments, the abbreviation is set to "0" // and the current offset from UTC and daylight saving time status are // used to guess the time zone. var dateNow = new Date(); var offsetNow = dateNow.getTimezoneOffset() * -60; // Use January 1 and July 1 as test dates for determining daylight // saving time status by comparing their offsets. var dateJan = new Date(dateNow.getFullYear(), 0, 1, 12, 0, 0, 0); var dateJul = new Date(dateNow.getFullYear(), 6, 1, 12, 0, 0, 0); var offsetJan = dateJan.getTimezoneOffset() * -60; var offsetJul = dateJul.getTimezoneOffset() * -60; var isDaylightSavingTime; // If the offset from UTC is identical on January 1 and July 1, // assume daylight saving time is not used in this time zone. if (offsetJan == offsetJul) { isDaylightSavingTime = ''; } // If the maximum annual offset is equivalent to the current offset, // assume daylight saving time is in effect. else if (Math.max(offsetJan, offsetJul) == offsetNow) { isDaylightSavingTime = 1; } // Otherwise, assume daylight saving time is not in effect. else { isDaylightSavingTime = 0; } // Submit request to the system/timezone callback and set the form field // to the response time zone. The client date is passed to the callback // for debugging purposes. Submit a synchronous request to avoid database // errors associated with concurrent requests during install. var path = 'system/timezone/' + abbreviation + '/' + offsetNow + '/' + isDaylightSavingTime; var element = this; $.ajax({ async: false, url: settings.basePath, data: { q: path, date: dateString }, dataType: 'json', success: function (data) { if (data) { $(element).val(data); } } }); }); } }; })(jQuery); drupal-7.41/misc/message-16-ok.png0000644000000000000000000000117712611765734015374 0ustar rootrootPNG  IHDRaFIDATxڥKSaǍ( K9sc?D<8v1s[8""j<ۜrg 6kV&M]+[Taԅo}>|x}:fr1݄ΤNy8 Mt; ]it_C{G :H˲ tS n¾i1?1C@6j <]ԼCC``qP*z>uzw k?tڏH1Biv TQE]p_ʀI38{׎mA|bʨ}" ^ojR ۸>w 1x:W:ѾE\^7$ L OȱrI(x-n8@f r^yL#gEphtKRp.‹1RDvK[vJMeQHV?TyP):Z~6{FvȦeB1G8N2>\E꓂ Zt1f3Y&D'O||$4ƨ"&!@2)%@][}C;wN]-``0Q9O[x>PdIENDB`drupal-7.41/misc/progress.js0000644000000000000000000000605012611765734014604 0ustar rootroot(function ($) { /** * A progressbar object. Initialized with the given id. Must be inserted into * the DOM afterwards through progressBar.element. * * method is the function which will perform the HTTP request to get the * progress bar state. Either "GET" or "POST". * * e.g. pb = new progressBar('myProgressBar'); * some_element.appendChild(pb.element); */ Drupal.progressBar = function (id, updateCallback, method, errorCallback) { var pb = this; this.id = id; this.method = method || 'GET'; this.updateCallback = updateCallback; this.errorCallback = errorCallback; // The WAI-ARIA setting aria-live="polite" will announce changes after users // have completed their current activity and not interrupt the screen reader. this.element = $('
          ').attr('id', id); this.element.html('
          ' + '
          ' + '
           
          '); }; /** * Set the percentage and status message for the progressbar. */ Drupal.progressBar.prototype.setProgress = function (percentage, message) { if (percentage >= 0 && percentage <= 100) { $('div.filled', this.element).css('width', percentage + '%'); $('div.percentage', this.element).html(percentage + '%'); } $('div.message', this.element).html(message); if (this.updateCallback) { this.updateCallback(percentage, message, this); } }; /** * Start monitoring progress via Ajax. */ Drupal.progressBar.prototype.startMonitoring = function (uri, delay) { this.delay = delay; this.uri = uri; this.sendPing(); }; /** * Stop monitoring progress via Ajax. */ Drupal.progressBar.prototype.stopMonitoring = function () { clearTimeout(this.timer); // This allows monitoring to be stopped from within the callback. this.uri = null; }; /** * Request progress data from server. */ Drupal.progressBar.prototype.sendPing = function () { if (this.timer) { clearTimeout(this.timer); } if (this.uri) { var pb = this; // When doing a post request, you need non-null data. Otherwise a // HTTP 411 or HTTP 406 (with Apache mod_security) error may result. $.ajax({ type: this.method, url: this.uri, data: '', dataType: 'json', success: function (progress) { // Display errors. if (progress.status == 0) { pb.displayError(progress.data); return; } // Update display. pb.setProgress(progress.percentage, progress.message); // Schedule next timer. pb.timer = setTimeout(function () { pb.sendPing(); }, pb.delay); }, error: function (xmlhttp) { pb.displayError(Drupal.ajaxError(xmlhttp, pb.uri)); } }); } }; /** * Display errors on the page. */ Drupal.progressBar.prototype.displayError = function (string) { var error = $('
          ').html(string); $(this.element).before(error).hide(); if (this.errorCallback) { this.errorCallback(this); } }; })(jQuery); drupal-7.41/misc/permissions.png0000644000000000000000000000036212611765734015463 0ustar rootrootPNG  IHDRaIDATxڕ D /BrM.F+ W{ʼnQJMlѽ@`#`:hxkEAIENDB`drupal-7.41/misc/help.png0000644000000000000000000000044612611765734014043 0ustar rootrootPNG  IHDRaIDATxڥ= @s#HN#"mnb2G-, B ^B2}ܝVYiP4+(kb* 1;d&ZERY-aԸ= - -5}/-a!q bcm53:9 NPq@:@bd{AD3Ag$u;ٜQy#mrlt쫛OB䃪 tIENDB`drupal-7.41/misc/jquery.once.js0000644000000000000000000000563612611765734015213 0ustar rootroot /** * jQuery Once Plugin v1.2 * http://plugins.jquery.com/project/once * * Dual licensed under the MIT and GPL licenses: * http://www.opensource.org/licenses/mit-license.php * http://www.gnu.org/licenses/gpl.html */ (function ($) { var cache = {}, uuid = 0; /** * Filters elements by whether they have not yet been processed. * * @param id * (Optional) If this is a string, then it will be used as the CSS class * name that is applied to the elements for determining whether it has * already been processed. The elements will get a class in the form of * "id-processed". * * If the id parameter is a function, it will be passed off to the fn * parameter and the id will become a unique identifier, represented as a * number. * * When the id is neither a string or a function, it becomes a unique * identifier, depicted as a number. The element's class will then be * represented in the form of "jquery-once-#-processed". * * Take note that the id must be valid for usage as an element's class name. * @param fn * (Optional) If given, this function will be called for each element that * has not yet been processed. The function's return value follows the same * logic as $.each(). Returning true will continue to the next matched * element in the set, while returning false will entirely break the * iteration. */ $.fn.once = function (id, fn) { if (typeof id != 'string') { // Generate a numeric ID if the id passed can't be used as a CSS class. if (!(id in cache)) { cache[id] = ++uuid; } // When the fn parameter is not passed, we interpret it from the id. if (!fn) { fn = id; } id = 'jquery-once-' + cache[id]; } // Remove elements from the set that have already been processed. var name = id + '-processed'; var elements = this.not('.' + name).addClass(name); return $.isFunction(fn) ? elements.each(fn) : elements; }; /** * Filters elements that have been processed once already. * * @param id * A required string representing the name of the class which should be used * when filtering the elements. This only filters elements that have already * been processed by the once function. The id should be the same id that * was originally passed to the once() function. * @param fn * (Optional) If given, this function will be called for each element that * has not yet been processed. The function's return value follows the same * logic as $.each(). Returning true will continue to the next matched * element in the set, while returning false will entirely break the * iteration. */ $.fn.removeOnce = function (id, fn) { var name = id + '-processed'; var elements = this.filter('.' + name).removeClass(name); return $.isFunction(fn) ? elements.each(fn) : elements; }; })(jQuery); drupal-7.41/misc/powered-black-80x15.png0000644000000000000000000000265012611765734016414 0ustar rootrootPNG  IHDRPDPLTE,$ahWYk&qb$m*2u)-r',p#*m #j hhfb ZD S [_ ZXSd[U)s!j!e^JimTϫڅ*6x$1t TT MQ]6|r)^J>W*;|#c [OVEJ|''\GGsootOԐ^k,9p=J}⻻;;p,r,?$7x+i(g.p2E{[[^''a,GA*C$={1q#d3Awޖ{tj-J0l (f %c#:q0hS`CU!j#oR-J)H&F$B4q2s4v2v -pTj&p$o#nz=K o\,L*K:w%Au.I{l={>>}=};|8z5x4v4w 2v .t -s$h"g*r)q&p,P)M'K!FDBA?=~:}8{8z 6y 4w/q0t.tl =,R)Q(N&M$J!H G HFEB@?= 9~ 6| 4y4z2y/x.w4z,U+U*T&P#N!LIHDB 9~8}2y>gAIDAT8Oh:M6O6W"RJѭ[;GCDhЩC!AR2""(9fsnޘ{͞mޯϧ(ί AaApؠO<:{xQI=IY!ׅ9:ZQ QGR5*C5o$ǎ'($s[:e^ǡ'ࡲvg.Y<^W$u.uJrM::W+Ͻٍ9 =/G4!k锫sʞOUq{OC{F&N6;,c3z6-T~6Ըfv;{5oTxjuvg50G]6mSi_sEWכ N o|o\hzqKqťTC{JPoTPЇ X{rdho*<|nh}릲TdƁﰗ *;"ݷܖrdgɑIM9Vogһ/nIENDB`drupal-7.41/misc/druplicon.png0000644000000000000000000000750112611765734015111 0ustar rootrootPNG  IHDRXd-IDATx] PTW}FͦĤTe2L*$:LM1jԸwA6*;"H@\AEAQDE]dߡY/{74O-}{}0t$>ʁMѵo!'w";W{]ue3? ݲ1bM)#4SD@GkQM3$V?!< c/o"BAzPd\7Bm(x=[~ ṍ,{S8Jg׉0vh# BNy=ywxN*.RǖFѱbWudd AB1ڡOG.gOҔTӌR`<o Z8H$do*[L+ZDQr?Tshq X m,0[qNT2b:BKG4.Ȋ K9rW˂1\W<.OBRާ$ ^A,% +Jj[ ()"³YĠz6ןzs5JƸA$3k= #+r*X#`w:z ۯtE a=iqF&4C\fSbѦDbx]JLՕ) O vJWR|qe˙"eŸ^ǡMm,km8^97M|ֻ|\nFE ؊6,?4Lz{CCngD4-dŻ>,={B+JZ k^-̈!]Sȏ'AiV\rPkSTOk+?["͗#J~ _)F6c'ډ7Df7/Hg_ u-])qgKb:4m/6p^XVip;?<.PYC&nf:;ž =F o9J޴=+XO$ξ xݖ9L*ЋzoJlv>6r\d0zԇ݋mizn#bI^L}T3&m9K/7u%x+NxmxP8>Ex,#M˚J/t`}lBbz,d,]"}LKQ|Gz/&YJ2`}G*=.!ڶ<>NDJ5{69a,'K&Ʉ;z!"y<L#]c_=\}B"ߗ0<73 `l^,s:AM9K "lYlr:m LDU1\+M8ZV ~SG; +[C"}قJ|f% b'\2:1ER-SАdv! %Nr"CHۑ`lkep +K`q>4AFpi Aop/z14JڀV6ćW6, 67 Dp +CAJA qn,;y O mw5> PnUăuִ-2pWۯ*Ȍ_vH$kZ4IYYq SB"luVԇ>'qM#Wz\G%%8q\v%( K\"MZM;JwkN!#Y'sCbx2n3̋g <+{E]6AAP% 0/mC ͒6*i 1эx=HNp#Z`K#3Ws8i xlR`4PUCRfz$(( Z0&vL%7\.юCKQ"BI'L4Â"Tf9vXG\oI'LDy UjH F}_O.hm8T iyevM:gx}?G>\ Pȃ//,hFZ[:P>olE&w`20˝w#v0sߩTZŬ,9D`Ły\<f z+el`Zޙ8@^$c CMӢ{tH(B^y-YLR(6L}mdEV/2zT*Y~#`qG!*V%IcqϘz+ N̡[Cdu-9 3Ngr3=9;Nr!W:.DF&g5.{A FS̜1r#2CӲl_rv Y 7=n! 4~lY¿P0(si+1G{KHr;NzMY]ye4M|}Ex\$ɱ #/ H2 GXH #3b%W <؟Ѭ GKD^Tbf!u0{E{n7툥)*)\cRgf'>S( [=`XfJDfAfj-Enà `K}tXz>v,eGZw;("dub?ԑ|ѓ}! T>>9fz(ŭ*GX3{?t2c QfܣjqDiвzq"쯃 '60EZ`ur[' zeM. >Q AJy}ǚFfIe4-d2$3>o>*[ք!Q>X3RrJ= Ёhv9ӐBf'A 6ߝWyܮ0_^ޟ0LK2$\jHAeIT?ϲٮBZ(9$eojXbfm(a-L5 4M{H'0=+p5 E3˽&H%%Ǯg {kO %oQuz7 BI!<ߎ>pO'#*'ɰxԱ@J4'B_uÿz鬖QPܤO%΍y,^W;Ǫa%Dځ83C,hMx{WɈ,/P>b&͊liD^_ann+ˋ Xu24mQȶ

          ').html(settings.batch.errorMessage)); $('#wait').hide(); }; var progress = new Drupal.progressBar('updateprogress', updateCallback, 'POST', errorCallback); progress.setProgress(-1, settings.batch.initMessage); holder.append(progress.element); progress.startMonitoring(settings.batch.uri + '&op=do', 10); }); } }; })(jQuery); drupal-7.41/misc/watchdog-warning.png0000644000000000000000000000047612611765734016361 0ustar rootrootPNG  IHDRVΎWIDAT8c`>}ؐSǼY?::?EP|s!2%z dK &U` KF0, U`<`c F0v5` 㯙C@ f`,FU CNo 3;21]vf\8]v&kΰN*k``#F0&*k;216h$ᵽX?[hnDIENDB`drupal-7.41/misc/vertical-tabs.js0000644000000000000000000001427312611765734015506 0ustar rootroot (function ($) { /** * This script transforms a set of fieldsets into a stack of vertical * tabs. Another tab pane can be selected by clicking on the respective * tab. * * Each tab may have a summary which can be updated by another * script. For that to work, each fieldset has an associated * 'verticalTabCallback' (with jQuery.data() attached to the fieldset), * which is called every time the user performs an update to a form * element inside the tab pane. */ Drupal.behaviors.verticalTabs = { attach: function (context) { $('.vertical-tabs-panes', context).once('vertical-tabs', function () { var focusID = $(':hidden.vertical-tabs-active-tab', this).val(); var tab_focus; // Check if there are some fieldsets that can be converted to vertical-tabs var $fieldsets = $('> fieldset', this); if ($fieldsets.length == 0) { return; } // Create the tab column. var tab_list = $('
            '); $(this).wrap('
            ').before(tab_list); // Transform each fieldset into a tab. $fieldsets.each(function () { var vertical_tab = new Drupal.verticalTab({ title: $('> legend', this).text(), fieldset: $(this) }); tab_list.append(vertical_tab.item); $(this) .removeClass('collapsible collapsed') .addClass('vertical-tabs-pane') .data('verticalTab', vertical_tab); if (this.id == focusID) { tab_focus = $(this); } }); $('> li:first', tab_list).addClass('first'); $('> li:last', tab_list).addClass('last'); if (!tab_focus) { // If the current URL has a fragment and one of the tabs contains an // element that matches the URL fragment, activate that tab. if (window.location.hash && $(this).find(window.location.hash).length) { tab_focus = $(this).find(window.location.hash).closest('.vertical-tabs-pane'); } else { tab_focus = $('> .vertical-tabs-pane:first', this); } } if (tab_focus.length) { tab_focus.data('verticalTab').focus(); } }); } }; /** * The vertical tab object represents a single tab within a tab group. * * @param settings * An object with the following keys: * - title: The name of the tab. * - fieldset: The jQuery object of the fieldset that is the tab pane. */ Drupal.verticalTab = function (settings) { var self = this; $.extend(this, settings, Drupal.theme('verticalTab', settings)); this.link.click(function () { self.focus(); return false; }); // Keyboard events added: // Pressing the Enter key will open the tab pane. this.link.keydown(function(event) { if (event.keyCode == 13) { self.focus(); // Set focus on the first input field of the visible fieldset/tab pane. $("fieldset.vertical-tabs-pane :input:visible:enabled:first").focus(); return false; } }); this.fieldset .bind('summaryUpdated', function () { self.updateSummary(); }) .trigger('summaryUpdated'); }; Drupal.verticalTab.prototype = { /** * Displays the tab's content pane. */ focus: function () { this.fieldset .siblings('fieldset.vertical-tabs-pane') .each(function () { var tab = $(this).data('verticalTab'); tab.fieldset.hide(); tab.item.removeClass('selected'); }) .end() .show() .siblings(':hidden.vertical-tabs-active-tab') .val(this.fieldset.attr('id')); this.item.addClass('selected'); // Mark the active tab for screen readers. $('#active-vertical-tab').remove(); this.link.append('' + Drupal.t('(active tab)') + ''); }, /** * Updates the tab's summary. */ updateSummary: function () { this.summary.html(this.fieldset.drupalGetSummary()); }, /** * Shows a vertical tab pane. */ tabShow: function () { // Display the tab. this.item.show(); // Show the vertical tabs. this.item.closest('.vertical-tabs').show(); // Update .first marker for items. We need recurse from parent to retain the // actual DOM element order as jQuery implements sortOrder, but not as public // method. this.item.parent().children('.vertical-tab-button').removeClass('first') .filter(':visible:first').addClass('first'); // Display the fieldset. this.fieldset.removeClass('vertical-tab-hidden').show(); // Focus this tab. this.focus(); return this; }, /** * Hides a vertical tab pane. */ tabHide: function () { // Hide this tab. this.item.hide(); // Update .first marker for items. We need recurse from parent to retain the // actual DOM element order as jQuery implements sortOrder, but not as public // method. this.item.parent().children('.vertical-tab-button').removeClass('first') .filter(':visible:first').addClass('first'); // Hide the fieldset. this.fieldset.addClass('vertical-tab-hidden').hide(); // Focus the first visible tab (if there is one). var $firstTab = this.fieldset.siblings('.vertical-tabs-pane:not(.vertical-tab-hidden):first'); if ($firstTab.length) { $firstTab.data('verticalTab').focus(); } // Hide the vertical tabs (if no tabs remain). else { this.item.closest('.vertical-tabs').hide(); } return this; } }; /** * Theme function for a vertical tab. * * @param settings * An object with the following keys: * - title: The name of the tab. * @return * This function has to return an object with at least these keys: * - item: The root tab jQuery element * - link: The anchor tag that acts as the clickable area of the tab * (jQuery version) * - summary: The jQuery element that contains the tab summary */ Drupal.theme.prototype.verticalTab = function (settings) { var tab = {}; tab.item = $('
          • ') .append(tab.link = $('') .append(tab.title = $('').text(settings.title)) .append(tab.summary = $('') ) ); return tab; }; })(jQuery); drupal-7.41/misc/draggable.png0000644000000000000000000000041412611765734015016 0ustar rootrootPNG  IHDR<{-PLTErrr{{{VktRNSAHIDATxN!w*BX`B1b?B/",YIcb{?皲^% cG< g grvt^}[M>?: QJ Z NAr !?#%U%IENDB`drupal-7.41/misc/arrow-asc.png0000644000000000000000000000016612611765734015010 0ustar rootrootPNG  IHDR H%v?PLTEkR%tRNS@fIDATxc`@0`o``g`` KzHIENDB`drupal-7.41/misc/throbber.gif0000644000000000000000000000247012611765734014702 0ustar rootrootGIF89a(s {{5FZk؋ᵵｽ! NETSCAPE2.0!,( Yۨ/[4PenBQ1(+"($Q pBWS%r"ͦn> LJ'{v~  {+*  #   " "  *++ !!, G Ӓڨ"7^G!qD0*O"`p.LisJX 5rLd,3uY G+i!, ? Xc*pʭM89#: %H(UȭVa'FӘHcZV^(!, H T(P "HŨM p8ȄqJhD1rwMgta!I, !, I Ӓڨ"7^Xl~# z'&Hxjc"S9 3yzyS`pZ!, @ Xc*pPܺ.xD !*J@0J ]xJc:Q:y!, E (P "Xw"Gb"LQ%I U&&.8 CNQ!, F ڨ"7^Xl~# WP[,'rB` bC1A+!, A Xc*pPܺ.xTP#I0PǮE`ul11(0< !, I T(P "H7h @<0PS`) NBbph&QaիS3D!, H Ӓڨ"7^Xc̊W8N ՊS ,] `Uo !, A Xc*pȭA,"q#9P@#+cUV\RDVw ;drupal-7.41/misc/message-24-error.png0000644000000000000000000000133512611765734016107 0ustar rootrootPNG  IHDRw=IDATxڵMHACDŃxS977M+Dq10~}} s{z@ vv"R[XKKPK !1;Ě5%pr3M 쬬2.k:Q쑺ui q:R_H pu5ȧf3޹\y/\O#)pM %1ܭ`q1brOLtn~<_\Do__ବmmr*i SSOjU+QW>">l*NCp2p'p}sU$|j*iiZpeӗGN8pE8 OG": 9h <)HiPHIENDB`drupal-7.41/misc/drupal.js0000644000000000000000000004063512611765734014236 0ustar rootroot var Drupal = Drupal || { 'settings': {}, 'behaviors': {}, 'locale': {} }; // Allow other JavaScript libraries to use $. jQuery.noConflict(); (function ($) { /** * Override jQuery.fn.init to guard against XSS attacks. * * See http://bugs.jquery.com/ticket/9521 */ var jquery_init = $.fn.init; $.fn.init = function (selector, context, rootjQuery) { // If the string contains a "#" before a "<", treat it as invalid HTML. if (selector && typeof selector === 'string') { var hash_position = selector.indexOf('#'); if (hash_position >= 0) { var bracket_position = selector.indexOf('<'); if (bracket_position > hash_position) { throw 'Syntax error, unrecognized expression: ' + selector; } } } return jquery_init.call(this, selector, context, rootjQuery); }; $.fn.init.prototype = jquery_init.prototype; /** * Attach all registered behaviors to a page element. * * Behaviors are event-triggered actions that attach to page elements, enhancing * default non-JavaScript UIs. Behaviors are registered in the Drupal.behaviors * object using the method 'attach' and optionally also 'detach' as follows: * @code * Drupal.behaviors.behaviorName = { * attach: function (context, settings) { * ... * }, * detach: function (context, settings, trigger) { * ... * } * }; * @endcode * * Drupal.attachBehaviors is added below to the jQuery ready event and so * runs on initial page load. Developers implementing AHAH/Ajax in their * solutions should also call this function after new page content has been * loaded, feeding in an element to be processed, in order to attach all * behaviors to the new content. * * Behaviors should use * @code * $(selector).once('behavior-name', function () { * ... * }); * @endcode * to ensure the behavior is attached only once to a given element. (Doing so * enables the reprocessing of given elements, which may be needed on occasion * despite the ability to limit behavior attachment to a particular element.) * * @param context * An element to attach behaviors to. If none is given, the document element * is used. * @param settings * An object containing settings for the current context. If none given, the * global Drupal.settings object is used. */ Drupal.attachBehaviors = function (context, settings) { context = context || document; settings = settings || Drupal.settings; // Execute all of them. $.each(Drupal.behaviors, function () { if ($.isFunction(this.attach)) { this.attach(context, settings); } }); }; /** * Detach registered behaviors from a page element. * * Developers implementing AHAH/Ajax in their solutions should call this * function before page content is about to be removed, feeding in an element * to be processed, in order to allow special behaviors to detach from the * content. * * Such implementations should look for the class name that was added in their * corresponding Drupal.behaviors.behaviorName.attach implementation, i.e. * behaviorName-processed, to ensure the behavior is detached only from * previously processed elements. * * @param context * An element to detach behaviors from. If none is given, the document element * is used. * @param settings * An object containing settings for the current context. If none given, the * global Drupal.settings object is used. * @param trigger * A string containing what's causing the behaviors to be detached. The * possible triggers are: * - unload: (default) The context element is being removed from the DOM. * - move: The element is about to be moved within the DOM (for example, * during a tabledrag row swap). After the move is completed, * Drupal.attachBehaviors() is called, so that the behavior can undo * whatever it did in response to the move. Many behaviors won't need to * do anything simply in response to the element being moved, but because * IFRAME elements reload their "src" when being moved within the DOM, * behaviors bound to IFRAME elements (like WYSIWYG editors) may need to * take some action. * - serialize: When an Ajax form is submitted, this is called with the * form as the context. This provides every behavior within the form an * opportunity to ensure that the field elements have correct content * in them before the form is serialized. The canonical use-case is so * that WYSIWYG editors can update the hidden textarea to which they are * bound. * * @see Drupal.attachBehaviors */ Drupal.detachBehaviors = function (context, settings, trigger) { context = context || document; settings = settings || Drupal.settings; trigger = trigger || 'unload'; // Execute all of them. $.each(Drupal.behaviors, function () { if ($.isFunction(this.detach)) { this.detach(context, settings, trigger); } }); }; /** * Encode special characters in a plain-text string for display as HTML. * * @ingroup sanitization */ Drupal.checkPlain = function (str) { var character, regex, replace = { '&': '&', '"': '"', '<': '<', '>': '>' }; str = String(str); for (character in replace) { if (replace.hasOwnProperty(character)) { regex = new RegExp(character, 'g'); str = str.replace(regex, replace[character]); } } return str; }; /** * Replace placeholders with sanitized values in a string. * * @param str * A string with placeholders. * @param args * An object of replacements pairs to make. Incidences of any key in this * array are replaced with the corresponding value. Based on the first * character of the key, the value is escaped and/or themed: * - !variable: inserted as is * - @variable: escape plain text to HTML (Drupal.checkPlain) * - %variable: escape text and theme as a placeholder for user-submitted * content (checkPlain + Drupal.theme('placeholder')) * * @see Drupal.t() * @ingroup sanitization */ Drupal.formatString = function(str, args) { // Transform arguments before inserting them. for (var key in args) { switch (key.charAt(0)) { // Escaped only. case '@': args[key] = Drupal.checkPlain(args[key]); break; // Pass-through. case '!': break; // Escaped and placeholder. case '%': default: args[key] = Drupal.theme('placeholder', args[key]); break; } str = str.replace(key, args[key]); } return str; }; /** * Translate strings to the page language or a given language. * * See the documentation of the server-side t() function for further details. * * @param str * A string containing the English string to translate. * @param args * An object of replacements pairs to make after translation. Incidences * of any key in this array are replaced with the corresponding value. * See Drupal.formatString(). * * @param options * - 'context' (defaults to the empty context): The context the source string * belongs to. * * @return * The translated string. */ Drupal.t = function (str, args, options) { options = options || {}; options.context = options.context || ''; // Fetch the localized version of the string. if (Drupal.locale.strings && Drupal.locale.strings[options.context] && Drupal.locale.strings[options.context][str]) { str = Drupal.locale.strings[options.context][str]; } if (args) { str = Drupal.formatString(str, args); } return str; }; /** * Format a string containing a count of items. * * This function ensures that the string is pluralized correctly. Since Drupal.t() is * called by this function, make sure not to pass already-localized strings to it. * * See the documentation of the server-side format_plural() function for further details. * * @param count * The item count to display. * @param singular * The string for the singular case. Please make sure it is clear this is * singular, to ease translation (e.g. use "1 new comment" instead of "1 new"). * Do not use @count in the singular string. * @param plural * The string for the plural case. Please make sure it is clear this is plural, * to ease translation. Use @count in place of the item count, as in "@count * new comments". * @param args * An object of replacements pairs to make after translation. Incidences * of any key in this array are replaced with the corresponding value. * See Drupal.formatString(). * Note that you do not need to include @count in this array. * This replacement is done automatically for the plural case. * @param options * The options to pass to the Drupal.t() function. * @return * A translated string. */ Drupal.formatPlural = function (count, singular, plural, args, options) { var args = args || {}; args['@count'] = count; // Determine the index of the plural form. var index = Drupal.locale.pluralFormula ? Drupal.locale.pluralFormula(args['@count']) : ((args['@count'] == 1) ? 0 : 1); if (index == 0) { return Drupal.t(singular, args, options); } else if (index == 1) { return Drupal.t(plural, args, options); } else { args['@count[' + index + ']'] = args['@count']; delete args['@count']; return Drupal.t(plural.replace('@count', '@count[' + index + ']'), args, options); } }; /** * Returns the passed in URL as an absolute URL. * * @param url * The URL string to be normalized to an absolute URL. * * @return * The normalized, absolute URL. * * @see https://github.com/angular/angular.js/blob/v1.4.4/src/ng/urlUtils.js * @see https://grack.com/blog/2009/11/17/absolutizing-url-in-javascript * @see https://github.com/jquery/jquery-ui/blob/1.11.4/ui/tabs.js#L53 */ Drupal.absoluteUrl = function (url) { var urlParsingNode = document.createElement('a'); // Decode the URL first; this is required by IE <= 6. Decoding non-UTF-8 // strings may throw an exception. try { url = decodeURIComponent(url); } catch (e) {} urlParsingNode.setAttribute('href', url); // IE <= 7 normalizes the URL when assigned to the anchor node similar to // the other browsers. return urlParsingNode.cloneNode(false).href; }; /** * Returns true if the URL is within Drupal's base path. * * @param url * The URL string to be tested. * * @return * Boolean true if local. * * @see https://github.com/jquery/jquery-ui/blob/1.11.4/ui/tabs.js#L58 */ Drupal.urlIsLocal = function (url) { // Always use browser-derived absolute URLs in the comparison, to avoid // attempts to break out of the base path using directory traversal. var absoluteUrl = Drupal.absoluteUrl(url); var protocol = location.protocol; // Consider URLs that match this site's base URL but use HTTPS instead of HTTP // as local as well. if (protocol === 'http:' && absoluteUrl.indexOf('https:') === 0) { protocol = 'https:'; } var baseUrl = protocol + '//' + location.host + Drupal.settings.basePath.slice(0, -1); // Decoding non-UTF-8 strings may throw an exception. try { absoluteUrl = decodeURIComponent(absoluteUrl); } catch (e) {} try { baseUrl = decodeURIComponent(baseUrl); } catch (e) {} // The given URL matches the site's base URL, or has a path under the site's // base URL. return absoluteUrl === baseUrl || absoluteUrl.indexOf(baseUrl + '/') === 0; }; /** * Generate the themed representation of a Drupal object. * * All requests for themed output must go through this function. It examines * the request and routes it to the appropriate theme function. If the current * theme does not provide an override function, the generic theme function is * called. * * For example, to retrieve the HTML for text that should be emphasized and * displayed as a placeholder inside a sentence, call * Drupal.theme('placeholder', text). * * @param func * The name of the theme function to call. * @param ... * Additional arguments to pass along to the theme function. * @return * Any data the theme function returns. This could be a plain HTML string, * but also a complex object. */ Drupal.theme = function (func) { var args = Array.prototype.slice.apply(arguments, [1]); return (Drupal.theme[func] || Drupal.theme.prototype[func]).apply(this, args); }; /** * Freeze the current body height (as minimum height). Used to prevent * unnecessary upwards scrolling when doing DOM manipulations. */ Drupal.freezeHeight = function () { Drupal.unfreezeHeight(); $('
            ').css({ position: 'absolute', top: '0px', left: '0px', width: '1px', height: $('body').css('height') }).appendTo('body'); }; /** * Unfreeze the body height. */ Drupal.unfreezeHeight = function () { $('#freeze-height').remove(); }; /** * Encodes a Drupal path for use in a URL. * * For aesthetic reasons slashes are not escaped. */ Drupal.encodePath = function (item, uri) { uri = uri || location.href; return encodeURIComponent(item).replace(/%2F/g, '/'); }; /** * Get the text selection in a textarea. */ Drupal.getSelection = function (element) { if (typeof element.selectionStart != 'number' && document.selection) { // The current selection. var range1 = document.selection.createRange(); var range2 = range1.duplicate(); // Select all text. range2.moveToElementText(element); // Now move 'dummy' end point to end point of original range. range2.setEndPoint('EndToEnd', range1); // Now we can calculate start and end points. var start = range2.text.length - range1.text.length; var end = start + range1.text.length; return { 'start': start, 'end': end }; } return { 'start': element.selectionStart, 'end': element.selectionEnd }; }; /** * Build an error message from an Ajax response. */ Drupal.ajaxError = function (xmlhttp, uri, customMessage) { var statusCode, statusText, pathText, responseText, readyStateText, message; if (xmlhttp.status) { statusCode = "\n" + Drupal.t("An AJAX HTTP error occurred.") + "\n" + Drupal.t("HTTP Result Code: !status", {'!status': xmlhttp.status}); } else { statusCode = "\n" + Drupal.t("An AJAX HTTP request terminated abnormally."); } statusCode += "\n" + Drupal.t("Debugging information follows."); pathText = "\n" + Drupal.t("Path: !uri", {'!uri': uri} ); statusText = ''; // In some cases, when statusCode == 0, xmlhttp.statusText may not be defined. // Unfortunately, testing for it with typeof, etc, doesn't seem to catch that // and the test causes an exception. So we need to catch the exception here. try { statusText = "\n" + Drupal.t("StatusText: !statusText", {'!statusText': $.trim(xmlhttp.statusText)}); } catch (e) {} responseText = ''; // Again, we don't have a way to know for sure whether accessing // xmlhttp.responseText is going to throw an exception. So we'll catch it. try { responseText = "\n" + Drupal.t("ResponseText: !responseText", {'!responseText': $.trim(xmlhttp.responseText) } ); } catch (e) {} // Make the responseText more readable by stripping HTML tags and newlines. responseText = responseText.replace(/<("[^"]*"|'[^']*'|[^'">])*>/gi,""); responseText = responseText.replace(/[\n]+\s+/g,"\n"); // We don't need readyState except for status == 0. readyStateText = xmlhttp.status == 0 ? ("\n" + Drupal.t("ReadyState: !readyState", {'!readyState': xmlhttp.readyState})) : ""; // Additional message beyond what the xmlhttp object provides. customMessage = customMessage ? ("\n" + Drupal.t("CustomMessage: !customMessage", {'!customMessage': customMessage})) : ""; message = statusCode + pathText + statusText + customMessage + responseText + readyStateText; return message; }; // Class indicating that JS is enabled; used for styling purpose. $('html').addClass('js'); // 'js enabled' cookie. document.cookie = 'has_js=1; path=/'; /** * Additions to jQuery.support. */ $(function () { /** * Boolean indicating whether or not position:fixed is supported. */ if (jQuery.support.positionFixed === undefined) { var el = $('
            ').appendTo(document.body); jQuery.support.positionFixed = el[0].offsetTop === 10; el.remove(); } }); //Attach all behaviors. $(function () { Drupal.attachBehaviors(document, Drupal.settings); }); /** * The default themes. */ Drupal.theme.prototype = { /** * Formats text for emphasized display in a placeholder inside a sentence. * * @param str * The text to format (plain-text). * @return * The formatted text (html). */ placeholder: function (str) { return '' + Drupal.checkPlain(str) + ''; } }; })(jQuery); drupal-7.41/misc/ui/0000755000000000000000000000000012611765734013016 5ustar rootrootdrupal-7.41/misc/ui/jquery.ui.accordion.min.js0000644000000000000000000002144612611765734020040 0ustar rootroot /* * jQuery UI Accordion 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Accordion * * Depends: * jquery.ui.core.js * jquery.ui.widget.js */ (function(c){c.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"); a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var f=d.closest(".ui-accordion-header");a.active=f.length?f:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion", function(g){return a._keydown(g)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(g){a._clickHandler.call(a,g,this);g.preventDefault()})},_createIcons:function(){var a=this.options;if(a.icons){c("").addClass("ui-icon "+ a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("tabIndex"); this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons(); b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,f=this.headers.index(a.target),g=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:g=this.headers[(f+1)%d];break;case b.LEFT:case b.UP:g=this.headers[(f-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target); a.preventDefault()}if(g){c(a.target).attr("tabIndex",-1);c(g).attr("tabIndex",0);g.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+ c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options; if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected); a.next().addClass("ui-accordion-content-active")}h=a.next();f=this.active.next();g={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):h,oldContent:f};d=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(h,f,g,b,d)}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header); this.active.next().addClass("ui-accordion-content-active");var f=this.active.next(),g={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:f},h=this.active=c([]);this._toggle(h,f,g)}},_toggle:function(a,b,d,f,g){var h=this,e=h.options;h.toShow=a;h.toHide=b;h.data=d;var j=function(){if(h)return h._completed.apply(h,arguments)};h._trigger("changestart",null,h.data);h.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&f?{toShow:c([]),toHide:b,complete:j, down:g,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:g,autoHeight:e.autoHeight||e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;f=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!f[k]&&!c.easing[k])k="slide";f[k]||(f[k]=function(l){this.slide(l,{easing:k,duration:i||700})}); f[k](d)}else{if(e.collapsible&&f)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.7",animations:{slide:function(a, b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),f=0,g={},h={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){h[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/);g[i]={value:j[1], unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(h,{step:function(j,i){if(i.prop=="height")f=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=f*g[i.prop].value+g[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide",paddingTop:"hide", paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery); drupal-7.41/misc/ui/jquery.effects.transfer.min.js0000644000000000000000000000146012611765734020717 0ustar rootroot /* * jQuery UI Effects Transfer 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Effects/Transfer * * Depends: * jquery.effects.core.js */ (function(e){e.effects.transfer=function(a){return this.queue(function(){var b=e(this),c=e(a.options.to),d=c.offset();c={top:d.top,left:d.left,height:c.innerHeight(),width:c.innerWidth()};d=b.offset();var f=e('
            ').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments); b.dequeue()})})}})(jQuery); drupal-7.41/misc/ui/jquery.ui.autocomplete.css0000644000000000000000000000212312611765734020161 0ustar rootroot /* * jQuery UI Autocomplete 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Autocomplete#theming */ .ui-autocomplete { position: absolute; cursor: default; } /* workarounds */ * html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ /* * jQuery UI Menu 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Menu#theming */ .ui-menu { list-style:none; padding: 2px; margin: 0; display:block; float: left; } .ui-menu .ui-menu { margin-top: -3px; } .ui-menu .ui-menu-item { margin:0; padding: 0; zoom: 1; float: left; clear: left; width: 100%; } .ui-menu .ui-menu-item a { text-decoration:none; display:block; padding:.2em .4em; line-height:1.5; zoom:1; } .ui-menu .ui-menu-item a.ui-state-hover, .ui-menu .ui-menu-item a.ui-state-active { font-weight: normal; margin: -1px; } drupal-7.41/misc/ui/jquery.effects.explode.min.js0000644000000000000000000000315412611765734020535 0ustar rootroot /* * jQuery UI Effects Explode 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Effects/Explode * * Depends: * jquery.effects.core.js */ (function(j){j.effects.explode=function(a){return this.queue(function(){var c=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3,d=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3;a.options.mode=a.options.mode=="toggle"?j(this).is(":visible")?"hide":"show":a.options.mode;var b=j(this).show().css("visibility","hidden"),g=b.offset();g.top-=parseInt(b.css("marginTop"),10)||0;g.left-=parseInt(b.css("marginLeft"),10)||0;for(var h=b.outerWidth(true),i=b.outerHeight(true),e=0;e
            ").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+ e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery); drupal-7.41/misc/ui/jquery.effects.slide.min.js0000644000000000000000000000204612611765734020174 0ustar rootroot /* * jQuery UI Effects Slide 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Effects/Slide * * Depends: * jquery.effects.core.js */ (function(c){c.effects.slide=function(d){return this.queue(function(){var a=c(this),h=["position","top","left"],f=c.effects.setMode(a,d.options.mode||"show"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a).css({overflow:"hidden"});var g=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var e=d.options.distance||(g=="top"?a.outerHeight({margin:true}):a.outerWidth({margin:true}));if(f=="show")a.css(g,b=="pos"?isNaN(e)?"-"+e:-e:e);var i={};i[g]=(f== "show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+e;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){f=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); drupal-7.41/misc/ui/jquery.ui.slider.css0000644000000000000000000000216512611765734016750 0ustar rootroot /* * jQuery UI Slider 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Slider#theming */ .ui-slider { position: relative; text-align: left; } .ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } .ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } .ui-slider-horizontal { height: .8em; } .ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } .ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } .ui-slider-horizontal .ui-slider-range-min { left: 0; } .ui-slider-horizontal .ui-slider-range-max { right: 0; } .ui-slider-vertical { width: .8em; height: 100px; } .ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } .ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } .ui-slider-vertical .ui-slider-range-min { bottom: 0; } .ui-slider-vertical .ui-slider-range-max { top: 0; } drupal-7.41/misc/ui/jquery.effects.fold.min.js0000644000000000000000000000215112611765734020015 0ustar rootroot /* * jQuery UI Effects Fold 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Effects/Fold * * Depends: * jquery.effects.core.js */ (function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","left"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1],10)/100* f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery); drupal-7.41/misc/ui/jquery.effects.drop.min.js0000644000000000000000000000205712611765734020042 0ustar rootroot /* * jQuery UI Effects Drop 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Effects/Drop * * Depends: * jquery.effects.core.js */ (function(c){c.effects.drop=function(d){return this.queue(function(){var a=c(this),h=["position","top","left","opacity"],e=c.effects.setMode(a,d.options.mode||"hide"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a);var f=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var g=d.options.distance||(f=="top"?a.outerHeight({margin:true})/2:a.outerWidth({margin:true})/2);if(e=="show")a.css("opacity",0).css(f,b=="pos"?-g:g);var i={opacity:e=="show"?1: 0};i[f]=(e=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); drupal-7.41/misc/ui/jquery.effects.scale.min.js0000644000000000000000000000752412611765734020171 0ustar rootroot /* * jQuery UI Effects Scale 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Effects/Scale * * Depends: * jquery.effects.core.js */ (function(c){c.effects.puff=function(b){return this.queue(function(){var a=c(this),e=c.effects.setMode(a,b.options.mode||"hide"),g=parseInt(b.options.percent,10)||150,h=g/100,i={height:a.height(),width:a.width()};c.extend(b.options,{fade:true,mode:e,percent:e=="hide"?g:100,from:e=="hide"?i:{height:i.height*h,width:i.width*h}});a.effect("scale",b.options,b.duration,b.callback);a.dequeue()})};c.effects.scale=function(b){return this.queue(function(){var a=c(this),e=c.extend(true,{},b.options),g=c.effects.setMode(a, b.options.mode||"effect"),h=parseInt(b.options.percent,10)||(parseInt(b.options.percent,10)==0?0:g=="hide"?0:100),i=b.options.direction||"both",f=b.options.origin;if(g!="effect"){e.origin=f||["middle","center"];e.restore=true}f={height:a.height(),width:a.width()};a.from=b.options.from||(g=="show"?{height:0,width:0}:f);h={y:i!="horizontal"?h/100:1,x:i!="vertical"?h/100:1};a.to={height:f.height*h.y,width:f.width*h.x};if(b.options.fade){if(g=="show"){a.from.opacity=0;a.to.opacity=1}if(g=="hide"){a.from.opacity= 1;a.to.opacity=0}}e.from=a.from;e.to=a.to;e.mode=g;a.effect("size",e,b.duration,b.callback);a.dequeue()})};c.effects.size=function(b){return this.queue(function(){var a=c(this),e=["position","top","left","width","height","overflow","opacity"],g=["position","top","left","overflow","opacity"],h=["width","height","overflow"],i=["fontSize"],f=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],k=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],p=c.effects.setMode(a, b.options.mode||"effect"),n=b.options.restore||false,m=b.options.scale||"both",l=b.options.origin,j={height:a.height(),width:a.width()};a.from=b.options.from||j;a.to=b.options.to||j;if(l){l=c.effects.getBaseline(l,j);a.from.top=(j.height-a.from.height)*l.y;a.from.left=(j.width-a.from.width)*l.x;a.to.top=(j.height-a.to.height)*l.y;a.to.left=(j.width-a.to.width)*l.x}var d={from:{y:a.from.height/j.height,x:a.from.width/j.width},to:{y:a.to.height/j.height,x:a.to.width/j.width}};if(m=="box"||m=="both"){if(d.from.y!= d.to.y){e=e.concat(f);a.from=c.effects.setTransition(a,f,d.from.y,a.from);a.to=c.effects.setTransition(a,f,d.to.y,a.to)}if(d.from.x!=d.to.x){e=e.concat(k);a.from=c.effects.setTransition(a,k,d.from.x,a.from);a.to=c.effects.setTransition(a,k,d.to.x,a.to)}}if(m=="content"||m=="both")if(d.from.y!=d.to.y){e=e.concat(i);a.from=c.effects.setTransition(a,i,d.from.y,a.from);a.to=c.effects.setTransition(a,i,d.to.y,a.to)}c.effects.save(a,n?e:g);a.show();c.effects.createWrapper(a);a.css("overflow","hidden").css(a.from); if(m=="content"||m=="both"){f=f.concat(["marginTop","marginBottom"]).concat(i);k=k.concat(["marginLeft","marginRight"]);h=e.concat(f).concat(k);a.find("*[width]").each(function(){child=c(this);n&&c.effects.save(child,h);var o={height:child.height(),width:child.width()};child.from={height:o.height*d.from.y,width:o.width*d.from.x};child.to={height:o.height*d.to.y,width:o.width*d.to.x};if(d.from.y!=d.to.y){child.from=c.effects.setTransition(child,f,d.from.y,child.from);child.to=c.effects.setTransition(child, f,d.to.y,child.to)}if(d.from.x!=d.to.x){child.from=c.effects.setTransition(child,k,d.from.x,child.from);child.to=c.effects.setTransition(child,k,d.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){n&&c.effects.restore(child,h)})})}a.animate(a.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){a.to.opacity===0&&a.css("opacity",a.from.opacity);p=="hide"&&a.hide();c.effects.restore(a,n?e:g);c.effects.removeWrapper(a);b.callback&& b.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); drupal-7.41/misc/ui/jquery.ui.datepicker.min.js0000644000000000000000000010545312611765734020213 0ustar rootroot /* * jQuery UI Datepicker 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Datepicker * * Depends: * jquery.ui.core.js */ (function(d,G){function K(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass= "ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su", "Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10", minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};d.extend(this._defaults,this.regional[""]);this.dpDiv=d('
            ')}function E(a,b){d.extend(a,b);for(var c in b)if(b[c]== null||b[c]==G)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.7"}});var y=(new Date).getTime();d.extend(K.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){E(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase(); f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:d('
            ')}}, _connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&& b.append.remove();if(c){b.append=d(''+c+"");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('').addClass(this._triggerClass).html(f== ""?c:d("").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;gh){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a, c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b), true);this._updateDatepicker(b);this._updateAlternate(b);b.dpDiv.show()}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d('');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}E(a.settings,e||{}); b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass); this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup", this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().removeClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs, function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().addClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null: f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true}, _showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);d.datepicker._curInst&&d.datepicker._curInst!=b&&d.datepicker._curInst.dpDiv.stop(true,true);var c=d.datepicker._get(b,"beforeShow");E(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos= d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b, c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){d.datepicker._datepickerShowing=true;var i=b.dpDiv.find("iframe.ui-datepicker-cover");if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.effects&& d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}},_updateDatepicker:function(a){var b=this,c=d.datepicker._getBorders(a.dpDiv);a.dpDiv.empty().append(this._generateHTML(a));var e=a.dpDiv.find("iframe.ui-datepicker-cover");e.length&&e.css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout", function(){d(this).removeClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).removeClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).removeClass("ui-datepicker-next-hover")}).bind("mouseover",function(){if(!b._isDisabledDatepicker(a.inline?a.dpDiv.parent()[0]:a.input[0])){d(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");d(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!= -1&&d(this).addClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).addClass("ui-datepicker-next-hover")}}).end().find("."+this._dayOverClass+" a").trigger("mouseover").end();c=this._getNumberOfMonths(a);e=c[1];e>1?a.dpDiv.addClass("ui-datepicker-multi-"+e).css("width",17*e+"em"):a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");a.dpDiv[(c[0]!=1||c[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a, "isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input.focus();if(a.yearshtml){var f=a.yearshtml;setTimeout(function(){f===a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);f=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]}, _checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e- g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1);)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst=null};d.effects&&d.effects[a]? b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();if(a=this._get(b,"onClose"))a.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")}, _checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"): 0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear= false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear=!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay= d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a); else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b= a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;for(var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff,f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames, j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=z+1-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}w=this._daylightSavingAdjust(new Date(c,j-1,l));if(w.getFullYear()!=c||w.getMonth()+1!=j||w.getDate()!=l)throw"Invalid date";return w},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y", RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=k+112?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay= a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(), b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n= this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&nn;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a));n=this._canAdjustMonth(a,-1,m,g)?''+n+"":f?"":''+n+"";var r=this._get(a,"nextText");r=!h?r:this.formatDate(r,this._daylightSavingAdjust(new Date(m,g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?''+r+"":f?"":''+r+"";j=this._get(a,"currentText");r=this._get(a,"gotoCurrent")&&a.currentDay?u:b;j=!h?j:this.formatDate(j,r,this._getFormatConfig(a));h=!a.inline?'":"";e=e?'
            '+(c?h:"")+(this._isInRange(a,r)?'":"")+(c?"":h)+"
            ":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");r=this._get(a,"dayNames");this._get(a,"dayNamesShort");var s=this._get(a,"dayNamesMin"),z= this._get(a,"monthNames"),w=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),v=this._get(a,"showOtherMonths"),H=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var L=this._getDefaultDate(a),I="",C=0;C1)switch(D){case 0:x+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]- 1:x+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:x+=" ui-datepicker-group-middle";t="";break}x+='">'}x+='
            '+(/all|left/.test(t)&&C==0?c?f:n:"")+(/all|right/.test(t)&&C==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,C>0||D>0,z,w)+'
            ';var A=j?'":"";for(t=0;t<7;t++){var q= (t+h)%7;A+="=5?' class="ui-datepicker-week-end"':"")+'>'+s[q]+""}x+=A+"";A=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,A);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;A=l?6:Math.ceil((t+A)/7);q=this._daylightSavingAdjust(new Date(m,g,1-t));for(var O=0;O";var P=!j?"":'";for(t=0;t<7;t++){var F= p?p.apply(a.input?a.input[0]:null,[q]):[true,""],B=q.getMonth()!=g,J=B&&!H||!F[0]||k&&qo;P+='";q.setDate(q.getDate()+1);q=this._daylightSavingAdjust(q)}x+= P+""}g++;if(g>11){g=0;m++}x+="
            '+this._get(a,"weekHeader")+"
            '+this._get(a,"calculateWeek")(q)+""+(B&&!v?" ":J?''+q.getDate()+"":''+q.getDate()+"")+"
            "+(l?""+(i[0]>0&&D==i[1]-1?'
            ':""):"");M+=x}I+=M}I+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'':"");a._keyEvent=false;return I},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='
            ', o="";if(h||!j)o+=''+i[b]+"";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='"}u||(k+=o+(h||!(j&& l)?" ":""));a.yearshtml="";if(h||!l)k+=''+c+"";else{g=this._get(a,"yearRange").split(":");var r=(new Date).getFullYear();i=function(s){s=s.match(/c[+-].*/)?c+parseInt(s.substring(1),10):s.match(/[+-].*/)?r+parseInt(s,10):parseInt(s,10);return isNaN(s)?r:s};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='";if(d.browser.mozilla)k+='";else{k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?" ":"")+o;k+="
            ";return k},_adjustInstDate:function(a,b,c){var e= a.drawYear+(c=="Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&ba?a:b},_notifyChange:function(a){var b=this._get(a, "onChangeMonthYear");if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a); c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a, "dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker= function(a){if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b)); return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new K;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.7";window["DP_jQuery_"+y]=d})(jQuery); drupal-7.41/misc/ui/jquery.effects.fade.min.js0000644000000000000000000000110112611765734017762 0ustar rootroot /* * jQuery UI Effects Fade 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Effects/Fade * * Depends: * jquery.effects.core.js */ (function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); drupal-7.41/misc/ui/jquery.ui.draggable.min.js0000644000000000000000000004417012611765734020006 0ustar rootroot /* * jQuery UI Draggable 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Draggables * * Depends: * jquery.ui.core.js * jquery.ui.mouse.js * jquery.ui.widget.js */ (function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== "original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b= this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;return true},_mouseStart:function(a){var b=this.options;this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top- this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions(); d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);return true},_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis|| this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if(!this.element[0]||!this.element[0].parentNode)return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element, b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this== a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone():this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]|| 0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0], this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top- (parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment== "parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[(a.containment=="document"?0:d(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(a.containment=="document"?0:d(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"? 0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){var b=d(a.containment)[0];if(b){a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"), 10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}}else if(a.containment.constructor== Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop(): f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,g=a.pageY; if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.leftthis.containment[2])e=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/ b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.topthis.containment[3])?g:!(g-this.offset.click.topthis.containment[2])?e:!(e-this.offset.click.left').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")})}, stop:function(){d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity=a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!= document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!="x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY=0;h--){var i=c.snapElements[h].left,k=i+c.snapElements[h].width,j=c.snapElements[h].top,l=j+c.snapElements[h].height;if(i-e")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX, c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting", c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d= this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.righti||a.bottomb&&a.rightg&&a.bottom").addClass("ui-effects-wrapper").css({fontSize:"100%", background:"transparent",border:"none",margin:0,padding:0});c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});c.css({position:"relative",top:0,left:0})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c); return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)});return d.call(this,b)},_show:f.fn.show,show:function(c){if(m(c))return this._show.apply(this,arguments); else{var a=k.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(m(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(m(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c), b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c, a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c, a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a== e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex", -1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("
            ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),h=c('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role", "button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("").addClass("ui-dialog-title").attr("id",e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose= b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");a.uiDialog.remove();a.originalTitle&& a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!==b.uiDialog[0]){e=c(this).css("z-index"); isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+=1;d.uiDialog.css("z-index",c.ui.dialog.maxZ); d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target===f[0]&&e.shiftKey){g.focus(1);return false}}}); c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("
            ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("
            ").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,function(){return!(d=true)});if(d){c.each(a,function(f, h){h=c.isFunction(h)?{click:h,text:f}:h;f=c('').attr(h,true).unbind("click").click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.fn.button&&f.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g= d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition,originalSize:f.originalSize, position:f.position,size:f.size}}a=a===j?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize",f,b(h))},stop:function(f, h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "):[a[0],a[1]];if(b.length=== 1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f);if(g in k)e=true;if(g in l)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"):e.removeClass("ui-dialog-disabled"); break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a=this.options,b,d,e= this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height-b,0));this.uiDialog.is(":data(resizable)")&& this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.7",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),create:function(a){if(this.instances.length=== 0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(), height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight); b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a").addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,e=d.primary&&d.secondary;if(d.primary||d.secondary){b.addClass("ui-button-text-icon"+(e?"s":d.primary?"-primary":"-secondary"));d.primary&&b.prepend("");d.secondary&&b.append("");if(!this.options.text){b.addClass(e?"ui-button-icons-only":"ui-button-icon-only").removeClass("ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary"); this.hasTitle||b.attr("title",c)}}else b.addClass("ui-button-text-only")}}});a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c);a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()}, destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");a.Widget.prototype.destroy.call(this)}})})(jQuery); drupal-7.41/misc/ui/jquery.ui.core.min.js0000644000000000000000000001034512611765734017023 0ustar rootroot /*! * jQuery UI 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI */ (function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.7",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106, NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this, "position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position"); if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(l)g-=parseFloat(c.curCSS(f, "border"+this+"Width",true))||0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h, d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b?a.href||!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}}); c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100* this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.7"})})(jQuery); drupal-7.41/misc/ui/jquery.ui.progressbar.css0000644000000000000000000000054612611765734020020 0ustar rootroot /* * jQuery UI Progressbar 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Progressbar#theming */ .ui-progressbar { height:2em; text-align: left; } .ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } drupal-7.41/misc/ui/jquery.effects.highlight.min.js0000644000000000000000000000162212611765734021042 0ustar rootroot /* * jQuery UI Effects Highlight 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Effects/Highlight * * Depends: * jquery.effects.core.js */ (function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&& this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); drupal-7.41/misc/ui/jquery.ui.autocomplete.min.js0000644000000000000000000002106112611765734020571 0ustar rootroot /* * jQuery UI Autocomplete 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Autocomplete * * Depends: * jquery.ui.core.js * jquery.ui.widget.js * jquery.ui.position.js */ (function(d){d.widget("ui.autocomplete",{options:{appendTo:"body",delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},_create:function(){var a=this,b=this.element[0].ownerDocument,f;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){f=false;var e=d.ui.keyCode;switch(c.keyCode){case e.PAGE_UP:a._move("previousPage", c);break;case e.PAGE_DOWN:a._move("nextPage",c);break;case e.UP:a._move("previous",c);c.preventDefault();break;case e.DOWN:a._move("next",c);c.preventDefault();break;case e.ENTER:case e.NUMPAD_ENTER:if(a.menu.active){f=true;c.preventDefault()}case e.TAB:if(!a.menu.active)return;a.menu.select(c);break;case e.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!=a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay); break}}}).bind("keypress.autocomplete",function(c){if(f){f=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)};this.menu=d("
              ").addClass("ui-autocomplete").appendTo(d(this.options.appendTo|| "body",b)[0]).mousedown(function(c){var e=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(g){g.target!==a.element[0]&&g.target!==e&&!d.ui.contains(e,g.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,e){e=e.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:e})&&/^key/.test(c.originalEvent.type)&&a.element.val(e.value)},selected:function(c,e){var g=e.item.data("item.autocomplete"), h=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=h;setTimeout(function(){a.previous=h;a.selectedItem=g},1)}false!==a._trigger("select",c,{item:g})&&a.element.val(g.value);a.term=a.element.val();a.close(c);a.selectedItem=g},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup"); this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0])},_initSource:function(){var a=this,b,f;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,e){e(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){f=this.options.source;this.source= function(c,e){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:f,data:c,dataType:"json",success:function(g,h,i){i===a.xhr&&e(g);a.xhr=null},error:function(g){g===a.xhr&&e([]);a.xhr=null}})}}else this.source=this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length").data("item.autocomplete",b).append(d("").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}}); d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,"\\$&")},filter:function(a,b){var f=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return f.test(c.label||c.value||c)})}})})(jQuery); (function(d){d.widget("ui.menu",{_create:function(){var a=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(b){if(d(b.target).closest(".ui-menu-item a").length){b.preventDefault();a.select(b)}});this.refresh()},refresh:function(){var a=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", -1).mouseenter(function(b){a.activate(b,d(this).parent())}).mouseleave(function(){a.deactivate()})},activate:function(a,b){this.deactivate();if(this.hasScroll()){var f=b.offset().top-this.element.offset().top,c=this.element.attr("scrollTop"),e=this.element.height();if(f<0)this.element.attr("scrollTop",c+f);else f>=e&&this.element.attr("scrollTop",c+f-e+b.height())}this.active=b.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",a,{item:b})}, deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(a){this.move("next",".ui-menu-item:first",a)},previous:function(a){this.move("prev",".ui-menu-item:last",a)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(a,b,f){if(this.active){a=this.active[a+"All"](".ui-menu-item").eq(0); a.length?this.activate(f,a):this.activate(f,this.element.children(b))}else this.activate(f,this.element.children(b))},nextPage:function(a){if(this.hasScroll())if(!this.active||this.last())this.activate(a,this.element.children(".ui-menu-item:first"));else{var b=this.active.offset().top,f=this.element.height(),c=this.element.children(".ui-menu-item").filter(function(){var e=d(this).offset().top-b-f+d(this).height();return e<10&&e>-10});c.length||(c=this.element.children(".ui-menu-item:last"));this.activate(a, c)}else this.activate(a,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(a){if(this.hasScroll())if(!this.active||this.first())this.activate(a,this.element.children(".ui-menu-item:last"));else{var b=this.active.offset().top,f=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-b+f-d(this).height();return c<10&&c>-10});result.length||(result=this.element.children(".ui-menu-item:first")); this.activate(a,result)}else this.activate(a,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()=j&&f<=l||h>=j&&h<=l||fl)&&(e>= i&&e<=k||g>=i&&g<=k||ek);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;fn~hhHIDATx]b۶H儒-{iZK:glkn-tIqq? E$dK>$>;PZsVh!Sy0E0}H)-t koܪKp\RϠ .E7 ) *V;~Pe Bx*,=$zDؾ JҸٻ9{ ǸHpqW@"2'B[$ @TiH/b٥96!XHq`DE*R HV!%;" i] dddddddd4y5  Rb@(8CdŪݡ,@T@ibrq0alX!pe, =4bW { 5Ƭhu~(Q^@3="b5XC@JCT76q_5 @,r šɩD)T|O@ ON-ՙ [n@RXIm݋(F @?=0puL;g$@6η K`>п @h գKVn"a" %l@.v$/U^ G:#`` uTtK~ŋZ5T%kxk]\*Q ,҇B44 OXK|yg+_M(lоEO V$T1BXb-|?@ fBXr%'@ҹA\IJ,}BBc\V rh(]tI^}oצo S3 ";ʙb}"߰ ){b$Gwwݾab")T@pF_er6JvШ"mޭM-d76x˰6ӥ;/`>KrP\_^u1%OTM.}Q3.Nس})>-w`a+sy$t)NbFFFFBejnNVn4,A*X*5>PGa 3 {oB &<L[ Nc.öi=`Q@d ͆I.Il`\t[< Cit484-r +f쑱BCB MH iy }>rxp|z;BǏ;burcK4tz1G~`ؚK| ̔>ۡO$~ Ao)0pzz }i`;ADm8n:cfA@s7L Z/..h8or? N93B~o_'`opO- :TG L;7]`B%˛>*wTpM0H}&t ^1'Oqr'2P͡+z,tIW''|en=dzgRm[NStK{҉mؓVt6ҲR`ζN&}B U(rۗ&1%Q''?l׸+&r{jN಻4) `N狌. ߭ ǣ)q 2?n3Hb`} .`pqY1e_bu7e+N_F(DT,L}LLrmP5|x芥1cx DAb`M(7NED~Mz +4BXd.Mzv͈Pd8p<6?8N*x.6ڍ6GFZ)O !lSshssNp8`'0/<s}.@Ǩs7ξO۟VDa5av]m1+3y6۠>@u50Ps51==p *KVҫ܂ݻc$N4(Xr2###c- 賟Lδ>]5.sYs1f0;'̨Yg銛{@9 `aC(=%bo2=n1 jBoS$n#m=i0ci9}oI qT]W%.(؅]z\x f"]o'u䫵tk{v;AC3ֆwwR_#X (xҋ/q%W hpk_IX'b/fXKi"#####QCLi2t 5L0 QiH2;yTOok;ע ٶ`RNg{zy!Kxm?A(vU~mL(`o/!nmX-{v[ dw=n「sdwzn(}Oy~ m ?XU;,V'+ V&JRZ]᧭:zC'-߆@y 4u `Vۓwъ#zP@Q N>2/{\o)W~a3xLw :_Q;=pּdt\'8~3SRP6y+XQ*޺r ̗ѭ*޺r gl/\U^u$|mbVnw \V|D͊NVNy7k<;/E}?E*dzgO ~g/96f cD}% g$QG7o)U Jo,O@0߾Q(;bw:5 NwRN5Iy'K?}:9mֽ*@f@jU9mҫÍ{$ؗ}dFp|%!DdF>}G{@FFFFFFƦQܞH 3 u Mo~vy}mwz<7nP9rWku=|_nz쿳}@IXn?sn~hhHIDATx]b۶H儒-{iZK:glkn-tIqq? E$dK>$>;PZsVh!Sy0E0}H)-t koܪKp\RϠ .E7 ) *V;~Pe Bx*,=$zDؾ JҸٻ9{ ǸHpqW@"2'B[$ @TiH/b٥96!XHq`DE*R HV!%;" i] dddddddd4y5  Rb@(8CdŪݡ,@T@ibrq0alX!pe, =4bW { 5Ƭhu~(Q^@3="b5XC@JCT76q_5 @,r šɩD)T|O@ ON-ՙ [n@RXIm݋(F @?=0puL;g$@6η K`>п @h գKVn"a" %l@.v$/U^ G:#`` uTtK~ŋZ5T%kxk]\*Q ,҇B44 OXK|yg+_M(lоEO V$T1BXb-|?@ fBXr%'@ҹA\IJ,}BBc\V rh(]tI^}oצo S3 ";ʙb}"߰ ){b$Gwwݾab")T@pF_er6JvШ"mޭM-d76x˰6ӥ;/`>KrP\_^u1%OTM.}Q3.Nس})>-w`a+sy$t)NbFFFFBejnNVn4,A*X*5>PGa 3 {oB &<L[ Nc.öi=`Q@d ͆I.Il`\t[< Cit484-r +f쑱BCB MH iy }>rxp|z;BǏ;burcK4tz1G~`ؚK| ̔>ۡO$~ Ao)0pzz }i`;ADm8n:cfA@s7L Z/..h8or? N93B~o_'`opO- :TG L;7]`B%˛>*wTpM0H}&t ^1'Oqr'2P͡+z,tIW''|en=dzgRm[NStK{҉mؓVt6ҲR`ζN&}B U(rۗ&1%Q''?l׸+&r{jN಻4) `N狌. ߭ ǣ)q 2?n3Hb`} .`pqY1e_bu7e+N_F(DT,L}LLrmP5|x芥1cx DAb`M(7NED~Mz +4BXd.Mzv͈Pd8p<6?8N*x.6ڍ6GFZ)O !lSshssNp8`'0/<s}.@Ǩs7ξO۟VDa5av]m1+3y6۠>@u50Ps51==p *KVҫ܂ݻc$N4(Xr2###c- 賟Lδ>]5.sYs1f0;'̨Yg銛{@9 `aC(=%bo2=n1 jBoS$n#m=i0ci9}oI qT]W%.(؅]z\x f"]o'u䫵tk{v;AC3ֆwwR_#X (xҋ/q%W hpk_IX'b/fXKi"#####QCLi2t 5L0 QiH2;yTOok;ע ٶ`RNg{zy!Kxm?A(vU~mL(`o/!nmX-{v[ dw=n「sdwzn(}Oy~ m ?XU;,V'+ V&JRZ]᧭:zC'-߆@y 4u `Vۓwъ#zP@Q N>2/{\o)W~a3xLw :_Q;=pּdt\'8~3SRP6y+XQ*޺r ̗ѭ*޺r gl/\U^u$|mbVnw \V|D͊NVNy7k<;/E}?E*dzgO ~g/96f cD}% g$QG7o)U Jo,O@0߾Q(;bw:5 NwRN5Iy'K?}:9mֽ*@f@jU9mҫÍ{$ؗ}dFp|%!DdF>}G{@FFFFFFƦQܞH 3 u Mo~vy}mwz<7nP9rWku=|_nz쿳}@IXn?sn~hhHIDATx]b۶H儒-{iZK:glkn-tIqq? E$dK>$>;PZsVh!Sy0E0}H)-t koܪKp\RϠ .E7 ) *V;~Pe Bx*,=$zDؾ JҸٻ9{ ǸHpqW@"2'B[$ @TiH/b٥96!XHq`DE*R HV!%;" i] dddddddd4y5  Rb@(8CdŪݡ,@T@ibrq0alX!pe, =4bW { 5Ƭhu~(Q^@3="b5XC@JCT76q_5 @,r šɩD)T|O@ ON-ՙ [n@RXIm݋(F @?=0puL;g$@6η K`>п @h գKVn"a" %l@.v$/U^ G:#`` uTtK~ŋZ5T%kxk]\*Q ,҇B44 OXK|yg+_M(lоEO V$T1BXb-|?@ fBXr%'@ҹA\IJ,}BBc\V rh(]tI^}oצo S3 ";ʙb}"߰ ){b$Gwwݾab")T@pF_er6JvШ"mޭM-d76x˰6ӥ;/`>KrP\_^u1%OTM.}Q3.Nس})>-w`a+sy$t)NbFFFFBejnNVn4,A*X*5>PGa 3 {oB &<L[ Nc.öi=`Q@d ͆I.Il`\t[< Cit484-r +f쑱BCB MH iy }>rxp|z;BǏ;burcK4tz1G~`ؚK| ̔>ۡO$~ Ao)0pzz }i`;ADm8n:cfA@s7L Z/..h8or? N93B~o_'`opO- :TG L;7]`B%˛>*wTpM0H}&t ^1'Oqr'2P͡+z,tIW''|en=dzgRm[NStK{҉mؓVt6ҲR`ζN&}B U(rۗ&1%Q''?l׸+&r{jN಻4) `N狌. ߭ ǣ)q 2?n3Hb`} .`pqY1e_bu7e+N_F(DT,L}LLrmP5|x芥1cx DAb`M(7NED~Mz +4BXd.Mzv͈Pd8p<6?8N*x.6ڍ6GFZ)O !lSshssNp8`'0/<s}.@Ǩs7ξO۟VDa5av]m1+3y6۠>@u50Ps51==p *KVҫ܂ݻc$N4(Xr2###c- 賟Lδ>]5.sYs1f0;'̨Yg銛{@9 `aC(=%bo2=n1 jBoS$n#m=i0ci9}oI qT]W%.(؅]z\x f"]o'u䫵tk{v;AC3ֆwwR_#X (xҋ/q%W hpk_IX'b/fXKi"#####QCLi2t 5L0 QiH2;yTOok;ע ٶ`RNg{zy!Kxm?A(vU~mL(`o/!nmX-{v[ dw=n「sdwzn(}Oy~ m ?XU;,V'+ V&JRZ]᧭:zC'-߆@y 4u `Vۓwъ#zP@Q N>2/{\o)W~a3xLw :_Q;=pּdt\'8~3SRP6y+XQ*޺r ̗ѭ*޺r gl/\U^u$|mbVnw \V|D͊NVNy7k<;/E}?E*dzgO ~g/96f cD}% g$QG7o)U Jo,O@0߾Q(;bw:5 NwRN5Iy'K?}:9mֽ*@f@jU9mҫÍ{$ؗ}dFp|%!DdF>}G{@FFFFFFƦQܞH 3 u Mo~vy}mwz<7nP9rWku=|_nz쿳}@IXn?sn~hhHIDATx]b۶H儒-{iZK:glkn-tIqq? E$dK>$>;PZsVh!Sy0E0}H)-t koܪKp\RϠ .E7 ) *V;~Pe Bx*,=$zDؾ JҸٻ9{ ǸHpqW@"2'B[$ @TiH/b٥96!XHq`DE*R HV!%;" i] dddddddd4y5  Rb@(8CdŪݡ,@T@ibrq0alX!pe, =4bW { 5Ƭhu~(Q^@3="b5XC@JCT76q_5 @,r šɩD)T|O@ ON-ՙ [n@RXIm݋(F @?=0puL;g$@6η K`>п @h գKVn"a" %l@.v$/U^ G:#`` uTtK~ŋZ5T%kxk]\*Q ,҇B44 OXK|yg+_M(lоEO V$T1BXb-|?@ fBXr%'@ҹA\IJ,}BBc\V rh(]tI^}oצo S3 ";ʙb}"߰ ){b$Gwwݾab")T@pF_er6JvШ"mޭM-d76x˰6ӥ;/`>KrP\_^u1%OTM.}Q3.Nس})>-w`a+sy$t)NbFFFFBejnNVn4,A*X*5>PGa 3 {oB &<L[ Nc.öi=`Q@d ͆I.Il`\t[< Cit484-r +f쑱BCB MH iy }>rxp|z;BǏ;burcK4tz1G~`ؚK| ̔>ۡO$~ Ao)0pzz }i`;ADm8n:cfA@s7L Z/..h8or? N93B~o_'`opO- :TG L;7]`B%˛>*wTpM0H}&t ^1'Oqr'2P͡+z,tIW''|en=dzgRm[NStK{҉mؓVt6ҲR`ζN&}B U(rۗ&1%Q''?l׸+&r{jN಻4) `N狌. ߭ ǣ)q 2?n3Hb`} .`pqY1e_bu7e+N_F(DT,L}LLrmP5|x芥1cx DAb`M(7NED~Mz +4BXd.Mzv͈Pd8p<6?8N*x.6ڍ6GFZ)O !lSshssNp8`'0/<s}.@Ǩs7ξO۟VDa5av]m1+3y6۠>@u50Ps51==p *KVҫ܂ݻc$N4(Xr2###c- 賟Lδ>]5.sYs1f0;'̨Yg銛{@9 `aC(=%bo2=n1 jBoS$n#m=i0ci9}oI qT]W%.(؅]z\x f"]o'u䫵tk{v;AC3ֆwwR_#X (xҋ/q%W hpk_IX'b/fXKi"#####QCLi2t 5L0 QiH2;yTOok;ע ٶ`RNg{zy!Kxm?A(vU~mL(`o/!nmX-{v[ dw=n「sdwzn(}Oy~ m ?XU;,V'+ V&JRZ]᧭:zC'-߆@y 4u `Vۓwъ#zP@Q N>2/{\o)W~a3xLw :_Q;=pּdt\'8~3SRP6y+XQ*޺r ̗ѭ*޺r gl/\U^u$|mbVnw \V|D͊NVNy7k<;/E}?E*dzgO ~g/96f cD}% g$QG7o)U Jo,O@0߾Q(;bw:5 NwRN5Iy'K?}:9mֽ*@f@jU9mҫÍ{$ؗ}dFp|%!DdF>}G{@FFFFFFƦQܞH 3 u Mo~vy}mwz<7nP9rWku=|_nz쿳}@IXn?sIDAT81 0Cџ $CB}1@)e_ƅ`I8-%cM0 )" LIENDB`drupal-7.41/misc/ui/images/ui-bg_glass_65_ffffff_1x400.png0000644000000000000000000000015112611765734021633 0ustar rootrootPNG  IHDRoX 0IDAT8! + ̼JHR)[lk=O_(<` H"IENDB`drupal-7.41/misc/ui/images/ui-icons_2e83ff_256x240.png0000644000000000000000000001042112611765734020604 0ustar rootrootPNG  IHDRIJPLTE...............................................................................%̘NtRNS2P."Tp@f` <BHJZ&0R,4j8D|($ blߝF>n~hhHIDATx]b۶H儒-{iZK:glkn-tIqq? E$dK>$>;PZsVh!Sy0E0}H)-t koܪKp\RϠ .E7 ) *V;~Pe Bx*,=$zDؾ JҸٻ9{ ǸHpqW@"2'B[$ @TiH/b٥96!XHq`DE*R HV!%;" i] dddddddd4y5  Rb@(8CdŪݡ,@T@ibrq0alX!pe, =4bW { 5Ƭhu~(Q^@3="b5XC@JCT76q_5 @,r šɩD)T|O@ ON-ՙ [n@RXIm݋(F @?=0puL;g$@6η K`>п @h գKVn"a" %l@.v$/U^ G:#`` uTtK~ŋZ5T%kxk]\*Q ,҇B44 OXK|yg+_M(lоEO V$T1BXb-|?@ fBXr%'@ҹA\IJ,}BBc\V rh(]tI^}oצo S3 ";ʙb}"߰ ){b$Gwwݾab")T@pF_er6JvШ"mޭM-d76x˰6ӥ;/`>KrP\_^u1%OTM.}Q3.Nس})>-w`a+sy$t)NbFFFFBejnNVn4,A*X*5>PGa 3 {oB &<L[ Nc.öi=`Q@d ͆I.Il`\t[< Cit484-r +f쑱BCB MH iy }>rxp|z;BǏ;burcK4tz1G~`ؚK| ̔>ۡO$~ Ao)0pzz }i`;ADm8n:cfA@s7L Z/..h8or? N93B~o_'`opO- :TG L;7]`B%˛>*wTpM0H}&t ^1'Oqr'2P͡+z,tIW''|en=dzgRm[NStK{҉mؓVt6ҲR`ζN&}B U(rۗ&1%Q''?l׸+&r{jN಻4) `N狌. ߭ ǣ)q 2?n3Hb`} .`pqY1e_bu7e+N_F(DT,L}LLrmP5|x芥1cx DAb`M(7NED~Mz +4BXd.Mzv͈Pd8p<6?8N*x.6ڍ6GFZ)O !lSshssNp8`'0/<s}.@Ǩs7ξO۟VDa5av]m1+3y6۠>@u50Ps51==p *KVҫ܂ݻc$N4(Xr2###c- 賟Lδ>]5.sYs1f0;'̨Yg銛{@9 `aC(=%bo2=n1 jBoS$n#m=i0ci9}oI qT]W%.(؅]z\x f"]o'u䫵tk{v;AC3ֆwwR_#X (xҋ/q%W hpk_IX'b/fXKi"#####QCLi2t 5L0 QiH2;yTOok;ע ٶ`RNg{zy!Kxm?A(vU~mL(`o/!nmX-{v[ dw=n「sdwzn(}Oy~ m ?XU;,V'+ V&JRZ]᧭:zC'-߆@y 4u `Vۓwъ#zP@Q N>2/{\o)W~a3xLw :_Q;=pּdt\'8~3SRP6y+XQ*޺r ̗ѭ*޺r gl/\U^u$|mbVnw \V|D͊NVNy7k<;/E}?E*dzgO ~g/96f cD}% g$QG7o)U Jo,O@0߾Q(;bw:5 NwRN5Iy'K?}:9mֽ*@f@jU9mҫÍ{$ؗ}dFp|%!DdF>}G{@FFFFFFƦQܞH 3 u Mo~vy}mwz<7nP9rWku=|_nz쿳}@IXn?s=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a); return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){c(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;a.target==this._mouseDownEvent.target&&c.data(a.target,this.widgetName+".preventClickEvent", true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); drupal-7.41/misc/ui/jquery.ui.position.min.js0000644000000000000000000000703512611765734017741 0ustar rootroot /* * jQuery UI Position 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Position */ (function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+parseInt(c.curCSS(this,"marginRight",true))||0,w=m+q+parseInt(c.curCSS(this,"marginBottom",true))||0,i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-=m/2; i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); drupal-7.41/misc/ui/jquery.ui.tabs.css0000644000000000000000000000254712611765734016423 0ustar rootroot /* * jQuery UI Tabs 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Tabs#theming */ .ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ .ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } .ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } .ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } .ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } .ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } .ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ .ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } .ui-tabs .ui-tabs-hide { display: none !important; } drupal-7.41/misc/ui/jquery.ui.core.css0000644000000000000000000000266312611765734016421 0ustar rootroot /* * jQuery UI CSS Framework 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Theming/API */ /* Layout helpers ----------------------------------*/ .ui-helper-hidden { display: none; } .ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } .ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } .ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } .ui-helper-clearfix { display: inline-block; } /* required comment for clearfix to work in Opera \*/ * html .ui-helper-clearfix { height:1%; } .ui-helper-clearfix { display:block; } /* end clearfix */ .ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } /* Interaction Cues ----------------------------------*/ .ui-state-disabled { cursor: default !important; } /* Icons ----------------------------------*/ /* states and images */ .ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } /* Misc visuals ----------------------------------*/ /* Overlays */ .ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } drupal-7.41/misc/ui/jquery.ui.tabs.min.js0000644000000000000000000002655412611765734017035 0ustar rootroot /* * jQuery UI Tabs 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Tabs * * Depends: * jquery.ui.core.js * jquery.ui.widget.js */ (function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
              ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
            • #{label}
              • "},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| (q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= -1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, "cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.7"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor== String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),k=0;k=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,k);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection(); this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){e(this).removeClass("ui-resizable-autohide");b._handles.show()},function(){if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()}; if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(), d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset= this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio: this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis];if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize", b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height; f={width:c.size.width-(f?0:c.sizeDiff.width),height:c.size.height-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f,{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop", b);this._helper&&this.helper.remove();return false},_updateCache:function(b){this.offset=this.helper.offset();if(l(b.left))this.position.left=b.left;if(l(b.top))this.position.top=b.top;if(l(b.height))this.size.height=b.height;if(l(b.width))this.size.width=b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(b.height)b.width=c.height*this.aspectRatio;else if(b.width)b.height=c.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=null}if(d=="nw"){b.top= a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this.options,c=this.axis,d=l(b.width)&&a.maxWidth&&a.maxWidthb.width,h=l(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height, k=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&k)b.left=i-a.minWidth;if(d&&k)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+ a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this, arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable, {version:"1.8.7"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize, function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top-f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var k=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:k.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n= (q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(k.css("position"))){c._revertToRelativePosition=true;k.css({position:"absolute",top:"auto",left:"auto"})}k.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition= false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left- a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize", b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top", "Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset, f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left:a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left= a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top-d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+ a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition,f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&& e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative", height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b=e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width= d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},l=function(b){return!isNaN(parseInt(b,10))}})(jQuery); drupal-7.41/misc/ui/jquery.effects.blind.min.js0000644000000000000000000000154712611765734020171 0ustar rootroot /* * jQuery UI Effects Blind 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Effects/Blind * * Depends: * jquery.effects.core.js */ (function(b){b.effects.blind=function(c){return this.queue(function(){var a=b(this),g=["position","top","left"],f=b.effects.setMode(a,c.options.mode||"hide"),d=c.options.direction||"vertical";b.effects.save(a,g);a.show();var e=b.effects.createWrapper(a).css({overflow:"hidden"}),h=d=="vertical"?"height":"width";d=d=="vertical"?e.height():e.width();f=="show"&&e.css(h,0);var i={};i[h]=f=="show"?d:0;e.animate(i,c.duration,c.options.easing,function(){f=="hide"&&a.hide();b.effects.restore(a,g);b.effects.removeWrapper(a); c.callback&&c.callback.apply(a[0],arguments);a.dequeue()})})}})(jQuery); drupal-7.41/misc/ui/jquery.ui.accordion.css0000644000000000000000000000205212611765734017422 0ustar rootroot /* * jQuery UI Accordion 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Accordion#theming */ /* IE/Win - Fix animation bug - #4615 */ .ui-accordion { width: 100%; } .ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } .ui-accordion .ui-accordion-li-fix { display: inline; } .ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } .ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } .ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } .ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } .ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } .ui-accordion .ui-accordion-content-active { display: block; } drupal-7.41/misc/ui/jquery.ui.dialog.css0000644000000000000000000000252312611765734016723 0ustar rootroot /* * jQuery UI Dialog 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Dialog#theming */ .ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } .ui-dialog .ui-dialog-titlebar { padding: .5em 1em .3em; position: relative; } .ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .2em 0; } .ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } .ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } .ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } .ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } .ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } .ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } .ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } .ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } .ui-draggable .ui-dialog-titlebar { cursor: move; } drupal-7.41/misc/ui/jquery.ui.theme.css0000644000000000000000000004530712611765734016575 0ustar rootroot /* * jQuery UI CSS Framework 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Theming/API * * To view and modify this theme, visit http://jqueryui.com/themeroller/ */ /* Component containers ----------------------------------*/ .ui-widget { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1.1em/*{fsDefault}*/; } .ui-widget .ui-widget { font-size: 1em; } .ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1em; } .ui-widget-content { border: 1px solid #aaaaaa/*{borderColorContent}*/; background: #ffffff/*{bgColorContent}*/ url(images/ui-bg_flat_75_ffffff_40x100.png)/*{bgImgUrlContent}*/ 50%/*{bgContentXPos}*/ 50%/*{bgContentYPos}*/ repeat-x/*{bgContentRepeat}*/; color: #222222/*{fcContent}*/; } .ui-widget-content a { color: #222222/*{fcContent}*/; } .ui-widget-header { border: 1px solid #aaaaaa/*{borderColorHeader}*/; background: #cccccc/*{bgColorHeader}*/ url(images/ui-bg_highlight-soft_75_cccccc_1x100.png)/*{bgImgUrlHeader}*/ 50%/*{bgHeaderXPos}*/ 50%/*{bgHeaderYPos}*/ repeat-x/*{bgHeaderRepeat}*/; color: #222222/*{fcHeader}*/; font-weight: bold; } .ui-widget-header a { color: #222222/*{fcHeader}*/; } /* Interaction states ----------------------------------*/ .ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3/*{borderColorDefault}*/; background: #e6e6e6/*{bgColorDefault}*/ url(images/ui-bg_glass_75_e6e6e6_1x400.png)/*{bgImgUrlDefault}*/ 50%/*{bgDefaultXPos}*/ 50%/*{bgDefaultYPos}*/ repeat-x/*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #555555/*{fcDefault}*/; } .ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555/*{fcDefault}*/; text-decoration: none; } .ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999/*{borderColorHover}*/; background: #dadada/*{bgColorHover}*/ url(images/ui-bg_glass_75_dadada_1x400.png)/*{bgImgUrlHover}*/ 50%/*{bgHoverXPos}*/ 50%/*{bgHoverYPos}*/ repeat-x/*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcHover}*/; } .ui-state-hover a, .ui-state-hover a:hover { color: #212121/*{fcHover}*/; text-decoration: none; } .ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa/*{borderColorActive}*/; background: #ffffff/*{bgColorActive}*/ url(images/ui-bg_glass_65_ffffff_1x400.png)/*{bgImgUrlActive}*/ 50%/*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; } .ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; text-decoration: none; } .ui-widget :active { outline: none; } /* Interaction Cues ----------------------------------*/ .ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png)/*{bgImgUrlHighlight}*/ 50%/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; } .ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636/*{fcHighlight}*/; } .ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_glass_95_fef1ec_1x400.png)/*{bgImgUrlError}*/ 50%/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; } .ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a/*{fcError}*/; } .ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a/*{fcError}*/; } .ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } .ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } .ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } /* Icons ----------------------------------*/ /* states and images */ .ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } .ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } .ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsHeader}*/; } .ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png)/*{iconsDefault}*/; } .ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsHover}*/; } .ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsActive}*/; } .ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png)/*{iconsHighlight}*/; } .ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png)/*{iconsError}*/; } /* positioning */ .ui-icon-carat-1-n { background-position: 0 0; } .ui-icon-carat-1-ne { background-position: -16px 0; } .ui-icon-carat-1-e { background-position: -32px 0; } .ui-icon-carat-1-se { background-position: -48px 0; } .ui-icon-carat-1-s { background-position: -64px 0; } .ui-icon-carat-1-sw { background-position: -80px 0; } .ui-icon-carat-1-w { background-position: -96px 0; } .ui-icon-carat-1-nw { background-position: -112px 0; } .ui-icon-carat-2-n-s { background-position: -128px 0; } .ui-icon-carat-2-e-w { background-position: -144px 0; } .ui-icon-triangle-1-n { background-position: 0 -16px; } .ui-icon-triangle-1-ne { background-position: -16px -16px; } .ui-icon-triangle-1-e { background-position: -32px -16px; } .ui-icon-triangle-1-se { background-position: -48px -16px; } .ui-icon-triangle-1-s { background-position: -64px -16px; } .ui-icon-triangle-1-sw { background-position: -80px -16px; } .ui-icon-triangle-1-w { background-position: -96px -16px; } .ui-icon-triangle-1-nw { background-position: -112px -16px; } .ui-icon-triangle-2-n-s { background-position: -128px -16px; } .ui-icon-triangle-2-e-w { background-position: -144px -16px; } .ui-icon-arrow-1-n { background-position: 0 -32px; } .ui-icon-arrow-1-ne { background-position: -16px -32px; } .ui-icon-arrow-1-e { background-position: -32px -32px; } .ui-icon-arrow-1-se { background-position: -48px -32px; } .ui-icon-arrow-1-s { background-position: -64px -32px; } .ui-icon-arrow-1-sw { background-position: -80px -32px; } .ui-icon-arrow-1-w { background-position: -96px -32px; } .ui-icon-arrow-1-nw { background-position: -112px -32px; } .ui-icon-arrow-2-n-s { background-position: -128px -32px; } .ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } .ui-icon-arrow-2-e-w { background-position: -160px -32px; } .ui-icon-arrow-2-se-nw { background-position: -176px -32px; } .ui-icon-arrowstop-1-n { background-position: -192px -32px; } .ui-icon-arrowstop-1-e { background-position: -208px -32px; } .ui-icon-arrowstop-1-s { background-position: -224px -32px; } .ui-icon-arrowstop-1-w { background-position: -240px -32px; } .ui-icon-arrowthick-1-n { background-position: 0 -48px; } .ui-icon-arrowthick-1-ne { background-position: -16px -48px; } .ui-icon-arrowthick-1-e { background-position: -32px -48px; } .ui-icon-arrowthick-1-se { background-position: -48px -48px; } .ui-icon-arrowthick-1-s { background-position: -64px -48px; } .ui-icon-arrowthick-1-sw { background-position: -80px -48px; } .ui-icon-arrowthick-1-w { background-position: -96px -48px; } .ui-icon-arrowthick-1-nw { background-position: -112px -48px; } .ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } .ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } .ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } .ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } .ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } .ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } .ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } .ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } .ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } .ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } .ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } .ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } .ui-icon-arrowreturn-1-w { background-position: -64px -64px; } .ui-icon-arrowreturn-1-n { background-position: -80px -64px; } .ui-icon-arrowreturn-1-e { background-position: -96px -64px; } .ui-icon-arrowreturn-1-s { background-position: -112px -64px; } .ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } .ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } .ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } .ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } .ui-icon-arrow-4 { background-position: 0 -80px; } .ui-icon-arrow-4-diag { background-position: -16px -80px; } .ui-icon-extlink { background-position: -32px -80px; } .ui-icon-newwin { background-position: -48px -80px; } .ui-icon-refresh { background-position: -64px -80px; } .ui-icon-shuffle { background-position: -80px -80px; } .ui-icon-transfer-e-w { background-position: -96px -80px; } .ui-icon-transferthick-e-w { background-position: -112px -80px; } .ui-icon-folder-collapsed { background-position: 0 -96px; } .ui-icon-folder-open { background-position: -16px -96px; } .ui-icon-document { background-position: -32px -96px; } .ui-icon-document-b { background-position: -48px -96px; } .ui-icon-note { background-position: -64px -96px; } .ui-icon-mail-closed { background-position: -80px -96px; } .ui-icon-mail-open { background-position: -96px -96px; } .ui-icon-suitcase { background-position: -112px -96px; } .ui-icon-comment { background-position: -128px -96px; } .ui-icon-person { background-position: -144px -96px; } .ui-icon-print { background-position: -160px -96px; } .ui-icon-trash { background-position: -176px -96px; } .ui-icon-locked { background-position: -192px -96px; } .ui-icon-unlocked { background-position: -208px -96px; } .ui-icon-bookmark { background-position: -224px -96px; } .ui-icon-tag { background-position: -240px -96px; } .ui-icon-home { background-position: 0 -112px; } .ui-icon-flag { background-position: -16px -112px; } .ui-icon-calendar { background-position: -32px -112px; } .ui-icon-cart { background-position: -48px -112px; } .ui-icon-pencil { background-position: -64px -112px; } .ui-icon-clock { background-position: -80px -112px; } .ui-icon-disk { background-position: -96px -112px; } .ui-icon-calculator { background-position: -112px -112px; } .ui-icon-zoomin { background-position: -128px -112px; } .ui-icon-zoomout { background-position: -144px -112px; } .ui-icon-search { background-position: -160px -112px; } .ui-icon-wrench { background-position: -176px -112px; } .ui-icon-gear { background-position: -192px -112px; } .ui-icon-heart { background-position: -208px -112px; } .ui-icon-star { background-position: -224px -112px; } .ui-icon-link { background-position: -240px -112px; } .ui-icon-cancel { background-position: 0 -128px; } .ui-icon-plus { background-position: -16px -128px; } .ui-icon-plusthick { background-position: -32px -128px; } .ui-icon-minus { background-position: -48px -128px; } .ui-icon-minusthick { background-position: -64px -128px; } .ui-icon-close { background-position: -80px -128px; } .ui-icon-closethick { background-position: -96px -128px; } .ui-icon-key { background-position: -112px -128px; } .ui-icon-lightbulb { background-position: -128px -128px; } .ui-icon-scissors { background-position: -144px -128px; } .ui-icon-clipboard { background-position: -160px -128px; } .ui-icon-copy { background-position: -176px -128px; } .ui-icon-contact { background-position: -192px -128px; } .ui-icon-image { background-position: -208px -128px; } .ui-icon-video { background-position: -224px -128px; } .ui-icon-script { background-position: -240px -128px; } .ui-icon-alert { background-position: 0 -144px; } .ui-icon-info { background-position: -16px -144px; } .ui-icon-notice { background-position: -32px -144px; } .ui-icon-help { background-position: -48px -144px; } .ui-icon-check { background-position: -64px -144px; } .ui-icon-bullet { background-position: -80px -144px; } .ui-icon-radio-off { background-position: -96px -144px; } .ui-icon-radio-on { background-position: -112px -144px; } .ui-icon-pin-w { background-position: -128px -144px; } .ui-icon-pin-s { background-position: -144px -144px; } .ui-icon-play { background-position: 0 -160px; } .ui-icon-pause { background-position: -16px -160px; } .ui-icon-seek-next { background-position: -32px -160px; } .ui-icon-seek-prev { background-position: -48px -160px; } .ui-icon-seek-end { background-position: -64px -160px; } .ui-icon-seek-start { background-position: -80px -160px; } /* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ .ui-icon-seek-first { background-position: -80px -160px; } .ui-icon-stop { background-position: -96px -160px; } .ui-icon-eject { background-position: -112px -160px; } .ui-icon-volume-off { background-position: -128px -160px; } .ui-icon-volume-on { background-position: -144px -160px; } .ui-icon-power { background-position: 0 -176px; } .ui-icon-signal-diag { background-position: -16px -176px; } .ui-icon-signal { background-position: -32px -176px; } .ui-icon-battery-0 { background-position: -48px -176px; } .ui-icon-battery-1 { background-position: -64px -176px; } .ui-icon-battery-2 { background-position: -80px -176px; } .ui-icon-battery-3 { background-position: -96px -176px; } .ui-icon-circle-plus { background-position: 0 -192px; } .ui-icon-circle-minus { background-position: -16px -192px; } .ui-icon-circle-close { background-position: -32px -192px; } .ui-icon-circle-triangle-e { background-position: -48px -192px; } .ui-icon-circle-triangle-s { background-position: -64px -192px; } .ui-icon-circle-triangle-w { background-position: -80px -192px; } .ui-icon-circle-triangle-n { background-position: -96px -192px; } .ui-icon-circle-arrow-e { background-position: -112px -192px; } .ui-icon-circle-arrow-s { background-position: -128px -192px; } .ui-icon-circle-arrow-w { background-position: -144px -192px; } .ui-icon-circle-arrow-n { background-position: -160px -192px; } .ui-icon-circle-zoomin { background-position: -176px -192px; } .ui-icon-circle-zoomout { background-position: -192px -192px; } .ui-icon-circle-check { background-position: -208px -192px; } .ui-icon-circlesmall-plus { background-position: 0 -208px; } .ui-icon-circlesmall-minus { background-position: -16px -208px; } .ui-icon-circlesmall-close { background-position: -32px -208px; } .ui-icon-squaresmall-plus { background-position: -48px -208px; } .ui-icon-squaresmall-minus { background-position: -64px -208px; } .ui-icon-squaresmall-close { background-position: -80px -208px; } .ui-icon-grip-dotted-vertical { background-position: 0 -224px; } .ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } .ui-icon-grip-solid-vertical { background-position: -32px -224px; } .ui-icon-grip-solid-horizontal { background-position: -48px -224px; } .ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } .ui-icon-grip-diagonal-se { background-position: -80px -224px; } /* Misc visuals ----------------------------------*/ /* Corner radius */ .ui-corner-tl { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; } .ui-corner-tr { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; } .ui-corner-bl { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; } .ui-corner-br { -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; } .ui-corner-top { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; } .ui-corner-bottom { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; } .ui-corner-right { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; } .ui-corner-left { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; } .ui-corner-all { -moz-border-radius: 4px/*{cornerRadius}*/; -webkit-border-radius: 4px/*{cornerRadius}*/; border-radius: 4px/*{cornerRadius}*/; } /* Overlays */ .ui-widget-overlay { background: #aaaaaa/*{bgColorOverlay}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlOverlay}*/ 50%/*{bgOverlayXPos}*/ 50%/*{bgOverlayYPos}*/ repeat-x/*{bgOverlayRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityOverlay}*/; } .ui-widget-shadow { margin: -8px/*{offsetTopShadow}*/ 0 0 -8px/*{offsetLeftShadow}*/; padding: 8px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlShadow}*/ 50%/*{bgShadowXPos}*/ 50%/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityShadow}*/; -moz-border-radius: 8px/*{cornerRadiusShadow}*/; -webkit-border-radius: 8px/*{cornerRadiusShadow}*/; border-radius: 8px/*{cornerRadiusShadow}*/; } drupal-7.41/misc/ui/jquery.ui.sortable.min.js0000644000000000000000000005621212611765734017711 0ustar rootroot /* * jQuery UI Sortable 1.8.7 * * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT or GPL Version 2 licenses. * http://jquery.org/license * * http://docs.jquery.com/UI/Sortables * * Depends: * jquery.ui.core.js * jquery.ui.mouse.js * jquery.ui.widget.js */ (function(d){d.widget("ui.sortable",d.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){this.containerCache={};this.element.addClass("ui-sortable"); this.refresh();this.floating=this.items.length?/left|right/.test(this.items[0].item.css("float")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a==="disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this, arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&&!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem= c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset, {click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment(); if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start", a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a);return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute"); if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0],e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a, c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset();c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]== document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp();this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate", null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null,dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem): d(this.domPosition.parent).prepend(this.currentItem);return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")},toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute|| "id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+jg&&b+la[this.floating?"width":"height"]?j:g0?"down":"up")}, _getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith();if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!= this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a= this.currentItem.find(":data(sortable-item)"),b=0;b=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable"); if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h= 0;b--){var c=this.items[b],e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b=this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width= this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f=d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f}, update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b= null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this)); this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h-f)this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.topthis.containment[3])? g:!(g-this.offset.click.topthis.containment[2])?f:!(f-this.offset.click.left=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive", g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this,this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over= 0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop",a,this._uiHash());for(e=0;e");if(!a.values)a.values=[this._valueMin(),this._valueMin()];if(a.values.length&&a.values.length!==2)a.values=[a.values[0],a.values[0]]}else this.range=d("
              ");this.range.appendTo(this.element).addClass("ui-slider-range");if(a.range==="min"||a.range==="max")this.range.addClass("ui-slider-range-"+a.range);this.range.addClass("ui-widget-header")}d(".ui-slider-handle",this.element).length===0&&d("").appendTo(this.element).addClass("ui-slider-handle"); if(a.values&&a.values.length)for(;d(".ui-slider-handle",this.element).length").appendTo(this.element).addClass("ui-slider-handle");this.handles=d(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(c){c.preventDefault()}).hover(function(){a.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur(); else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(c){d(this).data("index.ui-slider-handle",c)});this.handles.keydown(function(c){var e=true,f=d(this).data("index.ui-slider-handle"),h,g,i;if(!b.options.disabled){switch(c.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:e= false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");h=b._start(c,f);if(h===false)return}break}i=b.options.step;h=b.options.values&&b.options.values.length?(g=b.values(f)):(g=b.value());switch(c.keyCode){case d.ui.keyCode.HOME:g=b._valueMin();break;case d.ui.keyCode.END:g=b._valueMax();break;case d.ui.keyCode.PAGE_UP:g=b._trimAlignValue(h+(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:g=b._trimAlignValue(h-(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(h=== b._valueMax())return;g=b._trimAlignValue(h+i);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(h===b._valueMin())return;g=b._trimAlignValue(h-i);break}b._slide(c,f,g);return e}}).keyup(function(c){var e=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(c,e);b._change(c,e);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider"); this._mouseDestroy();return this},_mouseCapture:function(b){var a=this.options,c,e,f,h,g;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:b.pageX,y:b.pageY});e=this._valueMax()-this._valueMin()+1;h=this;this.handles.each(function(i){var j=Math.abs(c-h.values(i));if(e>j){e=j;f=d(this);g=i}});if(a.range===true&&this.values(1)===a.min){g+=1;f=d(this.handles[g])}if(this._start(b, g)===false)return false;this._mouseSliding=true;h._handleIndex=g;f.addClass("ui-state-active").focus();a=f.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-f.width()/2,top:b.pageY-a.top-f.height()/2-(parseInt(f.css("borderTopWidth"),10)||0)-(parseInt(f.css("borderBottomWidth"),10)||0)+(parseInt(f.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(b,g,c);return this._animateOff=true},_mouseStart:function(){return true}, _mouseDrag:function(b){var a=this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a; if(this.orientation==="horizontal"){a=this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value= this.values(a);c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var e;if(this.options.values&&this.options.values.length){e=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>e||a===1&&c1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;e=arguments[0];for(f=0;f=this._valueMax())return this._valueMax();var a=this.options.step>0?this.options.step:1,c=(b-this._valueMin())%a;alignValue=b-c;if(Math.abs(c)*2>=a)alignValue+=c>0?a:-a;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max}, _refreshValue:function(){var b=this.options.range,a=this.options,c=this,e=!this._animateOff?a.animate:false,f,h={},g,i,j,l;if(this.options.values&&this.options.values.length)this.handles.each(function(k){f=(c.values(k)-c._valueMin())/(c._valueMax()-c._valueMin())*100;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";d(this).stop(1,1)[e?"animate":"css"](h,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(k===0)c.range.stop(1,1)[e?"animate":"css"]({left:f+"%"},a.animate); if(k===1)c.range[e?"animate":"css"]({width:f-g+"%"},{queue:false,duration:a.animate})}else{if(k===0)c.range.stop(1,1)[e?"animate":"css"]({bottom:f+"%"},a.animate);if(k===1)c.range[e?"animate":"css"]({height:f-g+"%"},{queue:false,duration:a.animate})}g=f});else{i=this.value();j=this._valueMin();l=this._valueMax();f=l!==j?(i-j)/(l-j)*100:0;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";this.handle.stop(1,1)[e?"animate":"css"](h,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1, 1)[e?"animate":"css"]({width:f+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[e?"animate":"css"]({width:100-f+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[e?"animate":"css"]({height:f+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[e?"animate":"css"]({height:100-f+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.7"})})(jQuery); drupal-7.41/misc/ajax.js0000644000000000000000000006067112611765734013674 0ustar rootroot(function ($) { /** * Provides Ajax page updating via jQuery $.ajax (Asynchronous JavaScript and XML). * * Ajax is a method of making a request via JavaScript while viewing an HTML * page. The request returns an array of commands encoded in JSON, which is * then executed to make any changes that are necessary to the page. * * Drupal uses this file to enhance form elements with #ajax['path'] and * #ajax['wrapper'] properties. If set, this file will automatically be included * to provide Ajax capabilities. */ Drupal.ajax = Drupal.ajax || {}; Drupal.settings.urlIsAjaxTrusted = Drupal.settings.urlIsAjaxTrusted || {}; /** * Attaches the Ajax behavior to each Ajax form element. */ Drupal.behaviors.AJAX = { attach: function (context, settings) { // Load all Ajax behaviors specified in the settings. for (var base in settings.ajax) { if (!$('#' + base + '.ajax-processed').length) { var element_settings = settings.ajax[base]; if (typeof element_settings.selector == 'undefined') { element_settings.selector = '#' + base; } $(element_settings.selector).each(function () { element_settings.element = this; Drupal.ajax[base] = new Drupal.ajax(base, this, element_settings); }); $('#' + base).addClass('ajax-processed'); } } // Bind Ajax behaviors to all items showing the class. $('.use-ajax:not(.ajax-processed)').addClass('ajax-processed').each(function () { var element_settings = {}; // Clicked links look better with the throbber than the progress bar. element_settings.progress = { 'type': 'throbber' }; // For anchor tags, these will go to the target of the anchor rather // than the usual location. if ($(this).attr('href')) { element_settings.url = $(this).attr('href'); element_settings.event = 'click'; } var base = $(this).attr('id'); Drupal.ajax[base] = new Drupal.ajax(base, this, element_settings); }); // This class means to submit the form to the action using Ajax. $('.use-ajax-submit:not(.ajax-processed)').addClass('ajax-processed').each(function () { var element_settings = {}; // Ajax submits specified in this manner automatically submit to the // normal form action. element_settings.url = $(this.form).attr('action'); // Form submit button clicks need to tell the form what was clicked so // it gets passed in the POST request. element_settings.setClick = true; // Form buttons use the 'click' event rather than mousedown. element_settings.event = 'click'; // Clicked form buttons look better with the throbber than the progress bar. element_settings.progress = { 'type': 'throbber' }; var base = $(this).attr('id'); Drupal.ajax[base] = new Drupal.ajax(base, this, element_settings); }); } }; /** * Ajax object. * * All Ajax objects on a page are accessible through the global Drupal.ajax * object and are keyed by the submit button's ID. You can access them from * your module's JavaScript file to override properties or functions. * * For example, if your Ajax enabled button has the ID 'edit-submit', you can * redefine the function that is called to insert the new content like this * (inside a Drupal.behaviors attach block): * @code * Drupal.behaviors.myCustomAJAXStuff = { * attach: function (context, settings) { * Drupal.ajax['edit-submit'].commands.insert = function (ajax, response, status) { * new_content = $(response.data); * $('#my-wrapper').append(new_content); * alert('New content was appended to #my-wrapper'); * } * } * }; * @endcode */ Drupal.ajax = function (base, element, element_settings) { var defaults = { url: 'system/ajax', event: 'mousedown', keypress: true, selector: '#' + base, effect: 'none', speed: 'none', method: 'replaceWith', progress: { type: 'throbber', message: Drupal.t('Please wait...') }, submit: { 'js': true } }; $.extend(this, defaults, element_settings); this.element = element; this.element_settings = element_settings; // Replacing 'nojs' with 'ajax' in the URL allows for an easy method to let // the server detect when it needs to degrade gracefully. // There are five scenarios to check for: // 1. /nojs/ // 2. /nojs$ - The end of a URL string. // 3. /nojs? - Followed by a query (with clean URLs enabled). // E.g.: path/nojs?destination=foobar // 4. /nojs& - Followed by a query (without clean URLs enabled). // E.g.: ?q=path/nojs&destination=foobar // 5. /nojs# - Followed by a fragment. // E.g.: path/nojs#myfragment this.url = element_settings.url.replace(/\/nojs(\/|$|\?|&|#)/g, '/ajax$1'); // If the 'nojs' version of the URL is trusted, also trust the 'ajax' version. if (Drupal.settings.urlIsAjaxTrusted[element_settings.url]) { Drupal.settings.urlIsAjaxTrusted[this.url] = true; } this.wrapper = '#' + element_settings.wrapper; // If there isn't a form, jQuery.ajax() will be used instead, allowing us to // bind Ajax to links as well. if (this.element.form) { this.form = $(this.element.form); } // Set the options for the ajaxSubmit function. // The 'this' variable will not persist inside of the options object. var ajax = this; ajax.options = { url: ajax.url, data: ajax.submit, beforeSerialize: function (element_settings, options) { return ajax.beforeSerialize(element_settings, options); }, beforeSubmit: function (form_values, element_settings, options) { ajax.ajaxing = true; return ajax.beforeSubmit(form_values, element_settings, options); }, beforeSend: function (xmlhttprequest, options) { ajax.ajaxing = true; return ajax.beforeSend(xmlhttprequest, options); }, success: function (response, status, xmlhttprequest) { // Sanity check for browser support (object expected). // When using iFrame uploads, responses must be returned as a string. if (typeof response == 'string') { response = $.parseJSON(response); } // Prior to invoking the response's commands, verify that they can be // trusted by checking for a response header. See // ajax_set_verification_header() for details. // - Empty responses are harmless so can bypass verification. This avoids // an alert message for server-generated no-op responses that skip Ajax // rendering. // - Ajax objects with trusted URLs (e.g., ones defined server-side via // #ajax) can bypass header verification. This is especially useful for // Ajax with multipart forms. Because IFRAME transport is used, the // response headers cannot be accessed for verification. if (response !== null && !Drupal.settings.urlIsAjaxTrusted[ajax.url]) { if (xmlhttprequest.getResponseHeader('X-Drupal-Ajax-Token') !== '1') { var customMessage = Drupal.t("The response failed verification so will not be processed."); return ajax.error(xmlhttprequest, ajax.url, customMessage); } } return ajax.success(response, status); }, complete: function (xmlhttprequest, status) { ajax.ajaxing = false; if (status == 'error' || status == 'parsererror') { return ajax.error(xmlhttprequest, ajax.url); } }, dataType: 'json', type: 'POST' }; // Bind the ajaxSubmit function to the element event. $(ajax.element).bind(element_settings.event, function (event) { if (!Drupal.settings.urlIsAjaxTrusted[ajax.url] && !Drupal.urlIsLocal(ajax.url)) { throw new Error(Drupal.t('The callback URL is not local and not trusted: !url', {'!url': ajax.url})); } return ajax.eventResponse(this, event); }); // If necessary, enable keyboard submission so that Ajax behaviors // can be triggered through keyboard input as well as e.g. a mousedown // action. if (element_settings.keypress) { $(ajax.element).keypress(function (event) { return ajax.keypressResponse(this, event); }); } // If necessary, prevent the browser default action of an additional event. // For example, prevent the browser default action of a click, even if the // AJAX behavior binds to mousedown. if (element_settings.prevent) { $(ajax.element).bind(element_settings.prevent, false); } }; /** * Handle a key press. * * The Ajax object will, if instructed, bind to a key press response. This * will test to see if the key press is valid to trigger this event and * if it is, trigger it for us and prevent other keypresses from triggering. * In this case we're handling RETURN and SPACEBAR keypresses (event codes 13 * and 32. RETURN is often used to submit a form when in a textfield, and * SPACE is often used to activate an element without submitting. */ Drupal.ajax.prototype.keypressResponse = function (element, event) { // Create a synonym for this to reduce code confusion. var ajax = this; // Detect enter key and space bar and allow the standard response for them, // except for form elements of type 'text' and 'textarea', where the // spacebar activation causes inappropriate activation if #ajax['keypress'] is // TRUE. On a text-type widget a space should always be a space. if (event.which == 13 || (event.which == 32 && element.type != 'text' && element.type != 'textarea')) { $(ajax.element_settings.element).trigger(ajax.element_settings.event); return false; } }; /** * Handle an event that triggers an Ajax response. * * When an event that triggers an Ajax response happens, this method will * perform the actual Ajax call. It is bound to the event using * bind() in the constructor, and it uses the options specified on the * ajax object. */ Drupal.ajax.prototype.eventResponse = function (element, event) { // Create a synonym for this to reduce code confusion. var ajax = this; // Do not perform another ajax command if one is already in progress. if (ajax.ajaxing) { return false; } try { if (ajax.form) { // If setClick is set, we must set this to ensure that the button's // value is passed. if (ajax.setClick) { // Mark the clicked button. 'form.clk' is a special variable for // ajaxSubmit that tells the system which element got clicked to // trigger the submit. Without it there would be no 'op' or // equivalent. element.form.clk = element; } ajax.form.ajaxSubmit(ajax.options); } else { ajax.beforeSerialize(ajax.element, ajax.options); $.ajax(ajax.options); } } catch (e) { // Unset the ajax.ajaxing flag here because it won't be unset during // the complete response. ajax.ajaxing = false; alert("An error occurred while attempting to process " + ajax.options.url + ": " + e.message); } // For radio/checkbox, allow the default event. On IE, this means letting // it actually check the box. if (typeof element.type != 'undefined' && (element.type == 'checkbox' || element.type == 'radio')) { return true; } else { return false; } }; /** * Handler for the form serialization. * * Runs before the beforeSend() handler (see below), and unlike that one, runs * before field data is collected. */ Drupal.ajax.prototype.beforeSerialize = function (element, options) { // Allow detaching behaviors to update field values before collecting them. // This is only needed when field values are added to the POST data, so only // when there is a form such that this.form.ajaxSubmit() is used instead of // $.ajax(). When there is no form and $.ajax() is used, beforeSerialize() // isn't called, but don't rely on that: explicitly check this.form. if (this.form) { var settings = this.settings || Drupal.settings; Drupal.detachBehaviors(this.form, settings, 'serialize'); } // Prevent duplicate HTML ids in the returned markup. // @see drupal_html_id() options.data['ajax_html_ids[]'] = []; $('[id]').each(function () { options.data['ajax_html_ids[]'].push(this.id); }); // Allow Drupal to return new JavaScript and CSS files to load without // returning the ones already loaded. // @see ajax_base_page_theme() // @see drupal_get_css() // @see drupal_get_js() options.data['ajax_page_state[theme]'] = Drupal.settings.ajaxPageState.theme; options.data['ajax_page_state[theme_token]'] = Drupal.settings.ajaxPageState.theme_token; for (var key in Drupal.settings.ajaxPageState.css) { options.data['ajax_page_state[css][' + key + ']'] = 1; } for (var key in Drupal.settings.ajaxPageState.js) { options.data['ajax_page_state[js][' + key + ']'] = 1; } }; /** * Modify form values prior to form submission. */ Drupal.ajax.prototype.beforeSubmit = function (form_values, element, options) { // This function is left empty to make it simple to override for modules // that wish to add functionality here. }; /** * Prepare the Ajax request before it is sent. */ Drupal.ajax.prototype.beforeSend = function (xmlhttprequest, options) { // For forms without file inputs, the jQuery Form plugin serializes the form // values, and then calls jQuery's $.ajax() function, which invokes this // handler. In this circumstance, options.extraData is never used. For forms // with file inputs, the jQuery Form plugin uses the browser's normal form // submission mechanism, but captures the response in a hidden IFRAME. In this // circumstance, it calls this handler first, and then appends hidden fields // to the form to submit the values in options.extraData. There is no simple // way to know which submission mechanism will be used, so we add to extraData // regardless, and allow it to be ignored in the former case. if (this.form) { options.extraData = options.extraData || {}; // Let the server know when the IFRAME submission mechanism is used. The // server can use this information to wrap the JSON response in a TEXTAREA, // as per http://jquery.malsup.com/form/#file-upload. options.extraData.ajax_iframe_upload = '1'; // The triggering element is about to be disabled (see below), but if it // contains a value (e.g., a checkbox, textfield, select, etc.), ensure that // value is included in the submission. As per above, submissions that use // $.ajax() are already serialized prior to the element being disabled, so // this is only needed for IFRAME submissions. var v = $.fieldValue(this.element); if (v !== null) { options.extraData[this.element.name] = Drupal.checkPlain(v); } } // Disable the element that received the change to prevent user interface // interaction while the Ajax request is in progress. ajax.ajaxing prevents // the element from triggering a new request, but does not prevent the user // from changing its value. $(this.element).addClass('progress-disabled').attr('disabled', true); // Insert progressbar or throbber. if (this.progress.type == 'bar') { var progressBar = new Drupal.progressBar('ajax-progress-' + this.element.id, eval(this.progress.update_callback), this.progress.method, eval(this.progress.error_callback)); if (this.progress.message) { progressBar.setProgress(-1, this.progress.message); } if (this.progress.url) { progressBar.startMonitoring(this.progress.url, this.progress.interval || 1500); } this.progress.element = $(progressBar.element).addClass('ajax-progress ajax-progress-bar'); this.progress.object = progressBar; $(this.element).after(this.progress.element); } else if (this.progress.type == 'throbber') { this.progress.element = $('
               
              '); if (this.progress.message) { $('.throbber', this.progress.element).after('
              ' + this.progress.message + '
              '); } $(this.element).after(this.progress.element); } }; /** * Handler for the form redirection completion. */ Drupal.ajax.prototype.success = function (response, status) { // Remove the progress element. if (this.progress.element) { $(this.progress.element).remove(); } if (this.progress.object) { this.progress.object.stopMonitoring(); } $(this.element).removeClass('progress-disabled').removeAttr('disabled'); Drupal.freezeHeight(); for (var i in response) { if (response.hasOwnProperty(i) && response[i]['command'] && this.commands[response[i]['command']]) { this.commands[response[i]['command']](this, response[i], status); } } // Reattach behaviors, if they were detached in beforeSerialize(). The // attachBehaviors() called on the new content from processing the response // commands is not sufficient, because behaviors from the entire form need // to be reattached. if (this.form) { var settings = this.settings || Drupal.settings; Drupal.attachBehaviors(this.form, settings); } Drupal.unfreezeHeight(); // Remove any response-specific settings so they don't get used on the next // call by mistake. this.settings = null; }; /** * Build an effect object which tells us how to apply the effect when adding new HTML. */ Drupal.ajax.prototype.getEffect = function (response) { var type = response.effect || this.effect; var speed = response.speed || this.speed; var effect = {}; if (type == 'none') { effect.showEffect = 'show'; effect.hideEffect = 'hide'; effect.showSpeed = ''; } else if (type == 'fade') { effect.showEffect = 'fadeIn'; effect.hideEffect = 'fadeOut'; effect.showSpeed = speed; } else { effect.showEffect = type + 'Toggle'; effect.hideEffect = type + 'Toggle'; effect.showSpeed = speed; } return effect; }; /** * Handler for the form redirection error. */ Drupal.ajax.prototype.error = function (xmlhttprequest, uri, customMessage) { alert(Drupal.ajaxError(xmlhttprequest, uri, customMessage)); // Remove the progress element. if (this.progress.element) { $(this.progress.element).remove(); } if (this.progress.object) { this.progress.object.stopMonitoring(); } // Undo hide. $(this.wrapper).show(); // Re-enable the element. $(this.element).removeClass('progress-disabled').removeAttr('disabled'); // Reattach behaviors, if they were detached in beforeSerialize(). if (this.form) { var settings = this.settings || Drupal.settings; Drupal.attachBehaviors(this.form, settings); } }; /** * Provide a series of commands that the server can request the client perform. */ Drupal.ajax.prototype.commands = { /** * Command to insert new content into the DOM. */ insert: function (ajax, response, status) { // Get information from the response. If it is not there, default to // our presets. var wrapper = response.selector ? $(response.selector) : $(ajax.wrapper); var method = response.method || ajax.method; var effect = ajax.getEffect(response); // We don't know what response.data contains: it might be a string of text // without HTML, so don't rely on jQuery correctly iterpreting // $(response.data) as new HTML rather than a CSS selector. Also, if // response.data contains top-level text nodes, they get lost with either // $(response.data) or $('
              ').replaceWith(response.data). var new_content_wrapped = $('
              ').html(response.data); var new_content = new_content_wrapped.contents(); // For legacy reasons, the effects processing code assumes that new_content // consists of a single top-level element. Also, it has not been // sufficiently tested whether attachBehaviors() can be successfully called // with a context object that includes top-level text nodes. However, to // give developers full control of the HTML appearing in the page, and to // enable Ajax content to be inserted in places where DIV elements are not // allowed (e.g., within TABLE, TR, and SPAN parents), we check if the new // content satisfies the requirement of a single top-level element, and // only use the container DIV created above when it doesn't. For more // information, please see http://drupal.org/node/736066. if (new_content.length != 1 || new_content.get(0).nodeType != 1) { new_content = new_content_wrapped; } // If removing content from the wrapper, detach behaviors first. switch (method) { case 'html': case 'replaceWith': case 'replaceAll': case 'empty': case 'remove': var settings = response.settings || ajax.settings || Drupal.settings; Drupal.detachBehaviors(wrapper, settings); } // Add the new content to the page. wrapper[method](new_content); // Immediately hide the new content if we're using any effects. if (effect.showEffect != 'show') { new_content.hide(); } // Determine which effect to use and what content will receive the // effect, then show the new content. if ($('.ajax-new-content', new_content).length > 0) { $('.ajax-new-content', new_content).hide(); new_content.show(); $('.ajax-new-content', new_content)[effect.showEffect](effect.showSpeed); } else if (effect.showEffect != 'show') { new_content[effect.showEffect](effect.showSpeed); } // Attach all JavaScript behaviors to the new content, if it was successfully // added to the page, this if statement allows #ajax['wrapper'] to be // optional. if (new_content.parents('html').length > 0) { // Apply any settings from the returned JSON if available. var settings = response.settings || ajax.settings || Drupal.settings; Drupal.attachBehaviors(new_content, settings); } }, /** * Command to remove a chunk from the page. */ remove: function (ajax, response, status) { var settings = response.settings || ajax.settings || Drupal.settings; Drupal.detachBehaviors($(response.selector), settings); $(response.selector).remove(); }, /** * Command to mark a chunk changed. */ changed: function (ajax, response, status) { if (!$(response.selector).hasClass('ajax-changed')) { $(response.selector).addClass('ajax-changed'); if (response.asterisk) { $(response.selector).find(response.asterisk).append(' * '); } } }, /** * Command to provide an alert. */ alert: function (ajax, response, status) { alert(response.text, response.title); }, /** * Command to provide the jQuery css() function. */ css: function (ajax, response, status) { $(response.selector).css(response.argument); }, /** * Command to set the settings that will be used for other commands in this response. */ settings: function (ajax, response, status) { if (response.merge) { $.extend(true, Drupal.settings, response.settings); } else { ajax.settings = response.settings; } }, /** * Command to attach data using jQuery's data API. */ data: function (ajax, response, status) { $(response.selector).data(response.name, response.value); }, /** * Command to apply a jQuery method. */ invoke: function (ajax, response, status) { var $element = $(response.selector); $element[response.method].apply($element, response.arguments); }, /** * Command to restripe a table. */ restripe: function (ajax, response, status) { // :even and :odd are reversed because jQuery counts from 0 and // we count from 1, so we're out of sync. // Match immediate children of the parent element to allow nesting. $('> tbody > tr:visible, > tr:visible', $(response.selector)) .removeClass('odd even') .filter(':even').addClass('odd').end() .filter(':odd').addClass('even'); }, /** * Command to add css. * * Uses the proprietary addImport method if available as browsers which * support that method ignore @import statements in dynamically added * stylesheets. */ add_css: function (ajax, response, status) { // Add the styles in the normal way. $('head').prepend(response.data); // Add imports in the styles using the addImport method if available. var match, importMatch = /^@import url\("(.*)"\);$/igm; if (document.styleSheets[0].addImport && importMatch.test(response.data)) { importMatch.lastIndex = 0; while (match = importMatch.exec(response.data)) { document.styleSheets[0].addImport(match[1]); } } }, /** * Command to update a form's build ID. */ updateBuildId: function(ajax, response, status) { $('input[name="form_build_id"][value="' + response['old'] + '"]').val(response['new']); } }; })(jQuery); drupal-7.41/misc/favicon.ico0000644000000000000000000001246612611765734014533 0ustar rootroot h&  (  tro T@h~Zhڝs-ܔr9fN(l-+''''@@@D7#BZ YYbçwenx6*HD7"BVYu+{4[llffgwaHspll rݻ`\ms)urnhL pssĨzzn\rn ss߿ݿu(̵r~ ܺssvܸӮȐ6sp^}7ɰr*~"غsssssssssq]Yl$n&ssssssssssnYa)]H&Z~usssssssss^SC)R''&t׶͙Etsssssss{M*))UUUQMF&zsssssp ꒊ}& ͤx sss[H?/*\\\=7,TŶ̗As[?'f///\\\ ĥrk)mmmYG*d\[Z??( @ <<<<<<A?< `SɰdYYYYx/e V ,DDD $xKYYYYYYYYYYYYYYYYY[]쏇y,JHDqG؏Y\[Y;ræwYdYY¦v¥uYYURYYHv3:71d.krsuϩкh[ʱcYѻr@@@6msssիf¦v]\fYYϸ#B@@@@@@kBssssϩJYb ĥvX@@@IF@issssͤԽKG@q^@\rssssӦ\LSαr_@`v@sssssuرqscYZnлr@@ssssssع׶Æ"sssiYYp#ӻu+|@@ssssssss̘C޼Ȝ޽Ȑ6sssssslZYYn ` Y@@ssssssssssssssssssssmZYYYY|@JsssssssssssssssssssssjYYYYPxLzsssssssssssssssssssssscYYYvRrh^L 0) { $('.connection-settings-update-filetransfer-default-wrapper').css('float', 'none'); } // Hides the submit button for non-js users. $('#edit-submit-connection').hide(); $('#edit-submit-process').show(); } }; })(jQuery); drupal-7.41/misc/throbber-active.gif0000644000000000000000000000232112611765734016146 0ustar rootrootGIF89a  {{ƵZ5ʋkFs! NETSCAPE2.0!, _$N4ɨN  G. F9FC"dH٤qHë rdN!Z%Aᒔ84"BUU{A.<+0u+ ')+!!, G$NHL0>-".* GT* #Li"JhL5 d,@2uYmG+i!, ?$NϘct:$!L( @"R `(Ղ5ɭb'FӘ(`ZV^(!, H$N蔤b@HĨ$!krHpbhdDXrwNM@``9I, !, I$NHL0>-ʸl !,z'`HjƤ6E"!S  @2yzyS`prZ!, @$NϘctдú#2EH"6D !JJ0bD ]kx*`:Q:y!, E$N蔤b@Xw"C2"LN P1"PD 2.CNQ!, F$NL0>-ʸl rRk4'"E!L"bYE1)A+!, A$NϘctдú#2EH"TP;Iu@`ul01(< !, I$N蔤b@HAATPSd) NNch!bK&Sm0zD!, H$NHL0>-ʸc̊Aט@NiՊDn,]9aUo !, A$NϘct8Q,#.Q#H!L#J"QP$ +cV܉RDVw ;drupal-7.41/misc/powered-blue-135x42.png0000644000000000000000000000547712611765734016362 0ustar rootrootPNG  IHDR*PLTEID=3,$i dy$(+02-*#  ;um3 nDžwgQ(sjx|H%=ߖ4{t oٚҊ˲+w a6+$1jU ^D~g\ {bv0{9eK|sԼrUzٻpZ{۫({θ߀Q]ڈOkKCY\֕Z#˛n$#醰!ڤB:0+w4J<,^M;F1,; SYQ|> R|RLzU4:[`YE T^MTWLIwXYd`B Z^[$FLq/bA%diJsq4c.l[\dV,3p0m_;:8}AD5o#I"oWUl%qBA[ be+l$iahKSzIDATx^Ֆ0Ѽ$S.n֜Bz)ꊯ&[ LoK F@ f]U/@ŊPqCs:Qp- j)}v.l|/ql)vG IĩhP~!" C.K :JP T(vbyaz01HnY',xSPs*#:6;y?$#W@m ~1"]$A w"zP@'wadi7Qpoefb݌y$!ǿ{,긨ޤ"6m<2uCE.r {/=6)~4xiڈVp\:>If<ؽ`ܝ7K@MnpZ,9cȾ>J36WoMU{P(4M\v\r1Rv/ P+II"jTU1bEМCC|3L'IF;ʈLD;̴ {lex tee??$ի%{X}sbGjp9]wU?O/HX^-srTVcrÒc[yu| qܙb$U&]tbAj =044(UEх({X-s;P:5Hv Co9 3:ΉI(Do K0TUpbxx8N3&s%-3fl.۸@x҆NjAD> |4f#]m`…3Qӓt*F#]v8m (Bڱu[d8H8|ޙ&1_RC?z"vurpXZ)3(N\y|;ђ#\ iv̸-X_3$f]mv O_=Ϙԉ4&}%%T^`NFQ{]]LV΁Ł{[SZ”XМ?.V Џ#+tL 1*`l%GWL B\KZcWȃ' `4C%yf,Ϗ:E@uԗnb$["\ A&'q86X~?-Sd$UK66~7Ib/:ǔꖕv6_ݱ"Gz2Mh})>&)9{WC{1yi<(ނ\b3UKַRZ:8^̇xQ.yr㻽޽f7}~b:^c[.ny1/B }wwIeݸ +n@kV]vhn<&d4X[#!>P*CF JRM g2^'3 ^{88;l@Hz_nk.1tZ[M6  ipRD<2fCƛtwK$vSv̚|E cló] Axn$ۢ0l9|~BAa4AX/57rГh<)ÍN18RP ]W~}E\teUn1l0(bSȍF0@L& 7yy(8<Y-Rc$+W1׌Ğ)l!E%H ""%@&>EaLvYGdWN'ǑެYc ]RIZ'ʗ-_=Z,r:1=*±8x RH=S"{l쉂9``<_ Order allow,deny # Don't show directory listings for URLs which map to a directory. Options -Indexes # Follow symbolic links in this directory. Options +FollowSymLinks # Make Drupal handle any 404 errors. ErrorDocument 404 /index.php # Set the default handler. DirectoryIndex index.php index.html index.htm # Override PHP settings that cannot be changed at runtime. See # sites/default/default.settings.php and drupal_environment_initialize() in # includes/bootstrap.inc for settings that can be changed at runtime. # PHP 5, Apache 1 and 2. php_flag magic_quotes_gpc off php_flag magic_quotes_sybase off php_flag register_globals off php_flag session.auto_start off php_value mbstring.http_input pass php_value mbstring.http_output pass php_flag mbstring.encoding_translation off # Requires mod_expires to be enabled. # Enable expirations. ExpiresActive On # Cache all files for 2 weeks after access (A). ExpiresDefault A1209600 # Do not allow PHP scripts to be cached unless they explicitly send cache # headers themselves. Otherwise all scripts would have to overwrite the # headers set by mod_expires if they want another caching behavior. This may # fail if an error occurs early in the bootstrap process, and it may cause # problems if a non-Drupal PHP file is installed in a subdirectory. ExpiresActive Off # Various rewrite rules. RewriteEngine on # Set "protossl" to "s" if we were accessed via https://. This is used later # if you enable "www." stripping or enforcement, in order to ensure that # you don't bounce between http and https. RewriteRule ^ - [E=protossl] RewriteCond %{HTTPS} on RewriteRule ^ - [E=protossl:s] # Make sure Authorization HTTP header is available to PHP # even when running as CGI or FastCGI. RewriteRule ^ - [E=HTTP_AUTHORIZATION:%{HTTP:Authorization}] # Block access to "hidden" directories whose names begin with a period. This # includes directories used by version control systems such as Subversion or # Git to store control files. Files whose names begin with a period, as well # as the control files used by CVS, are protected by the FilesMatch directive # above. # # NOTE: This only works when mod_rewrite is loaded. Without mod_rewrite, it is # not possible to block access to entire directories from .htaccess, because # is not allowed here. # # If you do not have mod_rewrite installed, you should remove these # directories from your webroot or otherwise protect them from being # downloaded. RewriteRule "(^|/)\." - [F] # If your site can be accessed both with and without the 'www.' prefix, you # can use one of the following settings to redirect users to your preferred # URL, either WITH or WITHOUT the 'www.' prefix. Choose ONLY one option: # # To redirect all users to access the site WITH the 'www.' prefix, # (http://example.com/... will be redirected to http://www.example.com/...) # uncomment the following: # RewriteCond %{HTTP_HOST} . # RewriteCond %{HTTP_HOST} !^www\. [NC] # RewriteRule ^ http%{ENV:protossl}://www.%{HTTP_HOST}%{REQUEST_URI} [L,R=301] # # To redirect all users to access the site WITHOUT the 'www.' prefix, # (http://www.example.com/... will be redirected to http://example.com/...) # uncomment the following: # RewriteCond %{HTTP_HOST} ^www\.(.+)$ [NC] # RewriteRule ^ http%{ENV:protossl}://%1%{REQUEST_URI} [L,R=301] # Modify the RewriteBase if you are using Drupal in a subdirectory or in a # VirtualDocumentRoot and the rewrite rules are not working properly. # For example if your site is at http://example.com/drupal uncomment and # modify the following line: # RewriteBase /drupal # # If your site is running in a VirtualDocumentRoot at http://example.com/, # uncomment the following line: # RewriteBase / # Pass all requests not referring directly to files in the filesystem to # index.php. Clean URLs are handled in drupal_environment_initialize(). RewriteCond %{REQUEST_FILENAME} !-f RewriteCond %{REQUEST_FILENAME} !-d RewriteCond %{REQUEST_URI} !=/favicon.ico RewriteRule ^ index.php [L] # Rules to correctly serve gzip compressed CSS and JS files. # Requires both mod_rewrite and mod_headers to be enabled. # Serve gzip compressed CSS files if they exist and the client accepts gzip. RewriteCond %{HTTP:Accept-encoding} gzip RewriteCond %{REQUEST_FILENAME}\.gz -s RewriteRule ^(.*)\.css $1\.css\.gz [QSA] # Serve gzip compressed JS files if they exist and the client accepts gzip. RewriteCond %{HTTP:Accept-encoding} gzip RewriteCond %{REQUEST_FILENAME}\.gz -s RewriteRule ^(.*)\.js $1\.js\.gz [QSA] # Serve correct content types, and prevent mod_deflate double gzip. RewriteRule \.css\.gz$ - [T=text/css,E=no-gzip:1] RewriteRule \.js\.gz$ - [T=text/javascript,E=no-gzip:1] # Serve correct encoding type. Header set Content-Encoding gzip # Force proxies to cache gzipped & non-gzipped css/js files separately. Header append Vary Accept-Encoding # Add headers to all responses. # Disable content sniffing, since it's an attack vector. Header always set X-Content-Type-Options nosniff drupal-7.41/scripts/0000755000000000000000000000000012611765734013135 5ustar rootrootdrupal-7.41/scripts/test.script0000644000000000000000000000027112611765734015342 0ustar rootrootThis file is for testing purposes only. It is used to test the functionality of drupal_get_filename(). See BootstrapGetFilenameTestCase::testDrupalGetFilename() for more information. drupal-7.41/scripts/generate-d6-content.sh0000644000000000000000000001523612611765734017251 0ustar rootroot#!/usr/bin/env php 11 ? array('page' => TRUE) : array(); $vocabulary['multiple'] = $multiple[$i % 12]; $vocabulary['required'] = $required[$i % 12]; $vocabulary['relations'] = 1; $vocabulary['hierarchy'] = $hierarchy[$i % 12]; $vocabulary['weight'] = $i; taxonomy_save_vocabulary($vocabulary); $parents = array(); // Vocabularies without hierarchy get one term, single parent vocabularies get // one parent and one child term. Multiple parent vocabularies get three // terms: t0, t1, t2 where t0 is a parent of both t1 and t2. for ($j = 0; $j < $vocabulary['hierarchy'] + 1; $j++) { $term = array(); $term['vid'] = $vocabulary['vid']; // For multiple parent vocabularies, omit the t0-t1 relation, otherwise // every parent in the vocabulary is a parent. $term['parent'] = $vocabulary['hierarchy'] == 2 && i == 1 ? array() : $parents; ++$term_id; $term['name'] = "term $term_id of vocabulary $voc_id (j=$j)"; $term['description'] = 'description of ' . $term['name']; $term['weight'] = $i * 3 + $j; taxonomy_save_term($term); $terms[] = $term['tid']; $parents[] = $term['tid']; } } $node_id = 0; $revision_id = 0; module_load_include('inc', 'node', 'node.pages'); for ($i = 0; $i < 24; $i++) { $uid = intval($i / 8) + 3; $user = user_load($uid); $node = new stdClass(); $node->uid = $uid; $node->type = $i < 12 ? 'page' : 'story'; $node->sticky = 0; ++$node_id; ++$revision_id; $node->title = "node title $node_id rev $revision_id (i=$i)"; $type = node_get_types('type', $node->type); if ($type->has_body) { $node->body = str_repeat("node body ($node->type) - $i", 100); $node->teaser = node_teaser($node->body); $node->filter = variable_get('filter_default_format', 1); $node->format = FILTER_FORMAT_DEFAULT; } $node->status = intval($i / 4) % 2; $node->language = ''; $node->revision = $i < 12; $node->promote = $i % 2; $node->created = $now + $i * 86400; $node->log = "added $i node"; // Make every term association different a little. For nodes with revisions, // make the initial revision have a different set of terms than the // newest revision. $node_terms = $terms; unset($node_terms[$i], $node_terms[47 - $i]); if ($node->revision) { $node->taxonomy = array($i => $terms[$i], 47-$i => $terms[47 - $i]); } else { $node->taxonomy = $node_terms; } node_save($node); path_set_alias("node/$node->nid", "content/$node->created"); if ($node->revision) { $user = user_load($uid + 3); ++$revision_id; $node->title .= " rev2 $revision_id"; $node->body = str_repeat("node revision body ($node->type) - $i", 100); $node->log = "added $i revision"; $node->taxonomy = $node_terms; node_save($node); } } // Create poll content for ($i = 0; $i < 12; $i++) { $uid = intval($i / 4) + 3; $user = user_load($uid); $node = new stdClass(); $node->uid = $uid; $node->type = 'poll'; $node->sticky = 0; $node->title = "poll title $i"; $type = node_get_types('type', $node->type); if ($type->has_body) { $node->body = str_repeat("node body ($node->type) - $i", 100); $node->teaser = node_teaser($node->body); $node->filter = variable_get('filter_default_format', 1); $node->format = FILTER_FORMAT_DEFAULT; } $node->status = intval($i / 2) % 2; $node->language = ''; $node->revision = 1; $node->promote = $i % 2; $node->created = $now + $i * 43200; $node->log = "added $i poll"; $nbchoices = ($i % 4) + 2; for ($c = 0; $c < $nbchoices; $c++) { $node->choice[] = array('chtext' => "Choice $c for poll $i"); } node_save($node); path_set_alias("node/$node->nid", "content/poll/$i"); path_set_alias("node/$node->nid/results", "content/poll/$i/results"); // Add some votes for ($v = 0; $v < ($i % 4) + 5; $v++) { $c = $v % $nbchoices; $form_state = array(); $form_state['values']['choice'] = $c; $form_state['values']['op'] = t('Vote'); drupal_execute('poll_view_voting', $form_state, $node); } } $uid = 6; $user = user_load($uid); $node = new stdClass(); $node->uid = $uid; $node->type = 'broken'; $node->sticky = 0; $node->title = "node title 24"; $node->body = str_repeat("node body ($node->type) - 37", 100); $node->teaser = node_teaser($node->body); $node->filter = variable_get('filter_default_format', 1); $node->format = FILTER_FORMAT_DEFAULT; $node->status = 1; $node->language = ''; $node->revision = 0; $node->promote = 0; $node->created = 1263769200; $node->log = "added $i node"; node_save($node); path_set_alias("node/$node->nid", "content/1263769200"); drupal-7.41/scripts/generate-d7-content.sh0000644000000000000000000002504612611765734017252 0ustar rootroot#!/usr/bin/env php fields(array('uid', 'name', 'pass', 'mail', 'status', 'created', 'access')); for ($i = 0; $i < 6; $i++) { $name = "test user $i"; $pass = md5("test PassW0rd $i !(.)"); $mail = "test$i@example.com"; $now = mktime(0, 0, 0, 1, $i + 1, 2010); $query->values(array(db_next_id(), $name, user_hash_password($pass), $mail, 1, $now, $now)); } $query->execute(); // Create vocabularies and terms. if (module_exists('taxonomy')) { $terms = array(); // All possible combinations of these vocabulary properties. $hierarchy = array(0, 1, 2, 0, 1, 2, 0, 1, 2, 0, 1, 2); $multiple = array(0, 1, 0, 1, 0, 1, 0, 1, 0, 1, 0, 1); $required = array(0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1); $voc_id = 0; $term_id = 0; for ($i = 0; $i < 24; $i++) { $vocabulary = new stdClass; ++$voc_id; $vocabulary->name = "vocabulary $voc_id (i=$i)"; $vocabulary->machine_name = 'vocabulary_' . $voc_id . '_' . $i; $vocabulary->description = "description of ". $vocabulary->name; $vocabulary->multiple = $multiple[$i % 12]; $vocabulary->required = $required[$i % 12]; $vocabulary->relations = 1; $vocabulary->hierarchy = $hierarchy[$i % 12]; $vocabulary->weight = $i; taxonomy_vocabulary_save($vocabulary); $field = array( 'field_name' => 'taxonomy_'. $vocabulary->machine_name, 'module' => 'taxonomy', 'type' => 'taxonomy_term_reference', 'cardinality' => $vocabulary->multiple || $vocabulary->tags ? FIELD_CARDINALITY_UNLIMITED : 1, 'settings' => array( 'required' => $vocabulary->required ? TRUE : FALSE, 'allowed_values' => array( array( 'vocabulary' => $vocabulary->machine_name, 'parent' => 0, ), ), ), ); field_create_field($field); $node_types = $i > 11 ? array('page') : array_keys(node_type_get_types()); foreach ($node_types as $bundle) { $instance = array( 'label' => $vocabulary->name, 'field_name' => $field['field_name'], 'bundle' => $bundle, 'entity_type' => 'node', 'settings' => array(), 'description' => $vocabulary->help, 'required' => $vocabulary->required, 'widget' => array(), 'display' => array( 'default' => array( 'type' => 'taxonomy_term_reference_link', 'weight' => 10, ), 'teaser' => array( 'type' => 'taxonomy_term_reference_link', 'weight' => 10, ), ), ); if ($vocabulary->tags) { $instance['widget'] = array( 'type' => 'taxonomy_autocomplete', 'module' => 'taxonomy', 'settings' => array( 'size' => 60, 'autocomplete_path' => 'taxonomy/autocomplete', ), ); } else { $instance['widget'] = array( 'type' => 'options_select', 'settings' => array(), ); } field_create_instance($instance); } $parents = array(); // Vocabularies without hierarchy get one term; single parent vocabularies // get one parent and one child term. Multiple parent vocabularies get // three terms: t0, t1, t2 where t0 is a parent of both t1 and t2. for ($j = 0; $j < $vocabulary->hierarchy + 1; $j++) { $term = new stdClass; $term->vocabulary_machine_name = $vocabulary->machine_name; // For multiple parent vocabularies, omit the t0-t1 relation, otherwise // every parent in the vocabulary is a parent. $term->parent = $vocabulary->hierarchy == 2 && i == 1 ? array() : $parents; ++$term_id; $term->name = "term $term_id of vocabulary $voc_id (j=$j)"; $term->description = 'description of ' . $term->name; $term->format = 'filtered_html'; $term->weight = $i * 3 + $j; taxonomy_term_save($term); $terms[] = $term->tid; $term_vocabs[$term->tid] = 'taxonomy_' . $vocabulary->machine_name; $parents[] = $term->tid; } } } $node_id = 0; $revision_id = 0; module_load_include('inc', 'node', 'node.pages'); for ($i = 0; $i < 24; $i++) { $uid = intval($i / 8) + 3; $user = user_load($uid); $node = new stdClass(); $node->uid = $uid; $node->type = $i < 12 ? 'page' : 'story'; $node->sticky = 0; ++$node_id; ++$revision_id; $node->title = "node title $node_id rev $revision_id (i=$i)"; $node->language = LANGUAGE_NONE; $body_text = str_repeat("node body ($node->type) - $i", 100); $node->body[$node->language][0]['value'] = $body_text; $node->body[$node->language][0]['summary'] = text_summary($body_text); $node->body[$node->language][0]['format'] = 'filtered_html'; $node->status = intval($i / 4) % 2; $node->revision = $i < 12; $node->promote = $i % 2; $node->created = $now + $i * 86400; $node->log = "added $i node"; // Make every term association different a little. For nodes with revisions, // make the initial revision have a different set of terms than the // newest revision. $items = array(); if (module_exists('taxonomy')) { if ($node->revision) { $node_terms = array($terms[$i], $terms[47-$i]); } else { $node_terms = $terms; unset($node_terms[$i], $node_terms[47 - $i]); } foreach ($node_terms as $tid) { $field_name = $term_vocabs[$tid]; $node->{$field_name}[LANGUAGE_NONE][] = array('tid' => $tid); } } $node->path = array('alias' => "content/$node->created"); node_save($node); if ($node->revision) { $user = user_load($uid + 3); ++$revision_id; $node->title .= " rev2 $revision_id"; $body_text = str_repeat("node revision body ($node->type) - $i", 100); $node->body[$node->language][0]['value'] = $body_text; $node->body[$node->language][0]['summary'] = text_summary($body_text); $node->body[$node->language][0]['format'] = 'filtered_html'; $node->log = "added $i revision"; $node_terms = $terms; unset($node_terms[$i], $node_terms[47 - $i]); foreach ($node_terms as $tid) { $field_name = $term_vocabs[$tid]; $node->{$field_name}[LANGUAGE_NONE][] = array('tid' => $tid); } node_save($node); } } if (module_exists('poll')) { // Create poll content. for ($i = 0; $i < 12; $i++) { $uid = intval($i / 4) + 3; $user = user_load($uid); $node = new stdClass(); $node->uid = $uid; $node->type = 'poll'; $node->sticky = 0; $node->title = "poll title $i"; $node->language = LANGUAGE_NONE; $node->status = intval($i / 2) % 2; $node->revision = 1; $node->promote = $i % 2; $node->created = REQUEST_TIME + $i * 43200; $node->runtime = 0; $node->active = 1; $node->log = "added $i poll"; $node->path = array('alias' => "content/poll/$i"); $nbchoices = ($i % 4) + 2; for ($c = 0; $c < $nbchoices; $c++) { $node->choice[] = array('chtext' => "Choice $c for poll $i", 'chvotes' => 0, 'weight' => 0); } node_save($node); $path = array( 'alias' => "content/poll/$i/results", 'source' => "node/$node->nid/results", ); path_save($path); // Add some votes. $node = node_load($node->nid); $choices = array_keys($node->choice); $original_user = $GLOBALS['user']; for ($v = 0; $v < ($i % 4); $v++) { drupal_static_reset('ip_address'); $_SERVER['REMOTE_ADDR'] = "127.0.$v.1"; $GLOBALS['user'] = drupal_anonymous_user();// We should have already allowed anon to vote. $c = $v % $nbchoices; $form_state = array(); $form_state['values']['choice'] = $choices[$c]; $form_state['values']['op'] = t('Vote'); drupal_form_submit('poll_view_voting', $form_state, $node); } } } // Test that upgrade works even on a bundle whose parent module was disabled. // This is simulated by creating an existing content type and changing the // bundle to another type through direct database update queries. $node_type = 'broken'; $uid = 6; $user = user_load($uid); $node = new stdClass(); $node->uid = $uid; $node->type = 'article'; $body_text = str_repeat("node body ($node_type) - 37", 100); $node->sticky = 0; $node->title = "node title 24"; $node->language = LANGUAGE_NONE; $node->body[$node->language][0]['value'] = $body_text; $node->body[$node->language][0]['summary'] = text_summary($body_text); $node->body[$node->language][0]['format'] = 'filtered_html'; $node->status = 1; $node->revision = 0; $node->promote = 0; $node->created = 1263769200; $node->log = "added a broken node"; $node->path = array('alias' => "content/1263769200"); node_save($node); db_update('node') ->fields(array( 'type' => $node_type, )) ->condition('nid', $node->nid) ->execute(); if (db_table_exists('field_data_body')) { db_update('field_data_body') ->fields(array( 'bundle' => $node_type, )) ->condition('entity_id', $node->nid) ->condition('entity_type', 'node') ->execute(); db_update('field_revision_body') ->fields(array( 'bundle' => $node_type, )) ->condition('entity_id', $node->nid) ->condition('entity_type', 'node') ->execute(); } db_update('field_config_instance') ->fields(array( 'bundle' => $node_type, )) ->condition('bundle', 'article') ->execute(); drupal-7.41/scripts/code-clean.sh0000644000000000000000000000107112611765734015462 0ustar rootroot#!/bin/sh find . -name "*~" -type f | xargs rm -f find . -name ".#*" -type f | xargs rm -f find . -name "*.rej" -type f | xargs rm -f find . -name "*.orig" -type f | xargs rm -f find . -name "DEADJOE" -type f | xargs rm -f find . -type f | grep -v ".psp" | grep -v ".gif" | grep -v ".jpg" | grep -v ".png" | grep -v ".tgz" | grep -v ".ico" | grep -v "druplicon" | xargs perl -wi -pe 's/\s+$/\n/' find . -type f | grep -v ".psp" | grep -v ".gif" | grep -v ".jpg" | grep -v ".png" | grep -v ".tgz" | grep -v ".ico" | grep -v "druplicon" | xargs perl -wi -pe 's/\t/ /g' drupal-7.41/scripts/cron-curl.sh0000644000000000000000000000010212611765734015366 0ustar rootroot#!/bin/sh curl --silent --compressed http://example.com/cron.php drupal-7.41/scripts/drupal.sh0000755000000000000000000001025012611765734014761 0ustar rootroot#!/usr/bin/env php " Example: {$script} "http://mysite.org/node" All arguments are long options. --help This page. --root Set the working directory for the script to the specified path. To execute Drupal this has to be the root directory of your Drupal installation, f.e. /home/www/foo/drupal (assuming Drupal running on Unix). Current directory is not required. Use surrounding quotation marks on Windows. --verbose This option displays the options as they are set, but will produce errors from setting the session. URI The URI to execute, i.e. http://default/foo/bar for executing the path '/foo/bar' in your site 'default'. URI has to be enclosed by quotation marks if there are ampersands in it (f.e. index.php?q=node&foo=bar). Prefix 'http://' is required, and the domain must exist in Drupal's sites-directory. If the given path and file exists it will be executed directly, i.e. if URI is set to http://default/bar/foo.php and bar/foo.php exists, this script will be executed without bootstrapping Drupal. To execute Drupal's cron.php, specify http://default/cron.php as the URI. To run this script without --root argument invoke it from the root directory of your Drupal installation with ./scripts/{$script} \n EOF; exit; } // define default settings $cmd = 'index.php'; $_SERVER['HTTP_HOST'] = 'default'; $_SERVER['PHP_SELF'] = '/index.php'; $_SERVER['REMOTE_ADDR'] = '127.0.0.1'; $_SERVER['SERVER_SOFTWARE'] = NULL; $_SERVER['REQUEST_METHOD'] = 'GET'; $_SERVER['QUERY_STRING'] = ''; $_SERVER['PHP_SELF'] = $_SERVER['REQUEST_URI'] = '/'; $_SERVER['HTTP_USER_AGENT'] = 'console'; // toggle verbose mode if (in_array('--verbose', $_SERVER['argv'])) { $_verbose_mode = true; } else { $_verbose_mode = false; } // parse invocation arguments while ($param = array_shift($_SERVER['argv'])) { switch ($param) { case '--root': // change working directory $path = array_shift($_SERVER['argv']); if (is_dir($path)) { chdir($path); if ($_verbose_mode) { echo "cwd changed to: {$path}\n"; } } else { echo "\nERROR: {$path} not found.\n\n"; } break; default: if (substr($param, 0, 2) == '--') { // ignore unknown options break; } else { // parse the URI $path = parse_url($param); // set site name if (isset($path['host'])) { $_SERVER['HTTP_HOST'] = $path['host']; } // set query string if (isset($path['query'])) { $_SERVER['QUERY_STRING'] = $path['query']; parse_str($path['query'], $_GET); $_REQUEST = $_GET; } // set file to execute or Drupal path (clean URLs enabled) if (isset($path['path']) && file_exists(substr($path['path'], 1))) { $_SERVER['PHP_SELF'] = $_SERVER['REQUEST_URI'] = $path['path']; $cmd = substr($path['path'], 1); } elseif (isset($path['path'])) { if (!isset($_GET['q'])) { $_REQUEST['q'] = $_GET['q'] = $path['path']; } } // display setup in verbose mode if ($_verbose_mode) { echo "Hostname set to: {$_SERVER['HTTP_HOST']}\n"; echo "Script name set to: {$cmd}\n"; echo "Path set to: {$_GET['q']}\n"; } } break; } } if (file_exists($cmd)) { include $cmd; } else { echo "\nERROR: {$cmd} not found.\n\n"; } exit(); drupal-7.41/scripts/cron-lynx.sh0000644000000000000000000000011612611765734015420 0ustar rootroot#!/bin/sh /usr/bin/lynx -source http://example.com/cron.php > /dev/null 2>&1 drupal-7.41/scripts/password-hash.sh0000755000000000000000000000447712611765734016273 0ustar rootroot#!/usr/bin/env php " Example: {$script} "mynewpassword" All arguments are long options. --help Print this page. --root Set the working directory for the script to the specified path. To execute this script this has to be the root directory of your Drupal installation, e.g. /home/www/foo/drupal (assuming Drupal running on Unix). Use surrounding quotation marks on Windows. "" ["" ["" ...]] One or more plan-text passwords enclosed by double quotes. The output hash may be manually entered into the {users}.pass field to change a password via SQL to a known value. To run this script without the --root argument invoke it from the root directory of your Drupal installation as ./scripts/{$script} \n EOF; exit; } $passwords = array(); // Parse invocation arguments. while ($param = array_shift($_SERVER['argv'])) { switch ($param) { case '--root': // Change the working directory. $path = array_shift($_SERVER['argv']); if (is_dir($path)) { chdir($path); } break; default: // Add a password to the list to be processed. $passwords[] = $param; break; } } define('DRUPAL_ROOT', getcwd()); include_once DRUPAL_ROOT . '/includes/password.inc'; include_once DRUPAL_ROOT . '/includes/bootstrap.inc'; foreach ($passwords as $password) { print("\npassword: $password \t\thash: ". user_hash_password($password) ."\n"); } print("\n"); drupal-7.41/scripts/run-tests.sh0000755000000000000000000005337612611765734015456 0ustar rootroot $tests) { $all_tests = array_merge($all_tests, array_keys($tests)); } $test_list = array(); if ($args['list']) { // Display all available tests. echo "\nAvailable test groups & classes\n"; echo "-------------------------------\n\n"; foreach ($groups as $group => $tests) { echo $group . "\n"; foreach ($tests as $class => $info) { echo " - " . $info['name'] . ' (' . $class . ')' . "\n"; } } exit; } $test_list = simpletest_script_get_test_list(); // Try to allocate unlimited time to run the tests. drupal_set_time_limit(0); simpletest_script_reporter_init(); // Setup database for test results. $test_id = db_insert('simpletest_test_id')->useDefaults(array('test_id'))->execute(); // Execute tests. simpletest_script_execute_batch($test_id, simpletest_script_get_test_list()); // Retrieve the last database prefix used for testing and the last test class // that was run from. Use the information to read the lgo file in case any // fatal errors caused the test to crash. list($last_prefix, $last_test_class) = simpletest_last_test_get($test_id); simpletest_log_read($test_id, $last_prefix, $last_test_class); // Stop the timer. simpletest_script_reporter_timer_stop(); // Display results before database is cleared. simpletest_script_reporter_display_results(); if ($args['xml']) { simpletest_script_reporter_write_xml_results(); } // Cleanup our test results. simpletest_clean_results_table($test_id); // Test complete, exit. exit; /** * Print help text. */ function simpletest_script_help() { global $args; echo << Example: {$args['script']} Profile All arguments are long options. --help Print this page. --list Display all available test groups. --clean Cleans up database tables or directories from previous, failed, tests and then exits (no tests are run). --url Immediately precedes a URL to set the host and path. You will need this parameter if Drupal is in a subdirectory on your localhost and you have not set \$base_url in settings.php. Tests can be run under SSL by including https:// in the URL. --php The absolute path to the PHP executable. Usually not needed. --concurrency [num] Run tests in parallel, up to [num] tests at a time. --all Run all available tests. --class Run tests identified by specific class names, instead of group names. --file Run tests identified by specific file names, instead of group names. Specify the path and the extension (i.e. 'modules/user/user.test'). --xml If provided, test results will be written as xml files to this path. --color Output text format results with color highlighting. --verbose Output detailed assertion messages in addition to summary. [,[, ...]] One or more tests to be run. By default, these are interpreted as the names of test groups as shown at ?q=admin/config/development/testing. These group names typically correspond to module names like "User" or "Profile" or "System", but there is also a group "XML-RPC". If --class is specified then these are interpreted as the names of specific test classes whose test methods will be run. Tests must be separated by commas. Ignored if --all is specified. To run this script you will normally invoke it from the root directory of your Drupal installation as the webserver user (differs per configuration), or root: sudo -u [wwwrun|www-data|etc] php ./scripts/{$args['script']} --url http://example.com/ --all sudo -u [wwwrun|www-data|etc] php ./scripts/{$args['script']} --url http://example.com/ --class BlockTestCase \n EOF; } /** * Parse execution argument and ensure that all are valid. * * @return The list of arguments. */ function simpletest_script_parse_args() { // Set default values. $args = array( 'script' => '', 'help' => FALSE, 'list' => FALSE, 'clean' => FALSE, 'url' => '', 'php' => '', 'concurrency' => 1, 'all' => FALSE, 'class' => FALSE, 'file' => FALSE, 'color' => FALSE, 'verbose' => FALSE, 'test_names' => array(), // Used internally. 'test-id' => 0, 'execute-test' => '', 'xml' => '', ); // Override with set values. $args['script'] = basename(array_shift($_SERVER['argv'])); $count = 0; while ($arg = array_shift($_SERVER['argv'])) { if (preg_match('/--(\S+)/', $arg, $matches)) { // Argument found. if (array_key_exists($matches[1], $args)) { // Argument found in list. $previous_arg = $matches[1]; if (is_bool($args[$previous_arg])) { $args[$matches[1]] = TRUE; } else { $args[$matches[1]] = array_shift($_SERVER['argv']); } // Clear extraneous values. $args['test_names'] = array(); $count++; } else { // Argument not found in list. simpletest_script_print_error("Unknown argument '$arg'."); exit; } } else { // Values found without an argument should be test names. $args['test_names'] += explode(',', $arg); $count++; } } // Validate the concurrency argument if (!is_numeric($args['concurrency']) || $args['concurrency'] <= 0) { simpletest_script_print_error("--concurrency must be a strictly positive integer."); exit; } return array($args, $count); } /** * Initialize script variables and perform general setup requirements. */ function simpletest_script_init($server_software) { global $args, $php; $host = 'localhost'; $path = ''; // Determine location of php command automatically, unless a command line argument is supplied. if (!empty($args['php'])) { $php = $args['php']; } elseif ($php_env = getenv('_')) { // '_' is an environment variable set by the shell. It contains the command that was executed. $php = $php_env; } elseif ($sudo = getenv('SUDO_COMMAND')) { // 'SUDO_COMMAND' is an environment variable set by the sudo program. // Extract only the PHP interpreter, not the rest of the command. list($php, ) = explode(' ', $sudo, 2); } else { simpletest_script_print_error('Unable to automatically determine the path to the PHP interpreter. Supply the --php command line argument.'); simpletest_script_help(); exit(); } // Get URL from arguments. if (!empty($args['url'])) { $parsed_url = parse_url($args['url']); $host = $parsed_url['host'] . (isset($parsed_url['port']) ? ':' . $parsed_url['port'] : ''); $path = isset($parsed_url['path']) ? $parsed_url['path'] : ''; // If the passed URL schema is 'https' then setup the $_SERVER variables // properly so that testing will run under HTTPS. if ($parsed_url['scheme'] == 'https') { $_SERVER['HTTPS'] = 'on'; } } $_SERVER['HTTP_HOST'] = $host; $_SERVER['REMOTE_ADDR'] = '127.0.0.1'; $_SERVER['SERVER_ADDR'] = '127.0.0.1'; $_SERVER['SERVER_SOFTWARE'] = $server_software; $_SERVER['SERVER_NAME'] = 'localhost'; $_SERVER['REQUEST_URI'] = $path .'/'; $_SERVER['REQUEST_METHOD'] = 'GET'; $_SERVER['SCRIPT_NAME'] = $path .'/index.php'; $_SERVER['PHP_SELF'] = $path .'/index.php'; $_SERVER['HTTP_USER_AGENT'] = 'Drupal command line'; if (!empty($_SERVER['HTTPS']) && $_SERVER['HTTPS'] == 'on') { // Ensure that any and all environment variables are changed to https://. foreach ($_SERVER as $key => $value) { $_SERVER[$key] = str_replace('http://', 'https://', $_SERVER[$key]); } } chdir(realpath(dirname(__FILE__) . '/..')); define('DRUPAL_ROOT', getcwd()); require_once DRUPAL_ROOT . '/includes/bootstrap.inc'; } /** * Execute a batch of tests. */ function simpletest_script_execute_batch($test_id, $test_classes) { global $args; // Multi-process execution. $children = array(); while (!empty($test_classes) || !empty($children)) { while (count($children) < $args['concurrency']) { if (empty($test_classes)) { break; } // Fork a child process. $test_class = array_shift($test_classes); $command = simpletest_script_command($test_id, $test_class); $process = proc_open($command, array(), $pipes, NULL, NULL, array('bypass_shell' => TRUE)); if (!is_resource($process)) { echo "Unable to fork test process. Aborting.\n"; exit; } // Register our new child. $children[] = array( 'process' => $process, 'class' => $test_class, 'pipes' => $pipes, ); } // Wait for children every 200ms. usleep(200000); // Check if some children finished. foreach ($children as $cid => $child) { $status = proc_get_status($child['process']); if (empty($status['running'])) { // The child exited, unregister it. proc_close($child['process']); if ($status['exitcode']) { echo 'FATAL ' . $test_class . ': test runner returned a non-zero error code (' . $status['exitcode'] . ').' . "\n"; } unset($children[$cid]); } } } } /** * Bootstrap Drupal and run a single test. */ function simpletest_script_run_one_test($test_id, $test_class) { try { // Bootstrap Drupal. drupal_bootstrap(DRUPAL_BOOTSTRAP_FULL); simpletest_classloader_register(); $test = new $test_class($test_id); $test->run(); $info = $test->getInfo(); $had_fails = (isset($test->results['#fail']) && $test->results['#fail'] > 0); $had_exceptions = (isset($test->results['#exception']) && $test->results['#exception'] > 0); $status = ($had_fails || $had_exceptions ? 'fail' : 'pass'); simpletest_script_print($info['name'] . ' ' . _simpletest_format_summary_line($test->results) . "\n", simpletest_script_color_code($status)); // Finished, kill this runner. exit(0); } catch (Exception $e) { echo (string) $e; exit(1); } } /** * Return a command used to run a test in a separate process. * * @param $test_id * The current test ID. * @param $test_class * The name of the test class to run. */ function simpletest_script_command($test_id, $test_class) { global $args, $php; $command = escapeshellarg($php) . ' ' . escapeshellarg('./scripts/' . $args['script']) . ' --url ' . escapeshellarg($args['url']); if ($args['color']) { $command .= ' --color'; } $command .= " --php " . escapeshellarg($php) . " --test-id $test_id --execute-test " . escapeshellarg($test_class); return $command; } /** * Get list of tests based on arguments. If --all specified then * returns all available tests, otherwise reads list of tests. * * Will print error and exit if no valid tests were found. * * @return List of tests. */ function simpletest_script_get_test_list() { global $args, $all_tests, $groups; $test_list = array(); if ($args['all']) { $test_list = $all_tests; } else { if ($args['class']) { // Check for valid class names. $test_list = array(); foreach ($args['test_names'] as $test_class) { if (class_exists($test_class)) { $test_list[] = $test_class; } else { $groups = simpletest_test_get_all(); $all_classes = array(); foreach ($groups as $group) { $all_classes = array_merge($all_classes, array_keys($group)); } simpletest_script_print_error('Test class not found: ' . $test_class); simpletest_script_print_alternatives($test_class, $all_classes, 6); exit(1); } } } elseif ($args['file']) { $files = array(); foreach ($args['test_names'] as $file) { $files[drupal_realpath($file)] = 1; } // Check for valid class names. foreach ($all_tests as $class_name) { $refclass = new ReflectionClass($class_name); $file = $refclass->getFileName(); if (isset($files[$file])) { $test_list[] = $class_name; } } } else { // Check for valid group names and get all valid classes in group. foreach ($args['test_names'] as $group_name) { if (isset($groups[$group_name])) { $test_list = array_merge($test_list, array_keys($groups[$group_name])); } else { simpletest_script_print_error('Test group not found: ' . $group_name); simpletest_script_print_alternatives($group_name, array_keys($groups)); exit(1); } } } } if (empty($test_list)) { simpletest_script_print_error('No valid tests were specified.'); exit; } return $test_list; } /** * Initialize the reporter. */ function simpletest_script_reporter_init() { global $args, $all_tests, $test_list, $results_map; $results_map = array( 'pass' => 'Pass', 'fail' => 'Fail', 'exception' => 'Exception' ); echo "\n"; echo "Drupal test run\n"; echo "---------------\n"; echo "\n"; // Tell the user about what tests are to be run. if ($args['all']) { echo "All tests will run.\n\n"; } else { echo "Tests to be run:\n"; foreach ($test_list as $class_name) { $info = call_user_func(array($class_name, 'getInfo')); echo " - " . $info['name'] . ' (' . $class_name . ')' . "\n"; } echo "\n"; } echo "Test run started:\n"; echo " " . format_date($_SERVER['REQUEST_TIME'], 'long') . "\n"; timer_start('run-tests'); echo "\n"; echo "Test summary\n"; echo "------------\n"; echo "\n"; } /** * Display jUnit XML test results. */ function simpletest_script_reporter_write_xml_results() { global $args, $test_id, $results_map; $results = db_query("SELECT * FROM {simpletest} WHERE test_id = :test_id ORDER BY test_class, message_id", array(':test_id' => $test_id)); $test_class = ''; $xml_files = array(); foreach ($results as $result) { if (isset($results_map[$result->status])) { if ($result->test_class != $test_class) { // We've moved onto a new class, so write the last classes results to a file: if (isset($xml_files[$test_class])) { file_put_contents($args['xml'] . '/' . $test_class . '.xml', $xml_files[$test_class]['doc']->saveXML()); unset($xml_files[$test_class]); } $test_class = $result->test_class; if (!isset($xml_files[$test_class])) { $doc = new DomDocument('1.0'); $root = $doc->createElement('testsuite'); $root = $doc->appendChild($root); $xml_files[$test_class] = array('doc' => $doc, 'suite' => $root); } } // For convenience: $dom_document = &$xml_files[$test_class]['doc']; // Create the XML element for this test case: $case = $dom_document->createElement('testcase'); $case->setAttribute('classname', $test_class); list($class, $name) = explode('->', $result->function, 2); $case->setAttribute('name', $name); // Passes get no further attention, but failures and exceptions get to add more detail: if ($result->status == 'fail') { $fail = $dom_document->createElement('failure'); $fail->setAttribute('type', 'failure'); $fail->setAttribute('message', $result->message_group); $text = $dom_document->createTextNode($result->message); $fail->appendChild($text); $case->appendChild($fail); } elseif ($result->status == 'exception') { // In the case of an exception the $result->function may not be a class // method so we record the full function name: $case->setAttribute('name', $result->function); $fail = $dom_document->createElement('error'); $fail->setAttribute('type', 'exception'); $fail->setAttribute('message', $result->message_group); $full_message = $result->message . "\n\nline: " . $result->line . "\nfile: " . $result->file; $text = $dom_document->createTextNode($full_message); $fail->appendChild($text); $case->appendChild($fail); } // Append the test case XML to the test suite: $xml_files[$test_class]['suite']->appendChild($case); } } // The last test case hasn't been saved to a file yet, so do that now: if (isset($xml_files[$test_class])) { file_put_contents($args['xml'] . '/' . $test_class . '.xml', $xml_files[$test_class]['doc']->saveXML()); unset($xml_files[$test_class]); } } /** * Stop the test timer. */ function simpletest_script_reporter_timer_stop() { echo "\n"; $end = timer_stop('run-tests'); echo "Test run duration: " . format_interval($end['time'] / 1000); echo "\n\n"; } /** * Display test results. */ function simpletest_script_reporter_display_results() { global $args, $test_id, $results_map; if ($args['verbose']) { // Report results. echo "Detailed test results\n"; echo "---------------------\n"; $results = db_query("SELECT * FROM {simpletest} WHERE test_id = :test_id ORDER BY test_class, message_id", array(':test_id' => $test_id)); $test_class = ''; foreach ($results as $result) { if (isset($results_map[$result->status])) { if ($result->test_class != $test_class) { // Display test class every time results are for new test class. echo "\n\n---- $result->test_class ----\n\n\n"; $test_class = $result->test_class; // Print table header. echo "Status Group Filename Line Function \n"; echo "--------------------------------------------------------------------------------\n"; } simpletest_script_format_result($result); } } } } /** * Format the result so that it fits within the default 80 character * terminal size. * * @param $result The result object to format. */ function simpletest_script_format_result($result) { global $results_map, $color; $summary = sprintf("%-9.9s %-10.10s %-17.17s %4.4s %-35.35s\n", $results_map[$result->status], $result->message_group, basename($result->file), $result->line, $result->function); simpletest_script_print($summary, simpletest_script_color_code($result->status)); $lines = explode("\n", wordwrap(trim(strip_tags($result->message)), 76)); foreach ($lines as $line) { echo " $line\n"; } } /** * Print error message prefixed with " ERROR: " and displayed in fail color * if color output is enabled. * * @param $message The message to print. */ function simpletest_script_print_error($message) { simpletest_script_print(" ERROR: $message\n", SIMPLETEST_SCRIPT_COLOR_FAIL); } /** * Print a message to the console, if color is enabled then the specified * color code will be used. * * @param $message The message to print. * @param $color_code The color code to use for coloring. */ function simpletest_script_print($message, $color_code) { global $args; if ($args['color']) { echo "\033[" . $color_code . "m" . $message . "\033[0m"; } else { echo $message; } } /** * Get the color code associated with the specified status. * * @param $status The status string to get code for. * @return Color code. */ function simpletest_script_color_code($status) { switch ($status) { case 'pass': return SIMPLETEST_SCRIPT_COLOR_PASS; case 'fail': return SIMPLETEST_SCRIPT_COLOR_FAIL; case 'exception': return SIMPLETEST_SCRIPT_COLOR_EXCEPTION; } return 0; // Default formatting. } /** * Prints alternative test names. * * Searches the provided array of string values for close matches based on the * Levenshtein algorithm. * * @see http://php.net/manual/en/function.levenshtein.php * * @param string $string * A string to test. * @param array $array * A list of strings to search. * @param int $degree * The matching strictness. Higher values return fewer matches. A value of * 4 means that the function will return strings from $array if the candidate * string in $array would be identical to $string by changing 1/4 or fewer of * its characters. */ function simpletest_script_print_alternatives($string, $array, $degree = 4) { $alternatives = array(); foreach ($array as $item) { $lev = levenshtein($string, $item); if ($lev <= strlen($item) / $degree || FALSE !== strpos($string, $item)) { $alternatives[] = $item; } } if (!empty($alternatives)) { simpletest_script_print(" Did you mean?\n", SIMPLETEST_SCRIPT_COLOR_FAIL); foreach ($alternatives as $alternative) { simpletest_script_print(" - $alternative\n", SIMPLETEST_SCRIPT_COLOR_FAIL); } } } drupal-7.41/scripts/dump-database-d6.sh0000644000000000000000000000561312611765734016514 0ustar rootroot#!/usr/bin/env php $data) { // Remove descriptions to save time and code. unset($data['description']); foreach ($data['fields'] as &$field) { unset($field['description']); } // Dump the table structure. $output .= "db_create_table('" . $table . "', " . drupal_var_export($data) . ");\n"; // Don't output values for those tables. if (substr($table, 0, 5) == 'cache' || $table == 'sessions' || $table == 'watchdog') { $output .= "\n"; continue; } // Prepare the export of values. $result = db_query('SELECT * FROM {'. $table .'}'); $insert = ''; while ($record = db_fetch_array($result)) { // users.uid is a serial and inserting 0 into a serial can break MySQL. // So record uid + 1 instead of uid for every uid and once all records // are in place, fix them up. if ($table == 'users') { $record['uid']++; } $insert .= '->values('. drupal_var_export($record) .")\n"; } // Dump the values if there are some. if ($insert) { $output .= "db_insert('". $table . "')->fields(". drupal_var_export(array_keys($data['fields'])) .")\n"; $output .= $insert; $output .= "->execute();\n"; } // Add the statement fixing the serial in the user table. if ($table == 'users') { $output .= "db_query('UPDATE {users} SET uid = uid - 1');\n"; } $output .= "\n"; } print $output; drupal-7.41/scripts/dump-database-d7.sh0000644000000000000000000000501512611765734016511 0ustar rootroot#!/usr/bin/env php $data) { // Remove descriptions to save time and code. unset($data['description']); foreach ($data['fields'] as &$field) { unset($field['description']); } // Dump the table structure. $output .= "db_create_table('" . $table . "', " . drupal_var_export($data) . ");\n"; // Don't output values for those tables. if (substr($table, 0, 5) == 'cache' || $table == 'sessions' || $table == 'watchdog') { $output .= "\n"; continue; } // Prepare the export of values. $result = db_query('SELECT * FROM {'. $table .'}', array(), array('fetch' => PDO::FETCH_ASSOC)); $insert = ''; foreach ($result as $record) { $insert .= '->values('. drupal_var_export($record) .")\n"; } // Dump the values if there are some. if ($insert) { $output .= "db_insert('". $table . "')->fields(". drupal_var_export(array_keys($data['fields'])) .")\n"; $output .= $insert; $output .= "->execute();\n"; } $output .= "\n"; } print $output; drupal-7.41/UPGRADE.txt0000644000000000000000000002361312611765734013303 0ustar rootrootINTRODUCTION ------------ This document describes how to: * Update your Drupal site from one minor 7.x version to another minor 7.x version; for example, from 7.8 to 7.9, or from 7.6 to 7.10. * Upgrade your Drupal site's major version from 6.x to 7.x. First steps and definitions: * If you are upgrading to Drupal version x.y, then x is known as the major version number, and y is known as the minor version number. The download file will be named drupal-x.y.tar.gz (or drupal-x.y.zip). * All directories mentioned in this document are relative to the directory of your Drupal installation. * Make a full backup of all files, directories, and your database(s) before starting, and save it outside your Drupal installation directory. Instructions may be found at http://drupal.org/upgrade/backing-up-the-db * It is wise to try an update or upgrade on a test copy of your site before applying it to your live site. Even minor updates can cause your site's behavior to change. * Each new release of Drupal has release notes, which explain the changes made since the previous version and any special instructions needed to update or upgrade to the new version. You can find a link to the release notes for the version you are upgrading or updating to on the Drupal project page (http://drupal.org/project/drupal). UPGRADE PROBLEMS ---------------- If you encounter errors during this process, * Note any error messages you see. * Restore your site to its previous state, using the file and database backups you created before you started the upgrade process. Do not attempt to do further upgrades on a site that had update problems. * Consult one of the support options listed on http://drupal.org/support More in-depth information on upgrading can be found at http://drupal.org/upgrade MINOR VERSION UPDATES --------------------- To update from one minor 7.x version of Drupal to any later 7.x version, after following the instructions in the INTRODUCTION section at the top of this file: 1. Log in as a user with the permission "Administer software updates". 2. Go to Administration > Configuration > Development > Maintenance mode. Enable the "Put site into maintenance mode" checkbox and save the configuration. 3. Remove all old core files and directories, except for the 'sites' directory and any custom files you added elsewhere. If you made modifications to files like .htaccess or robots.txt, you will need to re-apply them from your backup, after the new files are in place. Sometimes an update includes changes to default.settings.php (this will be noted in the release notes). If that's the case, follow these steps: - Locate your settings.php file in the /sites/* directory. (Typically sites/default.) - Make a backup copy of your settings.php file, with a different file name. - Make a copy of the new default.settings.php file, and name the copy settings.php (overwriting your previous settings.php file). - Copy the custom and site-specific entries from the backup you made into the new settings.php file. You will definitely need the lines giving the database information, and you will also want to copy in any other customizations you have added. You can find the release notes for your version at https://www.drupal.org/project/drupal. At bottom of the project page under "Downloads" use the link for your version of Drupal to view the release notes. If your version is not listed, use the 'View all releases' link. From this page you can scroll down or use the filter to find your version and its release notes. 4. Download the latest Drupal 7.x release from http://drupal.org to a directory outside of your web root. Extract the archive and copy the files into your Drupal directory. On a typical Unix/Linux command line, use the following commands to download and extract: wget http://drupal.org/files/projects/drupal-x.y.tar.gz tar -zxvf drupal-x.y.tar.gz This creates a new directory drupal-x.y/ containing all Drupal files and directories. Copy the files into your Drupal installation directory: cp -R drupal-x.y/* drupal-x.y/.htaccess /path/to/your/installation If you do not have command line access to your server, download the archive from http://drupal.org using your web browser, extract it, and then use an FTP client to upload the files to your web root. 5. Re-apply any modifications to files such as .htaccess or robots.txt. 6. Run update.php by visiting http://www.example.com/update.php (replace www.example.com with your domain name). This will update the core database tables. If you are unable to access update.php do the following: - Open settings.php with a text editor. - Find the line that says: $update_free_access = FALSE; - Change it into: $update_free_access = TRUE; - Once the upgrade is done, $update_free_access must be reverted to FALSE. 7. Go to Administration > Reports > Status report. Verify that everything is working as expected. 8. Ensure that $update_free_access is FALSE in settings.php. 9. Go to Administration > Configuration > Development > Maintenance mode. Disable the "Put site into maintenance mode" checkbox and save the configuration. MAJOR VERSION UPGRADE --------------------- To upgrade from a previous major version of Drupal to Drupal 7.x, after following the instructions in the INTRODUCTION section at the top of this file: 1. Check on the Drupal 7 status of your contributed and custom modules and themes. See http://drupal.org/node/948216 for information on upgrading contributed modules and themes. See http://drupal.org/node/895314 for a list of modules that have been moved into core for Drupal 7, and instructions on how to update them. See http://drupal.org/update/modules for information on how to update your custom modules, and http://drupal.org/update/theme for custom themes. You may decide at this point that you cannot upgrade your site, because needed modules or themes are not ready for Drupal 7. 2. Update to the latest available version of Drupal 6.x (if your current version is Drupal 5.x, you have to upgrade to 6.x first). If you need to update, download Drupal 6.x and follow the instructions in its UPGRADE.txt. This document only applies for upgrades from 6.x to 7.x. 3. In addition to updating to the latest available version of Drupal 6.x core, you must also upgrade all of your contributed modules for Drupal to their latest Drupal 6.x versions. 4. Log in as user ID 1 (the site maintenance user). 5. Go to Administer > Site configuration > Site maintenance. Select "Off-line" and save the configuration. 6. Go to Administer > Site building > Themes. Enable "Garland" and select it as the default theme. 7. Go to Administer > Site building > Modules. Disable all modules that are not listed under "Core - required" or "Core - optional". It is possible that some modules cannot be disabled, because others depend on them. Repeat this step until all non-core modules are disabled. If you know that you will not re-enable some modules for Drupal 7.x and you no longer need their data, then you can uninstall them under the Uninstall tab after disabling them. 8. On the command line or in your FTP client, remove the file sites/default/default.settings.php 9. Remove all old core files and directories, except for the 'sites' directory and any custom files you added elsewhere. If you made modifications to files like .htaccess or robots.txt, you will need to re-apply them from your backup, after the new files are in place. 10. If you uninstalled any modules, remove them from the sites/all/modules and other sites/*/modules directories. Leave other modules in place, even though they are incompatible with Drupal 7.x. 11. Download the latest Drupal 7.x release from http://drupal.org to a directory outside of your web root. Extract the archive and copy the files into your Drupal directory. On a typical Unix/Linux command line, use the following commands to download and extract: wget http://drupal.org/files/projects/drupal-x.y.tar.gz tar -zxvf drupal-x.y.tar.gz This creates a new directory drupal-x.y/ containing all Drupal files and directories. Copy the files into your Drupal installation directory: cp -R drupal-x.y/* drupal-x.y/.htaccess /path/to/your/installation If you do not have command line access to your server, download the archive from http://drupal.org using your web browser, extract it, and then use an FTP client to upload the files to your web root. 12. Re-apply any modifications to files such as .htaccess or robots.txt. 13. Make your settings.php file writeable, so that the update process can convert it to the format of Drupal 7.x. settings.php is usually located in sites/default/settings.php 14. Run update.php by visiting http://www.example.com/update.php (replace www.example.com with your domain name). This will update the core database tables. If you are unable to access update.php do the following: - Open settings.php with a text editor. - Find the line that says: $update_free_access = FALSE; - Change it into: $update_free_access = TRUE; - Once the upgrade is done, $update_free_access must be reverted to FALSE. 15. Backup your database after the core upgrade has run. 16. Replace and update your non-core modules and themes, following the procedures at http://drupal.org/node/948216 17. Go to Administration > Reports > Status report. Verify that everything is working as expected. 18. Ensure that $update_free_access is FALSE in settings.php. 19. Go to Administration > Configuration > Development > Maintenance mode. Disable the "Put site into maintenance mode" checkbox and save the configuration. To get started with Drupal 7 administration, visit http://drupal.org/getting-started/7/admin drupal-7.41/cron.php0000644000000000000000000000132012611765734013114 0ustar rootroot..' => 'directory'. As an * example, to map http://www.drupal.org:8080/mysite/test to the configuration * directory sites/example.com, the array should be defined as: * @code * $sites = array( * '8080.www.drupal.org.mysite.test' => 'example.com', * ); * @endcode * The URL, http://www.drupal.org:8080/mysite/test/, could be a symbolic link or * an Apache Alias directive that points to the Drupal root containing * index.php. An alias could also be created for a subdomain. See the * @link http://drupal.org/documentation/install online Drupal installation guide @endlink * for more information on setting up domains, subdomains, and subdirectories. * * The following examples look for a site configuration in sites/example.com: * @code * URL: http://dev.drupal.org * $sites['dev.drupal.org'] = 'example.com'; * * URL: http://localhost/example * $sites['localhost.example'] = 'example.com'; * * URL: http://localhost:8080/example * $sites['8080.localhost.example'] = 'example.com'; * * URL: http://www.drupal.org:8080/mysite/test/ * $sites['8080.www.drupal.org.mysite.test'] = 'example.com'; * @endcode * * @see default.settings.php * @see conf_path() * @see http://drupal.org/documentation/install/multi-site */ drupal-7.41/sites/all/0000755000000000000000000000000012611765734013345 5ustar rootrootdrupal-7.41/sites/all/themes/0000755000000000000000000000000012611765734014632 5ustar rootrootdrupal-7.41/sites/all/themes/README.txt0000644000000000000000000000177412611765734016341 0ustar rootrootThemes allow you to change the look and feel of your Drupal site. You can use themes contributed by others or create your own. WHAT TO PLACE IN THIS DIRECTORY? -------------------------------- Placing downloaded and custom themes in this directory separates downloaded and custom themes from Drupal core's themes. This allows Drupal core to be updated without overwriting these files. DOWNLOAD ADDITIONAL THEMES -------------------------- Contributed themes from the Drupal community may be downloaded at https://www.drupal.org/project/project_theme. MULTISITE CONFIGURATION ----------------------- In multisite configurations, themes found in this directory are available to all sites. Alternatively, the sites/your_site_name/themes directory pattern may be used to restrict themes to a specific site instance. MORE INFORMATION ----------------- Refer to the "Appearance" section of the README.txt in the Drupal root directory for further information on customizing the appearance of Drupal with custom themes. drupal-7.41/sites/all/libraries/0000755000000000000000000000000012611765734015321 5ustar rootrootdrupal-7.41/sites/all/libraries/README.txt0000644000000000000000000000022712611765734017020 0ustar rootrootThis directory should be used to place downloaded and custom libraries (such as JavaScript libraries) which are used by contributed or custom modules. drupal-7.41/sites/all/modules/0000755000000000000000000000000012611765734015015 5ustar rootrootdrupal-7.41/sites/all/modules/README.txt0000644000000000000000000000270212611765734016514 0ustar rootrootModules extend your site functionality beyond Drupal core. WHAT TO PLACE IN THIS DIRECTORY? -------------------------------- Placing downloaded and custom modules in this directory separates downloaded and custom modules from Drupal core's modules. This allows Drupal core to be updated without overwriting these files. DOWNLOAD ADDITIONAL MODULES --------------------------- Contributed modules from the Drupal community may be downloaded at https://www.drupal.org/project/project_module. ORGANIZING MODULES IN THIS DIRECTORY ------------------------------------ You may create subdirectories in this directory, to organize your added modules, without breaking the site. Some common subdirectories include "contrib" for contributed modules, and "custom" for custom modules. Note that if you move a module to a subdirectory after it has been enabled, you may need to clear the Drupal cache so it can be found. (Alternatively, you can disable the module before moving it and then re-enable it after the move.) MULTISITE CONFIGURATION ----------------------- In multisite configurations, modules found in this directory are available to all sites. Alternatively, the sites/your_site_name/modules directory pattern may be used to restrict modules to a specific site instance. MORE INFORMATION ---------------- Refer to the "Developing for Drupal" section of the README.txt in the Drupal root directory for further information on extending Drupal with custom modules. drupal-7.41/sites/README.txt0000644000000000000000000000161012611765734014271 0ustar rootrootThis directory structure contains the settings and configuration files specific to your site or sites and is an integral part of multisite configuration. The sites/all/ subdirectory structure should be used to place your custom and downloaded extensions including modules, themes, and third party libraries. Downloaded installation profiles should be placed in the /profiles directory in the Drupal root. In multisite configuration, extensions found in the sites/all directory structure are available to all sites. Alternatively, the sites/your_site_name/ subdirectory pattern may be used to restrict extensions to a specific site instance. See the respective README.txt files in sites/all/themes and sites/all/modules for additional information about obtaining and organizing extensions. See INSTALL.txt in the Drupal root for information about single-site installation or multisite configuration. drupal-7.41/sites/default/0000755000000000000000000000000012611765734014221 5ustar rootrootdrupal-7.41/sites/default/default.settings.php0000644000000000000000000005755312611765734020234 0ustar rootroot 'mysql', * 'database' => 'databasename', * 'username' => 'username', * 'password' => 'password', * 'host' => 'localhost', * 'port' => 3306, * 'prefix' => 'myprefix_', * 'collation' => 'utf8_general_ci', * ); * @endcode * * The "driver" property indicates what Drupal database driver the * connection should use. This is usually the same as the name of the * database type, such as mysql or sqlite, but not always. The other * properties will vary depending on the driver. For SQLite, you must * specify a database file name in a directory that is writable by the * webserver. For most other drivers, you must specify a * username, password, host, and database name. * * Transaction support is enabled by default for all drivers that support it, * including MySQL. To explicitly disable it, set the 'transactions' key to * FALSE. * Note that some configurations of MySQL, such as the MyISAM engine, don't * support it and will proceed silently even if enabled. If you experience * transaction related crashes with such configuration, set the 'transactions' * key to FALSE. * * For each database, you may optionally specify multiple "target" databases. * A target database allows Drupal to try to send certain queries to a * different database if it can but fall back to the default connection if not. * That is useful for master/slave replication, as Drupal may try to connect * to a slave server when appropriate and if one is not available will simply * fall back to the single master server. * * The general format for the $databases array is as follows: * @code * $databases['default']['default'] = $info_array; * $databases['default']['slave'][] = $info_array; * $databases['default']['slave'][] = $info_array; * $databases['extra']['default'] = $info_array; * @endcode * * In the above example, $info_array is an array of settings described above. * The first line sets a "default" database that has one master database * (the second level default). The second and third lines create an array * of potential slave databases. Drupal will select one at random for a given * request as needed. The fourth line creates a new database with a name of * "extra". * * For a single database configuration, the following is sufficient: * @code * $databases['default']['default'] = array( * 'driver' => 'mysql', * 'database' => 'databasename', * 'username' => 'username', * 'password' => 'password', * 'host' => 'localhost', * 'prefix' => 'main_', * 'collation' => 'utf8_general_ci', * ); * @endcode * * You can optionally set prefixes for some or all database table names * by using the 'prefix' setting. If a prefix is specified, the table * name will be prepended with its value. Be sure to use valid database * characters only, usually alphanumeric and underscore. If no prefixes * are desired, leave it as an empty string ''. * * To have all database names prefixed, set 'prefix' as a string: * @code * 'prefix' => 'main_', * @endcode * To provide prefixes for specific tables, set 'prefix' as an array. * The array's keys are the table names and the values are the prefixes. * The 'default' element is mandatory and holds the prefix for any tables * not specified elsewhere in the array. Example: * @code * 'prefix' => array( * 'default' => 'main_', * 'users' => 'shared_', * 'sessions' => 'shared_', * 'role' => 'shared_', * 'authmap' => 'shared_', * ), * @endcode * You can also use a reference to a schema/database as a prefix. This may be * useful if your Drupal installation exists in a schema that is not the default * or you want to access several databases from the same code base at the same * time. * Example: * @code * 'prefix' => array( * 'default' => 'main.', * 'users' => 'shared.', * 'sessions' => 'shared.', * 'role' => 'shared.', * 'authmap' => 'shared.', * ); * @endcode * NOTE: MySQL and SQLite's definition of a schema is a database. * * Advanced users can add or override initial commands to execute when * connecting to the database server, as well as PDO connection settings. For * example, to enable MySQL SELECT queries to exceed the max_join_size system * variable, and to reduce the database connection timeout to 5 seconds: * * @code * $databases['default']['default'] = array( * 'init_commands' => array( * 'big_selects' => 'SET SQL_BIG_SELECTS=1', * ), * 'pdo' => array( * PDO::ATTR_TIMEOUT => 5, * ), * ); * @endcode * * WARNING: These defaults are designed for database portability. Changing them * may cause unexpected behavior, including potential data loss. * * @see DatabaseConnection_mysql::__construct * @see DatabaseConnection_pgsql::__construct * @see DatabaseConnection_sqlite::__construct * * Database configuration format: * @code * $databases['default']['default'] = array( * 'driver' => 'mysql', * 'database' => 'databasename', * 'username' => 'username', * 'password' => 'password', * 'host' => 'localhost', * 'prefix' => '', * ); * $databases['default']['default'] = array( * 'driver' => 'pgsql', * 'database' => 'databasename', * 'username' => 'username', * 'password' => 'password', * 'host' => 'localhost', * 'prefix' => '', * ); * $databases['default']['default'] = array( * 'driver' => 'sqlite', * 'database' => '/path/to/databasefilename', * ); * @endcode */ $databases = array(); /** * Access control for update.php script. * * If you are updating your Drupal installation using the update.php script but * are not logged in using either an account with the "Administer software * updates" permission or the site maintenance account (the account that was * created during installation), you will need to modify the access check * statement below. Change the FALSE to a TRUE to disable the access check. * After finishing the upgrade, be sure to open this file again and change the * TRUE back to a FALSE! */ $update_free_access = FALSE; /** * Salt for one-time login links and cancel links, form tokens, etc. * * This variable will be set to a random value by the installer. All one-time * login links will be invalidated if the value is changed. Note that if your * site is deployed on a cluster of web servers, you must ensure that this * variable has the same value on each server. If this variable is empty, a hash * of the serialized database credentials will be used as a fallback salt. * * For enhanced security, you may set this variable to a value using the * contents of a file outside your docroot that is never saved together * with any backups of your Drupal files and database. * * Example: * $drupal_hash_salt = file_get_contents('/home/example/salt.txt'); * */ $drupal_hash_salt = ''; /** * Base URL (optional). * * If Drupal is generating incorrect URLs on your site, which could * be in HTML headers (links to CSS and JS files) or visible links on pages * (such as in menus), uncomment the Base URL statement below (remove the * leading hash sign) and fill in the absolute URL to your Drupal installation. * * You might also want to force users to use a given domain. * See the .htaccess file for more information. * * Examples: * $base_url = 'http://www.example.com'; * $base_url = 'http://www.example.com:8888'; * $base_url = 'http://www.example.com/drupal'; * $base_url = 'https://www.example.com:8888/drupal'; * * It is not allowed to have a trailing slash; Drupal will add it * for you. */ # $base_url = 'http://www.example.com'; // NO trailing slash! /** * PHP settings: * * To see what PHP settings are possible, including whether they can be set at * runtime (by using ini_set()), read the PHP documentation: * http://www.php.net/manual/ini.list.php * See drupal_environment_initialize() in includes/bootstrap.inc for required * runtime settings and the .htaccess file for non-runtime settings. Settings * defined there should not be duplicated here so as to avoid conflict issues. */ /** * Some distributions of Linux (most notably Debian) ship their PHP * installations with garbage collection (gc) disabled. Since Drupal depends on * PHP's garbage collection for clearing sessions, ensure that garbage * collection occurs by using the most common settings. */ ini_set('session.gc_probability', 1); ini_set('session.gc_divisor', 100); /** * Set session lifetime (in seconds), i.e. the time from the user's last visit * to the active session may be deleted by the session garbage collector. When * a session is deleted, authenticated users are logged out, and the contents * of the user's $_SESSION variable is discarded. */ ini_set('session.gc_maxlifetime', 200000); /** * Set session cookie lifetime (in seconds), i.e. the time from the session is * created to the cookie expires, i.e. when the browser is expected to discard * the cookie. The value 0 means "until the browser is closed". */ ini_set('session.cookie_lifetime', 2000000); /** * If you encounter a situation where users post a large amount of text, and * the result is stripped out upon viewing but can still be edited, Drupal's * output filter may not have sufficient memory to process it. If you * experience this issue, you may wish to uncomment the following two lines * and increase the limits of these variables. For more information, see * http://php.net/manual/pcre.configuration.php. */ # ini_set('pcre.backtrack_limit', 200000); # ini_set('pcre.recursion_limit', 200000); /** * Drupal automatically generates a unique session cookie name for each site * based on its full domain name. If you have multiple domains pointing at the * same Drupal site, you can either redirect them all to a single domain (see * comment in .htaccess), or uncomment the line below and specify their shared * base domain. Doing so assures that users remain logged in as they cross * between your various domains. Make sure to always start the $cookie_domain * with a leading dot, as per RFC 2109. */ # $cookie_domain = '.example.com'; /** * Variable overrides: * * To override specific entries in the 'variable' table for this site, * set them here. You usually don't need to use this feature. This is * useful in a configuration file for a vhost or directory, rather than * the default settings.php. Any configuration setting from the 'variable' * table can be given a new value. Note that any values you provide in * these variable overrides will not be modifiable from the Drupal * administration interface. * * The following overrides are examples: * - site_name: Defines the site's name. * - theme_default: Defines the default theme for this site. * - anonymous: Defines the human-readable name of anonymous users. * Remove the leading hash signs to enable. */ # $conf['site_name'] = 'My Drupal site'; # $conf['theme_default'] = 'garland'; # $conf['anonymous'] = 'Visitor'; /** * A custom theme can be set for the offline page. This applies when the site * is explicitly set to maintenance mode through the administration page or when * the database is inactive due to an error. It can be set through the * 'maintenance_theme' key. The template file should also be copied into the * theme. It is located inside 'modules/system/maintenance-page.tpl.php'. * Note: This setting does not apply to installation and update pages. */ # $conf['maintenance_theme'] = 'bartik'; /** * Reverse Proxy Configuration: * * Reverse proxy servers are often used to enhance the performance * of heavily visited sites and may also provide other site caching, * security, or encryption benefits. In an environment where Drupal * is behind a reverse proxy, the real IP address of the client should * be determined such that the correct client IP address is available * to Drupal's logging, statistics, and access management systems. In * the most simple scenario, the proxy server will add an * X-Forwarded-For header to the request that contains the client IP * address. However, HTTP headers are vulnerable to spoofing, where a * malicious client could bypass restrictions by setting the * X-Forwarded-For header directly. Therefore, Drupal's proxy * configuration requires the IP addresses of all remote proxies to be * specified in $conf['reverse_proxy_addresses'] to work correctly. * * Enable this setting to get Drupal to determine the client IP from * the X-Forwarded-For header (or $conf['reverse_proxy_header'] if set). * If you are unsure about this setting, do not have a reverse proxy, * or Drupal operates in a shared hosting environment, this setting * should remain commented out. * * In order for this setting to be used you must specify every possible * reverse proxy IP address in $conf['reverse_proxy_addresses']. * If a complete list of reverse proxies is not available in your * environment (for example, if you use a CDN) you may set the * $_SERVER['REMOTE_ADDR'] variable directly in settings.php. * Be aware, however, that it is likely that this would allow IP * address spoofing unless more advanced precautions are taken. */ # $conf['reverse_proxy'] = TRUE; /** * Specify every reverse proxy IP address in your environment. * This setting is required if $conf['reverse_proxy'] is TRUE. */ # $conf['reverse_proxy_addresses'] = array('a.b.c.d', ...); /** * Set this value if your proxy server sends the client IP in a header * other than X-Forwarded-For. */ # $conf['reverse_proxy_header'] = 'HTTP_X_CLUSTER_CLIENT_IP'; /** * Page caching: * * By default, Drupal sends a "Vary: Cookie" HTTP header for anonymous page * views. This tells a HTTP proxy that it may return a page from its local * cache without contacting the web server, if the user sends the same Cookie * header as the user who originally requested the cached page. Without "Vary: * Cookie", authenticated users would also be served the anonymous page from * the cache. If the site has mostly anonymous users except a few known * editors/administrators, the Vary header can be omitted. This allows for * better caching in HTTP proxies (including reverse proxies), i.e. even if * clients send different cookies, they still get content served from the cache. * However, authenticated users should access the site directly (i.e. not use an * HTTP proxy, and bypass the reverse proxy if one is used) in order to avoid * getting cached pages from the proxy. */ # $conf['omit_vary_cookie'] = TRUE; /** * CSS/JS aggregated file gzip compression: * * By default, when CSS or JS aggregation and clean URLs are enabled Drupal will * store a gzip compressed (.gz) copy of the aggregated files. If this file is * available then rewrite rules in the default .htaccess file will serve these * files to browsers that accept gzip encoded content. This allows pages to load * faster for these users and has minimal impact on server load. If you are * using a webserver other than Apache httpd, or a caching reverse proxy that is * configured to cache and compress these files itself you may want to uncomment * one or both of the below lines, which will prevent gzip files being stored. */ # $conf['css_gzip_compression'] = FALSE; # $conf['js_gzip_compression'] = FALSE; /** * Block caching: * * Block caching may not be compatible with node access modules depending on * how the original block cache policy is defined by the module that provides * the block. By default, Drupal therefore disables block caching when one or * more modules implement hook_node_grants(). If you consider block caching to * be safe on your site and want to bypass this restriction, uncomment the line * below. */ # $conf['block_cache_bypass_node_grants'] = TRUE; /** * String overrides: * * To override specific strings on your site with or without enabling the Locale * module, add an entry to this list. This functionality allows you to change * a small number of your site's default English language interface strings. * * Remove the leading hash signs to enable. */ # $conf['locale_custom_strings_en'][''] = array( # 'forum' => 'Discussion board', # '@count min' => '@count minutes', # ); /** * * IP blocking: * * To bypass database queries for denied IP addresses, use this setting. * Drupal queries the {blocked_ips} table by default on every page request * for both authenticated and anonymous users. This allows the system to * block IP addresses from within the administrative interface and before any * modules are loaded. However on high traffic websites you may want to avoid * this query, allowing you to bypass database access altogether for anonymous * users under certain caching configurations. * * If using this setting, you will need to add back any IP addresses which * you may have blocked via the administrative interface. Each element of this * array represents a blocked IP address. Uncommenting the array and leaving it * empty will have the effect of disabling IP blocking on your site. * * Remove the leading hash signs to enable. */ # $conf['blocked_ips'] = array( # 'a.b.c.d', # ); /** * Fast 404 pages: * * Drupal can generate fully themed 404 pages. However, some of these responses * are for images or other resource files that are not displayed to the user. * This can waste bandwidth, and also generate server load. * * The options below return a simple, fast 404 page for URLs matching a * specific pattern: * - 404_fast_paths_exclude: A regular expression to match paths to exclude, * such as images generated by image styles, or dynamically-resized images. * The default pattern provided below also excludes the private file system. * If you need to add more paths, you can add '|path' to the expression. * - 404_fast_paths: A regular expression to match paths that should return a * simple 404 page, rather than the fully themed 404 page. If you don't have * any aliases ending in htm or html you can add '|s?html?' to the expression. * - 404_fast_html: The html to return for simple 404 pages. * * Add leading hash signs if you would like to disable this functionality. */ $conf['404_fast_paths_exclude'] = '/\/(?:styles)|(?:system\/files)\//'; $conf['404_fast_paths'] = '/\.(?:txt|png|gif|jpe?g|css|js|ico|swf|flv|cgi|bat|pl|dll|exe|asp)$/i'; $conf['404_fast_html'] = '404 Not Found

              Not Found

              The requested URL "@path" was not found on this server.

              '; /** * By default the page request process will return a fast 404 page for missing * files if they match the regular expression set in '404_fast_paths' and not * '404_fast_paths_exclude' above. 404 errors will simultaneously be logged in * the Drupal system log. * * You can choose to return a fast 404 page earlier for missing pages (as soon * as settings.php is loaded) by uncommenting the line below. This speeds up * server response time when loading 404 error pages and prevents the 404 error * from being logged in the Drupal system log. In order to prevent valid pages * such as image styles and other generated content that may match the * '404_fast_paths' regular expression from returning 404 errors, it is * necessary to add them to the '404_fast_paths_exclude' regular expression * above. Make sure that you understand the effects of this feature before * uncommenting the line below. */ # drupal_fast_404(); /** * External access proxy settings: * * If your site must access the Internet via a web proxy then you can enter * the proxy settings here. Currently only basic authentication is supported * by using the username and password variables. The proxy_user_agent variable * can be set to NULL for proxies that require no User-Agent header or to a * non-empty string for proxies that limit requests to a specific agent. The * proxy_exceptions variable is an array of host names to be accessed directly, * not via proxy. */ # $conf['proxy_server'] = ''; # $conf['proxy_port'] = 8080; # $conf['proxy_username'] = ''; # $conf['proxy_password'] = ''; # $conf['proxy_user_agent'] = ''; # $conf['proxy_exceptions'] = array('127.0.0.1', 'localhost'); /** * Authorized file system operations: * * The Update manager module included with Drupal provides a mechanism for * site administrators to securely install missing updates for the site * directly through the web user interface. On securely-configured servers, * the Update manager will require the administrator to provide SSH or FTP * credentials before allowing the installation to proceed; this allows the * site to update the new files as the user who owns all the Drupal files, * instead of as the user the webserver is running as. On servers where the * webserver user is itself the owner of the Drupal files, the administrator * will not be prompted for SSH or FTP credentials (note that these server * setups are common on shared hosting, but are inherently insecure). * * Some sites might wish to disable the above functionality, and only update * the code directly via SSH or FTP themselves. This setting completely * disables all functionality related to these authorized file operations. * * @see http://drupal.org/node/244924 * * Remove the leading hash signs to disable. */ # $conf['allow_authorize_operations'] = FALSE; /** * Theme debugging: * * When debugging is enabled: * - The markup of each template is surrounded by HTML comments that contain * theming information, such as template file name suggestions. * - Note that this debugging markup will cause automated tests that directly * check rendered HTML to fail. * * For more information about debugging theme templates, see * https://www.drupal.org/node/223440#theme-debug. * * Not recommended in production environments. * * Remove the leading hash sign to enable. */ # $conf['theme_debug'] = TRUE; drupal-7.41/modules/0000755000000000000000000000000012611765734013116 5ustar rootrootdrupal-7.41/modules/trigger/0000755000000000000000000000000012611765734014561 5ustar rootrootdrupal-7.41/modules/trigger/trigger.info0000644000000000000000000000053712611767501017100 0ustar rootrootname = Trigger description = Enables actions to be fired on certain system events, such as when new content is created. package = Core version = VERSION core = 7.x files[] = trigger.test configure = admin/structure/trigger ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/trigger/tests/0000755000000000000000000000000012611765734015723 5ustar rootrootdrupal-7.41/modules/trigger/tests/trigger_test.module0000644000000000000000000000750312611765734021641 0ustar rootroot array( 'type' => 'system', 'label' => t('Cron test action'), 'configurable' => FALSE, 'triggers' => array('cron'), ), 'trigger_test_system_cron_conf_action' => array( 'type' => 'system', 'label' => t('Cron test configurable action'), 'configurable' => TRUE, 'triggers' => array('cron'), ), 'trigger_test_generic_action' => array( 'type' => 'system', 'label' => t('Generic test action'), 'configurable' => FALSE, 'triggers' => array( 'taxonomy_term_insert', 'taxonomy_term_update', 'taxonomy_delete', 'comment_insert', 'comment_update', 'comment_delete', 'user_insert', 'user_update', 'user_delete', 'user_login', 'user_logout', 'user_view', ), ), 'trigger_test_generic_any_action' => array( 'type' => 'system', 'label' => t('Generic test action for any trigger'), 'configurable' => FALSE, 'triggers' => array('any'), ), ); } /** * Implements hook_trigger_info(). */ function trigger_test_trigger_info() { // Register triggers that this module provides. The first is an additional // node trigger and the second is our own, which should create a new tab // on the trigger assignment page. The last tests long trigger names. return array( 'node' => array( 'node_triggertest' => array( 'label' => t('A test trigger is fired'), ), ), 'trigger_test' => array( 'trigger_test_triggertest' => array( 'label' => t('Another test trigger is fired'), ), 'trigger_test_we_sweat_it_out_in_the_streets_of_a_runaway_american_dream' => array( 'label' => t('A test trigger with a name over 64 characters'), ), ), ); } /** * Action fired during the "cron run" trigger test. */ function trigger_test_system_cron_action() { // Indicate successful execution by setting a persistent variable. variable_set('trigger_test_system_cron_action', TRUE); } /** * Implement a configurable Drupal action. */ function trigger_test_system_cron_conf_action($object, $context) { // Indicate successful execution by incrementing a persistent variable. $value = variable_get('trigger_test_system_cron_conf_action', 0) + 1; variable_set('trigger_test_system_cron_conf_action', $value); } /** * Form for configurable test action. */ function trigger_test_system_cron_conf_action_form($context) { if (!isset($context['subject'])) { $context['subject'] = ''; } $form['subject'] = array( '#type' => 'textfield', '#default_value' => $context['subject'], ); return $form; } /** * Form submission handler for configurable test action. */ function trigger_test_system_cron_conf_action_submit($form, $form_state) { $form_values = $form_state['values']; // Process the HTML form to store configuration. The keyed array that // we return will be serialized to the database. $params = array( 'subject' => $form_values['subject'], ); return $params; } /** * Action fired during the "taxonomy", "comment", and "user" trigger tests. */ function trigger_test_generic_action($context) { // Indicate successful execution by setting a persistent variable. variable_set('trigger_test_generic_action', TRUE); } /** * Action fired during the additional trigger tests. */ function trigger_test_generic_any_action($context) { // Indicate successful execution by setting a persistent variable. variable_set('trigger_test_generic_any_action', variable_get('trigger_test_generic_any_action', 0) + 1); } drupal-7.41/modules/trigger/tests/trigger_test.info0000644000000000000000000000036312611767501021276 0ustar rootrootname = "Trigger Test" description = "Support module for Trigger tests." package = Testing core = 7.x hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/trigger/trigger.api.php0000644000000000000000000000517512611765734017515 0ustar rootroot array( 'node_presave' => array( 'label' => t('When either saving new content or updating existing content'), ), 'node_insert' => array( 'label' => t('After saving new content'), ), 'node_update' => array( 'label' => t('After saving updated content'), ), 'node_delete' => array( 'label' => t('After deleting content'), ), 'node_view' => array( 'label' => t('When content is viewed by an authenticated user'), ), ), ); } /** * Alter triggers declared by hook_trigger_info(). * * @param $triggers * Array of trigger information returned by hook_trigger_info() * implementations. Modify this array in place. See hook_trigger_info() * for information on what this might contain. */ function hook_trigger_info_alter(&$triggers) { $triggers['node']['node_insert']['label'] = t('When content is saved'); } /** * @} End of "addtogroup hooks". */ drupal-7.41/modules/trigger/trigger.admin.inc0000644000000000000000000002477412611765734020024 0ustar rootroot $hooks) { if ($module == $module_to_display) { foreach ($hooks as $hook => $description) { $form_id = 'trigger_' . $hook . '_assign_form'; $build[$form_id] = drupal_get_form($form_id, $module, $hook, $description['label']); } } } return $build; } /** * Form constructor for confirmation page for removal of an assigned action. * * @param $module * The tab of triggers the user will be directed to after successful * removal of the action, or if the confirmation form is cancelled. * @param $hook * The name of the trigger hook, e.g., 'node_insert'. * @param $aid * The action ID. * * @see trigger_unassign_submit() * @ingroup forms */ function trigger_unassign($form, $form_state, $module, $hook = NULL, $aid = NULL) { if (!isset($hook, $aid)) { drupal_goto('admin/structure/trigger'); } $form['hook'] = array( '#type' => 'value', '#value' => $hook, ); $form['module'] = array( '#type' => 'value', '#value' => $module, ); $form['aid'] = array( '#type' => 'value', '#value' => $aid, ); $action = actions_function_lookup($aid); $actions = actions_get_all_actions(); $destination = 'admin/structure/trigger/' . $module; return confirm_form($form, t('Are you sure you want to unassign the action %title?', array('%title' => $actions[$action]['label'])), $destination, t('You can assign it again later if you wish.'), t('Unassign'), t('Cancel') ); } /** * Form submission handler for trigger_unassign(). */ function trigger_unassign_submit($form, &$form_state) { if ($form_state['values']['confirm'] == 1) { $aid = actions_function_lookup($form_state['values']['aid']); db_delete('trigger_assignments') ->condition('hook', $form_state['values']['hook']) ->condition('aid', $aid) ->execute(); drupal_static_reset('trigger_get_assigned_actions'); $actions = actions_get_all_actions(); watchdog('actions', 'Action %action has been unassigned.', array('%action' => $actions[$aid]['label'])); drupal_set_message(t('Action %action has been unassigned.', array('%action' => $actions[$aid]['label']))); $form_state['redirect'] = 'admin/structure/trigger/' . $form_state['values']['module']; } else { drupal_goto('admin/structure/trigger'); } } /** * Returns the form for assigning an action to a trigger. * * @param $module * The name of the trigger group, e.g., 'node'. * @param $hook * The name of the trigger hook, e.g., 'node_insert'. * @param $label * A plain English description of what this trigger does. * * @see trigger_assign_form_validate() * @see trigger_assign_form_submit() * @ingroup forms */ function trigger_assign_form($form, $form_state, $module, $hook, $label) { $form['module'] = array( '#type' => 'hidden', '#value' => $module, ); $form['hook'] = array( '#type' => 'hidden', '#value' => $hook, ); // All of these forms use the same validate and submit functions. $form['#validate'][] = 'trigger_assign_form_validate'; $form['#submit'][] = 'trigger_assign_form_submit'; $options = array(); $functions = array(); // Restrict the options list to actions that declare support for this hook. foreach (actions_list() as $func => $metadata) { if (isset($metadata['triggers']) && array_intersect(array($hook, 'any'), $metadata['triggers'])) { $functions[] = $func; } } foreach (actions_actions_map(actions_get_all_actions()) as $aid => $action) { if (in_array($action['callback'], $functions)) { $options[$action['type']][$aid] = $action['label']; } } $form[$hook] = array( '#type' => 'fieldset', // !description is correct, since these labels are passed through t() in // hook_trigger_info(). '#title' => t('Trigger: !description', array('!description' => $label)), '#theme' => 'trigger_display', ); // Retrieve actions that are already assigned to this hook combination. $actions = trigger_get_assigned_actions($hook); $form[$hook]['assigned']['#type'] = 'value'; $form[$hook]['assigned']['#value'] = array(); foreach ($actions as $aid => $info) { // If action is defined unassign it, otherwise offer to delete all orphaned // actions. $hash = drupal_hash_base64($aid, TRUE); if (actions_function_lookup($hash)) { $form[$hook]['assigned']['#value'][$aid] = array( 'label' => $info['label'], 'link' => l(t('unassign'), "admin/structure/trigger/unassign/$module/$hook/$hash"), ); } else { // Link to system_actions_remove_orphans() to do the clean up. $form[$hook]['assigned']['#value'][$aid] = array( 'label' => $info['label'], 'link' => l(t('Remove orphaned actions'), "admin/config/system/actions/orphan"), ); } } $form[$hook]['parent'] = array( '#type' => 'container', '#attributes' => array('class' => array('container-inline')), ); // List possible actions that may be assigned. if (count($options) != 0) { $form[$hook]['parent']['aid'] = array( '#type' => 'select', '#title' => t('List of trigger actions when !description', array('!description' => $label)), '#title_display' => 'invisible', '#options' => $options, '#empty_option' => t('Choose an action'), ); $form[$hook]['parent']['submit'] = array( '#type' => 'submit', '#value' => t('Assign') ); } else { $form[$hook]['none'] = array( '#markup' => t('No actions available for this trigger. Add action.', array('@link' => url('admin/config/system/actions/manage'))) ); } return $form; } /** * Form validation handler for trigger_assign_form(). * * Makes sure that the user is not re-assigning an action to an event. * * @see trigger_assign_form_submit() */ function trigger_assign_form_validate($form, $form_state) { $form_values = $form_state['values']; if (!empty($form_values['aid'])) { $aid = actions_function_lookup($form_values['aid']); $aid_exists = db_query("SELECT aid FROM {trigger_assignments} WHERE hook = :hook AND aid = :aid", array( ':hook' => $form_values['hook'], ':aid' => $aid, ))->fetchField(); if ($aid_exists) { form_set_error($form_values['hook'], t('The action you chose is already assigned to that trigger.')); } } } /** * Form submission handler for trigger_assign_form(). * * @see trigger_assign_form_validate() */ function trigger_assign_form_submit($form, &$form_state) { if (!empty($form_state['values']['aid'])) { $aid = actions_function_lookup($form_state['values']['aid']); $weight = db_query("SELECT MAX(weight) FROM {trigger_assignments} WHERE hook = :hook", array(':hook' => $form_state['values']['hook']))->fetchField(); // Insert the new action. db_insert('trigger_assignments') ->fields(array( 'hook' => $form_state['values']['hook'], 'aid' => $aid, 'weight' => $weight + 1, )) ->execute(); // If we are not configuring an action for a "presave" hook and this action // changes an object property, then we need to save the object, so the // property change will persist. $actions = actions_list(); if (strpos($form_state['values']['hook'], 'presave') === FALSE && isset($actions[$aid]['behavior']) && in_array('changes_property', $actions[$aid]['behavior'])) { // Determine the corresponding save action name for this action. $save_action = strtok($aid, '_') . '_save_action'; // If no corresponding save action exists, we need to bail out. if (!isset($actions[$save_action])) { throw new Exception(t('Missing/undefined save action (%save_aid) for %aid action.', array('%save_aid' => $aid, '%aid' => $aid))); } // Delete previous save action if it exists, and re-add it using a higher // weight. $save_action_assigned = db_query("SELECT aid FROM {trigger_assignments} WHERE hook = :hook AND aid = :aid", array(':hook' => $form_state['values']['hook'], ':aid' => $save_action))->fetchField(); if ($save_action_assigned) { db_delete('trigger_assignments') ->condition('hook', $form_state['values']['hook']) ->condition('aid', $save_action) ->execute(); } db_insert('trigger_assignments') ->fields(array( 'hook' => $form_state['values']['hook'], 'aid' => $save_action, 'weight' => $weight + 2, )) ->execute(); // If no save action existed before, inform the user about it. if (!$save_action_assigned) { drupal_set_message(t('The %label action has been appended, which is required to save the property change.', array('%label' => $actions[$save_action]['label']))); } // Otherwise, just inform about the new weight. else { drupal_set_message(t('The %label action was moved to save the property change.', array('%label' => $actions[$save_action]['label']))); } } } drupal_static_reset('trigger_get_assigned_actions'); } /** * Returns HTML for the form showing actions assigned to a trigger. * * @param $variables * An associative array containing: * - element: The fieldset including all assigned actions. * * @ingroup themeable */ function theme_trigger_display($variables) { $element = $variables['element']; $header = array(); $rows = array(); if (isset($element['assigned']) && count($element['assigned']['#value'])) { $header = array(array('data' => t('Name')), array('data' => t('Operation'))); $rows = array(); foreach ($element['assigned']['#value'] as $aid => $info) { $rows[] = array( check_plain($info['label']), $info['link'] ); } } if (count($rows)) { $output = theme('table', array('header' => $header, 'rows' => $rows)) . drupal_render_children($element); } else { $output = drupal_render_children($element); } return $output; } drupal-7.41/modules/trigger/trigger.install0000644000000000000000000000702312611765734017616 0ustar rootroot 'Maps trigger to hook and operation assignments from trigger.module.', 'fields' => array( 'hook' => array( 'type' => 'varchar', 'length' => 78, 'not null' => TRUE, 'default' => '', 'description' => 'Primary Key: The name of the internal Drupal hook; for example, node_insert.', ), 'aid' => array( 'type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => '', 'description' => "Primary Key: Action's {actions}.aid.", ), 'weight' => array( 'type' => 'int', 'not null' => TRUE, 'default' => 0, 'description' => 'The weight of the trigger assignment in relation to other triggers.', ), ), 'primary key' => array('hook', 'aid'), 'foreign keys' => array( 'action' => array( 'table' => 'actions', 'columns' => array('aid' => 'aid'), ), ), ); return $schema; } /** * Implements hook_install(). */ function trigger_install() { // Do initial synchronization of actions in code and the database. actions_synchronize(); } /** * Alter the "hook" field and drop the "op field" of {trigger_assignments}. * * Increase the length of the "hook" field to 78 characters and adds operation * names to the hook names, and drops the "op" field. */ function trigger_update_7000() { db_drop_primary_key('trigger_assignments'); db_change_field('trigger_assignments', 'hook', 'hook', array('type' => 'varchar', 'length' => 78, 'not null' => TRUE, 'default' => '', 'description' => 'Primary Key: The name of the internal Drupal hook; for example, node_insert.')); $result = db_query("SELECT hook, op, aid FROM {trigger_assignments} WHERE op <> ''"); foreach ($result as $record) { db_update('trigger_assignments') ->fields(array('hook' => $record->hook . '_' . $record->op)) ->condition('hook', $record->hook) ->condition('op', $record->op) ->condition('aid', $record->aid) ->execute(); } db_drop_field('trigger_assignments', 'op'); db_add_primary_key('trigger_assignments', array('hook', 'aid')); } /** * @addtogroup updates-7.x-extra * @{ */ /** * Increase the length of the "hook" field to 78 characters. * * This is a separate function for those who ran an older version of * trigger_update_7000() that did not do this. */ function trigger_update_7001() { db_drop_primary_key('trigger_assignments'); db_change_field('trigger_assignments', 'hook', 'hook', array('type' => 'varchar', 'length' => 78, 'not null' => TRUE, 'default' => '', 'description' => 'Primary Key: The name of the internal Drupal hook; for example, node_insert.', ), array('primary key' => array('hook', 'aid'))); } /** * Renames nodeapi to node. */ function trigger_update_7002() { $result = db_query("SELECT hook, aid FROM {trigger_assignments}"); foreach($result as $record) { $new_hook = str_replace('nodeapi', 'node', $record->hook); db_update('trigger_assignments') ->fields(array('hook' => $new_hook)) ->condition('hook', $record->hook) ->condition('aid', $record->aid) ->execute(); } } /** * @} End of "addtogroup updates-7.x-extra". */ drupal-7.41/modules/trigger/trigger.module0000644000000000000000000005017712611765734017445 0ustar rootroot' . t('Triggers are events on your site, such as new content being added or a user logging in. The Trigger module associates these triggers with actions (functional tasks), such as unpublishing content containing certain keywords or e-mailing an administrator. The Actions settings page contains a list of existing actions and provides the ability to create and configure advanced actions (actions requiring configuration, such as an e-mail address or a list of banned words).', array('@url' => url('admin/config/system/actions'))) . '

              '; $module = $matches[1]; $trigger_info = _trigger_tab_information(); if (!empty($trigger_info[$module])) { $explanation .= '

              ' . t('There is a tab on this page for each module that defines triggers. On this tab you can assign actions to run when triggers from the @module-name module happen.', array('@module-help' => url('admin/help/' . $module), '@module-name' => $trigger_info[$module])) . '

              '; } return $explanation; } if ($path == 'admin/help#trigger') { $output = ''; $output .= '

              ' . t('About') . '

              '; $output .= '

              ' . t('The Trigger module provides the ability to cause actions to run when certain triggers take place on your site. Triggers are events, such as new content being added to your site or a user logging in, and actions are tasks, such as unpublishing content or e-mailing an administrator. For more information, see the online handbook entry for Trigger module.', array('@trigger' => 'http://drupal.org/documentation/modules/trigger/')) . '

              '; $output .= '

              ' . t('Uses') . '

              '; $output .= '
              '; $output .= '
              ' . t('Configuring triggers and actions') . '
              '; $output .= '
              ' . t('The combination of actions and triggers can perform many useful tasks, such as e-mailing an administrator if a user account is deleted, or automatically unpublishing comments that contain certain words. To set up a trigger/action combination, first visit the Actions configuration page, where you can either verify that the action you want is already listed, or create a new advanced action. You will need to set up an advanced action if there are configuration options in your trigger/action combination, such as specifying an e-mail address or a list of banned words. After configuring or verifying your action, visit the Triggers configuration page and choose the appropriate tab (Comment, Taxonomy, etc.), where you can assign the action to run when the trigger event occurs.', array('@triggers-page' => url('admin/structure/trigger'), '@actions-page' => url('admin/config/system/actions'))) . '
              '; $output .= '
              '; return $output; } } /** * Implements hook_menu(). */ function trigger_menu() { $items['admin/structure/trigger'] = array( 'title' => 'Triggers', 'description' => 'Configure when to execute actions.', 'page callback' => 'trigger_assign', 'access arguments' => array('administer actions'), 'file' => 'trigger.admin.inc', ); $trigger_info = _trigger_tab_information(); foreach ($trigger_info as $module => $module_name) { $items["admin/structure/trigger/$module"] = array( 'title' => $module_name, 'page callback' => 'trigger_assign', 'page arguments' => array($module), 'access arguments' => array('administer actions'), 'type' => MENU_LOCAL_TASK, 'file' => 'trigger.admin.inc', ); } $items['admin/structure/trigger/unassign'] = array( 'title' => 'Unassign', 'description' => 'Unassign an action from a trigger.', 'page callback' => 'drupal_get_form', 'page arguments' => array('trigger_unassign'), // Only accessible if there are any actions that can be unassigned. 'access callback' => 'trigger_menu_unassign_access', // Only output in the breadcrumb, not in menu trees. 'type' => MENU_VISIBLE_IN_BREADCRUMB, 'file' => 'trigger.admin.inc', ); return $items; } /** * Access callback: Determines if triggers can be unassigned. * * @return bool * TRUE if there are triggers that the user can unassign, FALSE otherwise. * * @see trigger_menu() */ function trigger_menu_unassign_access() { if (!user_access('administer actions')) { return FALSE; } $count = db_select('trigger_assignments') ->countQuery() ->execute() ->fetchField(); return $count > 0; } /** * Implements hook_trigger_info(). * * Defines all the triggers that this module implements triggers for. */ function trigger_trigger_info() { return array( 'node' => array( 'node_presave' => array( 'label' => t('When either saving new content or updating existing content'), ), 'node_insert' => array( 'label' => t('After saving new content'), ), 'node_update' => array( 'label' => t('After saving updated content'), ), 'node_delete' => array( 'label' => t('After deleting content'), ), 'node_view' => array( 'label' => t('When content is viewed by an authenticated user'), ), ), 'comment' => array( 'comment_presave' => array( 'label' => t('When either saving a new comment or updating an existing comment'), ), 'comment_insert' => array( 'label' => t('After saving a new comment'), ), 'comment_update' => array( 'label' => t('After saving an updated comment'), ), 'comment_delete' => array( 'label' => t('After deleting a comment'), ), 'comment_view' => array( 'label' => t('When a comment is being viewed by an authenticated user'), ), ), 'taxonomy' => array( 'taxonomy_term_insert' => array( 'label' => t('After saving a new term to the database'), ), 'taxonomy_term_update' => array( 'label' => t('After saving an updated term to the database'), ), 'taxonomy_term_delete' => array( 'label' => t('After deleting a term'), ), ), 'system' => array( 'cron' => array( 'label' => t('When cron runs'), ), ), 'user' => array( 'user_insert' => array( 'label' => t('After creating a new user account'), ), 'user_update' => array( 'label' => t('After updating a user account'), ), 'user_delete' => array( 'label' => t('After a user has been deleted'), ), 'user_login' => array( 'label' => t('After a user has logged in'), ), 'user_logout' => array( 'label' => t('After a user has logged out'), ), 'user_view' => array( 'label' => t("When a user's profile is being viewed"), ), ), ); } /** * Gets the action IDs of actions to be executed for a hook. * * @param $hook * The name of the hook being fired. * * @return * An array whose keys are action IDs that the user has associated with * this trigger, and whose values are arrays containing the action type and * label. */ function trigger_get_assigned_actions($hook) { $actions = &drupal_static(__FUNCTION__, array()); if (!isset($actions[$hook])) { $actions[$hook] = db_query("SELECT ta.aid, a.type, a.label FROM {trigger_assignments} ta LEFT JOIN {actions} a ON ta.aid = a.aid WHERE ta.hook = :hook ORDER BY ta.weight", array( ':hook' => $hook, ))->fetchAllAssoc('aid', PDO::FETCH_ASSOC); } return $actions[$hook]; } /** * Implements hook_theme(). */ function trigger_theme() { return array( 'trigger_display' => array( 'render element' => 'element', 'file' => 'trigger.admin.inc', ), ); } /** * Implements hook_forms(). * * We re-use code by using the same assignment form definition for each hook. */ function trigger_forms() { $trigger_info = _trigger_get_all_info(); $forms = array(); foreach ($trigger_info as $module => $hooks) { foreach ($hooks as $hook => $description) { $forms['trigger_' . $hook . '_assign_form'] = array('callback' => 'trigger_assign_form'); } } return $forms; } /** * Loads associated objects for node triggers. * * When an action is called in a context that does not match its type, the * object that the action expects must be retrieved. For example, when an action * that works on users is called during a node hook implementation, the user * object is not available since the node hook call doesn't pass it. So here we * load the object the action expects. * * @param $type * The type of action that is about to be called. * @param $node * The node that was passed via the node hook. * * @return * The object expected by the action that is about to be called. */ function _trigger_normalize_node_context($type, $node) { // Note that comment-type actions are not supported in node contexts, // because we wouldn't know which comment to choose. switch ($type) { // An action that works on users is being called in a node context. // Load the user object of the node's author. case 'user': return user_load($node->uid); } } /** * Calls action functions for node triggers. * * @param $node * Node object. * @param $hook * Hook to trigger. * @param $a3 * Additional argument to action function. * @param $a4 * Additional argument to action function. */ function _trigger_node($node, $hook, $a3 = NULL, $a4 = NULL) { // Keep objects for reuse so that changes actions make to objects can persist. static $objects; // Prevent recursion by tracking which operations have already been called. static $recursion; $aids = trigger_get_assigned_actions($hook); if (!$aids) { return; } if (isset($recursion[$hook])) { return; } $recursion[$hook] = TRUE; $context = array( 'group' => 'node', 'hook' => $hook, ); // We need to get the expected object if the action's type is not 'node'. // We keep the object in $objects so we can reuse it if we have multiple actions // that make changes to an object. foreach ($aids as $aid => $info) { $type = $info['type']; if ($type != 'node') { if (!isset($objects[$type])) { $objects[$type] = _trigger_normalize_node_context($type, $node); } // Since we know about the node, we pass that info along to the action. $context['node'] = $node; $result = actions_do($aid, $objects[$type], $context, $a3, $a4); } else { actions_do($aid, $node, $context, $a3, $a4); } } unset($recursion[$hook]); } /** * Implements hook_node_view(). */ function trigger_node_view($node, $view_mode) { _trigger_node($node, 'node_view', $view_mode); } /** * Implements hook_node_update(). */ function trigger_node_update($node) { _trigger_node($node, 'node_update'); } /** * Implements hook_node_presave(). */ function trigger_node_presave($node) { _trigger_node($node, 'node_presave'); } /** * Implements hook_node_insert(). */ function trigger_node_insert($node) { _trigger_node($node, 'node_insert'); } /** * Implements hook_node_delete(). */ function trigger_node_delete($node) { _trigger_node($node, 'node_delete'); } /** * Loads associated objects for comment triggers. * * When an action is called in a context that does not match its type, the * object that the action expects must be retrieved. For example, when an action * that works on nodes is called during the comment hook, the node object is not * available since the comment hook doesn't pass it. So here we load the object * the action expects. * * @param $type * The type of action that is about to be called. * @param $comment * The comment that was passed via the comment hook. * * @return * The object expected by the action that is about to be called. */ function _trigger_normalize_comment_context($type, $comment) { switch ($type) { // An action that works with nodes is being called in a comment context. case 'node': return node_load(is_array($comment) ? $comment['nid'] : $comment->nid); // An action that works on users is being called in a comment context. case 'user': return user_load(is_array($comment) ? $comment['uid'] : $comment->uid); } } /** * Implements hook_comment_presave(). */ function trigger_comment_presave($comment) { _trigger_comment($comment, 'comment_presave'); } /** * Implements hook_comment_insert(). */ function trigger_comment_insert($comment) { _trigger_comment($comment, 'comment_insert'); } /** * Implements hook_comment_update(). */ function trigger_comment_update($comment) { _trigger_comment($comment, 'comment_update'); } /** * Implements hook_comment_delete(). */ function trigger_comment_delete($comment) { _trigger_comment($comment, 'comment_delete'); } /** * Implements hook_comment_view(). */ function trigger_comment_view($comment) { _trigger_comment($comment, 'comment_view'); } /** * Calls action functions for comment triggers. * * @param $a1 * Comment object or array of form values. * @param $hook * Hook to trigger. */ function _trigger_comment($a1, $hook) { // Keep objects for reuse so that changes actions make to objects can persist. static $objects; $aids = trigger_get_assigned_actions($hook); $context = array( 'group' => 'comment', 'hook' => $hook, ); // We need to get the expected object if the action's type is not 'comment'. // We keep the object in $objects so we can reuse it if we have multiple // actions that make changes to an object. foreach ($aids as $aid => $info) { $type = $info['type']; if ($type != 'comment') { if (!isset($objects[$type])) { $objects[$type] = _trigger_normalize_comment_context($type, $a1); } // Since we know about the comment, we pass it along to the action // in case it wants to peek at it. $context['comment'] = (object) $a1; actions_do($aid, $objects[$type], $context); } else { actions_do($aid, $a1, $context); } } } /** * Implements hook_cron(). */ function trigger_cron() { $aids = trigger_get_assigned_actions('cron'); $context = array( 'group' => 'cron', 'hook' => 'cron', ); // Cron does not act on any specific object. $object = NULL; actions_do(array_keys($aids), $object, $context); } /** * Loads associated objects for user triggers. * * When an action is called in a context that does not match its type, the * object that the action expects must be retrieved. For example, when an action * that works on nodes is called during the user hook, the node object is not * available since the user hook doesn't pass it. So here we load the object the * action expects. * * @param $type * The type of action that is about to be called. * @param $account * The account object that was passed via the user hook. * * @return * The object expected by the action that is about to be called. */ function _trigger_normalize_user_context($type, $account) { // Note that comment-type actions are not supported in user contexts, // because we wouldn't know which comment to choose. switch ($type) { // An action that works with nodes is being called in a user context. // If a single node is being viewed, return the node. case 'node': // If we are viewing an individual node, return the node. if (arg(0) == 'node' && is_numeric(arg(1)) && arg(2) == NULL) { return node_load(array('nid' => arg(1))); } break; } } /** * Implements hook_user_login(). */ function trigger_user_login(&$edit, $account, $category) { _trigger_user('user_login', $edit, $account, $category); } /** * Implements hook_user_logout(). */ function trigger_user_logout($account) { $edit = array(); _trigger_user('user_logout', $edit, $account); } /** * Implements hook_user_insert(). */ function trigger_user_insert(&$edit, $account, $category) { _trigger_user('user_insert', $edit, $account, $category); } /** * Implements hook_user_update(). */ function trigger_user_update(&$edit, $account, $category) { _trigger_user('user_update', $edit, $account, $category); } /** * Implements hook_user_cancel(). */ function trigger_user_cancel($edit, $account, $method) { switch ($method) { case 'user_cancel_reassign': _trigger_user('user_delete', $edit, $account, $method); break; } } /** * Implements hook_user_delete(). */ function trigger_user_delete($account) { $edit = array(); _trigger_user('user_delete', $edit, $account, NULL); } /** * Implements hook_user_view(). */ function trigger_user_view($account) { $edit = NULL; _trigger_user('user_view', $edit, $account, NULL); } /** * Calls action functions for user triggers. * * @param $hook * The hook that called this function. * @param $edit * Edit variable passed in to the hook or empty array if not needed. * @param $account * Account variable passed in to the hook. * @param $method * Method variable passed in to the hook or NULL if not needed. */ function _trigger_user($hook, &$edit, $account, $category = NULL) { // Keep objects for reuse so that changes actions make to objects can persist. static $objects; $aids = trigger_get_assigned_actions($hook); $context = array( 'group' => 'user', 'hook' => $hook, 'form_values' => &$edit, ); foreach ($aids as $aid => $info) { $type = $info['type']; if ($type != 'user') { if (!isset($objects[$type])) { $objects[$type] = _trigger_normalize_user_context($type, $account); } $context['user'] = $account; actions_do($aid, $objects[$type], $context); } else { actions_do($aid, $account, $context, $category); } } } /** * Calls action functions for taxonomy triggers. * * @param $hook * Hook to trigger actions for taxonomy_term_insert(), * taxonomy_term_update(), and taxonomy_term_delete(). * @param $array * Item on which operation is being performed, either a term or * form values. */ function _trigger_taxonomy($hook, $array) { $aids = trigger_get_assigned_actions($hook); $context = array( 'group' => 'taxonomy', 'hook' => $hook ); actions_do(array_keys($aids), (object) $array, $context); } /** * Implements hook_taxonomy_term_insert(). */ function trigger_taxonomy_term_insert($term) { _trigger_taxonomy('taxonomy_term_insert', (array) $term); } /** * Implements hook_taxonomy_term_update(). */ function trigger_taxonomy_term_update($term) { _trigger_taxonomy('taxonomy_term_update', (array) $term); } /** * Implements hook_taxonomy_term_delete(). */ function trigger_taxonomy_term_delete($term) { _trigger_taxonomy('taxonomy_term_delete', (array) $term); } /** * Implements hook_actions_delete(). * * Removes all trigger entries for the given action, when an action is deleted. */ function trigger_actions_delete($aid) { db_delete('trigger_assignments') ->condition('aid', $aid) ->execute(); drupal_static_reset('trigger_get_assigned_actions'); } /** * Retrieves and caches information from hook_trigger_info() implementations. * * @return * Array of all triggers. */ function _trigger_get_all_info() { $triggers = &drupal_static(__FUNCTION__); if (!isset($triggers)) { $triggers = module_invoke_all('trigger_info'); drupal_alter('trigger_info', $triggers); } return $triggers; } /** * Gathers information about tabs on the triggers administration screen. * * @return * Array of modules that have triggers, with the keys being the * machine-readable name of the module, and the values being the * human-readable name of the module. */ function _trigger_tab_information() { // Gather information about all triggers and modules. $trigger_info = _trigger_get_all_info(); $modules = system_get_info('module'); $modules = array_intersect_key($modules, $trigger_info); $return_info = array(); foreach ($modules as $name => $info) { $return_info[$name] = $info['name']; } return $return_info; } drupal-7.41/modules/trigger/trigger.test0000644000000000000000000007364612611765734017145 0ustar rootrootdrupalPost("admin/config/system/actions/configure/$hash", $edit, t('Save')); $this->assertText(t('The action has been successfully saved.')); // Now we have to find out the action ID of what we created. return db_query('SELECT aid FROM {actions} WHERE callback = :callback AND label = :label', array(':callback' => $action, ':label' => $edit['actions_label']))->fetchField(); } } /** * Provides tests for node triggers. */ class TriggerContentTestCase extends TriggerWebTestCase { var $_cleanup_roles = array(); var $_cleanup_users = array(); public static function getInfo() { return array( 'name' => 'Trigger content (node) actions', 'description' => 'Perform various tests with content actions.', 'group' => 'Trigger', ); } function setUp() { parent::setUp('trigger', 'trigger_test'); } /** * Tests several content-oriented trigger issues. * * These are in one function to assure they happen in the right order. */ function testActionsContent() { global $user; $content_actions = array('node_publish_action', 'node_unpublish_action', 'node_make_sticky_action', 'node_make_unsticky_action', 'node_promote_action', 'node_unpromote_action'); $test_user = $this->drupalCreateUser(array('administer actions')); $web_user = $this->drupalCreateUser(array('create page content', 'access content', 'administer nodes')); foreach ($content_actions as $action) { $hash = drupal_hash_base64($action); $info = $this->actionInfo($action); // Assign an action to a trigger, then pull the trigger, and make sure // the actions fire. $this->drupalLogin($test_user); $edit = array('aid' => $hash); $this->drupalPost('admin/structure/trigger/node', $edit, t('Assign'), array(), array(), 'trigger-node-presave-assign-form'); // Create an unpublished node. $this->drupalLogin($web_user); $edit = array(); $langcode = LANGUAGE_NONE; $edit["title"] = '!SimpleTest test node! ' . $this->randomName(10); $edit["body[$langcode][0][value]"] = '!SimpleTest test body! ' . $this->randomName(32) . ' ' . $this->randomName(32); $edit[$info['property']] = !$info['expected']; $this->drupalPost('node/add/page', $edit, t('Save')); // Make sure the text we want appears. $this->assertRaw(t('!post %title has been created.', array('!post' => 'Basic page', '%title' => $edit["title"])), 'Make sure the Basic page has actually been created'); // Action should have been fired. $loaded_node = $this->drupalGetNodeByTitle($edit["title"]); $this->assertTrue($loaded_node->$info['property'] == $info['expected'], format_string('Make sure the @action action fired.', array('@action' => $info['name']))); // Leave action assigned for next test // There should be an error when the action is assigned to the trigger // twice. $this->drupalLogin($test_user); // This action already assigned in this test. $edit = array('aid' => $hash); $this->drupalPost('admin/structure/trigger/node', $edit, t('Assign'), array(), array(), 'trigger-node-presave-assign-form'); $this->assertRaw(t('The action you chose is already assigned to that trigger.'), 'Check to make sure an error occurs when assigning an action to a trigger twice.'); // The action should be able to be unassigned from a trigger. $this->drupalPost('admin/structure/trigger/unassign/node/node_presave/' . $hash, array(), t('Unassign')); $this->assertRaw(t('Action %action has been unassigned.', array('%action' => ucfirst($info['name']))), format_string('Check to make sure the @action action can be unassigned from the trigger.', array('@action' => $info['name']))); $assigned = db_query("SELECT COUNT(*) FROM {trigger_assignments} WHERE aid IN (:keys)", array(':keys' => $content_actions))->fetchField(); $this->assertFalse($assigned, 'Check to make sure unassign worked properly at the database level.'); } } /** * Tests multiple node actions. * * Verifies that node actions are fired for each node individually, if acting * on multiple nodes. */ function testActionContentMultiple() { // Assign an action to the node save/update trigger. $test_user = $this->drupalCreateUser(array('administer actions', 'administer nodes', 'create page content', 'access administration pages', 'access content overview')); $this->drupalLogin($test_user); $nodes = array(); for ($index = 0; $index < 3; $index++) { $nodes[] = $this->drupalCreateNode(array('type' => 'page')); } $action_id = 'trigger_test_generic_any_action'; $hash = drupal_hash_base64($action_id); $edit = array('aid' => $hash); $this->drupalPost('admin/structure/trigger/node', $edit, t('Assign'), array(), array(), 'trigger-node-update-assign-form'); $edit = array( 'operation' => 'unpublish', 'nodes[' . $nodes[0]->nid . ']' => TRUE, 'nodes[' . $nodes[1]->nid . ']' => TRUE, ); $this->drupalPost('admin/content', $edit, t('Update')); $count = variable_get('trigger_test_generic_any_action', 0); $this->assertTrue($count == 2, format_string('Action was triggered 2 times. Actual: %count', array('%count' => $count))); } /** * Returns some info about each of the content actions. * * This is helper function for testActionsContent(). * * @param $action * The name of the action to return info about. * * @return * An associative array of info about the action. */ function actionInfo($action) { $info = array( 'node_publish_action' => array( 'property' => 'status', 'expected' => 1, 'name' => t('publish content'), ), 'node_unpublish_action' => array( 'property' => 'status', 'expected' => 0, 'name' => t('unpublish content'), ), 'node_make_sticky_action' => array( 'property' => 'sticky', 'expected' => 1, 'name' => t('make content sticky'), ), 'node_make_unsticky_action' => array( 'property' => 'sticky', 'expected' => 0, 'name' => t('make content unsticky'), ), 'node_promote_action' => array( 'property' => 'promote', 'expected' => 1, 'name' => t('promote content to front page'), ), 'node_unpromote_action' => array( 'property' => 'promote', 'expected' => 0, 'name' => t('remove content from front page'), ), ); return $info[$action]; } } /** * Tests cron trigger. */ class TriggerCronTestCase extends TriggerWebTestCase { public static function getInfo() { return array( 'name' => 'Trigger cron (system) actions', 'description' => 'Perform various tests with cron trigger.', 'group' => 'Trigger', ); } function setUp() { parent::setUp('trigger', 'trigger_test'); } /** * Tests assigning multiple actions to the cron trigger. * * This test ensures that both simple and multiple complex actions * succeed properly. This is done in the cron trigger test because * cron allows passing multiple actions in at once. */ function testActionsCron() { // Create an administrative user. $test_user = $this->drupalCreateUser(array('administer actions')); $this->drupalLogin($test_user); // Assign a non-configurable action to the cron run trigger. $edit = array('aid' => drupal_hash_base64('trigger_test_system_cron_action')); $this->drupalPost('admin/structure/trigger/system', $edit, t('Assign'), array(), array(), 'trigger-cron-assign-form'); // Assign a configurable action to the cron trigger. $action_label = $this->randomName(); $edit = array( 'actions_label' => $action_label, 'subject' => $action_label, ); $aid = $this->configureAdvancedAction('trigger_test_system_cron_conf_action', $edit); // $aid is likely 3 but if we add more uses for the sequences table in // core it might break, so it is easier to get the value from the database. $edit = array('aid' => drupal_hash_base64($aid)); $this->drupalPost('admin/structure/trigger/system', $edit, t('Assign'), array(), array(), 'trigger-cron-assign-form'); // Add a second configurable action to the cron trigger. $action_label = $this->randomName(); $edit = array( 'actions_label' => $action_label, 'subject' => $action_label, ); $aid = $this->configureAdvancedAction('trigger_test_system_cron_conf_action', $edit); $edit = array('aid' => drupal_hash_base64($aid)); $this->drupalPost('admin/structure/trigger/system', $edit, t('Assign'), array(), array(), 'trigger-cron-assign-form'); // Force a cron run. $this->cronRun(); // Make sure the non-configurable action has fired. $action_run = variable_get('trigger_test_system_cron_action', FALSE); $this->assertTrue($action_run, 'Check that the cron run triggered the test action.'); // Make sure that both configurable actions have fired. $action_run = variable_get('trigger_test_system_cron_conf_action', 0) == 2; $this->assertTrue($action_run, 'Check that the cron run triggered both complex actions.'); } } /** * Provides a base class with trigger assignments and test comparisons. */ class TriggerActionTestCase extends TriggerWebTestCase { function setUp() { parent::setUp('trigger'); } /** * Creates a message with tokens. * * @param $trigger * * @return * A message with embedded tokens. */ function generateMessageWithTokens($trigger) { // Note that subject is limited to 254 characters in action configuration. $message = t('Action was triggered by trigger @trigger user:name=[user:name] user:uid=[user:uid] user:mail=[user:mail] user:url=[user:url] user:edit-url=[user:edit-url] user:created=[user:created]', array('@trigger' => $trigger)); return trim($message); } /** * Generates a comparison message to match the pre-token-replaced message. * * @param $trigger * Trigger, like 'user_login'. * @param $account * Associated user account. * * @return * The token-replaced equivalent message. This does not use token * functionality. * * @see generateMessageWithTokens() */ function generateTokenExpandedComparison($trigger, $account) { // Note that user:last-login was omitted because it changes and can't // be properly verified. $message = t('Action was triggered by trigger @trigger user:name=@username user:uid=@uid user:mail=@mail user:url=@user_url user:edit-url=@user_edit_url user:created=@user_created', array( '@trigger' => $trigger, '@username' => $account->name, '@uid' => !empty($account->uid) ? $account->uid : t('not yet assigned'), '@mail' => $account->mail, '@user_url' => !empty($account->uid) ? url("user/$account->uid", array('absolute' => TRUE)) : t('not yet assigned'), '@user_edit_url' => !empty($account->uid) ? url("user/$account->uid/edit", array('absolute' => TRUE)) : t('not yet assigned'), '@user_created' => isset($account->created) ? format_date($account->created, 'medium') : t('not yet created'), ) ); return trim($message); } /** * Assigns a simple (non-configurable) action to a trigger. * * @param $trigger * The trigger to assign to, like 'user_login'. * @param $action * The simple action to be assigned, like 'comment_insert'. */ function assignSimpleAction($trigger, $action) { $form_name = "trigger_{$trigger}_assign_form"; $form_html_id = strtr($form_name, '_', '-'); $edit = array('aid' => drupal_hash_base64($action)); $trigger_type = preg_replace('/_.*/', '', $trigger); $this->drupalPost("admin/structure/trigger/$trigger_type", $edit, t('Assign'), array(), array(), $form_html_id); $actions = trigger_get_assigned_actions($trigger); $this->assertTrue(!empty($actions[$action]), format_string('Simple action @action assigned to trigger @trigger', array('@action' => $action, '@trigger' => $trigger))); } /** * Assigns a system message action to the passed-in trigger. * * @param $trigger * For example, 'user_login' */ function assignSystemMessageAction($trigger) { $form_name = "trigger_{$trigger}_assign_form"; $form_html_id = strtr($form_name, '_', '-'); // Assign a configurable action 'System message' to the passed trigger. $action_edit = array( 'actions_label' => $trigger . "_system_message_action_" . $this->randomName(16), 'message' => $this->generateMessageWithTokens($trigger), ); // Configure an advanced action that we can assign. $aid = $this->configureAdvancedAction('system_message_action', $action_edit); $edit = array('aid' => drupal_hash_base64($aid)); $this->drupalPost('admin/structure/trigger/user', $edit, t('Assign'), array(), array(), $form_html_id); drupal_static_reset('trigger_get_asssigned_actions'); } /** * Assigns a system_send_email_action to the passed-in trigger. * * @param $trigger * For example, 'user_login' */ function assignSystemEmailAction($trigger) { $form_name = "trigger_{$trigger}_assign_form"; $form_html_id = strtr($form_name, '_', '-'); $message = $this->generateMessageWithTokens($trigger); // Assign a configurable action 'System message' to the passed trigger. $action_edit = array( // 'actions_label' => $trigger . "_system_send_message_action_" . $this->randomName(16), 'actions_label' => $trigger . "_system_send_email_action", 'recipient' => '[user:mail]', 'subject' => $message, 'message' => $message, ); // Configure an advanced action that we can assign. $aid = $this->configureAdvancedAction('system_send_email_action', $action_edit); $edit = array('aid' => drupal_hash_base64($aid)); $this->drupalPost('admin/structure/trigger/user', $edit, t('Assign'), array(), array(), $form_html_id); drupal_static_reset('trigger_get_assigned_actions'); } /** * Asserts correct token replacement in both system message and email. * * @param $trigger * A trigger like 'user_login'. * @param $account * The user account which triggered the action. * @param $email_depth * Number of emails to scan, starting with most recent. */ function assertSystemMessageAndEmailTokenReplacement($trigger, $account, $email_depth = 1) { $this->assertSystemMessageTokenReplacement($trigger, $account); $this->assertSystemEmailTokenReplacement($trigger, $account, $email_depth); } /** * Asserts correct token replacement for the given trigger and account. * * @param $trigger * A trigger like 'user_login'. * @param $account * The user account which triggered the action. */ function assertSystemMessageTokenReplacement($trigger, $account) { $expected = $this->generateTokenExpandedComparison($trigger, $account); $this->assertText($expected, format_string('Expected system message to contain token-replaced text "@expected" found in configured system message action', array('@expected' => $expected )) ); } /** * Asserts correct token replacement for the given trigger and account. * * @param $trigger * A trigger like 'user_login'. * @param $account * The user account which triggered the action. * @param $email_depth * Number of emails to scan, starting with most recent. */ function assertSystemEmailTokenReplacement($trigger, $account, $email_depth = 1) { $this->verboseEmail($email_depth); $expected = $this->generateTokenExpandedComparison($trigger, $account); $this->assertMailString('subject', $expected, $email_depth); $this->assertMailString('body', $expected, $email_depth); $this->assertMail('to', $account->mail, 'Mail sent to correct destination'); } } /** * Tests token substitution in trigger actions. * * This tests nearly every permutation of user triggers with system actions * and checks the token replacement. */ class TriggerUserTokenTestCase extends TriggerActionTestCase { public static function getInfo() { return array( 'name' => 'Test user triggers', 'description' => 'Test user triggers and system actions with token replacement.', 'group' => 'Trigger', ); } /** * Tests a variety of token replacements in actions. */ function testUserTriggerTokenReplacement() { $test_user = $this->drupalCreateUser(array('administer actions', 'administer users', 'change own username', 'access user profiles')); $this->drupalLogin($test_user); $triggers = array('user_login', 'user_insert', 'user_update', 'user_delete', 'user_logout', 'user_view'); foreach ($triggers as $trigger) { $this->assignSystemMessageAction($trigger); $this->assignSystemEmailAction($trigger); } $this->drupalLogout(); $this->assertSystemEmailTokenReplacement('user_logout', $test_user); $this->drupalLogin($test_user); $this->assertSystemMessageAndEmailTokenReplacement('user_login', $test_user, 2); $this->assertSystemMessageAndEmailTokenReplacement('user_view', $test_user, 2); $this->drupalPost("user/{$test_user->uid}/edit", array('name' => $test_user->name . '_changed'), t('Save')); $test_user->name .= '_changed'; // Since we just changed it. $this->assertSystemMessageAndEmailTokenReplacement('user_update', $test_user, 2); $this->drupalGet('user'); $this->assertSystemMessageAndEmailTokenReplacement('user_view', $test_user); $new_user = $this->drupalCreateUser(array('administer actions', 'administer users', 'cancel account', 'access administration pages')); $this->assertSystemEmailTokenReplacement('user_insert', $new_user); $this->drupalLogin($new_user); $user_to_delete = $this->drupalCreateUser(array('access content')); variable_set('user_cancel_method', 'user_cancel_delete'); $this->drupalPost("user/{$user_to_delete->uid}/cancel", array(), t('Cancel account')); $this->assertSystemMessageAndEmailTokenReplacement('user_delete', $user_to_delete); } } /** * Tests token substitution in trigger actions. * * This tests nearly every permutation of user triggers with system actions * and checks the token replacement. */ class TriggerUserActionTestCase extends TriggerActionTestCase { public static function getInfo() { return array( 'name' => 'Test user actions', 'description' => 'Test user actions.', 'group' => 'Trigger', ); } /** * Tests user action assignment and execution. */ function testUserActionAssignmentExecution() { $test_user = $this->drupalCreateUser(array('administer actions', 'create article content', 'access comments', 'administer comments', 'skip comment approval', 'edit own comments')); $this->drupalLogin($test_user); $triggers = array('comment_presave', 'comment_insert', 'comment_update'); // system_block_ip_action is difficult to test without ruining the test. $actions = array('user_block_user_action'); foreach ($triggers as $trigger) { foreach ($actions as $action) { $this->assignSimpleAction($trigger, $action); } } $node = $this->drupalCreateNode(array('type' => 'article')); $this->drupalPost("node/{$node->nid}", array('comment_body[und][0][value]' => t("my comment"), 'subject' => t("my comment subject")), t('Save')); // Posting a comment should have blocked this user. $account = user_load($test_user->uid, TRUE); $this->assertTrue($account->status == 0, 'Account is blocked'); $comment_author_uid = $account->uid; // Now rehabilitate the comment author so it can be be blocked again when // the comment is updated. user_save($account, array('status' => TRUE)); $test_user = $this->drupalCreateUser(array('administer actions', 'create article content', 'access comments', 'administer comments', 'skip comment approval', 'edit own comments')); $this->drupalLogin($test_user); // Our original comment will have been comment 1. $this->drupalPost("comment/1/edit", array('comment_body[und][0][value]' => t("my comment, updated"), 'subject' => t("my comment subject")), t('Save')); $comment_author_account = user_load($comment_author_uid, TRUE); $this->assertTrue($comment_author_account->status == 0, format_string('Comment author account (uid=@uid) is blocked after update to comment', array('@uid' => $comment_author_uid))); // Verify that the comment was updated. $test_user = $this->drupalCreateUser(array('administer actions', 'create article content', 'access comments', 'administer comments', 'skip comment approval', 'edit own comments')); $this->drupalLogin($test_user); $this->drupalGet("node/$node->nid"); $this->assertText(t("my comment, updated")); $this->verboseEmail(); } } /** * Tests other triggers. */ class TriggerOtherTestCase extends TriggerWebTestCase { var $_cleanup_roles = array(); var $_cleanup_users = array(); public static function getInfo() { return array( 'name' => 'Trigger other actions', 'description' => 'Test triggering of user, comment, taxonomy actions.', 'group' => 'Trigger', ); } function setUp() { parent::setUp('trigger', 'trigger_test', 'contact'); } /** * Tests triggering on user create and user login. */ function testActionsUser() { // Assign an action to the create user trigger. $test_user = $this->drupalCreateUser(array('administer actions')); $this->drupalLogin($test_user); $action_id = 'trigger_test_generic_action'; $hash = drupal_hash_base64($action_id); $edit = array('aid' => $hash); $this->drupalPost('admin/structure/trigger/user', $edit, t('Assign'), array(), array(), 'trigger-user-insert-assign-form'); // Set action variable to FALSE. variable_set($action_id, FALSE); // Create an unblocked user $web_user = $this->drupalCreateUser(array('administer users')); $this->drupalLogin($web_user); $name = $this->randomName(); $pass = user_password(); $edit = array(); $edit['name'] = $name; $edit['mail'] = $name . '@example.com'; $edit['pass[pass1]'] = $pass; $edit['pass[pass2]'] = $pass; $edit['status'] = 1; $this->drupalPost('admin/people/create', $edit, t('Create new account')); // Verify that the action variable has been set. $this->assertTrue(variable_get($action_id, FALSE), 'Check that creating a user triggered the test action.'); // Reset the action variable. variable_set($action_id, FALSE); $this->drupalLogin($test_user); // Assign a configurable action 'System message' to the user_login trigger. $action_edit = array( 'actions_label' => $this->randomName(16), 'message' => t("You have logged in:") . $this->randomName(16), ); // Configure an advanced action that we can assign. $aid = $this->configureAdvancedAction('system_message_action', $action_edit); $edit = array('aid' => drupal_hash_base64($aid)); $this->drupalPost('admin/structure/trigger/user', $edit, t('Assign'), array(), array(), 'trigger-user-login-assign-form'); // Verify that the action has been assigned to the correct hook. $actions = trigger_get_assigned_actions('user_login'); $this->assertEqual(1, count($actions), 'One Action assigned to the hook'); $this->assertEqual($actions[$aid]['label'], $action_edit['actions_label'], 'Correct action label found.'); // User should get the configured message at login. $contact_user = $this->drupalCreateUser(array('access site-wide contact form'));; $this->drupalLogin($contact_user); $this->assertText($action_edit['message']); } /** * Tests triggering on comment save. */ function testActionsComment() { // Assign an action to the comment save trigger. $test_user = $this->drupalCreateUser(array('administer actions')); $this->drupalLogin($test_user); $action_id = 'trigger_test_generic_action'; $hash = drupal_hash_base64($action_id); $edit = array('aid' => $hash); $this->drupalPost('admin/structure/trigger/comment', $edit, t('Assign'), array(), array(), 'trigger-comment-insert-assign-form'); // Set action variable to FALSE. variable_set($action_id, FALSE); // Create a node and add a comment to it. $web_user = $this->drupalCreateUser(array('create article content', 'access content', 'skip comment approval', 'post comments')); $this->drupalLogin($web_user); $node = $this->drupalCreateNode(array('type' => 'article', 'promote' => 1)); $edit = array(); $edit['subject'] = $this->randomName(10); $edit['comment_body[' . LANGUAGE_NONE . '][0][value]'] = $this->randomName(10) . ' ' . $this->randomName(10); $this->drupalGet('comment/reply/' . $node->nid); $this->drupalPost(NULL, $edit, t('Save')); // Verify that the action variable has been set. $this->assertTrue(variable_get($action_id, FALSE), 'Check that creating a comment triggered the action.'); } /** * Tests triggering on taxonomy new term. */ function testActionsTaxonomy() { // Assign an action to the taxonomy term save trigger. $test_user = $this->drupalCreateUser(array('administer actions')); $this->drupalLogin($test_user); $action_id = 'trigger_test_generic_action'; $hash = drupal_hash_base64($action_id); $edit = array('aid' => $hash); $this->drupalPost('admin/structure/trigger/taxonomy', $edit, t('Assign'), array(), array(), 'trigger-taxonomy-term-insert-assign-form'); // Set action variable to FALSE. variable_set($action_id, FALSE); // Create a taxonomy vocabulary and add a term to it. // Create a vocabulary. $vocabulary = new stdClass(); $vocabulary->name = $this->randomName(); $vocabulary->description = $this->randomName(); $vocabulary->machine_name = drupal_strtolower($this->randomName()); $vocabulary->help = ''; $vocabulary->nodes = array('article' => 'article'); $vocabulary->weight = mt_rand(0, 10); taxonomy_vocabulary_save($vocabulary); $term = new stdClass(); $term->name = $this->randomName(); $term->vid = $vocabulary->vid; taxonomy_term_save($term); // Verify that the action variable has been set. $this->assertTrue(variable_get($action_id, FALSE), 'Check that creating a taxonomy term triggered the action.'); } } /** * Tests that orphaned actions are properly handled. */ class TriggerOrphanedActionsTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Trigger orphaned actions', 'description' => 'Test triggering an action that has since been removed.', 'group' => 'Trigger', ); } function setUp() { parent::setUp('trigger', 'trigger_test'); } /** * Tests logic around orphaned actions. */ function testActionsOrphaned() { $action = 'trigger_test_generic_any_action'; $hash = drupal_hash_base64($action); // Assign an action from a disable-able module to a trigger, then pull the // trigger, and make sure the actions fire. $test_user = $this->drupalCreateUser(array('administer actions')); $this->drupalLogin($test_user); $edit = array('aid' => $hash); $this->drupalPost('admin/structure/trigger/node', $edit, t('Assign'), array(), array(), 'trigger-node-presave-assign-form'); // Create an unpublished node. $web_user = $this->drupalCreateUser(array('create page content', 'edit own page content', 'access content', 'administer nodes')); $this->drupalLogin($web_user); $edit = array(); $langcode = LANGUAGE_NONE; $edit["title"] = '!SimpleTest test node! ' . $this->randomName(10); $edit["body[$langcode][0][value]"] = '!SimpleTest test body! ' . $this->randomName(32) . ' ' . $this->randomName(32); $this->drupalPost('node/add/page', $edit, t('Save')); $this->assertRaw(t('!post %title has been created.', array('!post' => 'Basic page', '%title' => $edit["title"])), 'Make sure the Basic page has actually been created'); // Action should have been fired. $this->assertTrue(variable_get('trigger_test_generic_any_action', FALSE), 'Trigger test action successfully fired.'); // Disable the module that provides the action and make sure the trigger // doesn't white screen. module_disable(array('trigger_test')); $loaded_node = $this->drupalGetNodeByTitle($edit["title"]); $edit["body[$langcode][0][value]"] = '!SimpleTest test body! ' . $this->randomName(32) . ' ' . $this->randomName(32); $this->drupalPost("node/$loaded_node->nid/edit", $edit, t('Save')); // If the node body was updated successfully we have dealt with the // unavailable action. $this->assertRaw(t('!post %title has been updated.', array('!post' => 'Basic page', '%title' => $edit["title"])), 'Make sure the Basic page can be updated with the missing trigger function.'); } } /** * Tests the unassigning of triggers. */ class TriggerUnassignTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Trigger unassigning', 'description' => 'Tests the unassigning of triggers.', 'group' => 'Trigger', ); } function setUp() { parent::setUp('trigger', 'trigger_test'); $web_user = $this->drupalCreateUser(array('administer actions')); $this->drupalLogin($web_user); } /** * Tests an attempt to unassign triggers when none are assigned. */ function testUnassignAccessDenied() { $this->drupalGet('admin/structure/trigger/unassign'); $this->assertResponse(403, 'If there are no actions available, return access denied.'); } } drupal-7.41/modules/simpletest/0000755000000000000000000000000012611765734015307 5ustar rootrootdrupal-7.41/modules/simpletest/simpletest.css0000644000000000000000000000274412611765734020221 0ustar rootroot /* Test Table */ #simpletest-form-table th.select-all { width: 1em; } th.simpletest_test { width: 16em; } .simpletest-image { display: inline-block; cursor: pointer; width: 1em; } .simpletest-group-label label { display: inline; font-weight: bold; } .simpletest-test-label label { margin-left: 1em; /* LTR */ } .simpletest-test-description .description { margin: 0; } #simpletest-form-table tr td { background-color: white; color: #494949; } #simpletest-form-table tr.simpletest-group td { background-color: #EDF5FA; color: #494949; } table#simpletest-form-table tr.simpletest-group label { display: inline; } div.message > div.item-list { font-weight: normal; } div.simpletest-pass { color: #33a333; } .simpletest-fail { color: #981010; } tr.simpletest-pass.odd { background-color: #b6ffb6; } tr.simpletest-pass.even { background-color: #9bff9b; } tr.simpletest-fail.odd { background-color: #ffc9c9; } tr.simpletest-fail.even { background-color: #ffacac; } tr.simpletest-exception.odd { background-color: #f4ea71; } tr.simpletest-exception.even { background-color: #f5e742; } tr.simpletest-debug.odd { background-color: #eee; } tr.simpletest-debug.even { background-color: #fff; } a.simpletest-collapse { height: 0; width: 0; top: -99em; position: absolute; } a.simpletest-collapse:focus, a.simpletest-collapse:hover { font-size: 80%; top: 0px; height: auto; width: auto; overflow: visible; position: relative; z-index: 1000; } drupal-7.41/modules/simpletest/tests/0000755000000000000000000000000012611765734016451 5ustar rootrootdrupal-7.41/modules/simpletest/tests/batch.test0000644000000000000000000004076412611765734020446 0ustar rootroot 'Batch processing', 'description' => 'Test batch processing in form and non-form workflow.', 'group' => 'Batch API', ); } function setUp() { parent::setUp('batch_test'); } /** * Test batches triggered outside of form submission. */ function testBatchNoForm() { // Displaying the page triggers batch 1. $this->drupalGet('batch-test/no-form'); $this->assertBatchMessages($this->_resultMessages(1), t('Batch for step 2 performed successfully.')); $this->assertEqual(batch_test_stack(), $this->_resultStack('batch_1'), t('Execution order was correct.')); $this->assertText('Redirection successful.', t('Redirection after batch execution is correct.')); } /** * Test batches defined in a form submit handler. */ function testBatchForm() { // Batch 0: no operation. $edit = array('batch' => 'batch_0'); $this->drupalPost('batch-test/simple', $edit, 'Submit'); $this->assertBatchMessages($this->_resultMessages('batch_0'), t('Batch with no operation performed successfully.')); $this->assertText('Redirection successful.', t('Redirection after batch execution is correct.')); // Batch 1: several simple operations. $edit = array('batch' => 'batch_1'); $this->drupalPost('batch-test/simple', $edit, 'Submit'); $this->assertBatchMessages($this->_resultMessages('batch_1'), t('Batch with simple operations performed successfully.')); $this->assertEqual(batch_test_stack(), $this->_resultStack('batch_1'), t('Execution order was correct.')); $this->assertText('Redirection successful.', t('Redirection after batch execution is correct.')); // Batch 2: one multistep operation. $edit = array('batch' => 'batch_2'); $this->drupalPost('batch-test/simple', $edit, 'Submit'); $this->assertBatchMessages($this->_resultMessages('batch_2'), t('Batch with multistep operation performed successfully.')); $this->assertEqual(batch_test_stack(), $this->_resultStack('batch_2'), t('Execution order was correct.')); $this->assertText('Redirection successful.', t('Redirection after batch execution is correct.')); // Batch 3: simple + multistep combined. $edit = array('batch' => 'batch_3'); $this->drupalPost('batch-test/simple', $edit, 'Submit'); $this->assertBatchMessages($this->_resultMessages('batch_3'), t('Batch with simple and multistep operations performed successfully.')); $this->assertEqual(batch_test_stack(), $this->_resultStack('batch_3'), t('Execution order was correct.')); $this->assertText('Redirection successful.', t('Redirection after batch execution is correct.')); // Batch 4: nested batch. $edit = array('batch' => 'batch_4'); $this->drupalPost('batch-test/simple', $edit, 'Submit'); $this->assertBatchMessages($this->_resultMessages('batch_4'), t('Nested batch performed successfully.')); $this->assertEqual(batch_test_stack(), $this->_resultStack('batch_4'), t('Execution order was correct.')); $this->assertText('Redirection successful.', t('Redirection after batch execution is correct.')); } /** * Test batches defined in a multistep form. */ function testBatchFormMultistep() { $this->drupalGet('batch-test/multistep'); $this->assertText('step 1', t('Form is displayed in step 1.')); // First step triggers batch 1. $this->drupalPost(NULL, array(), 'Submit'); $this->assertBatchMessages($this->_resultMessages('batch_1'), t('Batch for step 1 performed successfully.')); $this->assertEqual(batch_test_stack(), $this->_resultStack('batch_1'), t('Execution order was correct.')); $this->assertText('step 2', t('Form is displayed in step 2.')); // Second step triggers batch 2. $this->drupalPost(NULL, array(), 'Submit'); $this->assertBatchMessages($this->_resultMessages('batch_2'), t('Batch for step 2 performed successfully.')); $this->assertEqual(batch_test_stack(), $this->_resultStack('batch_2'), t('Execution order was correct.')); $this->assertText('Redirection successful.', t('Redirection after batch execution is correct.')); } /** * Test batches defined in different submit handlers on the same form. */ function testBatchFormMultipleBatches() { // Batches 1, 2 and 3 are triggered in sequence by different submit // handlers. Each submit handler modify the submitted 'value'. $value = rand(0, 255); $edit = array('value' => $value); $this->drupalPost('batch-test/chained', $edit, 'Submit'); // Check that result messages are present and in the correct order. $this->assertBatchMessages($this->_resultMessages('chained'), t('Batches defined in separate submit handlers performed successfully.')); // The stack contains execution order of batch callbacks and submit // hanlders and logging of corresponding $form_state[{values']. $this->assertEqual(batch_test_stack(), $this->_resultStack('chained', $value), t('Execution order was correct, and $form_state is correctly persisted.')); $this->assertText('Redirection successful.', t('Redirection after batch execution is correct.')); } /** * Test batches defined in a programmatically submitted form. * * Same as above, but the form is submitted through drupal_form_execute(). */ function testBatchFormProgrammatic() { // Batches 1, 2 and 3 are triggered in sequence by different submit // handlers. Each submit handler modify the submitted 'value'. $value = rand(0, 255); $this->drupalGet('batch-test/programmatic/' . $value); // Check that result messages are present and in the correct order. $this->assertBatchMessages($this->_resultMessages('chained'), t('Batches defined in separate submit handlers performed successfully.')); // The stack contains execution order of batch callbacks and submit // hanlders and logging of corresponding $form_state[{values']. $this->assertEqual(batch_test_stack(), $this->_resultStack('chained', $value), t('Execution order was correct, and $form_state is correctly persisted.')); $this->assertText('Got out of a programmatic batched form.', t('Page execution continues normally.')); } /** * Test that drupal_form_submit() can run within a batch operation. */ function testDrupalFormSubmitInBatch() { // Displaying the page triggers a batch that programmatically submits a // form. $value = rand(0, 255); $this->drupalGet('batch-test/nested-programmatic/' . $value); $this->assertEqual(batch_test_stack(), array('mock form submitted with value = ' . $value), t('drupal_form_submit() ran successfully within a batch operation.')); } /** * Test batches that return $context['finished'] > 1 do in fact complete. * See http://drupal.org/node/600836 */ function testBatchLargePercentage() { // Displaying the page triggers batch 5. $this->drupalGet('batch-test/large-percentage'); $this->assertBatchMessages($this->_resultMessages(1), t('Batch for step 2 performed successfully.')); $this->assertEqual(batch_test_stack(), $this->_resultStack('batch_5'), t('Execution order was correct.')); $this->assertText('Redirection successful.', t('Redirection after batch execution is correct.')); } /** * Will trigger a pass if the texts were found in order in the raw content. * * @param $texts * Array of raw strings to look for . * @param $message * Message to display. * @return * TRUE on pass, FALSE on fail. */ function assertBatchMessages($texts, $message) { $pattern = '|' . implode('.*', $texts) .'|s'; return $this->assertPattern($pattern, $message); } /** * Helper function: return expected execution stacks for the test batches. */ function _resultStack($id, $value = 0) { $stack = array(); switch ($id) { case 'batch_1': for ($i = 1; $i <= 10; $i++) { $stack[] = "op 1 id $i"; } break; case 'batch_2': for ($i = 1; $i <= 10; $i++) { $stack[] = "op 2 id $i"; } break; case 'batch_3': for ($i = 1; $i <= 5; $i++) { $stack[] = "op 1 id $i"; } for ($i = 1; $i <= 5; $i++) { $stack[] = "op 2 id $i"; } for ($i = 6; $i <= 10; $i++) { $stack[] = "op 1 id $i"; } for ($i = 6; $i <= 10; $i++) { $stack[] = "op 2 id $i"; } break; case 'batch_4': for ($i = 1; $i <= 5; $i++) { $stack[] = "op 1 id $i"; } $stack[] = 'setting up batch 2'; for ($i = 6; $i <= 10; $i++) { $stack[] = "op 1 id $i"; } $stack = array_merge($stack, $this->_resultStack('batch_2')); break; case 'batch_5': for ($i = 1; $i <= 10; $i++) { $stack[] = "op 5 id $i"; } break; case 'chained': $stack[] = 'submit handler 1'; $stack[] = 'value = ' . $value; $stack = array_merge($stack, $this->_resultStack('batch_1')); $stack[] = 'submit handler 2'; $stack[] = 'value = ' . ($value + 1); $stack = array_merge($stack, $this->_resultStack('batch_2')); $stack[] = 'submit handler 3'; $stack[] = 'value = ' . ($value + 2); $stack[] = 'submit handler 4'; $stack[] = 'value = ' . ($value + 3); $stack = array_merge($stack, $this->_resultStack('batch_3')); break; } return $stack; } /** * Helper function: return expected result messages for the test batches. */ function _resultMessages($id) { $messages = array(); switch ($id) { case 'batch_0': $messages[] = 'results for batch 0
              none'; break; case 'batch_1': $messages[] = 'results for batch 1
              op 1: processed 10 elements'; break; case 'batch_2': $messages[] = 'results for batch 2
              op 2: processed 10 elements'; break; case 'batch_3': $messages[] = 'results for batch 3
              op 1: processed 10 elements
              op 2: processed 10 elements'; break; case 'batch_4': $messages[] = 'results for batch 4
              op 1: processed 10 elements'; $messages = array_merge($messages, $this->_resultMessages('batch_2')); break; case 'batch_5': $messages[] = 'results for batch 5
              op 1: processed 10 elements. $context[\'finished\'] > 1 returned from batch process, with success.'; break; case 'chained': $messages = array_merge($messages, $this->_resultMessages('batch_1')); $messages = array_merge($messages, $this->_resultMessages('batch_2')); $messages = array_merge($messages, $this->_resultMessages('batch_3')); break; } return $messages; } } /** * Tests for the Batch API Progress page. */ class BatchPageTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Batch progress page', 'description' => 'Test the content of the progress page.', 'group' => 'Batch API', ); } function setUp() { parent::setUp('batch_test'); } /** * Tests that the batch API progress page uses the correct theme. */ function testBatchProgressPageTheme() { // Make sure that the page which starts the batch (an administrative page) // is using a different theme than would normally be used by the batch API. variable_set('theme_default', 'bartik'); variable_set('admin_theme', 'seven'); // Log in as an administrator who can see the administrative theme. $admin_user = $this->drupalCreateUser(array('view the administration theme')); $this->drupalLogin($admin_user); // Visit an administrative page that runs a test batch, and check that the // theme that was used during batch execution (which the batch callback // function saved as a variable) matches the theme used on the // administrative page. $this->drupalGet('admin/batch-test/test-theme'); // The stack should contain the name of the theme used on the progress // page. $this->assertEqual(batch_test_stack(), array('seven'), t('A progressive batch correctly uses the theme of the page that started the batch.')); } } /** * Tests the function _batch_api_percentage() to make sure that the rounding * works properly in all cases. */ class BatchPercentagesUnitTestCase extends DrupalUnitTestCase { protected $testCases = array(); public static function getInfo() { return array( 'name' => 'Batch percentages', 'description' => 'Unit tests of progress percentage rounding.', 'group' => 'Batch API', ); } function setUp() { // Set up an array of test cases, where the expected values are the keys, // and the values are arrays with the keys 'total' and 'current', // corresponding with the function parameters of _batch_api_percentage(). $this->testCases = array( // 1/2 is 50%. '50' => array('total' => 2, 'current' => 1), // Though we should never encounter a case where the current set is set // 0, if we did, we should get 0%. '0' => array('total' => 3, 'current' => 0), // 1/3 is closer to 33% than to 34%. '33' => array('total' => 3, 'current' => 1), // 2/3 is closer to 67% than to 66%. '67' => array('total' => 3, 'current' => 2), // 1/199 should round up to 1%. '1' => array('total' => 199, 'current' => 1), // 198/199 should round down to 99%. '99' => array('total' => 199, 'current' => 198), // 199/200 would have rounded up to 100%, which would give the false // impression of being finished, so we add another digit and should get // 99.5%. '99.5' => array('total' => 200, 'current' => 199), // The same logic holds for 1/200: we should get 0.5%. '0.5' => array('total' => 200, 'current' => 1), // Numbers that come out evenly, such as 50/200, should be forced to have // extra digits for consistancy. '25.0' => array('total' => 200, 'current' => 50), // Regardless of number of digits we're using, 100% should always just be // 100%. '100' => array('total' => 200, 'current' => 200), // 1998/1999 should similarly round down to 99.9%. '99.9' => array('total' => 1999, 'current' => 1998), // 1999/2000 should add another digit and go to 99.95%. '99.95' => array('total' => 2000, 'current' => 1999), // 19999/20000 should add yet another digit and go to 99.995%. '99.995' => array('total' => 20000, 'current' => 19999), // The next five test cases simulate a batch with a single operation // ('total' equals 1) that takes several steps to complete. Within the // operation, we imagine that there are 501 items to process, and 100 are // completed during each step. The percentages we get back should be // rounded the usual way for the first few passes (i.e., 20%, 40%, etc.), // but for the last pass through, when 500 out of 501 items have been // processed, we do not want to round up to 100%, since that would // erroneously indicate that the processing is complete. '20' => array('total' => 1, 'current' => 100/501), '40' => array('total' => 1, 'current' => 200/501), '60' => array('total' => 1, 'current' => 300/501), '80' => array('total' => 1, 'current' => 400/501), '99.8' => array('total' => 1, 'current' => 500/501), ); require_once DRUPAL_ROOT . '/includes/batch.inc'; parent::setUp(); } /** * Test the _batch_api_percentage() function. */ function testBatchPercentages() { foreach ($this->testCases as $expected_result => $arguments) { // PHP sometimes casts numeric strings that are array keys to integers, // cast them back here. $expected_result = (string) $expected_result; $total = $arguments['total']; $current = $arguments['current']; $actual_result = _batch_api_percentage($total, $current); if ($actual_result === $expected_result) { $this->pass(t('Expected the batch api percentage at the state @numerator/@denominator to be @expected%, and got @actual%.', array('@numerator' => $current, '@denominator' => $total, '@expected' => $expected_result, '@actual' => $actual_result))); } else { $this->fail(t('Expected the batch api percentage at the state @numerator/@denominator to be @expected%, but got @actual%.', array('@numerator' => $current, '@denominator' => $total, '@expected' => $expected_result, '@actual' => $actual_result))); } } } } drupal-7.41/modules/simpletest/tests/drupal_autoload_test/0000755000000000000000000000000012611765734022667 5ustar rootrootdrupal-7.41/modules/simpletest/tests/drupal_autoload_test/drupal_autoload_test_class.inc0000644000000000000000000000032712611765734030767 0ustar rootrootname == 'drupal_autoload_test' && version_compare(PHP_VERSION, '5.4') >= 0) { $files["$module->dir/drupal_autoload_test_trait.sh"] = array( 'module' => $module->name, 'weight' => $module->weight, ); } } } drupal-7.41/modules/simpletest/tests/drupal_autoload_test/drupal_autoload_test_interface.inc0000644000000000000000000000027712611765734031626 0ustar rootrootinstallTables($schema); $this->addSampleData(); } /** * Set up several tables needed by a certain test. * * @param $schema * An array of table definitions to install. */ function installTables($schema) { // This ends up being a test for table drop and create, too, which is nice. foreach ($schema as $name => $data) { if (db_table_exists($name)) { db_drop_table($name); } db_create_table($name, $data); } foreach ($schema as $name => $data) { $this->assertTrue(db_table_exists($name), format_string('Table @name created successfully.', array('@name' => $name))); } } /** * Set up tables for NULL handling. */ function ensureSampleDataNull() { $schema['test_null'] = drupal_get_schema('test_null'); $this->installTables($schema); db_insert('test_null') ->fields(array('name', 'age')) ->values(array( 'name' => 'Kermit', 'age' => 25, )) ->values(array( 'name' => 'Fozzie', 'age' => NULL, )) ->values(array( 'name' => 'Gonzo', 'age' => 27, )) ->execute(); } /** * Setup our sample data. * * These are added using db_query(), since we're not trying to test the * INSERT operations here, just populate. */ function addSampleData() { // We need the IDs, so we can't use a multi-insert here. $john = db_insert('test') ->fields(array( 'name' => 'John', 'age' => 25, 'job' => 'Singer', )) ->execute(); $george = db_insert('test') ->fields(array( 'name' => 'George', 'age' => 27, 'job' => 'Singer', )) ->execute(); $ringo = db_insert('test') ->fields(array( 'name' => 'Ringo', 'age' => 28, 'job' => 'Drummer', )) ->execute(); $paul = db_insert('test') ->fields(array( 'name' => 'Paul', 'age' => 26, 'job' => 'Songwriter', )) ->execute(); db_insert('test_people') ->fields(array( 'name' => 'Meredith', 'age' => 30, 'job' => 'Speaker', )) ->execute(); db_insert('test_task') ->fields(array('pid', 'task', 'priority')) ->values(array( 'pid' => $john, 'task' => 'eat', 'priority' => 3, )) ->values(array( 'pid' => $john, 'task' => 'sleep', 'priority' => 4, )) ->values(array( 'pid' => $john, 'task' => 'code', 'priority' => 1, )) ->values(array( 'pid' => $george, 'task' => 'sing', 'priority' => 2, )) ->values(array( 'pid' => $george, 'task' => 'sleep', 'priority' => 2, )) ->values(array( 'pid' => $paul, 'task' => 'found new band', 'priority' => 1, )) ->values(array( 'pid' => $paul, 'task' => 'perform at superbowl', 'priority' => 3, )) ->execute(); } } /** * Test connection management. */ class DatabaseConnectionTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Connection tests', 'description' => 'Tests of the core database system.', 'group' => 'Database', ); } /** * Test that connections return appropriate connection objects. */ function testConnectionRouting() { // Clone the master credentials to a slave connection. // Note this will result in two independent connection objects that happen // to point to the same place. $connection_info = Database::getConnectionInfo('default'); Database::addConnectionInfo('default', 'slave', $connection_info['default']); $db1 = Database::getConnection('default', 'default'); $db2 = Database::getConnection('slave', 'default'); $this->assertNotNull($db1, 'default connection is a real connection object.'); $this->assertNotNull($db2, 'slave connection is a real connection object.'); $this->assertNotIdentical($db1, $db2, 'Each target refers to a different connection.'); // Try to open those targets another time, that should return the same objects. $db1b = Database::getConnection('default', 'default'); $db2b = Database::getConnection('slave', 'default'); $this->assertIdentical($db1, $db1b, 'A second call to getConnection() returns the same object.'); $this->assertIdentical($db2, $db2b, 'A second call to getConnection() returns the same object.'); // Try to open an unknown target. $unknown_target = $this->randomName(); $db3 = Database::getConnection($unknown_target, 'default'); $this->assertNotNull($db3, 'Opening an unknown target returns a real connection object.'); $this->assertIdentical($db1, $db3, 'An unknown target opens the default connection.'); // Try to open that unknown target another time, that should return the same object. $db3b = Database::getConnection($unknown_target, 'default'); $this->assertIdentical($db3, $db3b, 'A second call to getConnection() returns the same object.'); } /** * Test that connections return appropriate connection objects. */ function testConnectionRoutingOverride() { // Clone the master credentials to a slave connection. // Note this will result in two independent connection objects that happen // to point to the same place. $connection_info = Database::getConnectionInfo('default'); Database::addConnectionInfo('default', 'slave', $connection_info['default']); Database::ignoreTarget('default', 'slave'); $db1 = Database::getConnection('default', 'default'); $db2 = Database::getConnection('slave', 'default'); $this->assertIdentical($db1, $db2, 'Both targets refer to the same connection.'); } /** * Tests the closing of a database connection. */ function testConnectionClosing() { // Open the default target so we have an object to compare. $db1 = Database::getConnection('default', 'default'); // Try to close the default connection, then open a new one. Database::closeConnection('default', 'default'); $db2 = Database::getConnection('default', 'default'); // Opening a connection after closing it should yield an object different than the original. $this->assertNotIdentical($db1, $db2, 'Opening the default connection after it is closed returns a new object.'); } /** * Tests the connection options of the active database. */ function testConnectionOptions() { $connection_info = Database::getConnectionInfo('default'); // Be sure we're connected to the default database. $db = Database::getConnection('default', 'default'); $connectionOptions = $db->getConnectionOptions(); // In the MySQL driver, the port can be different, so check individual // options. $this->assertEqual($connection_info['default']['driver'], $connectionOptions['driver'], 'The default connection info driver matches the current connection options driver.'); $this->assertEqual($connection_info['default']['database'], $connectionOptions['database'], 'The default connection info database matches the current connection options database.'); // Set up identical slave and confirm connection options are identical. Database::addConnectionInfo('default', 'slave', $connection_info['default']); $db2 = Database::getConnection('slave', 'default'); $connectionOptions2 = $db2->getConnectionOptions(); // Get a fresh copy of the default connection options. $connectionOptions = $db->getConnectionOptions(); $this->assertIdentical($connectionOptions, $connectionOptions2, 'The default and slave connection options are identical.'); // Set up a new connection with different connection info. $test = $connection_info['default']; $test['database'] .= 'test'; Database::addConnectionInfo('test', 'default', $test); $connection_info = Database::getConnectionInfo('test'); // Get a fresh copy of the default connection options. $connectionOptions = $db->getConnectionOptions(); $this->assertNotEqual($connection_info['default']['database'], $connectionOptions['database'], 'The test connection info database does not match the current connection options database.'); } } /** * Test cloning Select queries. */ class DatabaseSelectCloneTest extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Select tests, cloning', 'description' => 'Test cloning Select queries.', 'group' => 'Database', ); } /** * Test that subqueries as value within conditions are cloned properly. */ function testSelectConditionSubQueryCloning() { $subquery = db_select('test', 't'); $subquery->addField('t', 'id', 'id'); $subquery->condition('age', 28, '<'); $query = db_select('test', 't'); $query->addField('t', 'name', 'name'); $query->condition('id', $subquery, 'IN'); $clone = clone $query; // Cloned query should not be altered by the following modification // happening on original query. $subquery->condition('age', 25, '>'); $clone_result = $clone->countQuery()->execute()->fetchField(); $query_result = $query->countQuery()->execute()->fetchField(); // Make sure the cloned query has not been modified $this->assertEqual(3, $clone_result, 'The cloned query returns the expected number of rows'); $this->assertEqual(2, $query_result, 'The query returns the expected number of rows'); } } /** * Test fetch actions, part 1. * * We get timeout errors if we try to run too many tests at once. */ class DatabaseFetchTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Fetch tests', 'description' => 'Test the Database system\'s various fetch capabilities.', 'group' => 'Database', ); } /** * Confirm that we can fetch a record properly in default object mode. */ function testQueryFetchDefault() { $records = array(); $result = db_query('SELECT name FROM {test} WHERE age = :age', array(':age' => 25)); $this->assertTrue($result instanceof DatabaseStatementInterface, 'Result set is a Drupal statement object.'); foreach ($result as $record) { $records[] = $record; $this->assertTrue(is_object($record), 'Record is an object.'); $this->assertIdentical($record->name, 'John', '25 year old is John.'); } $this->assertIdentical(count($records), 1, 'There is only one record.'); } /** * Confirm that we can fetch a record to an object explicitly. */ function testQueryFetchObject() { $records = array(); $result = db_query('SELECT name FROM {test} WHERE age = :age', array(':age' => 25), array('fetch' => PDO::FETCH_OBJ)); foreach ($result as $record) { $records[] = $record; $this->assertTrue(is_object($record), 'Record is an object.'); $this->assertIdentical($record->name, 'John', '25 year old is John.'); } $this->assertIdentical(count($records), 1, 'There is only one record.'); } /** * Confirm that we can fetch a record to an array associative explicitly. */ function testQueryFetchArray() { $records = array(); $result = db_query('SELECT name FROM {test} WHERE age = :age', array(':age' => 25), array('fetch' => PDO::FETCH_ASSOC)); foreach ($result as $record) { $records[] = $record; if ($this->assertTrue(is_array($record), 'Record is an array.')) { $this->assertIdentical($record['name'], 'John', 'Record can be accessed associatively.'); } } $this->assertIdentical(count($records), 1, 'There is only one record.'); } /** * Confirm that we can fetch a record into a new instance of a custom class. * * @see FakeRecord */ function testQueryFetchClass() { $records = array(); $result = db_query('SELECT name FROM {test} WHERE age = :age', array(':age' => 25), array('fetch' => 'FakeRecord')); foreach ($result as $record) { $records[] = $record; if ($this->assertTrue($record instanceof FakeRecord, 'Record is an object of class FakeRecord.')) { $this->assertIdentical($record->name, 'John', '25 year old is John.'); } } $this->assertIdentical(count($records), 1, 'There is only one record.'); } } /** * Test fetch actions, part 2. * * We get timeout errors if we try to run too many tests at once. */ class DatabaseFetch2TestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Fetch tests, part 2', 'description' => 'Test the Database system\'s various fetch capabilities.', 'group' => 'Database', ); } function setUp() { parent::setUp(); } // Confirm that we can fetch a record into an indexed array explicitly. function testQueryFetchNum() { $records = array(); $result = db_query('SELECT name FROM {test} WHERE age = :age', array(':age' => 25), array('fetch' => PDO::FETCH_NUM)); foreach ($result as $record) { $records[] = $record; if ($this->assertTrue(is_array($record), 'Record is an array.')) { $this->assertIdentical($record[0], 'John', 'Record can be accessed numerically.'); } } $this->assertIdentical(count($records), 1, 'There is only one record'); } /** * Confirm that we can fetch a record into a doubly-keyed array explicitly. */ function testQueryFetchBoth() { $records = array(); $result = db_query('SELECT name FROM {test} WHERE age = :age', array(':age' => 25), array('fetch' => PDO::FETCH_BOTH)); foreach ($result as $record) { $records[] = $record; if ($this->assertTrue(is_array($record), 'Record is an array.')) { $this->assertIdentical($record[0], 'John', 'Record can be accessed numerically.'); $this->assertIdentical($record['name'], 'John', 'Record can be accessed associatively.'); } } $this->assertIdentical(count($records), 1, 'There is only one record.'); } /** * Confirm that we can fetch an entire column of a result set at once. */ function testQueryFetchCol() { $records = array(); $result = db_query('SELECT name FROM {test} WHERE age > :age', array(':age' => 25)); $column = $result->fetchCol(); $this->assertIdentical(count($column), 3, 'fetchCol() returns the right number of records.'); $result = db_query('SELECT name FROM {test} WHERE age > :age', array(':age' => 25)); $i = 0; foreach ($result as $record) { $this->assertIdentical($record->name, $column[$i++], 'Column matches direct accesss.'); } } } /** * Test the insert builder. */ class DatabaseInsertTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Insert tests', 'description' => 'Test the Insert query builder.', 'group' => 'Database', ); } /** * Test the very basic insert functionality. */ function testSimpleInsert() { $num_records_before = db_query('SELECT COUNT(*) FROM {test}')->fetchField(); $query = db_insert('test'); $query->fields(array( 'name' => 'Yoko', 'age' => '29', )); $query->execute(); $num_records_after = db_query('SELECT COUNT(*) FROM {test}')->fetchField(); $this->assertIdentical($num_records_before + 1, (int) $num_records_after, 'Record inserts correctly.'); $saved_age = db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'Yoko'))->fetchField(); $this->assertIdentical($saved_age, '29', 'Can retrieve after inserting.'); } /** * Test that we can insert multiple records in one query object. */ function testMultiInsert() { $num_records_before = (int) db_query('SELECT COUNT(*) FROM {test}')->fetchField(); $query = db_insert('test'); $query->fields(array( 'name' => 'Larry', 'age' => '30', )); // We should be able to specify values in any order if named. $query->values(array( 'age' => '31', 'name' => 'Curly', )); // We should be able to say "use the field order". // This is not the recommended mechanism for most cases, but it should work. $query->values(array('Moe', '32')); $query->execute(); $num_records_after = (int) db_query('SELECT COUNT(*) FROM {test}')->fetchField(); $this->assertIdentical($num_records_before + 3, $num_records_after, 'Record inserts correctly.'); $saved_age = db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'Larry'))->fetchField(); $this->assertIdentical($saved_age, '30', 'Can retrieve after inserting.'); $saved_age = db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'Curly'))->fetchField(); $this->assertIdentical($saved_age, '31', 'Can retrieve after inserting.'); $saved_age = db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'Moe'))->fetchField(); $this->assertIdentical($saved_age, '32', 'Can retrieve after inserting.'); } /** * Test that an insert object can be reused with new data after it executes. */ function testRepeatedInsert() { $num_records_before = db_query('SELECT COUNT(*) FROM {test}')->fetchField(); $query = db_insert('test'); $query->fields(array( 'name' => 'Larry', 'age' => '30', )); $query->execute(); // This should run the insert, but leave the fields intact. // We should be able to specify values in any order if named. $query->values(array( 'age' => '31', 'name' => 'Curly', )); $query->execute(); // We should be able to say "use the field order". $query->values(array('Moe', '32')); $query->execute(); $num_records_after = db_query('SELECT COUNT(*) FROM {test}')->fetchField(); $this->assertIdentical((int) $num_records_before + 3, (int) $num_records_after, 'Record inserts correctly.'); $saved_age = db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'Larry'))->fetchField(); $this->assertIdentical($saved_age, '30', 'Can retrieve after inserting.'); $saved_age = db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'Curly'))->fetchField(); $this->assertIdentical($saved_age, '31', 'Can retrieve after inserting.'); $saved_age = db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'Moe'))->fetchField(); $this->assertIdentical($saved_age, '32', 'Can retrieve after inserting.'); } /** * Test that we can specify fields without values and specify values later. */ function testInsertFieldOnlyDefinintion() { // This is useful for importers, when we want to create a query and define // its fields once, then loop over a multi-insert execution. db_insert('test') ->fields(array('name', 'age')) ->values(array('Larry', '30')) ->values(array('Curly', '31')) ->values(array('Moe', '32')) ->execute(); $saved_age = db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'Larry'))->fetchField(); $this->assertIdentical($saved_age, '30', 'Can retrieve after inserting.'); $saved_age = db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'Curly'))->fetchField(); $this->assertIdentical($saved_age, '31', 'Can retrieve after inserting.'); $saved_age = db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'Moe'))->fetchField(); $this->assertIdentical($saved_age, '32', 'Can retrieve after inserting.'); } /** * Test that inserts return the proper auto-increment ID. */ function testInsertLastInsertID() { $id = db_insert('test') ->fields(array( 'name' => 'Larry', 'age' => '30', )) ->execute(); $this->assertIdentical($id, '5', 'Auto-increment ID returned successfully.'); } /** * Test that the INSERT INTO ... SELECT (fields) ... syntax works. */ function testInsertSelectFields() { $query = db_select('test_people', 'tp'); // The query builder will always append expressions after fields. // Add the expression first to test that the insert fields are correctly // re-ordered. $query->addExpression('tp.age', 'age'); $query ->fields('tp', array('name','job')) ->condition('tp.name', 'Meredith'); // The resulting query should be equivalent to: // INSERT INTO test (age, name, job) // SELECT tp.age AS age, tp.name AS name, tp.job AS job // FROM test_people tp // WHERE tp.name = 'Meredith' db_insert('test') ->from($query) ->execute(); $saved_age = db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'Meredith'))->fetchField(); $this->assertIdentical($saved_age, '30', 'Can retrieve after inserting.'); } /** * Tests that the INSERT INTO ... SELECT * ... syntax works. */ function testInsertSelectAll() { $query = db_select('test_people', 'tp') ->fields('tp') ->condition('tp.name', 'Meredith'); // The resulting query should be equivalent to: // INSERT INTO test_people_copy // SELECT * // FROM test_people tp // WHERE tp.name = 'Meredith' db_insert('test_people_copy') ->from($query) ->execute(); $saved_age = db_query('SELECT age FROM {test_people_copy} WHERE name = :name', array(':name' => 'Meredith'))->fetchField(); $this->assertIdentical($saved_age, '30', 'Can retrieve after inserting.'); } } /** * Insert tests using LOB fields, which are weird on some databases. */ class DatabaseInsertLOBTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Insert tests, LOB fields', 'description' => 'Test the Insert query builder with LOB fields.', 'group' => 'Database', ); } /** * Test that we can insert a single blob field successfully. */ function testInsertOneBlob() { $data = "This is\000a test."; $this->assertTrue(strlen($data) === 15, 'Test data contains a NULL.'); $id = db_insert('test_one_blob') ->fields(array('blob1' => $data)) ->execute(); $r = db_query('SELECT * FROM {test_one_blob} WHERE id = :id', array(':id' => $id))->fetchAssoc(); $this->assertTrue($r['blob1'] === $data, format_string('Can insert a blob: id @id, @data.', array('@id' => $id, '@data' => serialize($r)))); } /** * Test that we can insert multiple blob fields in the same query. */ function testInsertMultipleBlob() { $id = db_insert('test_two_blobs') ->fields(array( 'blob1' => 'This is', 'blob2' => 'a test', )) ->execute(); $r = db_query('SELECT * FROM {test_two_blobs} WHERE id = :id', array(':id' => $id))->fetchAssoc(); $this->assertTrue($r['blob1'] === 'This is' && $r['blob2'] === 'a test', 'Can insert multiple blobs per row.'); } } /** * Insert tests for "database default" values. */ class DatabaseInsertDefaultsTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Insert tests, default fields', 'description' => 'Test the Insert query builder with default values.', 'group' => 'Database', ); } /** * Test that we can run a query that is "default values for everything". */ function testDefaultInsert() { $query = db_insert('test')->useDefaults(array('job')); $id = $query->execute(); $schema = drupal_get_schema('test'); $job = db_query('SELECT job FROM {test} WHERE id = :id', array(':id' => $id))->fetchField(); $this->assertEqual($job, $schema['fields']['job']['default'], 'Default field value is set.'); } /** * Test that no action will be preformed if no fields are specified. */ function testDefaultEmptyInsert() { $num_records_before = (int) db_query('SELECT COUNT(*) FROM {test}')->fetchField(); try { $result = db_insert('test')->execute(); // This is only executed if no exception has been thrown. $this->fail('Expected exception NoFieldsException has not been thrown.'); } catch (NoFieldsException $e) { $this->pass('Expected exception NoFieldsException has been thrown.'); } $num_records_after = (int) db_query('SELECT COUNT(*) FROM {test}')->fetchField(); $this->assertIdentical($num_records_before, $num_records_after, 'Do nothing as no fields are specified.'); } /** * Test that we can insert fields with values and defaults in the same query. */ function testDefaultInsertWithFields() { $query = db_insert('test') ->fields(array('name' => 'Bob')) ->useDefaults(array('job')); $id = $query->execute(); $schema = drupal_get_schema('test'); $job = db_query('SELECT job FROM {test} WHERE id = :id', array(':id' => $id))->fetchField(); $this->assertEqual($job, $schema['fields']['job']['default'], 'Default field value is set.'); } } /** * Update builder tests. */ class DatabaseUpdateTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Update tests', 'description' => 'Test the Update query builder.', 'group' => 'Database', ); } /** * Confirm that we can update a single record successfully. */ function testSimpleUpdate() { $num_updated = db_update('test') ->fields(array('name' => 'Tiffany')) ->condition('id', 1) ->execute(); $this->assertIdentical($num_updated, 1, 'Updated 1 record.'); $saved_name = db_query('SELECT name FROM {test} WHERE id = :id', array(':id' => 1))->fetchField(); $this->assertIdentical($saved_name, 'Tiffany', 'Updated name successfully.'); } /** * Confirm updating to NULL. */ function testSimpleNullUpdate() { $this->ensureSampleDataNull(); $num_updated = db_update('test_null') ->fields(array('age' => NULL)) ->condition('name', 'Kermit') ->execute(); $this->assertIdentical($num_updated, 1, 'Updated 1 record.'); $saved_age = db_query('SELECT age FROM {test_null} WHERE name = :name', array(':name' => 'Kermit'))->fetchField(); $this->assertNull($saved_age, 'Updated name successfully.'); } /** * Confirm that we can update a multiple records successfully. */ function testMultiUpdate() { $num_updated = db_update('test') ->fields(array('job' => 'Musician')) ->condition('job', 'Singer') ->execute(); $this->assertIdentical($num_updated, 2, 'Updated 2 records.'); $num_matches = db_query('SELECT COUNT(*) FROM {test} WHERE job = :job', array(':job' => 'Musician'))->fetchField(); $this->assertIdentical($num_matches, '2', 'Updated fields successfully.'); } /** * Confirm that we can update a multiple records with a non-equality condition. */ function testMultiGTUpdate() { $num_updated = db_update('test') ->fields(array('job' => 'Musician')) ->condition('age', 26, '>') ->execute(); $this->assertIdentical($num_updated, 2, 'Updated 2 records.'); $num_matches = db_query('SELECT COUNT(*) FROM {test} WHERE job = :job', array(':job' => 'Musician'))->fetchField(); $this->assertIdentical($num_matches, '2', 'Updated fields successfully.'); } /** * Confirm that we can update a multiple records with a where call. */ function testWhereUpdate() { $num_updated = db_update('test') ->fields(array('job' => 'Musician')) ->where('age > :age', array(':age' => 26)) ->execute(); $this->assertIdentical($num_updated, 2, 'Updated 2 records.'); $num_matches = db_query('SELECT COUNT(*) FROM {test} WHERE job = :job', array(':job' => 'Musician'))->fetchField(); $this->assertIdentical($num_matches, '2', 'Updated fields successfully.'); } /** * Confirm that we can stack condition and where calls. */ function testWhereAndConditionUpdate() { $update = db_update('test') ->fields(array('job' => 'Musician')) ->where('age > :age', array(':age' => 26)) ->condition('name', 'Ringo'); $num_updated = $update->execute(); $this->assertIdentical($num_updated, 1, 'Updated 1 record.'); $num_matches = db_query('SELECT COUNT(*) FROM {test} WHERE job = :job', array(':job' => 'Musician'))->fetchField(); $this->assertIdentical($num_matches, '1', 'Updated fields successfully.'); } /** * Test updating with expressions. */ function testExpressionUpdate() { // Set age = 1 for a single row for this test to work. db_update('test') ->condition('id', 1) ->fields(array('age' => 1)) ->execute(); // Ensure that expressions are handled properly. This should set every // record's age to a square of itself, which will change only three of the // four records in the table since 1*1 = 1. That means only three records // are modified, so we should get back 3, not 4, from execute(). $num_rows = db_update('test') ->expression('age', 'age * age') ->execute(); $this->assertIdentical($num_rows, 3, 'Number of affected rows are returned.'); } /** * Confirm that we can update the primary key of a record successfully. */ function testPrimaryKeyUpdate() { $num_updated = db_update('test') ->fields(array('id' => 42, 'name' => 'John')) ->condition('id', 1) ->execute(); $this->assertIdentical($num_updated, 1, 'Updated 1 record.'); $saved_name= db_query('SELECT name FROM {test} WHERE id = :id', array(':id' => 42))->fetchField(); $this->assertIdentical($saved_name, 'John', 'Updated primary key successfully.'); } } /** * Tests for more complex update statements. */ class DatabaseUpdateComplexTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Update tests, Complex', 'description' => 'Test the Update query builder, complex queries.', 'group' => 'Database', ); } /** * Test updates with OR conditionals. */ function testOrConditionUpdate() { $update = db_update('test') ->fields(array('job' => 'Musician')) ->condition(db_or() ->condition('name', 'John') ->condition('name', 'Paul') ); $num_updated = $update->execute(); $this->assertIdentical($num_updated, 2, 'Updated 2 records.'); $num_matches = db_query('SELECT COUNT(*) FROM {test} WHERE job = :job', array(':job' => 'Musician'))->fetchField(); $this->assertIdentical($num_matches, '2', 'Updated fields successfully.'); } /** * Test WHERE IN clauses. */ function testInConditionUpdate() { $num_updated = db_update('test') ->fields(array('job' => 'Musician')) ->condition('name', array('John', 'Paul'), 'IN') ->execute(); $this->assertIdentical($num_updated, 2, 'Updated 2 records.'); $num_matches = db_query('SELECT COUNT(*) FROM {test} WHERE job = :job', array(':job' => 'Musician'))->fetchField(); $this->assertIdentical($num_matches, '2', 'Updated fields successfully.'); } /** * Test WHERE NOT IN clauses. */ function testNotInConditionUpdate() { // The o is lowercase in the 'NoT IN' operator, to make sure the operators // work in mixed case. $num_updated = db_update('test') ->fields(array('job' => 'Musician')) ->condition('name', array('John', 'Paul', 'George'), 'NoT IN') ->execute(); $this->assertIdentical($num_updated, 1, 'Updated 1 record.'); $num_matches = db_query('SELECT COUNT(*) FROM {test} WHERE job = :job', array(':job' => 'Musician'))->fetchField(); $this->assertIdentical($num_matches, '1', 'Updated fields successfully.'); } /** * Test BETWEEN conditional clauses. */ function testBetweenConditionUpdate() { $num_updated = db_update('test') ->fields(array('job' => 'Musician')) ->condition('age', array(25, 26), 'BETWEEN') ->execute(); $this->assertIdentical($num_updated, 2, 'Updated 2 records.'); $num_matches = db_query('SELECT COUNT(*) FROM {test} WHERE job = :job', array(':job' => 'Musician'))->fetchField(); $this->assertIdentical($num_matches, '2', 'Updated fields successfully.'); } /** * Test LIKE conditionals. */ function testLikeConditionUpdate() { $num_updated = db_update('test') ->fields(array('job' => 'Musician')) ->condition('name', '%ge%', 'LIKE') ->execute(); $this->assertIdentical($num_updated, 1, 'Updated 1 record.'); $num_matches = db_query('SELECT COUNT(*) FROM {test} WHERE job = :job', array(':job' => 'Musician'))->fetchField(); $this->assertIdentical($num_matches, '1', 'Updated fields successfully.'); } /** * Test update with expression values. */ function testUpdateExpression() { $before_age = db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'Ringo'))->fetchField(); $GLOBALS['larry_test'] = 1; $num_updated = db_update('test') ->condition('name', 'Ringo') ->fields(array('job' => 'Musician')) ->expression('age', 'age + :age', array(':age' => 4)) ->execute(); $this->assertIdentical($num_updated, 1, 'Updated 1 record.'); $num_matches = db_query('SELECT COUNT(*) FROM {test} WHERE job = :job', array(':job' => 'Musician'))->fetchField(); $this->assertIdentical($num_matches, '1', 'Updated fields successfully.'); $person = db_query('SELECT * FROM {test} WHERE name = :name', array(':name' => 'Ringo'))->fetch(); $this->assertEqual($person->name, 'Ringo', 'Name set correctly.'); $this->assertEqual($person->age, $before_age + 4, 'Age set correctly.'); $this->assertEqual($person->job, 'Musician', 'Job set correctly.'); $GLOBALS['larry_test'] = 0; } /** * Test update with only expression values. */ function testUpdateOnlyExpression() { $before_age = db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'Ringo'))->fetchField(); $num_updated = db_update('test') ->condition('name', 'Ringo') ->expression('age', 'age + :age', array(':age' => 4)) ->execute(); $this->assertIdentical($num_updated, 1, 'Updated 1 record.'); $after_age = db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'Ringo'))->fetchField(); $this->assertEqual($before_age + 4, $after_age, 'Age updated correctly'); } } /** * Test update queries involving LOB values. */ class DatabaseUpdateLOBTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Update tests, LOB', 'description' => 'Test the Update query builder with LOB fields.', 'group' => 'Database', ); } /** * Confirm that we can update a blob column. */ function testUpdateOneBlob() { $data = "This is\000a test."; $this->assertTrue(strlen($data) === 15, 'Test data contains a NULL.'); $id = db_insert('test_one_blob') ->fields(array('blob1' => $data)) ->execute(); $data .= $data; db_update('test_one_blob') ->condition('id', $id) ->fields(array('blob1' => $data)) ->execute(); $r = db_query('SELECT * FROM {test_one_blob} WHERE id = :id', array(':id' => $id))->fetchAssoc(); $this->assertTrue($r['blob1'] === $data, format_string('Can update a blob: id @id, @data.', array('@id' => $id, '@data' => serialize($r)))); } /** * Confirm that we can update two blob columns in the same table. */ function testUpdateMultipleBlob() { $id = db_insert('test_two_blobs') ->fields(array( 'blob1' => 'This is', 'blob2' => 'a test', )) ->execute(); db_update('test_two_blobs') ->condition('id', $id) ->fields(array('blob1' => 'and so', 'blob2' => 'is this')) ->execute(); $r = db_query('SELECT * FROM {test_two_blobs} WHERE id = :id', array(':id' => $id))->fetchAssoc(); $this->assertTrue($r['blob1'] === 'and so' && $r['blob2'] === 'is this', 'Can update multiple blobs per row.'); } } /** * Delete/Truncate tests. * * The DELETE tests are not as extensive, as all of the interesting code for * DELETE queries is in the conditional which is identical to the UPDATE and * SELECT conditional handling. * * The TRUNCATE tests are not extensive either, because the behavior of * TRUNCATE queries is not consistent across database engines. We only test * that a TRUNCATE query actually deletes all rows from the target table. */ class DatabaseDeleteTruncateTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Delete/Truncate tests', 'description' => 'Test the Delete and Truncate query builders.', 'group' => 'Database', ); } /** * Confirm that we can use a subselect in a delete successfully. */ function testSubselectDelete() { $num_records_before = db_query('SELECT COUNT(*) FROM {test_task}')->fetchField(); $pid_to_delete = db_query("SELECT * FROM {test_task} WHERE task = 'sleep'")->fetchField(); $subquery = db_select('test', 't') ->fields('t', array('id')) ->condition('t.id', array($pid_to_delete), 'IN'); $delete = db_delete('test_task') ->condition('task', 'sleep') ->condition('pid', $subquery, 'IN'); $num_deleted = $delete->execute(); $this->assertEqual($num_deleted, 1, "Deleted 1 record."); $num_records_after = db_query('SELECT COUNT(*) FROM {test_task}')->fetchField(); $this->assertEqual($num_records_before, $num_records_after + $num_deleted, 'Deletion adds up.'); } /** * Confirm that we can delete a single record successfully. */ function testSimpleDelete() { $num_records_before = db_query('SELECT COUNT(*) FROM {test}')->fetchField(); $num_deleted = db_delete('test') ->condition('id', 1) ->execute(); $this->assertIdentical($num_deleted, 1, 'Deleted 1 record.'); $num_records_after = db_query('SELECT COUNT(*) FROM {test}')->fetchField(); $this->assertEqual($num_records_before, $num_records_after + $num_deleted, 'Deletion adds up.'); } /** * Confirm that we can truncate a whole table successfully. */ function testTruncate() { $num_records_before = db_query("SELECT COUNT(*) FROM {test}")->fetchField(); db_truncate('test')->execute(); $num_records_after = db_query("SELECT COUNT(*) FROM {test}")->fetchField(); $this->assertEqual(0, $num_records_after, 'Truncate really deletes everything.'); } } /** * Test the MERGE query builder. */ class DatabaseMergeTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Merge tests', 'description' => 'Test the Merge query builder.', 'group' => 'Database', ); } /** * Confirm that we can merge-insert a record successfully. */ function testMergeInsert() { $num_records_before = db_query('SELECT COUNT(*) FROM {test_people}')->fetchField(); $result = db_merge('test_people') ->key(array('job' => 'Presenter')) ->fields(array( 'age' => 31, 'name' => 'Tiffany', )) ->execute(); $this->assertEqual($result, MergeQuery::STATUS_INSERT, 'Insert status returned.'); $num_records_after = db_query('SELECT COUNT(*) FROM {test_people}')->fetchField(); $this->assertEqual($num_records_before + 1, $num_records_after, 'Merge inserted properly.'); $person = db_query('SELECT * FROM {test_people} WHERE job = :job', array(':job' => 'Presenter'))->fetch(); $this->assertEqual($person->name, 'Tiffany', 'Name set correctly.'); $this->assertEqual($person->age, 31, 'Age set correctly.'); $this->assertEqual($person->job, 'Presenter', 'Job set correctly.'); } /** * Confirm that we can merge-update a record successfully. */ function testMergeUpdate() { $num_records_before = db_query('SELECT COUNT(*) FROM {test_people}')->fetchField(); $result = db_merge('test_people') ->key(array('job' => 'Speaker')) ->fields(array( 'age' => 31, 'name' => 'Tiffany', )) ->execute(); $this->assertEqual($result, MergeQuery::STATUS_UPDATE, 'Update status returned.'); $num_records_after = db_query('SELECT COUNT(*) FROM {test_people}')->fetchField(); $this->assertEqual($num_records_before, $num_records_after, 'Merge updated properly.'); $person = db_query('SELECT * FROM {test_people} WHERE job = :job', array(':job' => 'Speaker'))->fetch(); $this->assertEqual($person->name, 'Tiffany', 'Name set correctly.'); $this->assertEqual($person->age, 31, 'Age set correctly.'); $this->assertEqual($person->job, 'Speaker', 'Job set correctly.'); } /** * Confirm that we can merge-update a record successfully, with different insert and update. */ function testMergeUpdateExcept() { $num_records_before = db_query('SELECT COUNT(*) FROM {test_people}')->fetchField(); db_merge('test_people') ->key(array('job' => 'Speaker')) ->insertFields(array('age' => 31)) ->updateFields(array('name' => 'Tiffany')) ->execute(); $num_records_after = db_query('SELECT COUNT(*) FROM {test_people}')->fetchField(); $this->assertEqual($num_records_before, $num_records_after, 'Merge updated properly.'); $person = db_query('SELECT * FROM {test_people} WHERE job = :job', array(':job' => 'Speaker'))->fetch(); $this->assertEqual($person->name, 'Tiffany', 'Name set correctly.'); $this->assertEqual($person->age, 30, 'Age skipped correctly.'); $this->assertEqual($person->job, 'Speaker', 'Job set correctly.'); } /** * Confirm that we can merge-update a record successfully, with alternate replacement. */ function testMergeUpdateExplicit() { $num_records_before = db_query('SELECT COUNT(*) FROM {test_people}')->fetchField(); db_merge('test_people') ->key(array('job' => 'Speaker')) ->insertFields(array( 'age' => 31, 'name' => 'Tiffany', )) ->updateFields(array( 'name' => 'Joe', )) ->execute(); $num_records_after = db_query('SELECT COUNT(*) FROM {test_people}')->fetchField(); $this->assertEqual($num_records_before, $num_records_after, 'Merge updated properly.'); $person = db_query('SELECT * FROM {test_people} WHERE job = :job', array(':job' => 'Speaker'))->fetch(); $this->assertEqual($person->name, 'Joe', 'Name set correctly.'); $this->assertEqual($person->age, 30, 'Age skipped correctly.'); $this->assertEqual($person->job, 'Speaker', 'Job set correctly.'); } /** * Confirm that we can merge-update a record successfully, with expressions. */ function testMergeUpdateExpression() { $num_records_before = db_query('SELECT COUNT(*) FROM {test_people}')->fetchField(); $age_before = db_query('SELECT age FROM {test_people} WHERE job = :job', array(':job' => 'Speaker'))->fetchField(); // This is a very contrived example, as I have no idea why you'd want to // change age this way, but that's beside the point. // Note that we are also double-setting age here, once as a literal and // once as an expression. This test will only pass if the expression wins, // which is what is supposed to happen. db_merge('test_people') ->key(array('job' => 'Speaker')) ->fields(array('name' => 'Tiffany')) ->insertFields(array('age' => 31)) ->expression('age', 'age + :age', array(':age' => 4)) ->execute(); $num_records_after = db_query('SELECT COUNT(*) FROM {test_people}')->fetchField(); $this->assertEqual($num_records_before, $num_records_after, 'Merge updated properly.'); $person = db_query('SELECT * FROM {test_people} WHERE job = :job', array(':job' => 'Speaker'))->fetch(); $this->assertEqual($person->name, 'Tiffany', 'Name set correctly.'); $this->assertEqual($person->age, $age_before + 4, 'Age updated correctly.'); $this->assertEqual($person->job, 'Speaker', 'Job set correctly.'); } /** * Test that we can merge-insert without any update fields. */ function testMergeInsertWithoutUpdate() { $num_records_before = db_query('SELECT COUNT(*) FROM {test_people}')->fetchField(); db_merge('test_people') ->key(array('job' => 'Presenter')) ->execute(); $num_records_after = db_query('SELECT COUNT(*) FROM {test_people}')->fetchField(); $this->assertEqual($num_records_before + 1, $num_records_after, 'Merge inserted properly.'); $person = db_query('SELECT * FROM {test_people} WHERE job = :job', array(':job' => 'Presenter'))->fetch(); $this->assertEqual($person->name, '', 'Name set correctly.'); $this->assertEqual($person->age, 0, 'Age set correctly.'); $this->assertEqual($person->job, 'Presenter', 'Job set correctly.'); } /** * Confirm that we can merge-update without any update fields. */ function testMergeUpdateWithoutUpdate() { $num_records_before = db_query('SELECT COUNT(*) FROM {test_people}')->fetchField(); db_merge('test_people') ->key(array('job' => 'Speaker')) ->execute(); $num_records_after = db_query('SELECT COUNT(*) FROM {test_people}')->fetchField(); $this->assertEqual($num_records_before, $num_records_after, 'Merge skipped properly.'); $person = db_query('SELECT * FROM {test_people} WHERE job = :job', array(':job' => 'Speaker'))->fetch(); $this->assertEqual($person->name, 'Meredith', 'Name skipped correctly.'); $this->assertEqual($person->age, 30, 'Age skipped correctly.'); $this->assertEqual($person->job, 'Speaker', 'Job skipped correctly.'); db_merge('test_people') ->key(array('job' => 'Speaker')) ->insertFields(array('age' => 31)) ->execute(); $num_records_after = db_query('SELECT COUNT(*) FROM {test_people}')->fetchField(); $this->assertEqual($num_records_before, $num_records_after, 'Merge skipped properly.'); $person = db_query('SELECT * FROM {test_people} WHERE job = :job', array(':job' => 'Speaker'))->fetch(); $this->assertEqual($person->name, 'Meredith', 'Name skipped correctly.'); $this->assertEqual($person->age, 30, 'Age skipped correctly.'); $this->assertEqual($person->job, 'Speaker', 'Job skipped correctly.'); } /** * Test that an invalid merge query throws an exception like it is supposed to. */ function testInvalidMerge() { try { // This query should die because there is no key field specified. db_merge('test_people') ->fields(array( 'age' => 31, 'name' => 'Tiffany', )) ->execute(); } catch (InvalidMergeQueryException $e) { $this->pass('InvalidMergeQueryException thrown for invalid query.'); return; } $this->fail('No InvalidMergeQueryException thrown'); } } /** * Test the SELECT builder. */ class DatabaseSelectTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Select tests', 'description' => 'Test the Select query builder.', 'group' => 'Database', ); } /** * Test rudimentary SELECT statements. */ function testSimpleSelect() { $query = db_select('test'); $name_field = $query->addField('test', 'name'); $age_field = $query->addField('test', 'age', 'age'); $result = $query->execute(); $num_records = 0; foreach ($result as $record) { $num_records++; } $this->assertEqual($num_records, 4, 'Returned the correct number of rows.'); } /** * Test rudimentary SELECT statement with a COMMENT. */ function testSimpleComment() { $query = db_select('test')->comment('Testing query comments'); $name_field = $query->addField('test', 'name'); $age_field = $query->addField('test', 'age', 'age'); $result = $query->execute(); $num_records = 0; foreach ($result as $record) { $num_records++; } $query = (string)$query; $expected = "/* Testing query comments */ SELECT test.name AS name, test.age AS age\nFROM \n{test} test"; $this->assertEqual($num_records, 4, 'Returned the correct number of rows.'); $this->assertEqual($query, $expected, 'The flattened query contains the comment string.'); } /** * Test query COMMENT system against vulnerabilities. */ function testVulnerableComment() { $query = db_select('test')->comment('Testing query comments */ SELECT nid FROM {node}; --'); $name_field = $query->addField('test', 'name'); $age_field = $query->addField('test', 'age', 'age'); $result = $query->execute(); $num_records = 0; foreach ($result as $record) { $num_records++; } $query = (string)$query; $expected = "/* Testing query comments * / SELECT nid FROM {node}; -- */ SELECT test.name AS name, test.age AS age\nFROM \n{test} test"; $this->assertEqual($num_records, 4, 'Returned the correct number of rows.'); $this->assertEqual($query, $expected, 'The flattened query contains the sanitised comment string.'); $connection = Database::getConnection(); foreach ($this->makeCommentsProvider() as $test_set) { list($expected, $comments) = $test_set; $this->assertEqual($expected, $connection->makeComment($comments)); } } /** * Provides expected and input values for testVulnerableComment(). */ function makeCommentsProvider() { return array( array( '/* */ ', array(''), ), // Try and close the comment early. array( '/* Exploit * / DROP TABLE node; -- */ ', array('Exploit */ DROP TABLE node; --'), ), // Variations on comment closing. array( '/* Exploit * / * / DROP TABLE node; -- */ ', array('Exploit */*/ DROP TABLE node; --'), ), array( '/* Exploit * * // DROP TABLE node; -- */ ', array('Exploit **// DROP TABLE node; --'), ), // Try closing the comment in the second string which is appended. array( '/* Exploit * / DROP TABLE node; --; Another try * / DROP TABLE node; -- */ ', array('Exploit */ DROP TABLE node; --', 'Another try */ DROP TABLE node; --'), ), ); } /** * Test basic conditionals on SELECT statements. */ function testSimpleSelectConditional() { $query = db_select('test'); $name_field = $query->addField('test', 'name'); $age_field = $query->addField('test', 'age', 'age'); $query->condition('age', 27); $result = $query->execute(); // Check that the aliases are being created the way we want. $this->assertEqual($name_field, 'name', 'Name field alias is correct.'); $this->assertEqual($age_field, 'age', 'Age field alias is correct.'); // Ensure that we got the right record. $record = $result->fetch(); $this->assertEqual($record->$name_field, 'George', 'Fetched name is correct.'); $this->assertEqual($record->$age_field, 27, 'Fetched age is correct.'); } /** * Test SELECT statements with expressions. */ function testSimpleSelectExpression() { $query = db_select('test'); $name_field = $query->addField('test', 'name'); $age_field = $query->addExpression("age*2", 'double_age'); $query->condition('age', 27); $result = $query->execute(); // Check that the aliases are being created the way we want. $this->assertEqual($name_field, 'name', 'Name field alias is correct.'); $this->assertEqual($age_field, 'double_age', 'Age field alias is correct.'); // Ensure that we got the right record. $record = $result->fetch(); $this->assertEqual($record->$name_field, 'George', 'Fetched name is correct.'); $this->assertEqual($record->$age_field, 27*2, 'Fetched age expression is correct.'); } /** * Test SELECT statements with multiple expressions. */ function testSimpleSelectExpressionMultiple() { $query = db_select('test'); $name_field = $query->addField('test', 'name'); $age_double_field = $query->addExpression("age*2"); $age_triple_field = $query->addExpression("age*3"); $query->condition('age', 27); $result = $query->execute(); // Check that the aliases are being created the way we want. $this->assertEqual($age_double_field, 'expression', 'Double age field alias is correct.'); $this->assertEqual($age_triple_field, 'expression_2', 'Triple age field alias is correct.'); // Ensure that we got the right record. $record = $result->fetch(); $this->assertEqual($record->$name_field, 'George', 'Fetched name is correct.'); $this->assertEqual($record->$age_double_field, 27*2, 'Fetched double age expression is correct.'); $this->assertEqual($record->$age_triple_field, 27*3, 'Fetched triple age expression is correct.'); } /** * Test adding multiple fields to a select statement at the same time. */ function testSimpleSelectMultipleFields() { $record = db_select('test') ->fields('test', array('id', 'name', 'age', 'job')) ->condition('age', 27) ->execute()->fetchObject(); // Check that all fields we asked for are present. $this->assertNotNull($record->id, 'ID field is present.'); $this->assertNotNull($record->name, 'Name field is present.'); $this->assertNotNull($record->age, 'Age field is present.'); $this->assertNotNull($record->job, 'Job field is present.'); // Ensure that we got the right record. // Check that all fields we asked for are present. $this->assertEqual($record->id, 2, 'ID field has the correct value.'); $this->assertEqual($record->name, 'George', 'Name field has the correct value.'); $this->assertEqual($record->age, 27, 'Age field has the correct value.'); $this->assertEqual($record->job, 'Singer', 'Job field has the correct value.'); } /** * Test adding all fields from a given table to a select statement. */ function testSimpleSelectAllFields() { $record = db_select('test') ->fields('test') ->condition('age', 27) ->execute()->fetchObject(); // Check that all fields we asked for are present. $this->assertNotNull($record->id, 'ID field is present.'); $this->assertNotNull($record->name, 'Name field is present.'); $this->assertNotNull($record->age, 'Age field is present.'); $this->assertNotNull($record->job, 'Job field is present.'); // Ensure that we got the right record. // Check that all fields we asked for are present. $this->assertEqual($record->id, 2, 'ID field has the correct value.'); $this->assertEqual($record->name, 'George', 'Name field has the correct value.'); $this->assertEqual($record->age, 27, 'Age field has the correct value.'); $this->assertEqual($record->job, 'Singer', 'Job field has the correct value.'); } /** * Test that we can find a record with a NULL value. */ function testNullCondition() { $this->ensureSampleDataNull(); $names = db_select('test_null', 'tn') ->fields('tn', array('name')) ->isNull('age') ->execute()->fetchCol(); $this->assertEqual(count($names), 1, 'Correct number of records found with NULL age.'); $this->assertEqual($names[0], 'Fozzie', 'Correct record returned for NULL age.'); } /** * Test that we can find a record without a NULL value. */ function testNotNullCondition() { $this->ensureSampleDataNull(); $names = db_select('test_null', 'tn') ->fields('tn', array('name')) ->isNotNull('tn.age') ->orderBy('name') ->execute()->fetchCol(); $this->assertEqual(count($names), 2, 'Correct number of records found withNOT NULL age.'); $this->assertEqual($names[0], 'Gonzo', 'Correct record returned for NOT NULL age.'); $this->assertEqual($names[1], 'Kermit', 'Correct record returned for NOT NULL age.'); } /** * Test that we can UNION multiple Select queries together. This is * semantically equal to UNION DISTINCT, so we don't explicity test that. */ function testUnion() { $query_1 = db_select('test', 't') ->fields('t', array('name')) ->condition('age', array(27, 28), 'IN'); $query_2 = db_select('test', 't') ->fields('t', array('name')) ->condition('age', 28); $query_1->union($query_2); $names = $query_1->execute()->fetchCol(); // Ensure we only get 2 records. $this->assertEqual(count($names), 2, 'UNION correctly discarded duplicates.'); $this->assertEqual($names[0], 'George', 'First query returned correct name.'); $this->assertEqual($names[1], 'Ringo', 'Second query returned correct name.'); } /** * Test that we can UNION ALL multiple Select queries together. */ function testUnionAll() { $query_1 = db_select('test', 't') ->fields('t', array('name')) ->condition('age', array(27, 28), 'IN'); $query_2 = db_select('test', 't') ->fields('t', array('name')) ->condition('age', 28); $query_1->union($query_2, 'ALL'); $names = $query_1->execute()->fetchCol(); // Ensure we get all 3 records. $this->assertEqual(count($names), 3, 'UNION ALL correctly preserved duplicates.'); $this->assertEqual($names[0], 'George', 'First query returned correct first name.'); $this->assertEqual($names[1], 'Ringo', 'Second query returned correct second name.'); $this->assertEqual($names[2], 'Ringo', 'Third query returned correct name.'); } /** * Test that random ordering of queries works. * * We take the approach of testing the Drupal layer only, rather than trying * to test that the database's random number generator actually produces * random queries (which is very difficult to do without an unacceptable risk * of the test failing by accident). * * Therefore, in this test we simply run the same query twice and assert that * the two results are reordered versions of each other (as well as of the * same query without the random ordering). It is reasonable to assume that * if we run the same select query twice and the results are in a different * order each time, the only way this could happen is if we have successfully * triggered the database's random ordering functionality. */ function testRandomOrder() { // Use 52 items, so the chance that this test fails by accident will be the // same as the chance that a deck of cards will come out in the same order // after shuffling it (in other words, nearly impossible). $number_of_items = 52; while (db_query("SELECT MAX(id) FROM {test}")->fetchField() < $number_of_items) { db_insert('test')->fields(array('name' => $this->randomName()))->execute(); } // First select the items in order and make sure we get an ordered list. $expected_ids = range(1, $number_of_items); $ordered_ids = db_select('test', 't') ->fields('t', array('id')) ->range(0, $number_of_items) ->orderBy('id') ->execute() ->fetchCol(); $this->assertEqual($ordered_ids, $expected_ids, 'A query without random ordering returns IDs in the correct order.'); // Now perform the same query, but instead choose a random ordering. We // expect this to contain a differently ordered version of the original // result. $randomized_ids = db_select('test', 't') ->fields('t', array('id')) ->range(0, $number_of_items) ->orderRandom() ->execute() ->fetchCol(); $this->assertNotEqual($randomized_ids, $ordered_ids, 'A query with random ordering returns an unordered set of IDs.'); $sorted_ids = $randomized_ids; sort($sorted_ids); $this->assertEqual($sorted_ids, $ordered_ids, 'After sorting the random list, the result matches the original query.'); // Now perform the exact same query again, and make sure the order is // different. $randomized_ids_second_set = db_select('test', 't') ->fields('t', array('id')) ->range(0, $number_of_items) ->orderRandom() ->execute() ->fetchCol(); $this->assertNotEqual($randomized_ids_second_set, $randomized_ids, 'Performing the query with random ordering a second time returns IDs in a different order.'); $sorted_ids_second_set = $randomized_ids_second_set; sort($sorted_ids_second_set); $this->assertEqual($sorted_ids_second_set, $sorted_ids, 'After sorting the second random list, the result matches the sorted version of the first random list.'); } /** * Test that aliases are renamed when duplicates. */ function testSelectDuplicateAlias() { $query = db_select('test', 't'); $alias1 = $query->addField('t', 'name', 'the_alias'); $alias2 = $query->addField('t', 'age', 'the_alias'); $this->assertNotIdentical($alias1, $alias2, 'Duplicate aliases are renamed.'); } } /** * Test case for subselects in a dynamic SELECT query. */ class DatabaseSelectSubqueryTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Select tests, subqueries', 'description' => 'Test the Select query builder.', 'group' => 'Database', ); } /** * Test that we can use a subquery in a FROM clause. */ function testFromSubquerySelect() { // Create a subquery, which is just a normal query object. $subquery = db_select('test_task', 'tt'); $subquery->addField('tt', 'pid', 'pid'); $subquery->addField('tt', 'task', 'task'); $subquery->condition('priority', 1); for ($i = 0; $i < 2; $i++) { // Create another query that joins against the virtual table resulting // from the subquery. $select = db_select($subquery, 'tt2'); $select->join('test', 't', 't.id=tt2.pid'); $select->addField('t', 'name'); if ($i) { // Use a different number of conditions here to confuse the subquery // placeholder counter, testing http://drupal.org/node/1112854. $select->condition('name', 'John'); } $select->condition('task', 'code'); // The resulting query should be equivalent to: // SELECT t.name // FROM (SELECT tt.pid AS pid, tt.task AS task FROM test_task tt WHERE priority=1) tt // INNER JOIN test t ON t.id=tt.pid // WHERE tt.task = 'code' $people = $select->execute()->fetchCol(); $this->assertEqual(count($people), 1, 'Returned the correct number of rows.'); } } /** * Test that we can use a subquery in a FROM clause with a limit. */ function testFromSubquerySelectWithLimit() { // Create a subquery, which is just a normal query object. $subquery = db_select('test_task', 'tt'); $subquery->addField('tt', 'pid', 'pid'); $subquery->addField('tt', 'task', 'task'); $subquery->orderBy('priority', 'DESC'); $subquery->range(0, 1); // Create another query that joins against the virtual table resulting // from the subquery. $select = db_select($subquery, 'tt2'); $select->join('test', 't', 't.id=tt2.pid'); $select->addField('t', 'name'); // The resulting query should be equivalent to: // SELECT t.name // FROM (SELECT tt.pid AS pid, tt.task AS task FROM test_task tt ORDER BY priority DESC LIMIT 1 OFFSET 0) tt // INNER JOIN test t ON t.id=tt.pid $people = $select->execute()->fetchCol(); $this->assertEqual(count($people), 1, 'Returned the correct number of rows.'); } /** * Test that we can use a subquery in a WHERE clause. */ function testConditionSubquerySelect() { // Create a subquery, which is just a normal query object. $subquery = db_select('test_task', 'tt'); $subquery->addField('tt', 'pid', 'pid'); $subquery->condition('tt.priority', 1); // Create another query that joins against the virtual table resulting // from the subquery. $select = db_select('test_task', 'tt2'); $select->addField('tt2', 'task'); $select->condition('tt2.pid', $subquery, 'IN'); // The resulting query should be equivalent to: // SELECT tt2.name // FROM test tt2 // WHERE tt2.pid IN (SELECT tt.pid AS pid FROM test_task tt WHERE tt.priority=1) $people = $select->execute()->fetchCol(); $this->assertEqual(count($people), 5, 'Returned the correct number of rows.'); } /** * Test that we can use a subquery in a JOIN clause. */ function testJoinSubquerySelect() { // Create a subquery, which is just a normal query object. $subquery = db_select('test_task', 'tt'); $subquery->addField('tt', 'pid', 'pid'); $subquery->condition('priority', 1); // Create another query that joins against the virtual table resulting // from the subquery. $select = db_select('test', 't'); $select->join($subquery, 'tt', 't.id=tt.pid'); $select->addField('t', 'name'); // The resulting query should be equivalent to: // SELECT t.name // FROM test t // INNER JOIN (SELECT tt.pid AS pid FROM test_task tt WHERE priority=1) tt ON t.id=tt.pid $people = $select->execute()->fetchCol(); $this->assertEqual(count($people), 2, 'Returned the correct number of rows.'); } /** * Test EXISTS subquery conditionals on SELECT statements. * * We essentially select all rows from the {test} table that have matching * rows in the {test_people} table based on the shared name column. */ function testExistsSubquerySelect() { // Put George into {test_people}. db_insert('test_people') ->fields(array( 'name' => 'George', 'age' => 27, 'job' => 'Singer', )) ->execute(); // Base query to {test}. $query = db_select('test', 't') ->fields('t', array('name')); // Subquery to {test_people}. $subquery = db_select('test_people', 'tp') ->fields('tp', array('name')) ->where('tp.name = t.name'); $query->exists($subquery); $result = $query->execute(); // Ensure that we got the right record. $record = $result->fetch(); $this->assertEqual($record->name, 'George', 'Fetched name is correct using EXISTS query.'); } /** * Test NOT EXISTS subquery conditionals on SELECT statements. * * We essentially select all rows from the {test} table that don't have * matching rows in the {test_people} table based on the shared name column. */ function testNotExistsSubquerySelect() { // Put George into {test_people}. db_insert('test_people') ->fields(array( 'name' => 'George', 'age' => 27, 'job' => 'Singer', )) ->execute(); // Base query to {test}. $query = db_select('test', 't') ->fields('t', array('name')); // Subquery to {test_people}. $subquery = db_select('test_people', 'tp') ->fields('tp', array('name')) ->where('tp.name = t.name'); $query->notExists($subquery); // Ensure that we got the right number of records. $people = $query->execute()->fetchCol(); $this->assertEqual(count($people), 3, 'NOT EXISTS query returned the correct results.'); } } /** * Test select with order by clauses. */ class DatabaseSelectOrderedTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Select tests, ordered', 'description' => 'Test the Select query builder.', 'group' => 'Database', ); } /** * Test basic order by. */ function testSimpleSelectOrdered() { $query = db_select('test'); $name_field = $query->addField('test', 'name'); $age_field = $query->addField('test', 'age', 'age'); $query->orderBy($age_field); $result = $query->execute(); $num_records = 0; $last_age = 0; foreach ($result as $record) { $num_records++; $this->assertTrue($record->age >= $last_age, 'Results returned in correct order.'); $last_age = $record->age; } $this->assertEqual($num_records, 4, 'Returned the correct number of rows.'); } /** * Test multiple order by. */ function testSimpleSelectMultiOrdered() { $query = db_select('test'); $name_field = $query->addField('test', 'name'); $age_field = $query->addField('test', 'age', 'age'); $job_field = $query->addField('test', 'job'); $query->orderBy($job_field); $query->orderBy($age_field); $result = $query->execute(); $num_records = 0; $expected = array( array('Ringo', 28, 'Drummer'), array('John', 25, 'Singer'), array('George', 27, 'Singer'), array('Paul', 26, 'Songwriter'), ); $results = $result->fetchAll(PDO::FETCH_NUM); foreach ($expected as $k => $record) { $num_records++; foreach ($record as $kk => $col) { if ($expected[$k][$kk] != $results[$k][$kk]) { $this->assertTrue(FALSE, 'Results returned in correct order.'); } } } $this->assertEqual($num_records, 4, 'Returned the correct number of rows.'); } /** * Test order by descending. */ function testSimpleSelectOrderedDesc() { $query = db_select('test'); $name_field = $query->addField('test', 'name'); $age_field = $query->addField('test', 'age', 'age'); $query->orderBy($age_field, 'DESC'); $result = $query->execute(); $num_records = 0; $last_age = 100000000; foreach ($result as $record) { $num_records++; $this->assertTrue($record->age <= $last_age, 'Results returned in correct order.'); $last_age = $record->age; } $this->assertEqual($num_records, 4, 'Returned the correct number of rows.'); } /** * Tests that the sort direction is sanitized properly. */ function testOrderByEscaping() { $query = db_select('test')->orderBy('name', 'invalid direction'); $order_bys = $query->getOrderBy(); $this->assertEqual($order_bys['name'], 'ASC', 'Invalid order by direction is converted to ASC.'); } } /** * Test more complex select statements. */ class DatabaseSelectComplexTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Select tests, complex', 'description' => 'Test the Select query builder with more complex queries.', 'group' => 'Database', ); } /** * Test simple JOIN statements. */ function testDefaultJoin() { $query = db_select('test_task', 't'); $people_alias = $query->join('test', 'p', 't.pid = p.id'); $name_field = $query->addField($people_alias, 'name', 'name'); $task_field = $query->addField('t', 'task', 'task'); $priority_field = $query->addField('t', 'priority', 'priority'); $query->orderBy($priority_field); $result = $query->execute(); $num_records = 0; $last_priority = 0; foreach ($result as $record) { $num_records++; $this->assertTrue($record->$priority_field >= $last_priority, 'Results returned in correct order.'); $this->assertNotEqual($record->$name_field, 'Ringo', 'Taskless person not selected.'); $last_priority = $record->$priority_field; } $this->assertEqual($num_records, 7, 'Returned the correct number of rows.'); } /** * Test LEFT OUTER joins. */ function testLeftOuterJoin() { $query = db_select('test', 'p'); $people_alias = $query->leftJoin('test_task', 't', 't.pid = p.id'); $name_field = $query->addField('p', 'name', 'name'); $task_field = $query->addField($people_alias, 'task', 'task'); $priority_field = $query->addField($people_alias, 'priority', 'priority'); $query->orderBy($name_field); $result = $query->execute(); $num_records = 0; $last_name = 0; foreach ($result as $record) { $num_records++; $this->assertTrue(strcmp($record->$name_field, $last_name) >= 0, 'Results returned in correct order.'); $last_priority = $record->$name_field; } $this->assertEqual($num_records, 8, 'Returned the correct number of rows.'); } /** * Test GROUP BY clauses. */ function testGroupBy() { $query = db_select('test_task', 't'); $count_field = $query->addExpression('COUNT(task)', 'num'); $task_field = $query->addField('t', 'task'); $query->orderBy($count_field); $query->groupBy($task_field); $result = $query->execute(); $num_records = 0; $last_count = 0; $records = array(); foreach ($result as $record) { $num_records++; $this->assertTrue($record->$count_field >= $last_count, 'Results returned in correct order.'); $last_count = $record->$count_field; $records[$record->$task_field] = $record->$count_field; } $correct_results = array( 'eat' => 1, 'sleep' => 2, 'code' => 1, 'found new band' => 1, 'perform at superbowl' => 1, ); foreach ($correct_results as $task => $count) { $this->assertEqual($records[$task], $count, format_string("Correct number of '@task' records found.", array('@task' => $task))); } $this->assertEqual($num_records, 6, 'Returned the correct number of total rows.'); } /** * Test GROUP BY and HAVING clauses together. */ function testGroupByAndHaving() { $query = db_select('test_task', 't'); $count_field = $query->addExpression('COUNT(task)', 'num'); $task_field = $query->addField('t', 'task'); $query->orderBy($count_field); $query->groupBy($task_field); $query->having('COUNT(task) >= 2'); $result = $query->execute(); $num_records = 0; $last_count = 0; $records = array(); foreach ($result as $record) { $num_records++; $this->assertTrue($record->$count_field >= 2, 'Record has the minimum count.'); $this->assertTrue($record->$count_field >= $last_count, 'Results returned in correct order.'); $last_count = $record->$count_field; $records[$record->$task_field] = $record->$count_field; } $correct_results = array( 'sleep' => 2, ); foreach ($correct_results as $task => $count) { $this->assertEqual($records[$task], $count, format_string("Correct number of '@task' records found.", array('@task' => $task))); } $this->assertEqual($num_records, 1, 'Returned the correct number of total rows.'); } /** * Test range queries. The SQL clause varies with the database. */ function testRange() { $query = db_select('test'); $name_field = $query->addField('test', 'name'); $age_field = $query->addField('test', 'age', 'age'); $query->range(0, 2); $result = $query->execute(); $num_records = 0; foreach ($result as $record) { $num_records++; } $this->assertEqual($num_records, 2, 'Returned the correct number of rows.'); } /** * Test distinct queries. */ function testDistinct() { $query = db_select('test_task'); $task_field = $query->addField('test_task', 'task'); $query->distinct(); $result = $query->execute(); $num_records = 0; foreach ($result as $record) { $num_records++; } $this->assertEqual($num_records, 6, 'Returned the correct number of rows.'); } /** * Test that we can generate a count query from a built query. */ function testCountQuery() { $query = db_select('test'); $name_field = $query->addField('test', 'name'); $age_field = $query->addField('test', 'age', 'age'); $query->orderBy('name'); $count = $query->countQuery()->execute()->fetchField(); $this->assertEqual($count, 4, 'Counted the correct number of records.'); // Now make sure we didn't break the original query! We should still have // all of the fields we asked for. $record = $query->execute()->fetch(); $this->assertEqual($record->$name_field, 'George', 'Correct data retrieved.'); $this->assertEqual($record->$age_field, 27, 'Correct data retrieved.'); } function testHavingCountQuery() { $query = db_select('test') ->extend('PagerDefault') ->groupBy('age') ->having('age + 1 > 0'); $query->addField('test', 'age'); $query->addExpression('age + 1'); $count = count($query->execute()->fetchCol()); $this->assertEqual($count, 4, 'Counted the correct number of records.'); } /** * Test that countQuery properly removes 'all_fields' statements and * ordering clauses. */ function testCountQueryRemovals() { $query = db_select('test'); $query->fields('test'); $query->orderBy('name'); $count = $query->countQuery(); // Check that the 'all_fields' statement is handled properly. $tables = $query->getTables(); $this->assertEqual($tables['test']['all_fields'], 1, 'Query correctly sets \'all_fields\' statement.'); $tables = $count->getTables(); $this->assertFalse(isset($tables['test']['all_fields']), 'Count query correctly unsets \'all_fields\' statement.'); // Check that the ordering clause is handled properly. $orderby = $query->getOrderBy(); $this->assertEqual($orderby['name'], 'ASC', 'Query correctly sets ordering clause.'); $orderby = $count->getOrderBy(); $this->assertFalse(isset($orderby['name']), 'Count query correctly unsets ordering caluse.'); // Make sure that the count query works. $count = $count->execute()->fetchField(); $this->assertEqual($count, 4, 'Counted the correct number of records.'); } /** * Test that countQuery properly removes fields and expressions. */ function testCountQueryFieldRemovals() { // countQuery should remove all fields and expressions, so this can be // tested by adding a non-existent field and expression: if it ends // up in the query, an error will be thrown. If not, it will return the // number of records, which in this case happens to be 4 (there are four // records in the {test} table). $query = db_select('test'); $query->fields('test', array('fail')); $this->assertEqual(4, $query->countQuery()->execute()->fetchField(), 'Count Query removed fields'); $query = db_select('test'); $query->addExpression('fail'); $this->assertEqual(4, $query->countQuery()->execute()->fetchField(), 'Count Query removed expressions'); } /** * Test that we can generate a count query from a query with distinct. */ function testCountQueryDistinct() { $query = db_select('test_task'); $task_field = $query->addField('test_task', 'task'); $query->distinct(); $count = $query->countQuery()->execute()->fetchField(); $this->assertEqual($count, 6, 'Counted the correct number of records.'); } /** * Test that we can generate a count query from a query with GROUP BY. */ function testCountQueryGroupBy() { $query = db_select('test_task'); $pid_field = $query->addField('test_task', 'pid'); $query->groupBy('pid'); $count = $query->countQuery()->execute()->fetchField(); $this->assertEqual($count, 3, 'Counted the correct number of records.'); // Use a column alias as, without one, the query can succeed for the wrong // reason. $query = db_select('test_task'); $pid_field = $query->addField('test_task', 'pid', 'pid_alias'); $query->addExpression('COUNT(test_task.task)', 'count'); $query->groupBy('pid_alias'); $query->orderBy('pid_alias', 'asc'); $count = $query->countQuery()->execute()->fetchField(); $this->assertEqual($count, 3, 'Counted the correct number of records.'); } /** * Confirm that we can properly nest conditional clauses. */ function testNestedConditions() { // This query should translate to: // "SELECT job FROM {test} WHERE name = 'Paul' AND (age = 26 OR age = 27)" // That should find only one record. Yes it's a non-optimal way of writing // that query but that's not the point! $query = db_select('test'); $query->addField('test', 'job'); $query->condition('name', 'Paul'); $query->condition(db_or()->condition('age', 26)->condition('age', 27)); $job = $query->execute()->fetchField(); $this->assertEqual($job, 'Songwriter', 'Correct data retrieved.'); } /** * Confirm we can join on a single table twice with a dynamic alias. */ function testJoinTwice() { $query = db_select('test')->fields('test'); $alias = $query->join('test', 'test', 'test.job = %alias.job'); $query->addField($alias, 'name', 'othername'); $query->addField($alias, 'job', 'otherjob'); $query->where("$alias.name <> test.name"); $crowded_job = $query->execute()->fetch(); $this->assertEqual($crowded_job->job, $crowded_job->otherjob, 'Correctly joined same table twice.'); $this->assertNotEqual($crowded_job->name, $crowded_job->othername, 'Correctly joined same table twice.'); } } /** * Test more complex select statements, part 2. */ class DatabaseSelectComplexTestCase2 extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Select tests, complex 2', 'description' => 'Test the Select query builder with even more complex queries.', 'group' => 'Database', ); } function setUp() { DrupalWebTestCase::setUp('database_test', 'node_access_test'); $schema['test'] = drupal_get_schema('test'); $schema['test_people'] = drupal_get_schema('test_people'); $schema['test_one_blob'] = drupal_get_schema('test_one_blob'); $schema['test_two_blobs'] = drupal_get_schema('test_two_blobs'); $schema['test_task'] = drupal_get_schema('test_task'); $this->installTables($schema); $this->addSampleData(); } /** * Test that we can join on a query. */ function testJoinSubquery() { $acct = $this->drupalCreateUser(array('access content')); $this->drupalLogin($acct); $query = db_select('test_task', 'tt', array('target' => 'slave')); $query->addExpression('tt.pid + 1', 'abc'); $query->condition('priority', 1, '>'); $query->condition('priority', 100, '<'); $subquery = db_select('test', 'tp'); $subquery->join('test_one_blob', 'tpb', 'tp.id = tpb.id'); $subquery->join('node', 'n', 'tp.id = n.nid'); $subquery->addTag('node_access'); $subquery->addMetaData('account', $acct); $subquery->addField('tp', 'id'); $subquery->condition('age', 5, '>'); $subquery->condition('age', 500, '<'); $query->leftJoin($subquery, 'sq', 'tt.pid = sq.id'); $query->join('test_one_blob', 'tb3', 'tt.pid = tb3.id'); // Construct the query string. // This is the same sequence that SelectQuery::execute() goes through. $query->preExecute(); $query->getArguments(); $str = (string) $query; // Verify that the string only has one copy of condition placeholder 0. $pos = strpos($str, 'db_condition_placeholder_0', 0); $pos2 = strpos($str, 'db_condition_placeholder_0', $pos + 1); $this->assertFalse($pos2, 'Condition placeholder is not repeated.'); } } class DatabaseSelectPagerDefaultTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Pager query tests', 'description' => 'Test the pager query extender.', 'group' => 'Database', ); } /** * Confirm that a pager query returns the correct results. * * Note that we have to make an HTTP request to a test page handler * because the pager depends on GET parameters. */ function testEvenPagerQuery() { // To keep the test from being too brittle, we determine up front // what the page count should be dynamically, and pass the control // information forward to the actual query on the other side of the // HTTP request. $limit = 2; $count = db_query('SELECT COUNT(*) FROM {test}')->fetchField(); $correct_number = $limit; $num_pages = floor($count / $limit); // If there is no remainder from rounding, subtract 1 since we index from 0. if (!($num_pages * $limit < $count)) { $num_pages--; } for ($page = 0; $page <= $num_pages; ++$page) { $this->drupalGet('database_test/pager_query_even/' . $limit, array('query' => array('page' => $page))); $data = json_decode($this->drupalGetContent()); if ($page == $num_pages) { $correct_number = $count - ($limit * $page); } $this->assertEqual(count($data->names), $correct_number, format_string('Correct number of records returned by pager: @number', array('@number' => $correct_number))); } } /** * Confirm that a pager query returns the correct results. * * Note that we have to make an HTTP request to a test page handler * because the pager depends on GET parameters. */ function testOddPagerQuery() { // To keep the test from being too brittle, we determine up front // what the page count should be dynamically, and pass the control // information forward to the actual query on the other side of the // HTTP request. $limit = 2; $count = db_query('SELECT COUNT(*) FROM {test_task}')->fetchField(); $correct_number = $limit; $num_pages = floor($count / $limit); // If there is no remainder from rounding, subtract 1 since we index from 0. if (!($num_pages * $limit < $count)) { $num_pages--; } for ($page = 0; $page <= $num_pages; ++$page) { $this->drupalGet('database_test/pager_query_odd/' . $limit, array('query' => array('page' => $page))); $data = json_decode($this->drupalGetContent()); if ($page == $num_pages) { $correct_number = $count - ($limit * $page); } $this->assertEqual(count($data->names), $correct_number, format_string('Correct number of records returned by pager: @number', array('@number' => $correct_number))); } } /** * Confirm that a pager query with inner pager query returns valid results. * * This is a regression test for #467984. */ function testInnerPagerQuery() { $query = db_select('test', 't')->extend('PagerDefault'); $query ->fields('t', array('age')) ->orderBy('age') ->limit(5); $outer_query = db_select($query); $outer_query->addField('subquery', 'age'); $ages = $outer_query ->execute() ->fetchCol(); $this->assertEqual($ages, array(25, 26, 27, 28), 'Inner pager query returned the correct ages.'); } /** * Confirm that a paging query with a having expression returns valid results. * * This is a regression test for #467984. */ function testHavingPagerQuery() { $query = db_select('test', 't')->extend('PagerDefault'); $query ->fields('t', array('name')) ->orderBy('name') ->groupBy('name') ->having('MAX(age) > :count', array(':count' => 26)) ->limit(5); $ages = $query ->execute() ->fetchCol(); $this->assertEqual($ages, array('George', 'Ringo'), 'Pager query with having expression returned the correct ages.'); } /** * Confirm that every pager gets a valid non-overlaping element ID. */ function testElementNumbers() { $_GET['page'] = '3, 2, 1, 0'; $name = db_select('test', 't')->extend('PagerDefault') ->element(2) ->fields('t', array('name')) ->orderBy('age') ->limit(1) ->execute() ->fetchField(); $this->assertEqual($name, 'Paul', 'Pager query #1 with a specified element ID returned the correct results.'); // Setting an element smaller than the previous one // should not overwrite the pager $maxElement with a smaller value. $name = db_select('test', 't')->extend('PagerDefault') ->element(1) ->fields('t', array('name')) ->orderBy('age') ->limit(1) ->execute() ->fetchField(); $this->assertEqual($name, 'George', 'Pager query #2 with a specified element ID returned the correct results.'); $name = db_select('test', 't')->extend('PagerDefault') ->fields('t', array('name')) ->orderBy('age') ->limit(1) ->execute() ->fetchField(); $this->assertEqual($name, 'John', 'Pager query #3 with a generated element ID returned the correct results.'); unset($_GET['page']); } } class DatabaseSelectTableSortDefaultTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Tablesort query tests', 'description' => 'Test the tablesort query extender.', 'group' => 'Database', ); } /** * Confirm that a tablesort query returns the correct results. * * Note that we have to make an HTTP request to a test page handler * because the pager depends on GET parameters. */ function testTableSortQuery() { $sorts = array( array('field' => t('Task ID'), 'sort' => 'desc', 'first' => 'perform at superbowl', 'last' => 'eat'), array('field' => t('Task ID'), 'sort' => 'asc', 'first' => 'eat', 'last' => 'perform at superbowl'), array('field' => t('Task'), 'sort' => 'asc', 'first' => 'code', 'last' => 'sleep'), array('field' => t('Task'), 'sort' => 'desc', 'first' => 'sleep', 'last' => 'code'), // more elements here ); foreach ($sorts as $sort) { $this->drupalGet('database_test/tablesort/', array('query' => array('order' => $sort['field'], 'sort' => $sort['sort']))); $data = json_decode($this->drupalGetContent()); $first = array_shift($data->tasks); $last = array_pop($data->tasks); $this->assertEqual($first->task, $sort['first'], 'Items appear in the correct order.'); $this->assertEqual($last->task, $sort['last'], 'Items appear in the correct order.'); } } /** * Confirm that if a tablesort's orderByHeader is called before another orderBy, that the header happens first. * */ function testTableSortQueryFirst() { $sorts = array( array('field' => t('Task ID'), 'sort' => 'desc', 'first' => 'perform at superbowl', 'last' => 'eat'), array('field' => t('Task ID'), 'sort' => 'asc', 'first' => 'eat', 'last' => 'perform at superbowl'), array('field' => t('Task'), 'sort' => 'asc', 'first' => 'code', 'last' => 'sleep'), array('field' => t('Task'), 'sort' => 'desc', 'first' => 'sleep', 'last' => 'code'), // more elements here ); foreach ($sorts as $sort) { $this->drupalGet('database_test/tablesort_first/', array('query' => array('order' => $sort['field'], 'sort' => $sort['sort']))); $data = json_decode($this->drupalGetContent()); $first = array_shift($data->tasks); $last = array_pop($data->tasks); $this->assertEqual($first->task, $sort['first'], format_string('Items appear in the correct order sorting by @field @sort.', array('@field' => $sort['field'], '@sort' => $sort['sort']))); $this->assertEqual($last->task, $sort['last'], format_string('Items appear in the correct order sorting by @field @sort.', array('@field' => $sort['field'], '@sort' => $sort['sort']))); } } /** * Confirm that if a sort is not set in a tableselect form there is no error thrown when using the default. */ function testTableSortDefaultSort() { $this->drupalGet('database_test/tablesort_default_sort'); // Any PHP errors or notices thrown would trigger a simpletest exception, so // no additional assertions are needed. } } /** * Select tagging tests. * * Tags are a way to flag queries for alter hooks so they know * what type of query it is, such as "node_access". */ class DatabaseTaggingTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Query tagging tests', 'description' => 'Test the tagging capabilities of the Select builder.', 'group' => 'Database', ); } /** * Confirm that a query has a "tag" added to it. */ function testHasTag() { $query = db_select('test'); $query->addField('test', 'name'); $query->addField('test', 'age', 'age'); $query->addTag('test'); $this->assertTrue($query->hasTag('test'), 'hasTag() returned true.'); $this->assertFalse($query->hasTag('other'), 'hasTag() returned false.'); } /** * Test query tagging "has all of these tags" functionality. */ function testHasAllTags() { $query = db_select('test'); $query->addField('test', 'name'); $query->addField('test', 'age', 'age'); $query->addTag('test'); $query->addTag('other'); $this->assertTrue($query->hasAllTags('test', 'other'), 'hasAllTags() returned true.'); $this->assertFalse($query->hasAllTags('test', 'stuff'), 'hasAllTags() returned false.'); } /** * Test query tagging "has at least one of these tags" functionality. */ function testHasAnyTag() { $query = db_select('test'); $query->addField('test', 'name'); $query->addField('test', 'age', 'age'); $query->addTag('test'); $this->assertTrue($query->hasAnyTag('test', 'other'), 'hasAnyTag() returned true.'); $this->assertFalse($query->hasAnyTag('other', 'stuff'), 'hasAnyTag() returned false.'); } /** * Confirm that an extended query has a "tag" added to it. */ function testExtenderHasTag() { $query = db_select('test') ->extend('SelectQueryExtender'); $query->addField('test', 'name'); $query->addField('test', 'age', 'age'); $query->addTag('test'); $this->assertTrue($query->hasTag('test'), 'hasTag() returned true.'); $this->assertFalse($query->hasTag('other'), 'hasTag() returned false.'); } /** * Test extended query tagging "has all of these tags" functionality. */ function testExtenderHasAllTags() { $query = db_select('test') ->extend('SelectQueryExtender'); $query->addField('test', 'name'); $query->addField('test', 'age', 'age'); $query->addTag('test'); $query->addTag('other'); $this->assertTrue($query->hasAllTags('test', 'other'), 'hasAllTags() returned true.'); $this->assertFalse($query->hasAllTags('test', 'stuff'), 'hasAllTags() returned false.'); } /** * Test extended query tagging "has at least one of these tags" functionality. */ function testExtenderHasAnyTag() { $query = db_select('test') ->extend('SelectQueryExtender'); $query->addField('test', 'name'); $query->addField('test', 'age', 'age'); $query->addTag('test'); $this->assertTrue($query->hasAnyTag('test', 'other'), 'hasAnyTag() returned true.'); $this->assertFalse($query->hasAnyTag('other', 'stuff'), 'hasAnyTag() returned false.'); } /** * Test that we can attach meta data to a query object. * * This is how we pass additional context to alter hooks. */ function testMetaData() { $query = db_select('test'); $query->addField('test', 'name'); $query->addField('test', 'age', 'age'); $data = array( 'a' => 'A', 'b' => 'B', ); $query->addMetaData('test', $data); $return = $query->getMetaData('test'); $this->assertEqual($data, $return, 'Corect metadata returned.'); $return = $query->getMetaData('nothere'); $this->assertNull($return, 'Non-existent key returned NULL.'); } } /** * Select alter tests. * * @see database_test_query_alter() */ class DatabaseAlterTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Query altering tests', 'description' => 'Test the hook_query_alter capabilities of the Select builder.', 'group' => 'Database', ); } /** * Test that we can do basic alters. */ function testSimpleAlter() { $query = db_select('test'); $query->addField('test', 'name'); $query->addField('test', 'age', 'age'); $query->addTag('database_test_alter_add_range'); $result = $query->execute(); $num_records = 0; foreach ($result as $record) { $num_records++; } $this->assertEqual($num_records, 2, 'Returned the correct number of rows.'); } /** * Test that we can alter the joins on a query. */ function testAlterWithJoin() { $query = db_select('test_task'); $tid_field = $query->addField('test_task', 'tid'); $task_field = $query->addField('test_task', 'task'); $query->orderBy($task_field); $query->addTag('database_test_alter_add_join'); $result = $query->execute(); $records = $result->fetchAll(); $this->assertEqual(count($records), 2, 'Returned the correct number of rows.'); $this->assertEqual($records[0]->name, 'George', 'Correct data retrieved.'); $this->assertEqual($records[0]->$tid_field, 4, 'Correct data retrieved.'); $this->assertEqual($records[0]->$task_field, 'sing', 'Correct data retrieved.'); $this->assertEqual($records[1]->name, 'George', 'Correct data retrieved.'); $this->assertEqual($records[1]->$tid_field, 5, 'Correct data retrieved.'); $this->assertEqual($records[1]->$task_field, 'sleep', 'Correct data retrieved.'); } /** * Test that we can alter a query's conditionals. */ function testAlterChangeConditional() { $query = db_select('test_task'); $tid_field = $query->addField('test_task', 'tid'); $pid_field = $query->addField('test_task', 'pid'); $task_field = $query->addField('test_task', 'task'); $people_alias = $query->join('test', 'people', "test_task.pid = people.id"); $name_field = $query->addField($people_alias, 'name', 'name'); $query->condition('test_task.tid', '1'); $query->orderBy($tid_field); $query->addTag('database_test_alter_change_conditional'); $result = $query->execute(); $records = $result->fetchAll(); $this->assertEqual(count($records), 1, 'Returned the correct number of rows.'); $this->assertEqual($records[0]->$name_field, 'John', 'Correct data retrieved.'); $this->assertEqual($records[0]->$tid_field, 2, 'Correct data retrieved.'); $this->assertEqual($records[0]->$pid_field, 1, 'Correct data retrieved.'); $this->assertEqual($records[0]->$task_field, 'sleep', 'Correct data retrieved.'); } /** * Test that we can alter the fields of a query. */ function testAlterChangeFields() { $query = db_select('test'); $name_field = $query->addField('test', 'name'); $age_field = $query->addField('test', 'age', 'age'); $query->orderBy('name'); $query->addTag('database_test_alter_change_fields'); $record = $query->execute()->fetch(); $this->assertEqual($record->$name_field, 'George', 'Correct data retrieved.'); $this->assertFalse(isset($record->$age_field), 'Age field not found, as intended.'); } /** * Test that we can alter expressions in the query. */ function testAlterExpression() { $query = db_select('test'); $name_field = $query->addField('test', 'name'); $age_field = $query->addExpression("age*2", 'double_age'); $query->condition('age', 27); $query->addTag('database_test_alter_change_expressions'); $result = $query->execute(); // Ensure that we got the right record. $record = $result->fetch(); $this->assertEqual($record->$name_field, 'George', 'Fetched name is correct.'); $this->assertEqual($record->$age_field, 27*3, 'Fetched age expression is correct.'); } /** * Test that we can remove a range() value from a query. This also tests hook_query_TAG_alter(). */ function testAlterRemoveRange() { $query = db_select('test'); $query->addField('test', 'name'); $query->addField('test', 'age', 'age'); $query->range(0, 2); $query->addTag('database_test_alter_remove_range'); $num_records = count($query->execute()->fetchAll()); $this->assertEqual($num_records, 4, 'Returned the correct number of rows.'); } /** * Test that we can do basic alters on subqueries. */ function testSimpleAlterSubquery() { // Create a sub-query with an alter tag. $subquery = db_select('test', 'p'); $subquery->addField('p', 'name'); $subquery->addField('p', 'id'); // Pick out George. $subquery->condition('age', 27); $subquery->addExpression("age*2", 'double_age'); // This query alter should change it to age * 3. $subquery->addTag('database_test_alter_change_expressions'); // Create a main query and join to sub-query. $query = db_select('test_task', 'tt'); $query->join($subquery, 'pq', 'pq.id = tt.pid'); $age_field = $query->addField('pq', 'double_age'); $name_field = $query->addField('pq', 'name'); $record = $query->execute()->fetch(); $this->assertEqual($record->$name_field, 'George', 'Fetched name is correct.'); $this->assertEqual($record->$age_field, 27*3, 'Fetched age expression is correct.'); } } /** * Regression tests. */ class DatabaseRegressionTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Regression tests', 'description' => 'Regression tests cases for the database layer.', 'group' => 'Database', ); } /** * Regression test for #310447. * * Tries to insert non-ascii UTF-8 data in a database column and checks * if its stored properly. */ function testRegression_310447() { // That's a 255 character UTF-8 string. $name = str_repeat("é", 255); db_insert('test') ->fields(array( 'name' => $name, 'age' => 20, 'job' => 'Dancer', ))->execute(); $from_database = db_query('SELECT name FROM {test} WHERE name = :name', array(':name' => $name))->fetchField(); $this->assertIdentical($name, $from_database, "The database handles UTF-8 characters cleanly."); } /** * Test the db_table_exists() function. */ function testDBTableExists() { $this->assertIdentical(TRUE, db_table_exists('node'), 'Returns true for existent table.'); $this->assertIdentical(FALSE, db_table_exists('nosuchtable'), 'Returns false for nonexistent table.'); } /** * Test the db_field_exists() function. */ function testDBFieldExists() { $this->assertIdentical(TRUE, db_field_exists('node', 'nid'), 'Returns true for existent column.'); $this->assertIdentical(FALSE, db_field_exists('node', 'nosuchcolumn'), 'Returns false for nonexistent column.'); } /** * Test the db_index_exists() function. */ function testDBIndexExists() { $this->assertIdentical(TRUE, db_index_exists('node', 'node_created'), 'Returns true for existent index.'); $this->assertIdentical(FALSE, db_index_exists('node', 'nosuchindex'), 'Returns false for nonexistent index.'); } } /** * Query logging tests. */ class DatabaseLoggingTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Query logging', 'description' => 'Test the query logging facility.', 'group' => 'Database', ); } /** * Test that we can log the existence of a query. */ function testEnableLogging() { $log = Database::startLog('testing'); db_query('SELECT name FROM {test} WHERE age > :age', array(':age' => 25))->fetchCol(); db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'Ringo'))->fetchCol(); // Trigger a call that does not have file in the backtrace. call_user_func_array('db_query', array('SELECT age FROM {test} WHERE name = :name', array(':name' => 'Ringo')))->fetchCol(); $queries = Database::getLog('testing', 'default'); $this->assertEqual(count($queries), 3, 'Correct number of queries recorded.'); foreach ($queries as $query) { $this->assertEqual($query['caller']['function'], __FUNCTION__, 'Correct function in query log.'); } } /** * Test that we can run two logs in parallel. */ function testEnableMultiLogging() { Database::startLog('testing1'); db_query('SELECT name FROM {test} WHERE age > :age', array(':age' => 25))->fetchCol(); Database::startLog('testing2'); db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'Ringo'))->fetchCol(); $queries1 = Database::getLog('testing1'); $queries2 = Database::getLog('testing2'); $this->assertEqual(count($queries1), 2, 'Correct number of queries recorded for log 1.'); $this->assertEqual(count($queries2), 1, 'Correct number of queries recorded for log 2.'); } /** * Test that we can log queries against multiple targets on the same connection. */ function testEnableTargetLogging() { // Clone the master credentials to a slave connection and to another fake // connection. $connection_info = Database::getConnectionInfo('default'); Database::addConnectionInfo('default', 'slave', $connection_info['default']); Database::startLog('testing1'); db_query('SELECT name FROM {test} WHERE age > :age', array(':age' => 25))->fetchCol(); db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'Ringo'), array('target' => 'slave'));//->fetchCol(); $queries1 = Database::getLog('testing1'); $this->assertEqual(count($queries1), 2, 'Recorded queries from all targets.'); $this->assertEqual($queries1[0]['target'], 'default', 'First query used default target.'); $this->assertEqual($queries1[1]['target'], 'slave', 'Second query used slave target.'); } /** * Test that logs to separate targets collapse to the same connection properly. * * This test is identical to the one above, except that it doesn't create * a fake target so the query should fall back to running on the default * target. */ function testEnableTargetLoggingNoTarget() { Database::startLog('testing1'); db_query('SELECT name FROM {test} WHERE age > :age', array(':age' => 25))->fetchCol(); // We use "fake" here as a target because any non-existent target will do. // However, because all of the tests in this class share a single page // request there is likely to be a target of "slave" from one of the other // unit tests, so we use a target here that we know with absolute certainty // does not exist. db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'Ringo'), array('target' => 'fake'))->fetchCol(); $queries1 = Database::getLog('testing1'); $this->assertEqual(count($queries1), 2, 'Recorded queries from all targets.'); $this->assertEqual($queries1[0]['target'], 'default', 'First query used default target.'); $this->assertEqual($queries1[1]['target'], 'default', 'Second query used default target as fallback.'); } /** * Test that we can log queries separately on different connections. */ function testEnableMultiConnectionLogging() { // Clone the master credentials to a fake connection. // That both connections point to the same physical database is irrelevant. $connection_info = Database::getConnectionInfo('default'); Database::addConnectionInfo('test2', 'default', $connection_info['default']); Database::startLog('testing1'); Database::startLog('testing1', 'test2'); db_query('SELECT name FROM {test} WHERE age > :age', array(':age' => 25))->fetchCol(); $old_key = db_set_active('test2'); db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'Ringo'), array('target' => 'slave'))->fetchCol(); db_set_active($old_key); $queries1 = Database::getLog('testing1'); $queries2 = Database::getLog('testing1', 'test2'); $this->assertEqual(count($queries1), 1, 'Correct number of queries recorded for first connection.'); $this->assertEqual(count($queries2), 1, 'Correct number of queries recorded for second connection.'); } } /** * Query serialization tests. */ class DatabaseSerializeQueryTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Serialize query', 'description' => 'Test serializing and unserializing a query.', 'group' => 'Database', ); } /** * Confirm that a query can be serialized and unserialized. */ function testSerializeQuery() { $query = db_select('test'); $query->addField('test', 'age'); $query->condition('name', 'Ringo'); // If this doesn't work, it will throw an exception, so no need for an // assertion. $query = unserialize(serialize($query)); $results = $query->execute()->fetchCol(); $this->assertEqual($results[0], 28, 'Query properly executed after unserialization.'); } } /** * Range query tests. */ class DatabaseRangeQueryTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Range query test', 'description' => 'Test the Range query functionality.', 'group' => 'Database', ); } function setUp() { parent::setUp('database_test'); } /** * Confirm that range query work and return correct result. */ function testRangeQuery() { // Test if return correct number of rows. $range_rows = db_query_range("SELECT name FROM {system} ORDER BY name", 2, 3)->fetchAll(); $this->assertEqual(count($range_rows), 3, 'Range query work and return correct number of rows.'); // Test if return target data. $raw_rows = db_query('SELECT name FROM {system} ORDER BY name')->fetchAll(); $raw_rows = array_slice($raw_rows, 2, 3); $this->assertEqual($range_rows, $raw_rows, 'Range query work and return target data.'); } } /** * Temporary query tests. */ class DatabaseTemporaryQueryTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Temporary query test', 'description' => 'Test the temporary query functionality.', 'group' => 'Database', ); } function setUp() { parent::setUp('database_test'); } /** * Return the number of rows of a table. */ function countTableRows($table_name) { return db_select($table_name)->countQuery()->execute()->fetchField(); } /** * Confirm that temporary tables work and are limited to one request. */ function testTemporaryQuery() { $this->drupalGet('database_test/db_query_temporary'); $data = json_decode($this->drupalGetContent()); if ($data) { $this->assertEqual($this->countTableRows("system"), $data->row_count, 'The temporary table contains the correct amount of rows.'); $this->assertFalse(db_table_exists($data->table_name), 'The temporary table is, indeed, temporary.'); } else { $this->fail("The creation of the temporary table failed."); } // Now try to run two db_query_temporary() in the same request. $table_name_system = db_query_temporary('SELECT status FROM {system}', array()); $table_name_users = db_query_temporary('SELECT uid FROM {users}', array()); $this->assertEqual($this->countTableRows($table_name_system), $this->countTableRows("system"), 'A temporary table was created successfully in this request.'); $this->assertEqual($this->countTableRows($table_name_users), $this->countTableRows("users"), 'A second temporary table was created successfully in this request.'); // Check that leading whitespace and comments do not cause problems // in the modified query. $sql = " -- Let's select some rows into a temporary table SELECT name FROM {test} "; $table_name_test = db_query_temporary($sql, array()); $this->assertEqual($this->countTableRows($table_name_test), $this->countTableRows('test'), 'Leading white space and comments do not interfere with temporary table creation.'); } } /** * Test how the current database driver interprets the SQL syntax. * * In order to ensure consistent SQL handling throughout Drupal * across multiple kinds of database systems, we test that the * database system interprets SQL syntax in an expected fashion. */ class DatabaseBasicSyntaxTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Basic SQL syntax tests', 'description' => 'Test SQL syntax interpretation.', 'group' => 'Database', ); } function setUp() { parent::setUp('database_test'); } /** * Test for string concatenation. */ function testBasicConcat() { $result = db_query('SELECT CONCAT(:a1, CONCAT(:a2, CONCAT(:a3, CONCAT(:a4, :a5))))', array( ':a1' => 'This', ':a2' => ' ', ':a3' => 'is', ':a4' => ' a ', ':a5' => 'test.', )); $this->assertIdentical($result->fetchField(), 'This is a test.', 'Basic CONCAT works.'); } /** * Test for string concatenation with field values. */ function testFieldConcat() { $result = db_query('SELECT CONCAT(:a1, CONCAT(name, CONCAT(:a2, CONCAT(age, :a3)))) FROM {test} WHERE age = :age', array( ':a1' => 'The age of ', ':a2' => ' is ', ':a3' => '.', ':age' => 25, )); $this->assertIdentical($result->fetchField(), 'The age of John is 25.', 'Field CONCAT works.'); } /** * Test escaping of LIKE wildcards. */ function testLikeEscape() { db_insert('test') ->fields(array( 'name' => 'Ring_', )) ->execute(); // Match both "Ringo" and "Ring_". $num_matches = db_select('test', 't') ->condition('name', 'Ring_', 'LIKE') ->countQuery() ->execute() ->fetchField(); $this->assertIdentical($num_matches, '2', 'Found 2 records.'); // Match only "Ring_" using a LIKE expression with no wildcards. $num_matches = db_select('test', 't') ->condition('name', db_like('Ring_'), 'LIKE') ->countQuery() ->execute() ->fetchField(); $this->assertIdentical($num_matches, '1', 'Found 1 record.'); } /** * Test LIKE query containing a backslash. */ function testLikeBackslash() { db_insert('test') ->fields(array('name')) ->values(array( 'name' => 'abcde\f', )) ->values(array( 'name' => 'abc%\_', )) ->execute(); // Match both rows using a LIKE expression with two wildcards and a verbatim // backslash. $num_matches = db_select('test', 't') ->condition('name', 'abc%\\\\_', 'LIKE') ->countQuery() ->execute() ->fetchField(); $this->assertIdentical($num_matches, '2', 'Found 2 records.'); // Match only the former using a LIKE expression with no wildcards. $num_matches = db_select('test', 't') ->condition('name', db_like('abc%\_'), 'LIKE') ->countQuery() ->execute() ->fetchField(); $this->assertIdentical($num_matches, '1', 'Found 1 record.'); } } /** * Test case sensitivity handling. */ class DatabaseCaseSensitivityTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Case sensitivity', 'description' => 'Test handling case sensitive collation.', 'group' => 'Database', ); } /** * Test BINARY collation in MySQL. */ function testCaseSensitiveInsert() { $num_records_before = db_query('SELECT COUNT(*) FROM {test}')->fetchField(); $john = db_insert('test') ->fields(array( 'name' => 'john', // <- A record already exists with name 'John'. 'age' => 2, 'job' => 'Baby', )) ->execute(); $num_records_after = db_query('SELECT COUNT(*) FROM {test}')->fetchField(); $this->assertIdentical($num_records_before + 1, (int) $num_records_after, 'Record inserts correctly.'); $saved_age = db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'john'))->fetchField(); $this->assertIdentical($saved_age, '2', 'Can retrieve after inserting.'); } } /** * Test invalid data handling. */ class DatabaseInvalidDataTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Invalid data', 'description' => 'Test handling of some invalid data.', 'group' => 'Database', ); } function setUp() { parent::setUp('database_test'); } /** * Traditional SQL database systems abort inserts when invalid data is encountered. */ function testInsertDuplicateData() { // Try to insert multiple records where at least one has bad data. try { db_insert('test') ->fields(array('name', 'age', 'job')) ->values(array( 'name' => 'Elvis', 'age' => 63, 'job' => 'Singer', ))->values(array( 'name' => 'John', // <-- Duplicate value on unique field. 'age' => 17, 'job' => 'Consultant', )) ->values(array( 'name' => 'Frank', 'age' => 75, 'job' => 'Singer', )) ->execute(); $this->fail('Insert succeedded when it should not have.'); } catch (Exception $e) { // Check if the first record was inserted. $name = db_query('SELECT name FROM {test} WHERE age = :age', array(':age' => 63))->fetchField(); if ($name == 'Elvis') { if (!Database::getConnection()->supportsTransactions()) { // This is an expected fail. // Database engines that don't support transactions can leave partial // inserts in place when an error occurs. This is the case for MySQL // when running on a MyISAM table. $this->pass("The whole transaction has not been rolled-back when a duplicate key insert occurs, this is expected because the database doesn't support transactions"); } else { $this->fail('The whole transaction is rolled back when a duplicate key insert occurs.'); } } else { $this->pass('The whole transaction is rolled back when a duplicate key insert occurs.'); } // Ensure the other values were not inserted. $record = db_select('test') ->fields('test', array('name', 'age')) ->condition('age', array(17, 75), 'IN') ->execute()->fetchObject(); $this->assertFalse($record, 'The rest of the insert aborted as expected.'); } } } /** * Drupal-specific SQL syntax tests. */ class DatabaseQueryTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Custom query syntax tests', 'description' => 'Test Drupal\'s extended prepared statement syntax..', 'group' => 'Database', ); } function setUp() { parent::setUp('database_test'); } /** * Test that we can specify an array of values in the query by simply passing in an array. */ function testArraySubstitution() { $names = db_query('SELECT name FROM {test} WHERE age IN (:ages) ORDER BY age', array(':ages' => array(25, 26, 27)))->fetchAll(); $this->assertEqual(count($names), 3, 'Correct number of names returned'); } /** * Test SQL injection via database query array arguments. */ public function testArrayArgumentsSQLInjection() { // Attempt SQL injection and verify that it does not work. $condition = array( "1 ;INSERT INTO {test} (name) VALUES ('test12345678'); -- " => '', '1' => '', ); try { db_query("SELECT * FROM {test} WHERE name = :name", array(':name' => $condition))->fetchObject(); $this->fail('SQL injection attempt via array arguments should result in a PDOException.'); } catch (PDOException $e) { $this->pass('SQL injection attempt via array arguments should result in a PDOException.'); } // Test that the insert query that was used in the SQL injection attempt did // not result in a row being inserted in the database. $result = db_select('test') ->condition('name', 'test12345678') ->countQuery() ->execute() ->fetchField(); $this->assertFalse($result, 'SQL injection attempt did not result in a row being inserted in the database table.'); } } /** * Test transaction support, particularly nesting. * * We test nesting by having two transaction layers, an outer and inner. The * outer layer encapsulates the inner layer. Our transaction nesting abstraction * should allow the outer layer function to call any function it wants, * especially the inner layer that starts its own transaction, and be * confident that, when the function it calls returns, its own transaction * is still "alive." * * Call structure: * transactionOuterLayer() * Start transaction * transactionInnerLayer() * Start transaction (does nothing in database) * [Maybe decide to roll back] * Do more stuff * Should still be in transaction A * */ class DatabaseTransactionTestCase extends DatabaseTestCase { public static function getInfo() { return array( 'name' => 'Transaction tests', 'description' => 'Test the transaction abstraction system.', 'group' => 'Database', ); } /** * Helper method for transaction unit test. * * This "outer layer" transaction starts and then encapsulates the * "inner layer" transaction. This nesting is used to evaluate whether the * database transaction API properly supports nesting. By "properly supports," * we mean the outer transaction continues to exist regardless of what * functions are called and whether those functions start their own * transactions. * * In contrast, a typical database would commit the outer transaction, start * a new transaction for the inner layer, commit the inner layer transaction, * and then be confused when the outer layer transaction tries to commit its * transaction (which was already committed when the inner transaction * started). * * @param $suffix * Suffix to add to field values to differentiate tests. * @param $rollback * Whether or not to try rolling back the transaction when we're done. * @param $ddl_statement * Whether to execute a DDL statement during the inner transaction. */ protected function transactionOuterLayer($suffix, $rollback = FALSE, $ddl_statement = FALSE) { $connection = Database::getConnection(); $depth = $connection->transactionDepth(); $txn = db_transaction(); // Insert a single row into the testing table. db_insert('test') ->fields(array( 'name' => 'David' . $suffix, 'age' => '24', )) ->execute(); $this->assertTrue($connection->inTransaction(), 'In transaction before calling nested transaction.'); // We're already in a transaction, but we call ->transactionInnerLayer // to nest another transaction inside the current one. $this->transactionInnerLayer($suffix, $rollback, $ddl_statement); $this->assertTrue($connection->inTransaction(), 'In transaction after calling nested transaction.'); if ($rollback) { // Roll back the transaction, if requested. // This rollback should propagate to the last savepoint. $txn->rollback(); $this->assertTrue(($connection->transactionDepth() == $depth), 'Transaction has rolled back to the last savepoint after calling rollback().'); } } /** * Helper method for transaction unit tests. This "inner layer" transaction * is either used alone or nested inside of the "outer layer" transaction. * * @param $suffix * Suffix to add to field values to differentiate tests. * @param $rollback * Whether or not to try rolling back the transaction when we're done. * @param $ddl_statement * Whether to execute a DDL statement during the transaction. */ protected function transactionInnerLayer($suffix, $rollback = FALSE, $ddl_statement = FALSE) { $connection = Database::getConnection(); $depth = $connection->transactionDepth(); // Start a transaction. If we're being called from ->transactionOuterLayer, // then we're already in a transaction. Normally, that would make starting // a transaction here dangerous, but the database API handles this problem // for us by tracking the nesting and avoiding the danger. $txn = db_transaction(); $depth2 = $connection->transactionDepth(); $this->assertTrue($depth < $depth2, 'Transaction depth is has increased with new transaction.'); // Insert a single row into the testing table. db_insert('test') ->fields(array( 'name' => 'Daniel' . $suffix, 'age' => '19', )) ->execute(); $this->assertTrue($connection->inTransaction(), 'In transaction inside nested transaction.'); if ($ddl_statement) { $table = array( 'fields' => array( 'id' => array( 'type' => 'serial', 'unsigned' => TRUE, 'not null' => TRUE, ), ), 'primary key' => array('id'), ); db_create_table('database_test_1', $table); $this->assertTrue($connection->inTransaction(), 'In transaction inside nested transaction.'); } if ($rollback) { // Roll back the transaction, if requested. // This rollback should propagate to the last savepoint. $txn->rollback(); $this->assertTrue(($connection->transactionDepth() == $depth), 'Transaction has rolled back to the last savepoint after calling rollback().'); } } /** * Test transaction rollback on a database that supports transactions. * * If the active connection does not support transactions, this test does nothing. */ function testTransactionRollBackSupported() { // This test won't work right if transactions are not supported. if (!Database::getConnection()->supportsTransactions()) { return; } try { // Create two nested transactions. Roll back from the inner one. $this->transactionOuterLayer('B', TRUE); // Neither of the rows we inserted in the two transaction layers // should be present in the tables post-rollback. $saved_age = db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'DavidB'))->fetchField(); $this->assertNotIdentical($saved_age, '24', 'Cannot retrieve DavidB row after commit.'); $saved_age = db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'DanielB'))->fetchField(); $this->assertNotIdentical($saved_age, '19', 'Cannot retrieve DanielB row after commit.'); } catch (Exception $e) { $this->fail($e->getMessage()); } } /** * Test transaction rollback on a database that does not support transactions. * * If the active driver supports transactions, this test does nothing. */ function testTransactionRollBackNotSupported() { // This test won't work right if transactions are supported. if (Database::getConnection()->supportsTransactions()) { return; } try { // Create two nested transactions. Attempt to roll back from the inner one. $this->transactionOuterLayer('B', TRUE); // Because our current database claims to not support transactions, // the inserted rows should be present despite the attempt to roll back. $saved_age = db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'DavidB'))->fetchField(); $this->assertIdentical($saved_age, '24', 'DavidB not rolled back, since transactions are not supported.'); $saved_age = db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'DanielB'))->fetchField(); $this->assertIdentical($saved_age, '19', 'DanielB not rolled back, since transactions are not supported.'); } catch (Exception $e) { $this->fail($e->getMessage()); } } /** * Test committed transaction. * * The behavior of this test should be identical for connections that support * transactions and those that do not. */ function testCommittedTransaction() { try { // Create two nested transactions. The changes should be committed. $this->transactionOuterLayer('A'); // Because we committed, both of the inserted rows should be present. $saved_age = db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'DavidA'))->fetchField(); $this->assertIdentical($saved_age, '24', 'Can retrieve DavidA row after commit.'); $saved_age = db_query('SELECT age FROM {test} WHERE name = :name', array(':name' => 'DanielA'))->fetchField(); $this->assertIdentical($saved_age, '19', 'Can retrieve DanielA row after commit.'); } catch (Exception $e) { $this->fail($e->getMessage()); } } /** * Test the compatibility of transactions with DDL statements. */ function testTransactionWithDdlStatement() { // First, test that a commit works normally, even with DDL statements. $transaction = db_transaction(); $this->insertRow('row'); $this->executeDDLStatement(); unset($transaction); $this->assertRowPresent('row'); // Even in different order. $this->cleanUp(); $transaction = db_transaction(); $this->executeDDLStatement(); $this->insertRow('row'); unset($transaction); $this->assertRowPresent('row'); // Even with stacking. $this->cleanUp(); $transaction = db_transaction(); $transaction2 = db_transaction(); $this->executeDDLStatement(); unset($transaction2); $transaction3 = db_transaction(); $this->insertRow('row'); unset($transaction3); unset($transaction); $this->assertRowPresent('row'); // A transaction after a DDL statement should still work the same. $this->cleanUp(); $transaction = db_transaction(); $transaction2 = db_transaction(); $this->executeDDLStatement(); unset($transaction2); $transaction3 = db_transaction(); $this->insertRow('row'); $transaction3->rollback(); unset($transaction3); unset($transaction); $this->assertRowAbsent('row'); // The behavior of a rollback depends on the type of database server. if (Database::getConnection()->supportsTransactionalDDL()) { // For database servers that support transactional DDL, a rollback // of a transaction including DDL statements should be possible. $this->cleanUp(); $transaction = db_transaction(); $this->insertRow('row'); $this->executeDDLStatement(); $transaction->rollback(); unset($transaction); $this->assertRowAbsent('row'); // Including with stacking. $this->cleanUp(); $transaction = db_transaction(); $transaction2 = db_transaction(); $this->executeDDLStatement(); unset($transaction2); $transaction3 = db_transaction(); $this->insertRow('row'); unset($transaction3); $transaction->rollback(); unset($transaction); $this->assertRowAbsent('row'); } else { // For database servers that do not support transactional DDL, // the DDL statement should commit the transaction stack. $this->cleanUp(); $transaction = db_transaction(); $this->insertRow('row'); $this->executeDDLStatement(); // Rollback the outer transaction. try { $transaction->rollback(); unset($transaction); // @TODO: an exception should be triggered here, but is not, because // "ROLLBACK" fails silently in MySQL if there is no transaction active. // $this->fail(t('Rolling back a transaction containing DDL should fail.')); } catch (DatabaseTransactionNoActiveException $e) { $this->pass('Rolling back a transaction containing DDL should fail.'); } $this->assertRowPresent('row'); } } /** * Insert a single row into the testing table. */ protected function insertRow($name) { db_insert('test') ->fields(array( 'name' => $name, )) ->execute(); } /** * Execute a DDL statement. */ protected function executeDDLStatement() { static $count = 0; $table = array( 'fields' => array( 'id' => array( 'type' => 'serial', 'unsigned' => TRUE, 'not null' => TRUE, ), ), 'primary key' => array('id'), ); db_create_table('database_test_' . ++$count, $table); } /** * Start over for a new test. */ protected function cleanUp() { db_truncate('test') ->execute(); } /** * Assert that a given row is present in the test table. * * @param $name * The name of the row. * @param $message * The message to log for the assertion. */ function assertRowPresent($name, $message = NULL) { if (!isset($message)) { $message = format_string('Row %name is present.', array('%name' => $name)); } $present = (boolean) db_query('SELECT 1 FROM {test} WHERE name = :name', array(':name' => $name))->fetchField(); return $this->assertTrue($present, $message); } /** * Assert that a given row is absent from the test table. * * @param $name * The name of the row. * @param $message * The message to log for the assertion. */ function assertRowAbsent($name, $message = NULL) { if (!isset($message)) { $message = format_string('Row %name is absent.', array('%name' => $name)); } $present = (boolean) db_query('SELECT 1 FROM {test} WHERE name = :name', array(':name' => $name))->fetchField(); return $this->assertFalse($present, $message); } /** * Test transaction stacking and commit / rollback. */ function testTransactionStacking() { // This test won't work right if transactions are not supported. if (!Database::getConnection()->supportsTransactions()) { return; } $database = Database::getConnection(); // Standard case: pop the inner transaction before the outer transaction. $transaction = db_transaction(); $this->insertRow('outer'); $transaction2 = db_transaction(); $this->insertRow('inner'); // Pop the inner transaction. unset($transaction2); $this->assertTrue($database->inTransaction(), 'Still in a transaction after popping the inner transaction'); // Pop the outer transaction. unset($transaction); $this->assertFalse($database->inTransaction(), 'Transaction closed after popping the outer transaction'); $this->assertRowPresent('outer'); $this->assertRowPresent('inner'); // Pop the transaction in a different order they have been pushed. $this->cleanUp(); $transaction = db_transaction(); $this->insertRow('outer'); $transaction2 = db_transaction(); $this->insertRow('inner'); // Pop the outer transaction, nothing should happen. unset($transaction); $this->insertRow('inner-after-outer-commit'); $this->assertTrue($database->inTransaction(), 'Still in a transaction after popping the outer transaction'); // Pop the inner transaction, the whole transaction should commit. unset($transaction2); $this->assertFalse($database->inTransaction(), 'Transaction closed after popping the inner transaction'); $this->assertRowPresent('outer'); $this->assertRowPresent('inner'); $this->assertRowPresent('inner-after-outer-commit'); // Rollback the inner transaction. $this->cleanUp(); $transaction = db_transaction(); $this->insertRow('outer'); $transaction2 = db_transaction(); $this->insertRow('inner'); // Now rollback the inner transaction. $transaction2->rollback(); unset($transaction2); $this->assertTrue($database->inTransaction(), 'Still in a transaction after popping the outer transaction'); // Pop the outer transaction, it should commit. $this->insertRow('outer-after-inner-rollback'); unset($transaction); $this->assertFalse($database->inTransaction(), 'Transaction closed after popping the inner transaction'); $this->assertRowPresent('outer'); $this->assertRowAbsent('inner'); $this->assertRowPresent('outer-after-inner-rollback'); // Rollback the inner transaction after committing the outer one. $this->cleanUp(); $transaction = db_transaction(); $this->insertRow('outer'); $transaction2 = db_transaction(); $this->insertRow('inner'); // Pop the outer transaction, nothing should happen. unset($transaction); $this->assertTrue($database->inTransaction(), 'Still in a transaction after popping the outer transaction'); // Now rollback the inner transaction, it should rollback. $transaction2->rollback(); unset($transaction2); $this->assertFalse($database->inTransaction(), 'Transaction closed after popping the inner transaction'); $this->assertRowPresent('outer'); $this->assertRowAbsent('inner'); // Rollback the outer transaction while the inner transaction is active. // In that case, an exception will be triggered because we cannot // ensure that the final result will have any meaning. $this->cleanUp(); $transaction = db_transaction(); $this->insertRow('outer'); $transaction2 = db_transaction(); $this->insertRow('inner'); $transaction3 = db_transaction(); $this->insertRow('inner2'); // Rollback the outer transaction. try { $transaction->rollback(); unset($transaction); $this->fail('Rolling back the outer transaction while the inner transaction is active resulted in an exception.'); } catch (DatabaseTransactionOutOfOrderException $e) { $this->pass('Rolling back the outer transaction while the inner transaction is active resulted in an exception.'); } $this->assertFalse($database->inTransaction(), 'No more in a transaction after rolling back the outer transaction'); // Try to commit one inner transaction. unset($transaction3); $this->pass('Trying to commit an inner transaction resulted in an exception.'); // Try to rollback one inner transaction. try { $transaction->rollback(); unset($transaction2); $this->fail('Trying to commit an inner transaction resulted in an exception.'); } catch (DatabaseTransactionNoActiveException $e) { $this->pass('Trying to commit an inner transaction resulted in an exception.'); } $this->assertRowAbsent('outer'); $this->assertRowAbsent('inner'); $this->assertRowAbsent('inner2'); } } /** * Check the sequences API. */ class DatabaseNextIdCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Sequences API', 'description' => 'Test the secondary sequences API.', 'group' => 'Database', ); } /** * Test that the sequences API work. */ function testDbNextId() { $first = db_next_id(); $second = db_next_id(); // We can test for exact increase in here because we know there is no // other process operating on these tables -- normally we could only // expect $second > $first. $this->assertEqual($first + 1, $second, 'The second call from a sequence provides a number increased by one.'); $result = db_next_id(1000); $this->assertEqual($result, 1001, 'Sequence provides a larger number than the existing ID.'); } } /** * Tests the empty pseudo-statement class. */ class DatabaseEmptyStatementTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Empty statement', 'description' => 'Test the empty pseudo-statement class.', 'group' => 'Database', ); } /** * Test that the empty result set behaves as empty. */ function testEmpty() { $result = new DatabaseStatementEmpty(); $this->assertTrue($result instanceof DatabaseStatementInterface, 'Class implements expected interface'); $this->assertNull($result->fetchObject(), 'Null result returned.'); } /** * Test that the empty result set iterates safely. */ function testEmptyIteration() { $result = new DatabaseStatementEmpty(); foreach ($result as $record) { $this->fail('Iterating empty result set should not iterate.'); return; } $this->pass('Iterating empty result set skipped iteration.'); } /** * Test that the empty result set mass-fetches in an expected way. */ function testEmptyFetchAll() { $result = new DatabaseStatementEmpty(); $this->assertEqual($result->fetchAll(), array(), 'Empty array returned from empty result set.'); } } /** * Tests management of database connections. */ class ConnectionUnitTest extends DrupalUnitTestCase { protected $key; protected $target; protected $monitor; protected $originalCount; public static function getInfo() { return array( 'name' => 'Connection unit tests', 'description' => 'Tests management of database connections.', 'group' => 'Database', ); } function setUp() { parent::setUp(); $this->key = 'default'; $this->originalTarget = 'default'; $this->target = 'DatabaseConnectionUnitTest'; // Determine whether the database driver is MySQL. If it is not, the test // methods will not be executed. // @todo Make this test driver-agnostic, or find a proper way to skip it. // @see http://drupal.org/node/1273478 $connection_info = Database::getConnectionInfo('default'); $this->skipTest = (bool) $connection_info['default']['driver'] != 'mysql'; if ($this->skipTest) { // Insert an assertion to prevent Simpletest from interpreting the test // as failure. $this->pass('This test is only compatible with MySQL.'); } // Create an additional connection to monitor the connections being opened // and closed in this test. // @see TestBase::changeDatabasePrefix() $connection_info = Database::getConnectionInfo('default'); Database::addConnectionInfo('default', 'monitor', $connection_info['default']); global $databases; $databases['default']['monitor'] = $connection_info['default']; $this->monitor = Database::getConnection('monitor'); } /** * Adds a new database connection info to Database. */ protected function addConnection() { // Add a new target to the connection, by cloning the current connection. $connection_info = Database::getConnectionInfo($this->key); Database::addConnectionInfo($this->key, $this->target, $connection_info[$this->originalTarget]); // Verify that the new target exists. $info = Database::getConnectionInfo($this->key); // Note: Custom assertion message to not expose database credentials. $this->assertIdentical($info[$this->target], $connection_info[$this->key], 'New connection info found.'); } /** * Returns the connection ID of the current test connection. * * @return integer */ protected function getConnectionID() { return (int) Database::getConnection($this->target, $this->key)->query('SELECT CONNECTION_ID()')->fetchField(); } /** * Asserts that a connection ID exists. * * @param integer $id * The connection ID to verify. */ protected function assertConnection($id) { $list = $this->monitor->query('SHOW PROCESSLIST')->fetchAllKeyed(0, 0); return $this->assertTrue(isset($list[$id]), format_string('Connection ID @id found.', array('@id' => $id))); } /** * Asserts that a connection ID does not exist. * * @param integer $id * The connection ID to verify. */ protected function assertNoConnection($id) { $list = $this->monitor->query('SHOW PROCESSLIST')->fetchAllKeyed(0, 0); return $this->assertFalse(isset($list[$id]), format_string('Connection ID @id not found.', array('@id' => $id))); } /** * Tests Database::closeConnection() without query. * * @todo getConnectionID() executes a query. */ function testOpenClose() { if ($this->skipTest) { return; } // Add and open a new connection. $this->addConnection(); $id = $this->getConnectionID(); Database::getConnection($this->target, $this->key); // Verify that there is a new connection. $this->assertConnection($id); // Close the connection. Database::closeConnection($this->target, $this->key); // Wait 20ms to give the database engine sufficient time to react. usleep(20000); // Verify that we are back to the original connection count. $this->assertNoConnection($id); } /** * Tests Database::closeConnection() with a query. */ function testOpenQueryClose() { if ($this->skipTest) { return; } // Add and open a new connection. $this->addConnection(); $id = $this->getConnectionID(); Database::getConnection($this->target, $this->key); // Verify that there is a new connection. $this->assertConnection($id); // Execute a query. Database::getConnection($this->target, $this->key)->query('SHOW TABLES'); // Close the connection. Database::closeConnection($this->target, $this->key); // Wait 20ms to give the database engine sufficient time to react. usleep(20000); // Verify that we are back to the original connection count. $this->assertNoConnection($id); } /** * Tests Database::closeConnection() with a query and custom prefetch method. */ function testOpenQueryPrefetchClose() { if ($this->skipTest) { return; } // Add and open a new connection. $this->addConnection(); $id = $this->getConnectionID(); Database::getConnection($this->target, $this->key); // Verify that there is a new connection. $this->assertConnection($id); // Execute a query. Database::getConnection($this->target, $this->key)->query('SHOW TABLES')->fetchCol(); // Close the connection. Database::closeConnection($this->target, $this->key); // Wait 20ms to give the database engine sufficient time to react. usleep(20000); // Verify that we are back to the original connection count. $this->assertNoConnection($id); } /** * Tests Database::closeConnection() with a select query. */ function testOpenSelectQueryClose() { if ($this->skipTest) { return; } // Add and open a new connection. $this->addConnection(); $id = $this->getConnectionID(); Database::getConnection($this->target, $this->key); // Verify that there is a new connection. $this->assertConnection($id); // Create a table. $name = 'foo'; Database::getConnection($this->target, $this->key)->schema()->createTable($name, array( 'fields' => array( 'name' => array( 'type' => 'varchar', 'length' => 255, ), ), )); // Execute a query. Database::getConnection($this->target, $this->key)->select('foo', 'f') ->fields('f', array('name')) ->execute() ->fetchAll(); // Drop the table. Database::getConnection($this->target, $this->key)->schema()->dropTable($name); // Close the connection. Database::closeConnection($this->target, $this->key); // Wait 20ms to give the database engine sufficient time to react. usleep(20000); // Verify that we are back to the original connection count. $this->assertNoConnection($id); } } drupal-7.41/modules/simpletest/tests/update_test_3.info0000644000000000000000000000040512611767501022062 0ustar rootrootname = "Update test" description = "Support module for update testing." package = Testing version = VERSION core = 7.x hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/system_incompatible_core_version_dependencies_test.module0000644000000000000000000000000612611765734032250 0ustar rootroot 7000, ); $dependencies['system'][7001] = array( // Compare to update_test_2_update_dependencies(), where the same System // module update function is forced to depend on a different update // function within the same module. This allows us to test that only the // dependency on the higher-numbered update function is recorded. 'update_test_1' => 7002, ); return $dependencies; } /** * Dummy update_test_1 update 7000. */ function update_test_1_update_7000() { } /** * Dummy update_test_1 update 7001. */ function update_test_1_update_7001() { } /** * Dummy update_test_1 update 7002. */ function update_test_1_update_7002() { } drupal-7.41/modules/simpletest/tests/drupal_system_listing_compatible_test/0000755000000000000000000000000012611765734026333 5ustar rootroot././@LongLink0000000000000000000000000000017000000000000011563 Lustar rootrootdrupal-7.41/modules/simpletest/tests/drupal_system_listing_compatible_test/drupal_system_listing_compatible_test.moduledrupal-7.41/modules/simpletest/tests/drupal_system_listing_compatible_test/drupal_system_listing_com0000644000000000000000000000000612611765734033534 0ustar rootroot 'PSR4 example test: PSR-4 in disabled modules.', 'description' => 'We want to assert that this test case is being discovered.', 'group' => 'SimpleTest', ); } function testArithmetics() { $this->assert(1 + 1 == 2, '1 + 1 == 2'); } } drupal-7.41/modules/simpletest/tests/psr_4_test/src/Tests/Nested/0000755000000000000000000000000012611765734023652 5ustar rootrootdrupal-7.41/modules/simpletest/tests/psr_4_test/src/Tests/Nested/NestedExampleTest.php0000644000000000000000000000067112611765734027765 0ustar rootroot 'PSR4 example test: PSR-4 in nested subfolders.', 'description' => 'We want to assert that this PSR-4 test case is being discovered.', 'group' => 'SimpleTest', ); } function testArithmetics() { $this->assert(1 + 1 == 2, '1 + 1 == 2'); } } drupal-7.41/modules/simpletest/tests/psr_4_test/psr_4_test.module0000644000000000000000000000000612611765734024030 0ustar rootroot 'Early bootstrap test', 'description' => 'Confirm that calling module_implements() during early bootstrap does not pollute the module_implements() cache.', 'group' => 'System', ); } function setUp() { parent::setUp('boot_test_1', 'boot_test_2'); } /** * Test hook_boot() on both regular and "early exit" pages. */ public function testHookBoot() { $paths = array('', 'early_exit'); foreach ($paths as $path) { // Empty the module_implements() caches. module_implements(NULL, FALSE, TRUE); // Do a request to the front page, which will call module_implements() // during hook_boot(). $this->drupalGet($path); // Reset the static cache so we get implementation data from the persistent // cache. drupal_static_reset(); // Make sure we get a full list of all modules implementing hook_help(). $modules = module_implements('help'); $this->assertTrue(in_array('boot_test_2', $modules)); } } } drupal-7.41/modules/simpletest/tests/psr_0_test/0000755000000000000000000000000012611765734020533 5ustar rootrootdrupal-7.41/modules/simpletest/tests/psr_0_test/lib/0000755000000000000000000000000012611765734021301 5ustar rootrootdrupal-7.41/modules/simpletest/tests/psr_0_test/lib/Drupal/0000755000000000000000000000000012611765734022530 5ustar rootrootdrupal-7.41/modules/simpletest/tests/psr_0_test/lib/Drupal/psr_0_test/0000755000000000000000000000000012611765734024612 5ustar rootrootdrupal-7.41/modules/simpletest/tests/psr_0_test/lib/Drupal/psr_0_test/Tests/0000755000000000000000000000000012611765734025714 5ustar rootrootdrupal-7.41/modules/simpletest/tests/psr_0_test/lib/Drupal/psr_0_test/Tests/ExampleTest.php0000644000000000000000000000064512611765734030665 0ustar rootroot 'PSR0 example test: PSR-0 in disabled modules.', 'description' => 'We want to assert that this test case is being discovered.', 'group' => 'SimpleTest', ); } function testArithmetics() { $this->assert(1 + 1 == 2, '1 + 1 == 2'); } } drupal-7.41/modules/simpletest/tests/psr_0_test/lib/Drupal/psr_0_test/Tests/Nested/0000755000000000000000000000000012611765734027136 5ustar rootroot././@LongLink0000000000000000000000000000015100000000000011562 Lustar rootrootdrupal-7.41/modules/simpletest/tests/psr_0_test/lib/Drupal/psr_0_test/Tests/Nested/NestedExampleTest.phpdrupal-7.41/modules/simpletest/tests/psr_0_test/lib/Drupal/psr_0_test/Tests/Nested/NestedExampleTest0000644000000000000000000000067112611765734032463 0ustar rootroot 'PSR0 example test: PSR-0 in nested subfolders.', 'description' => 'We want to assert that this PSR-0 test case is being discovered.', 'group' => 'SimpleTest', ); } function testArithmetics() { $this->assert(1 + 1 == 2, '1 + 1 == 2'); } } drupal-7.41/modules/simpletest/tests/psr_0_test/psr_0_test.module0000644000000000000000000000000612611765734024020 0ustar rootroottoolkit = 'test'; // Pick a file for testing. $file = current($this->drupalGetTestFiles('image')); $this->file = $file->uri; // Setup a dummy image to work with, this replicate image_load() so we // can avoid calling it. $this->image = new stdClass(); $this->image->source = $this->file; $this->image->info = image_get_info($this->file); $this->image->toolkit = $this->toolkit; // Clear out any hook calls. image_test_reset(); } /** * Assert that all of the specified image toolkit operations were called * exactly once once, other values result in failure. * * @param $expected * Array with string containing with the operation name, e.g. 'load', * 'save', 'crop', etc. */ function assertToolkitOperationsCalled(array $expected) { // Determine which operations were called. $actual = array_keys(array_filter(image_test_get_all_calls())); // Determine if there were any expected that were not called. $uncalled = array_diff($expected, $actual); if (count($uncalled)) { $this->assertTrue(FALSE, format_string('Expected operations %expected to be called but %uncalled was not called.', array('%expected' => implode(', ', $expected), '%uncalled' => implode(', ', $uncalled)))); } else { $this->assertTrue(TRUE, format_string('All the expected operations were called: %expected', array('%expected' => implode(', ', $expected)))); } // Determine if there were any unexpected calls. $unexpected = array_diff($actual, $expected); if (count($unexpected)) { $this->assertTrue(FALSE, format_string('Unexpected operations were called: %unexpected.', array('%unexpected' => implode(', ', $unexpected)))); } else { $this->assertTrue(TRUE, 'No unexpected operations were called.'); } } } /** * Test that the functions in image.inc correctly pass data to the toolkit. */ class ImageToolkitUnitTest extends ImageToolkitTestCase { public static function getInfo() { return array( 'name' => 'Image toolkit tests', 'description' => 'Check image toolkit functions.', 'group' => 'Image', ); } /** * Check that hook_image_toolkits() is called and only available toolkits are * returned. */ function testGetAvailableToolkits() { $toolkits = image_get_available_toolkits(); $this->assertTrue(isset($toolkits['test']), 'The working toolkit was returned.'); $this->assertFalse(isset($toolkits['broken']), 'The toolkit marked unavailable was not returned'); $this->assertToolkitOperationsCalled(array()); } /** * Test the image_load() function. */ function testLoad() { $image = image_load($this->file, $this->toolkit); $this->assertTrue(is_object($image), 'Returned an object.'); $this->assertEqual($this->toolkit, $image->toolkit, 'Image had toolkit set.'); $this->assertToolkitOperationsCalled(array('load', 'get_info')); } /** * Test the image_save() function. */ function testSave() { $this->assertFalse(image_save($this->image), 'Function returned the expected value.'); $this->assertToolkitOperationsCalled(array('save')); } /** * Test the image_resize() function. */ function testResize() { $this->assertTrue(image_resize($this->image, 1, 2), 'Function returned the expected value.'); $this->assertToolkitOperationsCalled(array('resize')); // Check the parameters. $calls = image_test_get_all_calls(); $this->assertEqual($calls['resize'][0][1], 1, 'Width was passed correctly'); $this->assertEqual($calls['resize'][0][2], 2, 'Height was passed correctly'); } /** * Test the image_scale() function. */ function testScale() { // TODO: need to test upscaling $this->assertTrue(image_scale($this->image, 10, 10), 'Function returned the expected value.'); $this->assertToolkitOperationsCalled(array('resize')); // Check the parameters. $calls = image_test_get_all_calls(); $this->assertEqual($calls['resize'][0][1], 10, 'Width was passed correctly'); $this->assertEqual($calls['resize'][0][2], 5, 'Height was based off aspect ratio and passed correctly'); } /** * Test the image_scale_and_crop() function. */ function testScaleAndCrop() { $this->assertTrue(image_scale_and_crop($this->image, 5, 10), 'Function returned the expected value.'); $this->assertToolkitOperationsCalled(array('resize', 'crop')); // Check the parameters. $calls = image_test_get_all_calls(); $this->assertEqual($calls['crop'][0][1], 7.5, 'X was computed and passed correctly'); $this->assertEqual($calls['crop'][0][2], 0, 'Y was computed and passed correctly'); $this->assertEqual($calls['crop'][0][3], 5, 'Width was computed and passed correctly'); $this->assertEqual($calls['crop'][0][4], 10, 'Height was computed and passed correctly'); } /** * Test the image_rotate() function. */ function testRotate() { $this->assertTrue(image_rotate($this->image, 90, 1), 'Function returned the expected value.'); $this->assertToolkitOperationsCalled(array('rotate')); // Check the parameters. $calls = image_test_get_all_calls(); $this->assertEqual($calls['rotate'][0][1], 90, 'Degrees were passed correctly'); $this->assertEqual($calls['rotate'][0][2], 1, 'Background color was passed correctly'); } /** * Test the image_crop() function. */ function testCrop() { $this->assertTrue(image_crop($this->image, 1, 2, 3, 4), 'Function returned the expected value.'); $this->assertToolkitOperationsCalled(array('crop')); // Check the parameters. $calls = image_test_get_all_calls(); $this->assertEqual($calls['crop'][0][1], 1, 'X was passed correctly'); $this->assertEqual($calls['crop'][0][2], 2, 'Y was passed correctly'); $this->assertEqual($calls['crop'][0][3], 3, 'Width was passed correctly'); $this->assertEqual($calls['crop'][0][4], 4, 'Height was passed correctly'); } /** * Test the image_desaturate() function. */ function testDesaturate() { $this->assertTrue(image_desaturate($this->image), 'Function returned the expected value.'); $this->assertToolkitOperationsCalled(array('desaturate')); // Check the parameters. $calls = image_test_get_all_calls(); $this->assertEqual(count($calls['desaturate'][0]), 1, 'Only the image was passed.'); } } /** * Test the core GD image manipulation functions. */ class ImageToolkitGdTestCase extends DrupalWebTestCase { // Colors that are used in testing. protected $black = array(0, 0, 0, 0); protected $red = array(255, 0, 0, 0); protected $green = array(0, 255, 0, 0); protected $blue = array(0, 0, 255, 0); protected $yellow = array(255, 255, 0, 0); protected $fuchsia = array(255, 0, 255, 0); // Used as background colors. protected $transparent = array(0, 0, 0, 127); protected $white = array(255, 255, 255, 0); protected $width = 40; protected $height = 20; public static function getInfo() { return array( 'name' => 'Image GD manipulation tests', 'description' => 'Check that core image manipulations work properly: scale, resize, rotate, crop, scale and crop, and desaturate.', 'group' => 'Image', ); } /** * Function to compare two colors by RGBa. */ function colorsAreEqual($color_a, $color_b) { // Fully transparent pixels are equal, regardless of RGB. if ($color_a[3] == 127 && $color_b[3] == 127) { return TRUE; } foreach ($color_a as $key => $value) { if ($color_b[$key] != $value) { return FALSE; } } return TRUE; } /** * Function for finding a pixel's RGBa values. */ function getPixelColor($image, $x, $y) { $color_index = imagecolorat($image->resource, $x, $y); $transparent_index = imagecolortransparent($image->resource); if ($color_index == $transparent_index) { return array(0, 0, 0, 127); } return array_values(imagecolorsforindex($image->resource, $color_index)); } /** * Since PHP can't visually check that our images have been manipulated * properly, build a list of expected color values for each of the corners and * the expected height and widths for the final images. */ function testManipulations() { // If GD isn't available don't bother testing this. module_load_include('inc', 'system', 'image.gd'); if (!function_exists('image_gd_check_settings') || !image_gd_check_settings()) { $this->pass(t('Image manipulations for the GD toolkit were skipped because the GD toolkit is not available.')); return; } // Typically the corner colors will be unchanged. These colors are in the // order of top-left, top-right, bottom-right, bottom-left. $default_corners = array($this->red, $this->green, $this->blue, $this->transparent); // A list of files that will be tested. $files = array( 'image-test.png', 'image-test.gif', 'image-test.jpg', ); // Setup a list of tests to perform on each type. $operations = array( 'resize' => array( 'function' => 'resize', 'arguments' => array(20, 10), 'width' => 20, 'height' => 10, 'corners' => $default_corners, ), 'scale_x' => array( 'function' => 'scale', 'arguments' => array(20, NULL), 'width' => 20, 'height' => 10, 'corners' => $default_corners, ), 'scale_y' => array( 'function' => 'scale', 'arguments' => array(NULL, 10), 'width' => 20, 'height' => 10, 'corners' => $default_corners, ), 'upscale_x' => array( 'function' => 'scale', 'arguments' => array(80, NULL, TRUE), 'width' => 80, 'height' => 40, 'corners' => $default_corners, ), 'upscale_y' => array( 'function' => 'scale', 'arguments' => array(NULL, 40, TRUE), 'width' => 80, 'height' => 40, 'corners' => $default_corners, ), 'crop' => array( 'function' => 'crop', 'arguments' => array(12, 4, 16, 12), 'width' => 16, 'height' => 12, 'corners' => array_fill(0, 4, $this->white), ), 'scale_and_crop' => array( 'function' => 'scale_and_crop', 'arguments' => array(10, 8), 'width' => 10, 'height' => 8, 'corners' => array_fill(0, 4, $this->black), ), ); // Systems using non-bundled GD2 don't have imagerotate. Test if available. if (function_exists('imagerotate')) { $operations += array( 'rotate_5' => array( 'function' => 'rotate', 'arguments' => array(5, 0xFF00FF), // Fuchsia background. 'width' => 42, 'height' => 24, 'corners' => array_fill(0, 4, $this->fuchsia), ), 'rotate_90' => array( 'function' => 'rotate', 'arguments' => array(90, 0xFF00FF), // Fuchsia background. 'width' => 20, 'height' => 40, 'corners' => array($this->fuchsia, $this->red, $this->green, $this->blue), ), 'rotate_transparent_5' => array( 'function' => 'rotate', 'arguments' => array(5), 'width' => 42, 'height' => 24, 'corners' => array_fill(0, 4, $this->transparent), ), 'rotate_transparent_90' => array( 'function' => 'rotate', 'arguments' => array(90), 'width' => 20, 'height' => 40, 'corners' => array($this->transparent, $this->red, $this->green, $this->blue), ), ); } // Systems using non-bundled GD2 don't have imagefilter. Test if available. if (function_exists('imagefilter')) { $operations += array( 'desaturate' => array( 'function' => 'desaturate', 'arguments' => array(), 'height' => 20, 'width' => 40, // Grayscale corners are a bit funky. Each of the corners are a shade of // gray. The values of these were determined simply by looking at the // final image to see what desaturated colors end up being. 'corners' => array( array_fill(0, 3, 76) + array(3 => 0), array_fill(0, 3, 149) + array(3 => 0), array_fill(0, 3, 29) + array(3 => 0), array_fill(0, 3, 225) + array(3 => 127) ), ), ); } foreach ($files as $file) { foreach ($operations as $op => $values) { // Load up a fresh image. $image = image_load(drupal_get_path('module', 'simpletest') . '/files/' . $file, 'gd'); if (!$image) { $this->fail(t('Could not load image %file.', array('%file' => $file))); continue 2; } // All images should be converted to truecolor when loaded. $image_truecolor = imageistruecolor($image->resource); $this->assertTrue($image_truecolor, format_string('Image %file after load is a truecolor image.', array('%file' => $file))); if ($image->info['extension'] == 'gif') { if ($op == 'desaturate') { // Transparent GIFs and the imagefilter function don't work together. $values['corners'][3][3] = 0; } } // Perform our operation. $function = 'image_' . $values['function']; $arguments = array(); $arguments[] = &$image; $arguments = array_merge($arguments, $values['arguments']); call_user_func_array($function, $arguments); // To keep from flooding the test with assert values, make a general // value for whether each group of values fail. $correct_dimensions_real = TRUE; $correct_dimensions_object = TRUE; $correct_colors = TRUE; // Check the real dimensions of the image first. if (imagesy($image->resource) != $values['height'] || imagesx($image->resource) != $values['width']) { $correct_dimensions_real = FALSE; } // Check that the image object has an accurate record of the dimensions. if ($image->info['width'] != $values['width'] || $image->info['height'] != $values['height']) { $correct_dimensions_object = FALSE; } // Now check each of the corners to ensure color correctness. foreach ($values['corners'] as $key => $corner) { // Get the location of the corner. switch ($key) { case 0: $x = 0; $y = 0; break; case 1: $x = $values['width'] - 1; $y = 0; break; case 2: $x = $values['width'] - 1; $y = $values['height'] - 1; break; case 3: $x = 0; $y = $values['height'] - 1; break; } $color = $this->getPixelColor($image, $x, $y); $correct_colors = $this->colorsAreEqual($color, $corner); } $directory = file_default_scheme() . '://imagetests'; file_prepare_directory($directory, FILE_CREATE_DIRECTORY); $file_path = $directory . '/' . $op . '.' . $image->info['extension']; image_save($image, $file_path); $this->assertTrue($correct_dimensions_real, format_string('Image %file after %action action has proper dimensions.', array('%file' => $file, '%action' => $op))); $this->assertTrue($correct_dimensions_object, format_string('Image %file object after %action action is reporting the proper height and width values.', array('%file' => $file, '%action' => $op))); // JPEG colors will always be messed up due to compression. if ($image->info['extension'] != 'jpg') { $this->assertTrue($correct_colors, format_string('Image %file object after %action action has the correct color placement.', array('%file' => $file, '%action' => $op))); } } // Check that saved image reloads without raising PHP errors. $image_reloaded = image_load($file_path); } } /** * Tests loading an image whose transparent color index is out of range. */ function testTransparentColorOutOfRange() { // This image was generated by taking an initial image with a palette size // of 6 colors, and setting the transparent color index to 6 (one higher // than the largest allowed index), as follows: // @code // $image = imagecreatefromgif('modules/simpletest/files/image-test.gif'); // imagecolortransparent($image, 6); // imagegif($image, 'modules/simpletest/files/image-test-transparent-out-of-range.gif'); // @endcode // This allows us to test that an image with an out-of-range color index // can be loaded correctly. $file = 'image-test-transparent-out-of-range.gif'; $image = image_load(drupal_get_path('module', 'simpletest') . '/files/' . $file); if (!$image) { $this->fail(format_string('Could not load image %file.', array('%file' => $file))); } else { // All images should be converted to truecolor when loaded. $image_truecolor = imageistruecolor($image->resource); $this->assertTrue($image_truecolor, format_string('Image %file after load is a truecolor image.', array('%file' => $file))); } } } /** * Tests the file move function for managed files. */ class ImageFileMoveTest extends ImageToolkitTestCase { public static function getInfo() { return array( 'name' => 'Image moving', 'description' => 'Tests the file move function for managed files.', 'group' => 'Image', ); } /** * Tests moving a randomly generated image. */ function testNormal() { // Pick a file for testing. $file = current($this->drupalGetTestFiles('image')); // Create derivative image. $style = image_style_load(key(image_styles())); $derivative_uri = image_style_path($style['name'], $file->uri); image_style_create_derivative($style, $file->uri, $derivative_uri); // Check if derivative image exists. $this->assertTrue(file_exists($derivative_uri), 'Make sure derivative image is generated successfully.'); // Clone the object so we don't have to worry about the function changing // our reference copy. $desired_filepath = 'public://' . $this->randomName(); $result = file_move(clone $file, $desired_filepath, FILE_EXISTS_ERROR); // Check if image has been moved. $this->assertTrue(file_exists($result->uri), 'Make sure image is moved successfully.'); // Check if derivative image has been flushed. $this->assertFalse(file_exists($derivative_uri), 'Make sure derivative image has been flushed.'); } } drupal-7.41/modules/simpletest/tests/batch_test.callbacks.inc0000644000000000000000000001063212611765734023204 0ustar rootroot 1 $context['finished'] = 3.14; } /** * Implements callback_batch_operation(). * * Batch operation setting up its own batch. */ function _batch_test_nested_batch_callback() { batch_test_stack('setting up batch 2'); batch_set(_batch_test_batch_2()); } /** * Implements callback_batch_finished(). * * Common 'finished' callbacks for batches 1 to 4. */ function _batch_test_finished_helper($batch_id, $success, $results, $operations) { $messages = array("results for batch $batch_id"); if ($results) { foreach ($results as $op => $op_results) { $messages[] = 'op '. $op . ': processed ' . count($op_results) . ' elements'; } } else { $messages[] = 'none'; } if (!$success) { // A fatal error occurred during the processing. $error_operation = reset($operations); $messages[] = t('An error occurred while processing @op with arguments:
              @args', array('@op' => $error_operation[0], '@args' => print_r($error_operation[1], TRUE))); } drupal_set_message(implode('
              ', $messages)); } /** * Implements callback_batch_finished(). * * 'finished' callback for batch 0. */ function _batch_test_finished_0($success, $results, $operations) { _batch_test_finished_helper(0, $success, $results, $operations); } /** * Implements callback_batch_finished(). * * 'finished' callback for batch 1. */ function _batch_test_finished_1($success, $results, $operations) { _batch_test_finished_helper(1, $success, $results, $operations); } /** * Implements callback_batch_finished(). * * 'finished' callback for batch 2. */ function _batch_test_finished_2($success, $results, $operations) { _batch_test_finished_helper(2, $success, $results, $operations); } /** * Implements callback_batch_finished(). * * 'finished' callback for batch 3. */ function _batch_test_finished_3($success, $results, $operations) { _batch_test_finished_helper(3, $success, $results, $operations); } /** * Implements callback_batch_finished(). * * 'finished' callback for batch 4. */ function _batch_test_finished_4($success, $results, $operations) { _batch_test_finished_helper(4, $success, $results, $operations); } /** * Implements callback_batch_finished(). * * 'finished' callback for batch 5. */ function _batch_test_finished_5($success, $results, $operations) { _batch_test_finished_helper(5, $success, $results, $operations); } drupal-7.41/modules/simpletest/tests/update_test_1.info0000644000000000000000000000040512611767501022060 0ustar rootrootname = "Update test" description = "Support module for update testing." package = Testing version = VERSION core = 7.x hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/form_test.info0000644000000000000000000000040612611767501021322 0ustar rootrootname = "FormAPI Test" description = "Support module for Form API tests." package = Testing version = VERSION core = 7.x hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/url_alter_test.module0000644000000000000000000000340312611765734022710 0ustar rootroot 'Foo', 'page callback' => 'url_alter_test_foo', 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); return $items; } /** * Menu callback. */ function url_alter_test_foo() { print 'current_path=' . current_path() . ' request_path=' . request_path(); exit; } /** * Implements hook_url_inbound_alter(). */ function url_alter_test_url_inbound_alter(&$path, $original_path, $path_language) { if (!request_path() && !empty($_GET['q'])) { drupal_set_message("\$_GET['q'] is non-empty with an empty request path."); } // Rewrite user/username to user/uid. if (preg_match('!^user/([^/]+)(/.*)?!', $path, $matches)) { if ($account = user_load_by_name($matches[1])) { $matches += array(2 => ''); $path = 'user/' . $account->uid . $matches[2]; } } // Rewrite community/ to forum/. if ($path == 'community' || strpos($path, 'community/') === 0) { $path = 'forum' . substr($path, 9); } if ($path == 'url-alter-test/bar') { $path = 'url-alter-test/foo'; } } /** * Implements hook_url_outbound_alter(). */ function url_alter_test_url_outbound_alter(&$path, &$options, $original_path) { // Rewrite user/uid to user/username. if (preg_match('!^user/([0-9]+)(/.*)?!', $path, $matches)) { if ($account = user_load($matches[1])) { $matches += array(2 => ''); $path = 'user/' . $account->name . $matches[2]; } } // Rewrite forum/ to community/. if ($path == 'forum' || strpos($path, 'forum/') === 0) { $path = 'community' . substr($path, 5); } } drupal-7.41/modules/simpletest/tests/system_incompatible_module_version_dependencies_test.info0000644000000000000000000000067212611767501032256 0ustar rootrootname = "System incompatible module version dependencies test" description = "Support module for testing system dependencies." package = Testing version = VERSION core = 7.x hidden = TRUE ; system_incompatible_module_version_test declares version 1.0 dependencies[] = system_incompatible_module_version_test (>2.0) ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/theme_test.template_test.tpl.php0000644000000000000000000000010212611765734024763 0ustar rootroot Fail: Template not overridden. drupal-7.41/modules/simpletest/tests/update_test_2.module0000644000000000000000000000000612611765734022416 0ustar rootroot $value) { $_SERVER[$key] = str_replace('modules/simpletest/tests/https.php', 'index.php', $value); $_SERVER[$key] = str_replace('http://', 'https://', $_SERVER[$key]); } // Change current directory to the Drupal root. chdir('../../..'); define('DRUPAL_ROOT', getcwd()); require_once DRUPAL_ROOT . '/includes/bootstrap.inc'; // Make sure this file can only be used by simpletest. drupal_bootstrap(DRUPAL_BOOTSTRAP_CONFIGURATION); if (!drupal_valid_test_ua()) { header($_SERVER['SERVER_PROTOCOL'] . ' 403 Forbidden'); exit; } drupal_bootstrap(DRUPAL_BOOTSTRAP_FULL); menu_execute_active_handler(); drupal-7.41/modules/simpletest/tests/module_test.info0000644000000000000000000000041412611767501021643 0ustar rootrootname = "Module test" description = "Support module for module system testing." package = Testing version = VERSION core = 7.x hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/ajax_test.module0000644000000000000000000000354112611765734021645 0ustar rootroot 'ajax_render', 'page callback' => 'ajax_test_render', 'delivery callback' => 'ajax_deliver', 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['ajax-test/render-error'] = array( 'title' => 'ajax_render_error', 'page callback' => 'ajax_test_error', 'delivery callback' => 'ajax_deliver', 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['ajax-test/link'] = array( 'title' => 'AJAX Link', 'page callback' => 'ajax_test_link', 'access callback' => TRUE, ); return $items; } /** * Implements hook_system_theme_info(). */ function ajax_test_system_theme_info() { $themes['test_theme'] = drupal_get_path('module', 'ajax_test') . '/themes/test_theme/test_theme.info'; return $themes; } /** * Menu callback; Return an element suitable for use by ajax_deliver(). * * Additionally ensures that ajax_render() incorporates JavaScript settings * generated during the page request by invoking drupal_add_js() with a dummy * setting. */ function ajax_test_render() { drupal_add_js(array('ajax' => 'test'), 'setting'); return array('#type' => 'ajax', '#commands' => array()); } /** * Menu callback; Returns Ajax element with #error property set. */ function ajax_test_error() { $message = ''; if (!empty($_GET['message'])) { $message = $_GET['message']; } return array('#type' => 'ajax', '#error' => $message); } /** * Menu callback; Renders a #type link with #ajax. */ function ajax_test_link() { $build['link'] = array( '#type' => 'link', '#title' => 'Show help', '#href' => 'filter/tips', '#ajax' => array( 'wrapper' => 'block-system-main', ), ); return $build; } drupal-7.41/modules/simpletest/tests/ajax_test.info0000644000000000000000000000040512611767501021301 0ustar rootrootname = AJAX Test description = Support module for AJAX framework tests. package = Testing version = VERSION core = 7.x hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/actions_loop_test.info0000644000000000000000000000041412611767501023047 0ustar rootrootname = Actions loop test description = Support module for action loop testing. package = Testing version = VERSION core = 7.x hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/xmlrpc_test.info0000644000000000000000000000045712611767501021672 0ustar rootrootname = "XML-RPC Test" description = "Support module for XML-RPC tests according to the validator1 specification." package = Testing version = VERSION core = 7.x hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/theme_test.module0000644000000000000000000001025512611765734022024 0ustar rootroot 'theme_test.inc', 'variables' => array('foo' => ''), ); $items['theme_test_template_test'] = array( 'template' => 'theme_test.template_test', ); $items['theme_test_template_test_2'] = array( 'template' => 'theme_test.template_test', ); $items['theme_test_foo'] = array( 'variables' => array('foo' => NULL), ); return $items; } /** * Implements hook_system_theme_info(). */ function theme_test_system_theme_info() { $themes['test_theme'] = drupal_get_path('module', 'theme_test') . '/themes/test_theme/test_theme.info'; $themes['test_basetheme'] = drupal_get_path('module', 'theme_test') . '/themes/test_basetheme/test_basetheme.info'; $themes['test_subtheme'] = drupal_get_path('module', 'theme_test') . '/themes/test_subtheme/test_subtheme.info'; return $themes; } /** * Implements hook_menu(). */ function theme_test_menu() { $items['theme-test/suggestion'] = array( 'title' => 'Suggestion', 'page callback' => '_theme_test_suggestion', 'access arguments' => array('access content'), 'theme callback' => '_theme_custom_theme', 'type' => MENU_CALLBACK, ); $items['theme-test/alter'] = array( 'title' => 'Suggestion', 'page callback' => '_theme_test_alter', 'access arguments' => array('access content'), 'theme callback' => '_theme_custom_theme', 'type' => MENU_CALLBACK, ); $items['theme-test/hook-init'] = array( 'page callback' => 'theme_test_hook_init_page_callback', 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['theme-test/drupal-add-region-content'] = array( 'page callback' => '_theme_test_drupal_add_region_content', 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); return $items; } /** * Implements hook_init(). */ function theme_test_init() { if (arg(0) == 'theme-test' && arg(1) == 'hook-init') { // First, force the theme registry to be rebuilt on this page request. This // allows us to test a full initialization of the theme system in the code // below. drupal_theme_rebuild(); // Next, initialize the theme system by storing themed text in a global // variable. We will use this later in theme_test_hook_init_page_callback() // to test that even when the theme system is initialized this early, it is // still capable of returning output and theming the page as a whole. $GLOBALS['theme_test_output'] = theme('more_link', array('url' => 'user', 'title' => 'Themed output generated in hook_init()')); } } /** * Implements hook_exit(). */ function theme_test_exit() { if (arg(0) == 'user') { // Register a fake registry loading callback. If it gets called by // theme_get_registry(), the registry has not been initialized yet. _theme_registry_callback('_theme_test_load_registry', array()); print theme_get_registry() ? 'registry initialized' : 'registry not initialized'; } } /** * Fake registry loading callback. */ function _theme_test_load_registry() { return array(); } /** * Menu callback for testing themed output generated in hook_init(). */ function theme_test_hook_init_page_callback() { return $GLOBALS['theme_test_output']; } /** * Custom theme callback. */ function _theme_custom_theme() { return 'test_theme'; } /** * Page callback, calls drupal_alter(). * * This is for testing that the theme can have hook_*_alter() implementations * that run during page callback execution, even before theme() is called for * the first time. */ function _theme_test_alter() { $data = 'foo'; drupal_alter('theme_test_alter', $data); return "The altered data is $data."; } /** * Page callback, calls a theme hook suggestion. */ function _theme_test_suggestion() { return theme(array('theme_test__suggestion', 'theme_test'), array()); } /** * Page callback, calls drupal_add_region_content. */ function _theme_test_drupal_add_region_content() { drupal_add_region_content('content', 'World'); return 'Hello'; } /** * Theme function for testing theme('theme_test_foo'). */ function theme_theme_test_foo($variables) { return $variables['foo']; } drupal-7.41/modules/simpletest/tests/batch_test.module0000644000000000000000000003250312611765734022003 0ustar rootroot 'Batch test', 'page callback' => 'drupal_get_form', 'page arguments' => array('batch_test_simple_form'), 'access callback' => TRUE, ); // Simple form: one submit handler, setting a batch. $items['batch-test/simple'] = array( 'title' => 'Simple', 'type' => MENU_DEFAULT_LOCAL_TASK, 'weight' => 0, ); // Multistep form: two steps, each setting a batch. $items['batch-test/multistep'] = array( 'title' => 'Multistep', 'page callback' => 'drupal_get_form', 'page arguments' => array('batch_test_multistep_form'), 'access callback' => TRUE, 'type' => MENU_LOCAL_TASK, 'weight' => 1, ); // Chained form: four submit handlers, several of which set a batch. $items['batch-test/chained'] = array( 'title' => 'Chained', 'page callback' => 'drupal_get_form', 'page arguments' => array('batch_test_chained_form'), 'access callback' => TRUE, 'type' => MENU_LOCAL_TASK, 'weight' => 2, ); // Programmatic form: the page submits the 'Chained' form through // drupal_form_submit(). $items['batch-test/programmatic'] = array( 'title' => 'Programmatic', 'page callback' => 'batch_test_programmatic', 'access callback' => TRUE, 'type' => MENU_LOCAL_TASK, 'weight' => 3, ); // No form: fire a batch simply by accessing a page. $items['batch-test/no-form'] = array( 'title' => 'Simple page', 'page callback' => 'batch_test_no_form', 'access callback' => TRUE, 'type' => MENU_LOCAL_TASK, 'weight' => 4, ); // No form: fire a batch; return > 100% complete $items['batch-test/large-percentage'] = array( 'title' => 'Simple page with batch over 100% complete', 'page callback' => 'batch_test_large_percentage', 'access callback' => TRUE, 'type' => MENU_LOCAL_TASK, 'weight' => 5, ); // Tests programmatic form submission within a batch operation. $items['batch-test/nested-programmatic'] = array( 'title' => 'Nested programmatic', 'page callback' => 'batch_test_nested_drupal_form_submit', 'access callback' => TRUE, 'type' => MENU_LOCAL_TASK, 'weight' => 6, ); // Landing page to test redirects. $items['batch-test/redirect'] = array( 'title' => 'Redirect', 'page callback' => 'batch_test_redirect_page', 'access callback' => TRUE, 'type' => MENU_LOCAL_TASK, 'weight' => 7, ); // This item lives under 'admin' so that the page uses the admin theme. $items['admin/batch-test/test-theme'] = array( 'page callback' => 'batch_test_theme_batch', 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); return $items; } /** * Simple form. */ function batch_test_simple_form() { $form['batch'] = array( '#type' => 'select', '#title' => 'Choose batch', '#options' => array( 'batch_0' => 'batch 0', 'batch_1' => 'batch 1', 'batch_2' => 'batch 2', 'batch_3' => 'batch 3', 'batch_4' => 'batch 4', ), ); $form['submit'] = array( '#type' => 'submit', '#value' => 'Submit', ); return $form; } /** * Submit handler for the simple form. */ function batch_test_simple_form_submit($form, &$form_state) { batch_test_stack(NULL, TRUE); $function = '_batch_test_' . $form_state['values']['batch']; batch_set($function()); $form_state['redirect'] = 'batch-test/redirect'; } /** * Multistep form. */ function batch_test_multistep_form($form, &$form_state) { if (empty($form_state['storage']['step'])) { $form_state['storage']['step'] = 1; } $form['step_display'] = array( '#markup' => 'step ' . $form_state['storage']['step'] . '
              ', ); $form['submit'] = array( '#type' => 'submit', '#value' => 'Submit', ); return $form; } /** * Submit handler for the multistep form. */ function batch_test_multistep_form_submit($form, &$form_state) { batch_test_stack(NULL, TRUE); switch ($form_state['storage']['step']) { case 1: batch_set(_batch_test_batch_1()); break; case 2: batch_set(_batch_test_batch_2()); break; } if ($form_state['storage']['step'] < 2) { $form_state['storage']['step']++; $form_state['rebuild'] = TRUE; } // This will only be effective on the last step. $form_state['redirect'] = 'batch-test/redirect'; } /** * Form with chained submit callbacks. */ function batch_test_chained_form() { // This value is used to test that $form_state persists through batched // submit handlers. $form['value'] = array( '#type' => 'textfield', '#title' => 'Value', '#default_value' => 1, ); $form['submit'] = array( '#type' => 'submit', '#value' => 'Submit', ); $form['#submit'] = array( 'batch_test_chained_form_submit_1', 'batch_test_chained_form_submit_2', 'batch_test_chained_form_submit_3', 'batch_test_chained_form_submit_4', ); return $form; } /** * Submit handler #1 for the chained form. */ function batch_test_chained_form_submit_1($form, &$form_state) { batch_test_stack(NULL, TRUE); batch_test_stack('submit handler 1'); batch_test_stack('value = ' . $form_state['values']['value']); $form_state['values']['value']++; batch_set(_batch_test_batch_1()); // This redirect should not be taken into account. $form_state['redirect'] = 'should/be/discarded'; } /** * Submit handler #2 for the chained form. */ function batch_test_chained_form_submit_2($form, &$form_state) { batch_test_stack('submit handler 2'); batch_test_stack('value = ' . $form_state['values']['value']); $form_state['values']['value']++; batch_set(_batch_test_batch_2()); // This redirect should not be taken into account. $form_state['redirect'] = 'should/be/discarded'; } /** * Submit handler #3 for the chained form. */ function batch_test_chained_form_submit_3($form, &$form_state) { batch_test_stack('submit handler 3'); batch_test_stack('value = ' . $form_state['values']['value']); $form_state['values']['value']++; // This redirect should not be taken into account. $form_state['redirect'] = 'should/be/discarded'; } /** * Submit handler #4 for the chained form. */ function batch_test_chained_form_submit_4($form, &$form_state) { batch_test_stack('submit handler 4'); batch_test_stack('value = ' . $form_state['values']['value']); $form_state['values']['value']++; batch_set(_batch_test_batch_3()); // This is the redirect that should prevail. $form_state['redirect'] = 'batch-test/redirect'; } /** * Menu callback: programmatically submits the 'Chained' form. */ function batch_test_programmatic($value = 1) { $form_state = array( 'values' => array('value' => $value) ); drupal_form_submit('batch_test_chained_form', $form_state); return 'Got out of a programmatic batched form.'; } /** * Menu callback: programmatically submits a form within a batch. */ function batch_test_nested_drupal_form_submit($value = 1) { // Set the batch and process it. $batch['operations'] = array( array('_batch_test_nested_drupal_form_submit_callback', array($value)), ); batch_set($batch); batch_process('batch-test/redirect'); } /** * Batch operation: submits form_test_mock_form using drupal_form_submit(). */ function _batch_test_nested_drupal_form_submit_callback($value) { $state['values']['test_value'] = $value; drupal_form_submit('batch_test_mock_form', $state); } /** * A simple form with a textfield and submit button. */ function batch_test_mock_form($form, $form_state) { $form['test_value'] = array( '#type' => 'textfield', ); $form['submit'] = array( '#type' => 'submit', '#value' => t('Submit'), ); return $form; } /** * Submit handler for the batch_test_mock form. */ function batch_test_mock_form_submit($form, &$form_state) { batch_test_stack('mock form submitted with value = ' . $form_state['values']['test_value']); } /** * Menu callback: fire a batch process without a form submission. */ function batch_test_no_form() { batch_test_stack(NULL, TRUE); batch_set(_batch_test_batch_1()); batch_process('batch-test/redirect'); } /** * Menu callback: fire a batch process without a form submission. */ function batch_test_large_percentage() { batch_test_stack(NULL, TRUE); batch_set(_batch_test_batch_5()); batch_process('batch-test/redirect'); } /** * Menu callback: successful redirection. */ function batch_test_redirect_page() { return 'Redirection successful.'; } /** * Batch 0: no operation. */ function _batch_test_batch_0() { $batch = array( 'operations' => array(), 'finished' => '_batch_test_finished_0', 'file' => drupal_get_path('module', 'batch_test'). '/batch_test.callbacks.inc', ); return $batch; } /** * Batch 1: repeats a simple operation. * * Operations: op 1 from 1 to 10. */ function _batch_test_batch_1() { // Ensure the batch takes at least two iterations. $total = 10; $sleep = (1000000 / $total) * 2; $operations = array(); for ($i = 1; $i <= $total; $i++) { $operations[] = array('_batch_test_callback_1', array($i, $sleep)); } $batch = array( 'operations' => $operations, 'finished' => '_batch_test_finished_1', 'file' => drupal_get_path('module', 'batch_test'). '/batch_test.callbacks.inc', ); return $batch; } /** * Batch 2: single multistep operation. * * Operations: op 2 from 1 to 10. */ function _batch_test_batch_2() { // Ensure the batch takes at least two iterations. $total = 10; $sleep = (1000000 / $total) * 2; $operations = array( array('_batch_test_callback_2', array(1, $total, $sleep)), ); $batch = array( 'operations' => $operations, 'finished' => '_batch_test_finished_2', 'file' => drupal_get_path('module', 'batch_test') . '/batch_test.callbacks.inc', ); return $batch; } /** * Batch 3: both single and multistep operations. * * Operations: * - op 1 from 1 to 5, * - op 2 from 1 to 5, * - op 1 from 6 to 10, * - op 2 from 6 to 10. */ function _batch_test_batch_3() { // Ensure the batch takes at least two iterations. $total = 10; $sleep = (1000000 / $total) * 2; $operations = array(); for ($i = 1; $i <= round($total / 2); $i++) { $operations[] = array('_batch_test_callback_1', array($i, $sleep)); } $operations[] = array('_batch_test_callback_2', array(1, $total / 2, $sleep)); for ($i = round($total / 2) + 1; $i <= $total; $i++) { $operations[] = array('_batch_test_callback_1', array($i, $sleep)); } $operations[] = array('_batch_test_callback_2', array(6, $total / 2, $sleep)); $batch = array( 'operations' => $operations, 'finished' => '_batch_test_finished_3', 'file' => drupal_get_path('module', 'batch_test') . '/batch_test.callbacks.inc', ); return $batch; } /** * Batch 4: batch within a batch. * * Operations: * - op 1 from 1 to 5, * - set batch 2 (op 2 from 1 to 10, should run at the end) * - op 1 from 6 to 10, */ function _batch_test_batch_4() { // Ensure the batch takes at least two iterations. $total = 10; $sleep = (1000000 / $total) * 2; $operations = array(); for ($i = 1; $i <= round($total / 2); $i++) { $operations[] = array('_batch_test_callback_1', array($i, $sleep)); } $operations[] = array('_batch_test_nested_batch_callback', array()); for ($i = round($total / 2) + 1; $i <= $total; $i++) { $operations[] = array('_batch_test_callback_1', array($i, $sleep)); } $batch = array( 'operations' => $operations, 'finished' => '_batch_test_finished_4', 'file' => drupal_get_path('module', 'batch_test') . '/batch_test.callbacks.inc', ); return $batch; } /** * Batch 5: repeats a simple operation. * * Operations: op 1 from 1 to 10. */ function _batch_test_batch_5() { // Ensure the batch takes at least two iterations. $total = 10; $sleep = (1000000 / $total) * 2; $operations = array(); for ($i = 1; $i <= $total; $i++) { $operations[] = array('_batch_test_callback_5', array($i, $sleep)); } $batch = array( 'operations' => $operations, 'finished' => '_batch_test_finished_5', 'file' => drupal_get_path('module', 'batch_test'). '/batch_test.callbacks.inc', ); return $batch; } /** * Menu callback: run a batch for testing theme used on the progress page. */ function batch_test_theme_batch() { batch_test_stack(NULL, TRUE); $batch = array( 'operations' => array( array('_batch_test_theme_callback', array()), ), ); batch_set($batch); batch_process('batch-test/redirect'); } /** * Batch callback function for testing the theme used on the progress page. */ function _batch_test_theme_callback() { // Because drupalGet() steps through the full progressive batch before // returning control to the test function, we cannot test that the correct // theme is being used on the batch processing page by viewing that page // directly. Instead, we save the theme being used in a variable here, so // that it can be loaded and inspected in the thread running the test. global $theme; batch_test_stack($theme); } /** * Helper function: store or retrieve traced execution data. */ function batch_test_stack($data = NULL, $reset = FALSE) { if ($reset) { variable_del('batch_test_stack'); } if (!isset($data)) { return variable_get('batch_test_stack', array()); } $stack = variable_get('batch_test_stack', array()); $stack[] = $data; variable_set('batch_test_stack', $stack); } drupal-7.41/modules/simpletest/tests/system_test.info0000644000000000000000000000043612611767501021706 0ustar rootrootname = System test description = Support module for system testing. package = Testing version = VERSION core = 7.x files[] = system_test.module hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/filter_test.module0000644000000000000000000000326512611765734022212 0ustar rootroot 'Uncacheable filter', 'description' => 'Does nothing, but makes a text format uncacheable.', 'cache' => FALSE, ); $filters['filter_test_replace'] = array( 'title' => 'Testing filter', 'description' => 'Replaces all content with filter and text format information.', 'process callback' => 'filter_test_replace', ); return $filters; } /** * Implements callback_filter_process(). * * Process handler for filter_test_replace filter. * * Replaces all text with filter and text format information. */ function filter_test_replace($text, $filter, $format, $langcode, $cache, $cache_id) { $text = array(); $text[] = 'Filter: ' . $filter->title . ' (' . $filter->name . ')'; $text[] = 'Format: ' . $format->name . ' (' . $format->format . ')'; $text[] = 'Language: ' . $langcode; $text[] = 'Cache: ' . ($cache ? 'Enabled' : 'Disabled'); if ($cache_id) { $text[] = 'Cache ID: ' . $cache_id; } return implode("
              \n", $text); } drupal-7.41/modules/simpletest/tests/lock.test0000644000000000000000000000510012611765734020276 0ustar rootroot 'Locking framework tests', 'description' => 'Confirm locking works between two separate requests.', 'group' => 'System', ); } function setUp() { parent::setUp('system_test'); } /** * Confirm that we can acquire and release locks in two parallel requests. */ function testLockAcquire() { $lock_acquired = 'TRUE: Lock successfully acquired in system_test_lock_acquire()'; $lock_not_acquired = 'FALSE: Lock not acquired in system_test_lock_acquire()'; $this->assertTrue(lock_acquire('system_test_lock_acquire'), 'Lock acquired by this request.', 'Lock'); $this->assertTrue(lock_acquire('system_test_lock_acquire'), 'Lock extended by this request.', 'Lock'); lock_release('system_test_lock_acquire'); // Cause another request to acquire the lock. $this->drupalGet('system-test/lock-acquire'); $this->assertText($lock_acquired, 'Lock acquired by the other request.', 'Lock'); // The other request has finished, thus it should have released its lock. $this->assertTrue(lock_acquire('system_test_lock_acquire'), 'Lock acquired by this request.', 'Lock'); // This request holds the lock, so the other request cannot acquire it. $this->drupalGet('system-test/lock-acquire'); $this->assertText($lock_not_acquired, 'Lock not acquired by the other request.', 'Lock'); lock_release('system_test_lock_acquire'); // Try a very short timeout and lock breaking. $this->assertTrue(lock_acquire('system_test_lock_acquire', 0.5), 'Lock acquired by this request.', 'Lock'); sleep(1); // The other request should break our lock. $this->drupalGet('system-test/lock-acquire'); $this->assertText($lock_acquired, 'Lock acquired by the other request, breaking our lock.', 'Lock'); // We cannot renew it, since the other thread took it. $this->assertFalse(lock_acquire('system_test_lock_acquire'), 'Lock cannot be extended by this request.', 'Lock'); // Check the shut-down function. $lock_acquired_exit = 'TRUE: Lock successfully acquired in system_test_lock_exit()'; $lock_not_acquired_exit = 'FALSE: Lock not acquired in system_test_lock_exit()'; $this->drupalGet('system-test/lock-exit'); $this->assertText($lock_acquired_exit, 'Lock acquired by the other request before exit.', 'Lock'); $this->assertTrue(lock_acquire('system_test_lock_exit'), 'Lock acquired by this request after the other request exits.', 'Lock'); } } drupal-7.41/modules/simpletest/tests/taxonomy_test.install0000644000000000000000000000135312611765734022760 0ustar rootroot 'Stores term antonym.', 'fields' => array( 'tid' => array( 'type' => 'int', 'unsigned' => TRUE, 'not null' => TRUE, 'default' => 0, 'description' => 'The {taxonomy_term_data}.tid of the term.', ), 'name' => array( 'type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => '', 'description' => 'The name of the antonym.', ), ), 'primary key' => array('tid'), ); return $schema; } drupal-7.41/modules/simpletest/tests/actions_loop_test.install0000644000000000000000000000031612611765734023571 0ustar rootrootfields(array('weight' => 1)) ->condition('name', 'actions_loop_test') ->execute(); } drupal-7.41/modules/simpletest/tests/entity_crud_hook_test.test0000644000000000000000000003074312611765734023771 0ustar rootroot 'Entity CRUD hooks', 'description' => 'Tests the invocation of hooks when inserting, loading, updating or deleting an entity.', 'group' => 'Entity API', ); } public function setUp() { parent::setUp('entity_crud_hook_test', 'taxonomy', 'comment'); } /** * Pass if the message $text was set by one of the CRUD hooks in * entity_crud_hook_test.module, i.e., if the $text is an element of * $_SESSION['entity_crud_hook_test']. * * @param $text * Plain text to look for. * @param $message * Message to display. * @param $group * The group this message belongs to, defaults to 'Other'. * @return * TRUE on pass, FALSE on fail. */ protected function assertHookMessage($text, $message = NULL, $group = 'Other') { if (!isset($message)) { $message = $text; } return $this->assertTrue(array_search($text, $_SESSION['entity_crud_hook_test']) !== FALSE, $message, $group); } /** * Tests hook invocations for CRUD operations on comments. */ public function testCommentHooks() { $node = (object) array( 'uid' => 1, 'type' => 'article', 'title' => 'Test node', 'status' => 1, 'comment' => 2, 'promote' => 0, 'sticky' => 0, 'language' => LANGUAGE_NONE, 'created' => REQUEST_TIME, 'changed' => REQUEST_TIME, ); node_save($node); $nid = $node->nid; $comment = (object) array( 'cid' => NULL, 'pid' => 0, 'nid' => $nid, 'uid' => 1, 'subject' => 'Test comment', 'created' => REQUEST_TIME, 'changed' => REQUEST_TIME, 'status' => 1, 'language' => LANGUAGE_NONE, ); $_SESSION['entity_crud_hook_test'] = array(); comment_save($comment); $this->assertHookMessage('entity_crud_hook_test_entity_presave called for type comment'); $this->assertHookMessage('entity_crud_hook_test_comment_presave called'); $this->assertHookMessage('entity_crud_hook_test_entity_insert called for type comment'); $this->assertHookMessage('entity_crud_hook_test_comment_insert called'); $_SESSION['entity_crud_hook_test'] = array(); $comment = comment_load($comment->cid); $this->assertHookMessage('entity_crud_hook_test_entity_load called for type comment'); $this->assertHookMessage('entity_crud_hook_test_comment_load called'); $_SESSION['entity_crud_hook_test'] = array(); $comment->subject = 'New subject'; comment_save($comment); $this->assertHookMessage('entity_crud_hook_test_entity_presave called for type comment'); $this->assertHookMessage('entity_crud_hook_test_comment_presave called'); $this->assertHookMessage('entity_crud_hook_test_entity_update called for type comment'); $this->assertHookMessage('entity_crud_hook_test_comment_update called'); $_SESSION['entity_crud_hook_test'] = array(); comment_delete($comment->cid); $this->assertHookMessage('entity_crud_hook_test_entity_delete called for type comment'); $this->assertHookMessage('entity_crud_hook_test_comment_delete called'); } /** * Tests hook invocations for CRUD operations on files. */ public function testFileHooks() { $url = 'public://entity_crud_hook_test.file'; file_put_contents($url, 'Test test test'); $file = (object) array( 'fid' => NULL, 'uid' => 1, 'filename' => 'entity_crud_hook_test.file', 'uri' => $url, 'filemime' => 'text/plain', 'filesize' => filesize($url), 'status' => 1, 'timestamp' => REQUEST_TIME, ); $_SESSION['entity_crud_hook_test'] = array(); file_save($file); $this->assertHookMessage('entity_crud_hook_test_entity_presave called for type file'); $this->assertHookMessage('entity_crud_hook_test_file_presave called'); $this->assertHookMessage('entity_crud_hook_test_entity_insert called for type file'); $this->assertHookMessage('entity_crud_hook_test_file_insert called'); $_SESSION['entity_crud_hook_test'] = array(); $file = file_load($file->fid); $this->assertHookMessage('entity_crud_hook_test_entity_load called for type file'); $this->assertHookMessage('entity_crud_hook_test_file_load called'); $_SESSION['entity_crud_hook_test'] = array(); $file->filename = 'new.entity_crud_hook_test.file'; file_save($file); $this->assertHookMessage('entity_crud_hook_test_entity_presave called for type file'); $this->assertHookMessage('entity_crud_hook_test_file_presave called'); $this->assertHookMessage('entity_crud_hook_test_entity_update called for type file'); $this->assertHookMessage('entity_crud_hook_test_file_update called'); $_SESSION['entity_crud_hook_test'] = array(); file_delete($file); $this->assertHookMessage('entity_crud_hook_test_entity_delete called for type file'); $this->assertHookMessage('entity_crud_hook_test_file_delete called'); } /** * Tests hook invocations for CRUD operations on nodes. */ public function testNodeHooks() { $node = (object) array( 'uid' => 1, 'type' => 'article', 'title' => 'Test node', 'status' => 1, 'comment' => 2, 'promote' => 0, 'sticky' => 0, 'language' => LANGUAGE_NONE, 'created' => REQUEST_TIME, 'changed' => REQUEST_TIME, ); $_SESSION['entity_crud_hook_test'] = array(); node_save($node); $this->assertHookMessage('entity_crud_hook_test_entity_presave called for type node'); $this->assertHookMessage('entity_crud_hook_test_node_presave called'); $this->assertHookMessage('entity_crud_hook_test_entity_insert called for type node'); $this->assertHookMessage('entity_crud_hook_test_node_insert called'); $_SESSION['entity_crud_hook_test'] = array(); $node = node_load($node->nid); $this->assertHookMessage('entity_crud_hook_test_entity_load called for type node'); $this->assertHookMessage('entity_crud_hook_test_node_load called'); $_SESSION['entity_crud_hook_test'] = array(); $node->title = 'New title'; node_save($node); $this->assertHookMessage('entity_crud_hook_test_entity_presave called for type node'); $this->assertHookMessage('entity_crud_hook_test_node_presave called'); $this->assertHookMessage('entity_crud_hook_test_entity_update called for type node'); $this->assertHookMessage('entity_crud_hook_test_node_update called'); $_SESSION['entity_crud_hook_test'] = array(); node_delete($node->nid); $this->assertHookMessage('entity_crud_hook_test_entity_delete called for type node'); $this->assertHookMessage('entity_crud_hook_test_node_delete called'); } /** * Tests hook invocations for CRUD operations on taxonomy terms. */ public function testTaxonomyTermHooks() { $vocabulary = (object) array( 'name' => 'Test vocabulary', 'machine_name' => 'test', 'description' => NULL, 'module' => 'entity_crud_hook_test', ); taxonomy_vocabulary_save($vocabulary); $term = (object) array( 'vid' => $vocabulary->vid, 'name' => 'Test term', 'description' => NULL, 'format' => 1, ); $_SESSION['entity_crud_hook_test'] = array(); taxonomy_term_save($term); $this->assertHookMessage('entity_crud_hook_test_entity_presave called for type taxonomy_term'); $this->assertHookMessage('entity_crud_hook_test_taxonomy_term_presave called'); $this->assertHookMessage('entity_crud_hook_test_entity_insert called for type taxonomy_term'); $this->assertHookMessage('entity_crud_hook_test_taxonomy_term_insert called'); $_SESSION['entity_crud_hook_test'] = array(); $term = taxonomy_term_load($term->tid); $this->assertHookMessage('entity_crud_hook_test_entity_load called for type taxonomy_term'); $this->assertHookMessage('entity_crud_hook_test_taxonomy_term_load called'); $_SESSION['entity_crud_hook_test'] = array(); $term->name = 'New name'; taxonomy_term_save($term); $this->assertHookMessage('entity_crud_hook_test_entity_presave called for type taxonomy_term'); $this->assertHookMessage('entity_crud_hook_test_taxonomy_term_presave called'); $this->assertHookMessage('entity_crud_hook_test_entity_update called for type taxonomy_term'); $this->assertHookMessage('entity_crud_hook_test_taxonomy_term_update called'); $_SESSION['entity_crud_hook_test'] = array(); taxonomy_term_delete($term->tid); $this->assertHookMessage('entity_crud_hook_test_entity_delete called for type taxonomy_term'); $this->assertHookMessage('entity_crud_hook_test_taxonomy_term_delete called'); } /** * Tests hook invocations for CRUD operations on taxonomy vocabularies. */ public function testTaxonomyVocabularyHooks() { $vocabulary = (object) array( 'name' => 'Test vocabulary', 'machine_name' => 'test', 'description' => NULL, 'module' => 'entity_crud_hook_test', ); $_SESSION['entity_crud_hook_test'] = array(); taxonomy_vocabulary_save($vocabulary); $this->assertHookMessage('entity_crud_hook_test_entity_presave called for type taxonomy_vocabulary'); $this->assertHookMessage('entity_crud_hook_test_taxonomy_vocabulary_presave called'); $this->assertHookMessage('entity_crud_hook_test_entity_insert called for type taxonomy_vocabulary'); $this->assertHookMessage('entity_crud_hook_test_taxonomy_vocabulary_insert called'); $_SESSION['entity_crud_hook_test'] = array(); $vocabulary = taxonomy_vocabulary_load($vocabulary->vid); $this->assertHookMessage('entity_crud_hook_test_entity_load called for type taxonomy_vocabulary'); $this->assertHookMessage('entity_crud_hook_test_taxonomy_vocabulary_load called'); $_SESSION['entity_crud_hook_test'] = array(); $vocabulary->name = 'New name'; taxonomy_vocabulary_save($vocabulary); $this->assertHookMessage('entity_crud_hook_test_entity_presave called for type taxonomy_vocabulary'); $this->assertHookMessage('entity_crud_hook_test_taxonomy_vocabulary_presave called'); $this->assertHookMessage('entity_crud_hook_test_entity_update called for type taxonomy_vocabulary'); $this->assertHookMessage('entity_crud_hook_test_taxonomy_vocabulary_update called'); $_SESSION['entity_crud_hook_test'] = array(); taxonomy_vocabulary_delete($vocabulary->vid); $this->assertHookMessage('entity_crud_hook_test_entity_delete called for type taxonomy_vocabulary'); $this->assertHookMessage('entity_crud_hook_test_taxonomy_vocabulary_delete called'); } /** * Tests hook invocations for CRUD operations on users. */ public function testUserHooks() { $edit = array( 'name' => 'Test user', 'mail' => 'test@example.com', 'created' => REQUEST_TIME, 'status' => 1, 'language' => 'en', ); $account = (object) $edit; $_SESSION['entity_crud_hook_test'] = array(); $account = user_save($account, $edit); $this->assertHookMessage('entity_crud_hook_test_entity_presave called for type user'); $this->assertHookMessage('entity_crud_hook_test_user_presave called'); $this->assertHookMessage('entity_crud_hook_test_entity_insert called for type user'); $this->assertHookMessage('entity_crud_hook_test_user_insert called'); $_SESSION['entity_crud_hook_test'] = array(); $account = user_load($account->uid); $this->assertHookMessage('entity_crud_hook_test_entity_load called for type user'); $this->assertHookMessage('entity_crud_hook_test_user_load called'); $_SESSION['entity_crud_hook_test'] = array(); $edit['name'] = 'New name'; $account = user_save($account, $edit); $this->assertHookMessage('entity_crud_hook_test_entity_presave called for type user'); $this->assertHookMessage('entity_crud_hook_test_user_presave called'); $this->assertHookMessage('entity_crud_hook_test_entity_update called for type user'); $this->assertHookMessage('entity_crud_hook_test_user_update called'); $_SESSION['entity_crud_hook_test'] = array(); user_delete($account->uid); $this->assertHookMessage('entity_crud_hook_test_entity_delete called for type user'); $this->assertHookMessage('entity_crud_hook_test_user_delete called'); } } drupal-7.41/modules/simpletest/tests/entity_cache_test_dependency.module0000644000000000000000000000046112611765734025555 0ustar rootroot array( 'label' => variable_get('entity_cache_test_label', 'Entity Cache Test'), ), ); } drupal-7.41/modules/simpletest/tests/actions_loop_test.module0000644000000000000000000000504712611765734023416 0ustar rootroot array( 'watchdog' => array( 'label' => t('When a message is logged'), ), ), ); } /** * Implements hook_watchdog(). */ function actions_loop_test_watchdog(array $log_entry) { // If the triggering actions are not explicitly enabled, abort. if (empty($_GET['trigger_actions_on_watchdog'])) { return; } // Get all the action ids assigned to the trigger on the watchdog hook's // "run" event. $aids = trigger_get_assigned_actions('watchdog'); // We can pass in any applicable information in $context. There isn't much in // this case, but we'll pass in the hook name as the bare minimum. $context = array( 'hook' => 'watchdog', ); // Fire the actions on the associated object ($log_entry) and the context // variable. actions_do(array_keys($aids), $log_entry, $context); } /** * Implements hook_init(). */ function actions_loop_test_init() { if (!empty($_GET['trigger_actions_on_watchdog'])) { watchdog_skip_semaphore('actions_loop_test', 'Triggering action loop'); } } /** * Implements hook_action_info(). */ function actions_loop_test_action_info() { return array( 'actions_loop_test_log' => array( 'label' => t('Write a message to the log.'), 'type' => 'system', 'configurable' => FALSE, 'triggers' => array('any'), ), ); } /** * Write a message to the log. */ function actions_loop_test_log() { $count = &drupal_static(__FUNCTION__, 0); $count++; watchdog_skip_semaphore('actions_loop_test', "Test log #$count"); } /** * Replacement of the watchdog() function that eliminates the use of semaphores * so that we can test the abortion of an action loop. */ function watchdog_skip_semaphore($type, $message, $variables = array(), $severity = WATCHDOG_NOTICE, $link = NULL) { global $user, $base_root; // Prepare the fields to be logged $log_entry = array( 'type' => $type, 'message' => $message, 'variables' => $variables, 'severity' => $severity, 'link' => $link, 'user' => $user, 'uid' => isset($user->uid) ? $user->uid : 0, 'request_uri' => $base_root . request_uri(), 'referer' => $_SERVER['HTTP_REFERER'], 'ip' => ip_address(), 'timestamp' => REQUEST_TIME, ); // Call the logging hooks to log/process the message foreach (module_implements('watchdog') as $module) { module_invoke($module, 'watchdog', $log_entry); } } drupal-7.41/modules/simpletest/tests/file.test0000644000000000000000000033245112611765734020301 0ustar rootrootassertEqual($before->fid, $after->fid, format_string('File id is the same: %file1 == %file2.', array('%file1' => $before->fid, '%file2' => $after->fid)), 'File unchanged'); $this->assertEqual($before->uid, $after->uid, format_string('File owner is the same: %file1 == %file2.', array('%file1' => $before->uid, '%file2' => $after->uid)), 'File unchanged'); $this->assertEqual($before->filename, $after->filename, format_string('File name is the same: %file1 == %file2.', array('%file1' => $before->filename, '%file2' => $after->filename)), 'File unchanged'); $this->assertEqual($before->uri, $after->uri, format_string('File path is the same: %file1 == %file2.', array('%file1' => $before->uri, '%file2' => $after->uri)), 'File unchanged'); $this->assertEqual($before->filemime, $after->filemime, format_string('File MIME type is the same: %file1 == %file2.', array('%file1' => $before->filemime, '%file2' => $after->filemime)), 'File unchanged'); $this->assertEqual($before->filesize, $after->filesize, format_string('File size is the same: %file1 == %file2.', array('%file1' => $before->filesize, '%file2' => $after->filesize)), 'File unchanged'); $this->assertEqual($before->status, $after->status, format_string('File status is the same: %file1 == %file2.', array('%file1' => $before->status, '%file2' => $after->status)), 'File unchanged'); } /** * Check that two files are not the same by comparing the fid and filepath. * * @param $file1 * File object to compare. * @param $file2 * File object to compare. */ function assertDifferentFile($file1, $file2) { $this->assertNotEqual($file1->fid, $file2->fid, format_string('Files have different ids: %file1 != %file2.', array('%file1' => $file1->fid, '%file2' => $file2->fid)), 'Different file'); $this->assertNotEqual($file1->uri, $file2->uri, format_string('Files have different paths: %file1 != %file2.', array('%file1' => $file1->uri, '%file2' => $file2->uri)), 'Different file'); } /** * Check that two files are the same by comparing the fid and filepath. * * @param $file1 * File object to compare. * @param $file2 * File object to compare. */ function assertSameFile($file1, $file2) { $this->assertEqual($file1->fid, $file2->fid, format_string('Files have the same ids: %file1 == %file2.', array('%file1' => $file1->fid, '%file2-fid' => $file2->fid)), 'Same file'); $this->assertEqual($file1->uri, $file2->uri, format_string('Files have the same path: %file1 == %file2.', array('%file1' => $file1->uri, '%file2' => $file2->uri)), 'Same file'); } /** * Helper function to test the permissions of a file. * * @param $filepath * String file path. * @param $expected_mode * Octal integer like 0664 or 0777. * @param $message * Optional message. */ function assertFilePermissions($filepath, $expected_mode, $message = NULL) { // Clear out PHP's file stat cache to be sure we see the current value. clearstatcache(); // Mask out all but the last three octets. $actual_mode = fileperms($filepath) & 0777; // PHP on Windows has limited support for file permissions. Usually each of // "user", "group" and "other" use one octal digit (3 bits) to represent the // read/write/execute bits. On Windows, chmod() ignores the "group" and // "other" bits, and fileperms() returns the "user" bits in all three // positions. $expected_mode is updated to reflect this. if (substr(PHP_OS, 0, 3) == 'WIN') { // Reset the "group" and "other" bits. $expected_mode = $expected_mode & 0700; // Shift the "user" bits to the "group" and "other" positions also. $expected_mode = $expected_mode | $expected_mode >> 3 | $expected_mode >> 6; } if (!isset($message)) { $message = t('Expected file permission to be %expected, actually were %actual.', array('%actual' => decoct($actual_mode), '%expected' => decoct($expected_mode))); } $this->assertEqual($actual_mode, $expected_mode, $message); } /** * Helper function to test the permissions of a directory. * * @param $directory * String directory path. * @param $expected_mode * Octal integer like 0664 or 0777. * @param $message * Optional message. */ function assertDirectoryPermissions($directory, $expected_mode, $message = NULL) { // Clear out PHP's file stat cache to be sure we see the current value. clearstatcache(); // Mask out all but the last three octets. $actual_mode = fileperms($directory) & 0777; // PHP on Windows has limited support for file permissions. Usually each of // "user", "group" and "other" use one octal digit (3 bits) to represent the // read/write/execute bits. On Windows, chmod() ignores the "group" and // "other" bits, and fileperms() returns the "user" bits in all three // positions. $expected_mode is updated to reflect this. if (substr(PHP_OS, 0, 3) == 'WIN') { // Reset the "group" and "other" bits. $expected_mode = $expected_mode & 0700; // Shift the "user" bits to the "group" and "other" positions also. $expected_mode = $expected_mode | $expected_mode >> 3 | $expected_mode >> 6; } if (!isset($message)) { $message = t('Expected directory permission to be %expected, actually were %actual.', array('%actual' => decoct($actual_mode), '%expected' => decoct($expected_mode))); } $this->assertEqual($actual_mode, $expected_mode, $message); } /** * Create a directory and assert it exists. * * @param $path * Optional string with a directory path. If none is provided, a random * name in the site's files directory will be used. * @return * The path to the directory. */ function createDirectory($path = NULL) { // A directory to operate on. if (!isset($path)) { $path = file_default_scheme() . '://' . $this->randomName(); } $this->assertTrue(drupal_mkdir($path) && is_dir($path), 'Directory was created successfully.'); return $path; } /** * Create a file and save it to the files table and assert that it occurs * correctly. * * @param $filepath * Optional string specifying the file path. If none is provided then a * randomly named file will be created in the site's files directory. * @param $contents * Optional contents to save into the file. If a NULL value is provided an * arbitrary string will be used. * @param $scheme * Optional string indicating the stream scheme to use. Drupal core includes * public, private, and temporary. The public wrapper is the default. * @return * File object. */ function createFile($filepath = NULL, $contents = NULL, $scheme = NULL) { if (!isset($filepath)) { // Prefix with non-latin characters to ensure that all file-related // tests work with international filenames. $filepath = 'Файл для тестирования ' . $this->randomName(); } if (!isset($scheme)) { $scheme = file_default_scheme(); } $filepath = $scheme . '://' . $filepath; if (!isset($contents)) { $contents = "file_put_contents() doesn't seem to appreciate empty strings so let's put in some data."; } file_put_contents($filepath, $contents); $this->assertTrue(is_file($filepath), 'The test file exists on the disk.', 'Create test file'); $file = new stdClass(); $file->uri = $filepath; $file->filename = drupal_basename($file->uri); $file->filemime = 'text/plain'; $file->uid = 1; $file->timestamp = REQUEST_TIME; $file->filesize = filesize($file->uri); $file->status = 0; // Write the record directly rather than calling file_save() so we don't // invoke the hooks. $this->assertNotIdentical(drupal_write_record('file_managed', $file), FALSE, 'The file was added to the database.', 'Create test file'); return $file; } } /** * Base class for file tests that use the file_test module to test uploads and * hooks. */ class FileHookTestCase extends FileTestCase { function setUp() { // Install file_test module parent::setUp('file_test'); // Clear out any hook calls. file_test_reset(); } /** * Assert that all of the specified hook_file_* hooks were called once, other * values result in failure. * * @param $expected * Array with string containing with the hook name, e.g. 'load', 'save', * 'insert', etc. */ function assertFileHooksCalled($expected) { // Determine which hooks were called. $actual = array_keys(array_filter(file_test_get_all_calls())); // Determine if there were any expected that were not called. $uncalled = array_diff($expected, $actual); if (count($uncalled)) { $this->assertTrue(FALSE, format_string('Expected hooks %expected to be called but %uncalled was not called.', array('%expected' => implode(', ', $expected), '%uncalled' => implode(', ', $uncalled)))); } else { $this->assertTrue(TRUE, format_string('All the expected hooks were called: %expected', array('%expected' => empty($expected) ? t('(none)') : implode(', ', $expected)))); } // Determine if there were any unexpected calls. $unexpected = array_diff($actual, $expected); if (count($unexpected)) { $this->assertTrue(FALSE, format_string('Unexpected hooks were called: %unexpected.', array('%unexpected' => empty($unexpected) ? t('(none)') : implode(', ', $unexpected)))); } else { $this->assertTrue(TRUE, 'No unexpected hooks were called.'); } } /** * Assert that a hook_file_* hook was called a certain number of times. * * @param $hook * String with the hook name, e.g. 'load', 'save', 'insert', etc. * @param $expected_count * Optional integer count. * @param $message * Optional translated string message. */ function assertFileHookCalled($hook, $expected_count = 1, $message = NULL) { $actual_count = count(file_test_get_calls($hook)); if (!isset($message)) { if ($actual_count == $expected_count) { $message = format_string('hook_file_@name was called correctly.', array('@name' => $hook)); } elseif ($expected_count == 0) { $message = format_plural($actual_count, 'hook_file_@name was not expected to be called but was actually called once.', 'hook_file_@name was not expected to be called but was actually called @count times.', array('@name' => $hook, '@count' => $actual_count)); } else { $message = format_string('hook_file_@name was expected to be called %expected times but was called %actual times.', array('@name' => $hook, '%expected' => $expected_count, '%actual' => $actual_count)); } } $this->assertEqual($actual_count, $expected_count, $message); } } /** * This will run tests against the file_space_used() function. */ class FileSpaceUsedTest extends FileTestCase { public static function getInfo() { return array( 'name' => 'File space used tests', 'description' => 'Tests the file_space_used() function.', 'group' => 'File API', ); } function setUp() { parent::setUp(); // Create records for a couple of users with different sizes. $file = array('uid' => 2, 'uri' => 'public://example1.txt', 'filesize' => 50, 'status' => FILE_STATUS_PERMANENT); drupal_write_record('file_managed', $file); $file = array('uid' => 2, 'uri' => 'public://example2.txt', 'filesize' => 20, 'status' => FILE_STATUS_PERMANENT); drupal_write_record('file_managed', $file); $file = array('uid' => 3, 'uri' => 'public://example3.txt', 'filesize' => 100, 'status' => FILE_STATUS_PERMANENT); drupal_write_record('file_managed', $file); $file = array('uid' => 3, 'uri' => 'public://example4.txt', 'filesize' => 200, 'status' => FILE_STATUS_PERMANENT); drupal_write_record('file_managed', $file); // Now create some non-permanent files. $file = array('uid' => 2, 'uri' => 'public://example5.txt', 'filesize' => 1, 'status' => 0); drupal_write_record('file_managed', $file); $file = array('uid' => 3, 'uri' => 'public://example6.txt', 'filesize' => 3, 'status' => 0); drupal_write_record('file_managed', $file); } /** * Test different users with the default status. */ function testFileSpaceUsed() { // Test different users with default status. $this->assertEqual(file_space_used(2), 70); $this->assertEqual(file_space_used(3), 300); $this->assertEqual(file_space_used(), 370); // Test the status fields $this->assertEqual(file_space_used(NULL, 0), 4); $this->assertEqual(file_space_used(NULL, FILE_STATUS_PERMANENT), 370); // Test both the user and status. $this->assertEqual(file_space_used(1, 0), 0); $this->assertEqual(file_space_used(1, FILE_STATUS_PERMANENT), 0); $this->assertEqual(file_space_used(2, 0), 1); $this->assertEqual(file_space_used(2, FILE_STATUS_PERMANENT), 70); $this->assertEqual(file_space_used(3, 0), 3); $this->assertEqual(file_space_used(3, FILE_STATUS_PERMANENT), 300); } } /** * This will run tests against the file validation functions (file_validate_*). */ class FileValidatorTest extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'File validator tests', 'description' => 'Tests the functions used to validate uploaded files.', 'group' => 'File API', ); } function setUp() { parent::setUp(); $this->image = new stdClass(); $this->image->uri = 'misc/druplicon.png'; $this->image->filename = drupal_basename($this->image->uri); $this->non_image = new stdClass(); $this->non_image->uri = 'misc/jquery.js'; $this->non_image->filename = drupal_basename($this->non_image->uri); } /** * Test the file_validate_extensions() function. */ function testFileValidateExtensions() { $file = new stdClass(); $file->filename = 'asdf.txt'; $errors = file_validate_extensions($file, 'asdf txt pork'); $this->assertEqual(count($errors), 0, 'Valid extension accepted.', 'File'); $file->filename = 'asdf.txt'; $errors = file_validate_extensions($file, 'exe png'); $this->assertEqual(count($errors), 1, 'Invalid extension blocked.', 'File'); } /** * This ensures a specific file is actually an image. */ function testFileValidateIsImage() { $this->assertTrue(file_exists($this->image->uri), 'The image being tested exists.', 'File'); $errors = file_validate_is_image($this->image); $this->assertEqual(count($errors), 0, 'No error reported for our image file.', 'File'); $this->assertTrue(file_exists($this->non_image->uri), 'The non-image being tested exists.', 'File'); $errors = file_validate_is_image($this->non_image); $this->assertEqual(count($errors), 1, 'An error reported for our non-image file.', 'File'); } /** * This ensures the resolution of a specific file is within bounds. * The image will be resized if it's too large. */ function testFileValidateImageResolution() { // Non-images. $errors = file_validate_image_resolution($this->non_image); $this->assertEqual(count($errors), 0, 'Should not get any errors for a non-image file.', 'File'); $errors = file_validate_image_resolution($this->non_image, '50x50', '100x100'); $this->assertEqual(count($errors), 0, 'Do not check the resolution on non files.', 'File'); // Minimum size. $errors = file_validate_image_resolution($this->image); $this->assertEqual(count($errors), 0, 'No errors for an image when there is no minimum or maximum resolution.', 'File'); $errors = file_validate_image_resolution($this->image, 0, '200x1'); $this->assertEqual(count($errors), 1, 'Got an error for an image that was not wide enough.', 'File'); $errors = file_validate_image_resolution($this->image, 0, '1x200'); $this->assertEqual(count($errors), 1, 'Got an error for an image that was not tall enough.', 'File'); $errors = file_validate_image_resolution($this->image, 0, '200x200'); $this->assertEqual(count($errors), 1, 'Small images report an error.', 'File'); // Maximum size. if (image_get_toolkit()) { // Copy the image so that the original doesn't get resized. copy('misc/druplicon.png', 'temporary://druplicon.png'); $this->image->uri = 'temporary://druplicon.png'; $errors = file_validate_image_resolution($this->image, '10x5'); $this->assertEqual(count($errors), 0, 'No errors should be reported when an oversized image can be scaled down.', 'File'); $info = image_get_info($this->image->uri); $this->assertTrue($info['width'] <= 10, 'Image scaled to correct width.', 'File'); $this->assertTrue($info['height'] <= 5, 'Image scaled to correct height.', 'File'); drupal_unlink('temporary://druplicon.png'); } else { // TODO: should check that the error is returned if no toolkit is available. $errors = file_validate_image_resolution($this->image, '5x10'); $this->assertEqual(count($errors), 1, 'Oversize images that cannot be scaled get an error.', 'File'); } } /** * This will ensure the filename length is valid. */ function testFileValidateNameLength() { // Create a new file object. $file = new stdClass(); // Add a filename with an allowed length and test it. $file->filename = str_repeat('x', 240); $this->assertEqual(strlen($file->filename), 240); $errors = file_validate_name_length($file); $this->assertEqual(count($errors), 0, 'No errors reported for 240 length filename.', 'File'); // Add a filename with a length too long and test it. $file->filename = str_repeat('x', 241); $errors = file_validate_name_length($file); $this->assertEqual(count($errors), 1, 'An error reported for 241 length filename.', 'File'); // Add a filename with an empty string and test it. $file->filename = ''; $errors = file_validate_name_length($file); $this->assertEqual(count($errors), 1, 'An error reported for 0 length filename.', 'File'); } /** * Test file_validate_size(). */ function testFileValidateSize() { // Create a file with a size of 1000 bytes, and quotas of only 1 byte. $file = new stdClass(); $file->filesize = 1000; $errors = file_validate_size($file, 0, 0); $this->assertEqual(count($errors), 0, 'No limits means no errors.', 'File'); $errors = file_validate_size($file, 1, 0); $this->assertEqual(count($errors), 1, 'Error for the file being over the limit.', 'File'); $errors = file_validate_size($file, 0, 1); $this->assertEqual(count($errors), 1, 'Error for the user being over their limit.', 'File'); $errors = file_validate_size($file, 1, 1); $this->assertEqual(count($errors), 2, 'Errors for both the file and their limit.', 'File'); } } /** * Tests the file_unmanaged_save_data() function. */ class FileUnmanagedSaveDataTest extends FileTestCase { public static function getInfo() { return array( 'name' => 'Unmanaged file save data', 'description' => 'Tests the unmanaged file save data function.', 'group' => 'File API', ); } /** * Test the file_unmanaged_save_data() function. */ function testFileSaveData() { $contents = $this->randomName(8); // No filename. $filepath = file_unmanaged_save_data($contents); $this->assertTrue($filepath, 'Unnamed file saved correctly.'); $this->assertEqual(file_uri_scheme($filepath), file_default_scheme(), "File was placed in Drupal's files directory."); $this->assertEqual($contents, file_get_contents($filepath), 'Contents of the file are correct.'); // Provide a filename. $filepath = file_unmanaged_save_data($contents, 'public://asdf.txt', FILE_EXISTS_REPLACE); $this->assertTrue($filepath, 'Unnamed file saved correctly.'); $this->assertEqual('asdf.txt', drupal_basename($filepath), 'File was named correctly.'); $this->assertEqual($contents, file_get_contents($filepath), 'Contents of the file are correct.'); $this->assertFilePermissions($filepath, variable_get('file_chmod_file', 0664)); } } /** * Tests the file_unmanaged_save_data() function on remote filesystems. */ class RemoteFileUnmanagedSaveDataTest extends FileUnmanagedSaveDataTest { public static function getInfo() { $info = parent::getInfo(); $info['group'] = 'File API (remote)'; return $info; } function setUp() { parent::setUp('file_test'); variable_set('file_default_scheme', 'dummy-remote'); } } /** * Test the file_save_upload() function. */ class FileSaveUploadTest extends FileHookTestCase { /** * An image file path for uploading. */ protected $image; /** * A PHP file path for upload security testing. */ protected $phpfile; /** * The largest file id when the test starts. */ protected $maxFidBefore; public static function getInfo() { return array( 'name' => 'File uploading', 'description' => 'Tests the file uploading functions.', 'group' => 'File API', ); } function setUp() { parent::setUp(); $account = $this->drupalCreateUser(array('access content')); $this->drupalLogin($account); $image_files = $this->drupalGetTestFiles('image'); $this->image = current($image_files); list(, $this->image_extension) = explode('.', $this->image->filename); $this->assertTrue(is_file($this->image->uri), "The image file we're going to upload exists."); $this->phpfile = current($this->drupalGetTestFiles('php')); $this->assertTrue(is_file($this->phpfile->uri), "The PHP file we're going to upload exists."); $this->maxFidBefore = db_query('SELECT MAX(fid) AS fid FROM {file_managed}')->fetchField(); // Upload with replace to guarantee there's something there. $edit = array( 'file_test_replace' => FILE_EXISTS_REPLACE, 'files[file_test_upload]' => drupal_realpath($this->image->uri), ); $this->drupalPost('file-test/upload', $edit, t('Submit')); $this->assertResponse(200, 'Received a 200 response for posted test file.'); $this->assertRaw(t('You WIN!'), 'Found the success message.'); // Check that the correct hooks were called then clean out the hook // counters. $this->assertFileHooksCalled(array('validate', 'insert')); file_test_reset(); } /** * Test the file_save_upload() function. */ function testNormal() { $max_fid_after = db_query('SELECT MAX(fid) AS fid FROM {file_managed}')->fetchField(); $this->assertTrue($max_fid_after > $this->maxFidBefore, 'A new file was created.'); $file1 = file_load($max_fid_after); $this->assertTrue($file1, 'Loaded the file.'); // MIME type of the uploaded image may be either image/jpeg or image/png. $this->assertEqual(substr($file1->filemime, 0, 5), 'image', 'A MIME type was set.'); // Reset the hook counters to get rid of the 'load' we just called. file_test_reset(); // Upload a second file. $max_fid_before = db_query('SELECT MAX(fid) AS fid FROM {file_managed}')->fetchField(); $image2 = current($this->drupalGetTestFiles('image')); $edit = array('files[file_test_upload]' => drupal_realpath($image2->uri)); $this->drupalPost('file-test/upload', $edit, t('Submit')); $this->assertResponse(200, 'Received a 200 response for posted test file.'); $this->assertRaw(t('You WIN!')); $max_fid_after = db_query('SELECT MAX(fid) AS fid FROM {file_managed}')->fetchField(); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('validate', 'insert')); $file2 = file_load($max_fid_after); $this->assertTrue($file2); // MIME type of the uploaded image may be either image/jpeg or image/png. $this->assertEqual(substr($file2->filemime, 0, 5), 'image', 'A MIME type was set.'); // Load both files using file_load_multiple(). $files = file_load_multiple(array($file1->fid, $file2->fid)); $this->assertTrue(isset($files[$file1->fid]), 'File was loaded successfully'); $this->assertTrue(isset($files[$file2->fid]), 'File was loaded successfully'); // Upload a third file to a subdirectory. $image3 = current($this->drupalGetTestFiles('image')); $image3_realpath = drupal_realpath($image3->uri); $dir = $this->randomName(); $edit = array( 'files[file_test_upload]' => $image3_realpath, 'file_subdir' => $dir, ); $this->drupalPost('file-test/upload', $edit, t('Submit')); $this->assertResponse(200, 'Received a 200 response for posted test file.'); $this->assertRaw(t('You WIN!')); $this->assertTrue(is_file('temporary://' . $dir . '/' . trim(drupal_basename($image3_realpath)))); // Check that file_load_multiple() with no arguments returns FALSE. $this->assertFalse(file_load_multiple(), 'No files were loaded.'); } /** * Test extension handling. */ function testHandleExtension() { // The file being tested is a .gif which is in the default safe list // of extensions to allow when the extension validator isn't used. This is // implicitly tested at the testNormal() test. Here we tell // file_save_upload() to only allow ".foo". $extensions = 'foo'; $edit = array( 'file_test_replace' => FILE_EXISTS_REPLACE, 'files[file_test_upload]' => drupal_realpath($this->image->uri), 'extensions' => $extensions, ); $this->drupalPost('file-test/upload', $edit, t('Submit')); $this->assertResponse(200, 'Received a 200 response for posted test file.'); $message = t('Only files with the following extensions are allowed:') . ' ' . $extensions . ''; $this->assertRaw($message, 'Cannot upload a disallowed extension'); $this->assertRaw(t('Epic upload FAIL!'), 'Found the failure message.'); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('validate')); // Reset the hook counters. file_test_reset(); $extensions = 'foo ' . $this->image_extension; // Now tell file_save_upload() to allow the extension of our test image. $edit = array( 'file_test_replace' => FILE_EXISTS_REPLACE, 'files[file_test_upload]' => drupal_realpath($this->image->uri), 'extensions' => $extensions, ); $this->drupalPost('file-test/upload', $edit, t('Submit')); $this->assertResponse(200, 'Received a 200 response for posted test file.'); $this->assertNoRaw(t('Only files with the following extensions are allowed:'), 'Can upload an allowed extension.'); $this->assertRaw(t('You WIN!'), 'Found the success message.'); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('validate', 'load', 'update')); // Reset the hook counters. file_test_reset(); // Now tell file_save_upload() to allow any extension. $edit = array( 'file_test_replace' => FILE_EXISTS_REPLACE, 'files[file_test_upload]' => drupal_realpath($this->image->uri), 'allow_all_extensions' => TRUE, ); $this->drupalPost('file-test/upload', $edit, t('Submit')); $this->assertResponse(200, 'Received a 200 response for posted test file.'); $this->assertNoRaw(t('Only files with the following extensions are allowed:'), 'Can upload any extension.'); $this->assertRaw(t('You WIN!'), 'Found the success message.'); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('validate', 'load', 'update')); } /** * Test dangerous file handling. */ function testHandleDangerousFile() { // Allow the .php extension and make sure it gets renamed to .txt for // safety. Also check to make sure its MIME type was changed. $edit = array( 'file_test_replace' => FILE_EXISTS_REPLACE, 'files[file_test_upload]' => drupal_realpath($this->phpfile->uri), 'is_image_file' => FALSE, 'extensions' => 'php', ); $this->drupalPost('file-test/upload', $edit, t('Submit')); $this->assertResponse(200, 'Received a 200 response for posted test file.'); $message = t('For security reasons, your upload has been renamed to') . ' ' . $this->phpfile->filename . '.txt' . ''; $this->assertRaw($message, 'Dangerous file was renamed.'); $this->assertRaw(t('File MIME type is text/plain.'), "Dangerous file's MIME type was changed."); $this->assertRaw(t('You WIN!'), 'Found the success message.'); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('validate', 'insert')); // Ensure dangerous files are not renamed when insecure uploads is TRUE. // Turn on insecure uploads. variable_set('allow_insecure_uploads', 1); // Reset the hook counters. file_test_reset(); $this->drupalPost('file-test/upload', $edit, t('Submit')); $this->assertResponse(200, 'Received a 200 response for posted test file.'); $this->assertNoRaw(t('For security reasons, your upload has been renamed'), 'Found no security message.'); $this->assertRaw(t('File name is !filename', array('!filename' => $this->phpfile->filename)), 'Dangerous file was not renamed when insecure uploads is TRUE.'); $this->assertRaw(t('You WIN!'), 'Found the success message.'); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('validate', 'insert')); // Turn off insecure uploads. variable_set('allow_insecure_uploads', 0); } /** * Test file munge handling. */ function testHandleFileMunge() { // Ensure insecure uploads are disabled for this test. variable_set('allow_insecure_uploads', 0); $this->image = file_move($this->image, $this->image->uri . '.foo.' . $this->image_extension); // Reset the hook counters to get rid of the 'move' we just called. file_test_reset(); $extensions = $this->image_extension; $edit = array( 'files[file_test_upload]' => drupal_realpath($this->image->uri), 'extensions' => $extensions, ); $munged_filename = $this->image->filename; $munged_filename = substr($munged_filename, 0, strrpos($munged_filename, '.')); $munged_filename .= '_.' . $this->image_extension; $this->drupalPost('file-test/upload', $edit, t('Submit')); $this->assertResponse(200, 'Received a 200 response for posted test file.'); $this->assertRaw(t('For security reasons, your upload has been renamed'), 'Found security message.'); $this->assertRaw(t('File name is !filename', array('!filename' => $munged_filename)), 'File was successfully munged.'); $this->assertRaw(t('You WIN!'), 'Found the success message.'); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('validate', 'insert')); // Ensure we don't munge files if we're allowing any extension. // Reset the hook counters. file_test_reset(); $edit = array( 'files[file_test_upload]' => drupal_realpath($this->image->uri), 'allow_all_extensions' => TRUE, ); $this->drupalPost('file-test/upload', $edit, t('Submit')); $this->assertResponse(200, 'Received a 200 response for posted test file.'); $this->assertNoRaw(t('For security reasons, your upload has been renamed'), 'Found no security message.'); $this->assertRaw(t('File name is !filename', array('!filename' => $this->image->filename)), 'File was not munged when allowing any extension.'); $this->assertRaw(t('You WIN!'), 'Found the success message.'); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('validate', 'insert')); } /** * Test renaming when uploading over a file that already exists. */ function testExistingRename() { $edit = array( 'file_test_replace' => FILE_EXISTS_RENAME, 'files[file_test_upload]' => drupal_realpath($this->image->uri) ); $this->drupalPost('file-test/upload', $edit, t('Submit')); $this->assertResponse(200, 'Received a 200 response for posted test file.'); $this->assertRaw(t('You WIN!'), 'Found the success message.'); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('validate', 'insert')); } /** * Test replacement when uploading over a file that already exists. */ function testExistingReplace() { $edit = array( 'file_test_replace' => FILE_EXISTS_REPLACE, 'files[file_test_upload]' => drupal_realpath($this->image->uri) ); $this->drupalPost('file-test/upload', $edit, t('Submit')); $this->assertResponse(200, 'Received a 200 response for posted test file.'); $this->assertRaw(t('You WIN!'), 'Found the success message.'); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('validate', 'load', 'update')); } /** * Test for failure when uploading over a file that already exists. */ function testExistingError() { $edit = array( 'file_test_replace' => FILE_EXISTS_ERROR, 'files[file_test_upload]' => drupal_realpath($this->image->uri) ); $this->drupalPost('file-test/upload', $edit, t('Submit')); $this->assertResponse(200, 'Received a 200 response for posted test file.'); $this->assertRaw(t('Epic upload FAIL!'), 'Found the failure message.'); // Check that the no hooks were called while failing. $this->assertFileHooksCalled(array()); } /** * Test for no failures when not uploading a file. */ function testNoUpload() { $this->drupalPost('file-test/upload', array(), t('Submit')); $this->assertNoRaw(t('Epic upload FAIL!'), 'Failure message not found.'); } } /** * Test the file_save_upload() function on remote filesystems. */ class RemoteFileSaveUploadTest extends FileSaveUploadTest { public static function getInfo() { $info = parent::getInfo(); $info['group'] = 'File API (remote)'; return $info; } function setUp() { parent::setUp('file_test'); variable_set('file_default_scheme', 'dummy-remote'); } } /** * Directory related tests. */ class FileDirectoryTest extends FileTestCase { public static function getInfo() { return array( 'name' => 'File paths and directories', 'description' => 'Tests operations dealing with directories.', 'group' => 'File API', ); } /** * Test directory handling functions. */ function testFileCheckDirectoryHandling() { // A directory to operate on. $directory = file_default_scheme() . '://' . $this->randomName() . '/' . $this->randomName(); $this->assertFalse(is_dir($directory), 'Directory does not exist prior to testing.'); // Non-existent directory. $this->assertFalse(file_prepare_directory($directory, 0), 'Error reported for non-existing directory.', 'File'); // Make a directory. $this->assertTrue(file_prepare_directory($directory, FILE_CREATE_DIRECTORY), 'No error reported when creating a new directory.', 'File'); // Make sure directory actually exists. $this->assertTrue(is_dir($directory), 'Directory actually exists.', 'File'); if (substr(PHP_OS, 0, 3) != 'WIN') { // PHP on Windows doesn't support any kind of useful read-only mode for // directories. When executing a chmod() on a directory, PHP only sets the // read-only flag, which doesn't prevent files to actually be written // in the directory on any recent version of Windows. // Make directory read only. @drupal_chmod($directory, 0444); $this->assertFalse(file_prepare_directory($directory, 0), 'Error reported for a non-writeable directory.', 'File'); // Test directory permission modification. $this->assertTrue(file_prepare_directory($directory, FILE_MODIFY_PERMISSIONS), 'No error reported when making directory writeable.', 'File'); } // Test that the directory has the correct permissions. $this->assertDirectoryPermissions($directory, variable_get('file_chmod_directory', 0775)); // Remove .htaccess file to then test that it gets re-created. @drupal_unlink(file_default_scheme() . '://.htaccess'); $this->assertFalse(is_file(file_default_scheme() . '://.htaccess'), 'Successfully removed the .htaccess file in the files directory.', 'File'); file_ensure_htaccess(); $this->assertTrue(is_file(file_default_scheme() . '://.htaccess'), 'Successfully re-created the .htaccess file in the files directory.', 'File'); // Verify contents of .htaccess file. $file = file_get_contents(file_default_scheme() . '://.htaccess'); $this->assertEqual($file, file_htaccess_lines(FALSE), 'The .htaccess file contains the proper content.', 'File'); } /** * This will take a directory and path, and find a valid filepath that is not * taken by another file. */ function testFileCreateNewFilepath() { // First we test against an imaginary file that does not exist in a // directory. $basename = 'xyz.txt'; $directory = 'misc'; $original = $directory . '/' . $basename; $path = file_create_filename($basename, $directory); $this->assertEqual($path, $original, format_string('New filepath %new equals %original.', array('%new' => $path, '%original' => $original)), 'File'); // Then we test against a file that already exists within that directory. $basename = 'druplicon.png'; $original = $directory . '/' . $basename; $expected = $directory . '/druplicon_0.png'; $path = file_create_filename($basename, $directory); $this->assertEqual($path, $expected, format_string('Creating a new filepath from %original equals %new.', array('%new' => $path, '%original' => $original)), 'File'); // @TODO: Finally we copy a file into a directory several times, to ensure a properly iterating filename suffix. } /** * This will test the filepath for a destination based on passed flags and * whether or not the file exists. * * If a file exists, file_destination($destination, $replace) will either * return: * - the existing filepath, if $replace is FILE_EXISTS_REPLACE * - a new filepath if FILE_EXISTS_RENAME * - an error (returning FALSE) if FILE_EXISTS_ERROR. * If the file doesn't currently exist, then it will simply return the * filepath. */ function testFileDestination() { // First test for non-existent file. $destination = 'misc/xyz.txt'; $path = file_destination($destination, FILE_EXISTS_REPLACE); $this->assertEqual($path, $destination, 'Non-existing filepath destination is correct with FILE_EXISTS_REPLACE.', 'File'); $path = file_destination($destination, FILE_EXISTS_RENAME); $this->assertEqual($path, $destination, 'Non-existing filepath destination is correct with FILE_EXISTS_RENAME.', 'File'); $path = file_destination($destination, FILE_EXISTS_ERROR); $this->assertEqual($path, $destination, 'Non-existing filepath destination is correct with FILE_EXISTS_ERROR.', 'File'); $destination = 'misc/druplicon.png'; $path = file_destination($destination, FILE_EXISTS_REPLACE); $this->assertEqual($path, $destination, 'Existing filepath destination remains the same with FILE_EXISTS_REPLACE.', 'File'); $path = file_destination($destination, FILE_EXISTS_RENAME); $this->assertNotEqual($path, $destination, 'A new filepath destination is created when filepath destination already exists with FILE_EXISTS_RENAME.', 'File'); $path = file_destination($destination, FILE_EXISTS_ERROR); $this->assertEqual($path, FALSE, 'An error is returned when filepath destination already exists with FILE_EXISTS_ERROR.', 'File'); } /** * Ensure that the file_directory_temp() function always returns a value. */ function testFileDirectoryTemp() { // Start with an empty variable to ensure we have a clean slate. variable_set('file_temporary_path', ''); $tmp_directory = file_directory_temp(); $this->assertEqual(empty($tmp_directory), FALSE, 'file_directory_temp() returned a non-empty value.'); $setting = variable_get('file_temporary_path', ''); $this->assertEqual($setting, $tmp_directory, "The 'file_temporary_path' variable has the same value that file_directory_temp() returned."); } } /** * Directory related tests. */ class RemoteFileDirectoryTest extends FileDirectoryTest { public static function getInfo() { $info = parent::getInfo(); $info['group'] = 'File API (remote)'; return $info; } function setUp() { parent::setUp('file_test'); variable_set('file_default_scheme', 'dummy-remote'); } } /** * Tests the file_scan_directory() function. */ class FileScanDirectoryTest extends FileTestCase { public static function getInfo() { return array( 'name' => 'File scan directory', 'description' => 'Tests the file_scan_directory() function.', 'group' => 'File API', ); } function setUp() { parent::setUp(); $this->path = drupal_get_path('module', 'simpletest') . '/files'; } /** * Check the format of the returned values. */ function testReturn() { // Grab a listing of all the JavaSscript files and check that they're // passed to the callback. $all_files = file_scan_directory($this->path, '/^javascript-/'); ksort($all_files); $this->assertEqual(2, count($all_files), 'Found two, expected javascript files.'); // Check the first file. $file = reset($all_files); $this->assertEqual(key($all_files), $file->uri, 'Correct array key was used for the first returned file.'); $this->assertEqual($file->uri, $this->path . '/javascript-1.txt', 'First file name was set correctly.'); $this->assertEqual($file->filename, 'javascript-1.txt', 'First basename was set correctly'); $this->assertEqual($file->name, 'javascript-1', 'First name was set correctly.'); // Check the second file. $file = next($all_files); $this->assertEqual(key($all_files), $file->uri, 'Correct array key was used for the second returned file.'); $this->assertEqual($file->uri, $this->path . '/javascript-2.script', 'Second file name was set correctly.'); $this->assertEqual($file->filename, 'javascript-2.script', 'Second basename was set correctly'); $this->assertEqual($file->name, 'javascript-2', 'Second name was set correctly.'); } /** * Check that the callback function is called correctly. */ function testOptionCallback() { // When nothing is matched nothing should be passed to the callback. $all_files = file_scan_directory($this->path, '/^NONEXISTINGFILENAME/', array('callback' => 'file_test_file_scan_callback')); $this->assertEqual(0, count($all_files), 'No files were found.'); $results = file_test_file_scan_callback(); file_test_file_scan_callback_reset(); $this->assertEqual(0, count($results), 'No files were passed to the callback.'); // Grab a listing of all the JavaSscript files and check that they're // passed to the callback. $all_files = file_scan_directory($this->path, '/^javascript-/', array('callback' => 'file_test_file_scan_callback')); $this->assertEqual(2, count($all_files), 'Found two, expected javascript files.'); $results = file_test_file_scan_callback(); file_test_file_scan_callback_reset(); $this->assertEqual(2, count($results), 'Files were passed to the callback.'); } /** * Check that the no-mask parameter is honored. */ function testOptionNoMask() { // Grab a listing of all the JavaSscript files. $all_files = file_scan_directory($this->path, '/^javascript-/'); $this->assertEqual(2, count($all_files), 'Found two, expected javascript files.'); // Now use the nomast parameter to filter out the .script file. $filtered_files = file_scan_directory($this->path, '/^javascript-/', array('nomask' => '/.script$/')); $this->assertEqual(1, count($filtered_files), 'Filtered correctly.'); } /** * Check that key parameter sets the return value's key. */ function testOptionKey() { // "filename", for the path starting with $dir. $expected = array($this->path . '/javascript-1.txt', $this->path . '/javascript-2.script'); $actual = array_keys(file_scan_directory($this->path, '/^javascript-/', array('key' => 'filepath'))); sort($actual); $this->assertEqual($expected, $actual, 'Returned the correct values for the filename key.'); // "basename", for the basename of the file. $expected = array('javascript-1.txt', 'javascript-2.script'); $actual = array_keys(file_scan_directory($this->path, '/^javascript-/', array('key' => 'filename'))); sort($actual); $this->assertEqual($expected, $actual, 'Returned the correct values for the basename key.'); // "name" for the name of the file without an extension. $expected = array('javascript-1', 'javascript-2'); $actual = array_keys(file_scan_directory($this->path, '/^javascript-/', array('key' => 'name'))); sort($actual); $this->assertEqual($expected, $actual, 'Returned the correct values for the name key.'); // Invalid option that should default back to "filename". $expected = array($this->path . '/javascript-1.txt', $this->path . '/javascript-2.script'); $actual = array_keys(file_scan_directory($this->path, '/^javascript-/', array('key' => 'INVALID'))); sort($actual); $this->assertEqual($expected, $actual, 'An invalid key defaulted back to the default.'); } /** * Check that the recurse option decends into subdirectories. */ function testOptionRecurse() { $files = file_scan_directory(drupal_get_path('module', 'simpletest'), '/^javascript-/', array('recurse' => FALSE)); $this->assertTrue(empty($files), "Without recursion couldn't find javascript files."); $files = file_scan_directory(drupal_get_path('module', 'simpletest'), '/^javascript-/', array('recurse' => TRUE)); $this->assertEqual(2, count($files), 'With recursion we found the expected javascript files.'); } /** * Check that the min_depth options lets us ignore files in the starting * directory. */ function testOptionMinDepth() { $files = file_scan_directory($this->path, '/^javascript-/', array('min_depth' => 0)); $this->assertEqual(2, count($files), 'No minimum-depth gets files in current directory.'); $files = file_scan_directory($this->path, '/^javascript-/', array('min_depth' => 1)); $this->assertTrue(empty($files), "Minimum-depth of 1 successfully excludes files from current directory."); } } /** * Tests the file_scan_directory() function on remote filesystems. */ class RemoteFileScanDirectoryTest extends FileScanDirectoryTest { public static function getInfo() { $info = parent::getInfo(); $info['group'] = 'File API (remote)'; return $info; } function setUp() { parent::setUp('file_test'); variable_set('file_default_scheme', 'dummy-remote'); } } /** * Deletion related tests. */ class FileUnmanagedDeleteTest extends FileTestCase { public static function getInfo() { return array( 'name' => 'Unmanaged file delete', 'description' => 'Tests the unmanaged file delete function.', 'group' => 'File API', ); } /** * Delete a normal file. */ function testNormal() { // Create a file for testing $file = $this->createFile(); // Delete a regular file $this->assertTrue(file_unmanaged_delete($file->uri), 'Deleted worked.'); $this->assertFalse(file_exists($file->uri), 'Test file has actually been deleted.'); } /** * Try deleting a missing file. */ function testMissing() { // Try to delete a non-existing file $this->assertTrue(file_unmanaged_delete(file_default_scheme() . '/' . $this->randomName()), 'Returns true when deleting a non-existent file.'); } /** * Try deleting a directory. */ function testDirectory() { // A directory to operate on. $directory = $this->createDirectory(); // Try to delete a directory $this->assertFalse(file_unmanaged_delete($directory), 'Could not delete the delete directory.'); $this->assertTrue(file_exists($directory), 'Directory has not been deleted.'); } } /** * Deletion related tests on remote filesystems. */ class RemoteFileUnmanagedDeleteTest extends FileUnmanagedDeleteTest { public static function getInfo() { $info = parent::getInfo(); $info['group'] = 'File API (remote)'; return $info; } function setUp() { parent::setUp('file_test'); variable_set('file_default_scheme', 'dummy-remote'); } } /** * Deletion related tests. */ class FileUnmanagedDeleteRecursiveTest extends FileTestCase { public static function getInfo() { return array( 'name' => 'Unmanaged recursive file delete', 'description' => 'Tests the unmanaged file delete recursive function.', 'group' => 'File API', ); } /** * Delete a normal file. */ function testSingleFile() { // Create a file for testing $filepath = file_default_scheme() . '://' . $this->randomName(); file_put_contents($filepath, ''); // Delete the file. $this->assertTrue(file_unmanaged_delete_recursive($filepath), 'Function reported success.'); $this->assertFalse(file_exists($filepath), 'Test file has been deleted.'); } /** * Try deleting an empty directory. */ function testEmptyDirectory() { // A directory to operate on. $directory = $this->createDirectory(); // Delete the directory. $this->assertTrue(file_unmanaged_delete_recursive($directory), 'Function reported success.'); $this->assertFalse(file_exists($directory), 'Directory has been deleted.'); } /** * Try deleting a directory with some files. */ function testDirectory() { // A directory to operate on. $directory = $this->createDirectory(); $filepathA = $directory . '/A'; $filepathB = $directory . '/B'; file_put_contents($filepathA, ''); file_put_contents($filepathB, ''); // Delete the directory. $this->assertTrue(file_unmanaged_delete_recursive($directory), 'Function reported success.'); $this->assertFalse(file_exists($filepathA), 'Test file A has been deleted.'); $this->assertFalse(file_exists($filepathB), 'Test file B has been deleted.'); $this->assertFalse(file_exists($directory), 'Directory has been deleted.'); } /** * Try deleting subdirectories with some files. */ function testSubDirectory() { // A directory to operate on. $directory = $this->createDirectory(); $subdirectory = $this->createDirectory($directory . '/sub'); $filepathA = $directory . '/A'; $filepathB = $subdirectory . '/B'; file_put_contents($filepathA, ''); file_put_contents($filepathB, ''); // Delete the directory. $this->assertTrue(file_unmanaged_delete_recursive($directory), 'Function reported success.'); $this->assertFalse(file_exists($filepathA), 'Test file A has been deleted.'); $this->assertFalse(file_exists($filepathB), 'Test file B has been deleted.'); $this->assertFalse(file_exists($subdirectory), 'Subdirectory has been deleted.'); $this->assertFalse(file_exists($directory), 'Directory has been deleted.'); } } /** * Deletion related tests on remote filesystems. */ class RemoteFileUnmanagedDeleteRecursiveTest extends FileUnmanagedDeleteRecursiveTest { public static function getInfo() { $info = parent::getInfo(); $info['group'] = 'File API (remote)'; return $info; } function setUp() { parent::setUp('file_test'); variable_set('file_default_scheme', 'dummy-remote'); } } /** * Unmanaged move related tests. */ class FileUnmanagedMoveTest extends FileTestCase { public static function getInfo() { return array( 'name' => 'Unmanaged file moving', 'description' => 'Tests the unmanaged file move function.', 'group' => 'File API', ); } /** * Move a normal file. */ function testNormal() { // Create a file for testing $file = $this->createFile(); // Moving to a new name. $desired_filepath = 'public://' . $this->randomName(); $new_filepath = file_unmanaged_move($file->uri, $desired_filepath, FILE_EXISTS_ERROR); $this->assertTrue($new_filepath, 'Move was successful.'); $this->assertEqual($new_filepath, $desired_filepath, 'Returned expected filepath.'); $this->assertTrue(file_exists($new_filepath), 'File exists at the new location.'); $this->assertFalse(file_exists($file->uri), 'No file remains at the old location.'); $this->assertFilePermissions($new_filepath, variable_get('file_chmod_file', 0664)); // Moving with rename. $desired_filepath = 'public://' . $this->randomName(); $this->assertTrue(file_exists($new_filepath), 'File exists before moving.'); $this->assertTrue(file_put_contents($desired_filepath, ' '), 'Created a file so a rename will have to happen.'); $newer_filepath = file_unmanaged_move($new_filepath, $desired_filepath, FILE_EXISTS_RENAME); $this->assertTrue($newer_filepath, 'Move was successful.'); $this->assertNotEqual($newer_filepath, $desired_filepath, 'Returned expected filepath.'); $this->assertTrue(file_exists($newer_filepath), 'File exists at the new location.'); $this->assertFalse(file_exists($new_filepath), 'No file remains at the old location.'); $this->assertFilePermissions($newer_filepath, variable_get('file_chmod_file', 0664)); // TODO: test moving to a directory (rather than full directory/file path) // TODO: test creating and moving normal files (rather than streams) } /** * Try to move a missing file. */ function testMissing() { // Move non-existent file. $new_filepath = file_unmanaged_move($this->randomName(), $this->randomName()); $this->assertFalse($new_filepath, 'Moving a missing file fails.'); } /** * Try to move a file onto itself. */ function testOverwriteSelf() { // Create a file for testing. $file = $this->createFile(); // Move the file onto itself without renaming shouldn't make changes. $new_filepath = file_unmanaged_move($file->uri, $file->uri, FILE_EXISTS_REPLACE); $this->assertFalse($new_filepath, 'Moving onto itself without renaming fails.'); $this->assertTrue(file_exists($file->uri), 'File exists after moving onto itself.'); // Move the file onto itself with renaming will result in a new filename. $new_filepath = file_unmanaged_move($file->uri, $file->uri, FILE_EXISTS_RENAME); $this->assertTrue($new_filepath, 'Moving onto itself with renaming works.'); $this->assertFalse(file_exists($file->uri), 'Original file has been removed.'); $this->assertTrue(file_exists($new_filepath), 'File exists after moving onto itself.'); } } /** * Unmanaged move related tests on remote filesystems. */ class RemoteFileUnmanagedMoveTest extends FileUnmanagedMoveTest { public static function getInfo() { $info = parent::getInfo(); $info['group'] = 'File API (remote)'; return $info; } function setUp() { parent::setUp('file_test'); variable_set('file_default_scheme', 'dummy-remote'); } } /** * Unmanaged copy related tests. */ class FileUnmanagedCopyTest extends FileTestCase { public static function getInfo() { return array( 'name' => 'Unmanaged file copying', 'description' => 'Tests the unmanaged file copy function.', 'group' => 'File API', ); } /** * Copy a normal file. */ function testNormal() { // Create a file for testing $file = $this->createFile(); // Copying to a new name. $desired_filepath = 'public://' . $this->randomName(); $new_filepath = file_unmanaged_copy($file->uri, $desired_filepath, FILE_EXISTS_ERROR); $this->assertTrue($new_filepath, 'Copy was successful.'); $this->assertEqual($new_filepath, $desired_filepath, 'Returned expected filepath.'); $this->assertTrue(file_exists($file->uri), 'Original file remains.'); $this->assertTrue(file_exists($new_filepath), 'New file exists.'); $this->assertFilePermissions($new_filepath, variable_get('file_chmod_file', 0664)); // Copying with rename. $desired_filepath = 'public://' . $this->randomName(); $this->assertTrue(file_put_contents($desired_filepath, ' '), 'Created a file so a rename will have to happen.'); $newer_filepath = file_unmanaged_copy($file->uri, $desired_filepath, FILE_EXISTS_RENAME); $this->assertTrue($newer_filepath, 'Copy was successful.'); $this->assertNotEqual($newer_filepath, $desired_filepath, 'Returned expected filepath.'); $this->assertTrue(file_exists($file->uri), 'Original file remains.'); $this->assertTrue(file_exists($newer_filepath), 'New file exists.'); $this->assertFilePermissions($newer_filepath, variable_get('file_chmod_file', 0664)); // TODO: test copying to a directory (rather than full directory/file path) // TODO: test copying normal files using normal paths (rather than only streams) } /** * Copy a non-existent file. */ function testNonExistent() { // Copy non-existent file $desired_filepath = $this->randomName(); $this->assertFalse(file_exists($desired_filepath), "Randomly named file doesn't exists."); $new_filepath = file_unmanaged_copy($desired_filepath, $this->randomName()); $this->assertFalse($new_filepath, 'Copying a missing file fails.'); } /** * Copy a file onto itself. */ function testOverwriteSelf() { // Create a file for testing $file = $this->createFile(); // Copy the file onto itself with renaming works. $new_filepath = file_unmanaged_copy($file->uri, $file->uri, FILE_EXISTS_RENAME); $this->assertTrue($new_filepath, 'Copying onto itself with renaming works.'); $this->assertNotEqual($new_filepath, $file->uri, 'Copied file has a new name.'); $this->assertTrue(file_exists($file->uri), 'Original file exists after copying onto itself.'); $this->assertTrue(file_exists($new_filepath), 'Copied file exists after copying onto itself.'); $this->assertFilePermissions($new_filepath, variable_get('file_chmod_file', 0664)); // Copy the file onto itself without renaming fails. $new_filepath = file_unmanaged_copy($file->uri, $file->uri, FILE_EXISTS_ERROR); $this->assertFalse($new_filepath, 'Copying onto itself without renaming fails.'); $this->assertTrue(file_exists($file->uri), 'File exists after copying onto itself.'); // Copy the file into same directory without renaming fails. $new_filepath = file_unmanaged_copy($file->uri, drupal_dirname($file->uri), FILE_EXISTS_ERROR); $this->assertFalse($new_filepath, 'Copying onto itself fails.'); $this->assertTrue(file_exists($file->uri), 'File exists after copying onto itself.'); // Copy the file into same directory with renaming works. $new_filepath = file_unmanaged_copy($file->uri, drupal_dirname($file->uri), FILE_EXISTS_RENAME); $this->assertTrue($new_filepath, 'Copying into same directory works.'); $this->assertNotEqual($new_filepath, $file->uri, 'Copied file has a new name.'); $this->assertTrue(file_exists($file->uri), 'Original file exists after copying onto itself.'); $this->assertTrue(file_exists($new_filepath), 'Copied file exists after copying onto itself.'); $this->assertFilePermissions($new_filepath, variable_get('file_chmod_file', 0664)); } } /** * Unmanaged copy related tests on remote filesystems. */ class RemoteFileUnmanagedCopyTest extends FileUnmanagedCopyTest { public static function getInfo() { $info = parent::getInfo(); $info['group'] = 'File API (remote)'; return $info; } function setUp() { parent::setUp('file_test'); variable_set('file_default_scheme', 'dummy-remote'); } } /** * Deletion related tests. */ class FileDeleteTest extends FileHookTestCase { public static function getInfo() { return array( 'name' => 'File delete', 'description' => 'Tests the file delete function.', 'group' => 'File API', ); } /** * Tries deleting a normal file (as opposed to a directory, symlink, etc). */ function testUnused() { $file = $this->createFile(); // Check that deletion removes the file and database record. $this->assertTrue(is_file($file->uri), 'File exists.'); $this->assertIdentical(file_delete($file), TRUE, 'Delete worked.'); $this->assertFileHooksCalled(array('delete')); $this->assertFalse(file_exists($file->uri), 'Test file has actually been deleted.'); $this->assertFalse(file_load($file->fid), 'File was removed from the database.'); } /** * Tries deleting a file that is in use. */ function testInUse() { $file = $this->createFile(); file_usage_add($file, 'testing', 'test', 1); file_usage_add($file, 'testing', 'test', 1); file_usage_delete($file, 'testing', 'test', 1); file_delete($file); $usage = file_usage_list($file); $this->assertEqual($usage['testing']['test'], array(1 => 1), 'Test file is still in use.'); $this->assertTrue(file_exists($file->uri), 'File still exists on the disk.'); $this->assertTrue(file_load($file->fid), 'File still exists in the database.'); // Clear out the call to hook_file_load(). file_test_reset(); file_usage_delete($file, 'testing', 'test', 1); file_delete($file); $usage = file_usage_list($file); $this->assertFileHooksCalled(array('delete')); $this->assertTrue(empty($usage), 'File usage data was removed.'); $this->assertFalse(file_exists($file->uri), 'File has been deleted after its last usage was removed.'); $this->assertFalse(file_load($file->fid), 'File was removed from the database.'); } } /** * Move related tests */ class FileMoveTest extends FileHookTestCase { public static function getInfo() { return array( 'name' => 'File moving', 'description' => 'Tests the file move function.', 'group' => 'File API', ); } /** * Move a normal file. */ function testNormal() { $contents = $this->randomName(10); $source = $this->createFile(NULL, $contents); $desired_filepath = 'public://' . $this->randomName(); // Clone the object so we don't have to worry about the function changing // our reference copy. $result = file_move(clone $source, $desired_filepath, FILE_EXISTS_ERROR); // Check the return status and that the contents changed. $this->assertTrue($result, 'File moved successfully.'); $this->assertFalse(file_exists($source->uri)); $this->assertEqual($contents, file_get_contents($result->uri), 'Contents of file correctly written.'); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('move', 'load', 'update')); // Make sure we got the same file back. $this->assertEqual($source->fid, $result->fid, format_string("Source file id's' %fid is unchanged after move.", array('%fid' => $source->fid))); // Reload the file from the database and check that the changes were // actually saved. $loaded_file = file_load($result->fid, TRUE); $this->assertTrue($loaded_file, 'File can be loaded from the database.'); $this->assertFileUnchanged($result, $loaded_file); } /** * Test renaming when moving onto a file that already exists. */ function testExistingRename() { // Setup a file to overwrite. $contents = $this->randomName(10); $source = $this->createFile(NULL, $contents); $target = $this->createFile(); $this->assertDifferentFile($source, $target); // Clone the object so we don't have to worry about the function changing // our reference copy. $result = file_move(clone $source, $target->uri, FILE_EXISTS_RENAME); // Check the return status and that the contents changed. $this->assertTrue($result, 'File moved successfully.'); $this->assertFalse(file_exists($source->uri)); $this->assertEqual($contents, file_get_contents($result->uri), 'Contents of file correctly written.'); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('move', 'load', 'update')); // Compare the returned value to what made it into the database. $this->assertFileUnchanged($result, file_load($result->fid, TRUE)); // The target file should not have been altered. $this->assertFileUnchanged($target, file_load($target->fid, TRUE)); // Make sure we end up with two distinct files afterwards. $this->assertDifferentFile($target, $result); // Compare the source and results. $loaded_source = file_load($source->fid, TRUE); $this->assertEqual($loaded_source->fid, $result->fid, "Returned file's id matches the source."); $this->assertNotEqual($loaded_source->uri, $source->uri, 'Returned file path has changed from the original.'); } /** * Test replacement when moving onto a file that already exists. */ function testExistingReplace() { // Setup a file to overwrite. $contents = $this->randomName(10); $source = $this->createFile(NULL, $contents); $target = $this->createFile(); $this->assertDifferentFile($source, $target); // Clone the object so we don't have to worry about the function changing // our reference copy. $result = file_move(clone $source, $target->uri, FILE_EXISTS_REPLACE); // Look at the results. $this->assertEqual($contents, file_get_contents($result->uri), 'Contents of file were overwritten.'); $this->assertFalse(file_exists($source->uri)); $this->assertTrue($result, 'File moved successfully.'); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('move', 'update', 'delete', 'load')); // Reload the file from the database and check that the changes were // actually saved. $loaded_result = file_load($result->fid, TRUE); $this->assertFileUnchanged($result, $loaded_result); // Check that target was re-used. $this->assertSameFile($target, $loaded_result); // Source and result should be totally different. $this->assertDifferentFile($source, $loaded_result); } /** * Test replacement when moving onto itself. */ function testExistingReplaceSelf() { // Setup a file to overwrite. $contents = $this->randomName(10); $source = $this->createFile(NULL, $contents); // Copy the file over itself. Clone the object so we don't have to worry // about the function changing our reference copy. $result = file_move(clone $source, $source->uri, FILE_EXISTS_REPLACE); $this->assertFalse($result, 'File move failed.'); $this->assertEqual($contents, file_get_contents($source->uri), 'Contents of file were not altered.'); // Check that no hooks were called while failing. $this->assertFileHooksCalled(array()); // Load the file from the database and make sure it is identical to what // was returned. $this->assertFileUnchanged($source, file_load($source->fid, TRUE)); } /** * Test that moving onto an existing file fails when FILE_EXISTS_ERROR is * specified. */ function testExistingError() { $contents = $this->randomName(10); $source = $this->createFile(); $target = $this->createFile(NULL, $contents); $this->assertDifferentFile($source, $target); // Clone the object so we don't have to worry about the function changing // our reference copy. $result = file_move(clone $source, $target->uri, FILE_EXISTS_ERROR); // Check the return status and that the contents did not change. $this->assertFalse($result, 'File move failed.'); $this->assertTrue(file_exists($source->uri)); $this->assertEqual($contents, file_get_contents($target->uri), 'Contents of file were not altered.'); // Check that no hooks were called while failing. $this->assertFileHooksCalled(array()); // Load the file from the database and make sure it is identical to what // was returned. $this->assertFileUnchanged($source, file_load($source->fid, TRUE)); $this->assertFileUnchanged($target, file_load($target->fid, TRUE)); } } /** * Copy related tests. */ class FileCopyTest extends FileHookTestCase { public static function getInfo() { return array( 'name' => 'File copying', 'description' => 'Tests the file copy function.', 'group' => 'File API', ); } /** * Test file copying in the normal, base case. */ function testNormal() { $contents = $this->randomName(10); $source = $this->createFile(NULL, $contents); $desired_uri = 'public://' . $this->randomName(); // Clone the object so we don't have to worry about the function changing // our reference copy. $result = file_copy(clone $source, $desired_uri, FILE_EXISTS_ERROR); // Check the return status and that the contents changed. $this->assertTrue($result, 'File copied successfully.'); $this->assertEqual($contents, file_get_contents($result->uri), 'Contents of file were copied correctly.'); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('copy', 'insert')); $this->assertDifferentFile($source, $result); $this->assertEqual($result->uri, $desired_uri, 'The copied file object has the desired filepath.'); $this->assertTrue(file_exists($source->uri), 'The original file still exists.'); $this->assertTrue(file_exists($result->uri), 'The copied file exists.'); // Reload the file from the database and check that the changes were // actually saved. $this->assertFileUnchanged($result, file_load($result->fid, TRUE)); } /** * Test renaming when copying over a file that already exists. */ function testExistingRename() { // Setup a file to overwrite. $contents = $this->randomName(10); $source = $this->createFile(NULL, $contents); $target = $this->createFile(); $this->assertDifferentFile($source, $target); // Clone the object so we don't have to worry about the function changing // our reference copy. $result = file_copy(clone $source, $target->uri, FILE_EXISTS_RENAME); // Check the return status and that the contents changed. $this->assertTrue($result, 'File copied successfully.'); $this->assertEqual($contents, file_get_contents($result->uri), 'Contents of file were copied correctly.'); $this->assertNotEqual($result->uri, $source->uri, 'Returned file path has changed from the original.'); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('copy', 'insert')); // Load all the affected files to check the changes that actually made it // to the database. $loaded_source = file_load($source->fid, TRUE); $loaded_target = file_load($target->fid, TRUE); $loaded_result = file_load($result->fid, TRUE); // Verify that the source file wasn't changed. $this->assertFileUnchanged($source, $loaded_source); // Verify that what was returned is what's in the database. $this->assertFileUnchanged($result, $loaded_result); // Make sure we end up with three distinct files afterwards. $this->assertDifferentFile($loaded_source, $loaded_target); $this->assertDifferentFile($loaded_target, $loaded_result); $this->assertDifferentFile($loaded_source, $loaded_result); } /** * Test replacement when copying over a file that already exists. */ function testExistingReplace() { // Setup a file to overwrite. $contents = $this->randomName(10); $source = $this->createFile(NULL, $contents); $target = $this->createFile(); $this->assertDifferentFile($source, $target); // Clone the object so we don't have to worry about the function changing // our reference copy. $result = file_copy(clone $source, $target->uri, FILE_EXISTS_REPLACE); // Check the return status and that the contents changed. $this->assertTrue($result, 'File copied successfully.'); $this->assertEqual($contents, file_get_contents($result->uri), 'Contents of file were overwritten.'); $this->assertDifferentFile($source, $result); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('load', 'copy', 'update')); // Load all the affected files to check the changes that actually made it // to the database. $loaded_source = file_load($source->fid, TRUE); $loaded_target = file_load($target->fid, TRUE); $loaded_result = file_load($result->fid, TRUE); // Verify that the source file wasn't changed. $this->assertFileUnchanged($source, $loaded_source); // Verify that what was returned is what's in the database. $this->assertFileUnchanged($result, $loaded_result); // Target file was reused for the result. $this->assertFileUnchanged($loaded_target, $loaded_result); } /** * Test that copying over an existing file fails when FILE_EXISTS_ERROR is * specified. */ function testExistingError() { $contents = $this->randomName(10); $source = $this->createFile(); $target = $this->createFile(NULL, $contents); $this->assertDifferentFile($source, $target); // Clone the object so we don't have to worry about the function changing // our reference copy. $result = file_copy(clone $source, $target->uri, FILE_EXISTS_ERROR); // Check the return status and that the contents were not changed. $this->assertFalse($result, 'File copy failed.'); $this->assertEqual($contents, file_get_contents($target->uri), 'Contents of file were not altered.'); // Check that the correct hooks were called. $this->assertFileHooksCalled(array()); $this->assertFileUnchanged($source, file_load($source->fid, TRUE)); $this->assertFileUnchanged($target, file_load($target->fid, TRUE)); } } /** * Tests the file_load() function. */ class FileLoadTest extends FileHookTestCase { public static function getInfo() { return array( 'name' => 'File loading', 'description' => 'Tests the file_load() function.', 'group' => 'File API', ); } /** * Try to load a non-existent file by fid. */ function testLoadMissingFid() { $this->assertFalse(file_load(-1), "Try to load an invalid fid fails."); $this->assertFileHooksCalled(array()); } /** * Try to load a non-existent file by URI. */ function testLoadMissingFilepath() { $files = file_load_multiple(array(), array('uri' => 'foobar://misc/druplicon.png')); $this->assertFalse(reset($files), "Try to load a file that doesn't exist in the database fails."); $this->assertFileHooksCalled(array()); } /** * Try to load a non-existent file by status. */ function testLoadInvalidStatus() { $files = file_load_multiple(array(), array('status' => -99)); $this->assertFalse(reset($files), "Trying to load a file with an invalid status fails."); $this->assertFileHooksCalled(array()); } /** * Load a single file and ensure that the correct values are returned. */ function testSingleValues() { // Create a new file object from scratch so we know the values. $file = $this->createFile('druplicon.txt', NULL, 'public'); $by_fid_file = file_load($file->fid); $this->assertFileHookCalled('load'); $this->assertTrue(is_object($by_fid_file), 'file_load() returned an object.'); $this->assertEqual($by_fid_file->fid, $file->fid, 'Loading by fid got the same fid.', 'File'); $this->assertEqual($by_fid_file->uri, $file->uri, 'Loading by fid got the correct filepath.', 'File'); $this->assertEqual($by_fid_file->filename, $file->filename, 'Loading by fid got the correct filename.', 'File'); $this->assertEqual($by_fid_file->filemime, $file->filemime, 'Loading by fid got the correct MIME type.', 'File'); $this->assertEqual($by_fid_file->status, $file->status, 'Loading by fid got the correct status.', 'File'); $this->assertTrue($by_fid_file->file_test['loaded'], 'file_test_file_load() was able to modify the file during load.'); } /** * This will test loading file data from the database. */ function testMultiple() { // Create a new file object. $file = $this->createFile('druplicon.txt', NULL, 'public'); // Load by path. file_test_reset(); $by_path_files = file_load_multiple(array(), array('uri' => $file->uri)); $this->assertFileHookCalled('load'); $this->assertEqual(1, count($by_path_files), 'file_load_multiple() returned an array of the correct size.'); $by_path_file = reset($by_path_files); $this->assertTrue($by_path_file->file_test['loaded'], 'file_test_file_load() was able to modify the file during load.'); $this->assertEqual($by_path_file->fid, $file->fid, 'Loading by filepath got the correct fid.', 'File'); // Load by fid. file_test_reset(); $by_fid_files = file_load_multiple(array($file->fid), array()); $this->assertFileHookCalled('load'); $this->assertEqual(1, count($by_fid_files), 'file_load_multiple() returned an array of the correct size.'); $by_fid_file = reset($by_fid_files); $this->assertTrue($by_fid_file->file_test['loaded'], 'file_test_file_load() was able to modify the file during load.'); $this->assertEqual($by_fid_file->uri, $file->uri, 'Loading by fid got the correct filepath.', 'File'); } } /** * Tests the file_save() function. */ class FileSaveTest extends FileHookTestCase { public static function getInfo() { return array( 'name' => 'File saving', 'description' => 'Tests the file_save() function.', 'group' => 'File API', ); } function testFileSave() { // Create a new file object. $file = array( 'uid' => 1, 'filename' => 'druplicon.txt', 'uri' => 'public://druplicon.txt', 'filemime' => 'text/plain', 'timestamp' => 1, 'status' => FILE_STATUS_PERMANENT, ); $file = (object) $file; file_put_contents($file->uri, 'hello world'); // Save it, inserting a new record. $saved_file = file_save($file); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('insert')); $this->assertNotNull($saved_file, 'Saving the file should give us back a file object.', 'File'); $this->assertTrue($saved_file->fid > 0, 'A new file ID is set when saving a new file to the database.', 'File'); $loaded_file = db_query('SELECT * FROM {file_managed} f WHERE f.fid = :fid', array(':fid' => $saved_file->fid))->fetch(PDO::FETCH_OBJ); $this->assertNotNull($loaded_file, 'Record exists in the database.'); $this->assertEqual($loaded_file->status, $file->status, 'Status was saved correctly.'); $this->assertEqual($saved_file->filesize, filesize($file->uri), 'File size was set correctly.', 'File'); $this->assertTrue($saved_file->timestamp > 1, 'File size was set correctly.', 'File'); // Resave the file, updating the existing record. file_test_reset(); $saved_file->status = 7; $resaved_file = file_save($saved_file); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('load', 'update')); $this->assertEqual($resaved_file->fid, $saved_file->fid, 'The file ID of an existing file is not changed when updating the database.', 'File'); $this->assertTrue($resaved_file->timestamp >= $saved_file->timestamp, "Timestamp didn't go backwards.", 'File'); $loaded_file = db_query('SELECT * FROM {file_managed} f WHERE f.fid = :fid', array(':fid' => $saved_file->fid))->fetch(PDO::FETCH_OBJ); $this->assertNotNull($loaded_file, 'Record still exists in the database.', 'File'); $this->assertEqual($loaded_file->status, $saved_file->status, 'Status was saved correctly.'); // Try to insert a second file with the same name apart from case insensitivity // to ensure the 'uri' index allows for filenames with different cases. $file = (object) array( 'uid' => 1, 'filename' => 'DRUPLICON.txt', 'uri' => 'public://DRUPLICON.txt', 'filemime' => 'text/plain', 'timestamp' => 1, 'status' => FILE_STATUS_PERMANENT, ); file_put_contents($file->uri, 'hello world'); file_save($file); } } /** * Tests file usage functions. */ class FileUsageTest extends FileTestCase { public static function getInfo() { return array( 'name' => 'File usage', 'description' => 'Tests the file usage functions.', 'group' => 'File', ); } /** * Tests file_usage_list(). */ function testGetUsage() { $file = $this->createFile(); db_insert('file_usage') ->fields(array( 'fid' => $file->fid, 'module' => 'testing', 'type' => 'foo', 'id' => 1, 'count' => 1 )) ->execute(); db_insert('file_usage') ->fields(array( 'fid' => $file->fid, 'module' => 'testing', 'type' => 'bar', 'id' => 2, 'count' => 2 )) ->execute(); $usage = file_usage_list($file); $this->assertEqual(count($usage['testing']), 2, 'Returned the correct number of items.'); $this->assertTrue(isset($usage['testing']['foo'][1]), 'Returned the correct id.'); $this->assertTrue(isset($usage['testing']['bar'][2]), 'Returned the correct id.'); $this->assertEqual($usage['testing']['foo'][1], 1, 'Returned the correct count.'); $this->assertEqual($usage['testing']['bar'][2], 2, 'Returned the correct count.'); } /** * Tests file_usage_add(). */ function testAddUsage() { $file = $this->createFile(); file_usage_add($file, 'testing', 'foo', 1); // Add the file twice to ensure that the count is incremented rather than // creating additional records. file_usage_add($file, 'testing', 'bar', 2); file_usage_add($file, 'testing', 'bar', 2); $usage = db_select('file_usage', 'f') ->fields('f') ->condition('f.fid', $file->fid) ->execute() ->fetchAllAssoc('id'); $this->assertEqual(count($usage), 2, 'Created two records'); $this->assertEqual($usage[1]->module, 'testing', 'Correct module'); $this->assertEqual($usage[2]->module, 'testing', 'Correct module'); $this->assertEqual($usage[1]->type, 'foo', 'Correct type'); $this->assertEqual($usage[2]->type, 'bar', 'Correct type'); $this->assertEqual($usage[1]->count, 1, 'Correct count'); $this->assertEqual($usage[2]->count, 2, 'Correct count'); } /** * Tests file_usage_delete(). */ function testRemoveUsage() { $file = $this->createFile(); db_insert('file_usage') ->fields(array( 'fid' => $file->fid, 'module' => 'testing', 'type' => 'bar', 'id' => 2, 'count' => 3, )) ->execute(); // Normal decrement. file_usage_delete($file, 'testing', 'bar', 2); $count = db_select('file_usage', 'f') ->fields('f', array('count')) ->condition('f.fid', $file->fid) ->execute() ->fetchField(); $this->assertEqual(2, $count, 'The count was decremented correctly.'); // Multiple decrement and removal. file_usage_delete($file, 'testing', 'bar', 2, 2); $count = db_select('file_usage', 'f') ->fields('f', array('count')) ->condition('f.fid', $file->fid) ->execute() ->fetchField(); $this->assertIdentical(FALSE, $count, 'The count was removed entirely when empty.'); // Non-existent decrement. file_usage_delete($file, 'testing', 'bar', 2); $count = db_select('file_usage', 'f') ->fields('f', array('count')) ->condition('f.fid', $file->fid) ->execute() ->fetchField(); $this->assertIdentical(FALSE, $count, 'Decrementing non-exist record complete.'); } } /** * Tests the file_validate() function.. */ class FileValidateTest extends FileHookTestCase { public static function getInfo() { return array( 'name' => 'File validate', 'description' => 'Tests the file_validate() function.', 'group' => 'File API', ); } /** * Test that the validators passed into are checked. */ function testCallerValidation() { $file = $this->createFile(); // Empty validators. $this->assertEqual(file_validate($file, array()), array(), 'Validating an empty array works successfully.'); $this->assertFileHooksCalled(array('validate')); // Use the file_test.module's test validator to ensure that passing tests // return correctly. file_test_reset(); file_test_set_return('validate', array()); $passing = array('file_test_validator' => array(array())); $this->assertEqual(file_validate($file, $passing), array(), 'Validating passes.'); $this->assertFileHooksCalled(array('validate')); // Now test for failures in validators passed in and by hook_validate. file_test_reset(); file_test_set_return('validate', array('Epic fail')); $failing = array('file_test_validator' => array(array('Failed', 'Badly'))); $this->assertEqual(file_validate($file, $failing), array('Failed', 'Badly', 'Epic fail'), 'Validating returns errors.'); $this->assertFileHooksCalled(array('validate')); } } /** * Tests the file_save_data() function. */ class FileSaveDataTest extends FileHookTestCase { public static function getInfo() { return array( 'name' => 'File save data', 'description' => 'Tests the file save data function.', 'group' => 'File API', ); } /** * Test the file_save_data() function when no filename is provided. */ function testWithoutFilename() { $contents = $this->randomName(8); $result = file_save_data($contents); $this->assertTrue($result, 'Unnamed file saved correctly.'); $this->assertEqual(file_default_scheme(), file_uri_scheme($result->uri), "File was placed in Drupal's files directory."); $this->assertEqual($result->filename, drupal_basename($result->uri), "Filename was set to the file's basename."); $this->assertEqual($contents, file_get_contents($result->uri), 'Contents of the file are correct.'); $this->assertEqual($result->filemime, 'application/octet-stream', 'A MIME type was set.'); $this->assertEqual($result->status, FILE_STATUS_PERMANENT, "The file's status was set to permanent."); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('insert')); // Verify that what was returned is what's in the database. $this->assertFileUnchanged($result, file_load($result->fid, TRUE)); } /** * Test the file_save_data() function when a filename is provided. */ function testWithFilename() { $contents = $this->randomName(8); // Using filename with non-latin characters. $filename = 'Текстовый файл.txt'; $result = file_save_data($contents, 'public://' . $filename); $this->assertTrue($result, 'Unnamed file saved correctly.'); $this->assertEqual('public', file_uri_scheme($result->uri), "File was placed in Drupal's files directory."); $this->assertEqual($filename, drupal_basename($result->uri), 'File was named correctly.'); $this->assertEqual($contents, file_get_contents($result->uri), 'Contents of the file are correct.'); $this->assertEqual($result->filemime, 'text/plain', 'A MIME type was set.'); $this->assertEqual($result->status, FILE_STATUS_PERMANENT, "The file's status was set to permanent."); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('insert')); // Verify that what was returned is what's in the database. $this->assertFileUnchanged($result, file_load($result->fid, TRUE)); } /** * Test file_save_data() when renaming around an existing file. */ function testExistingRename() { // Setup a file to overwrite. $existing = $this->createFile(); $contents = $this->randomName(8); $result = file_save_data($contents, $existing->uri, FILE_EXISTS_RENAME); $this->assertTrue($result, 'File saved successfully.'); $this->assertEqual('public', file_uri_scheme($result->uri), "File was placed in Drupal's files directory."); $this->assertEqual($result->filename, $existing->filename, 'Filename was set to the basename of the source, rather than that of the renamed file.'); $this->assertEqual($contents, file_get_contents($result->uri), 'Contents of the file are correct.'); $this->assertEqual($result->filemime, 'application/octet-stream', 'A MIME type was set.'); $this->assertEqual($result->status, FILE_STATUS_PERMANENT, "The file's status was set to permanent."); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('insert')); // Ensure that the existing file wasn't overwritten. $this->assertDifferentFile($existing, $result); $this->assertFileUnchanged($existing, file_load($existing->fid, TRUE)); // Verify that was returned is what's in the database. $this->assertFileUnchanged($result, file_load($result->fid, TRUE)); } /** * Test file_save_data() when replacing an existing file. */ function testExistingReplace() { // Setup a file to overwrite. $existing = $this->createFile(); $contents = $this->randomName(8); $result = file_save_data($contents, $existing->uri, FILE_EXISTS_REPLACE); $this->assertTrue($result, 'File saved successfully.'); $this->assertEqual('public', file_uri_scheme($result->uri), "File was placed in Drupal's files directory."); $this->assertEqual($result->filename, $existing->filename, 'Filename was set to the basename of the existing file, rather than preserving the original name.'); $this->assertEqual($contents, file_get_contents($result->uri), 'Contents of the file are correct.'); $this->assertEqual($result->filemime, 'application/octet-stream', 'A MIME type was set.'); $this->assertEqual($result->status, FILE_STATUS_PERMANENT, "The file's status was set to permanent."); // Check that the correct hooks were called. $this->assertFileHooksCalled(array('load', 'update')); // Verify that the existing file was re-used. $this->assertSameFile($existing, $result); // Verify that what was returned is what's in the database. $this->assertFileUnchanged($result, file_load($result->fid, TRUE)); } /** * Test that file_save_data() fails overwriting an existing file. */ function testExistingError() { $contents = $this->randomName(8); $existing = $this->createFile(NULL, $contents); // Check the overwrite error. $result = file_save_data('asdf', $existing->uri, FILE_EXISTS_ERROR); $this->assertFalse($result, 'Overwriting a file fails when FILE_EXISTS_ERROR is specified.'); $this->assertEqual($contents, file_get_contents($existing->uri), 'Contents of existing file were unchanged.'); // Check that no hooks were called while failing. $this->assertFileHooksCalled(array()); // Ensure that the existing file wasn't overwritten. $this->assertFileUnchanged($existing, file_load($existing->fid, TRUE)); } } /** * Tests for download/file transfer functions. */ class FileDownloadTest extends FileTestCase { public static function getInfo() { return array( 'name' => 'File download', 'description' => 'Tests for file download/transfer functions.', 'group' => 'File API', ); } function setUp() { parent::setUp('file_test'); // Clear out any hook calls. file_test_reset(); } /** * Test the public file transfer system. */ function testPublicFileTransfer() { // Test generating an URL to a created file. $file = $this->createFile(); $url = file_create_url($file->uri); // URLs can't contain characters outside the ASCII set so $filename has to be // encoded. $filename = $GLOBALS['base_url'] . '/' . file_stream_wrapper_get_instance_by_scheme('public')->getDirectoryPath() . '/' . rawurlencode($file->filename); $this->assertEqual($filename, $url, 'Correctly generated a URL for a created file.'); $this->drupalHead($url); $this->assertResponse(200, 'Confirmed that the generated URL is correct by downloading the created file.'); // Test generating an URL to a shipped file (i.e. a file that is part of // Drupal core, a module or a theme, for example a JavaScript file). $filepath = 'misc/jquery.js'; $url = file_create_url($filepath); $this->assertEqual($GLOBALS['base_url'] . '/' . $filepath, $url, 'Correctly generated a URL for a shipped file.'); $this->drupalHead($url); $this->assertResponse(200, 'Confirmed that the generated URL is correct by downloading the shipped file.'); } /** * Test the private file transfer system. */ function testPrivateFileTransfer() { // Set file downloads to private so handler functions get called. // Create a file. $contents = $this->randomName(8); $file = $this->createFile(NULL, $contents, 'private'); $url = file_create_url($file->uri); // Set file_test access header to allow the download. file_test_set_return('download', array('x-foo' => 'Bar')); $this->drupalGet($url); $headers = $this->drupalGetHeaders(); $this->assertEqual($headers['x-foo'], 'Bar', 'Found header set by file_test module on private download.'); $this->assertResponse(200, 'Correctly allowed access to a file when file_test provides headers.'); // Test that the file transferred correctly. $this->assertEqual($contents, $this->content, 'Contents of the file are correct.'); // Deny access to all downloads via a -1 header. file_test_set_return('download', -1); $this->drupalHead($url); $this->assertResponse(403, 'Correctly denied access to a file when file_test sets the header to -1.'); // Try non-existent file. $url = file_create_url('private://' . $this->randomName()); $this->drupalHead($url); $this->assertResponse(404, 'Correctly returned 404 response for a non-existent file.'); } /** * Test file_create_url(). */ function testFileCreateUrl() { global $base_url; // Tilde (~) is excluded from this test because it is encoded by // rawurlencode() in PHP 5.2 but not in PHP 5.3, as per RFC 3986. // @see http://www.php.net/manual/en/function.rawurlencode.php#86506 $basename = " -._!$'\"()*@[]?&+%#,;=:\n\x00" . // "Special" ASCII characters. "%23%25%26%2B%2F%3F" . // Characters that look like a percent-escaped string. "éøïвβ中國書۞"; // Characters from various non-ASCII alphabets. $basename_encoded = '%20-._%21%24%27%22%28%29%2A%40%5B%5D%3F%26%2B%25%23%2C%3B%3D%3A__' . '%2523%2525%2526%252B%252F%253F' . '%C3%A9%C3%B8%C3%AF%D0%B2%CE%B2%E4%B8%AD%E5%9C%8B%E6%9B%B8%DB%9E'; $this->checkUrl('public', '', $basename, $base_url . '/' . file_stream_wrapper_get_instance_by_scheme('public')->getDirectoryPath() . '/' . $basename_encoded); $this->checkUrl('private', '', $basename, $base_url . '/system/files/' . $basename_encoded); $this->checkUrl('private', '', $basename, $base_url . '/?q=system/files/' . $basename_encoded, '0'); } /** * Download a file from the URL generated by file_create_url(). * * Create a file with the specified scheme, directory and filename; check that * the URL generated by file_create_url() for the specified file equals the * specified URL; fetch the URL and then compare the contents to the file. * * @param $scheme * A scheme, e.g. "public" * @param $directory * A directory, possibly "" * @param $filename * A filename * @param $expected_url * The expected URL * @param $clean_url * The value of the clean_url setting */ private function checkUrl($scheme, $directory, $filename, $expected_url, $clean_url = '1') { variable_set('clean_url', $clean_url); // Convert $filename to a valid filename, i.e. strip characters not // supported by the filesystem, and create the file in the specified // directory. $filepath = file_create_filename($filename, $directory); $directory_uri = $scheme . '://' . dirname($filepath); file_prepare_directory($directory_uri, FILE_CREATE_DIRECTORY); $file = $this->createFile($filepath, NULL, $scheme); $url = file_create_url($file->uri); $this->assertEqual($url, $expected_url, 'Generated URL matches expected URL.'); if ($scheme == 'private') { // Tell the implementation of hook_file_download() in file_test.module // that this file may be downloaded. file_test_set_return('download', array('x-foo' => 'Bar')); } $this->drupalGet($url); if ($this->assertResponse(200) == 'pass') { $this->assertRaw(file_get_contents($file->uri), 'Contents of the file are correct.'); } file_delete($file); } } /** * Tests for file URL rewriting. */ class FileURLRewritingTest extends FileTestCase { public static function getInfo() { return array( 'name' => 'File URL rewriting', 'description' => 'Tests for file URL rewriting.', 'group' => 'File', ); } function setUp() { parent::setUp('file_test'); } /** * Test the generating of rewritten shipped file URLs. */ function testShippedFileURL() { // Test generating an URL to a shipped file (i.e. a file that is part of // Drupal core, a module or a theme, for example a JavaScript file). // Test alteration of file URLs to use a CDN. variable_set('file_test_hook_file_url_alter', 'cdn'); $filepath = 'misc/jquery.js'; $url = file_create_url($filepath); $this->assertEqual(FILE_URL_TEST_CDN_1 . '/' . $filepath, $url, 'Correctly generated a CDN URL for a shipped file.'); $filepath = 'misc/favicon.ico'; $url = file_create_url($filepath); $this->assertEqual(FILE_URL_TEST_CDN_2 . '/' . $filepath, $url, 'Correctly generated a CDN URL for a shipped file.'); // Test alteration of file URLs to use root-relative URLs. variable_set('file_test_hook_file_url_alter', 'root-relative'); $filepath = 'misc/jquery.js'; $url = file_create_url($filepath); $this->assertEqual(base_path() . '/' . $filepath, $url, 'Correctly generated a root-relative URL for a shipped file.'); $filepath = 'misc/favicon.ico'; $url = file_create_url($filepath); $this->assertEqual(base_path() . '/' . $filepath, $url, 'Correctly generated a root-relative URL for a shipped file.'); // Test alteration of file URLs to use protocol-relative URLs. variable_set('file_test_hook_file_url_alter', 'protocol-relative'); $filepath = 'misc/jquery.js'; $url = file_create_url($filepath); $this->assertEqual('/' . base_path() . '/' . $filepath, $url, 'Correctly generated a protocol-relative URL for a shipped file.'); $filepath = 'misc/favicon.ico'; $url = file_create_url($filepath); $this->assertEqual('/' . base_path() . '/' . $filepath, $url, 'Correctly generated a protocol-relative URL for a shipped file.'); } /** * Test the generating of rewritten public created file URLs. */ function testPublicCreatedFileURL() { // Test generating an URL to a created file. // Test alteration of file URLs to use a CDN. variable_set('file_test_hook_file_url_alter', 'cdn'); $file = $this->createFile(); $url = file_create_url($file->uri); $public_directory_path = file_stream_wrapper_get_instance_by_scheme('public')->getDirectoryPath(); $this->assertEqual(FILE_URL_TEST_CDN_2 . '/' . $public_directory_path . '/' . $file->filename, $url, 'Correctly generated a CDN URL for a created file.'); // Test alteration of file URLs to use root-relative URLs. variable_set('file_test_hook_file_url_alter', 'root-relative'); $file = $this->createFile(); $url = file_create_url($file->uri); $this->assertEqual(base_path() . '/' . $public_directory_path . '/' . $file->filename, $url, 'Correctly generated a root-relative URL for a created file.'); // Test alteration of file URLs to use a protocol-relative URLs. variable_set('file_test_hook_file_url_alter', 'protocol-relative'); $file = $this->createFile(); $url = file_create_url($file->uri); $this->assertEqual('/' . base_path() . '/' . $public_directory_path . '/' . $file->filename, $url, 'Correctly generated a protocol-relative URL for a created file.'); } } /** * Tests for file_munge_filename() and file_unmunge_filename(). */ class FileNameMungingTest extends FileTestCase { public static function getInfo() { return array( 'name' => 'File naming', 'description' => 'Test filename munging and unmunging.', 'group' => 'File API', ); } function setUp() { parent::setUp(); $this->bad_extension = 'php'; $this->name = $this->randomName() . '.' . $this->bad_extension . '.txt'; $this->name_with_uc_ext = $this->randomName() . '.' . strtoupper($this->bad_extension) . '.txt'; } /** * Create a file and munge/unmunge the name. */ function testMunging() { // Disable insecure uploads. variable_set('allow_insecure_uploads', 0); $munged_name = file_munge_filename($this->name, '', TRUE); $messages = drupal_get_messages(); $this->assertTrue(in_array(t('For security reasons, your upload has been renamed to %filename.', array('%filename' => $munged_name)), $messages['status']), 'Alert properly set when a file is renamed.'); $this->assertNotEqual($munged_name, $this->name, format_string('The new filename (%munged) has been modified from the original (%original)', array('%munged' => $munged_name, '%original' => $this->name))); } /** * Tests munging with a null byte in the filename. */ function testMungeNullByte() { $prefix = $this->randomName(); $filename = $prefix . '.' . $this->bad_extension . "\0.txt"; $this->assertEqual(file_munge_filename($filename, ''), $prefix . '.' . $this->bad_extension . '_.txt', 'A filename with a null byte is correctly munged to remove the null byte.'); } /** * If the allow_insecure_uploads variable evaluates to true, the file should * come out untouched, no matter how evil the filename. */ function testMungeIgnoreInsecure() { variable_set('allow_insecure_uploads', 1); $munged_name = file_munge_filename($this->name, ''); $this->assertIdentical($munged_name, $this->name, format_string('The original filename (%original) matches the munged filename (%munged) when insecure uploads are enabled.', array('%munged' => $munged_name, '%original' => $this->name))); } /** * White listed extensions are ignored by file_munge_filename(). */ function testMungeIgnoreWhitelisted() { // Declare our extension as whitelisted. The declared extensions should // be case insensitive so test using one with a different case. $munged_name = file_munge_filename($this->name_with_uc_ext, $this->bad_extension); $this->assertIdentical($munged_name, $this->name_with_uc_ext, format_string('The new filename (%munged) matches the original (%original) once the extension has been whitelisted.', array('%munged' => $munged_name, '%original' => $this->name_with_uc_ext))); // The allowed extensions should also be normalized. $munged_name = file_munge_filename($this->name, strtoupper($this->bad_extension)); $this->assertIdentical($munged_name, $this->name, format_string('The new filename (%munged) matches the original (%original) also when the whitelisted extension is in uppercase.', array('%munged' => $munged_name, '%original' => $this->name))); } /** * Ensure that unmunge gets your name back. */ function testUnMunge() { $munged_name = file_munge_filename($this->name, '', FALSE); $unmunged_name = file_unmunge_filename($munged_name); $this->assertIdentical($unmunged_name, $this->name, format_string('The unmunged (%unmunged) filename matches the original (%original)', array('%unmunged' => $unmunged_name, '%original' => $this->name))); } } /** * Tests for file_get_mimetype(). */ class FileMimeTypeTest extends DrupalWebTestCase { function setUp() { parent::setUp('file_test'); } public static function getInfo() { return array( 'name' => 'File mimetypes', 'description' => 'Test filename mimetype detection.', 'group' => 'File API', ); } /** * Test mapping of mimetypes from filenames. */ public function testFileMimeTypeDetection() { $prefix = 'public://'; $test_case = array( 'test.jar' => 'application/java-archive', 'test.jpeg' => 'image/jpeg', 'test.JPEG' => 'image/jpeg', 'test.jpg' => 'image/jpeg', 'test.jar.jpg' => 'image/jpeg', 'test.jpg.jar' => 'application/java-archive', 'test.pcf.Z' => 'application/x-font', 'pcf.z' => 'application/octet-stream', 'jar' => 'application/octet-stream', 'some.junk' => 'application/octet-stream', 'foo.file_test_1' => 'madeup/file_test_1', 'foo.file_test_2' => 'madeup/file_test_2', 'foo.doc' => 'madeup/doc', 'test.ogg' => 'audio/ogg', ); // Test using default mappings. foreach ($test_case as $input => $expected) { // Test stream [URI]. $output = file_get_mimetype($prefix . $input); $this->assertIdentical($output, $expected, format_string('Mimetype for %input is %output (expected: %expected).', array('%input' => $input, '%output' => $output, '%expected' => $expected))); // Test normal path equivalent $output = file_get_mimetype($input); $this->assertIdentical($output, $expected, format_string('Mimetype (using default mappings) for %input is %output (expected: %expected).', array('%input' => $input, '%output' => $output, '%expected' => $expected))); } // Now test passing in the map. $mapping = array( 'mimetypes' => array( 0 => 'application/java-archive', 1 => 'image/jpeg', ), 'extensions' => array( 'jar' => 0, 'jpg' => 1, ) ); $test_case = array( 'test.jar' => 'application/java-archive', 'test.jpeg' => 'application/octet-stream', 'test.jpg' => 'image/jpeg', 'test.jar.jpg' => 'image/jpeg', 'test.jpg.jar' => 'application/java-archive', 'test.pcf.z' => 'application/octet-stream', 'pcf.z' => 'application/octet-stream', 'jar' => 'application/octet-stream', 'some.junk' => 'application/octet-stream', 'foo.file_test_1' => 'application/octet-stream', 'foo.file_test_2' => 'application/octet-stream', 'foo.doc' => 'application/octet-stream', 'test.ogg' => 'application/octet-stream', ); foreach ($test_case as $input => $expected) { $output = file_get_mimetype($input, $mapping); $this->assertIdentical($output, $expected, format_string('Mimetype (using passed-in mappings) for %input is %output (expected: %expected).', array('%input' => $input, '%output' => $output, '%expected' => $expected))); } } } /** * Tests stream wrapper functions. */ class StreamWrapperTest extends DrupalWebTestCase { protected $scheme = 'dummy'; protected $classname = 'DrupalDummyStreamWrapper'; public static function getInfo() { return array( 'name' => 'Stream wrappers', 'description' => 'Tests stream wrapper functions.', 'group' => 'File API', ); } function setUp() { parent::setUp('file_test'); drupal_static_reset('file_get_stream_wrappers'); } function tearDown() { parent::tearDown(); stream_wrapper_unregister($this->scheme); } /** * Test the getClassName() function. */ function testGetClassName() { // Check the dummy scheme. $this->assertEqual($this->classname, file_stream_wrapper_get_class($this->scheme), 'Got correct class name for dummy scheme.'); // Check core's scheme. $this->assertEqual('DrupalPublicStreamWrapper', file_stream_wrapper_get_class('public'), 'Got correct class name for public scheme.'); } /** * Test the file_stream_wrapper_get_instance_by_scheme() function. */ function testGetInstanceByScheme() { $instance = file_stream_wrapper_get_instance_by_scheme($this->scheme); $this->assertEqual($this->classname, get_class($instance), 'Got correct class type for dummy scheme.'); $instance = file_stream_wrapper_get_instance_by_scheme('public'); $this->assertEqual('DrupalPublicStreamWrapper', get_class($instance), 'Got correct class type for public scheme.'); } /** * Test the URI and target functions. */ function testUriFunctions() { $instance = file_stream_wrapper_get_instance_by_uri($this->scheme . '://foo'); $this->assertEqual($this->classname, get_class($instance), 'Got correct class type for dummy URI.'); $instance = file_stream_wrapper_get_instance_by_uri('public://foo'); $this->assertEqual('DrupalPublicStreamWrapper', get_class($instance), 'Got correct class type for public URI.'); // Test file_uri_target(). $this->assertEqual(file_uri_target('public://foo/bar.txt'), 'foo/bar.txt', 'Got a valid stream target from public://foo/bar.txt.'); $this->assertFalse(file_uri_target('foo/bar.txt'), 'foo/bar.txt is not a valid stream.'); // Test file_build_uri() and DrupalLocalStreamWrapper::getDirectoryPath(). $this->assertEqual(file_build_uri('foo/bar.txt'), 'public://foo/bar.txt', 'Expected scheme was added.'); $this->assertEqual(file_stream_wrapper_get_instance_by_scheme('public')->getDirectoryPath(), variable_get('file_public_path'), 'Expected default directory path was returned.'); $this->assertEqual(file_stream_wrapper_get_instance_by_scheme('temporary')->getDirectoryPath(), variable_get('file_temporary_path'), 'Expected temporary directory path was returned.'); variable_set('file_default_scheme', 'private'); $this->assertEqual(file_build_uri('foo/bar.txt'), 'private://foo/bar.txt', 'Got a valid URI from foo/bar.txt.'); } /** * Test the scheme functions. */ function testGetValidStreamScheme() { $this->assertEqual('foo', file_uri_scheme('foo://pork//chops'), 'Got the correct scheme from foo://asdf'); $this->assertTrue(file_stream_wrapper_valid_scheme(file_uri_scheme('public://asdf')), 'Got a valid stream scheme from public://asdf'); $this->assertFalse(file_stream_wrapper_valid_scheme(file_uri_scheme('foo://asdf')), 'Did not get a valid stream scheme from foo://asdf'); } } drupal-7.41/modules/simpletest/tests/pager.test0000644000000000000000000001256112611765734020455 0ustar rootroot 'Pager functionality', 'description' => 'Tests pager functionality.', 'group' => 'Pager', ); } function setUp() { parent::setUp(array('dblog')); // Insert 300 log messages. for ($i = 0; $i < 300; $i++) { watchdog('pager_test', $this->randomString(), NULL, WATCHDOG_DEBUG); } $this->admin_user = $this->drupalCreateUser(array( 'access site reports', )); $this->drupalLogin($this->admin_user); } /** * Tests markup and CSS classes of pager links. */ function testActiveClass() { // Verify first page. $this->drupalGet('admin/reports/dblog'); $current_page = 0; $this->assertPagerItems($current_page); // Verify any page but first/last. $current_page++; $this->drupalGet('admin/reports/dblog', array('query' => array('page' => $current_page))); $this->assertPagerItems($current_page); // Verify last page. $elements = $this->xpath('//li[contains(@class, :class)]/a', array(':class' => 'pager-last')); preg_match('@page=(\d+)@', $elements[0]['href'], $matches); $current_page = (int) $matches[1]; $this->drupalGet($GLOBALS['base_root'] . $elements[0]['href'], array('external' => TRUE)); $this->assertPagerItems($current_page); } /** * Asserts pager items and links. * * @param int $current_page * The current pager page the internal browser is on. */ protected function assertPagerItems($current_page) { $elements = $this->xpath('//ul[@class=:class]/li', array(':class' => 'pager')); $this->assertTrue(!empty($elements), 'Pager found.'); // Make current page 1-based. $current_page++; // Extract first/previous and next/last items. // first/previous only exist, if the current page is not the first. if ($current_page > 1) { $first = array_shift($elements); $previous = array_shift($elements); } // next/last always exist, unless the current page is the last. if ($current_page != count($elements)) { $last = array_pop($elements); $next = array_pop($elements); } // Verify items and links to pages. foreach ($elements as $page => $element) { // Make item/page index 1-based. $page++; if ($current_page == $page) { $this->assertClass($element, 'pager-current', 'Item for current page has .pager-current class.'); $this->assertFalse(isset($element->a), 'Item for current page has no link.'); } else { $this->assertNoClass($element, 'pager-current', "Item for page $page has no .pager-current class."); $this->assertClass($element, 'pager-item', "Item for page $page has .pager-item class."); $this->assertTrue($element->a, "Link to page $page found."); $this->assertNoClass($element->a, 'active', "Link to page $page is not active."); } unset($elements[--$page]); } // Verify that no other items remain untested. $this->assertTrue(empty($elements), 'All expected items found.'); // Verify first/previous and next/last items and links. if (isset($first)) { $this->assertClass($first, 'pager-first', 'Item for first page has .pager-first class.'); $this->assertTrue($first->a, 'Link to first page found.'); $this->assertNoClass($first->a, 'active', 'Link to first page is not active.'); } if (isset($previous)) { $this->assertClass($previous, 'pager-previous', 'Item for first page has .pager-previous class.'); $this->assertTrue($previous->a, 'Link to previous page found.'); $this->assertNoClass($previous->a, 'active', 'Link to previous page is not active.'); } if (isset($next)) { $this->assertClass($next, 'pager-next', 'Item for next page has .pager-next class.'); $this->assertTrue($next->a, 'Link to next page found.'); $this->assertNoClass($next->a, 'active', 'Link to next page is not active.'); } if (isset($last)) { $this->assertClass($last, 'pager-last', 'Item for last page has .pager-last class.'); $this->assertTrue($last->a, 'Link to last page found.'); $this->assertNoClass($last->a, 'active', 'Link to last page is not active.'); } } /** * Asserts that an element has a given class. * * @param SimpleXMLElement $element * The element to test. * @param string $class * The class to assert. * @param string $message * (optional) A verbose message to output. */ protected function assertClass(SimpleXMLElement $element, $class, $message = NULL) { if (!isset($message)) { $message = "Class .$class found."; } $this->assertTrue(strpos($element['class'], $class) !== FALSE, $message); } /** * Asserts that an element does not have a given class. * * @param SimpleXMLElement $element * The element to test. * @param string $class * The class to assert. * @param string $message * (optional) A verbose message to output. */ protected function assertNoClass(SimpleXMLElement $element, $class, $message = NULL) { if (!isset($message)) { $message = "Class .$class not found."; } $this->assertTrue(strpos($element['class'], $class) === FALSE, $message); } } drupal-7.41/modules/simpletest/tests/themes/0000755000000000000000000000000012611765734017736 5ustar rootrootdrupal-7.41/modules/simpletest/tests/themes/test_subtheme/0000755000000000000000000000000012611765734022611 5ustar rootrootdrupal-7.41/modules/simpletest/tests/themes/test_subtheme/test_subtheme.info0000644000000000000000000000050412611767501026332 0ustar rootrootname = Theme test subtheme description = Test theme which uses test_basetheme as the base theme. core = 7.x base theme = test_basetheme hidden = TRUE settings[subtheme_override] = subtheme value ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/themes/test_basetheme/0000755000000000000000000000000012611765734022732 5ustar rootrootdrupal-7.41/modules/simpletest/tests/themes/test_basetheme/test_basetheme.info0000644000000000000000000000054012611767501026574 0ustar rootrootname = Theme test base theme description = Test theme which acts as a base theme for other test subthemes. core = 7.x hidden = TRUE settings[basetheme_only] = base theme value settings[subtheme_override] = base theme value ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/themes/test_theme/0000755000000000000000000000000012611765734022077 5ustar rootrootdrupal-7.41/modules/simpletest/tests/themes/test_theme/test_theme.info0000644000000000000000000000202712611767501025110 0ustar rootrootname = Test theme description = Theme for testing the theme system core = 7.x hidden = TRUE ; Normally, themes may list CSS files like this, and if they exist in the theme ; folder, then they get added to the page. If they have the same file name as a ; module CSS file, then the theme's version overrides the module's version, so ; that the module's version is not added to the page. Additionally, a theme may ; have an entry like this one, without having the corresponding CSS file in the ; theme's folder, and in this case, it just stops the module's version from ; being loaded, and does not replace it with an alternate version. We have this ; here in order for a test to ensure that this correctly prevents the module ; version from being loaded, and that errors aren't caused by the lack of this ; file within the theme folder. stylesheets[all][] = system.base.css settings[theme_test_setting] = default value ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/themes/test_theme/templates/0000755000000000000000000000000012611765734024075 5ustar rootrootdrupal-7.41/modules/simpletest/tests/themes/test_theme/templates/node--1.tpl.php0000644000000000000000000000007712611765734026550 0ustar rootroot Node Content Dummy drupal-7.41/modules/simpletest/tests/themes/test_theme/template.php0000644000000000000000000000110512611765734024420 0ustar rootroot $value) { $_SERVER[$key] = str_replace('modules/simpletest/tests/http.php', 'index.php', $value); $_SERVER[$key] = str_replace('https://', 'http://', $_SERVER[$key]); } // Change current directory to the Drupal root. chdir('../../..'); define('DRUPAL_ROOT', getcwd()); require_once DRUPAL_ROOT . '/includes/bootstrap.inc'; // Make sure this file can only be used by simpletest. drupal_bootstrap(DRUPAL_BOOTSTRAP_CONFIGURATION); if (!drupal_valid_test_ua()) { header($_SERVER['SERVER_PROTOCOL'] . ' 403 Forbidden'); exit; } drupal_bootstrap(DRUPAL_BOOTSTRAP_FULL); menu_execute_active_handler(); drupal-7.41/modules/simpletest/tests/boot_test_1.module0000644000000000000000000000104612611765734022103 0ustar rootroot 'Dummy table to test the behavior of hook_schema() during module installation.', 'fields' => array( 'data' => array( 'type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => '', 'description' => 'An example data column for the module.', ), ), ); return $schema; } /** * Implements hook_install(). */ function module_test_install() { $record = array('data' => 'Data inserted in hook_install()'); drupal_write_record('module_test', $record); } /** * Implements hook_enable(). */ function module_test_enable() { $record = array('data' => 'Data inserted in hook_enable()'); drupal_write_record('module_test', $record); } drupal-7.41/modules/simpletest/tests/update_test_2.info0000644000000000000000000000040512611767501022061 0ustar rootrootname = "Update test" description = "Support module for update testing." package = Testing version = VERSION core = 7.x hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/database_test.module0000644000000000000000000001501012611765734022460 0ustar rootroothasTag('database_test_alter_add_range')) { $query->range(0, 2); } if ($query->hasTag('database_test_alter_add_join')) { $people_alias = $query->join('test', 'people', "test_task.pid = %alias.id"); $name_field = $query->addField($people_alias, 'name', 'name'); $query->condition($people_alias . '.id', 2); } if ($query->hasTag('database_test_alter_change_conditional')) { $conditions =& $query->conditions(); $conditions[0]['value'] = 2; } if ($query->hasTag('database_test_alter_change_fields')) { $fields =& $query->getFields(); unset($fields['age']); } if ($query->hasTag('database_test_alter_change_expressions')) { $expressions =& $query->getExpressions(); $expressions['double_age']['expression'] = 'age*3'; } } /** * Implements hook_query_TAG_alter(). * * Called by DatabaseTestCase::testAlterRemoveRange. */ function database_test_query_database_test_alter_remove_range_alter(QueryAlterableInterface $query) { $query->range(); } /** * Implements hook_menu(). */ function database_test_menu() { $items['database_test/db_query_temporary'] = array( 'access callback' => TRUE, 'page callback' => 'database_test_db_query_temporary', ); $items['database_test/pager_query_even'] = array( 'access callback' => TRUE, 'page callback' => 'database_test_even_pager_query', ); $items['database_test/pager_query_odd'] = array( 'access callback' => TRUE, 'page callback' => 'database_test_odd_pager_query', ); $items['database_test/tablesort'] = array( 'access callback' => TRUE, 'page callback' => 'database_test_tablesort', ); $items['database_test/tablesort_first'] = array( 'access callback' => TRUE, 'page callback' => 'database_test_tablesort_first', ); $items['database_test/tablesort_default_sort'] = array( 'access callback' => TRUE, 'page callback' => 'drupal_get_form', 'page arguments' => array('database_test_theme_tablesort'), ); return $items; } /** * Run a db_query_temporary and output the table name and its number of rows. * * We need to test that the table created is temporary, so we run it here, in a * separate menu callback request; After this request is done, the temporary * table should automatically dropped. */ function database_test_db_query_temporary() { $table_name = db_query_temporary('SELECT status FROM {system}', array()); drupal_json_output(array( 'table_name' => $table_name, 'row_count' => db_select($table_name)->countQuery()->execute()->fetchField(), )); exit; } /** * Run a pager query and return the results. * * This function does care about the page GET parameter, as set by the * simpletest HTTP call. */ function database_test_even_pager_query($limit) { $query = db_select('test', 't'); $query ->fields('t', array('name')) ->orderBy('age'); // This should result in 2 pages of results. $query = $query->extend('PagerDefault')->limit($limit); $names = $query->execute()->fetchCol(); drupal_json_output(array( 'names' => $names, )); exit; } /** * Run a pager query and return the results. * * This function does care about the page GET parameter, as set by the * simpletest HTTP call. */ function database_test_odd_pager_query($limit) { $query = db_select('test_task', 't'); $query ->fields('t', array('task')) ->orderBy('pid'); // This should result in 4 pages of results. $query = $query->extend('PagerDefault')->limit($limit); $names = $query->execute()->fetchCol(); drupal_json_output(array( 'names' => $names, )); exit; } /** * Run a tablesort query and return the results. * * This function does care about the page GET parameter, as set by the * simpletest HTTP call. */ function database_test_tablesort() { $header = array( 'tid' => array('data' => t('Task ID'), 'field' => 'tid', 'sort' => 'desc'), 'pid' => array('data' => t('Person ID'), 'field' => 'pid'), 'task' => array('data' => t('Task'), 'field' => 'task'), 'priority' => array('data' => t('Priority'), 'field' => 'priority', ), ); $query = db_select('test_task', 't'); $query ->fields('t', array('tid', 'pid', 'task', 'priority')); $query = $query->extend('TableSort')->orderByHeader($header); // We need all the results at once to check the sort. $tasks = $query->execute()->fetchAll(); drupal_json_output(array( 'tasks' => $tasks, )); exit; } /** * Run a tablesort query with a second order_by after and return the results. * * This function does care about the page GET parameter, as set by the * simpletest HTTP call. */ function database_test_tablesort_first() { $header = array( 'tid' => array('data' => t('Task ID'), 'field' => 'tid', 'sort' => 'desc'), 'pid' => array('data' => t('Person ID'), 'field' => 'pid'), 'task' => array('data' => t('Task'), 'field' => 'task'), 'priority' => array('data' => t('Priority'), 'field' => 'priority', ), ); $query = db_select('test_task', 't'); $query ->fields('t', array('tid', 'pid', 'task', 'priority')); $query = $query->extend('TableSort')->orderByHeader($header)->orderBy('priority'); // We need all the results at once to check the sort. $tasks = $query->execute()->fetchAll(); drupal_json_output(array( 'tasks' => $tasks, )); exit; } /** * Output a form without setting a header sort. */ function database_test_theme_tablesort($form, &$form_state) { $header = array( 'username' => array('data' => t('Username'), 'field' => 'u.name'), 'status' => array('data' => t('Status'), 'field' => 'u.status'), ); $query = db_select('users', 'u'); $query->condition('u.uid', 0, '<>'); user_build_filter_query($query); $count_query = clone $query; $count_query->addExpression('COUNT(u.uid)'); $query = $query->extend('PagerDefault')->extend('TableSort'); $query ->fields('u', array('uid', 'name', 'status', 'created', 'access')) ->limit(50) ->orderByHeader($header) ->setCountQuery($count_query); $result = $query->execute(); $options = array(); $status = array(t('blocked'), t('active')); $accounts = array(); foreach ($result as $account) { $options[$account->uid] = array( 'username' => check_plain($account->name), 'status' => $status[$account->status], ); } $form['accounts'] = array( '#type' => 'tableselect', '#header' => $header, '#options' => $options, '#empty' => t('No people available.'), ); return $form; } drupal-7.41/modules/simpletest/tests/form_test.module0000644000000000000000000016322612611765734021674 0ustar rootroot 'Form altering test', 'page callback' => 'drupal_get_form', 'page arguments' => array('form_test_alter_form'), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['form-test/validate'] = array( 'title' => 'Form validation handlers test', 'page callback' => 'drupal_get_form', 'page arguments' => array('form_test_validate_form'), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['form-test/validate-required'] = array( 'title' => 'Form #required validation', 'page callback' => 'drupal_get_form', 'page arguments' => array('form_test_validate_required_form'), 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['form-test/validate-required-no-title'] = array( 'title' => 'Form #required validation without #title', 'page callback' => 'drupal_get_form', 'page arguments' => array('form_test_validate_required_form_no_title'), 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['form-test/limit-validation-errors'] = array( 'title' => 'Form validation with some error suppression', 'page callback' => 'drupal_get_form', 'page arguments' => array('form_test_limit_validation_errors_form'), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['form_test/tableselect/multiple-true'] = array( 'title' => 'Tableselect checkboxes test', 'page callback' => 'drupal_get_form', 'page arguments' => array('_form_test_tableselect_multiple_true_form'), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['form_test/tableselect/multiple-false'] = array( 'title' => 'Tableselect radio button test', 'page callback' => 'drupal_get_form', 'page arguments' => array('_form_test_tableselect_multiple_false_form'), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['form_test/tableselect/empty-text'] = array( 'title' => 'Tableselect empty text test', 'page callback' => 'drupal_get_form', 'page arguments' => array('_form_test_tableselect_empty_form'), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['form_test/tableselect/advanced-select'] = array( 'title' => 'Tableselect js_select tests', 'page callback' => 'drupal_get_form', 'page arguments' => array('_form_test_tableselect_js_select_form'), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['form_test/vertical-tabs'] = array( 'title' => 'Vertical tabs tests', 'page callback' => 'drupal_get_form', 'page arguments' => array('_form_test_vertical_tabs_form'), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['form_test/form-storage'] = array( 'title' => 'Form storage test', 'page callback' => 'drupal_get_form', 'page arguments' => array('form_test_storage_form'), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['form_test/form-storage-legacy'] = array( 'title' => 'Emulate legacy AHAH-style ajax callback', 'page callback' => 'form_test_storage_legacy_handler', 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['form_test/form-storage-page-cache'] = array( 'title' => 'Form storage with page cache test', 'page callback' => 'drupal_get_form', 'page arguments' => array('form_test_storage_page_cache_form'), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['form_test/wrapper-callback'] = array( 'title' => 'Form wrapper callback test', 'page callback' => 'form_test_wrapper_callback', 'page arguments' => array('form_test_wrapper_callback_form'), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['form_test/form-state-values-clean'] = array( 'title' => 'Form state values clearance test', 'page callback' => 'drupal_get_form', 'page arguments' => array('form_test_form_state_values_clean_form'), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['form_test/form-state-values-clean-advanced'] = array( 'title' => 'Form state values clearance advanced test', 'page callback' => 'drupal_get_form', 'page arguments' => array('form_test_form_state_values_clean_advanced_form'), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['form-test/checkbox'] = array( 'title' => t('Form test'), 'page callback' => 'drupal_get_form', 'page arguments' => array('_form_test_checkbox'), 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['form-test/select'] = array( 'title' => t('Select'), 'page callback' => 'drupal_get_form', 'page arguments' => array('form_test_select'), 'access callback' => TRUE, ); $items['form-test/checkboxes-radios'] = array( 'title' => t('Checkboxes, Radios'), 'page callback' => 'drupal_get_form', 'page arguments' => array('form_test_checkboxes_radios'), 'access callback' => TRUE, ); $items['form-test/disabled-elements'] = array( 'title' => t('Form test'), 'page callback' => 'drupal_get_form', 'page arguments' => array('_form_test_disabled_elements'), 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['form-test/input-forgery'] = array( 'title' => t('Form test'), 'page callback' => 'drupal_get_form', 'page arguments' => array('_form_test_input_forgery'), 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['form-test/form-rebuild-preserve-values'] = array( 'title' => 'Form values preservation during rebuild test', 'page callback' => 'drupal_get_form', 'page arguments' => array('form_test_form_rebuild_preserve_values_form'), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['form-test/redirect'] = array( 'title' => 'Redirect test', 'page callback' => 'drupal_get_form', 'page arguments' => array('form_test_redirect'), 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['form_test/form-labels'] = array( 'title' => 'Form label test', 'page callback' => 'drupal_get_form', 'page arguments' => array('form_label_test_form'), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['form-test/state-persist'] = array( 'title' => 'Form state persistence without storage', 'page callback' => 'drupal_get_form', 'page arguments' => array('form_test_state_persist'), 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['form-test/clicked-button'] = array( 'title' => 'Clicked button test', 'page callback' => 'drupal_get_form', 'page arguments' => array('form_test_clicked_button'), 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); if (module_exists('node')) { $items['form-test/two-instances-of-same-form'] = array( 'title' => 'AJAX test with two form instances', 'page callback' => 'form_test_two_instances', 'access callback' => 'node_access', 'access arguments' => array('create', 'page'), 'file path' => drupal_get_path('module', 'node'), 'file' => 'node.pages.inc', 'type' => MENU_CALLBACK, ); } $items['form-test/double-form'] = array( 'title' => 'Double form test', 'page callback' => 'form_test_double_form', 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['form-test/load-include-menu'] = array( 'title' => 'FAPI test loading includes', 'page callback' => 'drupal_get_form', 'page arguments' => array('form_test_load_include_menu'), 'access callback' => TRUE, 'file' => 'form_test.file.inc', 'type' => MENU_CALLBACK, ); $items['form-test/load-include-custom'] = array( 'title' => 'FAPI test loading includes', 'page callback' => 'drupal_get_form', 'page arguments' => array('form_test_load_include_custom'), 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['form-test/checkboxes-zero'] = array( 'title' => 'FAPI test involving checkboxes and zero', 'page callback' => 'drupal_get_form', 'page arguments' => array('form_test_checkboxes_zero'), 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); return $items; } /** * Form submit handler to return form values as JSON. */ function _form_test_submit_values_json($form, &$form_state) { drupal_json_output($form_state['values']); drupal_exit(); } /** * Form builder for testing hook_form_alter() and hook_form_FORM_ID_alter(). */ function form_test_alter_form($form, &$form_state) { // Elements can be added as needed for future testing needs, but for now, // we're only testing alter hooks that do not require any elements added by // this function. return $form; } /** * Implements hook_form_FORM_ID_alter() on behalf of block.module. */ function block_form_form_test_alter_form_alter(&$form, &$form_state) { drupal_set_message('block_form_form_test_alter_form_alter() executed.'); } /** * Implements hook_form_alter(). */ function form_test_form_alter(&$form, &$form_state, $form_id) { if ($form_id == 'form_test_alter_form') { drupal_set_message('form_test_form_alter() executed.'); } } /** * Implements hook_form_FORM_ID_alter(). */ function form_test_form_form_test_alter_form_alter(&$form, &$form_state) { drupal_set_message('form_test_form_form_test_alter_form_alter() executed.'); } /** * Implements hook_form_FORM_ID_alter() on behalf of system.module. */ function system_form_form_test_alter_form_alter(&$form, &$form_state) { drupal_set_message('system_form_form_test_alter_form_alter() executed.'); } /** * Form builder for testing drupal_validate_form(). * * Serves for testing form processing and alterations by form validation * handlers, especially for the case of a validation error: * - form_set_value() should be able to alter submitted values in * $form_state['values'] without affecting the form element. * - #element_validate handlers should be able to alter the $element in the form * structure and the alterations should be contained in the rebuilt form. * - #validate handlers should be able to alter the $form and the alterations * should be contained in the rebuilt form. */ function form_test_validate_form($form, &$form_state) { $form['name'] = array( '#type' => 'textfield', '#title' => 'Name', '#default_value' => '', '#element_validate' => array('form_test_element_validate_name'), ); $form['submit'] = array( '#type' => 'submit', '#value' => 'Save', ); // To simplify this test, enable form caching and use form storage to // remember our alteration. $form_state['cache'] = TRUE; return $form; } /** * Form element validation handler for 'name' in form_test_validate_form(). */ function form_test_element_validate_name(&$element, &$form_state) { $triggered = FALSE; if ($form_state['values']['name'] == 'element_validate') { // Alter the form element. $element['#value'] = '#value changed by #element_validate'; // Alter the submitted value in $form_state. form_set_value($element, 'value changed by form_set_value() in #element_validate', $form_state); $triggered = TRUE; } if ($form_state['values']['name'] == 'element_validate_access') { $form_state['storage']['form_test_name'] = $form_state['values']['name']; // Alter the form element. $element['#access'] = FALSE; $triggered = TRUE; } elseif (!empty($form_state['storage']['form_test_name'])) { // To simplify this test, just take over the element's value into $form_state. form_set_value($element, $form_state['storage']['form_test_name'], $form_state); $triggered = TRUE; } if ($triggered) { // Output the element's value from $form_state. drupal_set_message(t('@label value: @value', array('@label' => $element['#title'], '@value' => $form_state['values']['name']))); // Trigger a form validation error to see our changes. form_set_error(''); } } /** * Form validation handler for form_test_validate_form(). */ function form_test_validate_form_validate(&$form, &$form_state) { if ($form_state['values']['name'] == 'validate') { // Alter the form element. $form['name']['#value'] = '#value changed by #validate'; // Alter the submitted value in $form_state. form_set_value($form['name'], 'value changed by form_set_value() in #validate', $form_state); // Output the element's value from $form_state. drupal_set_message(t('@label value: @value', array('@label' => $form['name']['#title'], '@value' => $form_state['values']['name']))); // Trigger a form validation error to see our changes. form_set_error(''); } } /** * Form constructor to test the #required property. */ function form_test_validate_required_form($form, &$form_state) { $options = drupal_map_assoc(array('foo', 'bar')); $form['textfield'] = array( '#type' => 'textfield', '#title' => 'Textfield', '#required' => TRUE, ); $form['checkboxes'] = array( '#type' => 'checkboxes', '#title' => 'Checkboxes', '#options' => $options, '#required' => TRUE, ); $form['select'] = array( '#type' => 'select', '#title' => 'Select', '#options' => $options, '#required' => TRUE, ); $form['radios'] = array( '#type' => 'radios', '#title' => 'Radios', '#options' => $options, '#required' => TRUE, ); $form['radios_optional'] = array( '#type' => 'radios', '#title' => 'Radios (optional)', '#options' => $options, ); $form['radios_optional_default_value_false'] = array( '#type' => 'radios', '#title' => 'Radios (optional, with a default value of FALSE)', '#options' => $options, '#default_value' => FALSE, ); $form['actions'] = array('#type' => 'actions'); $form['actions']['submit'] = array('#type' => 'submit', '#value' => 'Submit'); return $form; } /** * Form submission handler for form_test_validate_required_form(). */ function form_test_validate_required_form_submit($form, &$form_state) { drupal_set_message('The form_test_validate_required_form form was submitted successfully.'); } /** * Form constructor to test the #required property without #title. */ function form_test_validate_required_form_no_title($form, &$form_state) { $form['textfield'] = array( '#type' => 'textfield', '#required' => TRUE, ); $form['actions'] = array('#type' => 'actions'); $form['actions']['submit'] = array('#type' => 'submit', '#value' => 'Submit'); return $form; } /** * Form submission handler for form_test_validate_required_form_no_title(). */ function form_test_validate_required_form_no_title_submit($form, &$form_state) { drupal_set_message('The form_test_validate_required_form_no_title form was submitted successfully.'); } /** * Builds a simple form with a button triggering partial validation. */ function form_test_limit_validation_errors_form($form, &$form_state) { $form['title'] = array( '#type' => 'textfield', '#title' => 'Title', '#required' => TRUE, ); $form['test'] = array( '#title' => 'Test', '#type' => 'textfield', '#element_validate' => array('form_test_limit_validation_errors_element_validate_test'), ); $form['test_numeric_index'] = array( '#tree' => TRUE, ); $form['test_numeric_index'][0] = array( '#title' => 'Test (numeric index)', '#type' => 'textfield', '#element_validate' => array('form_test_limit_validation_errors_element_validate_test'), ); $form['test_substring'] = array( '#tree' => TRUE, ); $form['test_substring']['foo'] = array( '#title' => 'Test (substring) foo', '#type' => 'textfield', '#element_validate' => array('form_test_limit_validation_errors_element_validate_test'), ); $form['test_substring']['foobar'] = array( '#title' => 'Test (substring) foobar', '#type' => 'textfield', '#element_validate' => array('form_test_limit_validation_errors_element_validate_test'), ); $form['actions']['partial'] = array( '#type' => 'submit', '#limit_validation_errors' => array(array('test')), '#submit' => array('form_test_limit_validation_errors_form_partial_submit'), '#value' => t('Partial validate'), ); $form['actions']['partial_numeric_index'] = array( '#type' => 'submit', '#limit_validation_errors' => array(array('test_numeric_index', 0)), '#submit' => array('form_test_limit_validation_errors_form_partial_submit'), '#value' => t('Partial validate (numeric index)'), ); $form['actions']['substring'] = array( '#type' => 'submit', '#limit_validation_errors' => array(array('test_substring', 'foo')), '#submit' => array('form_test_limit_validation_errors_form_partial_submit'), '#value' => t('Partial validate (substring)'), ); $form['actions']['full'] = array( '#type' => 'submit', '#value' => t('Full validate'), ); return $form; } /** * Form element validation handler for the 'test' element. */ function form_test_limit_validation_errors_element_validate_test(&$element, &$form_state) { if ($element['#value'] == 'invalid') { form_error($element, t('@label element is invalid', array('@label' => $element['#title']))); } } /** * Form submit handler for the partial validation submit button. */ function form_test_limit_validation_errors_form_partial_submit($form, $form_state) { // The title has not been validated, thus its value - in case of the test case // an empty string - may not be set. if (!isset($form_state['values']['title']) && isset($form_state['values']['test'])) { drupal_set_message('Only validated values appear in the form values.'); } } /** * Create a header and options array. Helper function for callbacks. */ function _form_test_tableselect_get_data() { $header = array( 'one' => t('One'), 'two' => t('Two'), 'three' => t('Three'), 'four' => t('Four'), ); $options['row1'] = array( 'one' => 'row1col1', 'two' => t('row1col2'), 'three' => t('row1col3'), 'four' => t('row1col4'), ); $options['row2'] = array( 'one' => 'row2col1', 'two' => t('row2col2'), 'three' => t('row2col3'), 'four' => t('row2col4'), ); $options['row3'] = array( 'one' => 'row3col1', 'two' => t('row3col2'), 'three' => t('row3col3'), 'four' => t('row3col4'), ); return array($header, $options); } /** * Build a form to test the tableselect element. * * @param $form_state * The form_state * @param $element_properties * An array of element properties for the tableselect element. * * @return * A form with a tableselect element and a submit button. */ function _form_test_tableselect_form_builder($form, $form_state, $element_properties) { list($header, $options) = _form_test_tableselect_get_data(); $form['tableselect'] = $element_properties; $form['tableselect'] += array( '#type' => 'tableselect', '#header' => $header, '#options' => $options, '#multiple' => FALSE, '#empty' => t('Empty text.'), ); $form['submit'] = array( '#type' => 'submit', '#value' => t('Submit'), ); return $form; } /** * Test the tableselect #multiple = TRUE functionality. */ function _form_test_tableselect_multiple_true_form($form, $form_state) { return _form_test_tableselect_form_builder($form, $form_state, array('#multiple' => TRUE)); } /** * Process the tableselect #multiple = TRUE submitted values. */ function _form_test_tableselect_multiple_true_form_submit($form, &$form_state) { $selected = $form_state['values']['tableselect']; foreach ($selected as $key => $value) { drupal_set_message(t('Submitted: @key = @value', array('@key' => $key, '@value' => $value))); } } /** * Test the tableselect #multiple = FALSE functionality. */ function _form_test_tableselect_multiple_false_form($form, $form_state) { return _form_test_tableselect_form_builder($form, $form_state, array('#multiple' => FALSE)); } /** * Process the tableselect #multiple = FALSE submitted values. */ function _form_test_tableselect_multiple_false_form_submit($form, &$form_state) { drupal_set_message(t('Submitted: @value', array('@value' => $form_state['values']['tableselect']))); } /** * Test functionality of the tableselect #empty property. */ function _form_test_tableselect_empty_form($form, $form_state) { return _form_test_tableselect_form_builder($form, $form_state, array('#options' => array())); } /** * Test functionality of the tableselect #js_select property. */ function _form_test_tableselect_js_select_form($form, $form_state, $action) { switch ($action) { case 'multiple-true-default': $options = array('#multiple' => TRUE); break; case 'multiple-false-default': $options = array('#multiple' => FALSE); break; case 'multiple-true-no-advanced-select': $options = array('#multiple' => TRUE, '#js_select' => FALSE); break; case 'multiple-false-advanced-select': $options = array('#multiple' => FALSE, '#js_select' => TRUE); break; } return _form_test_tableselect_form_builder($form, $form_state, $options); } /** * Tests functionality of vertical tabs. */ function _form_test_vertical_tabs_form($form, &$form_state) { $form['vertical_tabs'] = array( '#type' => 'vertical_tabs', ); $form['tab1'] = array( '#type' => 'fieldset', '#title' => t('Tab 1'), '#collapsible' => TRUE, '#group' => 'vertical_tabs', ); $form['tab1']['field1'] = array( '#title' => t('Field 1'), '#type' => 'textfield', ); $form['tab2'] = array( '#type' => 'fieldset', '#title' => t('Tab 2'), '#collapsible' => TRUE, '#group' => 'vertical_tabs', ); $form['tab2']['field2'] = array( '#title' => t('Field 2'), '#type' => 'textfield', ); return $form; } /** * A multistep form for testing the form storage. * * It uses two steps for editing a virtual "thing". Any changes to it are saved * in the form storage and have to be present during any step. By setting the * request parameter "cache" the form can be tested with caching enabled, as * it would be the case, if the form would contain some #ajax callbacks. * * @see form_test_storage_form_submit() */ function form_test_storage_form($form, &$form_state) { if ($form_state['rebuild']) { $form_state['input'] = array(); } // Initialize if (empty($form_state['storage'])) { if (empty($form_state['input'])) { $_SESSION['constructions'] = 0; } // Put the initial thing into the storage $form_state['storage'] = array( 'thing' => array( 'title' => 'none', 'value' => '', ), ); } // Count how often the form is constructed. $_SESSION['constructions']++; drupal_set_message("Form constructions: " . $_SESSION['constructions']); $form['title'] = array( '#type' => 'textfield', '#title' => 'Title', '#default_value' => $form_state['storage']['thing']['title'], '#required' => TRUE, ); $form['value'] = array( '#type' => 'textfield', '#title' => 'Value', '#default_value' => $form_state['storage']['thing']['value'], '#element_validate' => array('form_test_storage_element_validate_value_cached'), ); $form['continue_button'] = array( '#type' => 'button', '#value' => 'Reset', // Rebuilds the form without keeping the values. ); $form['continue_submit'] = array( '#type' => 'submit', '#value' => 'Continue submit', '#submit' => array('form_storage_test_form_continue_submit'), ); $form['submit'] = array( '#type' => 'submit', '#value' => 'Save', ); if (isset($_REQUEST['cache'])) { // Manually activate caching, so we can test that the storage keeps working // when it's enabled. $form_state['cache'] = TRUE; } if (isset($_REQUEST['immutable'])) { $form_state['build_info']['immutable'] = TRUE; } return $form; } /** * Emulate legacy AHAH-style ajax callback. * * Drupal 6 AHAH callbacks used to operate directly on forms retrieved using * form_get_cache and stored using form_set_cache after manipulation. This * callback helps testing whether form_set_cache prevents resaving of immutable * forms. */ function form_test_storage_legacy_handler($form_build_id) { $form_state = array(); $form = form_get_cache($form_build_id, $form_state); drupal_json_output(array( 'form' => $form, 'form_state' => $form_state, )); $form['#poisoned'] = TRUE; $form_state['poisoned'] = TRUE; form_set_cache($form_build_id, $form, $form_state); } /** * Form element validation handler for 'value' element in form_test_storage_form(). * * Tests updating of cached form storage during validation. */ function form_test_storage_element_validate_value_cached($element, &$form_state) { // If caching is enabled and we receive a certain value, change the storage. // This presumes that another submitted form value triggers a validation error // elsewhere in the form. Form API should still update the cached form storage // though. if (isset($_REQUEST['cache']) && $form_state['values']['value'] == 'change_title') { $form_state['storage']['thing']['changed'] = TRUE; } } /** * Form submit handler to continue multi-step form. */ function form_storage_test_form_continue_submit($form, &$form_state) { $form_state['storage']['thing']['title'] = $form_state['values']['title']; $form_state['storage']['thing']['value'] = $form_state['values']['value']; $form_state['rebuild'] = TRUE; } /** * Form submit handler to finish multi-step form. */ function form_test_storage_form_submit($form, &$form_state) { drupal_set_message("Title: " . check_plain($form_state['values']['title'])); drupal_set_message("Form constructions: " . $_SESSION['constructions']); if (isset($form_state['storage']['thing']['changed'])) { drupal_set_message("The thing has been changed."); } $form_state['redirect'] = 'node'; } /** * A simple form for testing form storage when page caching is enabled. */ function form_test_storage_page_cache_form($form, &$form_state) { $form['title'] = array( '#type' => 'textfield', '#title' => 'Title', '#required' => TRUE, ); $form['test_build_id_old'] = array( '#type' => 'item', '#title' => 'Old build id', '#markup' => 'No old build id', ); $form['submit'] = array( '#type' => 'submit', '#value' => 'Save', ); $form['rebuild'] = array( '#type' => 'submit', '#value' => 'Rebuild', '#submit' => array('form_test_storage_page_cache_rebuild'), ); $form['#after_build'] = array('form_test_storage_page_cache_old_build_id'); $form_state['cache'] = TRUE; return $form; } /** * Form element #after_build callback: output the old form build-id. */ function form_test_storage_page_cache_old_build_id($form) { if (isset($form['#build_id_old'])) { $form['test_build_id_old']['#markup'] = check_plain($form['#build_id_old']); } return $form; } /** * Form submit callback: Rebuild the form and continue. */ function form_test_storage_page_cache_rebuild($form, &$form_state) { $form_state['rebuild'] = TRUE; } /** * A form for testing form labels and required marks. */ function form_label_test_form() { $form['form_checkboxes_test'] = array( '#type' => 'checkboxes', '#title' => t('Checkboxes test'), '#options' => array( 'first-checkbox' => t('First checkbox'), 'second-checkbox' => t('Second checkbox'), 'third-checkbox' => t('Third checkbox'), '0' => t('0'), ), ); $form['form_radios_test'] = array( '#type' => 'radios', '#title' => t('Radios test'), '#options' => array( 'first-radio' => t('First radio'), 'second-radio' => t('Second radio'), 'third-radio' => t('Third radio'), '0' => t('0'), ), // Test #field_prefix and #field_suffix placement. '#field_prefix' => '' . t('Radios #field_prefix element') . '', '#field_suffix' => '' . t('Radios #field_suffix element') . '', ); $form['form_checkbox_test'] = array( '#type' => 'checkbox', '#title' => t('Checkbox test'), ); $form['form_textfield_test_title_and_required'] = array( '#type' => 'textfield', '#title' => t('Textfield test for required with title'), '#required' => TRUE, ); $form['form_textfield_test_no_title_required'] = array( '#type' => 'textfield', // We use an empty title, since not setting #title suppresses the label // and required marker. '#title' => '', '#required' => TRUE, ); $form['form_textfield_test_title'] = array( '#type' => 'textfield', '#title' => t('Textfield test for title only'), // Not required. // Test #prefix and #suffix placement. '#prefix' => '
              ' . t('Textfield #prefix element') . '
              ', '#suffix' => '
              ' . t('Textfield #suffix element') . '
              ', ); $form['form_textfield_test_title_after'] = array( '#type' => 'textfield', '#title' => t('Textfield test for title after element'), '#title_display' => 'after', ); $form['form_textfield_test_title_invisible'] = array( '#type' => 'textfield', '#title' => t('Textfield test for invisible title'), '#title_display' => 'invisible', ); // Textfield test for title set not to display. $form['form_textfield_test_title_no_show'] = array( '#type' => 'textfield', ); // Checkboxes & radios with title as attribute. $form['form_checkboxes_title_attribute'] = array( '#type' => 'checkboxes', '#title' => 'Checkboxes test', '#options' => array( 'first-checkbox' => 'First checkbox', 'second-checkbox' => 'Second checkbox', ), '#title_display' => 'attribute', '#required' => TRUE, ); $form['form_radios_title_attribute'] = array( '#type' => 'radios', '#title' => 'Radios test', '#options' => array( 'first-radio' => 'First radio', 'second-radio' => 'Second radio', ), '#title_display' => 'attribute', '#required' => TRUE, ); return $form; } /** * Menu callback; Invokes a form builder function with a wrapper callback. */ function form_test_wrapper_callback($form_id) { $form_state = array( 'build_info' => array('args' => array()), 'wrapper_callback' => 'form_test_wrapper_callback_wrapper', ); return drupal_build_form($form_id, $form_state); } /** * Form wrapper for form_test_wrapper_callback_form(). */ function form_test_wrapper_callback_wrapper($form, &$form_state) { $form['wrapper'] = array('#markup' => 'Form wrapper callback element output.'); return $form; } /** * Form builder for form wrapper callback test. */ function form_test_wrapper_callback_form($form, &$form_state) { $form['builder'] = array('#markup' => 'Form builder element output.'); return $form; } /** * Form builder for form_state_values_clean() test. */ function form_test_form_state_values_clean_form($form, &$form_state) { // Build an example form containing multiple submit and button elements; not // only on the top-level. $form = array('#tree' => TRUE); $form['foo'] = array('#type' => 'submit', '#value' => t('Submit')); $form['bar'] = array('#type' => 'submit', '#value' => t('Submit')); $form['beer'] = array('#type' => 'value', '#value' => 1000); $form['baz']['foo'] = array('#type' => 'button', '#value' => t('Submit')); $form['baz']['baz'] = array('#type' => 'submit', '#value' => t('Submit')); $form['baz']['beer'] = array('#type' => 'value', '#value' => 2000); return $form; } /** * Form submit handler for form_state_values_clean() test form. */ function form_test_form_state_values_clean_form_submit($form, &$form_state) { form_state_values_clean($form_state); drupal_json_output($form_state['values']); exit; } /** * Form constructor for the form_state_values_clean() test. */ function form_test_form_state_values_clean_advanced_form($form, &$form_state) { // Build an example form containing a managed file and a submit form element. $form['image'] = array( '#type' => 'managed_file', '#title' => t('Image'), '#upload_location' => 'public://', '#default_value' => 0, ); $form['submit'] = array( '#type' => 'submit', '#value' => t('Submit'), ); return $form; } /** * Form submission handler for form_test_form_state_values_clean_advanced_form(). */ function form_test_form_state_values_clean_advanced_form_submit($form, &$form_state) { form_state_values_clean($form_state); print t('You WIN!'); exit; } /** * Build a form to test a checkbox. */ function _form_test_checkbox($form, &$form_state) { // A required checkbox. $form['required_checkbox'] = array( '#type' => 'checkbox', '#required' => TRUE, '#title' => 'required_checkbox', ); // A disabled checkbox should get its default value back. $form['disabled_checkbox_on'] = array( '#type' => 'checkbox', '#disabled' => TRUE, '#return_value' => 'disabled_checkbox_on', '#default_value' => 'disabled_checkbox_on', '#title' => 'disabled_checkbox_on', ); $form['disabled_checkbox_off'] = array( '#type' => 'checkbox', '#disabled' => TRUE, '#return_value' => 'disabled_checkbox_off', '#default_value' => NULL, '#title' => 'disabled_checkbox_off', ); // A checkbox is active when #default_value == #return_value. $form['checkbox_on'] = array( '#type' => 'checkbox', '#return_value' => 'checkbox_on', '#default_value' => 'checkbox_on', '#title' => 'checkbox_on', ); // But inactive in any other case. $form['checkbox_off'] = array( '#type' => 'checkbox', '#return_value' => 'checkbox_off', '#default_value' => 'checkbox_on', '#title' => 'checkbox_off', ); // Checkboxes with a #return_value of '0' are supported. $form['zero_checkbox_on'] = array( '#type' => 'checkbox', '#return_value' => '0', '#default_value' => '0', '#title' => 'zero_checkbox_on', ); // In that case, passing a #default_value != '0' means that the checkbox is off. $form['zero_checkbox_off'] = array( '#type' => 'checkbox', '#return_value' => '0', '#default_value' => '1', '#title' => 'zero_checkbox_off', ); $form['submit'] = array( '#type' => 'submit', '#value' => t('Submit') ); return $form; } /** * Return the form values via JSON. */ function _form_test_checkbox_submit($form, &$form_state) { drupal_json_output($form_state['values']); exit(); } /** * Builds a form to test #type 'select' validation. */ function form_test_select($form, &$form_state) { $base = array( '#type' => 'select', '#options' => drupal_map_assoc(array('one', 'two', 'three')), ); $form['select'] = $base + array( '#title' => '#default_value one', '#default_value' => 'one', ); $form['select_required'] = $base + array( '#title' => '#default_value one, #required', '#required' => TRUE, '#default_value' => 'one', ); $form['select_optional'] = $base + array( '#title' => '#default_value one, not #required', '#required' => FALSE, '#default_value' => 'one', ); $form['empty_value'] = $base + array( '#title' => '#default_value one, #required, #empty_value 0', '#required' => TRUE, '#default_value' => 'one', '#empty_value' => 0, ); $form['empty_value_one'] = $base + array( '#title' => '#default_value = #empty_value, #required', '#required' => TRUE, '#default_value' => 'one', '#empty_value' => 'one', ); $form['no_default'] = $base + array( '#title' => 'No #default_value, #required', '#required' => TRUE, ); $form['no_default_optional'] = $base + array( '#title' => 'No #default_value, not #required', '#required' => FALSE, '#description' => 'Should result in "one", because it is not required and there is no #empty_value requested, so default browser behavior of preselecting first option is in effect.', ); $form['no_default_optional_empty_value'] = $base + array( '#title' => 'No #default_value, not #required, #empty_value empty string', '#empty_value' => '', '#required' => FALSE, '#description' => 'Should result in an empty string (due to #empty_value), because it is optional.', ); $form['no_default_empty_option'] = $base + array( '#title' => 'No #default_value, #required, #empty_option', '#required' => TRUE, '#empty_option' => '- Choose -', ); $form['no_default_empty_option_optional'] = $base + array( '#title' => 'No #default_value, not #required, #empty_option', '#empty_option' => '- Dismiss -', '#description' => 'Should result in an empty string (default of #empty_value), because it is optional.', ); $form['no_default_empty_value'] = $base + array( '#title' => 'No #default_value, #required, #empty_value 0', '#required' => TRUE, '#empty_value' => 0, '#description' => 'Should never result in 0.', ); $form['no_default_empty_value_one'] = $base + array( '#title' => 'No #default_value, #required, #empty_value one', '#required' => TRUE, '#empty_value' => 'one', '#description' => 'A mistakenly assigned #empty_value contained in #options should not be valid.', ); $form['no_default_empty_value_optional'] = $base + array( '#title' => 'No #default_value, not #required, #empty_value 0', '#required' => FALSE, '#empty_value' => 0, '#description' => 'Should result in 0, because it is optional.', ); $form['multiple'] = $base + array( '#title' => '#multiple, #default_value two', '#default_value' => array('two'), '#multiple' => TRUE, ); $form['multiple_no_default'] = $base + array( '#title' => '#multiple, no #default_value', '#multiple' => TRUE, ); $form['multiple_no_default_required'] = $base + array( '#title' => '#multiple, #required, no #default_value', '#required' => TRUE, '#multiple' => TRUE, ); $form['submit'] = array('#type' => 'submit', '#value' => 'Submit'); return $form; } /** * Form submit handler for form_test_select(). */ function form_test_select_submit($form, &$form_state) { drupal_json_output($form_state['values']); exit(); } /** * Form constructor to test expansion of #type checkboxes and radios. */ function form_test_checkboxes_radios($form, &$form_state, $customize = FALSE) { $form['#submit'] = array('_form_test_submit_values_json'); // Expand #type checkboxes, setting custom element properties for some but not // all options. $form['checkboxes'] = array( '#type' => 'checkboxes', '#title' => 'Checkboxes', '#options' => array( 0 => 'Zero', 'foo' => 'Foo', 1 => 'One', 'bar' => 'Bar', '>' => 'Special Char', ), ); if ($customize) { $form['checkboxes'] += array( 'foo' => array( '#description' => 'Enable to foo.', ), 1 => array( '#weight' => 10, ), ); } // Expand #type radios, setting custom element properties for some but not // all options. $form['radios'] = array( '#type' => 'radios', '#title' => 'Radios', '#options' => array( 0 => 'Zero', 'foo' => 'Foo', 1 => 'One', 'bar' => 'Bar', '>' => 'Special Char', ), ); if ($customize) { $form['radios'] += array( 'foo' => array( '#description' => 'Enable to foo.', ), 1 => array( '#weight' => 10, ), ); } $form['submit'] = array('#type' => 'submit', '#value' => 'Submit'); return $form; } /** * Build a form to test disabled elements. */ function _form_test_disabled_elements($form, &$form_state) { // Elements that take a simple default value. foreach (array('textfield', 'textarea', 'hidden') as $type) { $form[$type] = array( '#type' => $type, '#title' => $type, '#default_value' => $type, '#test_hijack_value' => 'HIJACK', '#disabled' => TRUE, ); } // Multiple values option elements. foreach (array('checkboxes', 'select') as $type) { $form[$type . '_multiple'] = array( '#type' => $type, '#title' => $type . ' (multiple)', '#options' => array( 'test_1' => 'Test 1', 'test_2' => 'Test 2', ), '#multiple' => TRUE, '#default_value' => array('test_2' => 'test_2'), // The keys of #test_hijack_value need to match the #name of the control. // @see FormsTestCase::testDisabledElements() '#test_hijack_value' => $type == 'select' ? array('' => 'test_1') : array('test_1' => 'test_1'), '#disabled' => TRUE, ); } // Single values option elements. foreach (array('radios', 'select') as $type) { $form[$type . '_single'] = array( '#type' => $type, '#title' => $type . ' (single)', '#options' => array( 'test_1' => 'Test 1', 'test_2' => 'Test 2', ), '#multiple' => FALSE, '#default_value' => 'test_2', '#test_hijack_value' => 'test_1', '#disabled' => TRUE, ); } // Checkbox and radio. foreach (array('checkbox', 'radio') as $type) { $form[$type . '_unchecked'] = array( '#type' => $type, '#title' => $type . ' (unchecked)', '#return_value' => 1, '#default_value' => 0, '#test_hijack_value' => 1, '#disabled' => TRUE, ); $form[$type . '_checked'] = array( '#type' => $type, '#title' => $type . ' (checked)', '#return_value' => 1, '#default_value' => 1, '#test_hijack_value' => NULL, '#disabled' => TRUE, ); } // Weight. $form['weight'] = array( '#type' => 'weight', '#title' => 'weight', '#default_value' => 10, '#test_hijack_value' => 5, '#disabled' => TRUE, ); // Date. $form['date'] = array( '#type' => 'date', '#title' => 'date', '#disabled' => TRUE, '#default_value' => array( 'day' => 19, 'month' => 11, 'year' => 1978, ), '#test_hijack_value' => array( 'day' => 20, 'month' => 12, 'year' => 1979, ), ); // The #disabled state should propagate to children. $form['disabled_container'] = array( '#disabled' => TRUE, ); foreach (array('textfield', 'textarea', 'hidden') as $type) { $form['disabled_container']['disabled_container_' . $type] = array( '#type' => $type, '#title' => $type, '#default_value' => $type, '#test_hijack_value' => 'HIJACK', ); } // Text format. $form['text_format'] = array( '#type' => 'text_format', '#title' => 'Text format', '#disabled' => TRUE, '#default_value' => 'Text value', '#format' => 'plain_text', '#expected_value' => array( 'value' => 'Text value', 'format' => 'plain_text', ), '#test_hijack_value' => array( 'value' => 'HIJACK', 'format' => 'filtered_html', ), ); // Password fields. $form['password'] = array( '#type' => 'password', '#title' => 'Password', '#disabled' => TRUE, ); $form['password_confirm'] = array( '#type' => 'password_confirm', '#title' => 'Password confirm', '#disabled' => TRUE, ); // Files. $form['file'] = array( '#type' => 'file', '#title' => 'File', '#disabled' => TRUE, ); $form['managed_file'] = array( '#type' => 'managed_file', '#title' => 'Managed file', '#disabled' => TRUE, ); // Buttons. $form['image_button'] = array( '#type' => 'image_button', '#value' => 'Image button', '#disabled' => TRUE, ); $form['button'] = array( '#type' => 'button', '#value' => 'Button', '#disabled' => TRUE, ); $form['submit_disabled'] = array( '#type' => 'submit', '#value' => 'Submit', '#disabled' => TRUE, ); $form['submit'] = array( '#type' => 'submit', '#value' => t('Submit'), ); return $form; } /** * Return the form values via JSON. */ function _form_test_disabled_elements_submit($form, &$form_state) { drupal_json_output($form_state['values']); exit(); } /** * Build a form to test input forgery of enabled elements. */ function _form_test_input_forgery($form, &$form_state) { // For testing that a user can't submit a value not matching one of the // allowed options. $form['checkboxes'] = array( '#type' => 'checkboxes', '#options' => array( 'one' => 'One', 'two' => 'Two', ), ); $form['submit'] = array( '#type' => 'submit', '#value' => t('Submit'), ); return $form; } /** * Return the form values via JSON. */ function _form_test_input_forgery_submit($form, &$form_state) { drupal_json_output($form_state['values']); exit(); } /** * Form builder for testing preservation of values during a rebuild. */ function form_test_form_rebuild_preserve_values_form($form, &$form_state) { // Start the form with two checkboxes, to test different defaults, and a // textfield, to test more than one element type. $form = array( 'checkbox_1_default_off' => array( '#type' => 'checkbox', '#title' => t('This checkbox defaults to unchecked.'), '#default_value' => FALSE, ), 'checkbox_1_default_on' => array( '#type' => 'checkbox', '#title' => t('This checkbox defaults to checked.'), '#default_value' => TRUE, ), 'text_1' => array( '#type' => 'textfield', '#title' => t('This textfield has a non-empty default value.'), '#default_value' => 'DEFAULT 1', ), ); // Provide an 'add more' button that rebuilds the form with an additional two // checkboxes and a textfield. The test is to make sure that the rebuild // triggered by this button preserves the user input values for the initial // elements and initializes the new elements with the correct default values. if (empty($form_state['storage']['add_more'])) { $form['add_more'] = array( '#type' => 'submit', '#value' => 'Add more', '#submit' => array('form_test_form_rebuild_preserve_values_form_add_more'), ); } else { $form += array( 'checkbox_2_default_off' => array( '#type' => 'checkbox', '#title' => t('This checkbox defaults to unchecked.'), '#default_value' => FALSE, ), 'checkbox_2_default_on' => array( '#type' => 'checkbox', '#title' => t('This checkbox defaults to checked.'), '#default_value' => TRUE, ), 'text_2' => array( '#type' => 'textfield', '#title' => t('This textfield has a non-empty default value.'), '#default_value' => 'DEFAULT 2', ), ); } // A submit button that finishes the form workflow (does not rebuild). $form['submit'] = array( '#type' => 'submit', '#value' => 'Submit', ); return $form; } /** * Button submit handler for form_test_form_rebuild_preserve_values_form(). */ function form_test_form_rebuild_preserve_values_form_add_more($form, &$form_state) { // Rebuild, to test preservation of input values. $form_state['storage']['add_more'] = TRUE; $form_state['rebuild'] = TRUE; } /** * Form submit handler for form_test_form_rebuild_preserve_values_form(). */ function form_test_form_rebuild_preserve_values_form_submit($form, &$form_state) { // Finish the workflow. Do not rebuild. drupal_set_message(t('Form values: %values', array('%values' => var_export($form_state['values'], TRUE)))); } /** * Form constructor for testing form state persistence. */ function form_test_state_persist($form, &$form_state) { $form['title'] = array( '#type' => 'textfield', '#title' => 'title', '#default_value' => 'DEFAULT', '#required' => TRUE, ); $form_state['value'] = 'State persisted.'; $form['submit'] = array( '#type' => 'submit', '#value' => t('Submit'), ); return $form; } /** * Submit handler. * * @see form_test_state_persist() */ function form_test_state_persist_submit($form, &$form_state) { drupal_set_message($form_state['value']); $form_state['rebuild'] = TRUE; } /** * Implements hook_form_FORM_ID_alter(). * * @see form_test_state_persist() */ function form_test_form_form_test_state_persist_alter(&$form, &$form_state) { // Simulate a form alter implementation inserting form elements that enable // caching of the form, e.g. elements having #ajax. if (!empty($_REQUEST['cache'])) { $form_state['cache'] = TRUE; } } /** * Form builder to test programmatic form submissions. */ function form_test_programmatic_form($form, &$form_state) { $form['textfield'] = array( '#title' => 'Textfield', '#type' => 'textfield', ); $form['checkboxes'] = array( '#type' => 'checkboxes', '#options' => array( 1 => 'First checkbox', 2 => 'Second checkbox', ), // Both checkboxes are selected by default so that we can test the ability // of programmatic form submissions to uncheck them. '#default_value' => array(1, 2), ); // This is used to test that programmatic form submissions can bypass #access // restrictions. $form['textfield_no_access'] = array( '#type' => 'textfield', '#title' => 'Textfield no access', '#default_value' => 'default value', '#access' => FALSE, ); $form['field_to_validate'] = array( '#type' => 'radios', '#title' => 'Field to validate (in the case of limited validation)', '#description' => 'If the form is submitted by clicking the "Submit with limited validation" button, then validation can be limited based on the value of this radio button.', '#options' => array( 'all' => 'Validate all fields', 'textfield' => 'Validate the "Textfield" field', 'field_to_validate' => 'Validate the "Field to validate" field', ), '#default_value' => 'all', ); // The main submit button for the form. $form['submit'] = array( '#type' => 'submit', '#value' => 'Submit', ); // A secondary submit button that allows validation to be limited based on // the value of the above radio selector. $form['submit_limit_validation'] = array( '#type' => 'submit', '#value' => 'Submit with limited validation', // Use the same submit handler for this button as for the form itself. // (This must be set explicitly or otherwise the form API will ignore the // #limit_validation_errors property.) '#submit' => array('form_test_programmatic_form_submit'), ); if (!empty($form_state['input']['field_to_validate']) && $form_state['input']['field_to_validate'] != 'all') { $form['submit_limit_validation']['#limit_validation_errors'] = array( array($form_state['input']['field_to_validate']), ); } return $form; } /** * Form validation handler for programmatic form submissions. * * To test that the validation handler is correctly executed, the field value is * explicitly required here. */ function form_test_programmatic_form_validate($form, &$form_state) { if (empty($form_state['values']['textfield'])) { form_set_error('textfield', t('Textfield is required.')); } } /** * Form submit handler for programmatic form submissions. * * To test that the submission handler is correctly executed, we store the * submitted values in a place we can access from the caller context. */ function form_test_programmatic_form_submit($form, &$form_state) { $form_state['storage']['programmatic_form_submit'] = $form_state['values']; } /** * Form builder to test button click detection. */ function form_test_clicked_button($form, &$form_state) { // A single text field. In IE, when a form has only one non-button input field // and the ENTER key is pressed while that field has focus, the form is // submitted without any information identifying the button responsible for // the submission. In other browsers, the form is submitted as though the // first button were clicked. $form['text'] = array( '#title' => 'Text', '#type' => 'textfield', ); // Loop through each path argument, addding buttons based on the information // in the argument. For example, if the path is // form-test/clicked-button/s/i/rb, then 3 buttons are added: a 'submit', an // 'image_button', and a 'button' with #access=FALSE. This enables form.test // to test a variety of combinations. $i=0; $args = array_slice(arg(), 2); foreach ($args as $arg) { $name = 'button' . ++$i; // 's', 'b', or 'i' in the argument define the button type wanted. if (strpos($arg, 's') !== FALSE) { $type = 'submit'; } elseif (strpos($arg, 'b') !== FALSE) { $type = 'button'; } elseif (strpos($arg, 'i') !== FALSE) { $type = 'image_button'; } else { $type = NULL; } if (isset($type)) { $form[$name] = array( '#type' => $type, '#name' => $name, ); // Image buttons need a #src; the others need a #value. if ($type == 'image_button') { $form[$name]['#src'] = 'misc/druplicon.png'; } else { $form[$name]['#value'] = $name; } // 'r' for restricted, so we can test that button click detection code // correctly takes #access security into account. if (strpos($arg, 'r') !== FALSE) { $form[$name]['#access'] = FALSE; } } } return $form; } /** * Form validation handler for the form_test_clicked_button() form. */ function form_test_clicked_button_validate($form, &$form_state) { if (isset($form_state['triggering_element'])) { drupal_set_message(t('The clicked button is %name.', array('%name' => $form_state['triggering_element']['#name']))); } else { drupal_set_message('There is no clicked button.'); } } /** * Form submit handler for the form_test_clicked_button() form. */ function form_test_clicked_button_submit($form, &$form_state) { drupal_set_message('Submit handler for form_test_clicked_button executed.'); } /** * Form builder to detect form redirect. */ function form_test_redirect($form, &$form_state) { $form['redirection'] = array( '#type' => 'checkbox', '#title' => t('Use redirection'), ); $form['destination'] = array( '#type' => 'textfield', '#title' => t('Redirect destination'), '#states' => array( 'visible' => array( ':input[name="redirection"]' => array('checked' => TRUE), ), ), ); $form['submit'] = array( '#type' => 'submit', '#value' => t('Submit'), ); return $form; } /** * Form submit handler to test different redirect behaviours. */ function form_test_redirect_submit(&$form, &$form_state) { if (!empty($form_state['values']['redirection'])) { $form_state['redirect'] = !empty($form_state['values']['destination']) ? $form_state['values']['destination'] : NULL; } else { $form_state['redirect'] = FALSE; } } /** * Implements hook_form_FORM_ID_alter() for the registration form. */ function form_test_form_user_register_form_alter(&$form, &$form_state) { $form['test_rebuild'] = array( '#type' => 'submit', '#value' => t('Rebuild'), '#submit' => array('form_test_user_register_form_rebuild'), ); // If requested, add the test field by attaching the node page form. if (!empty($_REQUEST['field'])) { $node = (object)array('type' => 'page'); field_attach_form('node', $node, $form, $form_state); } } /** * Submit callback that just lets the form rebuild. */ function form_test_user_register_form_rebuild($form, &$form_state) { drupal_set_message('Form rebuilt.'); $form_state['rebuild'] = TRUE; } /** * Menu callback that returns two instances of the node form. */ function form_test_two_instances() { global $user; $node1 = (object) array( 'uid' => $user->uid, 'name' => (isset($user->name) ? $user->name : ''), 'type' => 'page', 'language' => LANGUAGE_NONE, ); $node2 = clone($node1); $return['node_form_1'] = drupal_get_form('page_node_form', $node1); $return['node_form_2'] = drupal_get_form('page_node_form', $node2); return $return; } /** * Menu callback for testing custom form includes. */ function form_test_load_include_custom($form, &$form_state) { $form['button'] = array( '#type' => 'submit', '#value' => t('Save'), '#submit' => array('form_test_load_include_submit'), ); // Specify the include file and enable form caching. That way the form is // cached when it is submitted, but needs to find the specified submit handler // in the include. // Filename is a bit weird here: modules/simpletest/tests/form_test.file.inc form_load_include($form_state, 'inc', 'form_test', 'form_test.file'); $form_state['cache'] = TRUE; return $form; } function form_test_checkbox_type_juggling($form, $form_state, $default_value, $return_value) { $form['checkbox'] = array( '#type' => 'checkbox', '#return_value' => $return_value, '#default_value' => $default_value, ); return $form; } function form_test_checkboxes_zero($form, &$form_state, $json = TRUE) { $form['checkbox_off'] = array( '#type' => 'checkboxes', '#options' => array('foo', 'bar', 'baz'), ); $form['checkbox_zero_default'] = array( '#type' => 'checkboxes', '#options' => array('foo', 'bar', 'baz'), '#default_value' => array(0), ); $form['checkbox_string_zero_default'] = array( '#type' => 'checkboxes', '#options' => array('foo', 'bar', 'baz'), '#default_value' => array('0'), ); $form['submit'] = array( '#type' => 'submit', '#value' => 'Save', ); if ($json) { $form['#submit'][] = '_form_test_checkbox_submit'; } else { $form['#submit'][] = '_form_test_checkboxes_zero_no_redirect'; } return $form; } function _form_test_checkboxes_zero_no_redirect($form, &$form_state) { $form_state['redirect'] = FALSE; } /** * Menu callback returns two instances of the same form. */ function form_test_double_form() { return array( 'form1' => drupal_get_form('form_test_html_id'), 'form2' => drupal_get_form('form_test_html_id'), ); } /** * Builds a simple form to test duplicate HTML IDs. */ function form_test_html_id($form, &$form_state) { $form['name'] = array( '#type' => 'textfield', '#title' => 'name', '#required' => TRUE, ); $form['submit'] = array( '#type' => 'submit', '#value' => 'Save', ); return $form; } drupal-7.41/modules/simpletest/tests/entity_crud_hook_test.module0000644000000000000000000001377712611765734024307 0ustar rootrootfields(array('weight' => 2)) ->condition('name', 'url_alter_test') ->execute(); } drupal-7.41/modules/simpletest/tests/ajax.test0000644000000000000000000006423412611765734020306 0ustar rootrootassertTrue($found, $message); } } /** * Tests primary Ajax framework functions. */ class AJAXFrameworkTestCase extends AJAXTestCase { protected $profile = 'testing'; public static function getInfo() { return array( 'name' => 'AJAX framework', 'description' => 'Performs tests on AJAX framework functions.', 'group' => 'AJAX', ); } /** * Test that ajax_render() returns JavaScript settings generated during the page request. * * @todo Add tests to ensure that ajax_render() returns commands for new CSS * and JavaScript files to be loaded by the page. See * http://drupal.org/node/561858. */ function testAJAXRender() { $commands = $this->drupalGetAJAX('ajax-test/render'); // Verify that there is a command to load settings added with // drupal_add_js(). $expected = array( 'command' => 'settings', 'settings' => array('basePath' => base_path(), 'ajax' => 'test'), ); $this->assertCommand($commands, $expected, t('ajax_render() loads settings added with drupal_add_js().')); // Verify that Ajax settings are loaded for #type 'link'. $this->drupalGet('ajax-test/link'); $settings = $this->drupalGetSettings(); $this->assertEqual($settings['ajax']['ajax-link']['url'], url('filter/tips')); $this->assertEqual($settings['ajax']['ajax-link']['wrapper'], 'block-system-main'); } /** * Test behavior of ajax_render_error(). */ function testAJAXRenderError() { // Verify default error message. $commands = $this->drupalGetAJAX('ajax-test/render-error'); $expected = array( 'command' => 'alert', 'text' => t('An error occurred while handling the request: The server received invalid input.'), ); $this->assertCommand($commands, $expected, t('ajax_render_error() invokes alert command.')); // Verify custom error message. $edit = array( 'message' => 'Custom error message.', ); $commands = $this->drupalGetAJAX('ajax-test/render-error', array('query' => $edit)); $expected = array( 'command' => 'alert', 'text' => $edit['message'], ); $this->assertCommand($commands, $expected, t('Custom error message is output.')); } /** * Test that new JavaScript and CSS files added during an AJAX request are returned. */ function testLazyLoad() { $expected = array( 'setting_name' => 'ajax_forms_test_lazy_load_form_submit', 'setting_value' => 'executed', 'css' => drupal_get_path('module', 'system') . '/system.admin.css', 'js' => drupal_get_path('module', 'system') . '/system.js', ); // @todo D8: Add a drupal_css_defaults() helper function. $expected_css_html = drupal_get_css(array($expected['css'] => array( 'type' => 'file', 'group' => CSS_DEFAULT, 'weight' => 0, 'every_page' => FALSE, 'media' => 'all', 'preprocess' => TRUE, 'data' => $expected['css'], 'browsers' => array('IE' => TRUE, '!IE' => TRUE), )), TRUE); $expected_js_html = drupal_get_js('header', array($expected['js'] => drupal_js_defaults($expected['js'])), TRUE); // Get the base page. $this->drupalGet('ajax_forms_test_lazy_load_form'); $original_settings = $this->drupalGetSettings(); $original_css = $original_settings['ajaxPageState']['css']; $original_js = $original_settings['ajaxPageState']['js']; // Verify that the base page doesn't have the settings and files that are to // be lazy loaded as part of the next requests. $this->assertTrue(!isset($original_settings[$expected['setting_name']]), t('Page originally lacks the %setting, as expected.', array('%setting' => $expected['setting_name']))); $this->assertTrue(!isset($original_settings[$expected['css']]), t('Page originally lacks the %css file, as expected.', array('%css' => $expected['css']))); $this->assertTrue(!isset($original_settings[$expected['js']]), t('Page originally lacks the %js file, as expected.', array('%js' => $expected['js']))); // Submit the AJAX request without triggering files getting added. $commands = $this->drupalPostAJAX(NULL, array('add_files' => FALSE), array('op' => t('Submit'))); $new_settings = $this->drupalGetSettings(); // Verify the setting was not added when not expected. $this->assertTrue(!isset($new_settings['setting_name']), t('Page still lacks the %setting, as expected.', array('%setting' => $expected['setting_name']))); // Verify a settings command does not add CSS or scripts to Drupal.settings // and no command inserts the corresponding tags on the page. $found_settings_command = FALSE; $found_markup_command = FALSE; foreach ($commands as $command) { if ($command['command'] == 'settings' && (array_key_exists('css', $command['settings']['ajaxPageState']) || array_key_exists('js', $command['settings']['ajaxPageState']))) { $found_settings_command = TRUE; } if (isset($command['data']) && ($command['data'] == $expected_js_html || $command['data'] == $expected_css_html)) { $found_markup_command = TRUE; } } $this->assertFalse($found_settings_command, t('Page state still lacks the %css and %js files, as expected.', array('%css' => $expected['css'], '%js' => $expected['js']))); $this->assertFalse($found_markup_command, t('Page still lacks the %css and %js files, as expected.', array('%css' => $expected['css'], '%js' => $expected['js']))); // Submit the AJAX request and trigger adding files. $commands = $this->drupalPostAJAX(NULL, array('add_files' => TRUE), array('op' => t('Submit'))); $new_settings = $this->drupalGetSettings(); $new_css = $new_settings['ajaxPageState']['css']; $new_js = $new_settings['ajaxPageState']['js']; // Verify the expected setting was added. $this->assertIdentical($new_settings[$expected['setting_name']], $expected['setting_value'], t('Page now has the %setting.', array('%setting' => $expected['setting_name']))); // Verify the expected CSS file was added, both to Drupal.settings, and as // an AJAX command for inclusion into the HTML. $this->assertEqual($new_css, $original_css + array($expected['css'] => 1), t('Page state now has the %css file.', array('%css' => $expected['css']))); $this->assertCommand($commands, array('data' => $expected_css_html), t('Page now has the %css file.', array('%css' => $expected['css']))); // Verify the expected JS file was added, both to Drupal.settings, and as // an AJAX command for inclusion into the HTML. By testing for an exact HTML // string containing the SCRIPT tag, we also ensure that unexpected // JavaScript code, such as a jQuery.extend() that would potentially clobber // rather than properly merge settings, didn't accidentally get added. $this->assertEqual($new_js, $original_js + array($expected['js'] => 1), t('Page state now has the %js file.', array('%js' => $expected['js']))); $this->assertCommand($commands, array('data' => $expected_js_html), t('Page now has the %js file.', array('%js' => $expected['js']))); } /** * Tests that overridden CSS files are not added during lazy load. */ function testLazyLoadOverriddenCSS() { // The test theme overrides system.base.css without an implementation, // thereby removing it. theme_enable(array('test_theme')); variable_set('theme_default', 'test_theme'); // This gets the form, and emulates an Ajax submission on it, including // adding markup to the HEAD and BODY for any lazy loaded JS/CSS files. $this->drupalPostAJAX('ajax_forms_test_lazy_load_form', array('add_files' => TRUE), array('op' => t('Submit'))); // Verify that the resulting HTML does not load the overridden CSS file. // We add a "?" to the assertion, because Drupal.settings may include // information about the file; we only really care about whether it appears // in a LINK or STYLE tag, for which Drupal always adds a query string for // cache control. $this->assertNoText('system.base.css?', 'Ajax lazy loading does not add overridden CSS files.'); } } /** * Tests Ajax framework commands. */ class AJAXCommandsTestCase extends AJAXTestCase { public static function getInfo() { return array( 'name' => 'AJAX commands', 'description' => 'Performs tests on AJAX framework commands.', 'group' => 'AJAX', ); } /** * Test the various Ajax Commands. */ function testAJAXCommands() { $form_path = 'ajax_forms_test_ajax_commands_form'; $web_user = $this->drupalCreateUser(array('access content')); $this->drupalLogin($web_user); $edit = array(); // Tests the 'after' command. $commands = $this->drupalPostAJAX($form_path, $edit, array('op' => t("AJAX 'After': Click to put something after the div"))); $expected = array( 'command' => 'insert', 'method' => 'after', 'data' => 'This will be placed after', ); $this->assertCommand($commands, $expected, "'after' AJAX command issued with correct data"); // Tests the 'alert' command. $commands = $this->drupalPostAJAX($form_path, $edit, array('op' => t("AJAX 'Alert': Click to alert"))); $expected = array( 'command' => 'alert', 'text' => 'Alert', ); $this->assertCommand($commands, $expected, "'alert' AJAX Command issued with correct text"); // Tests the 'append' command. $commands = $this->drupalPostAJAX($form_path, $edit, array('op' => t("AJAX 'Append': Click to append something"))); $expected = array( 'command' => 'insert', 'method' => 'append', 'data' => 'Appended text', ); $this->assertCommand($commands, $expected, "'append' AJAX command issued with correct data"); // Tests the 'before' command. $commands = $this->drupalPostAJAX($form_path, $edit, array('op' => t("AJAX 'before': Click to put something before the div"))); $expected = array( 'command' => 'insert', 'method' => 'before', 'data' => 'Before text', ); $this->assertCommand($commands, $expected, "'before' AJAX command issued with correct data"); // Tests the 'changed' command. $commands = $this->drupalPostAJAX($form_path, $edit, array('op' => t("AJAX changed: Click to mark div changed."))); $expected = array( 'command' => 'changed', 'selector' => '#changed_div', ); $this->assertCommand($commands, $expected, "'changed' AJAX command issued with correct selector"); // Tests the 'changed' command using the second argument. $commands = $this->drupalPostAJAX($form_path, $edit, array('op' => t("AJAX changed: Click to mark div changed with asterisk."))); $expected = array( 'command' => 'changed', 'selector' => '#changed_div', 'asterisk' => '#changed_div_mark_this', ); $this->assertCommand($commands, $expected, "'changed' AJAX command (with asterisk) issued with correct selector"); // Tests the 'css' command. $commands = $this->drupalPostAJAX($form_path, $edit, array('op' => t("Set the '#box' div to be blue."))); $expected = array( 'command' => 'css', 'selector' => '#css_div', 'argument' => array('background-color' => 'blue'), ); $this->assertCommand($commands, $expected, "'css' AJAX command issued with correct selector"); // Tests the 'data' command. $commands = $this->drupalPostAJAX($form_path, $edit, array('op' => t("AJAX data command: Issue command."))); $expected = array( 'command' => 'data', 'name' => 'testkey', 'value' => 'testvalue', ); $this->assertCommand($commands, $expected, "'data' AJAX command issued with correct key and value"); // Tests the 'invoke' command. $commands = $this->drupalPostAJAX($form_path, $edit, array('op' => t("AJAX invoke command: Invoke addClass() method."))); $expected = array( 'command' => 'invoke', 'method' => 'addClass', 'arguments' => array('error'), ); $this->assertCommand($commands, $expected, "'invoke' AJAX command issued with correct method and argument"); // Tests the 'html' command. $commands = $this->drupalPostAJAX($form_path, $edit, array('op' => t("AJAX html: Replace the HTML in a selector."))); $expected = array( 'command' => 'insert', 'method' => 'html', 'data' => 'replacement text', ); $this->assertCommand($commands, $expected, "'html' AJAX command issued with correct data"); // Tests the 'insert' command. $commands = $this->drupalPostAJAX($form_path, $edit, array('op' => t("AJAX insert: Let client insert based on #ajax['method']."))); $expected = array( 'command' => 'insert', 'data' => 'insert replacement text', ); $this->assertCommand($commands, $expected, "'insert' AJAX command issued with correct data"); // Tests the 'prepend' command. $commands = $this->drupalPostAJAX($form_path, $edit, array('op' => t("AJAX 'prepend': Click to prepend something"))); $expected = array( 'command' => 'insert', 'method' => 'prepend', 'data' => 'prepended text', ); $this->assertCommand($commands, $expected, "'prepend' AJAX command issued with correct data"); // Tests the 'remove' command. $commands = $this->drupalPostAJAX($form_path, $edit, array('op' => t("AJAX 'remove': Click to remove text"))); $expected = array( 'command' => 'remove', 'selector' => '#remove_text', ); $this->assertCommand($commands, $expected, "'remove' AJAX command issued with correct command and selector"); // Tests the 'restripe' command. $commands = $this->drupalPostAJAX($form_path, $edit, array('op' => t("AJAX 'restripe' command"))); $expected = array( 'command' => 'restripe', 'selector' => '#restripe_table', ); $this->assertCommand($commands, $expected, "'restripe' AJAX command issued with correct selector"); // Tests the 'settings' command. $commands = $this->drupalPostAJAX($form_path, $edit, array('op' => t("AJAX 'settings' command"))); $expected = array( 'command' => 'settings', 'settings' => array('ajax_forms_test' => array('foo' => 42)), ); $this->assertCommand($commands, $expected, "'settings' AJAX command issued with correct data"); // Tests the 'add_css' command. $commands = $this->drupalPostAJAX($form_path, $edit, array('op' => t("AJAX 'add_css' command"))); $expected = array( 'command' => 'add_css', 'data' => 'my/file.css', ); $this->assertCommand($commands, $expected, "'add_css' AJAX command issued with correct data"); } } /** * Test that $form_state['values'] is properly delivered to $ajax['callback']. */ class AJAXFormValuesTestCase extends AJAXTestCase { public static function getInfo() { return array( 'name' => 'AJAX command form values', 'description' => 'Tests that form values are properly delivered to AJAX callbacks.', 'group' => 'AJAX', ); } function setUp() { parent::setUp(); $this->web_user = $this->drupalCreateUser(array('access content')); $this->drupalLogin($this->web_user); } /** * Create a simple form, then POST to system/ajax to change to it. */ function testSimpleAJAXFormValue() { // Verify form values of a select element. foreach (array('red', 'green', 'blue') as $item) { $edit = array( 'select' => $item, ); $commands = $this->drupalPostAJAX('ajax_forms_test_get_form', $edit, 'select'); $expected = array( 'command' => 'data', 'value' => $item, ); $this->assertCommand($commands, $expected, "verification of AJAX form values from a selectbox issued with a correct value"); } // Verify form values of a checkbox element. foreach (array(FALSE, TRUE) as $item) { $edit = array( 'checkbox' => $item, ); $commands = $this->drupalPostAJAX('ajax_forms_test_get_form', $edit, 'checkbox'); $expected = array( 'command' => 'data', 'value' => (int) $item, ); $this->assertCommand($commands, $expected, "verification of AJAX form values from a checkbox issued with a correct value"); } } } /** * Tests that Ajax-enabled forms work when multiple instances of the same form are on a page. */ class AJAXMultiFormTestCase extends AJAXTestCase { public static function getInfo() { return array( 'name' => 'AJAX multi form', 'description' => 'Tests that AJAX-enabled forms work when multiple instances of the same form are on a page.', 'group' => 'AJAX', ); } function setUp() { parent::setUp(array('form_test')); // Create a multi-valued field for 'page' nodes to use for Ajax testing. $field_name = 'field_ajax_test'; $field = array( 'field_name' => $field_name, 'type' => 'text', 'cardinality' => FIELD_CARDINALITY_UNLIMITED, ); field_create_field($field); $instance = array( 'field_name' => $field_name, 'entity_type' => 'node', 'bundle' => 'page', ); field_create_instance($instance); // Login a user who can create 'page' nodes. $this->web_user = $this->drupalCreateUser(array('create page content')); $this->drupalLogin($this->web_user); } /** * Test that a page with the 'page_node_form' included twice works correctly. */ function testMultiForm() { // HTML IDs for elements within the field are potentially modified with // each Ajax submission, but these variables are stable and help target the // desired elements. $field_name = 'field_ajax_test'; $field_xpaths = array( 'page-node-form' => '//form[@id="page-node-form"]//div[contains(@class, "field-name-field-ajax-test")]', 'page-node-form--2' => '//form[@id="page-node-form--2"]//div[contains(@class, "field-name-field-ajax-test")]', ); $button_name = $field_name . '_add_more'; $button_value = t('Add another item'); $button_xpath_suffix = '//input[@name="' . $button_name . '"]'; $field_items_xpath_suffix = '//input[@type="text"]'; // Ensure the initial page contains both node forms and the correct number // of field items and "add more" button for the multi-valued field within // each form. $this->drupalGet('form-test/two-instances-of-same-form'); foreach ($field_xpaths as $form_html_id => $field_xpath) { $this->assert(count($this->xpath($field_xpath . $field_items_xpath_suffix)) == 1, t('Found the correct number of field items on the initial page.')); $this->assertFieldByXPath($field_xpath . $button_xpath_suffix, NULL, t('Found the "add more" button on the initial page.')); } $this->assertNoDuplicateIds(t('Initial page contains unique IDs'), 'Other'); // Submit the "add more" button of each form twice. After each corresponding // page update, ensure the same as above. foreach ($field_xpaths as $form_html_id => $field_xpath) { for ($i = 0; $i < 2; $i++) { $this->drupalPostAJAX(NULL, array(), array($button_name => $button_value), 'system/ajax', array(), array(), $form_html_id); $this->assert(count($this->xpath($field_xpath . $field_items_xpath_suffix)) == $i+2, t('Found the correct number of field items after an AJAX submission.')); $this->assertFieldByXPath($field_xpath . $button_xpath_suffix, NULL, t('Found the "add more" button after an AJAX submission.')); $this->assertNoDuplicateIds(t('Updated page contains unique IDs'), 'Other'); } } } } /** * Test Ajax forms when page caching for anonymous users is turned on. */ class AJAXFormPageCacheTestCase extends AJAXTestCase { protected $profile = 'testing'; public static function getInfo() { return array( 'name' => 'AJAX forms on cached pages', 'description' => 'Tests that AJAX forms work properly for anonymous users on cached pages.', 'group' => 'AJAX', ); } public function setUp() { parent::setUp(); variable_set('cache', TRUE); } /** * Return the build id of the current form. */ protected function getFormBuildId() { $build_id_fields = $this->xpath('//input[@name="form_build_id"]'); $this->assertEqual(count($build_id_fields), 1, 'One form build id field on the page'); return (string) $build_id_fields[0]['value']; } /** * Create a simple form, then POST to system/ajax to change to it. */ public function testSimpleAJAXFormValue() { $this->drupalGet('ajax_forms_test_get_form'); $this->assertEqual($this->drupalGetHeader('X-Drupal-Cache'), 'MISS', 'Page was not cached.'); $build_id_initial = $this->getFormBuildId(); $edit = array('select' => 'green'); $commands = $this->drupalPostAJAX(NULL, $edit, 'select'); $build_id_first_ajax = $this->getFormBuildId(); $this->assertNotEqual($build_id_initial, $build_id_first_ajax, 'Build id is changed in the simpletest-DOM on first AJAX submission'); $expected = array( 'command' => 'updateBuildId', 'old' => $build_id_initial, 'new' => $build_id_first_ajax, ); $this->assertCommand($commands, $expected, 'Build id change command issued on first AJAX submission'); $edit = array('select' => 'red'); $commands = $this->drupalPostAJAX(NULL, $edit, 'select'); $build_id_second_ajax = $this->getFormBuildId(); $this->assertEqual($build_id_first_ajax, $build_id_second_ajax, 'Build id remains the same on subsequent AJAX submissions'); // Repeat the test sequence but this time with a page loaded from the cache. $this->drupalGet('ajax_forms_test_get_form'); $this->assertEqual($this->drupalGetHeader('X-Drupal-Cache'), 'HIT', 'Page was cached.'); $build_id_from_cache_initial = $this->getFormBuildId(); $this->assertEqual($build_id_initial, $build_id_from_cache_initial, 'Build id is the same as on the first request'); $edit = array('select' => 'green'); $commands = $this->drupalPostAJAX(NULL, $edit, 'select'); $build_id_from_cache_first_ajax = $this->getFormBuildId(); $this->assertNotEqual($build_id_from_cache_initial, $build_id_from_cache_first_ajax, 'Build id is changed in the simpletest-DOM on first AJAX submission'); $this->assertNotEqual($build_id_first_ajax, $build_id_from_cache_first_ajax, 'Build id from first user is not reused'); $expected = array( 'command' => 'updateBuildId', 'old' => $build_id_from_cache_initial, 'new' => $build_id_from_cache_first_ajax, ); $this->assertCommand($commands, $expected, 'Build id change command issued on first AJAX submission'); $edit = array('select' => 'red'); $commands = $this->drupalPostAJAX(NULL, $edit, 'select'); $build_id_from_cache_second_ajax = $this->getFormBuildId(); $this->assertEqual($build_id_from_cache_first_ajax, $build_id_from_cache_second_ajax, 'Build id remains the same on subsequent AJAX submissions'); } } /** * Miscellaneous Ajax tests using ajax_test module. */ class AJAXElementValidation extends AJAXTestCase { public static function getInfo() { return array( 'name' => 'Miscellaneous AJAX tests', 'description' => 'Various tests of AJAX behavior', 'group' => 'AJAX', ); } /** * Try to post an Ajax change to a form that has a validated element. * * The drivertext field is Ajax-enabled. An additional field is not, but * is set to be a required field. In this test the required field is not * filled in, and we want to see if the activation of the "drivertext" * Ajax-enabled field fails due to the required field being empty. */ function testAJAXElementValidation() { $web_user = $this->drupalCreateUser(); $edit = array('drivertext' => t('some dumb text')); // Post with 'drivertext' as the triggering element. $post_result = $this->drupalPostAJAX('ajax_validation_test', $edit, 'drivertext'); // Look for a validation failure in the resultant JSON. $this->assertNoText(t('Error message'), "No error message in resultant JSON"); $this->assertText('ajax_forms_test_validation_form_callback invoked', 'The correct callback was invoked'); } } drupal-7.41/modules/simpletest/tests/entity_cache_test.info0000644000000000000000000000047712611767501023026 0ustar rootrootname = "Entity cache test" description = "Support module for testing entity cache." package = Testing version = VERSION core = 7.x dependencies[] = entity_cache_test_dependency hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/system_incompatible_core_version_dependencies_test.info0000644000000000000000000000056012611767501031715 0ustar rootrootname = "System incompatible core version dependencies test" description = "Support module for testing system dependencies." package = Testing version = VERSION core = 7.x hidden = TRUE dependencies[] = system_incompatible_core_version_test ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/path.test0000644000000000000000000003242012611765734020307 0ustar rootroot 'Drupal match path', 'description' => 'Tests the drupal_match_path() function to make sure it works properly.', 'group' => 'Path API', ); } function setUp() { // Set up the database and testing environment. parent::setUp(); // Set up a random site front page to test the '' placeholder. $this->front = $this->randomName(); variable_set('site_frontpage', $this->front); // Refresh our static variables from the database. $this->refreshVariables(); } /** * Run through our test cases, making sure each one works as expected. */ function testDrupalMatchPath() { // Set up our test cases. $tests = $this->drupalMatchPathTests(); foreach ($tests as $patterns => $cases) { foreach ($cases as $path => $expected_result) { $actual_result = drupal_match_path($path, $patterns); $this->assertIdentical($actual_result, $expected_result, format_string('Tried matching the path @path to the pattern 
              @patterns
              - expected @expected, got @actual.', array('@path' => $path, '@patterns' => $patterns, '@expected' => var_export($expected_result, TRUE), '@actual' => var_export($actual_result, TRUE)))); } } } /** * Helper function for testDrupalMatchPath(): set up an array of test cases. * * @return * An array of test cases to cycle through. */ private function drupalMatchPathTests() { return array( // Single absolute paths. 'blog/1' => array( 'blog/1' => TRUE, 'blog/2' => FALSE, 'test' => FALSE, ), // Single paths with wildcards. 'blog/*' => array( 'blog/1' => TRUE, 'blog/2' => TRUE, 'blog/3/edit' => TRUE, 'blog/' => TRUE, 'blog' => FALSE, 'test' => FALSE, ), // Single paths with multiple wildcards. 'node/*/revisions/*' => array( 'node/1/revisions/3' => TRUE, 'node/345/revisions/test' => TRUE, 'node/23/edit' => FALSE, 'test' => FALSE, ), // Single paths with ''. '' => array( $this->front => TRUE, "$this->front/" => FALSE, "$this->front/edit" => FALSE, 'node' => FALSE, '' => FALSE, ), // Paths with both '' and wildcards (should not work). '/*' => array( $this->front => FALSE, "$this->front/" => FALSE, "$this->front/edit" => FALSE, 'node/12' => FALSE, '' => FALSE, ), // Multiple paths with the \n delimiter. "node/*\nnode/*/edit" => array( 'node/1' => TRUE, 'node/view' => TRUE, 'node/32/edit' => TRUE, 'node/delete/edit' => TRUE, 'node/50/delete' => TRUE, 'test/example' => FALSE, ), // Multiple paths with the \r delimiter. "user/*\rblog/*" => array( 'user/1' => TRUE, 'blog/1' => TRUE, 'user/1/blog/1' => TRUE, 'user/blog' => TRUE, 'test/example' => FALSE, 'user' => FALSE, 'blog' => FALSE, ), // Multiple paths with the \r\n delimiter. "test\r\n" => array( 'test' => TRUE, $this->front => TRUE, 'example' => FALSE, ), // Test existing regular expressions (should be escaped). '[^/]+?/[0-9]' => array( 'test/1' => FALSE, '[^/]+?/[0-9]' => TRUE, ), ); } } /** * Tests hook_url_alter functions. */ class UrlAlterFunctionalTest extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => t('URL altering'), 'description' => t('Tests hook_url_inbound_alter() and hook_url_outbound_alter().'), 'group' => t('Path API'), ); } function setUp() { parent::setUp('path', 'forum', 'url_alter_test'); } /** * Test that URL altering works and that it occurs in the correct order. */ function testUrlAlter() { $account = $this->drupalCreateUser(array('administer url aliases')); $this->drupalLogin($account); $uid = $account->uid; $name = $account->name; // Test a single altered path. $this->assertUrlInboundAlter("user/$name", "user/$uid"); $this->assertUrlOutboundAlter("user/$uid", "user/$name"); // Test that a path always uses its alias. $path = array('source' => "user/$uid/test1", 'alias' => 'alias/test1'); path_save($path); $this->assertUrlInboundAlter('alias/test1', "user/$uid/test1"); $this->assertUrlOutboundAlter("user/$uid/test1", 'alias/test1'); // Test that alias source paths are normalized in the interface. $edit = array('source' => "user/$name/edit", 'alias' => 'alias/test2'); $this->drupalPost('admin/config/search/path/add', $edit, t('Save')); $this->assertText(t('The alias has been saved.')); // Test that a path always uses its alias. $this->assertUrlInboundAlter('alias/test2', "user/$uid/edit"); $this->assertUrlOutboundAlter("user/$uid/edit", 'alias/test2'); // Test a non-existent user is not altered. $uid++; $this->assertUrlInboundAlter("user/$uid", "user/$uid"); $this->assertUrlOutboundAlter("user/$uid", "user/$uid"); // Test that 'forum' is altered to 'community' correctly, both at the root // level and for a specific existing forum. $this->assertUrlInboundAlter('community', 'forum'); $this->assertUrlOutboundAlter('forum', 'community'); $forum_vid = db_query("SELECT vid FROM {taxonomy_vocabulary} WHERE module = 'forum'")->fetchField(); $tid = db_insert('taxonomy_term_data') ->fields(array( 'name' => $this->randomName(), 'vid' => $forum_vid, )) ->execute(); $this->assertUrlInboundAlter("community/$tid", "forum/$tid"); $this->assertUrlOutboundAlter("forum/$tid", "community/$tid"); } /** * Test current_path() and request_path(). */ function testCurrentUrlRequestedPath() { $this->drupalGet('url-alter-test/bar'); $this->assertRaw('request_path=url-alter-test/bar', 'request_path() returns the requested path.'); $this->assertRaw('current_path=url-alter-test/foo', 'current_path() returns the internal path.'); } /** * Tests that $_GET['q'] is initialized when the request path is empty. */ function testGetQInitialized() { $this->drupalGet(''); $this->assertText("\$_GET['q'] is non-empty with an empty request path.", "\$_GET['q'] is initialized with an empty request path."); } /** * Assert that an outbound path is altered to an expected value. * * @param $original * A string with the original path that is run through url(). * @param $final * A string with the expected result after url(). * @return * TRUE if $original was correctly altered to $final, FALSE otherwise. */ protected function assertUrlOutboundAlter($original, $final) { // Test outbound altering. $result = url($original); $base_path = base_path() . (variable_get('clean_url', '0') ? '' : '?q='); $result = substr($result, strlen($base_path)); $this->assertIdentical($result, $final, format_string('Altered outbound URL %original, expected %final, and got %result.', array('%original' => $original, '%final' => $final, '%result' => $result))); } /** * Assert that a inbound path is altered to an expected value. * * @param $original * A string with the aliased or un-normal path that is run through * drupal_get_normal_path(). * @param $final * A string with the expected result after url(). * @return * TRUE if $original was correctly altered to $final, FALSE otherwise. */ protected function assertUrlInboundAlter($original, $final) { // Test inbound altering. $result = drupal_get_normal_path($original); $this->assertIdentical($result, $final, format_string('Altered inbound URL %original, expected %final, and got %result.', array('%original' => $original, '%final' => $final, '%result' => $result))); } } /** * Unit test for drupal_lookup_path(). */ class PathLookupTest extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => t('Path lookup'), 'description' => t('Tests that drupal_lookup_path() returns correct paths.'), 'group' => t('Path API'), ); } /** * Test that drupal_lookup_path() returns the correct path. */ function testDrupalLookupPath() { $account = $this->drupalCreateUser(); $uid = $account->uid; $name = $account->name; // Test the situation where the source is the same for multiple aliases. // Start with a language-neutral alias, which we will override. $path = array( 'source' => "user/$uid", 'alias' => 'foo', ); path_save($path); $this->assertEqual(drupal_lookup_path('alias', $path['source']), $path['alias'], 'Basic alias lookup works.'); $this->assertEqual(drupal_lookup_path('source', $path['alias']), $path['source'], 'Basic source lookup works.'); // Create a language specific alias for the default language (English). $path = array( 'source' => "user/$uid", 'alias' => "users/$name", 'language' => 'en', ); path_save($path); $this->assertEqual(drupal_lookup_path('alias', $path['source']), $path['alias'], 'English alias overrides language-neutral alias.'); $this->assertEqual(drupal_lookup_path('source', $path['alias']), $path['source'], 'English source overrides language-neutral source.'); // Create a language-neutral alias for the same path, again. $path = array( 'source' => "user/$uid", 'alias' => 'bar', ); path_save($path); $this->assertEqual(drupal_lookup_path('alias', $path['source']), "users/$name", 'English alias still returned after entering a language-neutral alias.'); // Create a language-specific (xx-lolspeak) alias for the same path. $path = array( 'source' => "user/$uid", 'alias' => 'LOL', 'language' => 'xx-lolspeak', ); path_save($path); $this->assertEqual(drupal_lookup_path('alias', $path['source']), "users/$name", 'English alias still returned after entering a LOLspeak alias.'); // The LOLspeak alias should be returned if we really want LOLspeak. $this->assertEqual(drupal_lookup_path('alias', $path['source'], 'xx-lolspeak'), 'LOL', 'LOLspeak alias returned if we specify xx-lolspeak to drupal_lookup_path().'); // Create a new alias for this path in English, which should override the // previous alias for "user/$uid". $path = array( 'source' => "user/$uid", 'alias' => 'users/my-new-path', 'language' => 'en', ); path_save($path); $this->assertEqual(drupal_lookup_path('alias', $path['source']), $path['alias'], 'Recently created English alias returned.'); $this->assertEqual(drupal_lookup_path('source', $path['alias']), $path['source'], 'Recently created English source returned.'); // Remove the English aliases, which should cause a fallback to the most // recently created language-neutral alias, 'bar'. db_delete('url_alias') ->condition('language', 'en') ->execute(); drupal_clear_path_cache(); $this->assertEqual(drupal_lookup_path('alias', $path['source']), 'bar', 'Path lookup falls back to recently created language-neutral alias.'); // Test the situation where the alias and language are the same, but // the source differs. The newer alias record should be returned. $account2 = $this->drupalCreateUser(); $path = array( 'source' => 'user/' . $account2->uid, 'alias' => 'bar', ); path_save($path); $this->assertEqual(drupal_lookup_path('source', $path['alias']), $path['source'], 'Newer alias record is returned when comparing two LANGUAGE_NONE paths with the same alias.'); } } /** * Tests the path_save() function. */ class PathSaveTest extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => t('Path save'), 'description' => t('Tests that path_save() exposes the previous alias value.'), 'group' => t('Path API'), ); } function setUp() { // Enable a helper module that implements hook_path_update(). parent::setUp('path_test'); path_test_reset(); } /** * Tests that path_save() makes the original path available to modules. */ function testDrupalSaveOriginalPath() { $account = $this->drupalCreateUser(); $uid = $account->uid; $name = $account->name; // Create a language-neutral alias. $path = array( 'source' => "user/$uid", 'alias' => 'foo', ); $path_original = $path; path_save($path); // Alter the path. $path['alias'] = 'bar'; path_save($path); // Test to see if the original alias is available to modules during // hook_path_update(). $results = variable_get('path_test_results', array()); $this->assertIdentical($results['hook_path_update']['original']['alias'], $path_original['alias'], 'Old path alias available to modules during hook_path_update.'); $this->assertIdentical($results['hook_path_update']['original']['source'], $path_original['source'], 'Old path alias available to modules during hook_path_update.'); } } drupal-7.41/modules/simpletest/tests/common_test_info.txt0000644000000000000000000000051612611765734022556 0ustar rootroot; Test parsing with a simple string. simple_string = A simple string ; Test that constants can be used as values. simple_constant = WATCHDOG_INFO ; After parsing the .info file, 'double_colon' should hold the literal value. ; Parsing should not throw a fatal error or try to access a class constant. double_colon = dummyClassName:: drupal-7.41/modules/simpletest/tests/system_dependencies_test.module0000644000000000000000000000000612611765734024745 0ustar rootroot 'Update script test', 'value' => 'Warning', 'description' => 'This is a requirements warning provided by the update_script_test module.', 'severity' => REQUIREMENT_WARNING, ); break; case REQUIREMENT_ERROR: $requirements['update_script_test'] = array( 'title' => 'Update script test', 'value' => 'Error', 'description' => 'This is a requirements error provided by the update_script_test module.', 'severity' => REQUIREMENT_ERROR, ); break; } } return $requirements; } /** * Dummy update function to run during the tests. */ function update_script_test_update_7000() { return t('The update_script_test_update_7000() update was executed successfully.'); } drupal-7.41/modules/simpletest/tests/entity_query_access_test.module0000644000000000000000000000277712611765734025016 0ustar rootroot "Retrieve a sample of entity query access data", 'page callback' => 'entity_query_access_test_sample_query', 'page arguments' => array(2), 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); return $items; } /** * Returns the results from an example EntityFieldQuery. */ function entity_query_access_test_sample_query($field_name) { global $user; // Simulate user does not have access to view all nodes. $access = &drupal_static('node_access_view_all_nodes'); $access[$user->uid] = FALSE; $query = new EntityFieldQuery(); $query ->entityCondition('entity_type', 'test_entity_bundle_key') ->fieldCondition($field_name, 'value', 0, '>') ->entityOrderBy('entity_id', 'ASC'); $results = array( 'items' => array(), 'title' => t('EntityFieldQuery results'), ); foreach ($query->execute() as $entity_type => $entity_ids) { foreach ($entity_ids as $entity_id => $entity_stub) { $results['items'][] = format_string('Found entity of type @entity_type with id @entity_id', array('@entity_type' => $entity_type, '@entity_id' => $entity_id)); } } if (count($results['items']) > 0) { $output = theme('item_list', $results); } else { $output = 'No results found with EntityFieldQuery.'; } return $output; } drupal-7.41/modules/simpletest/tests/theme.test0000644000000000000000000006257212611765734020470 0ustar rootroot 'Theme API', 'description' => 'Test low-level theme functions.', 'group' => 'Theme', ); } function setUp() { parent::setUp('theme_test'); theme_enable(array('test_theme')); } /** * Test function theme_get_suggestions() for SA-CORE-2009-003. */ function testThemeSuggestions() { // Set the front page as something random otherwise the CLI // test runner fails. variable_set('site_frontpage', 'nobody-home'); $args = array('node', '1', 'edit'); $suggestions = theme_get_suggestions($args, 'page'); $this->assertEqual($suggestions, array('page__node', 'page__node__%', 'page__node__1', 'page__node__edit'), 'Found expected node edit page suggestions'); // Check attack vectors. $args = array('node', '\\1'); $suggestions = theme_get_suggestions($args, 'page'); $this->assertEqual($suggestions, array('page__node', 'page__node__%', 'page__node__1'), 'Removed invalid \\ from suggestions'); $args = array('node', '1/'); $suggestions = theme_get_suggestions($args, 'page'); $this->assertEqual($suggestions, array('page__node', 'page__node__%', 'page__node__1'), 'Removed invalid / from suggestions'); $args = array('node', "1\0"); $suggestions = theme_get_suggestions($args, 'page'); $this->assertEqual($suggestions, array('page__node', 'page__node__%', 'page__node__1'), 'Removed invalid \\0 from suggestions'); // Define path with hyphens to be used to generate suggestions. $args = array('node', '1', 'hyphen-path'); $result = array('page__node', 'page__node__%', 'page__node__1', 'page__node__hyphen_path'); $suggestions = theme_get_suggestions($args, 'page'); $this->assertEqual($suggestions, $result, 'Found expected page suggestions for paths containing hyphens.'); } /** * Ensures preprocess functions run even for suggestion implementations. * * The theme hook used by this test has its base preprocess function in a * separate file, so this test also ensures that that file is correctly loaded * when needed. */ function testPreprocessForSuggestions() { // Test with both an unprimed and primed theme registry. drupal_theme_rebuild(); for ($i = 0; $i < 2; $i++) { $this->drupalGet('theme-test/suggestion'); $this->assertText('Theme hook implementor=test_theme_theme_test__suggestion(). Foo=template_preprocess_theme_test', 'Theme hook suggestion ran with data available from a preprocess function for the base hook.'); } } /** * Ensure page-front template suggestion is added when on front page. */ function testFrontPageThemeSuggestion() { $q = $_GET['q']; // Set $_GET['q'] to node because theme_get_suggestions() will query it to // see if we are on the front page. $_GET['q'] = variable_get('site_frontpage', 'node'); $suggestions = theme_get_suggestions(explode('/', $_GET['q']), 'page'); // Set it back to not annoy the batch runner. $_GET['q'] = $q; $this->assertTrue(in_array('page__front', $suggestions), 'Front page template was suggested.'); } /** * Ensures theme hook_*_alter() implementations can run before anything is rendered. */ function testAlter() { $this->drupalGet('theme-test/alter'); $this->assertText('The altered data is test_theme_theme_test_alter_alter was invoked.', 'The theme was able to implement an alter hook during page building before anything was rendered.'); } /** * Ensures a theme's .info file is able to override a module CSS file from being added to the page. * * @see test_theme.info */ function testCSSOverride() { // Reuse the same page as in testPreprocessForSuggestions(). We're testing // what is output to the HTML HEAD based on what is in a theme's .info file, // so it doesn't matter what page we get, as long as it is themed with the // test theme. First we test with CSS aggregation disabled. variable_set('preprocess_css', 0); $this->drupalGet('theme-test/suggestion'); $this->assertNoText('system.base.css', 'The theme\'s .info file is able to override a module CSS file from being added to the page.'); // Also test with aggregation enabled, simply ensuring no PHP errors are // triggered during drupal_build_css_cache() when a source file doesn't // exist. Then allow remaining tests to continue with aggregation disabled // by default. variable_set('preprocess_css', 1); $this->drupalGet('theme-test/suggestion'); variable_set('preprocess_css', 0); } /** * Ensures the theme registry is rebuilt when modules are disabled/enabled. */ function testRegistryRebuild() { $this->assertIdentical(theme('theme_test_foo', array('foo' => 'a')), 'a', 'The theme registry contains theme_test_foo.'); module_disable(array('theme_test'), FALSE); $this->assertIdentical(theme('theme_test_foo', array('foo' => 'b')), '', 'The theme registry does not contain theme_test_foo, because the module is disabled.'); module_enable(array('theme_test'), FALSE); $this->assertIdentical(theme('theme_test_foo', array('foo' => 'c')), 'c', 'The theme registry contains theme_test_foo again after re-enabling the module.'); } /** * Test the list_themes() function. */ function testListThemes() { $themes = list_themes(); // Check if drupal_theme_access() retrieves enabled themes properly from list_themes(). $this->assertTrue(drupal_theme_access('test_theme'), 'Enabled theme detected'); // Check if list_themes() returns disabled themes. $this->assertTrue(array_key_exists('test_basetheme', $themes), 'Disabled theme detected'); // Check for base theme and subtheme lists. $base_theme_list = array('test_basetheme' => 'Theme test base theme'); $sub_theme_list = array('test_subtheme' => 'Theme test subtheme'); $this->assertIdentical($themes['test_basetheme']->sub_themes, $sub_theme_list, 'Base theme\'s object includes list of subthemes.'); $this->assertIdentical($themes['test_subtheme']->base_themes, $base_theme_list, 'Subtheme\'s object includes list of base themes.'); // Check for theme engine in subtheme. $this->assertIdentical($themes['test_subtheme']->engine, 'phptemplate', 'Subtheme\'s object includes the theme engine.'); // Check for theme engine prefix. $this->assertIdentical($themes['test_basetheme']->prefix, 'phptemplate', 'Base theme\'s object includes the theme engine prefix.'); $this->assertIdentical($themes['test_subtheme']->prefix, 'phptemplate', 'Subtheme\'s object includes the theme engine prefix.'); } /** * Test the theme_get_setting() function. */ function testThemeGetSetting() { $GLOBALS['theme_key'] = 'test_theme'; $this->assertIdentical(theme_get_setting('theme_test_setting'), 'default value', 'theme_get_setting() uses the default theme automatically.'); $this->assertNotEqual(theme_get_setting('subtheme_override', 'test_basetheme'), theme_get_setting('subtheme_override', 'test_subtheme'), 'Base theme\'s default settings values can be overridden by subtheme.'); $this->assertIdentical(theme_get_setting('basetheme_only', 'test_subtheme'), 'base theme value', 'Base theme\'s default settings values are inherited by subtheme.'); } /** * Test the drupal_add_region_content() function. */ function testDrupalAddRegionContent() { $this->drupalGet('theme-test/drupal-add-region-content'); $this->assertText('Hello'); $this->assertText('World'); } } /** * Unit tests for theme_table(). */ class ThemeTableTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Theme Table', 'description' => 'Tests built-in theme functions.', 'group' => 'Theme', ); } /** * Tableheader.js provides 'sticky' table headers, and is included by default. */ function testThemeTableStickyHeaders() { $header = array('one', 'two', 'three'); $rows = array(array(1,2,3), array(4,5,6), array(7,8,9)); $this->content = theme('table', array('header' => $header, 'rows' => $rows)); $js = drupal_add_js(); $this->assertTrue(isset($js['misc/tableheader.js']), 'tableheader.js was included when $sticky = TRUE.'); $this->assertRaw('sticky-enabled', 'Table has a class of sticky-enabled when $sticky = TRUE.'); drupal_static_reset('drupal_add_js'); } /** * If $sticky is FALSE, no tableheader.js should be included. */ function testThemeTableNoStickyHeaders() { $header = array('one', 'two', 'three'); $rows = array(array(1,2,3), array(4,5,6), array(7,8,9)); $attributes = array(); $caption = NULL; $colgroups = array(); $this->content = theme('table', array('header' => $header, 'rows' => $rows, 'attributes' => $attributes, 'caption' => $caption, 'colgroups' => $colgroups, 'sticky' => FALSE)); $js = drupal_add_js(); $this->assertFalse(isset($js['misc/tableheader.js']), 'tableheader.js was not included because $sticky = FALSE.'); $this->assertNoRaw('sticky-enabled', 'Table does not have a class of sticky-enabled because $sticky = FALSE.'); drupal_static_reset('drupal_add_js'); } /** * Tests that the table header is printed correctly even if there are no rows, * and that the empty text is displayed correctly. */ function testThemeTableWithEmptyMessage() { $header = array( t('Header 1'), array( 'data' => t('Header 2'), 'colspan' => 2, ), ); $this->content = theme('table', array('header' => $header, 'rows' => array(), 'empty' => t('No strings available.'))); $this->assertRaw('No strings available.', 'Correct colspan was set on empty message.'); $this->assertRaw('Header 1', 'Table header was printed.'); } /** * Tests that the 'no_striping' option works correctly. */ function testThemeTableWithNoStriping() { $rows = array( array( 'data' => array(1), 'no_striping' => TRUE, ), ); $this->content = theme('table', array('rows' => $rows)); $this->assertNoRaw('class="odd"', 'Odd/even classes were not added because $no_striping = TRUE.'); $this->assertNoRaw('no_striping', 'No invalid no_striping HTML attribute was printed.'); } } /** * Unit tests for theme_item_list(). */ class ThemeItemListUnitTest extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Theme item list', 'description' => 'Test the theme_item_list() function.', 'group' => 'Theme', ); } /** * Test item list rendering. */ function testItemList() { $items = array('a', array('data' => 'b', 'children' => array('c' => 'c', 'd' => 'd', 'e' => 'e')), 'f'); $expected = '
              • a
              • b
                • c
                • d
                • e
              • f
              '; $output = theme('item_list', array('items' => $items)); $this->assertIdentical($expected, $output, 'Item list is rendered correctly.'); } } /** * Unit tests for theme_links(). */ class ThemeLinksTest extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Links', 'description' => 'Test the theme_links() function and rendering groups of links.', 'group' => 'Theme', ); } /** * Test the use of drupal_pre_render_links() on a nested array of links. */ function testDrupalPreRenderLinks() { // Define the base array to be rendered, containing a variety of different // kinds of links. $base_array = array( '#theme' => 'links', '#pre_render' => array('drupal_pre_render_links'), '#links' => array( 'parent_link' => array( 'title' => 'Parent link original', 'href' => 'parent-link-original', ), ), 'first_child' => array( '#theme' => 'links', '#links' => array( // This should be rendered if 'first_child' is rendered separately, // but ignored if the parent is being rendered (since it duplicates // one of the parent's links). 'parent_link' => array( 'title' => 'Parent link copy', 'href' => 'parent-link-copy', ), // This should always be rendered. 'first_child_link' => array( 'title' => 'First child link', 'href' => 'first-child-link', ), ), ), // This should always be rendered as part of the parent. 'second_child' => array( '#theme' => 'links', '#links' => array( 'second_child_link' => array( 'title' => 'Second child link', 'href' => 'second-child-link', ), ), ), // This should never be rendered, since the user does not have access to // it. 'third_child' => array( '#theme' => 'links', '#links' => array( 'third_child_link' => array( 'title' => 'Third child link', 'href' => 'third-child-link', ), ), '#access' => FALSE, ), ); // Start with a fresh copy of the base array, and try rendering the entire // thing. We expect a single
                with appropriate links contained within // it. $render_array = $base_array; $html = drupal_render($render_array); $dom = new DOMDocument(); $dom->loadHTML($html); $this->assertEqual($dom->getElementsByTagName('ul')->length, 1, 'One "ul" tag found in the rendered HTML.'); $list_elements = $dom->getElementsByTagName('li'); $this->assertEqual($list_elements->length, 3, 'Three "li" tags found in the rendered HTML.'); $this->assertEqual($list_elements->item(0)->nodeValue, 'Parent link original', 'First expected link found.'); $this->assertEqual($list_elements->item(1)->nodeValue, 'First child link', 'Second expected link found.'); $this->assertEqual($list_elements->item(2)->nodeValue, 'Second child link', 'Third expected link found.'); $this->assertIdentical(strpos($html, 'Parent link copy'), FALSE, '"Parent link copy" link not found.'); $this->assertIdentical(strpos($html, 'Third child link'), FALSE, '"Third child link" link not found.'); // Now render 'first_child', followed by the rest of the links, and make // sure we get two separate
                  's with the appropriate links contained // within each. $render_array = $base_array; $child_html = drupal_render($render_array['first_child']); $parent_html = drupal_render($render_array); // First check the child HTML. $dom = new DOMDocument(); $dom->loadHTML($child_html); $this->assertEqual($dom->getElementsByTagName('ul')->length, 1, 'One "ul" tag found in the rendered child HTML.'); $list_elements = $dom->getElementsByTagName('li'); $this->assertEqual($list_elements->length, 2, 'Two "li" tags found in the rendered child HTML.'); $this->assertEqual($list_elements->item(0)->nodeValue, 'Parent link copy', 'First expected link found.'); $this->assertEqual($list_elements->item(1)->nodeValue, 'First child link', 'Second expected link found.'); // Then check the parent HTML. $dom = new DOMDocument(); $dom->loadHTML($parent_html); $this->assertEqual($dom->getElementsByTagName('ul')->length, 1, 'One "ul" tag found in the rendered parent HTML.'); $list_elements = $dom->getElementsByTagName('li'); $this->assertEqual($list_elements->length, 2, 'Two "li" tags found in the rendered parent HTML.'); $this->assertEqual($list_elements->item(0)->nodeValue, 'Parent link original', 'First expected link found.'); $this->assertEqual($list_elements->item(1)->nodeValue, 'Second child link', 'Second expected link found.'); $this->assertIdentical(strpos($parent_html, 'First child link'), FALSE, '"First child link" link not found.'); $this->assertIdentical(strpos($parent_html, 'Third child link'), FALSE, '"Third child link" link not found.'); } } /** * Functional test for initialization of the theme system in hook_init(). */ class ThemeHookInitTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Theme initialization in hook_init()', 'description' => 'Tests that the theme system can be correctly initialized in hook_init().', 'group' => 'Theme', ); } function setUp() { parent::setUp('theme_test'); } /** * Test that the theme system can generate output when called by hook_init(). */ function testThemeInitializationHookInit() { $this->drupalGet('theme-test/hook-init'); $this->assertRaw('Themed output generated in hook_init()', 'Themed output generated in hook_init() correctly appears on the page.'); $this->assertRaw('bartik/css/style.css', "The default theme's CSS appears on the page when the theme system is initialized in hook_init()."); } } /** * Tests autocompletion not loading registry. */ class ThemeFastTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Theme fast initialization', 'description' => 'Test that autocompletion does not load the registry.', 'group' => 'Theme' ); } function setUp() { parent::setUp('theme_test'); $this->account = $this->drupalCreateUser(array('access user profiles')); } /** * Tests access to user autocompletion and verify the correct results. */ function testUserAutocomplete() { $this->drupalLogin($this->account); $this->drupalGet('user/autocomplete/' . $this->account->name); $this->assertText('registry not initialized', 'The registry was not initialized'); } } /** * Tests the markup of core render element types passed to drupal_render(). */ class RenderElementTypesTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Render element types', 'description' => 'Tests the markup of core render element types passed to drupal_render().', 'group' => 'Theme', ); } /** * Asserts that an array of elements is rendered properly. * * @param array $elements * An array of associative arrays describing render elements and their * expected markup. Each item in $elements must contain the following: * - 'name': This human readable description will be displayed on the test * results page. * - 'value': This is the render element to test. * - 'expected': This is the expected markup for the element in 'value'. */ function assertElements($elements) { foreach($elements as $element) { $this->assertIdentical(drupal_render($element['value']), $element['expected'], '"' . $element['name'] . '" input rendered correctly by drupal_render().'); } } /** * Tests system #type 'container'. */ function testContainer() { $elements = array( // Basic container with no attributes. array( 'name' => "#type 'container' with no HTML attributes", 'value' => array( '#type' => 'container', 'child' => array( '#markup' => 'foo', ), ), 'expected' => '
                  foo
                  ', ), // Container with a class. array( 'name' => "#type 'container' with a class HTML attribute", 'value' => array( '#type' => 'container', 'child' => array( '#markup' => 'foo', ), '#attributes' => array( 'class' => 'bar', ), ), 'expected' => '
                  foo
                  ', ), ); $this->assertElements($elements); } /** * Tests system #type 'html_tag'. */ function testHtmlTag() { $elements = array( // Test auto-closure meta tag generation. array( 'name' => "#type 'html_tag' auto-closure meta tag generation", 'value' => array( '#type' => 'html_tag', '#tag' => 'meta', '#attributes' => array( 'name' => 'description', 'content' => 'Drupal test', ), ), 'expected' => '' . "\n", ), // Test title tag generation. array( 'name' => "#type 'html_tag' title tag generation", 'value' => array( '#type' => 'html_tag', '#tag' => 'title', '#value' => 'title test', ), 'expected' => 'title test' . "\n", ), ); $this->assertElements($elements); } } /** * Tests for the ThemeRegistry class. */ class ThemeRegistryTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'ThemeRegistry', 'description' => 'Tests the behavior of the ThemeRegistry class', 'group' => 'Theme', ); } function setUp() { parent::setUp('theme_test'); } /** * Tests the behavior of the theme registry class. */ function testRaceCondition() { $_SERVER['REQUEST_METHOD'] = 'GET'; $cid = 'test_theme_registry'; // Directly instantiate the theme registry, this will cause a base cache // entry to be written in __construct(). $registry = new ThemeRegistry($cid, 'cache'); $this->assertTrue(cache_get($cid), 'Cache entry was created.'); // Trigger a cache miss for an offset. $this->assertTrue($registry['theme_test_template_test'], 'Offset was returned correctly from the theme registry.'); // This will cause the ThemeRegistry class to write an updated version of // the cache entry when it is destroyed, usually at the end of the request. // Before that happens, manually delete the cache entry we created earlier // so that the new entry is written from scratch. cache_clear_all($cid, 'cache'); // Destroy the class so that it triggers a cache write for the offset. unset($registry); $this->assertTrue(cache_get($cid), 'Cache entry was created.'); // Create a new instance of the class. Confirm that both the offset // requested previously, and one that has not yet been requested are both // available. $registry = new ThemeRegistry($cid, 'cache'); $this->assertTrue($registry['theme_test_template_test'], 'Offset was returned correctly from the theme registry'); $this->assertTrue($registry['theme_test_template_test_2'], 'Offset was returned correctly from the theme registry'); } } /** * Tests for theme debug markup. */ class ThemeDebugMarkupTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Theme debug markup', 'description' => 'Tests theme debug markup output.', 'group' => 'Theme', ); } function setUp() { parent::setUp('theme_test', 'node'); theme_enable(array('test_theme')); } /** * Tests debug markup added to template output. */ function testDebugOutput() { variable_set('theme_default', 'test_theme'); // Enable the debug output. variable_set('theme_debug', TRUE); $registry = theme_get_registry(); $extension = '.tpl.php'; // Populate array of templates. $templates = drupal_find_theme_templates($registry, $extension, drupal_get_path('theme', 'test_theme')); $templates += drupal_find_theme_templates($registry, $extension, drupal_get_path('module', 'node')); // Create a node and test different features of the debug markup. $node = $this->drupalCreateNode(); $this->drupalGet('node/' . $node->nid); $this->assertRaw('', 'Theme debug markup found in theme output when debug is enabled.'); $this->assertRaw("CALL: theme('node')", 'Theme call information found.'); $this->assertRaw('x node--1' . $extension . PHP_EOL . ' * node--page' . $extension . PHP_EOL . ' * node' . $extension, 'Suggested template files found in order and node ID specific template shown as current template.'); $template_filename = $templates['node__1']['path'] . '/' . $templates['node__1']['template'] . $extension; $this->assertRaw("BEGIN OUTPUT from '$template_filename'", 'Full path to current template file found.'); // Create another node and make sure the template suggestions shown in the // debug markup are correct. $node2 = $this->drupalCreateNode(); $this->drupalGet('node/' . $node2->nid); $this->assertRaw('* node--2' . $extension . PHP_EOL . ' * node--page' . $extension . PHP_EOL . ' x node' . $extension, 'Suggested template files found in order and base template shown as current template.'); // Create another node and make sure the template suggestions shown in the // debug markup are correct. $node3 = $this->drupalCreateNode(); $build = array('#theme' => 'node__foo__bar'); $build += node_view($node3); $output = drupal_render($build); $this->assertTrue(strpos($output, "CALL: theme('node__foo__bar')") !== FALSE, 'Theme call information found.'); $this->assertTrue(strpos($output, '* node--foo--bar' . $extension . PHP_EOL . ' * node--foo' . $extension . PHP_EOL . ' * node--3' . $extension . PHP_EOL . ' * node--page' . $extension . PHP_EOL . ' x node' . $extension) !== FALSE, 'Suggested template files found in order and base template shown as current template.'); // Disable theme debug. variable_set('theme_debug', FALSE); $this->drupalGet('node/' . $node->nid); $this->assertNoRaw('', 'Theme debug markup not found in theme output when debug is disabled.'); } } drupal-7.41/modules/simpletest/tests/boot_test_2.module0000644000000000000000000000027512611765734022107 0ustar rootroot 'FileTransfer unit tests', 'description' => 'Test that the jail is respected and that protocols using recursive file move operations work.', 'group' => 'System' ); } function setUp() { parent::setUp(); $this->testConnection = TestFileTransfer::factory(DRUPAL_ROOT, array('hostname' => $this->hostname, 'username' => $this->username, 'password' => $this->password, 'port' => $this->port)); } function _getFakeModuleFiles() { $files = array( 'fake.module', 'fake.info', 'theme' => array( 'fake.tpl.php' ), 'inc' => array( 'fake.inc' ) ); return $files; } function _buildFakeModule() { $location = 'temporary://fake'; if (is_dir($location)) { $ret = 0; $output = array(); exec('rm -Rf ' . escapeshellarg($location), $output, $ret); if ($ret != 0) { throw new Exception('Error removing fake module directory.'); } } $files = $this->_getFakeModuleFiles(); $this->_writeDirectory($location, $files); return $location; } function _writeDirectory($base, $files = array()) { mkdir($base); foreach ($files as $key => $file) { if (is_array($file)) { $this->_writeDirectory($base . DIRECTORY_SEPARATOR . $key, $file); } else { //just write the filename into the file file_put_contents($base . DIRECTORY_SEPARATOR . $file, $file); } } } function testJail() { $source = $this->_buildFakeModule(); // This convoluted piece of code is here because our testing framework does // not support expecting exceptions. $gotit = FALSE; try { $this->testConnection->copyDirectory($source, '/tmp'); } catch (FileTransferException $e) { $gotit = TRUE; } $this->assertTrue($gotit, 'Was not able to copy a directory outside of the jailed area.'); $gotit = TRUE; try { $this->testConnection->copyDirectory($source, DRUPAL_ROOT . '/'. variable_get('file_public_path', conf_path() . '/files')); } catch (FileTransferException $e) { $gotit = FALSE; } $this->assertTrue($gotit, 'Was able to copy a directory inside of the jailed area'); } } /** * Mock FileTransfer object for test case. */ class TestFileTransfer extends FileTransfer { protected $host = NULL; protected $username = NULL; protected $password = NULL; protected $port = NULL; /** * This is for testing the CopyRecursive logic. */ public $shouldIsDirectoryReturnTrue = FALSE; function __construct($jail, $username, $password, $hostname = 'localhost', $port = 9999) { parent::__construct($jail, $username, $password, $hostname, $port); } static function factory($jail, $settings) { return new TestFileTransfer($jail, $settings['username'], $settings['password'], $settings['hostname'], $settings['port']); } function connect() { $parts = explode(':', $this->hostname); $port = (count($parts) == 2) ? $parts[1] : $this->port; $this->connection = new MockTestConnection(); $this->connection->connectionString = 'test://' . urlencode($this->username) . ':' . urlencode($this->password) . "@$this->host:$this->port/"; } function copyFileJailed($source, $destination) { $this->connection->run("copyFile $source $destination"); } protected function removeDirectoryJailed($directory) { $this->connection->run("rmdir $directory"); } function createDirectoryJailed($directory) { $this->connection->run("mkdir $directory"); } function removeFileJailed($destination) { if (!ftp_delete($this->connection, $item)) { throw new FileTransferException('Unable to remove to file @file.', NULL, array('@file' => $item)); } } function isDirectory($path) { return $this->shouldIsDirectoryReturnTrue; } function isFile($path) { return FALSE; } function chmodJailed($path, $mode, $recursive) { return; } } /** * Mock connection object for test case. */ class MockTestConnection { var $commandsRun = array(); var $connectionString; function run($cmd) { $this->commandsRun[] = $cmd; } function flushCommands() { $out = $this->commandsRun; $this->commandsRun = array(); return $out; } } drupal-7.41/modules/simpletest/tests/tablesort.test0000644000000000000000000001125712611765734021357 0ustar rootroot 'Tablesort', 'description' => 'Tests table sorting.', 'group' => 'System', ); } function setUp() { // Save the original $_GET to be restored later. $this->GET = $_GET; parent::setUp(); } function tearDown() { // Revert $_GET. $_GET = $this->GET; parent::tearDown(); } /** * Test tablesort_init(). */ function testTableSortInit() { // Test simple table headers. $headers = array('foo', 'bar', 'baz'); // Reset $_GET to prevent parameters from Simpletest and Batch API ending // up in $ts['query']. $_GET = array('q' => 'jahwohl'); $expected_ts = array( 'name' => 'foo', 'sql' => '', 'sort' => 'asc', 'query' => array(), ); $ts = tablesort_init($headers); $this->verbose(strtr('$ts: 
                  !ts
                  ', array('!ts' => check_plain(var_export($ts, TRUE))))); $this->assertEqual($ts, $expected_ts, 'Simple table headers sorted correctly.'); // Test with simple table headers plus $_GET parameters that should _not_ // override the default. $_GET = array( 'q' => 'jahwohl', // This should not override the table order because only complex // headers are overridable. 'order' => 'bar', ); $ts = tablesort_init($headers); $this->verbose(strtr('$ts: 
                  !ts
                  ', array('!ts' => check_plain(var_export($ts, TRUE))))); $this->assertEqual($ts, $expected_ts, 'Simple table headers plus non-overriding $_GET parameters sorted correctly.'); // Test with simple table headers plus $_GET parameters that _should_ // override the default. $_GET = array( 'q' => 'jahwohl', 'sort' => 'DESC', // Add an unrelated parameter to ensure that tablesort will include // it in the links that it creates. 'alpha' => 'beta', ); $expected_ts['sort'] = 'desc'; $expected_ts['query'] = array('alpha' => 'beta'); $ts = tablesort_init($headers); $this->verbose(strtr('$ts: 
                  !ts
                  ', array('!ts' => check_plain(var_export($ts, TRUE))))); $this->assertEqual($ts, $expected_ts, 'Simple table headers plus $_GET parameters sorted correctly.'); // Test complex table headers. $headers = array( 'foo', array( 'data' => '1', 'field' => 'one', 'sort' => 'asc', 'colspan' => 1, ), array( 'data' => '2', 'field' => 'two', 'sort' => 'desc', ), ); // Reset $_GET from previous assertion. $_GET = array( 'q' => 'jahwohl', 'order' => '2', ); $ts = tablesort_init($headers); $expected_ts = array( 'name' => '2', 'sql' => 'two', 'sort' => 'desc', 'query' => array(), ); $this->verbose(strtr('$ts: 
                  !ts
                  ', array('!ts' => check_plain(var_export($ts, TRUE))))); $this->assertEqual($ts, $expected_ts, 'Complex table headers sorted correctly.'); // Test complex table headers plus $_GET parameters that should _not_ // override the default. $_GET = array( 'q' => 'jahwohl', // This should not override the table order because this header does not // exist. 'order' => 'bar', ); $ts = tablesort_init($headers); $expected_ts = array( 'name' => '1', 'sql' => 'one', 'sort' => 'asc', 'query' => array(), ); $this->verbose(strtr('$ts: 
                  !ts
                  ', array('!ts' => check_plain(var_export($ts, TRUE))))); $this->assertEqual($ts, $expected_ts, 'Complex table headers plus non-overriding $_GET parameters sorted correctly.'); unset($_GET['sort'], $_GET['order'], $_GET['alpha']); // Test complex table headers plus $_GET parameters that _should_ // override the default. $_GET = array( 'q' => 'jahwohl', 'order' => '1', 'sort' => 'ASC', // Add an unrelated parameter to ensure that tablesort will include // it in the links that it creates. 'alpha' => 'beta', ); $expected_ts = array( 'name' => '1', 'sql' => 'one', 'sort' => 'asc', 'query' => array('alpha' => 'beta'), ); $ts = tablesort_init($headers); $this->verbose(strtr('$ts: 
                  !ts
                  ', array('!ts' => check_plain(var_export($ts, TRUE))))); $this->assertEqual($ts, $expected_ts, 'Complex table headers plus $_GET parameters sorted correctly.'); unset($_GET['sort'], $_GET['order'], $_GET['alpha']); } } drupal-7.41/modules/simpletest/tests/update_test_3.install0000644000000000000000000000066412611765734022612 0ustar rootroot 7000, ); return $dependencies; } /** * Dummy update_test_3 update 7000. */ function update_test_3_update_7000() { } drupal-7.41/modules/simpletest/tests/session.test0000644000000000000000000005547012611765734021050 0ustar rootroot 'Session tests', 'description' => 'Drupal session handling tests.', 'group' => 'Session' ); } function setUp() { parent::setUp('session_test'); } /** * Tests for drupal_save_session() and drupal_session_regenerate(). */ function testSessionSaveRegenerate() { $this->assertFalse(drupal_save_session(), 'drupal_save_session() correctly returns FALSE (inside of testing framework) when initially called with no arguments.', 'Session'); $this->assertFalse(drupal_save_session(FALSE), 'drupal_save_session() correctly returns FALSE when called with FALSE.', 'Session'); $this->assertFalse(drupal_save_session(), 'drupal_save_session() correctly returns FALSE when saving has been disabled.', 'Session'); $this->assertTrue(drupal_save_session(TRUE), 'drupal_save_session() correctly returns TRUE when called with TRUE.', 'Session'); $this->assertTrue(drupal_save_session(), 'drupal_save_session() correctly returns TRUE when saving has been enabled.', 'Session'); // Test session hardening code from SA-2008-044. $user = $this->drupalCreateUser(array('access content')); // Enable sessions. $this->sessionReset($user->uid); // Make sure the session cookie is set as HttpOnly. $this->drupalLogin($user); $this->assertTrue(preg_match('/HttpOnly/i', $this->drupalGetHeader('Set-Cookie', TRUE)), 'Session cookie is set as HttpOnly.'); $this->drupalLogout(); // Verify that the session is regenerated if a module calls exit // in hook_user_login(). user_save($user, array('name' => 'session_test_user')); $user->name = 'session_test_user'; $this->drupalGet('session-test/id'); $matches = array(); preg_match('/\s*session_id:(.*)\n/', $this->drupalGetContent(), $matches); $this->assertTrue(!empty($matches[1]) , 'Found session ID before logging in.'); $original_session = $matches[1]; // We cannot use $this->drupalLogin($user); because we exit in // session_test_user_login() which breaks a normal assertion. $edit = array( 'name' => $user->name, 'pass' => $user->pass_raw ); $this->drupalPost('user', $edit, t('Log in')); $this->drupalGet('user'); $pass = $this->assertText($user->name, format_string('Found name: %name', array('%name' => $user->name)), 'User login'); $this->_logged_in = $pass; $this->drupalGet('session-test/id'); $matches = array(); preg_match('/\s*session_id:(.*)\n/', $this->drupalGetContent(), $matches); $this->assertTrue(!empty($matches[1]) , 'Found session ID after logging in.'); $this->assertTrue($matches[1] != $original_session, 'Session ID changed after login.'); } /** * Test data persistence via the session_test module callbacks. */ function testDataPersistence() { $user = $this->drupalCreateUser(array('access content')); // Enable sessions. $this->sessionReset($user->uid); $this->drupalLogin($user); $value_1 = $this->randomName(); $this->drupalGet('session-test/set/' . $value_1); $this->assertText($value_1, 'The session value was stored.', 'Session'); $this->drupalGet('session-test/get'); $this->assertText($value_1, 'Session correctly returned the stored data for an authenticated user.', 'Session'); // Attempt to write over val_1. If drupal_save_session(FALSE) is working. // properly, val_1 will still be set. $value_2 = $this->randomName(); $this->drupalGet('session-test/no-set/' . $value_2); $this->assertText($value_2, 'The session value was correctly passed to session-test/no-set.', 'Session'); $this->drupalGet('session-test/get'); $this->assertText($value_1, 'Session data is not saved for drupal_save_session(FALSE).', 'Session'); // Switch browser cookie to anonymous user, then back to user 1. $this->sessionReset(); $this->sessionReset($user->uid); $this->assertText($value_1, 'Session data persists through browser close.', 'Session'); // Logout the user and make sure the stored value no longer persists. $this->drupalLogout(); $this->sessionReset(); $this->drupalGet('session-test/get'); $this->assertNoText($value_1, "After logout, previous user's session data is not available.", 'Session'); // Now try to store some data as an anonymous user. $value_3 = $this->randomName(); $this->drupalGet('session-test/set/' . $value_3); $this->assertText($value_3, 'Session data stored for anonymous user.', 'Session'); $this->drupalGet('session-test/get'); $this->assertText($value_3, 'Session correctly returned the stored data for an anonymous user.', 'Session'); // Try to store data when drupal_save_session(FALSE). $value_4 = $this->randomName(); $this->drupalGet('session-test/no-set/' . $value_4); $this->assertText($value_4, 'The session value was correctly passed to session-test/no-set.', 'Session'); $this->drupalGet('session-test/get'); $this->assertText($value_3, 'Session data is not saved for drupal_save_session(FALSE).', 'Session'); // Login, the data should persist. $this->drupalLogin($user); $this->sessionReset($user->uid); $this->drupalGet('session-test/get'); $this->assertNoText($value_1, 'Session has persisted for an authenticated user after logging out and then back in.', 'Session'); // Change session and create another user. $user2 = $this->drupalCreateUser(array('access content')); $this->sessionReset($user2->uid); $this->drupalLogin($user2); } /** * Test that empty anonymous sessions are destroyed. */ function testEmptyAnonymousSession() { // Verify that no session is automatically created for anonymous user. $this->drupalGet(''); $this->assertSessionCookie(FALSE); $this->assertSessionEmpty(TRUE); // The same behavior is expected when caching is enabled. variable_set('cache', 1); $this->drupalGet(''); $this->assertSessionCookie(FALSE); $this->assertSessionEmpty(TRUE); $this->assertEqual($this->drupalGetHeader('X-Drupal-Cache'), 'MISS', 'Page was not cached.'); // Start a new session by setting a message. $this->drupalGet('session-test/set-message'); $this->assertSessionCookie(TRUE); $this->assertTrue($this->drupalGetHeader('Set-Cookie'), 'New session was started.'); // Display the message, during the same request the session is destroyed // and the session cookie is unset. $this->drupalGet(''); $this->assertSessionCookie(FALSE); $this->assertSessionEmpty(FALSE); $this->assertFalse($this->drupalGetHeader('X-Drupal-Cache'), 'Caching was bypassed.'); $this->assertText(t('This is a dummy message.'), 'Message was displayed.'); $this->assertTrue(preg_match('/SESS\w+=deleted/', $this->drupalGetHeader('Set-Cookie')), 'Session cookie was deleted.'); // Verify that session was destroyed. $this->drupalGet(''); $this->assertSessionCookie(FALSE); $this->assertSessionEmpty(TRUE); $this->assertNoText(t('This is a dummy message.'), 'Message was not cached.'); $this->assertEqual($this->drupalGetHeader('X-Drupal-Cache'), 'HIT', 'Page was cached.'); $this->assertFalse($this->drupalGetHeader('Set-Cookie'), 'New session was not started.'); // Verify that no session is created if drupal_save_session(FALSE) is called. $this->drupalGet('session-test/set-message-but-dont-save'); $this->assertSessionCookie(FALSE); $this->assertSessionEmpty(TRUE); // Verify that no message is displayed. $this->drupalGet(''); $this->assertSessionCookie(FALSE); $this->assertSessionEmpty(TRUE); $this->assertNoText(t('This is a dummy message.'), 'The message was not saved.'); } /** * Test that sessions are only saved when necessary. */ function testSessionWrite() { $user = $this->drupalCreateUser(array('access content')); $this->drupalLogin($user); $sql = 'SELECT u.access, s.timestamp FROM {users} u INNER JOIN {sessions} s ON u.uid = s.uid WHERE u.uid = :uid'; $times1 = db_query($sql, array(':uid' => $user->uid))->fetchObject(); // Before every request we sleep one second to make sure that if the session // is saved, its timestamp will change. // Modify the session. sleep(1); $this->drupalGet('session-test/set/foo'); $times2 = db_query($sql, array(':uid' => $user->uid))->fetchObject(); $this->assertEqual($times2->access, $times1->access, 'Users table was not updated.'); $this->assertNotEqual($times2->timestamp, $times1->timestamp, 'Sessions table was updated.'); // Write the same value again, i.e. do not modify the session. sleep(1); $this->drupalGet('session-test/set/foo'); $times3 = db_query($sql, array(':uid' => $user->uid))->fetchObject(); $this->assertEqual($times3->access, $times1->access, 'Users table was not updated.'); $this->assertEqual($times3->timestamp, $times2->timestamp, 'Sessions table was not updated.'); // Do not change the session. sleep(1); $this->drupalGet(''); $times4 = db_query($sql, array(':uid' => $user->uid))->fetchObject(); $this->assertEqual($times4->access, $times3->access, 'Users table was not updated.'); $this->assertEqual($times4->timestamp, $times3->timestamp, 'Sessions table was not updated.'); // Force updating of users and sessions table once per second. variable_set('session_write_interval', 0); $this->drupalGet(''); $times5 = db_query($sql, array(':uid' => $user->uid))->fetchObject(); $this->assertNotEqual($times5->access, $times4->access, 'Users table was updated.'); $this->assertNotEqual($times5->timestamp, $times4->timestamp, 'Sessions table was updated.'); } /** * Test that empty session IDs are not allowed. */ function testEmptySessionID() { $user = $this->drupalCreateUser(array('access content')); $this->drupalLogin($user); $this->drupalGet('session-test/is-logged-in'); $this->assertResponse(200, 'User is logged in.'); // Reset the sid in {sessions} to a blank string. This may exist in the // wild in some cases, although we normally prevent it from happening. db_query("UPDATE {sessions} SET sid = '' WHERE uid = :uid", array(':uid' => $user->uid)); // Send a blank sid in the session cookie, and the session should no longer // be valid. Closing the curl handler will stop the previous session ID // from persisting. $this->curlClose(); $this->additionalCurlOptions[CURLOPT_COOKIE] = rawurlencode($this->session_name) . '=;'; $this->drupalGet('session-test/id-from-cookie'); $this->assertRaw("session_id:\n", 'Session ID is blank as sent from cookie header.'); // Assert that we have an anonymous session now. $this->drupalGet('session-test/is-logged-in'); $this->assertResponse(403, 'An empty session ID is not allowed.'); } /** * Reset the cookie file so that it refers to the specified user. * * @param $uid User id to set as the active session. */ function sessionReset($uid = 0) { // Close the internal browser. $this->curlClose(); $this->loggedInUser = FALSE; // Change cookie file for user. $this->cookieFile = file_stream_wrapper_get_instance_by_scheme('temporary')->getDirectoryPath() . '/cookie.' . $uid . '.txt'; $this->additionalCurlOptions[CURLOPT_COOKIEFILE] = $this->cookieFile; $this->additionalCurlOptions[CURLOPT_COOKIESESSION] = TRUE; $this->drupalGet('session-test/get'); $this->assertResponse(200, 'Session test module is correctly enabled.', 'Session'); } /** * Assert whether the SimpleTest browser sent a session cookie. */ function assertSessionCookie($sent) { if ($sent) { $this->assertNotNull($this->session_id, 'Session cookie was sent.'); } else { $this->assertNull($this->session_id, 'Session cookie was not sent.'); } } /** * Assert whether $_SESSION is empty at the beginning of the request. */ function assertSessionEmpty($empty) { if ($empty) { $this->assertIdentical($this->drupalGetHeader('X-Session-Empty'), '1', 'Session was empty.'); } else { $this->assertIdentical($this->drupalGetHeader('X-Session-Empty'), '0', 'Session was not empty.'); } } } /** * Ensure that when running under HTTPS two session cookies are generated. */ class SessionHttpsTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Session HTTPS handling', 'description' => 'Ensure that when running under HTTPS two session cookies are generated.', 'group' => 'Session' ); } public function setUp() { parent::setUp('session_test'); } protected function testHttpsSession() { global $is_https; if ($is_https) { $secure_session_name = session_name(); $insecure_session_name = substr(session_name(), 1); } else { $secure_session_name = 'S' . session_name(); $insecure_session_name = session_name(); } $user = $this->drupalCreateUser(array('access administration pages')); // Test HTTPS session handling by altering the form action to submit the // login form through https.php, which creates a mock HTTPS request. $this->drupalGet('user'); $form = $this->xpath('//form[@id="user-login"]'); $form[0]['action'] = $this->httpsUrl('user'); $edit = array('name' => $user->name, 'pass' => $user->pass_raw); $this->drupalPost(NULL, $edit, t('Log in')); // Test a second concurrent session. $this->curlClose(); $this->drupalGet('user'); $form = $this->xpath('//form[@id="user-login"]'); $form[0]['action'] = $this->httpsUrl('user'); $this->drupalPost(NULL, $edit, t('Log in')); // Check secure cookie on secure page. $this->assertTrue($this->cookies[$secure_session_name]['secure'], 'The secure cookie has the secure attribute'); // Check insecure cookie is not set. $this->assertFalse(isset($this->cookies[$insecure_session_name])); $ssid = $this->cookies[$secure_session_name]['value']; $this->assertSessionIds($ssid, $ssid, 'Session has a non-empty SID and a correct secure SID.'); $cookie = $secure_session_name . '=' . $ssid; // Verify that user is logged in on secure URL. $this->curlClose(); $this->drupalGet($this->httpsUrl('admin/config'), array(), array('Cookie: ' . $cookie)); $this->assertText(t('Configuration')); $this->assertResponse(200); // Verify that user is not logged in on non-secure URL. $this->curlClose(); $this->drupalGet($this->httpUrl('admin/config'), array(), array('Cookie: ' . $cookie)); $this->assertNoText(t('Configuration')); $this->assertResponse(403); // Verify that empty SID cannot be used on the non-secure site. $this->curlClose(); $cookie = $insecure_session_name . '='; $this->drupalGet($this->httpUrl('admin/config'), array(), array('Cookie: ' . $cookie)); $this->assertResponse(403); // Test HTTP session handling by altering the form action to submit the // login form through http.php, which creates a mock HTTP request on HTTPS // test environments. $this->curlClose(); $this->drupalGet('user'); $form = $this->xpath('//form[@id="user-login"]'); $form[0]['action'] = $this->httpUrl('user'); $edit = array('name' => $user->name, 'pass' => $user->pass_raw); $this->drupalPost(NULL, $edit, t('Log in')); $this->drupalGet($this->httpUrl('admin/config')); $this->assertResponse(200); $sid = $this->cookies[$insecure_session_name]['value']; $this->assertSessionIds($sid, '', 'Session has the correct SID and an empty secure SID.'); // Verify that empty secure SID cannot be used on the secure site. $this->curlClose(); $cookie = $secure_session_name . '='; $this->drupalGet($this->httpsUrl('admin/config'), array(), array('Cookie: ' . $cookie)); $this->assertResponse(403); // Clear browser cookie jar. $this->cookies = array(); if ($is_https) { // The functionality does not make sense when running on HTTPS. return; } // Enable secure pages. variable_set('https', TRUE); $this->curlClose(); // Start an anonymous session on the insecure site. $session_data = $this->randomName(); $this->drupalGet('session-test/set/' . $session_data); // Check secure cookie on insecure page. $this->assertFalse(isset($this->cookies[$secure_session_name]), 'The secure cookie is not sent on insecure pages.'); // Check insecure cookie on insecure page. $this->assertFalse($this->cookies[$insecure_session_name]['secure'], 'The insecure cookie does not have the secure attribute'); // Store the anonymous cookie so we can validate that its session is killed // after login. $anonymous_cookie = $insecure_session_name . '=' . $this->cookies[$insecure_session_name]['value']; // Check that password request form action is not secure. $this->drupalGet('user/password'); $form = $this->xpath('//form[@id="user-pass"]'); $this->assertNotEqual(substr($form[0]['action'], 0, 6), 'https:', 'Password request form action is not secure'); $form[0]['action'] = $this->httpsUrl('user'); // Check that user login form action is secure. $this->drupalGet('user'); $form = $this->xpath('//form[@id="user-login"]'); $this->assertEqual(substr($form[0]['action'], 0, 6), 'https:', 'Login form action is secure'); $form[0]['action'] = $this->httpsUrl('user'); $edit = array( 'name' => $user->name, 'pass' => $user->pass_raw, ); $this->drupalPost(NULL, $edit, t('Log in')); // Check secure cookie on secure page. $this->assertTrue($this->cookies[$secure_session_name]['secure'], 'The secure cookie has the secure attribute'); // Check insecure cookie on secure page. $this->assertFalse($this->cookies[$insecure_session_name]['secure'], 'The insecure cookie does not have the secure attribute'); $sid = $this->cookies[$insecure_session_name]['value']; $ssid = $this->cookies[$secure_session_name]['value']; $this->assertSessionIds($sid, $ssid, 'Session has both secure and insecure SIDs'); $cookies = array( $insecure_session_name . '=' . $sid, $secure_session_name . '=' . $ssid, ); // Test that session data saved before login is still available on the // authenticated session. $this->drupalGet('session-test/get'); $this->assertText($session_data, 'Session correctly returned the stored data set by the anonymous session.'); foreach ($cookies as $cookie_key => $cookie) { foreach (array('admin/config', $this->httpsUrl('admin/config')) as $url_key => $url) { $this->curlClose(); $this->drupalGet($url, array(), array('Cookie: ' . $cookie)); if ($cookie_key == $url_key) { $this->assertText(t('Configuration')); $this->assertResponse(200); } else { $this->assertNoText(t('Configuration')); $this->assertResponse(403); } } } // Test that session data saved before login is not available using the // pre-login anonymous cookie. $this->cookies = array(); $this->drupalGet('session-test/get', array('Cookie: ' . $anonymous_cookie)); $this->assertNoText($session_data, 'Initial anonymous session is inactive after login.'); // Clear browser cookie jar. $this->cookies = array(); // Start an anonymous session on the secure site. $this->drupalGet($this->httpsUrl('session-test/set/1')); // Mock a login to the secure site using the secure session cookie. $this->drupalGet('user'); $form = $this->xpath('//form[@id="user-login"]'); $form[0]['action'] = $this->httpsUrl('user'); $this->drupalPost(NULL, $edit, t('Log in')); // Test that the user is also authenticated on the insecure site. $this->drupalGet("user/{$user->uid}/edit"); $this->assertResponse(200); } /** * Tests that empty session IDs do not cause unrelated sessions to load. */ public function testEmptySessionId() { global $is_https; if ($is_https) { $secure_session_name = session_name(); } else { $secure_session_name = 'S' . session_name(); } // Enable mixed mode for HTTP and HTTPS. variable_set('https', TRUE); $admin_user = $this->drupalCreateUser(array('access administration pages')); $standard_user = $this->drupalCreateUser(array('access content')); // First log in as the admin user on HTTP. // We cannot use $this->drupalLogin() here because we need to use the // special http.php URLs. $edit = array( 'name' => $admin_user->name, 'pass' => $admin_user->pass_raw ); $this->drupalGet('user'); $form = $this->xpath('//form[@id="user-login"]'); $form[0]['action'] = $this->httpUrl('user'); $this->drupalPost(NULL, $edit, t('Log in')); $this->curlClose(); // Now start a session for the standard user on HTTPS. $edit = array( 'name' => $standard_user->name, 'pass' => $standard_user->pass_raw ); $this->drupalGet('user'); $form = $this->xpath('//form[@id="user-login"]'); $form[0]['action'] = $this->httpsUrl('user'); $this->drupalPost(NULL, $edit, t('Log in')); // Make the secure session cookie blank. curl_setopt($this->curlHandle, CURLOPT_COOKIE, "$secure_session_name="); $this->drupalGet($this->httpsUrl('user')); $this->assertNoText($admin_user->name, 'User is not logged in as admin'); $this->assertNoText($standard_user->name, "The user's own name is not displayed because the invalid session cookie has logged them out."); } /** * Test that there exists a session with two specific session IDs. * * @param $sid * The insecure session ID to search for. * @param $ssid * The secure session ID to search for. * @param $assertion_text * The text to display when we perform the assertion. * * @return * The result of assertTrue() that there's a session in the system that * has the given insecure and secure session IDs. */ protected function assertSessionIds($sid, $ssid, $assertion_text) { $args = array( ':sid' => $sid, ':ssid' => $ssid, ); return $this->assertTrue(db_query('SELECT timestamp FROM {sessions} WHERE sid = :sid AND ssid = :ssid', $args)->fetchField(), $assertion_text); } /** * Builds a URL for submitting a mock HTTPS request to HTTP test environments. * * @param $url * A Drupal path such as 'user'. * * @return * An absolute URL. */ protected function httpsUrl($url) { global $base_url; return $base_url . '/modules/simpletest/tests/https.php?q=' . $url; } /** * Builds a URL for submitting a mock HTTP request to HTTPS test environments. * * @param $url * A Drupal path such as 'user'. * * @return * An absolute URL. */ protected function httpUrl($url) { global $base_url; return $base_url . '/modules/simpletest/tests/http.php?q=' . $url; } } drupal-7.41/modules/simpletest/tests/update_test_2.install0000644000000000000000000000226712611765734022612 0ustar rootroot 7000, ); // These are coordinated with the corresponding dependencies declared in // update_test_1_update_dependencies(). $dependencies['system'][7000] = array( 'update_test_2' => 7001, ); $dependencies['system'][7001] = array( 'update_test_1' => 7001, ); return $dependencies; } /** * Dummy update_test_2 update 7000. */ function update_test_2_update_7000() { } /** * Dummy update_test_2 update 7001. */ function update_test_2_update_7001() { } /** * Dummy update_test_2 update 7002. */ function update_test_2_update_7002() { } drupal-7.41/modules/simpletest/tests/requirements1_test.install0000644000000000000000000000077112611765734023711 0ustar rootroot $t('Requirements 1 Test'), 'severity' => REQUIREMENT_ERROR, 'description' => $t('Requirements 1 Test failed requirements.'), ); } return $requirements; } drupal-7.41/modules/simpletest/tests/xmlrpc_test.module0000644000000000000000000000615312611765734022231 0ustar rootroot substr_count($string, '<'), 'ctRightAngleBrackets' => substr_count($string, '>'), 'ctAmpersands' => substr_count($string, '&'), 'ctApostrophes' => substr_count($string, "'"), 'ctQuotes' => substr_count($string, '"'), ); } function xmlrpc_test_easyStructTest($array) { return $array["curly"] + $array["moe"] + $array["larry"]; } function xmlrpc_test_echoStructTest($array) { return $array; } function xmlrpc_test_manyTypesTest($number, $boolean, $string, $double, $dateTime, $base64) { $timestamp = gmmktime($dateTime->hour, $dateTime->minute, $dateTime->second, $dateTime->month, $dateTime->day, $dateTime->year); return array($number, $boolean, $string, $double, xmlrpc_date($timestamp), xmlrpc_Base64($base64)); } function xmlrpc_test_moderateSizeArrayCheck($array) { return array_shift($array) . array_pop($array); } function xmlrpc_test_nestedStructTest($array) { return $array["2000"]["04"]["01"]["larry"] + $array["2000"]["04"]["01"]["moe"] + $array["2000"]["04"]["01"]["curly"]; } function xmlrpc_test_simpleStructReturnTest($number) { return array("times10" => ($number*10), "times100" => ($number*100), "times1000" => ($number*1000)); } /** * Implements hook_xmlrpc(). */ function xmlrpc_test_xmlrpc() { return array( 'validator1.arrayOfStructsTest' => 'xmlrpc_test_arrayOfStructsTest', 'validator1.countTheEntities' => 'xmlrpc_test_countTheEntities', 'validator1.easyStructTest' => 'xmlrpc_test_easyStructTest', 'validator1.echoStructTest' => 'xmlrpc_test_echoStructTest', 'validator1.manyTypesTest' => 'xmlrpc_test_manyTypesTest', 'validator1.moderateSizeArrayCheck' => 'xmlrpc_test_moderateSizeArrayCheck', 'validator1.nestedStructTest' => 'xmlrpc_test_nestedStructTest', 'validator1.simpleStructReturnTest' => 'xmlrpc_test_simpleStructReturnTest', 'messages.messageSizedInKB' => 'xmlrpc_test_message_sized_in_kb', ); } /** * Implements hook_xmlrpc_alter(). * * Hide (or not) the system.methodSignature() service depending on a variable. */ function xmlrpc_test_xmlrpc_alter(&$services) { if (variable_get('xmlrpc_test_xmlrpc_alter', FALSE)) { $remove = NULL; foreach ($services as $key => $value) { if (!is_array($value)) { continue; } if ($value[0] == 'system.methodSignature') { $remove = $key; break; } } if (isset($remove)) { unset($services[$remove]); } } } /** * Created a message of the desired size in KB. * * @param $size * Message size in KB. * @return array * Generated message structure. */ function xmlrpc_test_message_sized_in_kb($size) { $message = array(); $word = 'abcdefg'; // Create a ~1KB sized struct. for ($i = 0 ; $i < 128; $i++) { $line['word_' . $i] = $word; } for ($i = 0; $i < $size; $i++) { $message['line_' . $i] = $line; } return $message; } drupal-7.41/modules/simpletest/tests/error_test.info0000644000000000000000000000042112611767501021505 0ustar rootrootname = "Error test" description = "Support module for error and exception testing." package = Testing version = VERSION core = 7.x hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/update_test_1.module0000644000000000000000000000000612611765734022415 0ustar rootroot 'Session value', 'page callback' => '_session_test_get', 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['session-test/id'] = array( 'title' => 'Session ID', 'page callback' => '_session_test_id', 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['session-test/id-from-cookie'] = array( 'title' => 'Session ID from cookie', 'page callback' => '_session_test_id_from_cookie', 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['session-test/set/%'] = array( 'title' => 'Set session value', 'page callback' => '_session_test_set', 'page arguments' => array(2), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['session-test/no-set/%'] = array( 'title' => 'Set session value but do not save session', 'page callback' => '_session_test_no_set', 'page arguments' => array(2), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['session-test/set-message'] = array( 'title' => 'Set message', 'page callback' => '_session_test_set_message', 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['session-test/set-message-but-dont-save'] = array( 'title' => 'Set message but do not save session', 'page callback' => '_session_test_set_message_but_dont_save', 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['session-test/set-not-started'] = array( 'title' => 'Set message when session is not started', 'page callback' => '_session_test_set_not_started', 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['session-test/is-logged-in'] = array( 'title' => 'Check if user is logged in', 'page callback' => '_session_test_is_logged_in', 'access callback' => 'user_is_logged_in', 'type' => MENU_CALLBACK, ); return $items; } /** * Implements hook_boot(). */ function session_test_boot() { header('X-Session-Empty: ' . intval(empty($_SESSION))); } /** * Page callback, prints the stored session value to the screen. */ function _session_test_get() { if (!empty($_SESSION['session_test_value'])) { return t('The current value of the stored session variable is: %val', array('%val' => $_SESSION['session_test_value'])); } else { return ""; } } /** * Page callback, stores a value in $_SESSION['session_test_value']. */ function _session_test_set($value) { $_SESSION['session_test_value'] = $value; return t('The current value of the stored session variable has been set to %val', array('%val' => $value)); } /** * Menu callback: turns off session saving and then tries to save a value * anyway. */ function _session_test_no_set($value) { drupal_save_session(FALSE); _session_test_set($value); return t('session saving was disabled, and then %val was set', array('%val' => $value)); } /** * Menu callback: print the current session ID. */ function _session_test_id() { // Set a value in $_SESSION, so that drupal_session_commit() will start // a session. $_SESSION['test'] = 'test'; drupal_session_commit(); return 'session_id:' . session_id() . "\n"; } /** * Menu callback: print the current session ID as read from the cookie. */ function _session_test_id_from_cookie() { return 'session_id:' . $_COOKIE[session_name()] . "\n"; } /** * Menu callback, sets a message to me displayed on the following page. */ function _session_test_set_message() { drupal_set_message(t('This is a dummy message.')); print t('A message was set.'); // Do not return anything, so the current request does not result in a themed // page with messages. The message will be displayed in the following request // instead. } /** * Menu callback, sets a message but call drupal_save_session(FALSE). */ function _session_test_set_message_but_dont_save() { drupal_save_session(FALSE); _session_test_set_message(); } /** * Menu callback, stores a value in $_SESSION['session_test_value'] without * having started the session in advance. */ function _session_test_set_not_started() { if (!drupal_session_will_start()) { $_SESSION['session_test_value'] = t('Session was not started'); } } /** * Implements hook_user(). */ function session_test_user_login($edit = array(), $user = NULL) { if ($user->name == 'session_test_user') { // Exit so we can verify that the session was regenerated // before hook_user() was called. exit; } } /** * Implements hook_form_FORM_ID_alter(). */ function session_test_form_user_login_alter(&$form) { $form['#https'] = TRUE; } /** * Implements hook_drupal_goto_alter(). * * Force the redirection to go to a non-secure page after being on a secure * page through https.php. */ function session_test_drupal_goto_alter(&$path, &$options, &$http_response_code) { global $base_insecure_url, $is_https_mock; // Alter the redirect to use HTTP when using a mock HTTPS request through // https.php because form submissions would otherwise redirect to a // non-existent HTTPS site. if (!empty($is_https_mock)) { $path = $base_insecure_url . '/' . $path; } } /** * Menu callback, only available if current user is logged in. */ function _session_test_is_logged_in() { return t('User is logged in.'); } drupal-7.41/modules/simpletest/tests/theme_test.inc0000644000000000000000000000056412611765734021312 0ustar rootroot 'Module API', 'description' => 'Test low-level module functions.', 'group' => 'Module', ); } /** * The basic functionality of module_list(). */ function testModuleList() { // Build a list of modules, sorted alphabetically. $profile_info = install_profile_info('standard', 'en'); $module_list = $profile_info['dependencies']; // Installation profile is a module that is expected to be loaded. $module_list[] = 'standard'; sort($module_list); // Compare this list to the one returned by module_list(). We expect them // to match, since all default profile modules have a weight equal to 0 // (except for block.module, which has a lower weight but comes first in // the alphabet anyway). $this->assertModuleList($module_list, t('Standard profile')); // Try to install a new module. module_enable(array('contact')); $module_list[] = 'contact'; sort($module_list); $this->assertModuleList($module_list, t('After adding a module')); // Try to mess with the module weights. db_update('system') ->fields(array('weight' => 20)) ->condition('name', 'contact') ->condition('type', 'module') ->execute(); // Reset the module list. module_list(TRUE); // Move contact to the end of the array. unset($module_list[array_search('contact', $module_list)]); $module_list[] = 'contact'; $this->assertModuleList($module_list, t('After changing weights')); // Test the fixed list feature. $fixed_list = array( 'system' => array('filename' => drupal_get_path('module', 'system')), 'menu' => array('filename' => drupal_get_path('module', 'menu')), ); module_list(FALSE, FALSE, FALSE, $fixed_list); $new_module_list = array_combine(array_keys($fixed_list), array_keys($fixed_list)); $this->assertModuleList($new_module_list, t('When using a fixed list')); // Reset the module list. module_list(TRUE); $this->assertModuleList($module_list, t('After reset')); } /** * Assert that module_list() return the expected values. * * @param $expected_values * The expected values, sorted by weight and module name. */ protected function assertModuleList(Array $expected_values, $condition) { $expected_values = array_combine($expected_values, $expected_values); $this->assertEqual($expected_values, module_list(), format_string('@condition: module_list() returns correct results', array('@condition' => $condition))); ksort($expected_values); $this->assertIdentical($expected_values, module_list(FALSE, FALSE, TRUE), format_string('@condition: module_list() returns correctly sorted results', array('@condition' => $condition))); } /** * Test module_implements() caching. */ function testModuleImplements() { // Clear the cache. cache_clear_all('module_implements', 'cache_bootstrap'); $this->assertFalse(cache_get('module_implements', 'cache_bootstrap'), 'The module implements cache is empty.'); $this->drupalGet(''); $this->assertTrue(cache_get('module_implements', 'cache_bootstrap'), 'The module implements cache is populated after requesting a page.'); // Test again with an authenticated user. $this->user = $this->drupalCreateUser(); $this->drupalLogin($this->user); cache_clear_all('module_implements', 'cache_bootstrap'); $this->drupalGet(''); $this->assertTrue(cache_get('module_implements', 'cache_bootstrap'), 'The module implements cache is populated after requesting a page.'); // Make sure group include files are detected properly even when the file is // already loaded when the cache is rebuilt. // For that activate the module_test which provides the file to load. module_enable(array('module_test')); module_load_include('inc', 'module_test', 'module_test.file'); $modules = module_implements('test_hook'); $static = drupal_static('module_implements'); $this->assertTrue(in_array('module_test', $modules), 'Hook found.'); $this->assertEqual($static['test_hook']['module_test'], 'file', 'Include file detected.'); } /** * Test that module_invoke() can load a hook defined in hook_hook_info(). */ function testModuleInvoke() { module_enable(array('module_test'), FALSE); $this->resetAll(); $this->drupalGet('module-test/hook-dynamic-loading-invoke'); $this->assertText('success!', 'module_invoke() dynamically loads a hook defined in hook_hook_info().'); } /** * Test that module_invoke_all() can load a hook defined in hook_hook_info(). */ function testModuleInvokeAll() { module_enable(array('module_test'), FALSE); $this->resetAll(); $this->drupalGet('module-test/hook-dynamic-loading-invoke-all'); $this->assertText('success!', 'module_invoke_all() dynamically loads a hook defined in hook_hook_info().'); } /** * Test dependency resolution. */ function testDependencyResolution() { // Enable the test module, and make sure that other modules we are testing // are not already enabled. (If they were, the tests below would not work // correctly.) module_enable(array('module_test'), FALSE); $this->assertTrue(module_exists('module_test'), 'Test module is enabled.'); $this->assertFalse(module_exists('forum'), 'Forum module is disabled.'); $this->assertFalse(module_exists('poll'), 'Poll module is disabled.'); $this->assertFalse(module_exists('php'), 'PHP module is disabled.'); // First, create a fake missing dependency. Forum depends on poll, which // depends on a made-up module, foo. Nothing should be installed. variable_set('dependency_test', 'missing dependency'); drupal_static_reset('system_rebuild_module_data'); $result = module_enable(array('forum')); $this->assertFalse($result, 'module_enable() returns FALSE if dependencies are missing.'); $this->assertFalse(module_exists('forum'), 'module_enable() aborts if dependencies are missing.'); // Now, fix the missing dependency. Forum module depends on poll, but poll // depends on the PHP module. module_enable() should work. variable_set('dependency_test', 'dependency'); drupal_static_reset('system_rebuild_module_data'); $result = module_enable(array('forum')); $this->assertTrue($result, 'module_enable() returns the correct value.'); // Verify that the fake dependency chain was installed. $this->assertTrue(module_exists('poll') && module_exists('php'), 'Dependency chain was installed by module_enable().'); // Verify that the original module was installed. $this->assertTrue(module_exists('forum'), 'Module installation with unlisted dependencies succeeded.'); // Finally, verify that the modules were enabled in the correct order. $this->assertEqual(variable_get('test_module_enable_order', array()), array('php', 'poll', 'forum'), 'Modules were enabled in the correct order by module_enable().'); // Now, disable the PHP module. Both forum and poll should be disabled as // well, in the correct order. module_disable(array('php')); $this->assertTrue(!module_exists('forum') && !module_exists('poll'), 'Depedency chain was disabled by module_disable().'); $this->assertFalse(module_exists('php'), 'Disabling a module with unlisted dependents succeeded.'); $this->assertEqual(variable_get('test_module_disable_order', array()), array('forum', 'poll', 'php'), 'Modules were disabled in the correct order by module_disable().'); // Disable a module that is listed as a dependency by the installation // profile. Make sure that the profile itself is not on the list of // dependent modules to be disabled. $profile = drupal_get_profile(); $info = install_profile_info($profile); $this->assertTrue(in_array('comment', $info['dependencies']), 'Comment module is listed as a dependency of the installation profile.'); $this->assertTrue(module_exists('comment'), 'Comment module is enabled.'); module_disable(array('comment')); $this->assertFalse(module_exists('comment'), 'Comment module was disabled.'); $disabled_modules = variable_get('test_module_disable_order', array()); $this->assertTrue(in_array('comment', $disabled_modules), 'Comment module is in the list of disabled modules.'); $this->assertFalse(in_array($profile, $disabled_modules), 'The installation profile is not in the list of disabled modules.'); // Try to uninstall the PHP module by itself. This should be rejected, // since the modules which it depends on need to be uninstalled first, and // that is too destructive to perform automatically. $result = drupal_uninstall_modules(array('php')); $this->assertFalse($result, 'Calling drupal_uninstall_modules() on a module whose dependents are not uninstalled fails.'); foreach (array('forum', 'poll', 'php') as $module) { $this->assertNotEqual(drupal_get_installed_schema_version($module), SCHEMA_UNINSTALLED, format_string('The @module module was not uninstalled.', array('@module' => $module))); } // Now uninstall all three modules explicitly, but in the incorrect order, // and make sure that drupal_uninstal_modules() uninstalled them in the // correct sequence. $result = drupal_uninstall_modules(array('poll', 'php', 'forum')); $this->assertTrue($result, 'drupal_uninstall_modules() returns the correct value.'); foreach (array('forum', 'poll', 'php') as $module) { $this->assertEqual(drupal_get_installed_schema_version($module), SCHEMA_UNINSTALLED, format_string('The @module module was uninstalled.', array('@module' => $module))); } $this->assertEqual(variable_get('test_module_uninstall_order', array()), array('forum', 'poll', 'php'), 'Modules were uninstalled in the correct order by drupal_uninstall_modules().'); // Uninstall the profile module from above, and make sure that the profile // itself is not on the list of dependent modules to be uninstalled. $result = drupal_uninstall_modules(array('comment')); $this->assertTrue($result, 'drupal_uninstall_modules() returns the correct value.'); $this->assertEqual(drupal_get_installed_schema_version('comment'), SCHEMA_UNINSTALLED, 'Comment module was uninstalled.'); $uninstalled_modules = variable_get('test_module_uninstall_order', array()); $this->assertTrue(in_array('comment', $uninstalled_modules), 'Comment module is in the list of uninstalled modules.'); $this->assertFalse(in_array($profile, $uninstalled_modules), 'The installation profile is not in the list of uninstalled modules.'); // Enable forum module again, which should enable both the poll module and // php module. But, this time do it with poll module declaring a dependency // on a specific version of php module in its info file. Make sure that // module_enable() still works. variable_set('dependency_test', 'version dependency'); drupal_static_reset('system_rebuild_module_data'); $result = module_enable(array('forum')); $this->assertTrue($result, 'module_enable() returns the correct value.'); // Verify that the fake dependency chain was installed. $this->assertTrue(module_exists('poll') && module_exists('php'), 'Dependency chain was installed by module_enable().'); // Verify that the original module was installed. $this->assertTrue(module_exists('forum'), 'Module installation with version dependencies succeeded.'); // Finally, verify that the modules were enabled in the correct order. $enable_order = variable_get('test_module_enable_order', array()); $php_position = array_search('php', $enable_order); $poll_position = array_search('poll', $enable_order); $forum_position = array_search('forum', $enable_order); $php_before_poll = $php_position !== FALSE && $poll_position !== FALSE && $php_position < $poll_position; $poll_before_forum = $poll_position !== FALSE && $forum_position !== FALSE && $poll_position < $forum_position; $this->assertTrue($php_before_poll && $poll_before_forum, 'Modules were enabled in the correct order by module_enable().'); } } /** * Unit tests for module installation. */ class ModuleInstallTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Module installation', 'description' => 'Tests the installation of modules.', 'group' => 'Module', ); } function setUp() { parent::setUp('module_test'); } /** * Test that calls to drupal_write_record() work during module installation. * * This is a useful function to test because modules often use it to insert * initial data in their database tables when they are being installed or * enabled. Furthermore, drupal_write_record() relies on the module schema * information being available, so this also checks that the data from one of * the module's hook implementations, in particular hook_schema(), is * properly available during this time. Therefore, this test helps ensure * that modules are fully functional while Drupal is installing and enabling * them. */ function testDrupalWriteRecord() { // Check for data that was inserted using drupal_write_record() while the // 'module_test' module was being installed and enabled. $data = db_query("SELECT data FROM {module_test}")->fetchCol(); $this->assertTrue(in_array('Data inserted in hook_install()', $data), 'Data inserted using drupal_write_record() in hook_install() is correctly saved.'); $this->assertTrue(in_array('Data inserted in hook_enable()', $data), 'Data inserted using drupal_write_record() in hook_enable() is correctly saved.'); } } /** * Unit tests for module uninstallation and related hooks. */ class ModuleUninstallTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Module uninstallation', 'description' => 'Tests the uninstallation of modules.', 'group' => 'Module', ); } function setUp() { parent::setUp('module_test', 'user'); } /** * Tests the hook_modules_uninstalled() of the user module. */ function testUserPermsUninstalled() { // Uninstalls the module_test module, so hook_modules_uninstalled() // is executed. module_disable(array('module_test')); drupal_uninstall_modules(array('module_test')); // Are the perms defined by module_test removed from {role_permission}. $count = db_query("SELECT COUNT(rid) FROM {role_permission} WHERE permission = :perm", array(':perm' => 'module_test perm'))->fetchField(); $this->assertEqual(0, $count, 'Permissions were all removed.'); } } class ModuleImplementsAlterTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Module implements alter', 'description' => 'Tests hook_module_implements_alter().', 'group' => 'Module', ); } /** * Tests hook_module_implements_alter() adding an implementation. */ function testModuleImplementsAlter() { module_enable(array('module_test'), FALSE); $this->assertTrue(module_exists('module_test'), 'Test module is enabled.'); // Assert that module_test.module is now included. $this->assertTrue(function_exists('module_test_permission'), 'The file module_test.module was successfully included.'); $modules = module_implements('permission'); $this->assertTrue(in_array('module_test', $modules), 'module_test implements hook_permission.'); $modules = module_implements('module_implements_alter'); $this->assertTrue(in_array('module_test', $modules), 'module_test implements hook_module_implements_alter().'); // Assert that module_test.implementations.inc is not included yet. $this->assertFalse(function_exists('module_test_altered_test_hook'), 'The file module_test.implementations.inc is not included yet.'); // Assert that module_test_module_implements_alter(*, 'altered_test_hook') // has added an implementation $this->assertTrue(in_array('module_test', module_implements('altered_test_hook')), 'module_test implements hook_altered_test_hook().'); // Assert that module_test.implementations.inc was included as part of the process. $this->assertTrue(function_exists('module_test_altered_test_hook'), 'The file module_test.implementations.inc was included.'); } } drupal-7.41/modules/simpletest/tests/common_test.module0000644000000000000000000001640412611765734022214 0ustar rootroot 'Drupal Goto', 'page callback' => 'common_test_drupal_goto_land', 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['common-test/drupal_goto/fail'] = array( 'title' => 'Drupal Goto', 'page callback' => 'common_test_drupal_goto_land_fail', 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['common-test/drupal_goto/redirect'] = array( 'title' => 'Drupal Goto', 'page callback' => 'common_test_drupal_goto_redirect', 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['common-test/drupal_goto/redirect_advanced'] = array( 'title' => 'Drupal Goto', 'page callback' => 'common_test_drupal_goto_redirect_advanced', 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['common-test/drupal_goto/redirect_fail'] = array( 'title' => 'Drupal Goto Failure', 'page callback' => 'drupal_goto', 'page arguments' => array('common-test/drupal_goto/fail'), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['common-test/destination'] = array( 'title' => 'Drupal Get Destination', 'page callback' => 'common_test_destination', 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['common-test/query-string'] = array( 'title' => 'Test querystring', 'page callback' => 'common_test_js_and_css_querystring', 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); return $items; } /** * Redirect using drupal_goto(). */ function common_test_drupal_goto_redirect() { drupal_goto('common-test/drupal_goto'); } /** * Redirect using drupal_goto(). */ function common_test_drupal_goto_redirect_advanced() { drupal_goto('common-test/drupal_goto', array('query' => array('foo' => '123')), 301); } /** * Landing page for drupal_goto(). */ function common_test_drupal_goto_land() { print "drupal_goto"; } /** * Fail landing page for drupal_goto(). */ function common_test_drupal_goto_land_fail() { print "drupal_goto_fail"; } /** * Implements hook_drupal_goto_alter(). */ function common_test_drupal_goto_alter(&$path, &$options, &$http_response_code) { if ($path == 'common-test/drupal_goto/fail') { $path = 'common-test/drupal_goto/redirect'; } } /** * Print destination query parameter. */ function common_test_destination() { $destination = drupal_get_destination(); print "The destination: " . check_plain($destination['destination']); } /** * Applies #printed to an element to help test #pre_render. */ function common_test_drupal_render_printing_pre_render($elements) { $elements['#printed'] = TRUE; return $elements; } /** * Implements hook_TYPE_alter(). */ function common_test_drupal_alter_alter(&$data, &$arg2 = NULL, &$arg3 = NULL) { // Alter first argument. if (is_array($data)) { $data['foo'] = 'Drupal'; } elseif (is_object($data)) { $data->foo = 'Drupal'; } // Alter second argument, if present. if (isset($arg2)) { if (is_array($arg2)) { $arg2['foo'] = 'Drupal'; } elseif (is_object($arg2)) { $arg2->foo = 'Drupal'; } } // Try to alter third argument, if present. if (isset($arg3)) { if (is_array($arg3)) { $arg3['foo'] = 'Drupal'; } elseif (is_object($arg3)) { $arg3->foo = 'Drupal'; } } } /** * Implements hook_TYPE_alter() on behalf of Bartik theme. * * Same as common_test_drupal_alter_alter(), but here, we verify that themes * can also alter and come last. */ function bartik_drupal_alter_alter(&$data, &$arg2 = NULL, &$arg3 = NULL) { // Alter first argument. if (is_array($data)) { $data['foo'] .= ' theme'; } elseif (is_object($data)) { $data->foo .= ' theme'; } // Alter second argument, if present. if (isset($arg2)) { if (is_array($arg2)) { $arg2['foo'] .= ' theme'; } elseif (is_object($arg2)) { $arg2->foo .= ' theme'; } } // Try to alter third argument, if present. if (isset($arg3)) { if (is_array($arg3)) { $arg3['foo'] .= ' theme'; } elseif (is_object($arg3)) { $arg3->foo .= ' theme'; } } } /** * Implements hook_TYPE_alter() on behalf of block module. * * This is for verifying that drupal_alter(array(TYPE1, TYPE2), ...) allows * hook_module_implements_alter() to affect the order in which module * implementations are executed. */ function block_drupal_alter_foo_alter(&$data, &$arg2 = NULL, &$arg3 = NULL) { $data['foo'] .= ' block'; } /** * Implements hook_module_implements_alter(). * * @see block_drupal_alter_foo_alter() */ function common_test_module_implements_alter(&$implementations, $hook) { // For drupal_alter(array('drupal_alter', 'drupal_alter_foo'), ...), make the // block module implementations run after all the other modules. Note that // when drupal_alter() is called with an array of types, the first type is // considered primary and controls the module order. if ($hook == 'drupal_alter_alter' && isset($implementations['block'])) { $group = $implementations['block']; unset($implementations['block']); $implementations['block'] = $group; } } /** * Implements hook_theme(). */ function common_test_theme() { return array( 'common_test_foo' => array( 'variables' => array('foo' => 'foo', 'bar' => 'bar'), ), ); } /** * Theme function for testing drupal_render() theming. */ function theme_common_test_foo($variables) { return $variables['foo'] . $variables['bar']; } /** * Implements hook_library_alter(). */ function common_test_library_alter(&$libraries, $module) { if ($module == 'system' && isset($libraries['farbtastic'])) { // Change the title of Farbtastic to "Farbtastic: Altered Library". $libraries['farbtastic']['title'] = 'Farbtastic: Altered Library'; // Make Farbtastic depend on jQuery Form to test library dependencies. $libraries['farbtastic']['dependencies'][] = array('system', 'form'); } } /** * Implements hook_library(). * * Adds Farbtastic in a different version. */ function common_test_library() { $libraries['farbtastic'] = array( 'title' => 'Custom Farbtastic Library', 'website' => 'http://code.google.com/p/farbtastic/', 'version' => '5.3', 'js' => array( 'misc/farbtastic/farbtastic.js' => array(), ), 'css' => array( 'misc/farbtastic/farbtastic.css' => array(), ), ); return $libraries; } /** * Adds a JavaScript file and a CSS file with a query string appended. */ function common_test_js_and_css_querystring() { drupal_add_js(drupal_get_path('module', 'node') . '/node.js'); drupal_add_css(drupal_get_path('module', 'node') . '/node.css'); // A relative URI may have a query string. drupal_add_css('/' . drupal_get_path('module', 'node') . '/node-fake.css?arg1=value1&arg2=value2'); return ''; } /** * Implements hook_cron(). * * System module should handle if a module does not catch an exception and keep * cron going. * * @see common_test_cron_helper() * */ function common_test_cron() { throw new Exception(t('Uncaught exception')); } drupal-7.41/modules/simpletest/tests/database_test.info0000644000000000000000000000041512611767501022123 0ustar rootrootname = "Database Test" description = "Support module for Database layer tests." core = 7.x package = Testing version = VERSION hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/entity_crud_hook_test.info0000644000000000000000000000042112611767501023725 0ustar rootrootname = "Entity CRUD Hooks Test" description = "Support module for CRUD hook tests." core = 7.x package = Testing version = VERSION hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/file_test.module0000644000000000000000000003035212611765734021641 0ustar rootroot 'Upload test', 'page callback' => 'drupal_get_form', 'page arguments' => array('_file_test_form'), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); return $items; } /** * Implements hook_stream_wrappers(). */ function file_test_stream_wrappers() { return array( 'dummy' => array( 'name' => t('Dummy files'), 'class' => 'DrupalDummyStreamWrapper', 'description' => t('Dummy wrapper for simpletest.'), ), 'dummy-remote' => array( 'name' => t('Dummy files (remote)'), 'class' => 'DrupalDummyRemoteStreamWrapper', 'description' => t('Dummy wrapper for simpletest (remote).'), ), ); } /** * Form to test file uploads. */ function _file_test_form($form, &$form_state) { $form['file_test_upload'] = array( '#type' => 'file', '#title' => t('Upload a file'), ); $form['file_test_replace'] = array( '#type' => 'select', '#title' => t('Replace existing image'), '#options' => array( FILE_EXISTS_RENAME => t('Appends number until name is unique'), FILE_EXISTS_REPLACE => t('Replace the existing file'), FILE_EXISTS_ERROR => t('Fail with an error'), ), '#default_value' => FILE_EXISTS_RENAME, ); $form['file_subdir'] = array( '#type' => 'textfield', '#title' => t('Subdirectory for test file'), '#default_value' => '', ); $form['extensions'] = array( '#type' => 'textfield', '#title' => t('Allowed extensions.'), '#default_value' => '', ); $form['allow_all_extensions'] = array( '#type' => 'checkbox', '#title' => t('Allow all extensions?'), '#default_value' => FALSE, ); $form['is_image_file'] = array( '#type' => 'checkbox', '#title' => t('Is this an image file?'), '#default_value' => TRUE, ); $form['submit'] = array( '#type' => 'submit', '#value' => t('Submit'), ); return $form; } /** * Process the upload. */ function _file_test_form_submit(&$form, &$form_state) { // Process the upload and perform validation. Note: we're using the // form value for the $replace parameter. if (!empty($form_state['values']['file_subdir'])) { $destination = 'temporary://' . $form_state['values']['file_subdir']; file_prepare_directory($destination, FILE_CREATE_DIRECTORY); } else { $destination = FALSE; } // Setup validators. $validators = array(); if ($form_state['values']['is_image_file']) { $validators['file_validate_is_image'] = array(); } if ($form_state['values']['allow_all_extensions']) { $validators['file_validate_extensions'] = array(); } elseif (!empty($form_state['values']['extensions'])) { $validators['file_validate_extensions'] = array($form_state['values']['extensions']); } $file = file_save_upload('file_test_upload', $validators, $destination, $form_state['values']['file_test_replace']); if ($file) { $form_state['values']['file_test_upload'] = $file; drupal_set_message(t('File @filepath was uploaded.', array('@filepath' => $file->uri))); drupal_set_message(t('File name is @filename.', array('@filename' => $file->filename))); drupal_set_message(t('File MIME type is @mimetype.', array('@mimetype' => $file->filemime))); drupal_set_message(t('You WIN!')); } elseif ($file === FALSE) { drupal_set_message(t('Epic upload FAIL!'), 'error'); } } /** * Reset/initialize the history of calls to the file_* hooks. * * @see file_test_get_calls() * @see file_test_reset() */ function file_test_reset() { // Keep track of calls to these hooks $results = array( 'load' => array(), 'validate' => array(), 'download' => array(), 'insert' => array(), 'update' => array(), 'copy' => array(), 'move' => array(), 'delete' => array(), ); variable_set('file_test_results', $results); // These hooks will return these values, see file_test_set_return(). $return = array( 'validate' => array(), 'download' => NULL, ); variable_set('file_test_return', $return); } /** * Get the arguments passed to invocation of a given hook since * file_test_reset() was last called. * * @param $op * One of the hook_file_* operations: 'load', 'validate', 'download', * 'insert', 'update', 'copy', 'move', 'delete'. * * @return * Array of the parameters passed to each call. * * @see _file_test_log_call() * @see file_test_reset() */ function file_test_get_calls($op) { $results = variable_get('file_test_results', array()); return $results[$op]; } /** * Get an array with the calls for all hooks. * * @return * An array keyed by hook name ('load', 'validate', 'download', 'insert', * 'update', 'copy', 'move', 'delete') with values being arrays of parameters * passed to each call. */ function file_test_get_all_calls() { return variable_get('file_test_results', array()); } /** * Store the values passed to a hook invocation. * * @param $op * One of the hook_file_* operations: 'load', 'validate', 'download', * 'insert', 'update', 'copy', 'move', 'delete'. * @param $args * Values passed to hook. * * @see file_test_get_calls() * @see file_test_reset() */ function _file_test_log_call($op, $args) { $results = variable_get('file_test_results', array()); $results[$op][] = $args; variable_set('file_test_results', $results); } /** * Load the appropriate return value. * * @param $op * One of the hook_file_[validate,download] operations. * * @return * Value set by file_test_set_return(). * * @see file_test_set_return() * @see file_test_reset() */ function _file_test_get_return($op) { $return = variable_get('file_test_return', array($op => NULL)); return $return[$op]; } /** * Assign a return value for a given operation. * * @param $op * One of the hook_file_[validate,download] operations. * @param $value * Value for the hook to return. * * @see _file_test_get_return() * @see file_test_reset() */ function file_test_set_return($op, $value) { $return = variable_get('file_test_return', array()); $return[$op] = $value; variable_set('file_test_return', $return); } /** * Implements hook_file_load(). */ function file_test_file_load($files) { foreach ($files as $file) { _file_test_log_call('load', array($file)); // Assign a value on the object so that we can test that the $file is passed // by reference. $file->file_test['loaded'] = TRUE; } } /** * Implements hook_file_validate(). */ function file_test_file_validate($file) { _file_test_log_call('validate', array($file)); return _file_test_get_return('validate'); } /** * Implements hook_file_download(). */ function file_test_file_download($uri) { _file_test_log_call('download', array($uri)); return _file_test_get_return('download'); } /** * Implements hook_file_insert(). */ function file_test_file_insert($file) { _file_test_log_call('insert', array($file)); } /** * Implements hook_file_update(). */ function file_test_file_update($file) { _file_test_log_call('update', array($file)); } /** * Implements hook_file_copy(). */ function file_test_file_copy($file, $source) { _file_test_log_call('copy', array($file, $source)); } /** * Implements hook_file_move(). */ function file_test_file_move($file, $source) { _file_test_log_call('move', array($file, $source)); } /** * Implements hook_file_delete(). */ function file_test_file_delete($file) { _file_test_log_call('delete', array($file)); } /** * Implements hook_file_url_alter(). */ function file_test_file_url_alter(&$uri) { // Only run this hook when this variable is set. Otherwise, we'd have to add // another hidden test module just for this hook. $alter_mode = variable_get('file_test_hook_file_url_alter', FALSE); if (!$alter_mode) { return; } // Test alteration of file URLs to use a CDN. elseif ($alter_mode == 'cdn') { $cdn_extensions = array('css', 'js', 'gif', 'jpg', 'jpeg', 'png'); // Most CDNs don't support private file transfers without a lot of hassle, // so don't support this in the common case. $schemes = array('public'); $scheme = file_uri_scheme($uri); // Only serve shipped files and public created files from the CDN. if (!$scheme || in_array($scheme, $schemes)) { // Shipped files. if (!$scheme) { $path = $uri; } // Public created files. else { $wrapper = file_stream_wrapper_get_instance_by_scheme($scheme); $path = $wrapper->getDirectoryPath() . '/' . file_uri_target($uri); } // Clean up Windows paths. $path = str_replace('\\', '/', $path); // Serve files with one of the CDN extensions from CDN 1, all others from // CDN 2. $pathinfo = pathinfo($path); if (array_key_exists('extension', $pathinfo) && in_array($pathinfo['extension'], $cdn_extensions)) { $uri = FILE_URL_TEST_CDN_1 . '/' . $path; } else { $uri = FILE_URL_TEST_CDN_2 . '/' . $path; } } } // Test alteration of file URLs to use root-relative URLs. elseif ($alter_mode == 'root-relative') { // Only serve shipped files and public created files with root-relative // URLs. $scheme = file_uri_scheme($uri); if (!$scheme || $scheme == 'public') { // Shipped files. if (!$scheme) { $path = $uri; } // Public created files. else { $wrapper = file_stream_wrapper_get_instance_by_scheme($scheme); $path = $wrapper->getDirectoryPath() . '/' . file_uri_target($uri); } // Clean up Windows paths. $path = str_replace('\\', '/', $path); // Generate a root-relative URL. $uri = base_path() . '/' . $path; } } // Test alteration of file URLs to use protocol-relative URLs. elseif ($alter_mode == 'protocol-relative') { // Only serve shipped files and public created files with protocol-relative // URLs. $scheme = file_uri_scheme($uri); if (!$scheme || $scheme == 'public') { // Shipped files. if (!$scheme) { $path = $uri; } // Public created files. else { $wrapper = file_stream_wrapper_get_instance_by_scheme($scheme); $path = $wrapper->getDirectoryPath() . '/' . file_uri_target($uri); } // Clean up Windows paths. $path = str_replace('\\', '/', $path); // Generate a protocol-relative URL. $uri = '/' . base_path() . '/' . $path; } } } /** * Implements hook_file_mimetype_mapping_alter(). */ function file_test_file_mimetype_mapping_alter(&$mapping) { // Add new mappings. $mapping['mimetypes']['file_test_mimetype_1'] = 'madeup/file_test_1'; $mapping['mimetypes']['file_test_mimetype_2'] = 'madeup/file_test_2'; $mapping['mimetypes']['file_test_mimetype_3'] = 'madeup/doc'; $mapping['extensions']['file_test_1'] = 'file_test_mimetype_1'; $mapping['extensions']['file_test_2'] = 'file_test_mimetype_2'; $mapping['extensions']['file_test_3'] = 'file_test_mimetype_2'; // Override existing mapping. $mapping['extensions']['doc'] = 'file_test_mimetype_3'; } /** * Helper class for testing the stream wrapper registry. * * Dummy stream wrapper implementation (dummy://). */ class DrupalDummyStreamWrapper extends DrupalLocalStreamWrapper { function getDirectoryPath() { return variable_get('stream_public_path', 'sites/default/files'); } /** * Override getInternalUri(). * * Return a dummy path for testing. */ function getInternalUri() { return '/dummy/example.txt'; } /** * Override getExternalUrl(). * * Return the HTML URI of a public file. */ function getExternalUrl() { return '/dummy/example.txt'; } } /** * Helper class for testing the stream wrapper registry. * * Dummy remote stream wrapper implementation (dummy-remote://). * * Basically just the public scheme but not returning a local file for realpath. */ class DrupalDummyRemoteStreamWrapper extends DrupalPublicStreamWrapper { function realpath() { return FALSE; } } drupal-7.41/modules/simpletest/tests/drupal_system_listing_incompatible_test/0000755000000000000000000000000012611765734026662 5ustar rootroot././@LongLink0000000000000000000000000000017400000000000011567 Lustar rootrootdrupal-7.41/modules/simpletest/tests/drupal_system_listing_incompatible_test/drupal_system_listing_incompatible_test.moduledrupal-7.41/modules/simpletest/tests/drupal_system_listing_incompatible_test/drupal_system_listing_i0000644000000000000000000000000612611765734033535 0ustar rootroot 'IP address and HTTP_HOST test', 'description' => 'Get the IP address from the current visitor from the server variables, check hostname validation.', 'group' => 'Bootstrap' ); } function setUp() { $this->oldserver = $_SERVER; $this->remote_ip = '127.0.0.1'; $this->proxy_ip = '127.0.0.2'; $this->proxy2_ip = '127.0.0.3'; $this->forwarded_ip = '127.0.0.4'; $this->cluster_ip = '127.0.0.5'; $this->untrusted_ip = '0.0.0.0'; drupal_static_reset('ip_address'); $_SERVER['REMOTE_ADDR'] = $this->remote_ip; unset($_SERVER['HTTP_X_FORWARDED_FOR']); unset($_SERVER['HTTP_X_CLUSTER_CLIENT_IP']); parent::setUp(); } function tearDown() { $_SERVER = $this->oldserver; drupal_static_reset('ip_address'); parent::tearDown(); } /** * test IP Address and hostname */ function testIPAddressHost() { // Test the normal IP address. $this->assertTrue( ip_address() == $this->remote_ip, 'Got remote IP address.' ); // Proxy forwarding on but no proxy addresses defined. variable_set('reverse_proxy', 1); $this->assertTrue( ip_address() == $this->remote_ip, 'Proxy forwarding without trusted proxies got remote IP address.' ); // Proxy forwarding on and proxy address not trusted. variable_set('reverse_proxy_addresses', array($this->proxy_ip, $this->proxy2_ip)); drupal_static_reset('ip_address'); $_SERVER['REMOTE_ADDR'] = $this->untrusted_ip; $this->assertTrue( ip_address() == $this->untrusted_ip, 'Proxy forwarding with untrusted proxy got remote IP address.' ); // Proxy forwarding on and proxy address trusted. $_SERVER['REMOTE_ADDR'] = $this->proxy_ip; $_SERVER['HTTP_X_FORWARDED_FOR'] = $this->forwarded_ip; drupal_static_reset('ip_address'); $this->assertTrue( ip_address() == $this->forwarded_ip, 'Proxy forwarding with trusted proxy got forwarded IP address.' ); // Multi-tier architecture with comma separated values in header. $_SERVER['REMOTE_ADDR'] = $this->proxy_ip; $_SERVER['HTTP_X_FORWARDED_FOR'] = implode(', ', array($this->untrusted_ip, $this->forwarded_ip, $this->proxy2_ip)); drupal_static_reset('ip_address'); $this->assertTrue( ip_address() == $this->forwarded_ip, 'Proxy forwarding with trusted 2-tier proxy got forwarded IP address.' ); // Custom client-IP header. variable_set('reverse_proxy_header', 'HTTP_X_CLUSTER_CLIENT_IP'); $_SERVER['HTTP_X_CLUSTER_CLIENT_IP'] = $this->cluster_ip; drupal_static_reset('ip_address'); $this->assertTrue( ip_address() == $this->cluster_ip, 'Cluster environment got cluster client IP.' ); // Verifies that drupal_valid_http_host() prevents invalid characters. $this->assertFalse(drupal_valid_http_host('security/.drupal.org:80'), 'HTTP_HOST with / is invalid'); $this->assertFalse(drupal_valid_http_host('security\\.drupal.org:80'), 'HTTP_HOST with \\ is invalid'); $this->assertFalse(drupal_valid_http_host('security<.drupal.org:80'), 'HTTP_HOST with < is invalid'); $this->assertFalse(drupal_valid_http_host('security..drupal.org:80'), 'HTTP_HOST with .. is invalid'); // Verifies that host names are shorter than 1000 characters. $this->assertFalse(drupal_valid_http_host(str_repeat('x', 1001)), 'HTTP_HOST with more than 1000 characters is invalid.'); $this->assertFalse(drupal_valid_http_host(str_repeat('.', 101)), 'HTTP_HOST with more than 100 subdomains is invalid.'); $this->assertFalse(drupal_valid_http_host(str_repeat(':', 101)), 'HTTP_HOST with more than 100 portseparators is invalid.'); // IPv6 loopback address $this->assertTrue(drupal_valid_http_host('[::1]:80'), 'HTTP_HOST containing IPv6 loopback is valid'); } } class BootstrapPageCacheTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Page cache test', 'description' => 'Enable the page cache and test it with various HTTP requests.', 'group' => 'Bootstrap' ); } function setUp() { parent::setUp('system_test'); } /** * Test support for requests containing If-Modified-Since and If-None-Match headers. */ function testConditionalRequests() { variable_set('cache', 1); // Fill the cache. $this->drupalGet(''); $this->drupalHead(''); $this->assertEqual($this->drupalGetHeader('X-Drupal-Cache'), 'HIT', 'Page was cached.'); $etag = $this->drupalGetHeader('ETag'); $last_modified = $this->drupalGetHeader('Last-Modified'); $this->drupalGet('', array(), array('If-Modified-Since: ' . $last_modified, 'If-None-Match: ' . $etag)); $this->assertResponse(304, 'Conditional request returned 304 Not Modified.'); $this->drupalGet('', array(), array('If-Modified-Since: ' . gmdate(DATE_RFC822, strtotime($last_modified)), 'If-None-Match: ' . $etag)); $this->assertResponse(304, 'Conditional request with obsolete If-Modified-Since date returned 304 Not Modified.'); $this->drupalGet('', array(), array('If-Modified-Since: ' . gmdate(DATE_RFC850, strtotime($last_modified)), 'If-None-Match: ' . $etag)); $this->assertResponse(304, 'Conditional request with obsolete If-Modified-Since date returned 304 Not Modified.'); $this->drupalGet('', array(), array('If-Modified-Since: ' . $last_modified)); $this->assertResponse(200, 'Conditional request without If-None-Match returned 200 OK.'); $this->assertEqual($this->drupalGetHeader('X-Drupal-Cache'), 'HIT', 'Page was cached.'); $this->drupalGet('', array(), array('If-Modified-Since: ' . gmdate(DATE_RFC7231, strtotime($last_modified) + 1), 'If-None-Match: ' . $etag)); $this->assertResponse(200, 'Conditional request with new a If-Modified-Since date newer than Last-Modified returned 200 OK.'); $this->assertEqual($this->drupalGetHeader('X-Drupal-Cache'), 'HIT', 'Page was cached.'); $user = $this->drupalCreateUser(); $this->drupalLogin($user); $this->drupalGet('', array(), array('If-Modified-Since: ' . $last_modified, 'If-None-Match: ' . $etag)); $this->assertResponse(200, 'Conditional request returned 200 OK for authenticated user.'); $this->assertFalse($this->drupalGetHeader('X-Drupal-Cache'), 'Absense of Page was not cached.'); $this->assertFalse($this->drupalGetHeader('ETag'), 'ETag HTTP headers are not present for logged in users.'); $this->assertFalse($this->drupalGetHeader('Last-Modified'), 'Last-Modified HTTP headers are not present for logged in users.'); } /** * Test cache headers. */ function testPageCache() { variable_set('cache', 1); // Fill the cache. $this->drupalGet('system-test/set-header', array('query' => array('name' => 'Foo', 'value' => 'bar'))); $this->assertEqual($this->drupalGetHeader('X-Drupal-Cache'), 'MISS', 'Page was not cached.'); $this->assertEqual($this->drupalGetHeader('Vary'), 'Cookie,Accept-Encoding', 'Vary header was sent.'); $this->assertEqual($this->drupalGetHeader('Cache-Control'), 'public, max-age=0', 'Cache-Control header was sent.'); $this->assertEqual($this->drupalGetHeader('Expires'), 'Sun, 19 Nov 1978 05:00:00 GMT', 'Expires header was sent.'); $this->assertEqual($this->drupalGetHeader('Foo'), 'bar', 'Custom header was sent.'); // Check cache. $this->drupalGet('system-test/set-header', array('query' => array('name' => 'Foo', 'value' => 'bar'))); $this->assertEqual($this->drupalGetHeader('X-Drupal-Cache'), 'HIT', 'Page was cached.'); $this->assertEqual($this->drupalGetHeader('Vary'), 'Cookie,Accept-Encoding', 'Vary: Cookie header was sent.'); $this->assertEqual($this->drupalGetHeader('Cache-Control'), 'public, max-age=0', 'Cache-Control header was sent.'); $this->assertEqual($this->drupalGetHeader('Expires'), 'Sun, 19 Nov 1978 05:00:00 GMT', 'Expires header was sent.'); $this->assertEqual($this->drupalGetHeader('Foo'), 'bar', 'Custom header was sent.'); // Check replacing default headers. $this->drupalGet('system-test/set-header', array('query' => array('name' => 'Expires', 'value' => 'Fri, 19 Nov 2008 05:00:00 GMT'))); $this->assertEqual($this->drupalGetHeader('Expires'), 'Fri, 19 Nov 2008 05:00:00 GMT', 'Default header was replaced.'); $this->drupalGet('system-test/set-header', array('query' => array('name' => 'Vary', 'value' => 'User-Agent'))); $this->assertEqual($this->drupalGetHeader('Vary'), 'User-Agent,Accept-Encoding', 'Default header was replaced.'); // Check that authenticated users bypass the cache. $user = $this->drupalCreateUser(); $this->drupalLogin($user); $this->drupalGet('system-test/set-header', array('query' => array('name' => 'Foo', 'value' => 'bar'))); $this->assertFalse($this->drupalGetHeader('X-Drupal-Cache'), 'Caching was bypassed.'); $this->assertTrue(strpos($this->drupalGetHeader('Vary'), 'Cookie') === FALSE, 'Vary: Cookie header was not sent.'); $this->assertEqual($this->drupalGetHeader('Cache-Control'), 'no-cache, must-revalidate, post-check=0, pre-check=0', 'Cache-Control header was sent.'); $this->assertEqual($this->drupalGetHeader('Expires'), 'Sun, 19 Nov 1978 05:00:00 GMT', 'Expires header was sent.'); $this->assertEqual($this->drupalGetHeader('Foo'), 'bar', 'Custom header was sent.'); } /** * Test page compression. * * The test should pass even if zlib.output_compression is enabled in php.ini, * .htaccess or similar, or if compression is done outside PHP, e.g. by the * mod_deflate Apache module. */ function testPageCompression() { variable_set('cache', 1); // Fill the cache and verify that output is compressed. $this->drupalGet('', array(), array('Accept-Encoding: gzip,deflate')); $this->assertEqual($this->drupalGetHeader('X-Drupal-Cache'), 'MISS', 'Page was not cached.'); $this->drupalSetContent(gzinflate(substr($this->drupalGetContent(), 10, -8))); $this->assertRaw('', 'Page was gzip compressed.'); // Verify that cached output is compressed. $this->drupalGet('', array(), array('Accept-Encoding: gzip,deflate')); $this->assertEqual($this->drupalGetHeader('X-Drupal-Cache'), 'HIT', 'Page was cached.'); $this->assertEqual($this->drupalGetHeader('Content-Encoding'), 'gzip', 'A Content-Encoding header was sent.'); $this->drupalSetContent(gzinflate(substr($this->drupalGetContent(), 10, -8))); $this->assertRaw('', 'Page was gzip compressed.'); // Verify that a client without compression support gets an uncompressed page. $this->drupalGet(''); $this->assertEqual($this->drupalGetHeader('X-Drupal-Cache'), 'HIT', 'Page was cached.'); $this->assertFalse($this->drupalGetHeader('Content-Encoding'), 'A Content-Encoding header was not sent.'); $this->assertTitle(t('Welcome to @site-name | @site-name', array('@site-name' => variable_get('site_name', 'Drupal'))), 'Site title matches.'); $this->assertRaw('', 'Page was not compressed.'); // Disable compression mode. variable_set('page_compression', FALSE); // Verify if cached page is still available for a client with compression support. $this->drupalGet('', array(), array('Accept-Encoding: gzip,deflate')); $this->drupalSetContent(gzinflate(substr($this->drupalGetContent(), 10, -8))); $this->assertRaw('', 'Page was delivered after compression mode is changed (compression support enabled).'); // Verify if cached page is still available for a client without compression support. $this->drupalGet(''); $this->assertRaw('', 'Page was delivered after compression mode is changed (compression support disabled).'); } } class BootstrapVariableTestCase extends DrupalWebTestCase { function setUp() { parent::setUp('system_test'); } public static function getInfo() { return array( 'name' => 'Variable test', 'description' => 'Make sure the variable system functions correctly.', 'group' => 'Bootstrap' ); } /** * testVariable */ function testVariable() { // Setting and retrieving values. $variable = $this->randomName(); variable_set('simpletest_bootstrap_variable_test', $variable); $this->assertIdentical($variable, variable_get('simpletest_bootstrap_variable_test'), 'Setting and retrieving values'); // Make sure the variable persists across multiple requests. $this->drupalGet('system-test/variable-get'); $this->assertText($variable, 'Variable persists across multiple requests'); // Deleting variables. $default_value = $this->randomName(); variable_del('simpletest_bootstrap_variable_test'); $variable = variable_get('simpletest_bootstrap_variable_test', $default_value); $this->assertIdentical($variable, $default_value, 'Deleting variables'); } /** * Makes sure that the default variable parameter is passed through okay. */ function testVariableDefaults() { // Tests passing nothing through to the default. $this->assertIdentical(NULL, variable_get('simpletest_bootstrap_variable_test'), 'Variables are correctly defaulting to NULL.'); // Tests passing 5 to the default parameter. $this->assertIdentical(5, variable_get('simpletest_bootstrap_variable_test', 5), 'The default variable parameter is passed through correctly.'); } } /** * Tests the auto-loading behavior of the code registry. */ class BootstrapAutoloadTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Code registry', 'description' => 'Test that the code registry functions correctly.', 'group' => 'Bootstrap', ); } function setUp() { parent::setUp('drupal_autoload_test'); } /** * Tests that autoloader name matching is not case sensitive. */ function testAutoloadCase() { // Test interface autoloader. $this->assertTrue(drupal_autoload_interface('drupalautoloadtestinterface'), 'drupal_autoload_interface() recognizes DrupalAutoloadTestInterface in lower case.'); // Test class autoloader. $this->assertTrue(drupal_autoload_class('drupalautoloadtestclass'), 'drupal_autoload_class() recognizes DrupalAutoloadTestClass in lower case.'); // Test trait autoloader. if (version_compare(PHP_VERSION, '5.4') >= 0) { $this->assertTrue(drupal_autoload_trait('drupalautoloadtesttrait'), 'drupal_autoload_trait() recognizes DrupalAutoloadTestTrait in lower case.'); } } } /** * Test hook_boot() and hook_exit(). */ class HookBootExitTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Boot and exit hook invocation', 'description' => 'Test that hook_boot() and hook_exit() are called correctly.', 'group' => 'Bootstrap', ); } function setUp() { parent::setUp('system_test', 'dblog'); } /** * Test calling of hook_boot() and hook_exit(). */ function testHookBootExit() { // Test with cache disabled. Boot and exit should always fire. variable_set('cache', 0); $this->drupalGet(''); $calls = 1; $this->assertEqual(db_query('SELECT COUNT(*) FROM {watchdog} WHERE type = :type AND message = :message', array(':type' => 'system_test', ':message' => 'hook_boot'))->fetchField(), $calls, t('hook_boot called with disabled cache.')); $this->assertEqual(db_query('SELECT COUNT(*) FROM {watchdog} WHERE type = :type AND message = :message', array(':type' => 'system_test', ':message' => 'hook_exit'))->fetchField(), $calls, t('hook_exit called with disabled cache.')); // Test with normal cache. Boot and exit should be called. variable_set('cache', 1); $this->drupalGet(''); $calls++; $this->assertEqual(db_query('SELECT COUNT(*) FROM {watchdog} WHERE type = :type AND message = :message', array(':type' => 'system_test', ':message' => 'hook_boot'))->fetchField(), $calls, t('hook_boot called with normal cache.')); $this->assertEqual(db_query('SELECT COUNT(*) FROM {watchdog} WHERE type = :type AND message = :message', array(':type' => 'system_test', ':message' => 'hook_exit'))->fetchField(), $calls, t('hook_exit called with normal cache.')); // Boot and exit should not fire since the page is cached. variable_set('page_cache_invoke_hooks', FALSE); $this->assertTrue(cache_get(url('', array('absolute' => TRUE)), 'cache_page'), t('Page has been cached.')); $this->drupalGet(''); $this->assertEqual(db_query('SELECT COUNT(*) FROM {watchdog} WHERE type = :type AND message = :message', array(':type' => 'system_test', ':message' => 'hook_boot'))->fetchField(), $calls, t('hook_boot not called with aggressive cache and a cached page.')); $this->assertEqual(db_query('SELECT COUNT(*) FROM {watchdog} WHERE type = :type AND message = :message', array(':type' => 'system_test', ':message' => 'hook_exit'))->fetchField(), $calls, t('hook_exit not called with aggressive cache and a cached page.')); // Test with page cache cleared, boot and exit should be called. $this->assertTrue(db_delete('cache_page')->execute(), t('Page cache cleared.')); $this->drupalGet(''); $calls++; $this->assertEqual(db_query('SELECT COUNT(*) FROM {watchdog} WHERE type = :type AND message = :message', array(':type' => 'system_test', ':message' => 'hook_boot'))->fetchField(), $calls, t('hook_boot called with aggressive cache and no cached page.')); $this->assertEqual(db_query('SELECT COUNT(*) FROM {watchdog} WHERE type = :type AND message = :message', array(':type' => 'system_test', ':message' => 'hook_exit'))->fetchField(), $calls, t('hook_exit called with aggressive cache and no cached page.')); } } /** * Test drupal_get_filename()'s availability. */ class BootstrapGetFilenameTestCase extends DrupalUnitTestCase { public static function getInfo() { return array( 'name' => 'Get filename test', 'description' => 'Test that drupal_get_filename() works correctly when the file is not found in the database.', 'group' => 'Bootstrap', ); } /** * Test that drupal_get_filename() works correctly when the file is not found in the database. */ function testDrupalGetFilename() { // Reset the static cache so we can test the "db is not active" code of // drupal_get_filename(). drupal_static_reset('drupal_get_filename'); // Retrieving the location of a module. $this->assertIdentical(drupal_get_filename('module', 'php'), 'modules/php/php.module', t('Retrieve module location.')); // Retrieving the location of a theme. $this->assertIdentical(drupal_get_filename('theme', 'stark'), 'themes/stark/stark.info', t('Retrieve theme location.')); // Retrieving the location of a theme engine. $this->assertIdentical(drupal_get_filename('theme_engine', 'phptemplate'), 'themes/engines/phptemplate/phptemplate.engine', t('Retrieve theme engine location.')); // Retrieving the location of a profile. Profiles are a special case with // a fixed location and naming. $this->assertIdentical(drupal_get_filename('profile', 'standard'), 'profiles/standard/standard.profile', t('Retrieve install profile location.')); // When a file is not found in the database cache, drupal_get_filename() // searches several locations on the filesystem, including the DRUPAL_ROOT // directory. We use the '.script' extension below because this is a // non-existent filetype that will definitely not exist in the database. // Since there is already a scripts directory, drupal_get_filename() will // automatically check there for 'script' files, just as it does for (e.g.) // 'module' files in modules. $this->assertIdentical(drupal_get_filename('script', 'test'), 'scripts/test.script', t('Retrieve test script location.')); } } class BootstrapTimerTestCase extends DrupalUnitTestCase { public static function getInfo() { return array( 'name' => 'Timer test', 'description' => 'Test that timer_read() works both when a timer is running and when a timer is stopped.', 'group' => 'Bootstrap', ); } /** * Test timer_read() to ensure it properly accumulates time when the timer * started and stopped multiple times. * @return */ function testTimer() { timer_start('test'); sleep(1); $this->assertTrue(timer_read('test') >= 1000, 'Timer measured 1 second of sleeping while running.'); sleep(1); timer_stop('test'); $this->assertTrue(timer_read('test') >= 2000, 'Timer measured 2 seconds of sleeping after being stopped.'); timer_start('test'); sleep(1); $this->assertTrue(timer_read('test') >= 3000, 'Timer measured 3 seconds of sleeping after being restarted.'); sleep(1); $timer = timer_stop('test'); $this->assertTrue(timer_read('test') >= 4000, 'Timer measured 4 seconds of sleeping after being stopped for a second time.'); $this->assertEqual($timer['count'], 2, 'Timer counted 2 instances of being started.'); } } /** * Test that resetting static variables works. */ class BootstrapResettableStaticTestCase extends DrupalUnitTestCase { public static function getInfo() { return array( 'name' => 'Resettable static variables test', 'description' => 'Test that drupal_static() and drupal_static_reset() work.', 'group' => 'Bootstrap', ); } /** * Test that a variable reference returned by drupal_static() gets reset when * drupal_static_reset() is called. */ function testDrupalStatic() { $name = __CLASS__ . '_' . __METHOD__; $var = &drupal_static($name, 'foo'); $this->assertEqual($var, 'foo', 'Variable returned by drupal_static() was set to its default.'); // Call the specific reset and the global reset each twice to ensure that // multiple resets can be issued without odd side effects. $var = 'bar'; drupal_static_reset($name); $this->assertEqual($var, 'foo', 'Variable was reset after first invocation of name-specific reset.'); $var = 'bar'; drupal_static_reset($name); $this->assertEqual($var, 'foo', 'Variable was reset after second invocation of name-specific reset.'); $var = 'bar'; drupal_static_reset(); $this->assertEqual($var, 'foo', 'Variable was reset after first invocation of global reset.'); $var = 'bar'; drupal_static_reset(); $this->assertEqual($var, 'foo', 'Variable was reset after second invocation of global reset.'); } } /** * Test miscellaneous functions in bootstrap.inc. */ class BootstrapMiscTestCase extends DrupalUnitTestCase { public static function getInfo() { return array( 'name' => 'Miscellaneous bootstrap unit tests', 'description' => 'Test miscellaneous functions in bootstrap.inc.', 'group' => 'Bootstrap', ); } /** * Test miscellaneous functions in bootstrap.inc. */ function testMisc() { // Test drupal_array_merge_deep(). $link_options_1 = array('fragment' => 'x', 'attributes' => array('title' => 'X', 'class' => array('a', 'b')), 'language' => 'en'); $link_options_2 = array('fragment' => 'y', 'attributes' => array('title' => 'Y', 'class' => array('c', 'd')), 'html' => TRUE); $expected = array('fragment' => 'y', 'attributes' => array('title' => 'Y', 'class' => array('a', 'b', 'c', 'd')), 'language' => 'en', 'html' => TRUE); $this->assertIdentical(drupal_array_merge_deep($link_options_1, $link_options_2), $expected, 'drupal_array_merge_deep() returned a properly merged array.'); } /** * Tests that the drupal_check_memory_limit() function works as expected. */ function testCheckMemoryLimit() { $memory_limit = ini_get('memory_limit'); // Test that a very reasonable amount of memory is available. $this->assertTrue(drupal_check_memory_limit('30MB'), '30MB of memory tested available.'); // Get the available memory and multiply it by two to make it unreasonably // high. $twice_avail_memory = ($memory_limit * 2) . 'MB'; // The function should always return true if the memory limit is set to -1. $this->assertTrue(drupal_check_memory_limit($twice_avail_memory, -1), 'drupal_check_memory_limit() returns TRUE when a limit of -1 (none) is supplied'); // Test that even though we have 30MB of memory available - the function // returns FALSE when given an upper limit for how much memory can be used. $this->assertFalse(drupal_check_memory_limit('30MB', '16MB'), 'drupal_check_memory_limit() returns FALSE with a 16MB upper limit on a 30MB requirement.'); // Test that an equal amount of memory to the amount requested returns TRUE. $this->assertTrue(drupal_check_memory_limit('30MB', '30MB'), 'drupal_check_memory_limit() returns TRUE when requesting 30MB on a 30MB requirement.'); } } /** * Tests for overriding server variables via the API. */ class BootstrapOverrideServerVariablesTestCase extends DrupalUnitTestCase { public static function getInfo() { return array( 'name' => 'Overriding server variables', 'description' => 'Test that drupal_override_server_variables() works correctly.', 'group' => 'Bootstrap', ); } /** * Test providing a direct URL to to drupal_override_server_variables(). */ function testDrupalOverrideServerVariablesProvidedURL() { $tests = array( 'http://example.com' => array( 'HTTP_HOST' => 'example.com', 'SCRIPT_NAME' => isset($_SERVER['SCRIPT_NAME']) ? $_SERVER['SCRIPT_NAME'] : NULL, ), 'http://example.com/index.php' => array( 'HTTP_HOST' => 'example.com', 'SCRIPT_NAME' => '/index.php', ), 'http://example.com/subdirectory/index.php' => array( 'HTTP_HOST' => 'example.com', 'SCRIPT_NAME' => '/subdirectory/index.php', ), ); foreach ($tests as $url => $expected_server_values) { // Remember the original value of $_SERVER, since the function call below // will modify it. $original_server = $_SERVER; // Call drupal_override_server_variables() and ensure that all expected // $_SERVER variables were modified correctly. drupal_override_server_variables(array('url' => $url)); foreach ($expected_server_values as $key => $value) { $this->assertIdentical($_SERVER[$key], $value); } // Restore the original value of $_SERVER. $_SERVER = $original_server; } } } /** * Tests for $_GET['destination'] and $_REQUEST['destination'] validation. */ class BootstrapDestinationTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'URL destination validation', 'description' => 'Test that $_GET[\'destination\'] and $_REQUEST[\'destination\'] cannot contain external URLs.', 'group' => 'Bootstrap', ); } function setUp() { parent::setUp('system_test'); } /** * Tests that $_GET/$_REQUEST['destination'] only contain internal URLs. * * @see _drupal_bootstrap_variables() * @see system_test_get_destination() * @see system_test_request_destination() */ public function testDestination() { $test_cases = array( array( 'input' => 'node', 'output' => 'node', 'message' => "Standard internal example node path is present in the 'destination' parameter.", ), array( 'input' => '/example.com', 'output' => '/example.com', 'message' => 'Internal path with one leading slash is allowed.', ), array( 'input' => '//example.com/test', 'output' => '', 'message' => 'External URL without scheme is not allowed.', ), array( 'input' => 'example:test', 'output' => 'example:test', 'message' => 'Internal URL using a colon is allowed.', ), array( 'input' => 'http://example.com', 'output' => '', 'message' => 'External URL is not allowed.', ), array( 'input' => 'javascript:alert(0)', 'output' => 'javascript:alert(0)', 'message' => 'Javascript URL is allowed because it is treated as an internal URL.', ), ); foreach ($test_cases as $test_case) { // Test $_GET['destination']. $this->drupalGet('system-test/get-destination', array('query' => array('destination' => $test_case['input']))); $this->assertIdentical($test_case['output'], $this->drupalGetContent(), $test_case['message']); // Test $_REQUEST['destination']. There's no form to submit to, so // drupalPost() won't work here; this just tests a direct $_POST request // instead. $curl_parameters = array( CURLOPT_URL => $this->getAbsoluteUrl('system-test/request-destination'), CURLOPT_POST => TRUE, CURLOPT_POSTFIELDS => 'destination=' . urlencode($test_case['input']), CURLOPT_HTTPHEADER => array(), ); $post_output = $this->curlExec($curl_parameters); $this->assertIdentical($test_case['output'], $post_output, $test_case['message']); } // Make sure that 404 pages do not populate $_GET['destination'] with // external URLs. variable_set('site_404', 'system-test/get-destination'); $this->drupalGet('http://example.com', array('external' => FALSE)); $this->assertIdentical('', $this->drupalGetContent(), 'External URL is not allowed on 404 pages.'); } } drupal-7.41/modules/simpletest/tests/module_test.implementations.inc0000644000000000000000000000025312611765734024677 0ustar rootroot 'Password hashing', 'description' => 'Password hashing unit tests.', 'group' => 'System', ); } function setUp() { require_once DRUPAL_ROOT . '/' . variable_get('password_inc', 'includes/password.inc'); parent::setUp(); } /** * Test password hashing. */ function testPasswordHashing() { // Set a log2 iteration count that is deliberately out of bounds to test // that it is corrected to be within bounds. variable_set('password_count_log2', 1); // Set up a fake $account with a password 'baz', hashed with md5. $password = 'baz'; $account = (object) array('name' => 'foo', 'pass' => md5($password)); // The md5 password should be flagged as needing an update. $this->assertTrue(user_needs_new_hash($account), 'User with md5 password needs a new hash.'); // Re-hash the password. $old_hash = $account->pass; $account->pass = user_hash_password($password); $this->assertIdentical(_password_get_count_log2($account->pass), DRUPAL_MIN_HASH_COUNT, 'Re-hashed password has the minimum number of log2 iterations.'); $this->assertTrue($account->pass != $old_hash, 'Password hash changed.'); $this->assertTrue(user_check_password($password, $account), 'Password check succeeds.'); // Since the log2 setting hasn't changed and the user has a valid password, // user_needs_new_hash() should return FALSE. $this->assertFalse(user_needs_new_hash($account), 'User does not need a new hash.'); // Increment the log2 iteration to MIN + 1. variable_set('password_count_log2', DRUPAL_MIN_HASH_COUNT + 1); $this->assertTrue(user_needs_new_hash($account), 'User needs a new hash after incrementing the log2 count.'); // Re-hash the password. $old_hash = $account->pass; $account->pass = user_hash_password($password); $this->assertIdentical(_password_get_count_log2($account->pass), DRUPAL_MIN_HASH_COUNT + 1, 'Re-hashed password has the correct number of log2 iterations.'); $this->assertTrue($account->pass != $old_hash, 'Password hash changed again.'); // Now the hash should be OK. $this->assertFalse(user_needs_new_hash($account), 'Re-hashed password does not need a new hash.'); $this->assertTrue(user_check_password($password, $account), 'Password check succeeds with re-hashed password.'); } /** * Verifies that passwords longer than 512 bytes are not hashed. */ public function testLongPassword() { $password = str_repeat('x', 512); $result = user_hash_password($password); $this->assertFalse(empty($result), '512 byte long password is allowed.'); $password = str_repeat('x', 513); $result = user_hash_password($password); $this->assertFalse($result, '513 byte long password is not allowed.'); // Check a string of 3-byte UTF-8 characters. $password = str_repeat('€', 170); $result = user_hash_password($password); $this->assertFalse(empty($result), '510 byte long password is allowed.'); $password .= 'xx'; $this->assertFalse(empty($result), '512 byte long password is allowed.'); $password = str_repeat('€', 171); $result = user_hash_password($password); $this->assertFalse($result, '513 byte long password is not allowed.'); } } drupal-7.41/modules/simpletest/tests/common_test.info0000644000000000000000000000052512611767501021651 0ustar rootrootname = "Common Test" description = "Support module for Common tests." package = Testing version = VERSION core = 7.x stylesheets[all][] = common_test.css stylesheets[print][] = common_test.print.css hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/schema.test0000644000000000000000000003271412611765734020621 0ustar rootroot 'Schema API', 'description' => 'Tests table creation and modification via the schema API.', 'group' => 'Database', ); } /** * */ function testSchema() { // Try creating a table. $table_specification = array( 'description' => 'Schema table description.', 'fields' => array( 'id' => array( 'type' => 'int', 'default' => NULL, ), 'test_field' => array( 'type' => 'int', 'not null' => TRUE, 'description' => 'Schema column description.', ), ), ); db_create_table('test_table', $table_specification); // Assert that the table exists. $this->assertTrue(db_table_exists('test_table'), 'The table exists.'); // Assert that the table comment has been set. $this->checkSchemaComment($table_specification['description'], 'test_table'); // Assert that the column comment has been set. $this->checkSchemaComment($table_specification['fields']['test_field']['description'], 'test_table', 'test_field'); // An insert without a value for the column 'test_table' should fail. $this->assertFalse($this->tryInsert(), 'Insert without a default failed.'); // Add a default value to the column. db_field_set_default('test_table', 'test_field', 0); // The insert should now succeed. $this->assertTrue($this->tryInsert(), 'Insert with a default succeeded.'); // Remove the default. db_field_set_no_default('test_table', 'test_field'); // The insert should fail again. $this->assertFalse($this->tryInsert(), 'Insert without a default failed.'); // Test for fake index and test for the boolean result of indexExists(). $index_exists = Database::getConnection()->schema()->indexExists('test_table', 'test_field'); $this->assertIdentical($index_exists, FALSE, 'Fake index does not exists'); // Add index. db_add_index('test_table', 'test_field', array('test_field')); // Test for created index and test for the boolean result of indexExists(). $index_exists = Database::getConnection()->schema()->indexExists('test_table', 'test_field'); $this->assertIdentical($index_exists, TRUE, 'Index created.'); // Rename the table. db_rename_table('test_table', 'test_table2'); // Index should be renamed. $index_exists = Database::getConnection()->schema()->indexExists('test_table2', 'test_field'); $this->assertTrue($index_exists, 'Index was renamed.'); // We need the default so that we can insert after the rename. db_field_set_default('test_table2', 'test_field', 0); $this->assertFalse($this->tryInsert(), 'Insert into the old table failed.'); $this->assertTrue($this->tryInsert('test_table2'), 'Insert into the new table succeeded.'); // We should have successfully inserted exactly two rows. $count = db_query('SELECT COUNT(*) FROM {test_table2}')->fetchField(); $this->assertEqual($count, 2, 'Two fields were successfully inserted.'); // Try to drop the table. db_drop_table('test_table2'); $this->assertFalse(db_table_exists('test_table2'), 'The dropped table does not exist.'); // Recreate the table. db_create_table('test_table', $table_specification); db_field_set_default('test_table', 'test_field', 0); db_add_field('test_table', 'test_serial', array('type' => 'int', 'not null' => TRUE, 'default' => 0, 'description' => 'Added column description.')); // Assert that the column comment has been set. $this->checkSchemaComment('Added column description.', 'test_table', 'test_serial'); // Change the new field to a serial column. db_change_field('test_table', 'test_serial', 'test_serial', array('type' => 'serial', 'not null' => TRUE, 'description' => 'Changed column description.'), array('primary key' => array('test_serial'))); // Assert that the column comment has been set. $this->checkSchemaComment('Changed column description.', 'test_table', 'test_serial'); $this->assertTrue($this->tryInsert(), 'Insert with a serial succeeded.'); $max1 = db_query('SELECT MAX(test_serial) FROM {test_table}')->fetchField(); $this->assertTrue($this->tryInsert(), 'Insert with a serial succeeded.'); $max2 = db_query('SELECT MAX(test_serial) FROM {test_table}')->fetchField(); $this->assertTrue($max2 > $max1, 'The serial is monotone.'); $count = db_query('SELECT COUNT(*) FROM {test_table}')->fetchField(); $this->assertEqual($count, 2, 'There were two rows.'); // Use database specific data type and ensure that table is created. $table_specification = array( 'description' => 'Schema table description.', 'fields' => array( 'timestamp' => array( 'mysql_type' => 'timestamp', 'pgsql_type' => 'timestamp', 'sqlite_type' => 'datetime', 'not null' => FALSE, 'default' => NULL, ), ), ); try { db_create_table('test_timestamp', $table_specification); } catch (Exception $e) {} $this->assertTrue(db_table_exists('test_timestamp'), 'Table with database specific datatype was created.'); } function tryInsert($table = 'test_table') { try { db_insert($table) ->fields(array('id' => mt_rand(10, 20))) ->execute(); return TRUE; } catch (Exception $e) { return FALSE; } } /** * Checks that a table or column comment matches a given description. * * @param $description * The asserted description. * @param $table * The table to test. * @param $column * Optional column to test. */ function checkSchemaComment($description, $table, $column = NULL) { if (method_exists(Database::getConnection()->schema(), 'getComment')) { $comment = Database::getConnection()->schema()->getComment($table, $column); $this->assertEqual($comment, $description, 'The comment matches the schema description.'); } } /** * Tests creating unsigned columns and data integrity thereof. */ function testUnsignedColumns() { // First create the table with just a serial column. $table_name = 'unsigned_table'; $table_spec = array( 'fields' => array('serial_column' => array('type' => 'serial', 'unsigned' => TRUE, 'not null' => TRUE)), 'primary key' => array('serial_column'), ); $ret = array(); db_create_table($table_name, $table_spec); // Now set up columns for the other types. $types = array('int', 'float', 'numeric'); foreach ($types as $type) { $column_spec = array('type' => $type, 'unsigned'=> TRUE); if ($type == 'numeric') { $column_spec += array('precision' => 10, 'scale' => 0); } $column_name = $type . '_column'; $table_spec['fields'][$column_name] = $column_spec; db_add_field($table_name, $column_name, $column_spec); } // Finally, check each column and try to insert invalid values into them. foreach ($table_spec['fields'] as $column_name => $column_spec) { $this->assertTrue(db_field_exists($table_name, $column_name), format_string('Unsigned @type column was created.', array('@type' => $column_spec['type']))); $this->assertFalse($this->tryUnsignedInsert($table_name, $column_name), format_string('Unsigned @type column rejected a negative value.', array('@type' => $column_spec['type']))); } } /** * Tries to insert a negative value into columns defined as unsigned. * * @param $table_name * The table to insert * @param $column_name * The column to insert * @return * TRUE if the insert succeeded, FALSE otherwise */ function tryUnsignedInsert($table_name, $column_name) { try { db_insert($table_name) ->fields(array($column_name => -1)) ->execute(); return TRUE; } catch (Exception $e) { return FALSE; } } /** * Test adding columns to an existing table. */ function testSchemaAddField() { // Test varchar types. foreach (array(1, 32, 128, 256, 512) as $length) { $base_field_spec = array( 'type' => 'varchar', 'length' => $length, ); $variations = array( array('not null' => FALSE), array('not null' => FALSE, 'default' => '7'), array('not null' => TRUE, 'initial' => 'd'), array('not null' => TRUE, 'initial' => 'd', 'default' => '7'), ); foreach ($variations as $variation) { $field_spec = $variation + $base_field_spec; $this->assertFieldAdditionRemoval($field_spec); } } // Test int and float types. foreach (array('int', 'float') as $type) { foreach (array('tiny', 'small', 'medium', 'normal', 'big') as $size) { $base_field_spec = array( 'type' => $type, 'size' => $size, ); $variations = array( array('not null' => FALSE), array('not null' => FALSE, 'default' => 7), array('not null' => TRUE, 'initial' => 1), array('not null' => TRUE, 'initial' => 1, 'default' => 7), ); foreach ($variations as $variation) { $field_spec = $variation + $base_field_spec; $this->assertFieldAdditionRemoval($field_spec); } } } // Test numeric types. foreach (array(1, 5, 10, 40, 65) as $precision) { foreach (array(0, 2, 10, 30) as $scale) { if ($precision <= $scale) { // Precision must be smaller then scale. continue; } $base_field_spec = array( 'type' => 'numeric', 'scale' => $scale, 'precision' => $precision, ); $variations = array( array('not null' => FALSE), array('not null' => FALSE, 'default' => 7), array('not null' => TRUE, 'initial' => 1), array('not null' => TRUE, 'initial' => 1, 'default' => 7), ); foreach ($variations as $variation) { $field_spec = $variation + $base_field_spec; $this->assertFieldAdditionRemoval($field_spec); } } } } /** * Assert that a given field can be added and removed from a table. * * The addition test covers both defining a field of a given specification * when initially creating at table and extending an existing table. * * @param $field_spec * The schema specification of the field. */ protected function assertFieldAdditionRemoval($field_spec) { // Try creating the field on a new table. $table_name = 'test_table_' . ($this->counter++); $table_spec = array( 'fields' => array( 'serial_column' => array('type' => 'serial', 'unsigned' => TRUE, 'not null' => TRUE), 'test_field' => $field_spec, ), 'primary key' => array('serial_column'), ); db_create_table($table_name, $table_spec); $this->pass(format_string('Table %table created.', array('%table' => $table_name))); // Check the characteristics of the field. $this->assertFieldCharacteristics($table_name, 'test_field', $field_spec); // Clean-up. db_drop_table($table_name); // Try adding a field to an existing table. $table_name = 'test_table_' . ($this->counter++); $table_spec = array( 'fields' => array( 'serial_column' => array('type' => 'serial', 'unsigned' => TRUE, 'not null' => TRUE), ), 'primary key' => array('serial_column'), ); db_create_table($table_name, $table_spec); $this->pass(format_string('Table %table created.', array('%table' => $table_name))); // Insert some rows to the table to test the handling of initial values. for ($i = 0; $i < 3; $i++) { db_insert($table_name) ->useDefaults(array('serial_column')) ->execute(); } db_add_field($table_name, 'test_field', $field_spec); $this->pass(format_string('Column %column created.', array('%column' => 'test_field'))); // Check the characteristics of the field. $this->assertFieldCharacteristics($table_name, 'test_field', $field_spec); // Clean-up. db_drop_field($table_name, 'test_field'); db_drop_table($table_name); } /** * Assert that a newly added field has the correct characteristics. */ protected function assertFieldCharacteristics($table_name, $field_name, $field_spec) { // Check that the initial value has been registered. if (isset($field_spec['initial'])) { // There should be no row with a value different then $field_spec['initial']. $count = db_select($table_name) ->fields($table_name, array('serial_column')) ->condition($field_name, $field_spec['initial'], '<>') ->countQuery() ->execute() ->fetchField(); $this->assertEqual($count, 0, 'Initial values filled out.'); } // Check that the default value has been registered. if (isset($field_spec['default'])) { // Try inserting a row, and check the resulting value of the new column. $id = db_insert($table_name) ->useDefaults(array('serial_column')) ->execute(); $field_value = db_select($table_name) ->fields($table_name, array($field_name)) ->condition('serial_column', $id) ->execute() ->fetchField(); $this->assertEqual($field_value, $field_spec['default'], 'Default value registered.'); } db_drop_field($table_name, $field_name); } } drupal-7.41/modules/simpletest/tests/update.test0000644000000000000000000001127712611765734020644 0ustar rootroot 'Update dependency ordering', 'description' => 'Test that update functions are run in the proper order.', 'group' => 'Update API', ); } function setUp() { parent::setUp('update_test_1', 'update_test_2', 'update_test_3'); require_once DRUPAL_ROOT . '/includes/update.inc'; } /** * Test that updates within a single module run in the correct order. */ function testUpdateOrderingSingleModule() { $starting_updates = array( 'update_test_1' => 7000, ); $expected_updates = array( 'update_test_1_update_7000', 'update_test_1_update_7001', 'update_test_1_update_7002', ); $actual_updates = array_keys(update_resolve_dependencies($starting_updates)); $this->assertEqual($expected_updates, $actual_updates, 'Updates within a single module run in the correct order.'); } /** * Test that dependencies between modules are resolved correctly. */ function testUpdateOrderingModuleInterdependency() { $starting_updates = array( 'update_test_2' => 7000, 'update_test_3' => 7000, ); $update_order = array_keys(update_resolve_dependencies($starting_updates)); // Make sure that each dependency is satisfied. $first_dependency_satisfied = array_search('update_test_2_update_7000', $update_order) < array_search('update_test_3_update_7000', $update_order); $this->assertTrue($first_dependency_satisfied, 'The dependency of the second module on the first module is respected by the update function order.'); $second_dependency_satisfied = array_search('update_test_3_update_7000', $update_order) < array_search('update_test_2_update_7001', $update_order); $this->assertTrue($second_dependency_satisfied, 'The dependency of the first module on the second module is respected by the update function order.'); } } /** * Tests for missing update dependencies. */ class UpdateDependencyMissingTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Missing update dependencies', 'description' => 'Test that missing update dependencies are correctly flagged.', 'group' => 'Update API', ); } function setUp() { // Only install update_test_2.module, even though its updates have a // dependency on update_test_3.module. parent::setUp('update_test_2'); require_once DRUPAL_ROOT . '/includes/update.inc'; } function testMissingUpdate() { $starting_updates = array( 'update_test_2' => 7000, ); $update_graph = update_resolve_dependencies($starting_updates); $this->assertTrue($update_graph['update_test_2_update_7000']['allowed'], "The module's first update function is allowed to run, since it does not have any missing dependencies."); $this->assertFalse($update_graph['update_test_2_update_7001']['allowed'], "The module's second update function is not allowed to run, since it has a direct dependency on a missing update."); $this->assertFalse($update_graph['update_test_2_update_7002']['allowed'], "The module's third update function is not allowed to run, since it has an indirect dependency on a missing update."); } } /** * Tests for the invocation of hook_update_dependencies(). */ class UpdateDependencyHookInvocationTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Update dependency hook invocation', 'description' => 'Test that the hook invocation for determining update dependencies works correctly.', 'group' => 'Update API', ); } function setUp() { parent::setUp('update_test_1', 'update_test_2'); require_once DRUPAL_ROOT . '/includes/update.inc'; } /** * Test the structure of the array returned by hook_update_dependencies(). */ function testHookUpdateDependencies() { $update_dependencies = update_retrieve_dependencies(); $this->assertTrue($update_dependencies['system'][7000]['update_test_1'] == 7000, 'An update function that has a dependency on two separate modules has the first dependency recorded correctly.'); $this->assertTrue($update_dependencies['system'][7000]['update_test_2'] == 7001, 'An update function that has a dependency on two separate modules has the second dependency recorded correctly.'); $this->assertTrue($update_dependencies['system'][7001]['update_test_1'] == 7002, 'An update function that depends on more than one update from the same module only has the dependency on the higher-numbered update function recorded.'); } } drupal-7.41/modules/simpletest/tests/error_test.module0000644000000000000000000000361312611765734022053 0ustar rootroot 'Generate warnings', 'page callback' => 'error_test_generate_warnings', 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['error-test/generate-warnings-with-report'] = array( 'title' => 'Generate warnings with Simpletest reporting', 'page callback' => 'error_test_generate_warnings', 'page arguments' => array(TRUE), 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['error-test/trigger-exception'] = array( 'title' => 'Trigger an exception', 'page callback' => 'error_test_trigger_exception', 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['error-test/trigger-pdo-exception'] = array( 'title' => 'Trigger a PDO exception', 'page callback' => 'error_test_trigger_pdo_exception', 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); return $items; } /** * Menu callback; generate warnings to test the error handler. */ function error_test_generate_warnings($collect_errors = FALSE) { // Tell Drupal error reporter to send errors to Simpletest or not. define('SIMPLETEST_COLLECT_ERRORS', $collect_errors); // This will generate a notice. $monkey_love = $bananas; // This will generate a warning. $awesomely_big = 1/0; // This will generate a user error. trigger_error("Drupal is awesome", E_USER_WARNING); return ""; } /** * Menu callback; trigger an exception to test the exception handler. */ function error_test_trigger_exception() { define('SIMPLETEST_COLLECT_ERRORS', FALSE); throw new Exception("Drupal is awesome"); } /** * Menu callback; trigger an exception to test the exception handler. */ function error_test_trigger_pdo_exception() { define('SIMPLETEST_COLLECT_ERRORS', FALSE); db_query('SELECT * FROM bananas_are_awesome'); } drupal-7.41/modules/simpletest/tests/image_test.info0000644000000000000000000000041112611767501021435 0ustar rootrootname = "Image test" description = "Support module for image toolkit tests." package = Testing version = VERSION core = 7.x hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/requirements1_test.module0000644000000000000000000000015712611765734023526 0ustar rootroot 'system_test_sleep', 'page arguments' => array(2), 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['system-test/auth'] = array( 'page callback' => 'system_test_basic_auth_page', 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['system-test/authorize-init/%'] = array( 'page callback' => 'system_test_authorize_init_page', 'page arguments' => array(2), 'access arguments' => array('administer software updates'), 'type' => MENU_CALLBACK, ); $items['system-test/redirect/%'] = array( 'title' => 'Redirect', 'page callback' => 'system_test_redirect', 'page arguments' => array(2), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['system-test/multiple-redirects/%'] = array( 'title' => 'Redirect', 'page callback' => 'system_test_multiple_redirects', 'page arguments' => array(2), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['system-test/set-header'] = array( 'page callback' => 'system_test_set_header', 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['system-test/redirect-noscheme'] = array( 'page callback' => 'system_test_redirect_noscheme', 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['system-test/redirect-noparse'] = array( 'page callback' => 'system_test_redirect_noparse', 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['system-test/redirect-invalid-scheme'] = array( 'page callback' => 'system_test_redirect_invalid_scheme', 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['system-test/variable-get'] = array( 'title' => 'Variable Get', 'page callback' => 'variable_get', 'page arguments' => array('simpletest_bootstrap_variable_test', NULL), 'access arguments' => array('access content'), 'type' => MENU_CALLBACK, ); $items['system-test/lock-acquire'] = array( 'title' => 'Lock acquire', 'page callback' => 'system_test_lock_acquire', 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['system-test/lock-exit'] = array( 'title' => 'Lock acquire then exit', 'page callback' => 'system_test_lock_exit', 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['system-test/drupal-set-message'] = array( 'title' => 'Set messages with drupal_set_message()', 'page callback' => 'system_test_drupal_set_message', 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['system-test/main-content-handling'] = array( 'title' => 'Test main content handling', 'page callback' => 'system_test_main_content_fallback', 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['system-test/main-content-fallback'] = array( 'title' => 'Test main content fallback', 'page callback' => 'system_test_main_content_fallback', 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['system-test/main-content-duplication'] = array( 'title' => 'Test main content duplication', 'page callback' => 'system_test_main_content_fallback', 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['system-test/shutdown-functions'] = array( 'title' => 'Test main content duplication', 'page callback' => 'system_test_page_shutdown_functions', 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['system-test/get-destination'] = array( 'title' => 'Test $_GET[\'destination\']', 'page callback' => 'system_test_get_destination', 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); $items['system-test/request-destination'] = array( 'title' => 'Test $_REQUEST[\'destination\']', 'page callback' => 'system_test_request_destination', 'access callback' => TRUE, 'type' => MENU_CALLBACK, ); return $items; } function system_test_sleep($seconds) { sleep($seconds); } function system_test_basic_auth_page() { // The Authorization HTTP header is forwarded via Drupal's .htaccess file even // for PHP CGI SAPIs. if (isset($_SERVER['HTTP_AUTHORIZATION'])) { $authorization_header = $_SERVER['HTTP_AUTHORIZATION']; } // If using CGI on Apache with mod_rewrite, the forwarded HTTP header appears // in the redirected HTTP headers. See // https://github.com/symfony/symfony/blob/master/src/Symfony/Component/HttpFoundation/ServerBag.php#L61 elseif (isset($_SERVER['REDIRECT_HTTP_AUTHORIZATION'])) { $authorization_header = $_SERVER['REDIRECT_HTTP_AUTHORIZATION']; } // Resemble PHP_AUTH_USER and PHP_AUTH_PW for a Basic authentication from // the HTTP_AUTHORIZATION header. See // http://www.php.net/manual/features.http-auth.php list($user, $pw) = explode(':', base64_decode(substr($authorization_header, 6))); $output = t('Username is @username.', array('@username' => $user)); $output .= t('Password is @password.', array('@password' => $pw)); return $output; } function system_test_redirect($code) { $code = (int) $code; if ($code != 200) { // Header names are case-insensitive. header("locaTION: " . url('system-test/redirect/200', array('absolute' => TRUE)), TRUE, $code); exit; } return ''; } /** * Menu callback; sends a redirect header to itself until $count argument is 0. * * Emulates the variable number of redirects (given by initial $count argument) * to the final destination URL by continuous sending of 301 HTTP redirect * headers to itself together with decrementing the $count parameter until the * $count parameter reaches 0. After that it returns an empty string to render * the final destination page. * * @param $count * The count of redirects left until the final destination page. * * @returns * The location redirect if the $count > 0, otherwise an empty string. */ function system_test_multiple_redirects($count) { $count = (int) $count; if ($count > 0) { header("location: " . url('system-test/multiple-redirects/' . --$count, array('absolute' => TRUE)), TRUE, 301); exit; } return ''; } function system_test_set_header() { drupal_add_http_header($_GET['name'], $_GET['value']); return t('The following header was set: %name: %value', array('%name' => $_GET['name'], '%value' => $_GET['value'])); } function system_test_redirect_noscheme() { header("Location: localhost/path", TRUE, 301); exit; } function system_test_redirect_noparse() { header("Location: http:///path", TRUE, 301); exit; } function system_test_redirect_invalid_scheme() { header("Location: ftp://localhost/path", TRUE, 301); exit; } /** * Implements hook_modules_installed(). */ function system_test_modules_installed($modules) { if (variable_get('test_verbose_module_hooks')) { foreach ($modules as $module) { drupal_set_message(t('hook_modules_installed fired for @module', array('@module' => $module))); } } } /** * Implements hook_modules_enabled(). */ function system_test_modules_enabled($modules) { if (variable_get('test_verbose_module_hooks')) { foreach ($modules as $module) { drupal_set_message(t('hook_modules_enabled fired for @module', array('@module' => $module))); } } } /** * Implements hook_modules_disabled(). */ function system_test_modules_disabled($modules) { if (variable_get('test_verbose_module_hooks')) { foreach ($modules as $module) { drupal_set_message(t('hook_modules_disabled fired for @module', array('@module' => $module))); } } } /** * Implements hook_modules_uninstalled(). */ function system_test_modules_uninstalled($modules) { if (variable_get('test_verbose_module_hooks')) { foreach ($modules as $module) { drupal_set_message(t('hook_modules_uninstalled fired for @module', array('@module' => $module))); } } } /** * Implements hook_boot(). */ function system_test_boot() { watchdog('system_test', 'hook_boot'); } /** * Implements hook_init(). */ function system_test_init() { // Used by FrontPageTestCase to get the results of drupal_is_front_page(). if (variable_get('front_page_output', 0) && drupal_is_front_page()) { drupal_set_message(t('On front page.')); } } /** * Implements hook_exit(). */ function system_test_exit() { watchdog('system_test', 'hook_exit'); } /** * Implements hook_system_info_alter(). */ function system_test_system_info_alter(&$info, $file, $type) { // We need a static otherwise the last test will fail to alter common_test. static $test; if (($dependencies = variable_get('dependencies', array())) || $test) { if ($file->name == 'module_test') { $info['hidden'] = FALSE; $info['dependencies'][] = array_shift($dependencies); variable_set('dependencies', $dependencies); $test = TRUE; } if ($file->name == 'common_test') { $info['hidden'] = FALSE; $info['version'] = '7.x-2.4-beta3'; } } if ($file->name == 'system_project_namespace_test') { $info['hidden'] = FALSE; } // Make the system_dependencies_test visible by default. if ($file->name == 'system_dependencies_test') { $info['hidden'] = FALSE; } if (in_array($file->name, array( 'system_incompatible_module_version_dependencies_test', 'system_incompatible_core_version_dependencies_test', 'system_incompatible_module_version_test', 'system_incompatible_core_version_test', ))) { $info['hidden'] = FALSE; } if ($file->name == 'requirements1_test' || $file->name == 'requirements2_test') { $info['hidden'] = FALSE; } } /** * Try to acquire a named lock and report the outcome. */ function system_test_lock_acquire() { if (lock_acquire('system_test_lock_acquire')) { lock_release('system_test_lock_acquire'); return 'TRUE: Lock successfully acquired in system_test_lock_acquire()'; } else { return 'FALSE: Lock not acquired in system_test_lock_acquire()'; } } /** * Try to acquire a specific lock, and then exit. */ function system_test_lock_exit() { if (lock_acquire('system_test_lock_exit', 900)) { echo 'TRUE: Lock successfully acquired in system_test_lock_exit()'; // The shut-down function should release the lock. exit(); } else { return 'FALSE: Lock not acquired in system_test_lock_exit()'; } } /** * Implements hook_page_build(). */ function system_test_page_build(&$page) { $menu_item = menu_get_item(); $main_content_display = &drupal_static('system_main_content_added', FALSE); if ($menu_item['path'] == 'system-test/main-content-handling') { $page['footer'] = drupal_set_page_content(); $page['footer']['main']['#markup'] = '
                  ' . $page['footer']['main']['#markup'] . '
                  '; } elseif ($menu_item['path'] == 'system-test/main-content-fallback') { drupal_set_page_content(); $main_content_display = FALSE; } elseif ($menu_item['path'] == 'system-test/main-content-duplication') { drupal_set_page_content(); } } /** * Menu callback to test main content fallback(). */ function system_test_main_content_fallback() { return t('Content to test main content fallback'); } /** * A simple page callback which adds a register shutdown function. */ function system_test_page_shutdown_functions($arg1, $arg2) { drupal_register_shutdown_function('_system_test_first_shutdown_function', $arg1, $arg2); } /** * Dummy shutdown function which registers another shutdown function. */ function _system_test_first_shutdown_function($arg1, $arg2) { // Output something, page has already been printed and the session stored // so we can't use drupal_set_message. print t('First shutdown function, arg1 : @arg1, arg2: @arg2', array('@arg1' => $arg1, '@arg2' => $arg2)); drupal_register_shutdown_function('_system_test_second_shutdown_function', $arg1, $arg2); } /** * Dummy shutdown function. */ function _system_test_second_shutdown_function($arg1, $arg2) { // Output something, page has already been printed and the session stored // so we can't use drupal_set_message. print t('Second shutdown function, arg1 : @arg1, arg2: @arg2', array('@arg1' => $arg1, '@arg2' => $arg2)); // Throw an exception with an HTML tag. Since this is called in a shutdown // function, it will not bubble up to the default exception handler but will // be caught in _drupal_shutdown_function() and be displayed through // _drupal_render_exception_safe(). throw new Exception('Drupal is awesome.'); } /** * Implements hook_filetransfer_info(). */ function system_test_filetransfer_info() { return array( 'system_test' => array( 'title' => t('System Test FileTransfer'), 'file' => 'system_test.module', // Should be a .inc, but for test, ok. 'class' => 'SystemTestFileTransfer', 'weight' => -10, ), ); } /** * Mock FileTransfer object to test the settings form functionality. */ class SystemTestFileTransfer { public static function factory() { return new SystemTestFileTransfer; } public function getSettingsForm() { $form = array(); $form['system_test_username'] = array( '#type' => 'textfield', '#title' => t('System Test Username'), ); return $form; } } /** * Page callback to initialize authorize.php during testing. * * @see system_authorized_init(). */ function system_test_authorize_init_page($page_title) { $authorize_url = $GLOBALS['base_url'] . '/authorize.php'; system_authorized_init('system_test_authorize_run', drupal_get_path('module', 'system_test') . '/system_test.module', array(), $page_title); drupal_goto($authorize_url); } /** * Sets two messages and removes the first one before the messages are displayed. */ function system_test_drupal_set_message() { // Set two messages. drupal_set_message('First message (removed).'); drupal_set_message('Second message (not removed).'); // Remove the first. unset($_SESSION['messages']['status'][0]); return ''; } /** * Page callback to print out $_GET['destination'] for testing. */ function system_test_get_destination() { if (isset($_GET['destination'])) { print $_GET['destination']; } // No need to render the whole page, we are just interested in this bit of // information. exit; } /** * Page callback to print out $_REQUEST['destination'] for testing. */ function system_test_request_destination() { if (isset($_REQUEST['destination'])) { print $_REQUEST['destination']; } // No need to render the whole page, we are just interested in this bit of // information. exit; } drupal-7.41/modules/simpletest/tests/database_test.install0000644000000000000000000001333512611765734022651 0ustar rootroot 'Basic test table for the database unit tests.', 'fields' => array( 'id' => array( 'type' => 'serial', 'unsigned' => TRUE, 'not null' => TRUE, ), 'name' => array( 'description' => "A person's name", 'type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => '', 'binary' => TRUE, ), 'age' => array( 'description' => "The person's age", 'type' => 'int', 'unsigned' => TRUE, 'not null' => TRUE, 'default' => 0, ), 'job' => array( 'description' => "The person's job", 'type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => 'Undefined', ), ), 'primary key' => array('id'), 'unique keys' => array( 'name' => array('name') ), 'indexes' => array( 'ages' => array('age'), ), ); // This is an alternate version of the same table that is structured the same // but has a non-serial Primary Key. $schema['test_people'] = array( 'description' => 'A duplicate version of the test table, used for additional tests.', 'fields' => array( 'name' => array( 'description' => "A person's name", 'type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => '', ), 'age' => array( 'description' => "The person's age", 'type' => 'int', 'unsigned' => TRUE, 'not null' => TRUE, 'default' => 0, ), 'job' => array( 'description' => "The person's job", 'type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => '', ), ), 'primary key' => array('job'), 'indexes' => array( 'ages' => array('age'), ), ); $schema['test_people_copy'] = $schema['test_people']; $schema['test_people_copy']['description'] = 'A duplicate version of the test_people table, used for additional tests.'; $schema['test_one_blob'] = array( 'description' => 'A simple table including a BLOB field for testing BLOB behavior.', 'fields' => array( 'id' => array( 'description' => 'Simple unique ID.', 'type' => 'serial', 'not null' => TRUE, ), 'blob1' => array( 'description' => 'A BLOB field.', 'type' => 'blob', ), ), 'primary key' => array('id'), ); $schema['test_two_blobs'] = array( 'description' => 'A simple test table with two BLOB fields.', 'fields' => array( 'id' => array( 'description' => 'Simple unique ID.', 'type' => 'serial', 'not null' => TRUE, ), 'blob1' => array( 'description' => 'A dummy BLOB field.', 'type' => 'blob', ), 'blob2' => array( 'description' => 'A second BLOB field.', 'type' => 'blob' ), ), 'primary key' => array('id'), ); $schema['test_task'] = array( 'description' => 'A task list for people in the test table.', 'fields' => array( 'tid' => array( 'description' => 'Task ID, primary key.', 'type' => 'serial', 'not null' => TRUE, ), 'pid' => array( 'description' => 'The {test_people}.pid, foreign key for the test table.', 'type' => 'int', 'unsigned' => TRUE, 'not null' => TRUE, 'default' => 0, ), 'task' => array( 'description' => 'The task to be completed.', 'type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => '', ), 'priority' => array( 'description' => 'The priority of the task.', 'type' => 'int', 'unsigned' => TRUE, 'not null' => TRUE, 'default' => 0, ), ), 'primary key' => array('tid'), ); $schema['test_null'] = array( 'description' => 'Basic test table for NULL value handling.', 'fields' => array( 'id' => array( 'type' => 'serial', 'unsigned' => TRUE, 'not null' => TRUE, ), 'name' => array( 'description' => "A person's name.", 'type' => 'varchar', 'length' => 255, 'not null' => FALSE, 'default' => '', ), 'age' => array( 'description' => "The person's age.", 'type' => 'int', 'unsigned' => TRUE, 'not null' => FALSE, 'default' => 0), ), 'primary key' => array('id'), 'unique keys' => array( 'name' => array('name') ), 'indexes' => array( 'ages' => array('age'), ), ); $schema['test_serialized'] = array( 'description' => 'Basic test table for NULL value handling.', 'fields' => array( 'id' => array( 'type' => 'serial', 'unsigned' => TRUE, 'not null' => TRUE, ), 'name' => array( 'description' => "A person's name.", 'type' => 'varchar', 'length' => 255, 'not null' => FALSE, 'default' => '', ), 'info' => array( 'description' => "The person's data in serialized form.", 'type' => 'blob', 'serialize' => TRUE, ), ), 'primary key' => array('id'), 'unique keys' => array( 'name' => array('name') ), ); return $schema; } drupal-7.41/modules/simpletest/tests/requirements2_test.info0000644000000000000000000000061012611767501023161 0ustar rootrootname = Requirements 2 Test description = "Tests that a module is not installed when the one it depends on fails hook_requirements('install)." dependencies[] = requirements1_test dependencies[] = comment package = Testing version = VERSION core = 7.x hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/menu.test0000644000000000000000000021720612611765734020326 0ustar rootrootdrupalGet($goto); } // Compare paths with actual breadcrumb. $parts = $this->getParts(); $pass = TRUE; foreach ($trail as $path => $title) { $url = url($path); $part = array_shift($parts); $pass = ($pass && $part['href'] === $url && $part['text'] === check_plain($title)); } // No parts must be left, or an expected "Home" will always pass. $pass = ($pass && empty($parts)); $this->assertTrue($pass, format_string('Breadcrumb %parts found on @path.', array( '%parts' => implode(' » ', $trail), '@path' => $this->getUrl(), ))); // Additionally assert page title, if given. if (isset($page_title)) { $this->assertTitle(strtr('@title | Drupal', array('@title' => $page_title))); } // Additionally assert active trail in a menu tree output, if given. if ($tree) { end($tree); $active_link_path = key($tree); $active_link_title = array_pop($tree); $xpath = ''; if ($tree) { $i = 0; foreach ($tree as $link_path => $link_title) { $part_xpath = (!$i ? '//' : '/following-sibling::ul/descendant::'); $part_xpath .= 'li[contains(@class, :class)]/a[contains(@href, :href) and contains(text(), :title)]'; $part_args = array( ':class' => 'active-trail', ':href' => url($link_path), ':title' => $link_title, ); $xpath .= $this->buildXPathQuery($part_xpath, $part_args); $i++; } $elements = $this->xpath($xpath); $this->assertTrue(!empty($elements), 'Active trail to current page was found in menu tree.'); // Append prefix for active link asserted below. $xpath .= '/following-sibling::ul/descendant::'; } else { $xpath .= '//'; } $xpath_last_active = ($last_active ? 'and contains(@class, :class-active)' : ''); $xpath .= 'li[contains(@class, :class-trail)]/a[contains(@href, :href) ' . $xpath_last_active . 'and contains(text(), :title)]'; $args = array( ':class-trail' => 'active-trail', ':class-active' => 'active', ':href' => url($active_link_path), ':title' => $active_link_title, ); $elements = $this->xpath($xpath, $args); $this->assertTrue(!empty($elements), format_string('Active link %title was found in menu tree, including active trail links %tree.', array( '%title' => $active_link_title, '%tree' => implode(' » ', $tree), ))); } } /** * Returns the breadcrumb contents of the current page in the internal browser. */ protected function getParts() { $parts = array(); $elements = $this->xpath('//div[@class="breadcrumb"]/a'); if (!empty($elements)) { foreach ($elements as $element) { $parts[] = array( 'text' => (string) $element, 'href' => (string) $element['href'], 'title' => (string) $element['title'], ); } } return $parts; } } class MenuRouterTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Menu router', 'description' => 'Tests menu router and hook_menu() functionality.', 'group' => 'Menu', ); } function setUp() { // Enable dummy module that implements hook_menu. parent::setUp('menu_test'); // Make the tests below more robust by explicitly setting the default theme // and administrative theme that they expect. theme_enable(array('bartik')); variable_set('theme_default', 'bartik'); variable_set('admin_theme', 'seven'); } /** * Test title callback set to FALSE. */ function testTitleCallbackFalse() { $this->drupalGet('node'); $this->assertText('A title with @placeholder', 'Raw text found on the page'); $this->assertNoText(t('A title with @placeholder', array('@placeholder' => 'some other text')), 'Text with placeholder substitutions not found.'); } /** * Tests page title of MENU_CALLBACKs. */ function testTitleMenuCallback() { // Verify that the menu router item title is not visible. $this->drupalGet(''); $this->assertNoText(t('Menu Callback Title')); // Verify that the menu router item title is output as page title. $this->drupalGet('menu_callback_title'); $this->assertText(t('Menu Callback Title')); } /** * Test the theme callback when it is set to use an administrative theme. */ function testThemeCallbackAdministrative() { $this->drupalGet('menu-test/theme-callback/use-admin-theme'); $this->assertText('Custom theme: seven. Actual theme: seven.', 'The administrative theme can be correctly set in a theme callback.'); $this->assertRaw('seven/style.css', "The administrative theme's CSS appears on the page."); } /** * Test that the theme callback is properly inherited. */ function testThemeCallbackInheritance() { $this->drupalGet('menu-test/theme-callback/use-admin-theme/inheritance'); $this->assertText('Custom theme: seven. Actual theme: seven. Theme callback inheritance is being tested.', 'Theme callback inheritance correctly uses the administrative theme.'); $this->assertRaw('seven/style.css', "The administrative theme's CSS appears on the page."); } /** * Test that 'page callback', 'file' and 'file path' keys are properly * inherited from parent menu paths. */ function testFileInheritance() { $this->drupalGet('admin/config/development/file-inheritance'); $this->assertText('File inheritance test description', 'File inheritance works.'); } /** * Test path containing "exotic" characters. */ function testExoticPath() { $path = "menu-test/ -._~!$'\"()*@[]?&+%#,;=:" . // "Special" ASCII characters. "%23%25%26%2B%2F%3F" . // Characters that look like a percent-escaped string. "éøïвβ中國書۞"; // Characters from various non-ASCII alphabets. $this->drupalGet($path); $this->assertRaw('This is menu_test_callback().'); } /** * Test the theme callback when the site is in maintenance mode. */ function testThemeCallbackMaintenanceMode() { variable_set('maintenance_mode', TRUE); // For a regular user, the fact that the site is in maintenance mode means // we expect the theme callback system to be bypassed entirely. $this->drupalGet('menu-test/theme-callback/use-admin-theme'); $this->assertRaw('bartik/css/style.css', "The maintenance theme's CSS appears on the page."); // An administrator, however, should continue to see the requested theme. $admin_user = $this->drupalCreateUser(array('access site in maintenance mode')); $this->drupalLogin($admin_user); $this->drupalGet('menu-test/theme-callback/use-admin-theme'); $this->assertText('Custom theme: seven. Actual theme: seven.', 'The theme callback system is correctly triggered for an administrator when the site is in maintenance mode.'); $this->assertRaw('seven/style.css', "The administrative theme's CSS appears on the page."); } /** * Make sure the maintenance mode can be bypassed using hook_menu_site_status_alter(). * * @see hook_menu_site_status_alter(). */ function testMaintenanceModeLoginPaths() { variable_set('maintenance_mode', TRUE); $offline_message = t('@site is currently under maintenance. We should be back shortly. Thank you for your patience.', array('@site' => variable_get('site_name', 'Drupal'))); $this->drupalLogout(); $this->drupalGet('node'); $this->assertText($offline_message); $this->drupalGet('menu_login_callback'); $this->assertText('This is menu_login_callback().', t('Maintenance mode can be bypassed through hook_login_paths().')); } /** * Test that an authenticated user hitting 'user/login' gets redirected to * 'user' and 'user/register' gets redirected to the user edit page. */ function testAuthUserUserLogin() { $loggedInUser = $this->drupalCreateUser(array()); $this->drupalLogin($loggedInUser); $this->drupalGet('user/login'); // Check that we got to 'user'. $this->assertTrue($this->url == url('user', array('absolute' => TRUE)), "Logged-in user redirected to q=user on accessing q=user/login"); // user/register should redirect to user/UID/edit. $this->drupalGet('user/register'); $this->assertTrue($this->url == url('user/' . $this->loggedInUser->uid . '/edit', array('absolute' => TRUE)), "Logged-in user redirected to q=user/UID/edit on accessing q=user/register"); } /** * Test the theme callback when it is set to use an optional theme. */ function testThemeCallbackOptionalTheme() { // Request a theme that is not enabled. $this->drupalGet('menu-test/theme-callback/use-stark-theme'); $this->assertText('Custom theme: NONE. Actual theme: bartik.', 'The theme callback system falls back on the default theme when a theme that is not enabled is requested.'); $this->assertRaw('bartik/css/style.css', "The default theme's CSS appears on the page."); // Now enable the theme and request it again. theme_enable(array('stark')); $this->drupalGet('menu-test/theme-callback/use-stark-theme'); $this->assertText('Custom theme: stark. Actual theme: stark.', 'The theme callback system uses an optional theme once it has been enabled.'); $this->assertRaw('stark/layout.css', "The optional theme's CSS appears on the page."); } /** * Test the theme callback when it is set to use a theme that does not exist. */ function testThemeCallbackFakeTheme() { $this->drupalGet('menu-test/theme-callback/use-fake-theme'); $this->assertText('Custom theme: NONE. Actual theme: bartik.', 'The theme callback system falls back on the default theme when a theme that does not exist is requested.'); $this->assertRaw('bartik/css/style.css', "The default theme's CSS appears on the page."); } /** * Test the theme callback when no theme is requested. */ function testThemeCallbackNoThemeRequested() { $this->drupalGet('menu-test/theme-callback/no-theme-requested'); $this->assertText('Custom theme: NONE. Actual theme: bartik.', 'The theme callback system falls back on the default theme when no theme is requested.'); $this->assertRaw('bartik/css/style.css', "The default theme's CSS appears on the page."); } /** * Test that hook_custom_theme() can control the theme of a page. */ function testHookCustomTheme() { // Trigger hook_custom_theme() to dynamically request the Stark theme for // the requested page. variable_set('menu_test_hook_custom_theme_name', 'stark'); theme_enable(array('stark')); // Visit a page that does not implement a theme callback. The above request // should be honored. $this->drupalGet('menu-test/no-theme-callback'); $this->assertText('Custom theme: stark. Actual theme: stark.', 'The result of hook_custom_theme() is used as the theme for the current page.'); $this->assertRaw('stark/layout.css', "The Stark theme's CSS appears on the page."); } /** * Test that the theme callback wins out over hook_custom_theme(). */ function testThemeCallbackHookCustomTheme() { // Trigger hook_custom_theme() to dynamically request the Stark theme for // the requested page. variable_set('menu_test_hook_custom_theme_name', 'stark'); theme_enable(array('stark')); // The menu "theme callback" should take precedence over a value set in // hook_custom_theme(). $this->drupalGet('menu-test/theme-callback/use-admin-theme'); $this->assertText('Custom theme: seven. Actual theme: seven.', 'The result of hook_custom_theme() does not override what was set in a theme callback.'); $this->assertRaw('seven/style.css', "The Seven theme's CSS appears on the page."); } /** * Tests for menu_link_maintain(). */ function testMenuLinkMaintain() { $admin_user = $this->drupalCreateUser(array('administer site configuration')); $this->drupalLogin($admin_user); // Create three menu items. menu_link_maintain('menu_test', 'insert', 'menu_test_maintain/1', 'Menu link #1'); menu_link_maintain('menu_test', 'insert', 'menu_test_maintain/1', 'Menu link #1-1'); menu_link_maintain('menu_test', 'insert', 'menu_test_maintain/2', 'Menu link #2'); // Move second link to the main-menu, to test caching later on. db_update('menu_links') ->fields(array('menu_name' => 'main-menu')) ->condition('link_title', 'Menu link #1-1') ->condition('customized', 0) ->condition('module', 'menu_test') ->execute(); menu_cache_clear('main-menu'); // Load front page. $this->drupalGet('node'); $this->assertLink(t('Menu link #1'), 0, 'Found menu link #1'); $this->assertLink(t('Menu link #1-1'), 0, 'Found menu link #1-1'); $this->assertLink(t('Menu link #2'), 0, 'Found menu link #2'); // Rename all links for the given path. menu_link_maintain('menu_test', 'update', 'menu_test_maintain/1', 'Menu link updated'); // Load a different page to be sure that we have up to date information. $this->drupalGet('menu_test_maintain/1'); $this->assertLink(t('Menu link updated'), 0, 'Found updated menu link'); $this->assertNoLink(t('Menu link #1'), 0, 'Not found menu link #1'); $this->assertNoLink(t('Menu link #1'), 0, 'Not found menu link #1-1'); $this->assertLink(t('Menu link #2'), 0, 'Found menu link #2'); // Delete all links for the given path. menu_link_maintain('menu_test', 'delete', 'menu_test_maintain/1', ''); // Load a different page to be sure that we have up to date information. $this->drupalGet('menu_test_maintain/2'); $this->assertNoLink(t('Menu link updated'), 0, 'Not found deleted menu link'); $this->assertNoLink(t('Menu link #1'), 0, 'Not found menu link #1'); $this->assertNoLink(t('Menu link #1'), 0, 'Not found menu link #1-1'); $this->assertLink(t('Menu link #2'), 0, 'Found menu link #2'); } /** * Test menu_get_names(). */ function testMenuGetNames() { // Create three menu items. for ($i = 0; $i < 3; $i++) { $menu_link = array( 'link_title' => 'Menu link #' . $i, 'link_path' => 'menu_test/' . $i, 'module' => 'menu_test', 'menu_name' => 'menu_test_' . $i, ); menu_link_save($menu_link); } drupal_static_reset('menu_get_names'); // Verify that the menu names are correctly reported by menu_get_names(). $menu_names = menu_get_names(); $this->pass(implode(' | ', $menu_names)); for ($i = 0; $i < 3; $i++) { $this->assertTrue(in_array('menu_test_' . $i, $menu_names), t('Expected menu name %expected is returned.', array('%expected' => 'menu_test_' . $i))); } } /** * Tests for menu_name parameter for hook_menu(). */ function testMenuName() { $admin_user = $this->drupalCreateUser(array('administer site configuration')); $this->drupalLogin($admin_user); $sql = "SELECT menu_name FROM {menu_links} WHERE router_path = 'menu_name_test'"; $name = db_query($sql)->fetchField(); $this->assertEqual($name, 'original', 'Menu name is "original".'); // Change the menu_name parameter in menu_test.module, then force a menu // rebuild. menu_test_menu_name('changed'); menu_rebuild(); $sql = "SELECT menu_name FROM {menu_links} WHERE router_path = 'menu_name_test'"; $name = db_query($sql)->fetchField(); $this->assertEqual($name, 'changed', 'Menu name was successfully changed after rebuild.'); } /** * Tests for menu hierarchy. */ function testMenuHierarchy() { $parent_link = db_query('SELECT * FROM {menu_links} WHERE link_path = :link_path', array(':link_path' => 'menu-test/hierarchy/parent'))->fetchAssoc(); $child_link = db_query('SELECT * FROM {menu_links} WHERE link_path = :link_path', array(':link_path' => 'menu-test/hierarchy/parent/child'))->fetchAssoc(); $unattached_child_link = db_query('SELECT * FROM {menu_links} WHERE link_path = :link_path', array(':link_path' => 'menu-test/hierarchy/parent/child2/child'))->fetchAssoc(); $this->assertEqual($child_link['plid'], $parent_link['mlid'], 'The parent of a directly attached child is correct.'); $this->assertEqual($unattached_child_link['plid'], $parent_link['mlid'], 'The parent of a non-directly attached child is correct.'); } /** * Tests menu link depth and parents of local tasks and menu callbacks. */ function testMenuHidden() { // Verify links for one dynamic argument. $links = db_select('menu_links', 'ml') ->fields('ml') ->condition('ml.router_path', 'menu-test/hidden/menu%', 'LIKE') ->orderBy('ml.router_path') ->execute() ->fetchAllAssoc('router_path', PDO::FETCH_ASSOC); $parent = $links['menu-test/hidden/menu']; $depth = $parent['depth'] + 1; $plid = $parent['mlid']; $link = $links['menu-test/hidden/menu/list']; $this->assertEqual($link['depth'], $depth, format_string('%path depth @link_depth is equal to @depth.', array('%path' => $link['router_path'], '@link_depth' => $link['depth'], '@depth' => $depth))); $this->assertEqual($link['plid'], $plid, format_string('%path plid @link_plid is equal to @plid.', array('%path' => $link['router_path'], '@link_plid' => $link['plid'], '@plid' => $plid))); $link = $links['menu-test/hidden/menu/add']; $this->assertEqual($link['depth'], $depth, format_string('%path depth @link_depth is equal to @depth.', array('%path' => $link['router_path'], '@link_depth' => $link['depth'], '@depth' => $depth))); $this->assertEqual($link['plid'], $plid, format_string('%path plid @link_plid is equal to @plid.', array('%path' => $link['router_path'], '@link_plid' => $link['plid'], '@plid' => $plid))); $link = $links['menu-test/hidden/menu/settings']; $this->assertEqual($link['depth'], $depth, format_string('%path depth @link_depth is equal to @depth.', array('%path' => $link['router_path'], '@link_depth' => $link['depth'], '@depth' => $depth))); $this->assertEqual($link['plid'], $plid, format_string('%path plid @link_plid is equal to @plid.', array('%path' => $link['router_path'], '@link_plid' => $link['plid'], '@plid' => $plid))); $link = $links['menu-test/hidden/menu/manage/%']; $this->assertEqual($link['depth'], $depth, format_string('%path depth @link_depth is equal to @depth.', array('%path' => $link['router_path'], '@link_depth' => $link['depth'], '@depth' => $depth))); $this->assertEqual($link['plid'], $plid, format_string('%path plid @link_plid is equal to @plid.', array('%path' => $link['router_path'], '@link_plid' => $link['plid'], '@plid' => $plid))); $parent = $links['menu-test/hidden/menu/manage/%']; $depth = $parent['depth'] + 1; $plid = $parent['mlid']; $link = $links['menu-test/hidden/menu/manage/%/list']; $this->assertEqual($link['depth'], $depth, format_string('%path depth @link_depth is equal to @depth.', array('%path' => $link['router_path'], '@link_depth' => $link['depth'], '@depth' => $depth))); $this->assertEqual($link['plid'], $plid, format_string('%path plid @link_plid is equal to @plid.', array('%path' => $link['router_path'], '@link_plid' => $link['plid'], '@plid' => $plid))); $link = $links['menu-test/hidden/menu/manage/%/add']; $this->assertEqual($link['depth'], $depth, format_string('%path depth @link_depth is equal to @depth.', array('%path' => $link['router_path'], '@link_depth' => $link['depth'], '@depth' => $depth))); $this->assertEqual($link['plid'], $plid, format_string('%path plid @link_plid is equal to @plid.', array('%path' => $link['router_path'], '@link_plid' => $link['plid'], '@plid' => $plid))); $link = $links['menu-test/hidden/menu/manage/%/edit']; $this->assertEqual($link['depth'], $depth, format_string('%path depth @link_depth is equal to @depth.', array('%path' => $link['router_path'], '@link_depth' => $link['depth'], '@depth' => $depth))); $this->assertEqual($link['plid'], $plid, format_string('%path plid @link_plid is equal to @plid.', array('%path' => $link['router_path'], '@link_plid' => $link['plid'], '@plid' => $plid))); $link = $links['menu-test/hidden/menu/manage/%/delete']; $this->assertEqual($link['depth'], $depth, format_string('%path depth @link_depth is equal to @depth.', array('%path' => $link['router_path'], '@link_depth' => $link['depth'], '@depth' => $depth))); $this->assertEqual($link['plid'], $plid, format_string('%path plid @link_plid is equal to @plid.', array('%path' => $link['router_path'], '@link_plid' => $link['plid'], '@plid' => $plid))); // Verify links for two dynamic arguments. $links = db_select('menu_links', 'ml') ->fields('ml') ->condition('ml.router_path', 'menu-test/hidden/block%', 'LIKE') ->orderBy('ml.router_path') ->execute() ->fetchAllAssoc('router_path', PDO::FETCH_ASSOC); $parent = $links['menu-test/hidden/block']; $depth = $parent['depth'] + 1; $plid = $parent['mlid']; $link = $links['menu-test/hidden/block/list']; $this->assertEqual($link['depth'], $depth, format_string('%path depth @link_depth is equal to @depth.', array('%path' => $link['router_path'], '@link_depth' => $link['depth'], '@depth' => $depth))); $this->assertEqual($link['plid'], $plid, format_string('%path plid @link_plid is equal to @plid.', array('%path' => $link['router_path'], '@link_plid' => $link['plid'], '@plid' => $plid))); $link = $links['menu-test/hidden/block/add']; $this->assertEqual($link['depth'], $depth, format_string('%path depth @link_depth is equal to @depth.', array('%path' => $link['router_path'], '@link_depth' => $link['depth'], '@depth' => $depth))); $this->assertEqual($link['plid'], $plid, format_string('%path plid @link_plid is equal to @plid.', array('%path' => $link['router_path'], '@link_plid' => $link['plid'], '@plid' => $plid))); $link = $links['menu-test/hidden/block/manage/%/%']; $this->assertEqual($link['depth'], $depth, format_string('%path depth @link_depth is equal to @depth.', array('%path' => $link['router_path'], '@link_depth' => $link['depth'], '@depth' => $depth))); $this->assertEqual($link['plid'], $plid, format_string('%path plid @link_plid is equal to @plid.', array('%path' => $link['router_path'], '@link_plid' => $link['plid'], '@plid' => $plid))); $parent = $links['menu-test/hidden/block/manage/%/%']; $depth = $parent['depth'] + 1; $plid = $parent['mlid']; $link = $links['menu-test/hidden/block/manage/%/%/configure']; $this->assertEqual($link['depth'], $depth, format_string('%path depth @link_depth is equal to @depth.', array('%path' => $link['router_path'], '@link_depth' => $link['depth'], '@depth' => $depth))); $this->assertEqual($link['plid'], $plid, format_string('%path plid @link_plid is equal to @plid.', array('%path' => $link['router_path'], '@link_plid' => $link['plid'], '@plid' => $plid))); $link = $links['menu-test/hidden/block/manage/%/%/delete']; $this->assertEqual($link['depth'], $depth, format_string('%path depth @link_depth is equal to @depth.', array('%path' => $link['router_path'], '@link_depth' => $link['depth'], '@depth' => $depth))); $this->assertEqual($link['plid'], $plid, format_string('%path plid @link_plid is equal to @plid.', array('%path' => $link['router_path'], '@link_plid' => $link['plid'], '@plid' => $plid))); } /** * Test menu_get_item() with empty ancestors. */ function testMenuGetItemNoAncestors() { variable_set('menu_masks', array()); $this->drupalGet(''); } /** * Test menu_set_item(). */ function testMenuSetItem() { $item = menu_get_item('node'); $this->assertEqual($item['path'], 'node', "Path from menu_get_item('node') is equal to 'node'", 'menu'); // Modify the path for the item then save it. $item['path'] = 'node_test'; $item['href'] = 'node_test'; menu_set_item('node', $item); $compare_item = menu_get_item('node'); $this->assertEqual($compare_item, $item, 'Modified menu item is equal to newly retrieved menu item.', 'menu'); } /** * Test menu maintenance hooks. */ function testMenuItemHooks() { // Create an item. menu_link_maintain('menu_test', 'insert', 'menu_test_maintain/4', 'Menu link #4'); $this->assertEqual(menu_test_static_variable(), 'insert', 'hook_menu_link_insert() fired correctly'); // Update the item. menu_link_maintain('menu_test', 'update', 'menu_test_maintain/4', 'Menu link updated'); $this->assertEqual(menu_test_static_variable(), 'update', 'hook_menu_link_update() fired correctly'); // Delete the item. menu_link_maintain('menu_test', 'delete', 'menu_test_maintain/4', ''); $this->assertEqual(menu_test_static_variable(), 'delete', 'hook_menu_link_delete() fired correctly'); } /** * Test menu link 'options' storage and rendering. */ function testMenuLinkOptions() { // Create a menu link with options. $menu_link = array( 'link_title' => 'Menu link options test', 'link_path' => 'node', 'module' => 'menu_test', 'options' => array( 'attributes' => array( 'title' => 'Test title attribute', ), 'query' => array( 'testparam' => 'testvalue', ), ), ); menu_link_save($menu_link); // Load front page. $this->drupalGet('node'); $this->assertRaw('title="Test title attribute"', 'Title attribute of a menu link renders.'); $this->assertRaw('testparam=testvalue', 'Query parameter added to menu link.'); } /** * Tests the possible ways to set the title for menu items. * Also tests that menu item titles work with string overrides. */ function testMenuItemTitlesCases() { // Build array with string overrides. $test_data = array( 1 => array('Example title - Case 1' => 'Alternative example title - Case 1'), 2 => array('Example @sub1 - Case @op2' => 'Alternative example @sub1 - Case @op2'), 3 => array('Example title' => 'Alternative example title'), 4 => array('Example title' => 'Alternative example title'), ); foreach ($test_data as $case_no => $override) { $this->menuItemTitlesCasesHelper($case_no); variable_set('locale_custom_strings_en', array('' => $override)); $this->menuItemTitlesCasesHelper($case_no, TRUE); variable_set('locale_custom_strings_en', array()); } } /** * Get a URL and assert the title given a case number. If override is true, * the title is asserted to begin with "Alternative". */ private function menuItemTitlesCasesHelper($case_no, $override = FALSE) { $this->drupalGet('menu-title-test/case' . $case_no); $this->assertResponse(200); $asserted_title = $override ? 'Alternative example title - Case ' . $case_no : 'Example title - Case ' . $case_no; $this->assertTitle($asserted_title . ' | Drupal', format_string('Menu title is: %title.', array('%title' => $asserted_title)), 'Menu'); } /** * Load the router for a given path. */ protected function menuLoadRouter($router_path) { return db_query('SELECT * FROM {menu_router} WHERE path = :path', array(':path' => $router_path))->fetchAssoc(); } /** * Tests inheritance of 'load arguments'. */ function testMenuLoadArgumentsInheritance() { $expected = array( 'menu-test/arguments/%/%' => array( 2 => array('menu_test_argument_load' => array(3)), 3 => NULL, ), // Arguments are inherited to normal children. 'menu-test/arguments/%/%/default' => array( 2 => array('menu_test_argument_load' => array(3)), 3 => NULL, ), // Arguments are inherited to tab children. 'menu-test/arguments/%/%/task' => array( 2 => array('menu_test_argument_load' => array(3)), 3 => NULL, ), // Arguments are only inherited to the same loader functions. 'menu-test/arguments/%/%/common-loader' => array( 2 => array('menu_test_argument_load' => array(3)), 3 => 'menu_test_other_argument_load', ), // Arguments are not inherited to children not using the same loader // function. 'menu-test/arguments/%/%/different-loaders-1' => array( 2 => NULL, 3 => 'menu_test_argument_load', ), 'menu-test/arguments/%/%/different-loaders-2' => array( 2 => 'menu_test_other_argument_load', 3 => NULL, ), 'menu-test/arguments/%/%/different-loaders-3' => array( 2 => NULL, 3 => NULL, ), // Explicit loader arguments should not be overriden by parent. 'menu-test/arguments/%/%/explicit-arguments' => array( 2 => array('menu_test_argument_load' => array()), 3 => NULL, ), ); foreach ($expected as $router_path => $load_functions) { $router_item = $this->menuLoadRouter($router_path); $this->assertIdentical(unserialize($router_item['load_functions']), $load_functions, format_string('Expected load functions for router %router_path' , array('%router_path' => $router_path))); } } } /** * Tests for menu links. */ class MenuLinksUnitTestCase extends DrupalWebTestCase { // Use the lightweight testing profile for this test. protected $profile = 'testing'; public static function getInfo() { return array( 'name' => 'Menu links', 'description' => 'Test handling of menu links hierarchies.', 'group' => 'Menu', ); } /** * Create a simple hierarchy of links. */ function createLinkHierarchy($module = 'menu_test') { // First remove all the menu links. db_truncate('menu_links')->execute(); // Then create a simple link hierarchy: // - $parent // - $child-1 // - $child-1-1 // - $child-1-2 // - $child-2 $base_options = array( 'link_title' => 'Menu link test', 'module' => $module, 'menu_name' => 'menu_test', ); $links['parent'] = $base_options + array( 'link_path' => 'menu-test/parent', ); menu_link_save($links['parent']); $links['child-1'] = $base_options + array( 'link_path' => 'menu-test/parent/child-1', 'plid' => $links['parent']['mlid'], ); menu_link_save($links['child-1']); $links['child-1-1'] = $base_options + array( 'link_path' => 'menu-test/parent/child-1/child-1-1', 'plid' => $links['child-1']['mlid'], ); menu_link_save($links['child-1-1']); $links['child-1-2'] = $base_options + array( 'link_path' => 'menu-test/parent/child-1/child-1-2', 'plid' => $links['child-1']['mlid'], ); menu_link_save($links['child-1-2']); $links['child-2'] = $base_options + array( 'link_path' => 'menu-test/parent/child-2', 'plid' => $links['parent']['mlid'], ); menu_link_save($links['child-2']); return $links; } /** * Assert that at set of links is properly parented. */ function assertMenuLinkParents($links, $expected_hierarchy) { foreach ($expected_hierarchy as $child => $parent) { $mlid = $links[$child]['mlid']; $plid = $parent ? $links[$parent]['mlid'] : 0; $menu_link = menu_link_load($mlid); menu_link_save($menu_link); $this->assertEqual($menu_link['plid'], $plid, format_string('Menu link %mlid has parent of %plid, expected %expected_plid.', array('%mlid' => $mlid, '%plid' => $menu_link['plid'], '%expected_plid' => $plid))); } } /** * Test automatic reparenting of menu links. */ function testMenuLinkReparenting($module = 'menu_test') { // Check the initial hierarchy. $links = $this->createLinkHierarchy($module); $expected_hierarchy = array( 'parent' => FALSE, 'child-1' => 'parent', 'child-1-1' => 'child-1', 'child-1-2' => 'child-1', 'child-2' => 'parent', ); $this->assertMenuLinkParents($links, $expected_hierarchy); // Start over, and move child-1 under child-2, and check that all the // childs of child-1 have been moved too. $links = $this->createLinkHierarchy($module); $links['child-1']['plid'] = $links['child-2']['mlid']; menu_link_save($links['child-1']); $expected_hierarchy = array( 'parent' => FALSE, 'child-1' => 'child-2', 'child-1-1' => 'child-1', 'child-1-2' => 'child-1', 'child-2' => 'parent', ); $this->assertMenuLinkParents($links, $expected_hierarchy); // Start over, and delete child-1, and check that the children of child-1 // have been reassigned to the parent. menu_link_delete() will cowardly // refuse to delete a menu link defined by the system module, so skip the // test in that case. if ($module != 'system') { $links = $this->createLinkHierarchy($module); menu_link_delete($links['child-1']['mlid']); $expected_hierarchy = array( 'parent' => FALSE, 'child-1-1' => 'parent', 'child-1-2' => 'parent', 'child-2' => 'parent', ); $this->assertMenuLinkParents($links, $expected_hierarchy); } // Start over, forcefully delete child-1 from the database, simulating a // database crash. Check that the children of child-1 have been reassigned // to the parent, going up on the old path hierarchy stored in each of the // links. $links = $this->createLinkHierarchy($module); // Don't do that at home. db_delete('menu_links') ->condition('mlid', $links['child-1']['mlid']) ->execute(); $expected_hierarchy = array( 'parent' => FALSE, 'child-1-1' => 'parent', 'child-1-2' => 'parent', 'child-2' => 'parent', ); $this->assertMenuLinkParents($links, $expected_hierarchy); // Start over, forcefully delete the parent from the database, simulating a // database crash. Check that the children of parent are now top-level. $links = $this->createLinkHierarchy($module); // Don't do that at home. db_delete('menu_links') ->condition('mlid', $links['parent']['mlid']) ->execute(); $expected_hierarchy = array( 'child-1-1' => 'child-1', 'child-1-2' => 'child-1', 'child-2' => FALSE, ); $this->assertMenuLinkParents($links, $expected_hierarchy); } /** * Test automatic reparenting of menu links derived from menu routers. */ function testMenuLinkRouterReparenting() { // Run all the standard parenting tests on menu links derived from // menu routers. $this->testMenuLinkReparenting('system'); // Additionnaly, test reparenting based on path. $links = $this->createLinkHierarchy('system'); // Move child-1-2 has a child of child-2, making the link hierarchy // inconsistent with the path hierarchy. $links['child-1-2']['plid'] = $links['child-2']['mlid']; menu_link_save($links['child-1-2']); // Check the new hierarchy. $expected_hierarchy = array( 'parent' => FALSE, 'child-1' => 'parent', 'child-1-1' => 'child-1', 'child-2' => 'parent', 'child-1-2' => 'child-2', ); $this->assertMenuLinkParents($links, $expected_hierarchy); // Now delete 'parent' directly from the database, simulating a database // crash. 'child-1' and 'child-2' should get moved to the // top-level. // Don't do that at home. db_delete('menu_links') ->condition('mlid', $links['parent']['mlid']) ->execute(); $expected_hierarchy = array( 'child-1' => FALSE, 'child-1-1' => 'child-1', 'child-2' => FALSE, 'child-1-2' => 'child-2', ); $this->assertMenuLinkParents($links, $expected_hierarchy); // Now delete 'child-2' directly from the database, simulating a database // crash. 'child-1-2' will get reparented under 'child-1' based on its // path. // Don't do that at home. db_delete('menu_links') ->condition('mlid', $links['child-2']['mlid']) ->execute(); $expected_hierarchy = array( 'child-1' => FALSE, 'child-1-1' => 'child-1', 'child-1-2' => 'child-1', ); $this->assertMenuLinkParents($links, $expected_hierarchy); } } /** * Tests rebuilding the menu by setting 'menu_rebuild_needed.' */ class MenuRebuildTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Menu rebuild test', 'description' => 'Test rebuilding of menu.', 'group' => 'Menu', ); } /** * Test if the 'menu_rebuild_needed' variable triggers a menu_rebuild() call. */ function testMenuRebuildByVariable() { // Check if 'admin' path exists. $admin_exists = db_query('SELECT path from {menu_router} WHERE path = :path', array(':path' => 'admin'))->fetchField(); $this->assertEqual($admin_exists, 'admin', "The path 'admin/' exists prior to deleting."); // Delete the path item 'admin', and test that the path doesn't exist in the database. $delete = db_delete('menu_router') ->condition('path', 'admin') ->execute(); $admin_exists = db_query('SELECT path from {menu_router} WHERE path = :path', array(':path' => 'admin'))->fetchField(); $this->assertFalse($admin_exists, "The path 'admin/' has been deleted and doesn't exist in the database."); // Now we enable the rebuild variable and trigger menu_execute_active_handler() // to rebuild the menu item. Now 'admin' should exist. variable_set('menu_rebuild_needed', TRUE); // menu_execute_active_handler() should trigger the rebuild. $this->drupalGet(''); $admin_exists = db_query('SELECT path from {menu_router} WHERE path = :path', array(':path' => 'admin'))->fetchField(); $this->assertEqual($admin_exists, 'admin', "The menu has been rebuilt, the path 'admin' now exists again."); } } /** * Menu tree data related tests. */ class MenuTreeDataTestCase extends DrupalUnitTestCase { /** * Dummy link structure acceptable for menu_tree_data(). */ var $links = array( 1 => array('mlid' => 1, 'depth' => 1), 2 => array('mlid' => 2, 'depth' => 1), 3 => array('mlid' => 3, 'depth' => 2), 4 => array('mlid' => 4, 'depth' => 3), 5 => array('mlid' => 5, 'depth' => 1), ); public static function getInfo() { return array( 'name' => 'Menu tree generation', 'description' => 'Tests recursive menu tree generation functions.', 'group' => 'Menu', ); } /** * Validate the generation of a proper menu tree hierarchy. */ function testMenuTreeData() { $tree = menu_tree_data($this->links); // Validate that parent items #1, #2, and #5 exist on the root level. $this->assertSameLink($this->links[1], $tree[1]['link'], 'Parent item #1 exists.'); $this->assertSameLink($this->links[2], $tree[2]['link'], 'Parent item #2 exists.'); $this->assertSameLink($this->links[5], $tree[5]['link'], 'Parent item #5 exists.'); // Validate that child item #4 exists at the correct location in the hierarchy. $this->assertSameLink($this->links[4], $tree[2]['below'][3]['below'][4]['link'], 'Child item #4 exists in the hierarchy.'); } /** * Check that two menu links are the same by comparing the mlid. * * @param $link1 * A menu link item. * @param $link2 * A menu link item. * @param $message * The message to display along with the assertion. * @return * TRUE if the assertion succeeded, FALSE otherwise. */ protected function assertSameLink($link1, $link2, $message = '') { return $this->assert($link1['mlid'] == $link2['mlid'], $message ? $message : 'First link is identical to second link'); } } /** * Menu tree output related tests. */ class MenuTreeOutputTestCase extends DrupalWebTestCase { /** * Dummy link structure acceptable for menu_tree_output(). */ var $tree_data = array( '1'=> array( 'link' => array( 'menu_name' => 'main-menu', 'mlid' => 1, 'hidden'=>0, 'has_children' => 1, 'title' => 'Item 1', 'in_active_trail' => 1, 'access'=>1, 'href' => 'a', 'localized_options' => array('attributes' => array('title' =>'')) ), 'below' => array( '2' => array('link' => array( 'menu_name' => 'main-menu', 'mlid' => 2, 'hidden'=>0, 'has_children' => 1, 'title' => 'Item 2', 'in_active_trail' => 1, 'access'=>1, 'href' => 'a/b', 'localized_options' => array('attributes' => array('title' =>'')) ), 'below' => array( '3' => array('link' => array( 'menu_name' => 'main-menu', 'mlid' => 3, 'hidden'=>0, 'has_children' => 0, 'title' => 'Item 3', 'in_active_trail' => 0, 'access'=>1, 'href' => 'a/b/c', 'localized_options' => array('attributes' => array('title' =>'')) ), 'below' => array() ), '4' => array('link' => array( 'menu_name' => 'main-menu', 'mlid' => 4, 'hidden'=>0, 'has_children' => 0, 'title' => 'Item 4', 'in_active_trail' => 0, 'access'=>1, 'href' => 'a/b/d', 'localized_options' => array('attributes' => array('title' =>'')) ), 'below' => array() ) ) ) ) ), '5' => array('link' => array( 'menu_name' => 'main-menu', 'mlid' => 5, 'hidden'=>1, 'has_children' => 0, 'title' => 'Item 5', 'in_active_trail' => 0, 'access'=>1, 'href' => 'e', 'localized_options' => array('attributes' => array('title' =>'')) ), 'below' => array( ) ), '6' => array('link' => array( 'menu_name' => 'main-menu', 'mlid' => 6, 'hidden'=>0, 'has_children' => 0, 'title' => 'Item 6', 'in_active_trail' => 0, 'access'=>0, 'href' => 'f', 'localized_options' => array('attributes' => array('title' =>'')) ), 'below' => array( ) ), '7' => array('link' => array( 'menu_name' => 'main-menu', 'mlid' => 7, 'hidden'=>0, 'has_children' => 0, 'title' => 'Item 7', 'in_active_trail' => 0, 'access'=>1, 'href' => 'g', 'localized_options' => array('attributes' => array('title' =>'')) ), 'below' => array( ) ) ); public static function getInfo() { return array( 'name' => 'Menu tree output', 'description' => 'Tests menu tree output functions.', 'group' => 'Menu', ); } function setUp() { parent::setUp(); } /** * Validate the generation of a proper menu tree output. */ function testMenuTreeData() { $output = menu_tree_output($this->tree_data); // Validate that the - in main-menu is changed into an underscore $this->assertEqual($output['1']['#theme'], 'menu_link__main_menu', 'Hyphen is changed to an underscore on menu_link'); $this->assertEqual($output['#theme_wrappers'][0], 'menu_tree__main_menu', 'Hyphen is changed to an underscore on menu_tree wrapper'); // Looking for child items in the data $this->assertEqual( $output['1']['#below']['2']['#href'], 'a/b', 'Checking the href on a child item'); $this->assertTrue( in_array('active-trail',$output['1']['#below']['2']['#attributes']['class']) , 'Checking the active trail class'); // Validate that the hidden and no access items are missing $this->assertFalse( isset($output['5']), 'Hidden item should be missing'); $this->assertFalse( isset($output['6']), 'False access should be missing'); // Item 7 is after a couple hidden items. Just to make sure that 5 and 6 are skipped and 7 still included $this->assertTrue( isset($output['7']), 'Item after hidden items is present'); } } /** * Menu breadcrumbs related tests. */ class MenuBreadcrumbTestCase extends MenuWebTestCase { public static function getInfo() { return array( 'name' => 'Breadcrumbs', 'description' => 'Tests breadcrumbs functionality.', 'group' => 'Menu', ); } function setUp() { $modules = func_get_args(); if (isset($modules[0]) && is_array($modules[0])) { $modules = $modules[0]; } $modules[] = 'menu_test'; parent::setUp($modules); $perms = array_keys(module_invoke_all('permission')); $this->admin_user = $this->drupalCreateUser($perms); $this->drupalLogin($this->admin_user); // This test puts menu links in the Navigation menu and then tests for // their presence on the page, so we need to ensure that the Navigation // block will be displayed in all active themes. db_update('block') ->fields(array( // Use a region that is valid for all themes. 'region' => 'content', 'status' => 1, )) ->condition('module', 'system') ->condition('delta', 'navigation') ->execute(); } /** * Tests breadcrumbs on node and administrative paths. */ function testBreadCrumbs() { // Prepare common base breadcrumb elements. $home = array('' => 'Home'); $admin = $home + array('admin' => t('Administration')); $config = $admin + array('admin/config' => t('Configuration')); $type = 'article'; $langcode = LANGUAGE_NONE; // Verify breadcrumbs for default local tasks. $expected = array( 'menu-test' => t('Menu test root'), ); $title = t('Breadcrumbs test: Local tasks'); $trail = $home + $expected; $tree = $expected + array( 'menu-test/breadcrumb/tasks' => $title, ); $this->assertBreadcrumb('menu-test/breadcrumb/tasks', $trail, $title, $tree); $this->assertBreadcrumb('menu-test/breadcrumb/tasks/first', $trail, $title, $tree); $this->assertBreadcrumb('menu-test/breadcrumb/tasks/first/first', $trail, $title, $tree); $trail += array( 'menu-test/breadcrumb/tasks' => t('Breadcrumbs test: Local tasks'), ); $this->assertBreadcrumb('menu-test/breadcrumb/tasks/first/second', $trail, $title, $tree); $this->assertBreadcrumb('menu-test/breadcrumb/tasks/second', $trail, $title, $tree); $this->assertBreadcrumb('menu-test/breadcrumb/tasks/second/first', $trail, $title, $tree); $trail += array( 'menu-test/breadcrumb/tasks/second' => t('Second'), ); $this->assertBreadcrumb('menu-test/breadcrumb/tasks/second/second', $trail, $title, $tree); // Verify Taxonomy administration breadcrumbs. $trail = $admin + array( 'admin/structure' => t('Structure'), ); $this->assertBreadcrumb('admin/structure/taxonomy', $trail); $trail += array( 'admin/structure/taxonomy' => t('Taxonomy'), ); $this->assertBreadcrumb('admin/structure/taxonomy/tags', $trail); $trail += array( 'admin/structure/taxonomy/tags' => t('Tags'), ); $this->assertBreadcrumb('admin/structure/taxonomy/tags/edit', $trail); $this->assertBreadcrumb('admin/structure/taxonomy/tags/fields', $trail); $this->assertBreadcrumb('admin/structure/taxonomy/tags/add', $trail); // Verify Menu administration breadcrumbs. $trail = $admin + array( 'admin/structure' => t('Structure'), ); $this->assertBreadcrumb('admin/structure/menu', $trail); $trail += array( 'admin/structure/menu' => t('Menus'), ); $this->assertBreadcrumb('admin/structure/menu/manage/navigation', $trail); $trail += array( 'admin/structure/menu/manage/navigation' => t('Navigation'), ); $this->assertBreadcrumb("admin/structure/menu/item/6/edit", $trail); $this->assertBreadcrumb('admin/structure/menu/manage/navigation/edit', $trail); $this->assertBreadcrumb('admin/structure/menu/manage/navigation/add', $trail); // Verify Node administration breadcrumbs. $trail = $admin + array( 'admin/structure' => t('Structure'), 'admin/structure/types' => t('Content types'), ); $this->assertBreadcrumb('admin/structure/types/add', $trail); $this->assertBreadcrumb("admin/structure/types/manage/$type", $trail); $trail += array( "admin/structure/types/manage/$type" => t('Article'), ); $this->assertBreadcrumb("admin/structure/types/manage/$type/fields", $trail); $this->assertBreadcrumb("admin/structure/types/manage/$type/display", $trail); $trail_teaser = $trail + array( "admin/structure/types/manage/$type/display" => t('Manage display'), ); $this->assertBreadcrumb("admin/structure/types/manage/$type/display/teaser", $trail_teaser); $this->assertBreadcrumb("admin/structure/types/manage/$type/comment/fields", $trail); $this->assertBreadcrumb("admin/structure/types/manage/$type/comment/display", $trail); $this->assertBreadcrumb("admin/structure/types/manage/$type/delete", $trail); $trail += array( "admin/structure/types/manage/$type/fields" => t('Manage fields'), ); $this->assertBreadcrumb("admin/structure/types/manage/$type/fields/body", $trail); $trail += array( "admin/structure/types/manage/$type/fields/body" => t('Body'), ); $this->assertBreadcrumb("admin/structure/types/manage/$type/fields/body/widget-type", $trail); // Verify Filter text format administration breadcrumbs. $format = db_query_range("SELECT format, name FROM {filter_format}", 1, 1)->fetch(); $format_id = $format->format; $trail = $config + array( 'admin/config/content' => t('Content authoring'), ); $this->assertBreadcrumb('admin/config/content/formats', $trail); $trail += array( 'admin/config/content/formats' => t('Text formats'), ); $this->assertBreadcrumb('admin/config/content/formats/add', $trail); $this->assertBreadcrumb("admin/config/content/formats/$format_id", $trail); $trail += array( "admin/config/content/formats/$format_id" => $format->name, ); $this->assertBreadcrumb("admin/config/content/formats/$format_id/disable", $trail); // Verify node breadcrumbs (without menu link). $node1 = $this->drupalCreateNode(); $nid1 = $node1->nid; $trail = $home; $this->assertBreadcrumb("node/$nid1", $trail); // Also verify that the node does not appear elsewhere (e.g., menu trees). $this->assertNoLink($node1->title); // The node itself should not be contained in the breadcrumb on the default // local task, since there is no difference between both pages. $this->assertBreadcrumb("node/$nid1/view", $trail); // Also verify that the node does not appear elsewhere (e.g., menu trees). $this->assertNoLink($node1->title); $trail += array( "node/$nid1" => $node1->title, ); $this->assertBreadcrumb("node/$nid1/edit", $trail); // Verify that breadcrumb on node listing page contains "Home" only. $trail = array(); $this->assertBreadcrumb('node', $trail); // Verify node breadcrumbs (in menu). // Do this separately for Main menu and Navigation menu, since only the // latter is a preferred menu by default. // @todo Also test all themes? Manually testing led to the suspicion that // breadcrumbs may differ, possibly due to template.php overrides. $menus = array('main-menu', 'navigation'); // Alter node type menu settings. variable_set("menu_options_$type", $menus); variable_set("menu_parent_$type", 'navigation:0'); foreach ($menus as $menu) { // Create a parent node in the current menu. $title = $this->randomName(); $node2 = $this->drupalCreateNode(array( 'type' => $type, 'title' => $title, 'menu' => array( 'enabled' => 1, 'link_title' => 'Parent ' . $title, 'description' => '', 'menu_name' => $menu, 'plid' => 0, ), )); $nid2 = $node2->nid; $trail = $home; $tree = array( "node/$nid2" => $node2->menu['link_title'], ); $this->assertBreadcrumb("node/$nid2", $trail, $node2->title, $tree); // The node itself should not be contained in the breadcrumb on the // default local task, since there is no difference between both pages. $this->assertBreadcrumb("node/$nid2/view", $trail, $node2->title, $tree); $trail += array( "node/$nid2" => $node2->menu['link_title'], ); $this->assertBreadcrumb("node/$nid2/edit", $trail); // Create a child node in the current menu. $title = $this->randomName(); $node3 = $this->drupalCreateNode(array( 'type' => $type, 'title' => $title, 'menu' => array( 'enabled' => 1, 'link_title' => 'Child ' . $title, 'description' => '', 'menu_name' => $menu, 'plid' => $node2->menu['mlid'], ), )); $nid3 = $node3->nid; $this->assertBreadcrumb("node/$nid3", $trail, $node3->title, $tree, FALSE); // The node itself should not be contained in the breadcrumb on the // default local task, since there is no difference between both pages. $this->assertBreadcrumb("node/$nid3/view", $trail, $node3->title, $tree, FALSE); $trail += array( "node/$nid3" => $node3->menu['link_title'], ); $tree += array( "node/$nid3" => $node3->menu['link_title'], ); $this->assertBreadcrumb("node/$nid3/edit", $trail); // Verify that node listing page still contains "Home" only. $trail = array(); $this->assertBreadcrumb('node', $trail); if ($menu == 'navigation') { $parent = $node2; $child = $node3; } } // Create a Navigation menu link for 'node', move the last parent node menu // link below it, and verify a full breadcrumb for the last child node. $menu = 'navigation'; $edit = array( 'link_title' => 'Root', 'link_path' => 'node', ); $this->drupalPost("admin/structure/menu/manage/$menu/add", $edit, t('Save')); $link = db_query('SELECT * FROM {menu_links} WHERE link_title = :title', array(':title' => 'Root'))->fetchAssoc(); $edit = array( 'menu[parent]' => $link['menu_name'] . ':' . $link['mlid'], ); $this->drupalPost("node/{$parent->nid}/edit", $edit, t('Save')); $expected = array( "node" => $link['link_title'], ); $trail = $home + $expected; $tree = $expected + array( "node/{$parent->nid}" => $parent->menu['link_title'], ); $this->assertBreadcrumb(NULL, $trail, $parent->title, $tree); $trail += array( "node/{$parent->nid}" => $parent->menu['link_title'], ); $tree += array( "node/{$child->nid}" => $child->menu['link_title'], ); $this->assertBreadcrumb("node/{$child->nid}", $trail, $child->title, $tree); // Add a taxonomy term/tag to last node, and add a link for that term to the // Navigation menu. $tags = array( 'Drupal' => array(), 'Breadcrumbs' => array(), ); $edit = array( "field_tags[$langcode]" => implode(',', array_keys($tags)), ); $this->drupalPost("node/{$parent->nid}/edit", $edit, t('Save')); // Put both terms into a hierarchy Drupal » Breadcrumbs. Required for both // the menu links and the terms itself, since taxonomy_term_page() resets // the breadcrumb based on taxonomy term hierarchy. $parent_tid = 0; foreach ($tags as $name => $null) { $terms = taxonomy_term_load_multiple(NULL, array('name' => $name)); $term = reset($terms); $tags[$name]['term'] = $term; if ($parent_tid) { $edit = array( 'parent[]' => array($parent_tid), ); $this->drupalPost("taxonomy/term/{$term->tid}/edit", $edit, t('Save')); } $parent_tid = $term->tid; } $parent_mlid = 0; foreach ($tags as $name => $data) { $term = $data['term']; $edit = array( 'link_title' => "$name link", 'link_path' => "taxonomy/term/{$term->tid}", 'parent' => "$menu:{$parent_mlid}", ); $this->drupalPost("admin/structure/menu/manage/$menu/add", $edit, t('Save')); $tags[$name]['link'] = db_query('SELECT * FROM {menu_links} WHERE link_title = :title AND link_path = :href', array( ':title' => $edit['link_title'], ':href' => $edit['link_path'], ))->fetchAssoc(); $tags[$name]['link']['link_path'] = $edit['link_path']; $parent_mlid = $tags[$name]['link']['mlid']; } // Verify expected breadcrumbs for menu links. $trail = $home; $tree = array(); foreach ($tags as $name => $data) { $term = $data['term']; $link = $data['link']; $tree += array( $link['link_path'] => $link['link_title'], ); $this->assertBreadcrumb($link['link_path'], $trail, $term->name, $tree); $this->assertRaw(check_plain($parent->title), 'Tagged node found.'); // Additionally make sure that this link appears only once; i.e., the // untranslated menu links automatically generated from menu router items // ('taxonomy/term/%') should never be translated and appear in any menu // other than the breadcrumb trail. $elements = $this->xpath('//div[@id=:menu]/descendant::a[@href=:href]', array( ':menu' => 'block-system-navigation', ':href' => url($link['link_path']), )); $this->assertTrue(count($elements) == 1, "Link to {$link['link_path']} appears only once."); // Next iteration should expect this tag as parent link. // Note: Term name, not link name, due to taxonomy_term_page(). $trail += array( $link['link_path'] => $term->name, ); } // Verify breadcrumbs on user and user/%. // We need to log back in and out below, and cannot simply grant the // 'administer users' permission, since user_page() makes your head explode. user_role_grant_permissions(DRUPAL_ANONYMOUS_RID, array( 'access user profiles', )); $this->drupalLogout(); // Verify breadcrumb on front page. $this->assertBreadcrumb('', array()); // Verify breadcrumb on user pages (without menu link) for anonymous user. $trail = $home; $this->assertBreadcrumb('user', $trail, t('User account')); $this->assertBreadcrumb('user/' . $this->admin_user->uid, $trail, $this->admin_user->name); // Verify breadcrumb on user pages (without menu link) for registered users. $this->drupalLogin($this->admin_user); $trail = $home; $this->assertBreadcrumb('user', $trail, $this->admin_user->name); $this->assertBreadcrumb('user/' . $this->admin_user->uid, $trail, $this->admin_user->name); $trail += array( 'user/' . $this->admin_user->uid => $this->admin_user->name, ); $this->assertBreadcrumb('user/' . $this->admin_user->uid . '/edit', $trail, $this->admin_user->name); // Create a second user to verify breadcrumb on user pages again. $this->web_user = $this->drupalCreateUser(array( 'administer users', 'access user profiles', )); $this->drupalLogin($this->web_user); // Verify correct breadcrumb and page title on another user's account pages // (without menu link). $trail = $home; $this->assertBreadcrumb('user/' . $this->admin_user->uid, $trail, $this->admin_user->name); $trail += array( 'user/' . $this->admin_user->uid => $this->admin_user->name, ); $this->assertBreadcrumb('user/' . $this->admin_user->uid . '/edit', $trail, $this->admin_user->name); // Verify correct breadcrumb and page title when viewing own user account // pages (without menu link). $trail = $home; $this->assertBreadcrumb('user/' . $this->web_user->uid, $trail, $this->web_user->name); $trail += array( 'user/' . $this->web_user->uid => $this->web_user->name, ); $this->assertBreadcrumb('user/' . $this->web_user->uid . '/edit', $trail, $this->web_user->name); // Add a Navigation menu links for 'user' and $this->admin_user. // Although it may be faster to manage these links via low-level API // functions, there's a lot that can go wrong in doing so. $this->drupalLogin($this->admin_user); $edit = array( 'link_title' => 'User', 'link_path' => 'user', ); $this->drupalPost("admin/structure/menu/manage/$menu/add", $edit, t('Save')); $link_user = db_query('SELECT * FROM {menu_links} WHERE link_title = :title AND link_path = :href', array( ':title' => $edit['link_title'], ':href' => $edit['link_path'], ))->fetchAssoc(); $edit = array( 'link_title' => $this->admin_user->name . ' link', 'link_path' => 'user/' . $this->admin_user->uid, ); $this->drupalPost("admin/structure/menu/manage/$menu/add", $edit, t('Save')); $link_admin_user = db_query('SELECT * FROM {menu_links} WHERE link_title = :title AND link_path = :href', array( ':title' => $edit['link_title'], ':href' => $edit['link_path'], ))->fetchAssoc(); // Verify expected breadcrumbs for the two separate links. $this->drupalLogout(); $trail = $home; $tree = array( $link_user['link_path'] => $link_user['link_title'], ); $this->assertBreadcrumb('user', $trail, $link_user['link_title'], $tree); $tree = array( $link_admin_user['link_path'] => $link_admin_user['link_title'], ); $this->assertBreadcrumb('user/' . $this->admin_user->uid, $trail, $link_admin_user['link_title'], $tree); $this->drupalLogin($this->admin_user); $trail += array( $link_admin_user['link_path'] => $link_admin_user['link_title'], ); $this->assertBreadcrumb('user/' . $this->admin_user->uid . '/edit', $trail, $link_admin_user['link_title'], $tree, FALSE); // Move 'user/%' below 'user' and verify again. $edit = array( 'parent' => "$menu:{$link_user['mlid']}", ); $this->drupalPost("admin/structure/menu/item/{$link_admin_user['mlid']}/edit", $edit, t('Save')); $this->drupalLogout(); $trail = $home; $tree = array( $link_user['link_path'] => $link_user['link_title'], ); $this->assertBreadcrumb('user', $trail, $link_user['link_title'], $tree); $trail += array( $link_user['link_path'] => $link_user['link_title'], ); $tree += array( $link_admin_user['link_path'] => $link_admin_user['link_title'], ); $this->assertBreadcrumb('user/' . $this->admin_user->uid, $trail, $link_admin_user['link_title'], $tree); $this->drupalLogin($this->admin_user); $trail += array( $link_admin_user['link_path'] => $link_admin_user['link_title'], ); $this->assertBreadcrumb('user/' . $this->admin_user->uid . '/edit', $trail, $link_admin_user['link_title'], $tree, FALSE); // Create an only slightly privileged user being able to access site reports // but not administration pages. $this->web_user = $this->drupalCreateUser(array( 'access site reports', )); $this->drupalLogin($this->web_user); // Verify that we can access recent log entries, there is a corresponding // page title, and that the breadcrumb is empty (because the user is not // able to access "Administer", so the trail cannot recurse into it). $trail = array(); $this->assertBreadcrumb('admin', $trail, t('Access denied')); $this->assertResponse(403); $trail = $home; $this->assertBreadcrumb('admin/reports', $trail, t('Reports')); $this->assertNoResponse(403); $this->assertBreadcrumb('admin/reports/dblog', $trail, t('Recent log messages')); $this->assertNoResponse(403); } } /** * Tests active menu trails. */ class MenuTrailTestCase extends MenuWebTestCase { public static function getInfo() { return array( 'name' => 'Active trail', 'description' => 'Tests active menu trails and alteration functionality.', 'group' => 'Menu', ); } function setUp() { $modules = func_get_args(); if (isset($modules[0]) && is_array($modules[0])) { $modules = $modules[0]; } $modules[] = 'menu_test'; parent::setUp($modules); $this->admin_user = $this->drupalCreateUser(array('administer site configuration', 'access administration pages')); $this->drupalLogin($this->admin_user); // This test puts menu links in the Navigation menu and then tests for // their presence on the page, so we need to ensure that the Navigation // block will be displayed in all active themes. db_update('block') ->fields(array( // Use a region that is valid for all themes. 'region' => 'content', 'status' => 1, )) ->condition('module', 'system') ->condition('delta', 'navigation') ->execute(); // This test puts menu links in the Management menu and then tests for // their presence on the page, so we need to ensure that the Management // block will be displayed in all active themes. db_update('block') ->fields(array( // Use a region that is valid for all themes. 'region' => 'content', 'status' => 1, )) ->condition('module', 'system') ->condition('delta', 'management') ->execute(); } /** * Tests active trails are properly affected by menu_tree_set_path(). */ function testMenuTreeSetPath() { $home = array('' => 'Home'); $config_tree = array( 'admin' => t('Administration'), 'admin/config' => t('Configuration'), ); $config = $home + $config_tree; // The menu_test_menu_tree_set_path system variable controls whether or not // the menu_test_menu_trail_callback() callback (used by all paths in these // tests) issues an overriding call to menu_trail_set_path(). $test_menu_path = array( 'menu_name' => 'management', 'path' => 'admin/config/system/site-information', ); $breadcrumb = $home + array( 'menu-test' => t('Menu test root'), ); $tree = array( 'menu-test' => t('Menu test root'), 'menu-test/menu-trail' => t('Menu trail - Case 1'), ); // Test the tree generation for the Navigation menu. variable_del('menu_test_menu_tree_set_path'); $this->assertBreadcrumb('menu-test/menu-trail', $breadcrumb, t('Menu trail - Case 1'), $tree); // Override the active trail for the Management tree; it should not affect // the Navigation tree. variable_set('menu_test_menu_tree_set_path', $test_menu_path); $this->assertBreadcrumb('menu-test/menu-trail', $breadcrumb, t('Menu trail - Case 1'), $tree); $breadcrumb = $config + array( 'admin/config/development' => t('Development'), ); $tree = $config_tree + array( 'admin/config/development' => t('Development'), 'admin/config/development/menu-trail' => t('Menu trail - Case 2'), ); $override_breadcrumb = $config + array( 'admin/config/system' => t('System'), 'admin/config/system/site-information' => t('Site information'), ); $override_tree = $config_tree + array( 'admin/config/system' => t('System'), 'admin/config/system/site-information' => t('Site information'), ); // Test the tree generation for the Management menu. variable_del('menu_test_menu_tree_set_path'); $this->assertBreadcrumb('admin/config/development/menu-trail', $breadcrumb, t('Menu trail - Case 2'), $tree); // Override the active trail for the Management tree; it should affect the // breadcrumbs and Management tree. variable_set('menu_test_menu_tree_set_path', $test_menu_path); $this->assertBreadcrumb('admin/config/development/menu-trail', $override_breadcrumb, t('Menu trail - Case 2'), $override_tree); } /** * Tests that the active trail works correctly on custom 403 and 404 pages. */ function testCustom403And404Pages() { // Set the custom 403 and 404 pages we will use. variable_set('site_403', 'menu-test/custom-403-page'); variable_set('site_404', 'menu-test/custom-404-page'); // Define the paths we'll visit to trigger 403 and 404 responses during // this test, and the expected active trail for each case. $paths = array( 403 => 'admin/config', 404 => $this->randomName(), ); // For the 403 page, the initial trail during the Drupal bootstrap should // include the page that the user is trying to visit, while the final trail // should reflect the custom 403 page that the user was redirected to. $expected_trail[403]['initial'] = array( '' => 'Home', 'admin/config' => 'Configuration', ); $expected_trail[403]['final'] = array( '' => 'Home', 'menu-test' => 'Menu test root', 'menu-test/custom-403-page' => 'Custom 403 page', ); // For the 404 page, the initial trail during the Drupal bootstrap should // only contain the link back to "Home" (since the page the user is trying // to visit doesn't have any menu items associated with it), while the // final trail should reflect the custom 404 page that the user was // redirected to. $expected_trail[404]['initial'] = array( '' => 'Home', ); $expected_trail[404]['final'] = array( '' => 'Home', 'menu-test' => 'Menu test root', 'menu-test/custom-404-page' => 'Custom 404 page', ); // Visit each path as an anonymous user so that we will actually get a 403 // on admin/config. $this->drupalLogout(); foreach (array(403, 404) as $status_code) { // Before visiting the page, trigger the code in the menu_test module // that will record the active trail (so we can check it in this test). variable_set('menu_test_record_active_trail', TRUE); $this->drupalGet($paths[$status_code]); $this->assertResponse($status_code); // Check that the initial trail (during the Drupal bootstrap) matches // what we expect. $initial_trail = variable_get('menu_test_active_trail_initial', array()); $this->assertEqual(count($initial_trail), count($expected_trail[$status_code]['initial']), format_string('The initial active trail for a @status_code page contains the expected number of items (expected: @expected, found: @found).', array( '@status_code' => $status_code, '@expected' => count($expected_trail[$status_code]['initial']), '@found' => count($initial_trail), ))); foreach (array_keys($expected_trail[$status_code]['initial']) as $index => $path) { $this->assertEqual($initial_trail[$index]['href'], $path, format_string('Element number @number of the initial active trail for a @status_code page contains the correct path (expected: @expected, found: @found)', array( '@number' => $index + 1, '@status_code' => $status_code, '@expected' => $path, '@found' => $initial_trail[$index]['href'], ))); } // Check that the final trail (after the user has been redirected to the // custom 403/404 page) matches what we expect. $final_trail = variable_get('menu_test_active_trail_final', array()); $this->assertEqual(count($final_trail), count($expected_trail[$status_code]['final']), format_string('The final active trail for a @status_code page contains the expected number of items (expected: @expected, found: @found).', array( '@status_code' => $status_code, '@expected' => count($expected_trail[$status_code]['final']), '@found' => count($final_trail), ))); foreach (array_keys($expected_trail[$status_code]['final']) as $index => $path) { $this->assertEqual($final_trail[$index]['href'], $path, format_string('Element number @number of the final active trail for a @status_code page contains the correct path (expected: @expected, found: @found)', array( '@number' => $index + 1, '@status_code' => $status_code, '@expected' => $path, '@found' => $final_trail[$index]['href'], ))); } // Check that the breadcrumb displayed on the final custom 403/404 page // matches what we expect. (The last item of the active trail represents // the current page, which is not supposed to appear in the breadcrumb, // so we need to remove it from the array before checking.) array_pop($expected_trail[$status_code]['final']); $this->assertBreadcrumb(NULL, $expected_trail[$status_code]['final']); } } } drupal-7.41/modules/simpletest/tests/system_dependencies_test.info0000644000000000000000000000050212611767501024406 0ustar rootrootname = "System dependency test" description = "Support module for testing system dependencies." package = Testing version = VERSION core = 7.x hidden = TRUE dependencies[] = _missing_dependency ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/requirements1_test.info0000644000000000000000000000047112611767501023165 0ustar rootrootname = Requirements 1 Test description = "Tests that a module is not installed when it fails hook_requirements('install')." package = Testing version = VERSION core = 7.x hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/theme_test.info0000644000000000000000000000041212611767501021456 0ustar rootrootname = "Theme test" description = "Support module for theme system testing." package = Testing version = VERSION core = 7.x hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/menu_test.info0000644000000000000000000000041412611767501021322 0ustar rootrootname = "Hook menu tests" description = "Support module for menu hook testing." package = Testing version = VERSION core = 7.x hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/session_test.info0000644000000000000000000000041412611767501022041 0ustar rootrootname = "Session test" description = "Support module for session data testing." package = Testing version = VERSION core = 7.x hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/xmlrpc.test0000644000000000000000000002316212611765734020663 0ustar rootroot 'XML-RPC basic', 'description' => 'Perform basic XML-RPC tests that do not require additional callbacks.', 'group' => 'XML-RPC', ); } /** * Ensure that a basic XML-RPC call with no parameters works. */ protected function testListMethods() { // Minimum list of methods that should be included. $minimum = array( 'system.multicall', 'system.methodSignature', 'system.getCapabilities', 'system.listMethods', 'system.methodHelp', ); // Invoke XML-RPC call to get list of methods. $url = url(NULL, array('absolute' => TRUE)) . 'xmlrpc.php'; $methods = xmlrpc($url, array('system.listMethods' => array())); // Ensure that the minimum methods were found. $count = 0; foreach ($methods as $method) { if (in_array($method, $minimum)) { $count++; } } $this->assertEqual($count, count($minimum), 'system.listMethods returned at least the minimum listing'); } /** * Ensure that system.methodSignature returns an array of signatures. */ protected function testMethodSignature() { $url = url(NULL, array('absolute' => TRUE)) . 'xmlrpc.php'; $signature = xmlrpc($url, array('system.methodSignature' => array('system.listMethods'))); $this->assert(is_array($signature) && !empty($signature) && is_array($signature[0]), 'system.methodSignature returns an array of signature arrays.'); } /** * Ensure that XML-RPC correctly handles invalid messages when parsing. */ protected function testInvalidMessageParsing() { $invalid_messages = array( array( 'message' => xmlrpc_message(''), 'assertion' => 'Empty message correctly rejected during parsing.', ), array( 'message' => xmlrpc_message(''), 'assertion' => 'Empty message with XML declaration correctly rejected during parsing.', ), array( 'message' => xmlrpc_message('value'), 'assertion' => 'Non-empty message without a valid message type is rejected during parsing.', ), array( 'message' => xmlrpc_message('value'), 'assertion' => 'Non-empty malformed message is rejected during parsing.', ), ); foreach ($invalid_messages as $assertion) { $this->assertFalse(xmlrpc_message_parse($assertion['message']), $assertion['assertion']); } } } class XMLRPCValidator1IncTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'XML-RPC validator', 'description' => 'See the xmlrpc validator1 specification.', 'group' => 'XML-RPC', ); } function setUp() { parent::setUp('xmlrpc_test'); } /** * Run validator1 tests. */ function testValidator1() { $xml_url = url(NULL, array('absolute' => TRUE)) . 'xmlrpc.php'; srand(); mt_srand(); $array_1 = array(array('curly' => mt_rand(-100, 100)), array('curly' => mt_rand(-100, 100)), array('larry' => mt_rand(-100, 100)), array('larry' => mt_rand(-100, 100)), array('moe' => mt_rand(-100, 100)), array('moe' => mt_rand(-100, 100)), array('larry' => mt_rand(-100, 100))); shuffle($array_1); $l_res_1 = xmlrpc_test_arrayOfStructsTest($array_1); $r_res_1 = xmlrpc($xml_url, array('validator1.arrayOfStructsTest' => array($array_1))); $this->assertIdentical($l_res_1, $r_res_1); $string_2 = 't\'&>>zf"md>yr>xlcev">>uai"np&s>>q\'&b<>"&&&'; $l_res_2 = xmlrpc_test_countTheEntities($string_2); $r_res_2 = xmlrpc($xml_url, array('validator1.countTheEntities' => array($string_2))); $this->assertIdentical($l_res_2, $r_res_2); $struct_3 = array('moe' => mt_rand(-100, 100), 'larry' => mt_rand(-100, 100), 'curly' => mt_rand(-100, 100), 'homer' => mt_rand(-100, 100)); $l_res_3 = xmlrpc_test_easyStructTest($struct_3); $r_res_3 = xmlrpc($xml_url, array('validator1.easyStructTest' => array($struct_3))); $this->assertIdentical($l_res_3, $r_res_3); $struct_4 = array('sub1' => array('bar' => 13), 'sub2' => 14, 'sub3' => array('foo' => 1, 'baz' => 2), 'sub4' => array('ss' => array('sss' => array('ssss' => 'sssss')))); $l_res_4 = xmlrpc_test_echoStructTest($struct_4); $r_res_4 = xmlrpc($xml_url, array('validator1.echoStructTest' => array($struct_4))); $this->assertIdentical($l_res_4, $r_res_4); $int_5 = mt_rand(-100, 100); $bool_5 = (($int_5 % 2) == 0); $string_5 = $this->randomName(); $double_5 = (double)(mt_rand(-1000, 1000) / 100); $time_5 = REQUEST_TIME; $base64_5 = $this->randomName(100); $l_res_5 = xmlrpc_test_manyTypesTest($int_5, $bool_5, $string_5, $double_5, xmlrpc_date($time_5), $base64_5); // See http://drupal.org/node/37766 why this currently fails $l_res_5[5] = $l_res_5[5]->data; $r_res_5 = xmlrpc($xml_url, array('validator1.manyTypesTest' => array($int_5, $bool_5, $string_5, $double_5, xmlrpc_date($time_5), xmlrpc_base64($base64_5)))); // @todo Contains objects, objects are not equal. $this->assertEqual($l_res_5, $r_res_5); $size = mt_rand(100, 200); $array_6 = array(); for ($i = 0; $i < $size; $i++) { $array_6[] = $this->randomName(mt_rand(8, 12)); } $l_res_6 = xmlrpc_test_moderateSizeArrayCheck($array_6); $r_res_6 = xmlrpc($xml_url, array('validator1.moderateSizeArrayCheck' => array($array_6))); $this->assertIdentical($l_res_6, $r_res_6); $struct_7 = array(); for ($y = 2000; $y < 2002; $y++) { for ($m = 3; $m < 5; $m++) { for ($d = 1; $d < 6; $d++) { $ys = (string) $y; $ms = sprintf('%02d', $m); $ds = sprintf('%02d', $d); $struct_7[$ys][$ms][$ds]['moe'] = mt_rand(-100, 100); $struct_7[$ys][$ms][$ds]['larry'] = mt_rand(-100, 100); $struct_7[$ys][$ms][$ds]['curly'] = mt_rand(-100, 100); } } } $l_res_7 = xmlrpc_test_nestedStructTest($struct_7); $r_res_7 = xmlrpc($xml_url, array('validator1.nestedStructTest' => array($struct_7))); $this->assertIdentical($l_res_7, $r_res_7); $int_8 = mt_rand(-100, 100); $l_res_8 = xmlrpc_test_simpleStructReturnTest($int_8); $r_res_8 = xmlrpc($xml_url, array('validator1.simpleStructReturnTest' => array($int_8))); $this->assertIdentical($l_res_8, $r_res_8); /* Now test multicall */ $x = array(); $x['validator1.arrayOfStructsTest'] = array($array_1); $x['validator1.countTheEntities'] = array($string_2); $x['validator1.easyStructTest'] = array($struct_3); $x['validator1.echoStructTest'] = array($struct_4); $x['validator1.manyTypesTest'] = array($int_5, $bool_5, $string_5, $double_5, xmlrpc_date($time_5), xmlrpc_base64($base64_5)); $x['validator1.moderateSizeArrayCheck'] = array($array_6); $x['validator1.nestedStructTest'] = array($struct_7); $x['validator1.simpleStructReturnTest'] = array($int_8); $a_l_res = array($l_res_1, $l_res_2, $l_res_3, $l_res_4, $l_res_5, $l_res_6, $l_res_7, $l_res_8); $a_r_res = xmlrpc($xml_url, $x); $this->assertEqual($a_l_res, $a_r_res); } } class XMLRPCMessagesTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'XML-RPC message and alteration', 'description' => 'Test large messages and method alterations.', 'group' => 'XML-RPC', ); } function setUp() { parent::setUp('xmlrpc_test'); } /** * Make sure that XML-RPC can transfer large messages. */ function testSizedMessages() { // These tests can produce up to 128 x 160 words in the XML-RPC message // (see xmlrpc_test_message_sized_in_kb()) with 4 tags used to represent // each. Set a large enough tag limit to allow this to be tested. variable_set('xmlrpc_message_maximum_tag_count', 100000); $xml_url = url(NULL, array('absolute' => TRUE)) . 'xmlrpc.php'; $sizes = array(8, 80, 160); foreach ($sizes as $size) { $xml_message_l = xmlrpc_test_message_sized_in_kb($size); $xml_message_r = xmlrpc($xml_url, array('messages.messageSizedInKB' => array($size))); $this->assertEqual($xml_message_l, $xml_message_r, format_string('XML-RPC messages.messageSizedInKB of %s Kb size received', array('%s' => $size))); } } /** * Ensure that hook_xmlrpc_alter() can hide even builtin methods. */ protected function testAlterListMethods() { // Ensure xmlrpc_test_xmlrpc_alter() is disabled and retrieve regular list of methods. variable_set('xmlrpc_test_xmlrpc_alter', FALSE); $url = url(NULL, array('absolute' => TRUE)) . 'xmlrpc.php'; $methods1 = xmlrpc($url, array('system.listMethods' => array())); // Enable the alter hook and retrieve the list of methods again. variable_set('xmlrpc_test_xmlrpc_alter', TRUE); $methods2 = xmlrpc($url, array('system.listMethods' => array())); $diff = array_diff($methods1, $methods2); $this->assertTrue(is_array($diff) && !empty($diff), 'Method list is altered by hook_xmlrpc_alter'); $removed = reset($diff); $this->assertEqual($removed, 'system.methodSignature', 'Hiding builting system.methodSignature with hook_xmlrpc_alter works'); } } drupal-7.41/modules/simpletest/tests/image_test.module0000644000000000000000000000625312611765734022007 0ustar rootroot array( 'title' => t('A dummy toolkit that works'), 'available' => TRUE, ), 'broken' => array( 'title' => t('A dummy toolkit that is "broken"'), 'available' => FALSE, ), ); } /** * Reset/initialize the history of calls to the toolkit functions. * * @see image_test_get_all_calls() */ function image_test_reset() { // Keep track of calls to these operations $results = array( 'load' => array(), 'save' => array(), 'settings' => array(), 'resize' => array(), 'rotate' => array(), 'crop' => array(), 'desaturate' => array(), ); variable_set('image_test_results', $results); } /** * Get an array with the all the calls to the toolkits since image_test_reset() * was called. * * @return * An array keyed by operation name ('load', 'save', 'settings', 'resize', * 'rotate', 'crop', 'desaturate') with values being arrays of parameters * passed to each call. */ function image_test_get_all_calls() { return variable_get('image_test_results', array()); } /** * Store the values passed to a toolkit call. * * @param $op * One of the image toolkit operations: 'get_info', 'load', 'save', * 'settings', 'resize', 'rotate', 'crop', 'desaturate'. * @param $args * Values passed to hook. * * @see image_test_get_all_calls() * @see image_test_reset() */ function _image_test_log_call($op, $args) { $results = variable_get('image_test_results', array()); $results[$op][] = $args; variable_set('image_test_results', $results); } /** * Image tookit's settings operation. */ function image_test_settings() { _image_test_log_call('settings', array()); return array(); } /** * Image toolkit's get_info operation. */ function image_test_get_info(stdClass $image) { _image_test_log_call('get_info', array($image)); return array(); } /** * Image tookit's load operation. */ function image_test_load(stdClass $image) { _image_test_log_call('load', array($image)); return $image; } /** * Image tookit's save operation. */ function image_test_save(stdClass $image, $destination) { _image_test_log_call('save', array($image, $destination)); // Return false so that image_save() doesn't try to chmod the destination // file that we didn't bother to create. return FALSE; } /** * Image tookit's crop operation. */ function image_test_crop(stdClass $image, $x, $y, $width, $height) { _image_test_log_call('crop', array($image, $x, $y, $width, $height)); return TRUE; } /** * Image tookit's resize operation. */ function image_test_resize(stdClass $image, $width, $height) { _image_test_log_call('resize', array($image, $width, $height)); return TRUE; } /** * Image tookit's rotate operation. */ function image_test_rotate(stdClass $image, $degrees, $background = NULL) { _image_test_log_call('rotate', array($image, $degrees, $background)); return TRUE; } /** * Image tookit's desaturate operation. */ function image_test_desaturate(stdClass $image) { _image_test_log_call('desaturate', array($image)); return TRUE; } drupal-7.41/modules/simpletest/tests/batch_test.info0000644000000000000000000000041112611767501021434 0ustar rootrootname = "Batch API test" description = "Support module for Batch API tests." package = Testing version = VERSION core = 7.x hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/taxonomy_test.info0000644000000000000000000000046112611767501022236 0ustar rootrootname = "Taxonomy test module" description = "Tests functions and hooks not used in core". package = Testing version = VERSION core = 7.x hidden = TRUE dependencies[] = taxonomy ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/system.base.css0000644000000000000000000000021712611765734021420 0ustar rootroot /** * This file is for testing CSS file override in * CascadingStylesheetsTestCase::testRenderOverride(). * No contents are necessary. */ drupal-7.41/modules/simpletest/tests/common.test0000644000000000000000000040533712611765734020656 0ustar rootroot 'drupal_alter() tests', 'description' => 'Confirm that alteration of arguments passed to drupal_alter() works correctly.', 'group' => 'System', ); } function setUp() { parent::setUp('common_test'); } function testDrupalAlter() { // This test depends on Bartik, so make sure that it is always the current // active theme. global $theme, $base_theme_info; $theme = 'bartik'; $base_theme_info = array(); $array = array('foo' => 'bar'); $entity = new stdClass(); $entity->foo = 'bar'; // Verify alteration of a single argument. $array_copy = $array; $array_expected = array('foo' => 'Drupal theme'); drupal_alter('drupal_alter', $array_copy); $this->assertEqual($array_copy, $array_expected, 'Single array was altered.'); $entity_copy = clone $entity; $entity_expected = clone $entity; $entity_expected->foo = 'Drupal theme'; drupal_alter('drupal_alter', $entity_copy); $this->assertEqual($entity_copy, $entity_expected, 'Single object was altered.'); // Verify alteration of multiple arguments. $array_copy = $array; $array_expected = array('foo' => 'Drupal theme'); $entity_copy = clone $entity; $entity_expected = clone $entity; $entity_expected->foo = 'Drupal theme'; $array2_copy = $array; $array2_expected = array('foo' => 'Drupal theme'); drupal_alter('drupal_alter', $array_copy, $entity_copy, $array2_copy); $this->assertEqual($array_copy, $array_expected, 'First argument to drupal_alter() was altered.'); $this->assertEqual($entity_copy, $entity_expected, 'Second argument to drupal_alter() was altered.'); $this->assertEqual($array2_copy, $array2_expected, 'Third argument to drupal_alter() was altered.'); // Verify alteration order when passing an array of types to drupal_alter(). // common_test_module_implements_alter() places 'block' implementation after // other modules. $array_copy = $array; $array_expected = array('foo' => 'Drupal block theme'); drupal_alter(array('drupal_alter', 'drupal_alter_foo'), $array_copy); $this->assertEqual($array_copy, $array_expected, 'hook_TYPE_alter() implementations ran in correct order.'); } } /** * Tests for URL generation functions. * * url() calls module_implements(), which may issue a db query, which requires * inheriting from a web test case rather than a unit test case. */ class CommonURLUnitTest extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'URL generation tests', 'description' => 'Confirm that url(), drupal_get_query_parameters(), drupal_http_build_query(), and l() work correctly with various input.', 'group' => 'System', ); } /** * Confirm that invalid text given as $path is filtered. */ function testLXSS() { $text = $this->randomName(); $path = ""; $link = l($text, $path); $sanitized_path = check_url(url($path)); $this->assertTrue(strpos($link, $sanitized_path) !== FALSE, format_string('XSS attack @path was filtered', array('@path' => $path))); } /* * Tests for active class in l() function. */ function testLActiveClass() { $link = l($this->randomName(), $_GET['q']); $this->assertTrue($this->hasClass($link, 'active'), format_string('Class @class is present on link to the current page', array('@class' => 'active'))); } /** * Tests for custom class in l() function. */ function testLCustomClass() { $class = $this->randomName(); $link = l($this->randomName(), $_GET['q'], array('attributes' => array('class' => array($class)))); $this->assertTrue($this->hasClass($link, $class), format_string('Custom class @class is present on link when requested', array('@class' => $class))); $this->assertTrue($this->hasClass($link, 'active'), format_string('Class @class is present on link to the current page', array('@class' => 'active'))); } private function hasClass($link, $class) { return preg_match('|class="([^\"\s]+\s+)*' . $class . '|', $link); } /** * Test drupal_get_query_parameters(). */ function testDrupalGetQueryParameters() { $original = array( 'a' => 1, 'b' => array( 'd' => 4, 'e' => array( 'f' => 5, ), ), 'c' => 3, 'q' => 'foo/bar', ); // Default arguments. $result = $_GET; unset($result['q']); $this->assertEqual(drupal_get_query_parameters(), $result, "\$_GET['q'] was removed."); // Default exclusion. $result = $original; unset($result['q']); $this->assertEqual(drupal_get_query_parameters($original), $result, "'q' was removed."); // First-level exclusion. $result = $original; unset($result['b']); $this->assertEqual(drupal_get_query_parameters($original, array('b')), $result, "'b' was removed."); // Second-level exclusion. $result = $original; unset($result['b']['d']); $this->assertEqual(drupal_get_query_parameters($original, array('b[d]')), $result, "'b[d]' was removed."); // Third-level exclusion. $result = $original; unset($result['b']['e']['f']); $this->assertEqual(drupal_get_query_parameters($original, array('b[e][f]')), $result, "'b[e][f]' was removed."); // Multiple exclusions. $result = $original; unset($result['a'], $result['b']['e'], $result['c']); $this->assertEqual(drupal_get_query_parameters($original, array('a', 'b[e]', 'c')), $result, "'a', 'b[e]', 'c' were removed."); } /** * Test drupal_http_build_query(). */ function testDrupalHttpBuildQuery() { $this->assertEqual(drupal_http_build_query(array('a' => ' &#//+%20@۞')), 'a=%20%26%23//%2B%2520%40%DB%9E', 'Value was properly encoded.'); $this->assertEqual(drupal_http_build_query(array(' &#//+%20@۞' => 'a')), '%20%26%23%2F%2F%2B%2520%40%DB%9E=a', 'Key was properly encoded.'); $this->assertEqual(drupal_http_build_query(array('a' => '1', 'b' => '2', 'c' => '3')), 'a=1&b=2&c=3', 'Multiple values were properly concatenated.'); $this->assertEqual(drupal_http_build_query(array('a' => array('b' => '2', 'c' => '3'), 'd' => 'foo')), 'a[b]=2&a[c]=3&d=foo', 'Nested array was properly encoded.'); } /** * Test drupal_parse_url(). */ function testDrupalParseUrl() { // Relative URL. $url = 'foo/bar?foo=bar&bar=baz&baz#foo'; $result = array( 'path' => 'foo/bar', 'query' => array('foo' => 'bar', 'bar' => 'baz', 'baz' => ''), 'fragment' => 'foo', ); $this->assertEqual(drupal_parse_url($url), $result, 'Relative URL parsed correctly.'); // Relative URL that is known to confuse parse_url(). $url = 'foo/bar:1'; $result = array( 'path' => 'foo/bar:1', 'query' => array(), 'fragment' => '', ); $this->assertEqual(drupal_parse_url($url), $result, 'Relative URL parsed correctly.'); // Absolute URL. $url = '/foo/bar?foo=bar&bar=baz&baz#foo'; $result = array( 'path' => '/foo/bar', 'query' => array('foo' => 'bar', 'bar' => 'baz', 'baz' => ''), 'fragment' => 'foo', ); $this->assertEqual(drupal_parse_url($url), $result, 'Absolute URL parsed correctly.'); // External URL testing. $url = 'http://drupal.org/foo/bar?foo=bar&bar=baz&baz#foo'; // Test that drupal can recognize an absolute URL. Used to prevent attack vectors. $this->assertTrue(url_is_external($url), 'Correctly identified an external URL.'); // External URL without an explicit protocol. $url = '//drupal.org/foo/bar?foo=bar&bar=baz&baz#foo'; $this->assertTrue(url_is_external($url), 'Correctly identified an external URL without a protocol part.'); // Internal URL starting with a slash. $url = '/drupal.org'; $this->assertFalse(url_is_external($url), 'Correctly identified an internal URL with a leading slash.'); // Test the parsing of absolute URLs. $url = 'http://drupal.org/foo/bar?foo=bar&bar=baz&baz#foo'; $result = array( 'path' => 'http://drupal.org/foo/bar', 'query' => array('foo' => 'bar', 'bar' => 'baz', 'baz' => ''), 'fragment' => 'foo', ); $this->assertEqual(drupal_parse_url($url), $result, 'External URL parsed correctly.'); // Verify proper parsing of URLs when clean URLs are disabled. $result = array( 'path' => 'foo/bar', 'query' => array('bar' => 'baz'), 'fragment' => 'foo', ); // Non-clean URLs #1: Absolute URL generated by url(). $url = $GLOBALS['base_url'] . '/?q=foo/bar&bar=baz#foo'; $this->assertEqual(drupal_parse_url($url), $result, 'Absolute URL with clean URLs disabled parsed correctly.'); // Non-clean URLs #2: Relative URL generated by url(). $url = '?q=foo/bar&bar=baz#foo'; $this->assertEqual(drupal_parse_url($url), $result, 'Relative URL with clean URLs disabled parsed correctly.'); // Non-clean URLs #3: URL generated by url() on non-Apache webserver. $url = 'index.php?q=foo/bar&bar=baz#foo'; $this->assertEqual(drupal_parse_url($url), $result, 'Relative URL on non-Apache webserver with clean URLs disabled parsed correctly.'); // Test that drupal_parse_url() does not allow spoofing a URL to force a malicious redirect. $parts = drupal_parse_url('forged:http://cwe.mitre.org/data/definitions/601.html'); $this->assertFalse(valid_url($parts['path'], TRUE), 'drupal_parse_url() correctly parsed a forged URL.'); } /** * Test url() with/without query, with/without fragment, absolute on/off and * assert all that works when clean URLs are on and off. */ function testUrl() { global $base_url; foreach (array(FALSE, TRUE) as $absolute) { // Get the expected start of the path string. $base = $absolute ? $base_url . '/' : base_path(); $absolute_string = $absolute ? 'absolute' : NULL; // Disable Clean URLs. $GLOBALS['conf']['clean_url'] = 0; $url = $base . '?q=node/123'; $result = url('node/123', array('absolute' => $absolute)); $this->assertEqual($url, $result, "$url == $result"); $url = $base . '?q=node/123#foo'; $result = url('node/123', array('fragment' => 'foo', 'absolute' => $absolute)); $this->assertEqual($url, $result, "$url == $result"); $url = $base . '?q=node/123&foo'; $result = url('node/123', array('query' => array('foo' => NULL), 'absolute' => $absolute)); $this->assertEqual($url, $result, "$url == $result"); $url = $base . '?q=node/123&foo=bar&bar=baz'; $result = url('node/123', array('query' => array('foo' => 'bar', 'bar' => 'baz'), 'absolute' => $absolute)); $this->assertEqual($url, $result, "$url == $result"); $url = $base . '?q=node/123&foo#bar'; $result = url('node/123', array('query' => array('foo' => NULL), 'fragment' => 'bar', 'absolute' => $absolute)); $this->assertEqual($url, $result, "$url == $result"); $url = $base . '?q=node/123&foo#0'; $result = url('node/123', array('query' => array('foo' => NULL), 'fragment' => '0', 'absolute' => $absolute)); $this->assertEqual($url, $result, "$url == $result"); $url = $base . '?q=node/123&foo'; $result = url('node/123', array('query' => array('foo' => NULL), 'fragment' => '', 'absolute' => $absolute)); $this->assertEqual($url, $result, "$url == $result"); $url = $base; $result = url('', array('absolute' => $absolute)); $this->assertEqual($url, $result, "$url == $result"); // Enable Clean URLs. $GLOBALS['conf']['clean_url'] = 1; $url = $base . 'node/123'; $result = url('node/123', array('absolute' => $absolute)); $this->assertEqual($url, $result, "$url == $result"); $url = $base . 'node/123#foo'; $result = url('node/123', array('fragment' => 'foo', 'absolute' => $absolute)); $this->assertEqual($url, $result, "$url == $result"); $url = $base . 'node/123?foo'; $result = url('node/123', array('query' => array('foo' => NULL), 'absolute' => $absolute)); $this->assertEqual($url, $result, "$url == $result"); $url = $base . 'node/123?foo=bar&bar=baz'; $result = url('node/123', array('query' => array('foo' => 'bar', 'bar' => 'baz'), 'absolute' => $absolute)); $this->assertEqual($url, $result, "$url == $result"); $url = $base . 'node/123?foo#bar'; $result = url('node/123', array('query' => array('foo' => NULL), 'fragment' => 'bar', 'absolute' => $absolute)); $this->assertEqual($url, $result, "$url == $result"); $url = $base; $result = url('', array('absolute' => $absolute)); $this->assertEqual($url, $result, "$url == $result"); } } /** * Test external URL handling. */ function testExternalUrls() { $test_url = 'http://drupal.org/'; // Verify external URL can contain a fragment. $url = $test_url . '#drupal'; $result = url($url); $this->assertEqual($url, $result, 'External URL with fragment works without a fragment in $options.'); // Verify fragment can be overidden in an external URL. $url = $test_url . '#drupal'; $fragment = $this->randomName(10); $result = url($url, array('fragment' => $fragment)); $this->assertEqual($test_url . '#' . $fragment, $result, 'External URL fragment is overidden with a custom fragment in $options.'); // Verify external URL can contain a query string. $url = $test_url . '?drupal=awesome'; $result = url($url); $this->assertEqual($url, $result, 'External URL with query string works without a query string in $options.'); // Verify external URL can be extended with a query string. $url = $test_url; $query = array($this->randomName(5) => $this->randomName(5)); $result = url($url, array('query' => $query)); $this->assertEqual($url . '?' . http_build_query($query, '', '&'), $result, 'External URL can be extended with a query string in $options.'); // Verify query string can be extended in an external URL. $url = $test_url . '?drupal=awesome'; $query = array($this->randomName(5) => $this->randomName(5)); $result = url($url, array('query' => $query)); $this->assertEqual($url . '&' . http_build_query($query, '', '&'), $result, 'External URL query string can be extended with a custom query string in $options.'); // Verify that an internal URL does not result in an external URL without // protocol part. $url = '/drupal.org'; $result = url($url); $this->assertTrue(strpos($result, '//') === FALSE, 'Internal URL does not turn into an external URL.'); // Verify that an external URL without protocol part is recognized as such. $url = '//drupal.org'; $result = url($url); $this->assertEqual($url, $result, 'External URL without protocol is not altered.'); } } /** * Tests for check_plain(), filter_xss(), format_string(), and check_url(). */ class CommonXssUnitTest extends DrupalUnitTestCase { public static function getInfo() { return array( 'name' => 'String filtering tests', 'description' => 'Confirm that check_plain(), filter_xss(), format_string() and check_url() work correctly, including invalid multi-byte sequences.', 'group' => 'System', ); } /** * Check that invalid multi-byte sequences are rejected. */ function testInvalidMultiByte() { // Ignore PHP 5.3+ invalid multibyte sequence warning. $text = @check_plain("Foo\xC0barbaz"); $this->assertEqual($text, '', 'check_plain() rejects invalid sequence "Foo\xC0barbaz"'); // Ignore PHP 5.3+ invalid multibyte sequence warning. $text = @check_plain("\xc2\""); $this->assertEqual($text, '', 'check_plain() rejects invalid sequence "\xc2\""'); $text = check_plain("Fooÿñ"); $this->assertEqual($text, "Fooÿñ", 'check_plain() accepts valid sequence "Fooÿñ"'); $text = filter_xss("Foo\xC0barbaz"); $this->assertEqual($text, '', 'filter_xss() rejects invalid sequence "Foo\xC0barbaz"'); $text = filter_xss("Fooÿñ"); $this->assertEqual($text, "Fooÿñ", 'filter_xss() accepts valid sequence Fooÿñ'); } /** * Check that special characters are escaped. */ function testEscaping() { $text = check_plain("' => "Drupal\n", ); foreach ($tests as $html => $text) { $this->assertHtmlToText($html, $text, 'Supported tags'); } } /** * Test $allowed_tags argument of drupal_html_to_text(). */ function testDrupalHtmlToTextArgs() { // The second parameter of drupal_html_to_text() overrules the allowed tags. $this->assertHtmlToText( 'Drupal Drupal Drupal', "Drupal *Drupal* Drupal\n", 'Allowed tag found', array('b') ); $this->assertHtmlToText( 'Drupal

                  Drupal

                  Drupal', "Drupal Drupal Drupal\n", 'Disallowed

                  tag not found', array('b') ); $this->assertHtmlToText( 'Drupal

                  Drupal

                  Drupal', "Drupal Drupal Drupal\n", 'Disallowed

                  , , and tags not found', array('a', 'br', 'h1') ); $this->assertHtmlToText( 'Drupal', "Drupal\n", 'Unsupported and tags not found', array('html', 'body') ); } /** * Tests that drupal_wrap_mail() removes trailing whitespace before newlines. */ function testDrupalHtmltoTextRemoveTrailingWhitespace() { $text = "Hi there! \nHerp Derp"; $mail_lines = explode("\n", drupal_wrap_mail($text)); $this->assertNotEqual(" ", substr($mail_lines[0], -1), 'Trailing whitespace removed.'); } /** * Tests drupal_wrap_mail() retains whitespace from Usenet style signatures. * * RFC 3676 says, "This is a special case; an (optionally quoted or quoted and * stuffed) line consisting of DASH DASH SP is neither fixed nor flowed." */ function testDrupalHtmltoTextUsenetSignature() { $text = "Hi there!\n-- \nHerp Derp"; $mail_lines = explode("\n", drupal_wrap_mail($text)); $this->assertEqual("-- ", $mail_lines[1], 'Trailing whitespace not removed for dash-dash-space signatures.'); $text = "Hi there!\n-- \nHerp Derp"; $mail_lines = explode("\n", drupal_wrap_mail($text)); $this->assertEqual("--", $mail_lines[1], 'Trailing whitespace removed for incorrect dash-dash-space signatures.'); } /** * Test that whitespace is collapsed. */ function testDrupalHtmltoTextCollapsesWhitespace() { $input = "

                  Drupal Drupal\n\nDrupal

                  Drupal  Drupal\n\nDrupal
                  Drupal Drupal\n\nDrupal

                  "; // @todo The whitespace should be collapsed. $collapsed = "Drupal Drupal\n\nDrupalDrupal Drupal\n\nDrupalDrupal Drupal\n\nDrupal\n\n"; $this->assertHtmlToText( $input, $collapsed, 'Whitespace is collapsed', array('p') ); } /** * Test that text separated by block-level tags in HTML get separated by * (at least) a newline in the plaintext version. */ function testDrupalHtmlToTextBlockTagToNewline() { $input = '[text]' . '
                  [blockquote]
                  ' . '
                  [br]' . '
                  [dl-dt]
                  ' . '
                  [dt]
                  ' . '
                  [dd]
                  ' . '
                  [dd-dl]
                  ' . '

                  [h1]

                  ' . '

                  [h2]

                  ' . '

                  [h3]

                  ' . '

                  [h4]

                  ' . '
                  [h5]
                  ' . '
                  [h6]
                  ' . '
                  [hr]' . '
                  1. [ol-li]
                    2. ' . '
                  2. [li]
                    3. ' . '
                  3. [li-ol]
                  ' . '

                  [p]

                  ' . '
                  • [ul-li]
                    • ' . '
                  • [li-ul]
                  ' . '[text]'; $output = drupal_html_to_text($input); $pass = $this->assertFalse( preg_match('/\][^\n]*\[/s', $output), 'Block-level HTML tags should force newlines' ); if (!$pass) { $this->verbose($this->stringToHtml($output)); } $output_upper = drupal_strtoupper($output); $upper_input = drupal_strtoupper($input); $upper_output = drupal_html_to_text($upper_input); $pass = $this->assertEqual( $upper_output, $output_upper, 'Tag recognition should be case-insensitive' ); if (!$pass) { $this->verbose( $upper_output . '
                  should be equal to
                  ' . $output_upper ); } } /** * Test that headers are properly separated from surrounding text. */ function testHeaderSeparation() { $html = 'Drupal

                  Drupal

                  Drupal'; // @todo There should be more space above the header than below it. $text = "Drupal\n======== DRUPAL ==============================================================\n\nDrupal\n"; $this->assertHtmlToText($html, $text, 'Text before and after

                  tag'); $html = '

                  Drupal

                  Drupal

                  Drupal'; // @todo There should be more space above the header than below it. $text = "Drupal\n\n======== DRUPAL ==============================================================\n\nDrupal\n"; $this->assertHtmlToText($html, $text, 'Paragraph before and text after

                  tag'); $html = 'Drupal

                  Drupal

                  Drupal

                  '; // @todo There should be more space above the header than below it. $text = "Drupal\n======== DRUPAL ==============================================================\n\nDrupal\n\n"; $this->assertHtmlToText($html, $text, 'Text before and paragraph after

                  tag'); $html = '

                  Drupal

                  Drupal

                  Drupal

                  '; $text = "Drupal\n\n======== DRUPAL ==============================================================\n\nDrupal\n\n"; $this->assertHtmlToText($html, $text, 'Paragraph before and after

                  tag'); } /** * Test that footnote references are properly generated. */ function testFootnoteReferences() { global $base_path, $base_url; $source = 'Host and path' . '
                  Host, no path' . '
                  Path, no host' . '
                  Relative path'; // @todo Footnote URLs should be absolute. $tt = "Host and path [1]" . "\nHost, no path [2]" // @todo The following two references should be combined. . "\nPath, no host [3]" . "\nRelative path [4]" . "\n" . "\n[1] http://www.example.com/node/1" . "\n[2] http://www.example.com" // @todo The following two references should be combined. . "\n[3] $base_url/node/1" . "\n[4] node/1\n"; $this->assertHtmlToText($source, $tt, 'Footnotes'); } /** * Test that combinations of paragraph breaks, line breaks, linefeeds, * and spaces are properly handled. */ function testDrupalHtmlToTextParagraphs() { $tests = array(); $tests[] = array( 'html' => "

                  line 1
                  \nline 2
                  line 3\n
                  line 4

                  paragraph

                  ", // @todo Trailing line breaks should be trimmed. 'text' => "line 1\nline 2\nline 3\nline 4\n\nparagraph\n\n", ); $tests[] = array( 'html' => "

                  line 1
                  line 2

                  line 4
                  line 5

                  0

                  ", // @todo Trailing line breaks should be trimmed. 'text' => "line 1\nline 2\n\nline 4\nline 5\n\n0\n\n", ); foreach ($tests as $test) { $this->assertHtmlToText($test['html'], $test['text'], 'Paragraph breaks'); } } /** * Tests that drupal_html_to_text() wraps before 1000 characters. * * RFC 3676 says, "The Text/Plain media type is the lowest common * denominator of Internet email, with lines of no more than 998 characters." * * RFC 2046 says, "SMTP [RFC-821] allows a maximum of 998 octets before the * next CRLF sequence." * * RFC 821 says, "The maximum total length of a text line including the * is 1000 characters." */ function testVeryLongLineWrap() { $input = 'Drupal

                  ' . str_repeat('x', 2100) . '
                  Drupal'; $output = drupal_html_to_text($input); // This awkward construct comes from includes/mail.inc lines 8-13. $eol = variable_get('mail_line_endings', MAIL_LINE_ENDINGS); // We must use strlen() rather than drupal_strlen() in order to count // octets rather than characters. $line_length_limit = 1000 - drupal_strlen($eol); $maximum_line_length = 0; foreach (explode($eol, $output) as $line) { // We must use strlen() rather than drupal_strlen() in order to count // octets rather than characters. $maximum_line_length = max($maximum_line_length, strlen($line . $eol)); } $verbose = 'Maximum line length found was ' . $maximum_line_length . ' octets.'; // @todo This should assert that $maximum_line_length <= 1000. $this->pass($verbose); } } drupal-7.41/modules/simpletest/tests/system_incompatible_module_version_dependencies_test.module0000644000000000000000000000000612611765734032605 0ustar rootroot 'Test menu_name router item', 'page callback' => 'node_save', 'menu_name' => menu_test_menu_name(), ); // This item is of type MENU_CALLBACK with no parents to test title. $items['menu_callback_title'] = array( 'title' => 'Menu Callback Title', 'page callback' => 'menu_test_callback', 'type' => MENU_CALLBACK, 'access arguments' => array('access content'), ); // Use FALSE as 'title callback' to bypass t(). $items['menu_no_title_callback'] = array( 'title' => 'A title with @placeholder', 'title callback' => FALSE, 'title arguments' => array('@placeholder' => 'some other text'), 'page callback' => 'menu_test_callback', 'access arguments' => array('access content'), ); // Hidden link for menu_link_maintain tests $items['menu_test_maintain/%'] = array( 'title' => 'Menu maintain test', 'page callback' => 'node_page_default', 'access arguments' => array('access content'), ); // Hierarchical tests. $items['menu-test/hierarchy/parent'] = array( 'title' => 'Parent menu router', 'page callback' => 'node_page_default', ); $items['menu-test/hierarchy/parent/child'] = array( 'title' => 'Child menu router', 'page callback' => 'node_page_default', ); $items['menu-test/hierarchy/parent/child2/child'] = array( 'title' => 'Unattached subchild router', 'page callback' => 'node_page_default', ); // Theme callback tests. $items['menu-test/theme-callback/%'] = array( 'title' => 'Page that displays different themes', 'page callback' => 'menu_test_theme_page_callback', 'access arguments' => array('access content'), 'theme callback' => 'menu_test_theme_callback', 'theme arguments' => array(2), ); $items['menu-test/theme-callback/%/inheritance'] = array( 'title' => 'Page that tests theme callback inheritance.', 'page callback' => 'menu_test_theme_page_callback', 'page arguments' => array(TRUE), 'access arguments' => array('access content'), ); $items['menu-test/no-theme-callback'] = array( 'title' => 'Page that displays different themes without using a theme callback.', 'page callback' => 'menu_test_theme_page_callback', 'access arguments' => array('access content'), ); // Path containing "exotic" characters. $path = "menu-test/ -._~!$'\"()*@[]?&+%#,;=:" . // "Special" ASCII characters. "%23%25%26%2B%2F%3F" . // Characters that look like a percent-escaped string. "éøïвβ中國書۞"; // Characters from various non-ASCII alphabets. $items[$path] = array( 'title' => '"Exotic" path', 'page callback' => 'menu_test_callback', 'access arguments' => array('access content'), ); // Hidden tests; base parents. // Same structure as in Menu and Block modules. Since those structures can // change, we need to simulate our own in here. $items['menu-test'] = array( 'title' => 'Menu test root', 'page callback' => 'node_page_default', 'access arguments' => array('access content'), ); $items['menu-test/hidden'] = array( 'title' => 'Hidden test root', 'page callback' => 'node_page_default', 'access arguments' => array('access content'), ); // Hidden tests; one dynamic argument. $items['menu-test/hidden/menu'] = array( 'title' => 'Menus', 'page callback' => 'node_page_default', 'access arguments' => array('access content'), ); $items['menu-test/hidden/menu/list'] = array( 'title' => 'List menus', 'type' => MENU_DEFAULT_LOCAL_TASK, 'weight' => -10, ); $items['menu-test/hidden/menu/add'] = array( 'title' => 'Add menu', 'page callback' => 'node_page_default', 'access arguments' => array('access content'), 'type' => MENU_LOCAL_ACTION, ); $items['menu-test/hidden/menu/settings'] = array( 'title' => 'Settings', 'page callback' => 'node_page_default', 'access arguments' => array('access content'), 'type' => MENU_LOCAL_TASK, 'weight' => 5, ); $items['menu-test/hidden/menu/manage/%menu'] = array( 'title' => 'Customize menu', 'page callback' => 'node_page_default', 'access arguments' => array('access content'), ); $items['menu-test/hidden/menu/manage/%menu/list'] = array( 'title' => 'List links', 'weight' => -10, 'type' => MENU_DEFAULT_LOCAL_TASK, 'context' => MENU_CONTEXT_PAGE | MENU_CONTEXT_INLINE, ); $items['menu-test/hidden/menu/manage/%menu/add'] = array( 'title' => 'Add link', 'page callback' => 'node_page_default', 'access arguments' => array('access content'), 'type' => MENU_LOCAL_ACTION, ); $items['menu-test/hidden/menu/manage/%menu/edit'] = array( 'title' => 'Edit menu', 'page callback' => 'node_page_default', 'access arguments' => array('access content'), 'type' => MENU_LOCAL_TASK, 'context' => MENU_CONTEXT_PAGE | MENU_CONTEXT_INLINE, ); $items['menu-test/hidden/menu/manage/%menu/delete'] = array( 'title' => 'Delete menu', 'page callback' => 'node_page_default', 'access arguments' => array('access content'), ); // Hidden tests; two dynamic arguments. $items['menu-test/hidden/block'] = array( 'title' => 'Blocks', 'page callback' => 'node_page_default', 'access arguments' => array('access content'), ); $items['menu-test/hidden/block/list'] = array( 'title' => 'List', 'type' => MENU_DEFAULT_LOCAL_TASK, 'weight' => -10, ); $items['menu-test/hidden/block/add'] = array( 'title' => 'Add block', 'page callback' => 'node_page_default', 'access arguments' => array('access content'), 'type' => MENU_LOCAL_ACTION, ); $items['menu-test/hidden/block/manage/%/%'] = array( 'title' => 'Configure block', 'page callback' => 'node_page_default', 'access arguments' => array('access content'), ); $items['menu-test/hidden/block/manage/%/%/configure'] = array( 'title' => 'Configure block', 'type' => MENU_DEFAULT_LOCAL_TASK, 'context' => MENU_CONTEXT_INLINE, ); $items['menu-test/hidden/block/manage/%/%/delete'] = array( 'title' => 'Delete block', 'page callback' => 'node_page_default', 'access arguments' => array('access content'), 'type' => MENU_LOCAL_TASK, 'context' => MENU_CONTEXT_NONE, ); // Breadcrumbs tests. // @see MenuBreadcrumbTestCase $base = array( 'page callback' => 'menu_test_callback', 'access callback' => TRUE, ); // Local tasks: Second level below default local task. $items['menu-test/breadcrumb/tasks'] = array( 'title' => 'Breadcrumbs test: Local tasks', ) + $base; $items['menu-test/breadcrumb/tasks/first'] = array( 'title' => 'First', 'type' => MENU_DEFAULT_LOCAL_TASK, ) + $base; $items['menu-test/breadcrumb/tasks/second'] = array( 'title' => 'Second', 'type' => MENU_LOCAL_TASK, ) + $base; $items['menu-test/breadcrumb/tasks/first/first'] = array( 'title' => 'First first', 'type' => MENU_DEFAULT_LOCAL_TASK, ) + $base; $items['menu-test/breadcrumb/tasks/first/second'] = array( 'title' => 'First second', 'type' => MENU_LOCAL_TASK, ) + $base; $items['menu-test/breadcrumb/tasks/second/first'] = array( 'title' => 'Second first', 'type' => MENU_DEFAULT_LOCAL_TASK, ) + $base; $items['menu-test/breadcrumb/tasks/second/second'] = array( 'title' => 'Second second', 'type' => MENU_LOCAL_TASK, ) + $base; // Menu trail tests. // @see MenuTrailTestCase $items['menu-test/menu-trail'] = array( 'title' => 'Menu trail - Case 1', 'page callback' => 'menu_test_menu_trail_callback', 'access arguments' => array('access content'), ); $items['admin/config/development/menu-trail'] = array( 'title' => 'Menu trail - Case 2', 'description' => 'Tests menu_tree_set_path()', 'page callback' => 'menu_test_menu_trail_callback', 'access arguments' => array('access administration pages'), ); $items['menu-test/custom-403-page'] = array( 'title' => 'Custom 403 page', 'page callback' => 'menu_test_custom_403_404_callback', 'access arguments' => array('access content'), ); $items['menu-test/custom-404-page'] = array( 'title' => 'Custom 404 page', 'page callback' => 'menu_test_custom_403_404_callback', 'access arguments' => array('access content'), ); // File inheritance tests. This menu item should inherit the page callback // system_admin_menu_block_page() and therefore render its children as links // on the page. $items['admin/config/development/file-inheritance'] = array( 'title' => 'File inheritance', 'description' => 'Test file inheritance', 'access arguments' => array('access content'), ); $items['admin/config/development/file-inheritance/inherit'] = array( 'title' => 'Inherit', 'description' => 'File inheritance test description', 'page callback' => 'menu_test_callback', 'access arguments' => array('access content'), ); $items['menu_login_callback'] = array( 'title' => 'Used as a login path', 'page callback' => 'menu_login_callback', 'access callback' => TRUE, ); $items['menu-title-test/case1'] = array( 'title' => 'Example title - Case 1', 'access callback' => TRUE, 'page callback' => 'menu_test_callback', ); $items['menu-title-test/case2'] = array( 'title' => 'Example @sub1 - Case @op2', // If '2' is not in quotes, the argument becomes arg(2). 'title arguments' => array('@sub1' => 'title', '@op2' => '2'), 'access callback' => TRUE, 'page callback' => 'menu_test_callback', ); $items['menu-title-test/case3'] = array( 'title' => 'Example title', 'title callback' => 'menu_test_title_callback', 'access callback' => TRUE, 'page callback' => 'menu_test_callback', ); $items['menu-title-test/case4'] = array( // Title gets completely ignored. Good thing, too. 'title' => 'Bike sheds full of blue smurfs', 'title callback' => 'menu_test_title_callback', // If '4' is not in quotes, the argument becomes arg(4). 'title arguments' => array('Example title', '4'), 'access callback' => TRUE, 'page callback' => 'menu_test_callback', ); // Load arguments inheritance test. $items['menu-test/arguments/%menu_test_argument/%'] = array( 'title' => 'Load arguments inheritance test', 'load arguments' => array(3), 'page callback' => 'menu_test_callback', 'access callback' => TRUE, ); $items['menu-test/arguments/%menu_test_argument/%/default'] = array( 'title' => 'Default local task', 'type' => MENU_DEFAULT_LOCAL_TASK, ); $items['menu-test/arguments/%menu_test_argument/%/task'] = array( 'title' => 'Local task', 'page callback' => 'menu_test_callback', 'access callback' => TRUE, 'type' => MENU_LOCAL_TASK, ); // For this path, load arguments should be inherited for the first loader only. $items['menu-test/arguments/%menu_test_argument/%menu_test_other_argument/common-loader'] = array( 'title' => 'Local task', 'page callback' => 'menu_test_callback', 'access callback' => TRUE, 'type' => MENU_LOCAL_TASK, ); // For these paths, no load arguments should be inherited. // Not on the same position. $items['menu-test/arguments/%/%menu_test_argument/different-loaders-1'] = array( 'title' => 'An item not sharing the same loader', 'page callback' => 'menu_test_callback', 'access callback' => TRUE, ); // Not the same loader. $items['menu-test/arguments/%menu_test_other_argument/%/different-loaders-2'] = array( 'title' => 'An item not sharing the same loader', 'page callback' => 'menu_test_callback', 'access callback' => TRUE, ); // Not the same loader. $items['menu-test/arguments/%/%/different-loaders-3'] = array( 'title' => 'An item not sharing the same loader', 'page callback' => 'menu_test_callback', 'access callback' => TRUE, ); // Explict load arguments should not be overriden (even if empty). $items['menu-test/arguments/%menu_test_argument/%/explicit-arguments'] = array( 'title' => 'An item defining explicit load arguments', 'load arguments' => array(), 'page callback' => 'menu_test_callback', 'access callback' => TRUE, ); return $items; } /** * Dummy argument loader for hook_menu() to point to. */ function menu_test_argument_load($arg1) { return FALSE; } /** * Dummy argument loader for hook_menu() to point to. */ function menu_test_other_argument_load($arg1) { return FALSE; } /** * Dummy callback for hook_menu() to point to. * * @return * A random string. */ function menu_test_callback() { return 'This is menu_test_callback().'; } /** * Callback that test menu_test_menu_tree_set_path(). */ function menu_test_menu_trail_callback() { $menu_path = variable_get('menu_test_menu_tree_set_path', array()); if (!empty($menu_path)) { menu_tree_set_path($menu_path['menu_name'], $menu_path['path']); } return 'This is menu_test_menu_trail_callback().'; } /** * Implements hook_init(). */ function menu_test_init() { // When requested by one of the MenuTrailTestCase tests, record the initial // active trail during Drupal's bootstrap (before the user is redirected to a // custom 403 or 404 page). See menu_test_custom_403_404_callback(). if (variable_get('menu_test_record_active_trail', FALSE)) { variable_set('menu_test_active_trail_initial', menu_get_active_trail()); } } /** * Callback for our custom 403 and 404 pages. */ function menu_test_custom_403_404_callback() { // When requested by one of the MenuTrailTestCase tests, record the final // active trail now that the user has been redirected to the custom 403 or // 404 page. See menu_test_init(). if (variable_get('menu_test_record_active_trail', FALSE)) { variable_set('menu_test_active_trail_final', menu_get_active_trail()); } return 'This is menu_test_custom_403_404_callback().'; } /** * Page callback to use when testing the theme callback functionality. * * @param $inherited * An optional boolean to set to TRUE when the requested page is intended to * inherit the theme of its parent. * @return * A string describing the requested custom theme and actual theme being used * for the current page request. */ function menu_test_theme_page_callback($inherited = FALSE) { global $theme_key; // Initialize the theme system so that $theme_key will be populated. drupal_theme_initialize(); // Now check both the requested custom theme and the actual theme being used. $custom_theme = menu_get_custom_theme(); $requested_theme = empty($custom_theme) ? 'NONE' : $custom_theme; $output = "Custom theme: $requested_theme. Actual theme: $theme_key."; if ($inherited) { $output .= ' Theme callback inheritance is being tested.'; } return $output; } /** * Theme callback to use when testing the theme callback functionality. * * @param $argument * The argument passed in from the URL. * @return * The name of the custom theme to request for the current page. */ function menu_test_theme_callback($argument) { // Test using the variable administrative theme. if ($argument == 'use-admin-theme') { return variable_get('admin_theme'); } // Test using a theme that exists, but may or may not be enabled. elseif ($argument == 'use-stark-theme') { return 'stark'; } // Test using a theme that does not exist. elseif ($argument == 'use-fake-theme') { return 'fake_theme'; } // For any other value of the URL argument, do not return anything. This // allows us to test that returning nothing from a theme callback function // causes the page to correctly fall back on using the main site theme. } /** * Implement hook_custom_theme(). * * @return * The name of the custom theme to use for the current page. */ function menu_test_custom_theme() { // If an appropriate variable has been set in the database, request the theme // that is stored there. Otherwise, do not attempt to dynamically set the // theme. if ($theme = variable_get('menu_test_hook_custom_theme_name', FALSE)) { return $theme; } } /** * Helper function for the testMenuName() test. Used to change the menu_name * parameter of a menu. * * @param $new_name * If set, will change the menu_name value. * @return * The menu_name value to use. */ function menu_test_menu_name($new_name = '') { static $name = 'original'; if ($new_name) { $name = $new_name; } return $name; } /** * Implements hook_menu_link_insert(). * * @return * A random string. */ function menu_test_menu_link_insert($item) { menu_test_static_variable('insert'); } /** * Implements hook_menu_link_update(). * * @return * A random string. */ function menu_test_menu_link_update($item) { menu_test_static_variable('update'); } /** * Implements hook_menu_link_delete(). * * @return * A random string. */ function menu_test_menu_link_delete($item) { menu_test_static_variable('delete'); } /** * Static function for testing hook results. * * @param $value * The value to set or NULL to return the current value. * @return * A text string for comparison to test assertions. */ function menu_test_static_variable($value = NULL) { static $variable; if (!empty($value)) { $variable = $value; } return $variable; } /** * Implements hook_menu_site_status_alter(). */ function menu_test_menu_site_status_alter(&$menu_site_status, $path) { // Allow access to ?q=menu_login_callback even if in maintenance mode. if ($menu_site_status == MENU_SITE_OFFLINE && $path == 'menu_login_callback') { $menu_site_status = MENU_SITE_ONLINE; } } /** * Menu callback to be used as a login path. */ function menu_login_callback() { return 'This is menu_login_callback().'; } /** * Concatenates a string, by using the t() function and a case number. * * @param $title * Title string. * @param $case_number * The current case number which is tests (defaults to 3). */ function menu_test_title_callback($title, $case_no = 3) { return t($title) . ' - Case ' . $case_no; } drupal-7.41/modules/simpletest/tests/system_project_namespace_test.module0000644000000000000000000000000612611765734026001 0ustar rootroot 'Drupal error handlers', 'description' => 'Performs tests on the Drupal error and exception handler.', 'group' => 'System', ); } function setUp() { parent::setUp('error_test'); } /** * Test the error handler. */ function testErrorHandler() { $error_notice = array( '%type' => 'Notice', '!message' => 'Undefined variable: bananas', '%function' => 'error_test_generate_warnings()', '%file' => drupal_realpath('modules/simpletest/tests/error_test.module'), ); $error_warning = array( '%type' => 'Warning', '!message' => 'Division by zero', '%function' => 'error_test_generate_warnings()', '%file' => drupal_realpath('modules/simpletest/tests/error_test.module'), ); $error_user_notice = array( '%type' => 'User warning', '!message' => 'Drupal is awesome', '%function' => 'error_test_generate_warnings()', '%file' => drupal_realpath('modules/simpletest/tests/error_test.module'), ); // Set error reporting to collect notices. variable_set('error_level', ERROR_REPORTING_DISPLAY_ALL); $this->drupalGet('error-test/generate-warnings'); $this->assertResponse(200, 'Received expected HTTP status code.'); $this->assertErrorMessage($error_notice); $this->assertErrorMessage($error_warning); $this->assertErrorMessage($error_user_notice); // Set error reporting to not collect notices. variable_set('error_level', ERROR_REPORTING_DISPLAY_SOME); $this->drupalGet('error-test/generate-warnings'); $this->assertResponse(200, 'Received expected HTTP status code.'); $this->assertNoErrorMessage($error_notice); $this->assertErrorMessage($error_warning); $this->assertErrorMessage($error_user_notice); // Set error reporting to not show any errors. variable_set('error_level', ERROR_REPORTING_HIDE); $this->drupalGet('error-test/generate-warnings'); $this->assertResponse(200, 'Received expected HTTP status code.'); $this->assertNoErrorMessage($error_notice); $this->assertNoErrorMessage($error_warning); $this->assertNoErrorMessage($error_user_notice); } /** * Test the exception handler. */ function testExceptionHandler() { $error_exception = array( '%type' => 'Exception', '!message' => 'Drupal is awesome', '%function' => 'error_test_trigger_exception()', '%line' => 57, '%file' => drupal_realpath('modules/simpletest/tests/error_test.module'), ); $error_pdo_exception = array( '%type' => 'PDOException', '!message' => 'SELECT * FROM bananas_are_awesome', '%function' => 'error_test_trigger_pdo_exception()', '%line' => 65, '%file' => drupal_realpath('modules/simpletest/tests/error_test.module'), ); $this->drupalGet('error-test/trigger-exception'); $this->assertTrue(strpos($this->drupalGetHeader(':status'), '500 Service unavailable (with message)'), 'Received expected HTTP status line.'); $this->assertErrorMessage($error_exception); $this->drupalGet('error-test/trigger-pdo-exception'); $this->assertTrue(strpos($this->drupalGetHeader(':status'), '500 Service unavailable (with message)'), 'Received expected HTTP status line.'); // We cannot use assertErrorMessage() since the extact error reported // varies from database to database. Check that the SQL string is displayed. $this->assertText($error_pdo_exception['%type'], format_string('Found %type in error page.', $error_pdo_exception)); $this->assertText($error_pdo_exception['!message'], format_string('Found !message in error page.', $error_pdo_exception)); $error_details = format_string('in %function (line ', $error_pdo_exception); $this->assertRaw($error_details, format_string("Found '!message' in error page.", array('!message' => $error_details))); } /** * Helper function: assert that the error message is found. */ function assertErrorMessage(array $error) { $message = t('%type: !message in %function (line ', $error); $this->assertRaw($message, format_string('Found error message: !message.', array('!message' => $message))); } /** * Helper function: assert that the error message is not found. */ function assertNoErrorMessage(array $error) { $message = t('%type: !message in %function (line ', $error); $this->assertNoRaw($message, format_string('Did not find error message: !message.', array('!message' => $message))); } } drupal-7.41/modules/simpletest/tests/form_test.file.inc0000644000000000000000000000263112611765734022066 0ustar rootroot '

                  ', ); $form['button'] = array( '#type' => 'submit', '#value' => t('Save'), '#submit' => array('form_test_load_include_submit'), '#ajax' => array( 'wrapper' => $ajax_wrapper_id, 'method' => 'append', 'callback' => 'form_test_load_include_menu_ajax', ), ); return $form; } /** * Submit callback for the form API file inclusion test forms. */ function form_test_load_include_submit($form, $form_state) { drupal_set_message('Submit callback called.'); } /** * Ajax callback for the file inclusion via menu test. */ function form_test_load_include_menu_ajax($form) { // We don't need to return anything, since #ajax['method'] is 'append', which // does not remove the original #ajax['wrapper'] element, and status messages // are automatically added by the Ajax framework as long as there's a wrapper // element to add them to. return ''; } drupal-7.41/modules/simpletest/tests/form.test0000644000000000000000000026230212611765734020322 0ustar rootroot 'Form element validation', 'description' => 'Tests various form element validation mechanisms.', 'group' => 'Form API', ); } function setUp() { parent::setUp('form_test'); } /** * Check several empty values for required forms elements. * * Carriage returns, tabs, spaces, and unchecked checkbox elements are not * valid content for a required field. * * If the form field is found in form_get_errors() then the test pass. */ function testRequiredFields() { // Originates from http://drupal.org/node/117748 // Sets of empty strings and arrays. $empty_strings = array('""' => "", '"\n"' => "\n", '" "' => " ", '"\t"' => "\t", '" \n\t "' => " \n\t ", '"\n\n\n\n\n"' => "\n\n\n\n\n"); $empty_arrays = array('array()' => array()); $empty_checkbox = array(NULL); $elements['textfield']['element'] = array('#title' => $this->randomName(), '#type' => 'textfield'); $elements['textfield']['empty_values'] = $empty_strings; $elements['password']['element'] = array('#title' => $this->randomName(), '#type' => 'password'); $elements['password']['empty_values'] = $empty_strings; $elements['password_confirm']['element'] = array('#title' => $this->randomName(), '#type' => 'password_confirm'); // Provide empty values for both password fields. foreach ($empty_strings as $key => $value) { $elements['password_confirm']['empty_values'][$key] = array('pass1' => $value, 'pass2' => $value); } $elements['textarea']['element'] = array('#title' => $this->randomName(), '#type' => 'textarea'); $elements['textarea']['empty_values'] = $empty_strings; $elements['radios']['element'] = array('#title' => $this->randomName(), '#type' => 'radios', '#options' => array('' => t('None'), $this->randomName(), $this->randomName(), $this->randomName())); $elements['radios']['empty_values'] = $empty_arrays; $elements['checkbox']['element'] = array('#title' => $this->randomName(), '#type' => 'checkbox', '#required' => TRUE); $elements['checkbox']['empty_values'] = $empty_checkbox; $elements['checkboxes']['element'] = array('#title' => $this->randomName(), '#type' => 'checkboxes', '#options' => array($this->randomName(), $this->randomName(), $this->randomName())); $elements['checkboxes']['empty_values'] = $empty_arrays; $elements['select']['element'] = array('#title' => $this->randomName(), '#type' => 'select', '#options' => array('' => t('None'), $this->randomName(), $this->randomName(), $this->randomName())); $elements['select']['empty_values'] = $empty_strings; $elements['file']['element'] = array('#title' => $this->randomName(), '#type' => 'file'); $elements['file']['empty_values'] = $empty_strings; // Regular expression to find the expected marker on required elements. $required_marker_preg = '@\*@'; // Go through all the elements and all the empty values for them. foreach ($elements as $type => $data) { foreach ($data['empty_values'] as $key => $empty) { foreach (array(TRUE, FALSE) as $required) { $form_id = $this->randomName(); $form = array(); $form_state = form_state_defaults(); form_clear_error(); $form['op'] = array('#type' => 'submit', '#value' => t('Submit')); $element = $data['element']['#title']; $form[$element] = $data['element']; $form[$element]['#required'] = $required; $form_state['input'][$element] = $empty; $form_state['input']['form_id'] = $form_id; $form_state['method'] = 'post'; // The form token CSRF protection should not interfere with this test, // so we bypass it by marking this test form as programmed. $form_state['programmed'] = TRUE; drupal_prepare_form($form_id, $form, $form_state); drupal_process_form($form_id, $form, $form_state); $errors = form_get_errors(); // Form elements of type 'radios' throw all sorts of PHP notices // when you try to render them like this, so we ignore those for // testing the required marker. // @todo Fix this work-around (http://drupal.org/node/588438). $form_output = ($type == 'radios') ? '' : drupal_render($form); if ($required) { // Make sure we have a form error for this element. $this->assertTrue(isset($errors[$element]), "Check empty($key) '$type' field '$element'"); if (!empty($form_output)) { // Make sure the form element is marked as required. $this->assertTrue(preg_match($required_marker_preg, $form_output), "Required '$type' field is marked as required"); } } else { if (!empty($form_output)) { // Make sure the form element is *not* marked as required. $this->assertFalse(preg_match($required_marker_preg, $form_output), "Optional '$type' field is not marked as required"); } if ($type == 'select') { // Select elements are going to have validation errors with empty // input, since those are illegal choices. Just make sure the // error is not "field is required". $this->assertTrue((empty($errors[$element]) || strpos('field is required', $errors[$element]) === FALSE), "Optional '$type' field '$element' is not treated as a required element"); } else { // Make sure there is *no* form error for this element. $this->assertTrue(empty($errors[$element]), "Optional '$type' field '$element' has no errors with empty input"); } } } } } // Clear the expected form error messages so they don't appear as exceptions. drupal_get_messages(); } /** * Tests validation for required checkbox, select, and radio elements. * * Submits a test form containing several types of form elements. The form * is submitted twice, first without values for required fields and then * with values. Each submission is checked for relevant error messages. * * @see form_test_validate_required_form() */ function testRequiredCheckboxesRadio() { $form = $form_state = array(); $form = form_test_validate_required_form($form, $form_state); // Attempt to submit the form with no required fields set. $edit = array(); $this->drupalPost('form-test/validate-required', $edit, 'Submit'); // The only error messages that should appear are the relevant 'required' // messages for each field. $expected = array(); foreach (array('textfield', 'checkboxes', 'select', 'radios') as $key) { $expected[] = t('!name field is required.', array('!name' => $form[$key]['#title'])); } // Check the page for error messages. $errors = $this->xpath('//div[contains(@class, "error")]//li'); foreach ($errors as $error) { $expected_key = array_search($error[0], $expected); // If the error message is not one of the expected messages, fail. if ($expected_key === FALSE) { $this->fail(format_string("Unexpected error message: @error", array('@error' => $error[0]))); } // Remove the expected message from the list once it is found. else { unset($expected[$expected_key]); } } // Fail if any expected messages were not found. foreach ($expected as $not_found) { $this->fail(format_string("Found error message: @error", array('@error' => $not_found))); } // Verify that input elements are still empty. $this->assertFieldByName('textfield', ''); $this->assertNoFieldChecked('edit-checkboxes-foo'); $this->assertNoFieldChecked('edit-checkboxes-bar'); $this->assertOptionSelected('edit-select', ''); $this->assertNoFieldChecked('edit-radios-foo'); $this->assertNoFieldChecked('edit-radios-bar'); $this->assertNoFieldChecked('edit-radios-optional-foo'); $this->assertNoFieldChecked('edit-radios-optional-bar'); $this->assertNoFieldChecked('edit-radios-optional-default-value-false-foo'); $this->assertNoFieldChecked('edit-radios-optional-default-value-false-bar'); // Submit again with required fields set and verify that there are no // error messages. $edit = array( 'textfield' => $this->randomString(), 'checkboxes[foo]' => TRUE, 'select' => 'foo', 'radios' => 'bar', ); $this->drupalPost(NULL, $edit, 'Submit'); $this->assertNoFieldByXpath('//div[contains(@class, "error")]', FALSE, 'No error message is displayed when all required fields are filled.'); $this->assertRaw("The form_test_validate_required_form form was submitted successfully.", 'Validation form submitted successfully.'); } /** * Tests validation for required textfield element without title. * * Submits a test form containing a textfield form elements without title. * The form is submitted twice, first without value for the required field * and then with value. Each submission is checked for relevant error * messages. * * @see form_test_validate_required_form_no_title() */ function testRequiredTextfieldNoTitle() { $form = $form_state = array(); $form = form_test_validate_required_form_no_title($form, $form_state); // Attempt to submit the form with no required field set. $edit = array(); $this->drupalPost('form-test/validate-required-no-title', $edit, 'Submit'); $this->assertNoRaw("The form_test_validate_required_form_no_title form was submitted successfully.", 'Validation form submitted successfully.'); // Check the page for the error class on the textfield. $this->assertFieldByXPath('//input[contains(@class, "error")]', FALSE, 'Error input form element class found.'); // Submit again with required fields set and verify that there are no // error messages. $edit = array( 'textfield' => $this->randomString(), ); $this->drupalPost(NULL, $edit, 'Submit'); $this->assertNoFieldByXpath('//input[contains(@class, "error")]', FALSE, 'No error input form element class found.'); $this->assertRaw("The form_test_validate_required_form_no_title form was submitted successfully.", 'Validation form submitted successfully.'); } /** * Test default value handling for checkboxes. * * @see _form_test_checkbox() */ function testCheckboxProcessing() { // First, try to submit without the required checkbox. $edit = array(); $this->drupalPost('form-test/checkbox', $edit, t('Submit')); $this->assertRaw(t('!name field is required.', array('!name' => 'required_checkbox')), 'A required checkbox is actually mandatory'); // Now try to submit the form correctly. $values = drupal_json_decode($this->drupalPost(NULL, array('required_checkbox' => 1), t('Submit'))); $expected_values = array( 'disabled_checkbox_on' => 'disabled_checkbox_on', 'disabled_checkbox_off' => '', 'checkbox_on' => 'checkbox_on', 'checkbox_off' => '', 'zero_checkbox_on' => '0', 'zero_checkbox_off' => '', ); foreach ($expected_values as $widget => $expected_value) { $this->assertEqual($values[$widget], $expected_value, format_string('Checkbox %widget returns expected value (expected: %expected, got: %value)', array( '%widget' => var_export($widget, TRUE), '%expected' => var_export($expected_value, TRUE), '%value' => var_export($values[$widget], TRUE), ))); } } /** * Tests validation of #type 'select' elements. */ function testSelect() { $form = $form_state = array(); $form = form_test_select($form, $form_state); $error = '!name field is required.'; $this->drupalGet('form-test/select'); // Posting without any values should throw validation errors. $this->drupalPost(NULL, array(), 'Submit'); $this->assertNoText(t($error, array('!name' => $form['select']['#title']))); $this->assertNoText(t($error, array('!name' => $form['select_required']['#title']))); $this->assertNoText(t($error, array('!name' => $form['select_optional']['#title']))); $this->assertNoText(t($error, array('!name' => $form['empty_value']['#title']))); $this->assertNoText(t($error, array('!name' => $form['empty_value_one']['#title']))); $this->assertText(t($error, array('!name' => $form['no_default']['#title']))); $this->assertNoText(t($error, array('!name' => $form['no_default_optional']['#title']))); $this->assertText(t($error, array('!name' => $form['no_default_empty_option']['#title']))); $this->assertNoText(t($error, array('!name' => $form['no_default_empty_option_optional']['#title']))); $this->assertText(t($error, array('!name' => $form['no_default_empty_value']['#title']))); $this->assertText(t($error, array('!name' => $form['no_default_empty_value_one']['#title']))); $this->assertNoText(t($error, array('!name' => $form['no_default_empty_value_optional']['#title']))); $this->assertNoText(t($error, array('!name' => $form['multiple']['#title']))); $this->assertNoText(t($error, array('!name' => $form['multiple_no_default']['#title']))); $this->assertText(t($error, array('!name' => $form['multiple_no_default_required']['#title']))); // Post values for required fields. $edit = array( 'no_default' => 'three', 'no_default_empty_option' => 'three', 'no_default_empty_value' => 'three', 'no_default_empty_value_one' => 'three', 'multiple_no_default_required[]' => 'three', ); $this->drupalPost(NULL, $edit, 'Submit'); $values = drupal_json_decode($this->drupalGetContent()); // Verify expected values. $expected = array( 'select' => 'one', 'empty_value' => 'one', 'empty_value_one' => 'one', 'no_default' => 'three', 'no_default_optional' => 'one', 'no_default_optional_empty_value' => '', 'no_default_empty_option' => 'three', 'no_default_empty_option_optional' => '', 'no_default_empty_value' => 'three', 'no_default_empty_value_one' => 'three', 'no_default_empty_value_optional' => 0, 'multiple' => array('two' => 'two'), 'multiple_no_default' => array(), 'multiple_no_default_required' => array('three' => 'three'), ); foreach ($expected as $key => $value) { $this->assertIdentical($values[$key], $value, format_string('@name: @actual is equal to @expected.', array( '@name' => $key, '@actual' => var_export($values[$key], TRUE), '@expected' => var_export($value, TRUE), ))); } } /** * Test handling of disabled elements. * * @see _form_test_disabled_elements() */ function testDisabledElements() { // Get the raw form in its original state. $form_state = array(); $form = _form_test_disabled_elements(array(), $form_state); // Build a submission that tries to hijack the form by submitting input for // elements that are disabled. $edit = array(); foreach (element_children($form) as $key) { if (isset($form[$key]['#test_hijack_value'])) { if (is_array($form[$key]['#test_hijack_value'])) { foreach ($form[$key]['#test_hijack_value'] as $subkey => $value) { $edit[$key . '[' . $subkey . ']'] = $value; } } else { $edit[$key] = $form[$key]['#test_hijack_value']; } } } // Submit the form with no input, as the browser does for disabled elements, // and fetch the $form_state['values'] that is passed to the submit handler. $this->drupalPost('form-test/disabled-elements', array(), t('Submit')); $returned_values['normal'] = drupal_json_decode($this->content); // Do the same with input, as could happen if JavaScript un-disables an // element. drupalPost() emulates a browser by not submitting input for // disabled elements, so we need to un-disable those elements first. $this->drupalGet('form-test/disabled-elements'); $disabled_elements = array(); foreach ($this->xpath('//*[@disabled]') as $element) { $disabled_elements[] = (string) $element['name']; unset($element['disabled']); } // All the elements should be marked as disabled, including the ones below // the disabled container. $this->assertEqual(count($disabled_elements), 32, 'The correct elements have the disabled property in the HTML code.'); $this->drupalPost(NULL, $edit, t('Submit')); $returned_values['hijacked'] = drupal_json_decode($this->content); // Ensure that the returned values match the form's default values in both // cases. foreach ($returned_values as $type => $values) { $this->assertFormValuesDefault($values, $form); } } /** * Assert that the values submitted to a form matches the default values of the elements. */ function assertFormValuesDefault($values, $form) { foreach (element_children($form) as $key) { if (isset($form[$key]['#default_value'])) { if (isset($form[$key]['#expected_value'])) { $expected_value = $form[$key]['#expected_value']; } else { $expected_value = $form[$key]['#default_value']; } if ($key == 'checkboxes_multiple') { // Checkboxes values are not filtered out. $values[$key] = array_filter($values[$key]); } $this->assertIdentical($expected_value, $values[$key], format_string('Default value for %type: expected %expected, returned %returned.', array('%type' => $key, '%expected' => var_export($expected_value, TRUE), '%returned' => var_export($values[$key], TRUE)))); } // Recurse children. $this->assertFormValuesDefault($values, $form[$key]); } } /** * Verify markup for disabled form elements. * * @see _form_test_disabled_elements() */ function testDisabledMarkup() { $this->drupalGet('form-test/disabled-elements'); $form_state = array(); $form = _form_test_disabled_elements(array(), $form_state); $type_map = array( 'textarea' => 'textarea', 'select' => 'select', 'weight' => 'select', 'date' => 'select', ); foreach ($form as $name => $item) { // Skip special #types. if (!isset($item['#type']) || in_array($item['#type'], array('hidden', 'text_format'))) { continue; } // Setup XPath and CSS class depending on #type. if (in_array($item['#type'], array('image_button', 'button', 'submit'))) { $path = "//!type[contains(@class, :div-class) and @value=:value]"; $class = 'form-button-disabled'; } else { // starts-with() required for checkboxes. $path = "//div[contains(@class, :div-class)]/descendant::!type[starts-with(@name, :name)]"; $class = 'form-disabled'; } // Replace DOM element name in $path according to #type. $type = 'input'; if (isset($type_map[$item['#type']])) { $type = $type_map[$item['#type']]; } $path = strtr($path, array('!type' => $type)); // Verify that the element exists. $element = $this->xpath($path, array( ':name' => check_plain($name), ':div-class' => $class, ':value' => isset($item['#value']) ? $item['#value'] : '', )); $this->assertTrue(isset($element[0]), format_string('Disabled form element class found for #type %type.', array('%type' => $item['#type']))); } // Verify special element #type text-format. $element = $this->xpath('//div[contains(@class, :div-class)]/descendant::textarea[@name=:name]', array( ':name' => 'text_format[value]', ':div-class' => 'form-disabled', )); $this->assertTrue(isset($element[0]), format_string('Disabled form element class found for #type %type.', array('%type' => 'text_format[value]'))); $element = $this->xpath('//div[contains(@class, :div-class)]/descendant::select[@name=:name]', array( ':name' => 'text_format[format]', ':div-class' => 'form-disabled', )); $this->assertTrue(isset($element[0]), format_string('Disabled form element class found for #type %type.', array('%type' => 'text_format[format]'))); } /** * Test Form API protections against input forgery. * * @see _form_test_input_forgery() */ function testInputForgery() { $this->drupalGet('form-test/input-forgery'); $checkbox = $this->xpath('//input[@name="checkboxes[two]"]'); $checkbox[0]['value'] = 'FORGERY'; $this->drupalPost(NULL, array('checkboxes[one]' => TRUE, 'checkboxes[two]' => TRUE), t('Submit')); $this->assertText('An illegal choice has been detected.', 'Input forgery was detected.'); } /** * Tests that submitted values are converted to scalar strings for textfields. */ public function testTextfieldStringValue() { // Check multivalued submissions. $multivalue = array('evil' => 'multivalue', 'not so' => 'good'); $this->checkFormValue('textfield', $multivalue, ''); $this->checkFormValue('password', $multivalue, ''); $this->checkFormValue('textarea', $multivalue, ''); $this->checkFormValue('machine_name', $multivalue, ''); $this->checkFormValue('password_confirm', $multivalue, array('pass1' => '', 'pass2' => '')); // Check integer submissions. $integer = 5; $string = '5'; $this->checkFormValue('textfield', $integer, $string); $this->checkFormValue('password', $integer, $string); $this->checkFormValue('textarea', $integer, $string); $this->checkFormValue('machine_name', $integer, $string); $this->checkFormValue('password_confirm', array('pass1' => $integer, 'pass2' => $integer), array('pass1' => $string, 'pass2' => $string)); // Check that invalid array keys are ignored for password confirm elements. $this->checkFormValue('password_confirm', array('pass1' => 'test', 'pass2' => 'test', 'extra' => 'invalid'), array('pass1' => 'test', 'pass2' => 'test')); } /** * Checks that a given form input value is sanitized to the expected result. * * @param string $element_type * The form element type. Example: textfield. * @param mixed $input_value * The submitted user input value for the form element. * @param mixed $expected_value * The sanitized result value in the form state after calling * form_builder(). */ protected function checkFormValue($element_type, $input_value, $expected_value) { $form_id = $this->randomName(); $form = array(); $form_state = form_state_defaults(); $form['op'] = array('#type' => 'submit', '#value' => t('Submit')); $form[$element_type] = array( '#type' => $element_type, '#title' => 'test', ); $form_state['input'][$element_type] = $input_value; $form_state['input']['form_id'] = $form_id; $form_state['method'] = 'post'; $form_state['values'] = array(); drupal_prepare_form($form_id, $form, $form_state); // This is the main function we want to test: it is responsible for // populating user supplied $form_state['input'] to sanitized // $form_state['values']. form_builder($form_id, $form, $form_state); $this->assertIdentical($form_state['values'][$element_type], $expected_value, format_string('Form submission for the "@element_type" element type has been correctly sanitized.', array('@element_type' => $element_type))); } } /** * Tests building and processing of core form elements. */ class FormElementTestCase extends DrupalWebTestCase { protected $profile = 'testing'; public static function getInfo() { return array( 'name' => 'Element processing', 'description' => 'Tests building and processing of core form elements.', 'group' => 'Form API', ); } function setUp() { parent::setUp(array('form_test')); } /** * Tests expansion of #options for #type checkboxes and radios. */ function testOptions() { $this->drupalGet('form-test/checkboxes-radios'); // Verify that all options appear in their defined order. foreach (array('checkbox', 'radio') as $type) { $elements = $this->xpath('//input[@type=:type]', array(':type' => $type)); $expected_values = array('0', 'foo', '1', 'bar', '>'); foreach ($elements as $element) { $expected = array_shift($expected_values); $this->assertIdentical((string) $element['value'], $expected); } } // Enable customized option sub-elements. $this->drupalGet('form-test/checkboxes-radios/customize'); // Verify that all options appear in their defined order, taking a custom // #weight into account. foreach (array('checkbox', 'radio') as $type) { $elements = $this->xpath('//input[@type=:type]', array(':type' => $type)); $expected_values = array('0', 'foo', 'bar', '>', '1'); foreach ($elements as $element) { $expected = array_shift($expected_values); $this->assertIdentical((string) $element['value'], $expected); } } // Verify that custom #description properties are output. foreach (array('checkboxes', 'radios') as $type) { $elements = $this->xpath('//input[@id=:id]/following-sibling::div[@class=:class]', array( ':id' => 'edit-' . $type . '-foo', ':class' => 'description', )); $this->assertTrue(count($elements), format_string('Custom %type option description found.', array( '%type' => $type, ))); } } } /** * Test form alter hooks. */ class FormAlterTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Form alter hooks', 'description' => 'Tests hook_form_alter() and hook_form_FORM_ID_alter().', 'group' => 'Form API', ); } function setUp() { parent::setUp('form_test'); } /** * Tests execution order of hook_form_alter() and hook_form_FORM_ID_alter(). */ function testExecutionOrder() { $this->drupalGet('form-test/alter'); // Ensure that the order is first by module, then for a given module, the // id-specific one after the generic one. $expected = array( 'block_form_form_test_alter_form_alter() executed.', 'form_test_form_alter() executed.', 'form_test_form_form_test_alter_form_alter() executed.', 'system_form_form_test_alter_form_alter() executed.', ); $content = preg_replace('/\s+/', ' ', filter_xss($this->content, array())); $this->assert(strpos($content, implode(' ', $expected)) !== FALSE, 'Form alter hooks executed in the expected order.'); } } /** * Test form validation handlers. */ class FormValidationTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Form validation handlers', 'description' => 'Tests form processing and alteration via form validation handlers.', 'group' => 'Form API', ); } function setUp() { parent::setUp('form_test'); } /** * Tests form alterations by #element_validate, #validate, and form_set_value(). */ function testValidate() { $this->drupalGet('form-test/validate'); // Verify that #element_validate handlers can alter the form and submitted // form values. $edit = array( 'name' => 'element_validate', ); $this->drupalPost(NULL, $edit, 'Save'); $this->assertFieldByName('name', '#value changed by #element_validate', 'Form element #value was altered.'); $this->assertText('Name value: value changed by form_set_value() in #element_validate', 'Form element value in $form_state was altered.'); // Verify that #validate handlers can alter the form and submitted // form values. $edit = array( 'name' => 'validate', ); $this->drupalPost(NULL, $edit, 'Save'); $this->assertFieldByName('name', '#value changed by #validate', 'Form element #value was altered.'); $this->assertText('Name value: value changed by form_set_value() in #validate', 'Form element value in $form_state was altered.'); // Verify that #element_validate handlers can make form elements // inaccessible, but values persist. $edit = array( 'name' => 'element_validate_access', ); $this->drupalPost(NULL, $edit, 'Save'); $this->assertNoFieldByName('name', 'Form element was hidden.'); $this->assertText('Name value: element_validate_access', 'Value for inaccessible form element exists.'); // Verify that value for inaccessible form element persists. $this->drupalPost(NULL, array(), 'Save'); $this->assertNoFieldByName('name', 'Form element was hidden.'); $this->assertText('Name value: element_validate_access', 'Value for inaccessible form element exists.'); // Verify that #validate handlers don't run if the CSRF token is invalid. $this->drupalLogin($this->drupalCreateUser()); $this->drupalGet('form-test/validate'); $edit = array( 'name' => 'validate', 'form_token' => 'invalid token' ); $this->drupalPost(NULL, $edit, 'Save'); $this->assertNoFieldByName('name', '#value changed by #validate', 'Form element #value was not altered.'); $this->assertNoText('Name value: value changed by form_set_value() in #validate', 'Form element value in $form_state was not altered.'); $this->assertText('The form has become outdated. Copy any unsaved work in the form below'); } /** * Tests partial form validation through #limit_validation_errors. */ function testValidateLimitErrors() { $edit = array( 'test' => 'invalid', 'test_numeric_index[0]' => 'invalid', 'test_substring[foo]' => 'invalid', ); $path = 'form-test/limit-validation-errors'; // Submit the form by pressing the 'Partial validate' button (uses // #limit_validation_errors) and ensure that the title field is not // validated, but the #element_validate handler for the 'test' field // is triggered. $this->drupalPost($path, $edit, t('Partial validate')); $this->assertNoText(t('!name field is required.', array('!name' => 'Title'))); $this->assertText('Test element is invalid'); // Edge case of #limit_validation_errors containing numeric indexes: same // thing with the 'Partial validate (numeric index)' button and the // 'test_numeric_index' field. $this->drupalPost($path, $edit, t('Partial validate (numeric index)')); $this->assertNoText(t('!name field is required.', array('!name' => 'Title'))); $this->assertText('Test (numeric index) element is invalid'); // Ensure something like 'foobar' isn't considered "inside" 'foo'. $this->drupalPost($path, $edit, t('Partial validate (substring)')); $this->assertNoText(t('!name field is required.', array('!name' => 'Title'))); $this->assertText('Test (substring) foo element is invalid'); // Ensure not validated values are not available to submit handlers. $this->drupalPost($path, array('title' => '', 'test' => 'valid'), t('Partial validate')); $this->assertText('Only validated values appear in the form values.'); // Now test full form validation and ensure that the #element_validate // handler is still triggered. $this->drupalPost($path, $edit, t('Full validate')); $this->assertText(t('!name field is required.', array('!name' => 'Title'))); $this->assertText('Test element is invalid'); } /** * Tests error border of multiple fields with same name in a page. */ function testMultiFormSameNameErrorClass() { $this->drupalGet('form-test/double-form'); $edit = array(); $this->drupalPost(NULL, $edit, t('Save')); $this->assertFieldByXpath('//input[@id="edit-name" and contains(@class, "error")]', NULL, 'Error input form element class found for first element.'); $this->assertNoFieldByXpath('//input[@id="edit-name--2" and contains(@class, "error")]', NULL, 'No error input form element class found for second element.'); } } /** * Test form element labels, required markers and associated output. */ class FormsElementsLabelsTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Form element and label output test', 'description' => 'Test form element labels, required markers and associated output.', 'group' => 'Form API', ); } function setUp() { parent::setUp('form_test'); } /** * Test form elements, labels, title attibutes and required marks output * correctly and have the correct label option class if needed. */ function testFormLabels() { $this->drupalGet('form_test/form-labels'); // Check that the checkbox/radio processing is not interfering with // basic placement. $elements = $this->xpath('//input[@id="edit-form-checkboxes-test-third-checkbox"]/following-sibling::label[@for="edit-form-checkboxes-test-third-checkbox" and @class="option"]'); $this->assertTrue(isset($elements[0]), "Label follows field and label option class correct for regular checkboxes."); // Make sure the label is rendered for checkboxes. $elements = $this->xpath('//input[@id="edit-form-checkboxes-test-0"]/following-sibling::label[@for="edit-form-checkboxes-test-0" and @class="option"]'); $this->assertTrue(isset($elements[0]), "Label 0 found checkbox."); $elements = $this->xpath('//input[@id="edit-form-radios-test-second-radio"]/following-sibling::label[@for="edit-form-radios-test-second-radio" and @class="option"]'); $this->assertTrue(isset($elements[0]), "Label follows field and label option class correct for regular radios."); // Make sure the label is rendered for radios. $elements = $this->xpath('//input[@id="edit-form-radios-test-0"]/following-sibling::label[@for="edit-form-radios-test-0" and @class="option"]'); $this->assertTrue(isset($elements[0]), "Label 0 found radios."); // Exercise various defaults for checkboxes and modifications to ensure // appropriate override and correct behavior. $elements = $this->xpath('//input[@id="edit-form-checkbox-test"]/following-sibling::label[@for="edit-form-checkbox-test" and @class="option"]'); $this->assertTrue(isset($elements[0]), "Label follows field and label option class correct for a checkbox by default."); // Exercise various defaults for textboxes and modifications to ensure // appropriate override and correct behavior. $elements = $this->xpath('//label[@for="edit-form-textfield-test-title-and-required"]/child::span[@class="form-required"]/parent::*/following-sibling::input[@id="edit-form-textfield-test-title-and-required"]'); $this->assertTrue(isset($elements[0]), "Label precedes textfield, with required marker inside label."); $elements = $this->xpath('//input[@id="edit-form-textfield-test-no-title-required"]/preceding-sibling::label[@for="edit-form-textfield-test-no-title-required"]/span[@class="form-required"]'); $this->assertTrue(isset($elements[0]), "Label tag with required marker precedes required textfield with no title."); $elements = $this->xpath('//input[@id="edit-form-textfield-test-title-invisible"]/preceding-sibling::label[@for="edit-form-textfield-test-title-invisible" and @class="element-invisible"]'); $this->assertTrue(isset($elements[0]), "Label preceding field and label class is element-invisible."); $elements = $this->xpath('//input[@id="edit-form-textfield-test-title"]/preceding-sibling::span[@class="form-required"]'); $this->assertFalse(isset($elements[0]), "No required marker on non-required field."); $elements = $this->xpath('//input[@id="edit-form-textfield-test-title-after"]/following-sibling::label[@for="edit-form-textfield-test-title-after" and @class="option"]'); $this->assertTrue(isset($elements[0]), "Label after field and label option class correct for text field."); $elements = $this->xpath('//label[@for="edit-form-textfield-test-title-no-show"]'); $this->assertFalse(isset($elements[0]), "No label tag when title set not to display."); // Check #field_prefix and #field_suffix placement. $elements = $this->xpath('//span[@class="field-prefix"]/following-sibling::div[@id="edit-form-radios-test"]'); $this->assertTrue(isset($elements[0]), "Properly placed the #field_prefix element after the label and before the field."); $elements = $this->xpath('//span[@class="field-suffix"]/preceding-sibling::div[@id="edit-form-radios-test"]'); $this->assertTrue(isset($elements[0]), "Properly places the #field_suffix element immediately after the form field."); // Check #prefix and #suffix placement. $elements = $this->xpath('//div[@id="form-test-textfield-title-prefix"]/following-sibling::div[contains(@class, \'form-item-form-textfield-test-title\')]'); $this->assertTrue(isset($elements[0]), "Properly places the #prefix element before the form item."); $elements = $this->xpath('//div[@id="form-test-textfield-title-suffix"]/preceding-sibling::div[contains(@class, \'form-item-form-textfield-test-title\')]'); $this->assertTrue(isset($elements[0]), "Properly places the #suffix element before the form item."); // Check title attribute for radios and checkboxes. $elements = $this->xpath('//div[@id="edit-form-checkboxes-title-attribute"]'); $this->assertEqual($elements[0]['title'], 'Checkboxes test' . ' (' . t('Required') . ')', 'Title attribute found.'); $elements = $this->xpath('//div[@id="edit-form-radios-title-attribute"]'); $this->assertEqual($elements[0]['title'], 'Radios test' . ' (' . t('Required') . ')', 'Title attribute found.'); } } /** * Test the tableselect form element for expected behavior. */ class FormsElementsTableSelectFunctionalTest extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Tableselect form element type test', 'description' => 'Test the tableselect element for expected behavior', 'group' => 'Form API', ); } function setUp() { parent::setUp('form_test'); } /** * Test the display of checkboxes when #multiple is TRUE. */ function testMultipleTrue() { $this->drupalGet('form_test/tableselect/multiple-true'); $this->assertNoText(t('Empty text.'), 'Empty text should not be displayed.'); // Test for the presence of the Select all rows tableheader. $this->assertFieldByXPath('//th[@class="select-all"]', NULL, 'Presence of the "Select all" checkbox.'); $rows = array('row1', 'row2', 'row3'); foreach ($rows as $row) { $this->assertFieldByXPath('//input[@type="checkbox"]', $row, format_string('Checkbox for value @row.', array('@row' => $row))); } } /** * Test the display of radios when #multiple is FALSE. */ function testMultipleFalse() { $this->drupalGet('form_test/tableselect/multiple-false'); $this->assertNoText(t('Empty text.'), 'Empty text should not be displayed.'); // Test for the absence of the Select all rows tableheader. $this->assertNoFieldByXPath('//th[@class="select-all"]', '', 'Absence of the "Select all" checkbox.'); $rows = array('row1', 'row2', 'row3'); foreach ($rows as $row) { $this->assertFieldByXPath('//input[@type="radio"]', $row, format_string('Radio button for value @row.', array('@row' => $row))); } } /** * Test the display of the #empty text when #options is an empty array. */ function testEmptyText() { $this->drupalGet('form_test/tableselect/empty-text'); $this->assertText(t('Empty text.'), 'Empty text should be displayed.'); } /** * Test the submission of single and multiple values when #multiple is TRUE. */ function testMultipleTrueSubmit() { // Test a submission with one checkbox checked. $edit = array(); $edit['tableselect[row1]'] = TRUE; $this->drupalPost('form_test/tableselect/multiple-true', $edit, 'Submit'); $this->assertText(t('Submitted: row1 = row1'), 'Checked checkbox row1'); $this->assertText(t('Submitted: row2 = 0'), 'Unchecked checkbox row2.'); $this->assertText(t('Submitted: row3 = 0'), 'Unchecked checkbox row3.'); // Test a submission with multiple checkboxes checked. $edit['tableselect[row1]'] = TRUE; $edit['tableselect[row3]'] = TRUE; $this->drupalPost('form_test/tableselect/multiple-true', $edit, 'Submit'); $this->assertText(t('Submitted: row1 = row1'), 'Checked checkbox row1.'); $this->assertText(t('Submitted: row2 = 0'), 'Unchecked checkbox row2.'); $this->assertText(t('Submitted: row3 = row3'), 'Checked checkbox row3.'); } /** * Test submission of values when #multiple is FALSE. */ function testMultipleFalseSubmit() { $edit['tableselect'] = 'row1'; $this->drupalPost('form_test/tableselect/multiple-false', $edit, 'Submit'); $this->assertText(t('Submitted: row1'), 'Selected radio button'); } /** * Test the #js_select property. */ function testAdvancedSelect() { // When #multiple = TRUE a Select all checkbox should be displayed by default. $this->drupalGet('form_test/tableselect/advanced-select/multiple-true-default'); $this->assertFieldByXPath('//th[@class="select-all"]', NULL, 'Display a "Select all" checkbox by default when #multiple is TRUE.'); // When #js_select is set to FALSE, a "Select all" checkbox should not be displayed. $this->drupalGet('form_test/tableselect/advanced-select/multiple-true-no-advanced-select'); $this->assertNoFieldByXPath('//th[@class="select-all"]', NULL, 'Do not display a "Select all" checkbox when #js_select is FALSE.'); // A "Select all" checkbox never makes sense when #multiple = FALSE, regardless of the value of #js_select. $this->drupalGet('form_test/tableselect/advanced-select/multiple-false-default'); $this->assertNoFieldByXPath('//th[@class="select-all"]', NULL, 'Do not display a "Select all" checkbox when #multiple is FALSE.'); $this->drupalGet('form_test/tableselect/advanced-select/multiple-false-advanced-select'); $this->assertNoFieldByXPath('//th[@class="select-all"]', NULL, 'Do not display a "Select all" checkbox when #multiple is FALSE, even when #js_select is TRUE.'); } /** * Test the whether the option checker gives an error on invalid tableselect values for checkboxes. */ function testMultipleTrueOptionchecker() { list($header, $options) = _form_test_tableselect_get_data(); $form['tableselect'] = array( '#type' => 'tableselect', '#header' => $header, '#options' => $options, ); // Test with a valid value. list($processed_form, $form_state, $errors) = $this->formSubmitHelper($form, array('tableselect' => array('row1' => 'row1'))); $this->assertFalse(isset($errors['tableselect']), 'Option checker allows valid values for checkboxes.'); // Test with an invalid value. list($processed_form, $form_state, $errors) = $this->formSubmitHelper($form, array('tableselect' => array('non_existing_value' => 'non_existing_value'))); $this->assertTrue(isset($errors['tableselect']), 'Option checker disallows invalid values for checkboxes.'); } /** * Test the whether the option checker gives an error on invalid tableselect values for radios. */ function testMultipleFalseOptionchecker() { list($header, $options) = _form_test_tableselect_get_data(); $form['tableselect'] = array( '#type' => 'tableselect', '#header' => $header, '#options' => $options, '#multiple' => FALSE, ); // Test with a valid value. list($processed_form, $form_state, $errors) = $this->formSubmitHelper($form, array('tableselect' => 'row1')); $this->assertFalse(isset($errors['tableselect']), 'Option checker allows valid values for radio buttons.'); // Test with an invalid value. list($processed_form, $form_state, $errors) = $this->formSubmitHelper($form, array('tableselect' => 'non_existing_value')); $this->assertTrue(isset($errors['tableselect']), 'Option checker disallows invalid values for radio buttons.'); } /** * Helper function for the option check test to submit a form while collecting errors. * * @param $form_element * A form element to test. * @param $edit * An array containing post data. * * @return * An array containing the processed form, the form_state and any errors. */ private function formSubmitHelper($form, $edit) { $form_id = $this->randomName(); $form_state = form_state_defaults(); $form['op'] = array('#type' => 'submit', '#value' => t('Submit')); $form_state['input'] = $edit; $form_state['input']['form_id'] = $form_id; // The form token CSRF protection should not interfere with this test, // so we bypass it by marking this test form as programmed. $form_state['programmed'] = TRUE; drupal_prepare_form($form_id, $form, $form_state); drupal_process_form($form_id, $form, $form_state); $errors = form_get_errors(); // Clear errors and messages. drupal_get_messages(); form_clear_error(); // Return the processed form together with form_state and errors // to allow the caller lowlevel access to the form. return array($form, $form_state, $errors); } } /** * Test the vertical_tabs form element for expected behavior. */ class FormsElementsVerticalTabsFunctionalTest extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Vertical tabs form element type test', 'description' => 'Test the vertical_tabs element for expected behavior', 'group' => 'Form API', ); } function setUp() { parent::setUp('form_test'); } /** * Ensures that vertical-tabs.js is included before collapse.js. * * Otherwise, collapse.js adds "SHOW" or "HIDE" labels to the tabs. */ function testJavaScriptOrdering() { $this->drupalGet('form_test/vertical-tabs'); $position1 = strpos($this->content, 'misc/vertical-tabs.js'); $position2 = strpos($this->content, 'misc/collapse.js'); $this->assertTrue($position1 !== FALSE && $position2 !== FALSE && $position1 < $position2, 'vertical-tabs.js is included before collapse.js'); } } /** * Test the form storage on a multistep form. * * The tested form puts data into the storage during the initial form * construction. These tests verify that there are no duplicate form * constructions, with and without manual form caching activiated. Furthermore * when a validation error occurs, it makes sure that changed form element * values aren't lost due to a wrong form rebuild. */ class FormsFormStorageTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Multistep form using form storage', 'description' => 'Tests a multistep form using form storage and makes sure validation and caching works right.', 'group' => 'Form API', ); } function setUp() { parent::setUp('form_test'); $this->web_user = $this->drupalCreateUser(array('access content')); $this->drupalLogin($this->web_user); } /** * Tests using the form in a usual way. */ function testForm() { $this->drupalGet('form_test/form-storage'); $this->assertText('Form constructions: 1'); $edit = array('title' => 'new', 'value' => 'value_is_set'); // Use form rebuilding triggered by a submit button. $this->drupalPost(NULL, $edit, 'Continue submit'); $this->assertText('Form constructions: 2'); $this->assertText('Form constructions: 3'); // Reset the form to the values of the storage, using a form rebuild // triggered by button of type button. $this->drupalPost(NULL, array('title' => 'changed'), 'Reset'); $this->assertFieldByName('title', 'new', 'Values have been resetted.'); // After rebuilding, the form has been cached. $this->assertText('Form constructions: 4'); $this->drupalPost(NULL, $edit, 'Save'); $this->assertText('Form constructions: 4'); $this->assertText('Title: new', 'The form storage has stored the values.'); } /** * Tests using the form with an activated $form_state['cache'] property. */ function testFormCached() { $this->drupalGet('form_test/form-storage', array('query' => array('cache' => 1))); $this->assertText('Form constructions: 1'); $edit = array('title' => 'new', 'value' => 'value_is_set'); // Use form rebuilding triggered by a submit button. $this->drupalPost(NULL, $edit, 'Continue submit'); $this->assertText('Form constructions: 2'); // Reset the form to the values of the storage, using a form rebuild // triggered by button of type button. $this->drupalPost(NULL, array('title' => 'changed'), 'Reset'); $this->assertFieldByName('title', 'new', 'Values have been resetted.'); $this->assertText('Form constructions: 3'); $this->drupalPost(NULL, $edit, 'Save'); $this->assertText('Form constructions: 3'); $this->assertText('Title: new', 'The form storage has stored the values.'); } /** * Tests validation when form storage is used. */ function testValidation() { $this->drupalPost('form_test/form-storage', array('title' => '', 'value' => 'value_is_set'), 'Continue submit'); $this->assertPattern('/value_is_set/', 'The input values have been kept.'); } /** * Tests updating cached form storage during form validation. * * If form caching is enabled and a form stores data in the form storage, then * the form storage also has to be updated in case of a validation error in * the form. This test re-uses the existing form for multi-step tests, but * triggers a special #element_validate handler to update the form storage * during form validation, while another, required element in the form * triggers a form validation error. */ function testCachedFormStorageValidation() { // Request the form with 'cache' query parameter to enable form caching. $this->drupalGet('form_test/form-storage', array('query' => array('cache' => 1))); // Skip step 1 of the multi-step form, since the first step copies over // 'title' into form storage, but we want to verify that changes in the form // storage are updated in the cache during form validation. $edit = array('title' => 'foo'); $this->drupalPost(NULL, $edit, 'Continue submit'); // In step 2, trigger a validation error for the required 'title' field, and // post the special 'change_title' value for the 'value' field, which // conditionally invokes the #element_validate handler to update the form // storage. $edit = array('title' => '', 'value' => 'change_title'); $this->drupalPost(NULL, $edit, 'Save'); // At this point, the form storage should contain updated values, but we do // not see them, because the form has not been rebuilt yet due to the // validation error. Post again and verify that the rebuilt form contains // the values of the updated form storage. $this->drupalPost(NULL, array('title' => 'foo', 'value' => 'bar'), 'Save'); $this->assertText("The thing has been changed.", 'The altered form storage value was updated in cache and taken over.'); } /** * Tests a form using form state without using 'storage' to pass data from the * constructor to a submit handler. The data has to persist even when caching * gets activated, what may happen when a modules alter the form and adds * #ajax properties. */ function testFormStatePersist() { // Test the form one time with caching activated and one time without. $run_options = array( array(), array('query' => array('cache' => 1)), ); foreach ($run_options as $options) { $this->drupalPost('form-test/state-persist', array(), t('Submit'), $options); // The submit handler outputs the value in $form_state, assert it's there. $this->assertText('State persisted.'); // Test it again, but first trigger a validation error, then test. $this->drupalPost('form-test/state-persist', array('title' => ''), t('Submit'), $options); $this->assertText(t('!name field is required.', array('!name' => 'title'))); // Submit the form again triggering no validation error. $this->drupalPost(NULL, array('title' => 'foo'), t('Submit'), $options); $this->assertText('State persisted.'); // Now post to the rebuilt form and verify it's still there afterwards. $this->drupalPost(NULL, array('title' => 'bar'), t('Submit'), $options); $this->assertText('State persisted.'); } } /** * Verify that the form build-id remains the same when validation errors * occur on a mutable form. */ function testMutableForm() { // Request the form with 'cache' query parameter to enable form caching. $this->drupalGet('form_test/form-storage', array('query' => array('cache' => 1))); $buildIdFields = $this->xpath('//input[@name="form_build_id"]'); $this->assertEqual(count($buildIdFields), 1, 'One form build id field on the page'); $buildId = (string) $buildIdFields[0]['value']; // Trigger validation error by submitting an empty title. $edit = array('title' => ''); $this->drupalPost(NULL, $edit, 'Continue submit'); // Verify that the build-id did not change. $this->assertFieldByName('form_build_id', $buildId, 'Build id remains the same when form validation fails'); } /** * Verifies that form build-id is regenerated when loading an immutable form * from the cache. */ function testImmutableForm() { // Request the form with 'cache' query parameter to enable form caching. $this->drupalGet('form_test/form-storage', array('query' => array('cache' => 1, 'immutable' => 1))); $buildIdFields = $this->xpath('//input[@name="form_build_id"]'); $this->assertEqual(count($buildIdFields), 1, 'One form build id field on the page'); $buildId = (string) $buildIdFields[0]['value']; // Trigger validation error by submitting an empty title. $edit = array('title' => ''); $this->drupalPost(NULL, $edit, 'Continue submit'); // Verify that the build-id did change. $this->assertNoFieldByName('form_build_id', $buildId, 'Build id changes when form validation fails'); // Retrieve the new build-id. $buildIdFields = $this->xpath('//input[@name="form_build_id"]'); $this->assertEqual(count($buildIdFields), 1, 'One form build id field on the page'); $buildId = (string) $buildIdFields[0]['value']; // Trigger validation error by again submitting an empty title. $edit = array('title' => ''); $this->drupalPost(NULL, $edit, 'Continue submit'); // Verify that the build-id does not change the second time. $this->assertFieldByName('form_build_id', $buildId, 'Build id remains the same when form validation fails subsequently'); } /** * Verify that existing contrib code cannot overwrite immutable form state. */ public function testImmutableFormLegacyProtection() { $this->drupalGet('form_test/form-storage', array('query' => array('cache' => 1, 'immutable' => 1))); $build_id_fields = $this->xpath('//input[@name="form_build_id"]'); $this->assertEqual(count($build_id_fields), 1, 'One form build id field on the page'); $build_id = (string) $build_id_fields[0]['value']; // Try to poison the form cache. $original = $this->drupalGetAJAX('form_test/form-storage-legacy/' . $build_id); $this->assertEqual($original['form']['#build_id_old'], $build_id, 'Original build_id was recorded'); $this->assertNotEqual($original['form']['#build_id'], $build_id, 'New build_id was generated'); // Assert that a watchdog message was logged by form_set_cache. $status = (bool) db_query_range('SELECT 1 FROM {watchdog} WHERE message = :message', 0, 1, array(':message' => 'Form build-id mismatch detected while attempting to store a form in the cache.')); $this->assert($status, 'A watchdog message was logged by form_set_cache'); // Ensure that the form state was not poisoned by the preceeding call. $original = $this->drupalGetAJAX('form_test/form-storage-legacy/' . $build_id); $this->assertEqual($original['form']['#build_id_old'], $build_id, 'Original build_id was recorded'); $this->assertNotEqual($original['form']['#build_id'], $build_id, 'New build_id was generated'); $this->assert(empty($original['form']['#poisoned']), 'Original form structure was preserved'); $this->assert(empty($original['form_state']['poisoned']), 'Original form state was preserved'); } } /** * Test the form storage when page caching for anonymous users is turned on. */ class FormsFormStoragePageCacheTestCase extends DrupalWebTestCase { protected $profile = 'testing'; public static function getInfo() { return array( 'name' => 'Forms using form storage on cached pages', 'description' => 'Tests a form using form storage and makes sure validation and caching works when page caching for anonymous users is turned on.', 'group' => 'Form API', ); } public function setUp() { parent::setUp('form_test'); variable_set('cache', TRUE); } /** * Return the build id of the current form. */ protected function getFormBuildId() { $build_id_fields = $this->xpath('//input[@name="form_build_id"]'); $this->assertEqual(count($build_id_fields), 1, 'One form build id field on the page'); return (string) $build_id_fields[0]['value']; } /** * Build-id is regenerated when validating cached form. */ public function testValidateFormStorageOnCachedPage() { $this->drupalGet('form_test/form-storage-page-cache'); $this->assertEqual($this->drupalGetHeader('X-Drupal-Cache'), 'MISS', 'Page was not cached.'); $this->assertText('No old build id', 'No old build id on the page'); $build_id_initial = $this->getFormBuildId(); // Trigger validation error by submitting an empty title. $edit = array('title' => ''); $this->drupalPost(NULL, $edit, 'Save'); $this->assertText($build_id_initial, 'Old build id on the page'); $build_id_first_validation = $this->getFormBuildId(); $this->assertNotEqual($build_id_initial, $build_id_first_validation, 'Build id changes when form validation fails'); // Trigger validation error by again submitting an empty title. $edit = array('title' => ''); $this->drupalPost(NULL, $edit, 'Save'); $this->assertText('No old build id', 'No old build id on the page'); $build_id_second_validation = $this->getFormBuildId(); $this->assertEqual($build_id_first_validation, $build_id_second_validation, 'Build id remains the same when form validation fails subsequently'); // Repeat the test sequence but this time with a page loaded from the cache. $this->drupalGet('form_test/form-storage-page-cache'); $this->assertEqual($this->drupalGetHeader('X-Drupal-Cache'), 'HIT', 'Page was cached.'); $this->assertText('No old build id', 'No old build id on the page'); $build_id_from_cache_initial = $this->getFormBuildId(); $this->assertEqual($build_id_initial, $build_id_from_cache_initial, 'Build id is the same as on the first request'); // Trigger validation error by submitting an empty title. $edit = array('title' => ''); $this->drupalPost(NULL, $edit, 'Save'); $this->assertText($build_id_initial, 'Old build id is initial build id'); $build_id_from_cache_first_validation = $this->getFormBuildId(); $this->assertNotEqual($build_id_initial, $build_id_from_cache_first_validation, 'Build id changes when form validation fails'); $this->assertNotEqual($build_id_first_validation, $build_id_from_cache_first_validation, 'Build id from first user is not reused'); // Trigger validation error by again submitting an empty title. $edit = array('title' => ''); $this->drupalPost(NULL, $edit, 'Save'); $this->assertText('No old build id', 'No old build id on the page'); $build_id_from_cache_second_validation = $this->getFormBuildId(); $this->assertEqual($build_id_from_cache_first_validation, $build_id_from_cache_second_validation, 'Build id remains the same when form validation fails subsequently'); } /** * Build-id is regenerated when rebuilding cached form. */ public function testRebuildFormStorageOnCachedPage() { $this->drupalGet('form_test/form-storage-page-cache'); $this->assertEqual($this->drupalGetHeader('X-Drupal-Cache'), 'MISS', 'Page was not cached.'); $this->assertText('No old build id', 'No old build id on the page'); $build_id_initial = $this->getFormBuildId(); // Trigger rebuild, should regenerate build id. $edit = array('title' => 'something'); $this->drupalPost(NULL, $edit, 'Rebuild'); $this->assertText($build_id_initial, 'Initial build id as old build id on the page'); $build_id_first_rebuild = $this->getFormBuildId(); $this->assertNotEqual($build_id_initial, $build_id_first_rebuild, 'Build id changes on first rebuild.'); // Trigger subsequent rebuild, should regenerate the build id again. $edit = array('title' => 'something'); $this->drupalPost(NULL, $edit, 'Rebuild'); $this->assertText($build_id_first_rebuild, 'First build id as old build id on the page'); $build_id_second_rebuild = $this->getFormBuildId(); $this->assertNotEqual($build_id_first_rebuild, $build_id_second_rebuild, 'Build id changes on second rebuild.'); } } /** * Test wrapper form callbacks. */ class FormsFormWrapperTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Form wrapper callback', 'description' => 'Tests form wrapper callbacks to pass a prebuilt form to form builder functions.', 'group' => 'Form API', ); } function setUp() { parent::setUp('form_test'); } /** * Tests using the form in a usual way. */ function testWrapperCallback() { $this->drupalGet('form_test/wrapper-callback'); $this->assertText('Form wrapper callback element output.', 'The form contains form wrapper elements.'); $this->assertText('Form builder element output.', 'The form contains form builder elements.'); } } /** * Test $form_state clearance. */ class FormStateValuesCleanTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Form state values clearance', 'description' => 'Test proper removal of submitted form values using form_state_values_clean().', 'group' => 'Form API', ); } function setUp() { parent::setUp('form_test'); } /** * Tests form_state_values_clean(). */ function testFormStateValuesClean() { $values = drupal_json_decode($this->drupalPost('form_test/form-state-values-clean', array(), t('Submit'))); // Setup the expected result. $result = array( 'beer' => 1000, 'baz' => array('beer' => 2000), ); // Verify that all internal Form API elements were removed. $this->assertFalse(isset($values['form_id']), format_string('%element was removed.', array('%element' => 'form_id'))); $this->assertFalse(isset($values['form_token']), format_string('%element was removed.', array('%element' => 'form_token'))); $this->assertFalse(isset($values['form_build_id']), format_string('%element was removed.', array('%element' => 'form_build_id'))); $this->assertFalse(isset($values['op']), format_string('%element was removed.', array('%element' => 'op'))); // Verify that all buttons were removed. $this->assertFalse(isset($values['foo']), format_string('%element was removed.', array('%element' => 'foo'))); $this->assertFalse(isset($values['bar']), format_string('%element was removed.', array('%element' => 'bar'))); $this->assertFalse(isset($values['baz']['foo']), format_string('%element was removed.', array('%element' => 'foo'))); $this->assertFalse(isset($values['baz']['baz']), format_string('%element was removed.', array('%element' => 'baz'))); // Verify that nested form value still exists. $this->assertTrue(isset($values['baz']['beer']), 'Nested form value still exists.'); // Verify that actual form values equal resulting form values. $this->assertEqual($values, $result, 'Expected form values equal actual form values.'); } } /** * Tests $form_state clearance with form elements having buttons. */ class FormStateValuesCleanAdvancedTestCase extends DrupalWebTestCase { /** * An image file path for uploading. */ protected $image; public static function getInfo() { return array( 'name' => 'Form state values clearance (advanced)', 'description' => 'Test proper removal of submitted form values using form_state_values_clean() when having forms with elements containing buttons like "managed_file".', 'group' => 'Form API', ); } function setUp() { parent::setUp('form_test'); } /** * Tests form_state_values_clean(). */ function testFormStateValuesCleanAdvanced() { // Get an image for uploading. $image_files = $this->drupalGetTestFiles('image'); $this->image = current($image_files); // Check if the physical file is there. $this->assertTrue(is_file($this->image->uri), "The image file we're going to upload exists."); // "Browse" for the desired file. $edit = array('files[image]' => drupal_realpath($this->image->uri)); // Post the form. $this->drupalPost('form_test/form-state-values-clean-advanced', $edit, t('Submit')); // Expecting a 200 HTTP code. $this->assertResponse(200, 'Received a 200 response for posted test file.'); $this->assertRaw(t('You WIN!'), 'Found the success message.'); } } /** * Tests form rebuilding. * * @todo Add tests for other aspects of form rebuilding. */ class FormsRebuildTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Form rebuilding', 'description' => 'Tests functionality of drupal_rebuild_form().', 'group' => 'Form API', ); } function setUp() { parent::setUp('form_test'); $this->web_user = $this->drupalCreateUser(array('access content')); $this->drupalLogin($this->web_user); } /** * Tests preservation of values. */ function testRebuildPreservesValues() { $edit = array( 'checkbox_1_default_off' => TRUE, 'checkbox_1_default_on' => FALSE, 'text_1' => 'foo', ); $this->drupalPost('form-test/form-rebuild-preserve-values', $edit, 'Add more'); // Verify that initial elements retained their submitted values. $this->assertFieldChecked('edit-checkbox-1-default-off', 'A submitted checked checkbox retained its checked state during a rebuild.'); $this->assertNoFieldChecked('edit-checkbox-1-default-on', 'A submitted unchecked checkbox retained its unchecked state during a rebuild.'); $this->assertFieldById('edit-text-1', 'foo', 'A textfield retained its submitted value during a rebuild.'); // Verify that newly added elements were initialized with their default values. $this->assertFieldChecked('edit-checkbox-2-default-on', 'A newly added checkbox was initialized with a default checked state.'); $this->assertNoFieldChecked('edit-checkbox-2-default-off', 'A newly added checkbox was initialized with a default unchecked state.'); $this->assertFieldById('edit-text-2', 'DEFAULT 2', 'A newly added textfield was initialized with its default value.'); } /** * Tests that a form's action is retained after an Ajax submission. * * The 'action' attribute of a form should not change after an Ajax submission * followed by a non-Ajax submission, which triggers a validation error. */ function testPreserveFormActionAfterAJAX() { // Create a multi-valued field for 'page' nodes to use for Ajax testing. $field_name = 'field_ajax_test'; $field = array( 'field_name' => $field_name, 'type' => 'text', 'cardinality' => FIELD_CARDINALITY_UNLIMITED, ); field_create_field($field); $instance = array( 'field_name' => $field_name, 'entity_type' => 'node', 'bundle' => 'page', ); field_create_instance($instance); // Log in a user who can create 'page' nodes. $this->web_user = $this->drupalCreateUser(array('create page content')); $this->drupalLogin($this->web_user); // Get the form for adding a 'page' node. Submit an "add another item" Ajax // submission and verify it worked by ensuring the updated page has two text // field items in the field for which we just added an item. $this->drupalGet('node/add/page'); $this->drupalPostAJAX(NULL, array(), array('field_ajax_test_add_more' => t('Add another item')), 'system/ajax', array(), array(), 'page-node-form'); $this->assert(count($this->xpath('//div[contains(@class, "field-name-field-ajax-test")]//input[@type="text"]')) == 2, 'AJAX submission succeeded.'); // Submit the form with the non-Ajax "Save" button, leaving the title field // blank to trigger a validation error, and ensure that a validation error // occurred, because this test is for testing what happens when a form is // re-rendered without being re-built, which is what happens when there's // a validation error. $this->drupalPost(NULL, array(), t('Save')); $this->assertText('Title field is required.', 'Non-AJAX submission correctly triggered a validation error.'); // Ensure that the form contains two items in the multi-valued field, so we // know we're testing a form that was correctly retrieved from cache. $this->assert(count($this->xpath('//form[contains(@id, "page-node-form")]//div[contains(@class, "form-item-field-ajax-test")]//input[@type="text"]')) == 2, 'Form retained its state from cache.'); // Ensure that the form's action is correct. $forms = $this->xpath('//form[contains(@class, "node-page-form")]'); $this->assert(count($forms) == 1 && $forms[0]['action'] == url('node/add/page'), 'Re-rendered form contains the correct action value.'); } } /** * Tests form redirection. */ class FormsRedirectTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Form redirecting', 'description' => 'Tests functionality of drupal_redirect_form().', 'group' => 'Form API', ); } function setUp() { parent::setUp(array('form_test')); } /** * Tests form redirection. */ function testRedirect() { $path = 'form-test/redirect'; $options = array('query' => array('foo' => 'bar')); $options['absolute'] = TRUE; // Test basic redirection. $edit = array( 'redirection' => TRUE, 'destination' => $this->randomName(), ); $this->drupalPost($path, $edit, t('Submit')); $this->assertUrl($edit['destination'], array(), 'Basic redirection works.'); // Test without redirection. $edit = array( 'redirection' => FALSE, ); $this->drupalPost($path, $edit, t('Submit')); $this->assertUrl($path, array(), 'When redirect is set to FALSE, there should be no redirection.'); // Test redirection with query parameters. $edit = array( 'redirection' => TRUE, 'destination' => $this->randomName(), ); $this->drupalPost($path, $edit, t('Submit'), $options); $this->assertUrl($edit['destination'], array(), 'Redirection with query parameters works.'); // Test without redirection but with query parameters. $edit = array( 'redirection' => FALSE, ); $this->drupalPost($path, $edit, t('Submit'), $options); $this->assertUrl($path, $options, 'When redirect is set to FALSE, there should be no redirection, and the query parameters should be passed along.'); // Test redirection back to the original path. $edit = array( 'redirection' => TRUE, 'destination' => '', ); $this->drupalPost($path, $edit, t('Submit')); $this->assertUrl($path, array(), 'When using an empty redirection string, there should be no redirection.'); // Test redirection back to the original path with query parameters. $edit = array( 'redirection' => TRUE, 'destination' => '', ); $this->drupalPost($path, $edit, t('Submit'), $options); $this->assertUrl($path, $options, 'When using an empty redirection string, there should be no redirection, and the query parameters should be passed along.'); } } /** * Test the programmatic form submission behavior. */ class FormsProgrammaticTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Programmatic form submissions', 'description' => 'Test the programmatic form submission behavior.', 'group' => 'Form API', ); } function setUp() { parent::setUp('form_test'); } /** * Test the programmatic form submission workflow. */ function testSubmissionWorkflow() { // Backup the current batch status and reset it to avoid conflicts while // processing the dummy form submit handler. $current_batch = $batch =& batch_get(); $batch = array(); // Test that a programmatic form submission is rejected when a required // textfield is omitted and correctly processed when it is provided. $this->submitForm(array(), FALSE); $this->submitForm(array('textfield' => 'test 1'), TRUE); $this->submitForm(array(), FALSE); $this->submitForm(array('textfield' => 'test 2'), TRUE); // Test that a programmatic form submission can turn on and off checkboxes // which are, by default, checked. $this->submitForm(array('textfield' => 'dummy value', 'checkboxes' => array(1 => 1, 2 => 2)), TRUE); $this->submitForm(array('textfield' => 'dummy value', 'checkboxes' => array(1 => 1, 2 => NULL)), TRUE); $this->submitForm(array('textfield' => 'dummy value', 'checkboxes' => array(1 => NULL, 2 => 2)), TRUE); $this->submitForm(array('textfield' => 'dummy value', 'checkboxes' => array(1 => NULL, 2 => NULL)), TRUE); // Test that a programmatic form submission can successfully submit values // even for fields where the #access property is FALSE. $this->submitForm(array('textfield' => 'dummy value', 'textfield_no_access' => 'test value'), TRUE); // Test that #access is respected for programmatic form submissions when // requested to do so. $submitted_values = array('textfield' => 'dummy value', 'textfield_no_access' => 'test value'); $expected_values = array('textfield' => 'dummy value', 'textfield_no_access' => 'default value'); $form_state = array('programmed_bypass_access_check' => FALSE); $this->submitForm($submitted_values, TRUE, $expected_values, $form_state); // Test that a programmatic form submission can correctly click a button // that limits validation errors based on user input. Since we do not // submit any values for "textfield" here and the textfield is required, we // only expect form validation to pass when validation is limited to a // different field. $this->submitForm(array('op' => 'Submit with limited validation', 'field_to_validate' => 'all'), FALSE); $this->submitForm(array('op' => 'Submit with limited validation', 'field_to_validate' => 'textfield'), FALSE); $this->submitForm(array('op' => 'Submit with limited validation', 'field_to_validate' => 'field_to_validate'), TRUE); // Restore the current batch status. $batch = $current_batch; } /** * Helper function used to programmatically submit the form defined in * form_test.module with the given values. * * @param $values * An array of field values to be submitted. * @param $valid_input * A boolean indicating whether or not the form submission is expected to * be valid. * @param $expected_values * (Optional) An array of field values that are expected to be stored by * the form submit handler. If not set, the submitted $values are assumed * to also be the expected stored values. * @param $form_state * (Optional) A keyed array containing the state of the form, to be sent in * the call to drupal_form_submit(). The $values parameter is added to * $form_state['values'] by default, if it is not already set. */ private function submitForm($values, $valid_input, $expected_values = NULL, $form_state = array()) { // Programmatically submit the given values. $form_state += array('values' => $values); drupal_form_submit('form_test_programmatic_form', $form_state); // Check that the form returns an error when expected, and vice versa. $errors = form_get_errors(); $valid_form = empty($errors); $args = array( '%values' => print_r($values, TRUE), '%errors' => $valid_form ? t('None') : implode(' ', $errors), ); $this->assertTrue($valid_input == $valid_form, format_string('Input values: %values
                  Validation handler errors: %errors', $args)); // We check submitted values only if we have a valid input. if ($valid_input) { // By fetching the values from $form_state['storage'] we ensure that the // submission handler was properly executed. $stored_values = $form_state['storage']['programmatic_form_submit']; if (!isset($expected_values)) { $expected_values = $values; } foreach ($expected_values as $key => $value) { $this->assertTrue(isset($stored_values[$key]) && $stored_values[$key] == $value, format_string('Submission handler correctly executed: %stored_key is %stored_value', array('%stored_key' => $key, '%stored_value' => print_r($value, TRUE)))); } } } } /** * Test that FAPI correctly determines $form_state['triggering_element']. */ class FormsTriggeringElementTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Form triggering element determination', 'description' => 'Test the determination of $form_state[\'triggering_element\'].', 'group' => 'Form API', ); } function setUp() { parent::setUp('form_test'); } /** * Test the determination of $form_state['triggering_element'] when no button * information is included in the POST data, as is sometimes the case when * the ENTER key is pressed in a textfield in Internet Explorer. */ function testNoButtonInfoInPost() { $path = 'form-test/clicked-button'; $edit = array(); $form_html_id = 'form-test-clicked-button'; // Ensure submitting a form with no buttons results in no // $form_state['triggering_element'] and the form submit handler not // running. $this->drupalPost($path, $edit, NULL, array(), array(), $form_html_id); $this->assertText('There is no clicked button.', '$form_state[\'triggering_element\'] set to NULL.'); $this->assertNoText('Submit handler for form_test_clicked_button executed.', 'Form submit handler did not execute.'); // Ensure submitting a form with one or more submit buttons results in // $form_state['triggering_element'] being set to the first one the user has // access to. An argument with 'r' in it indicates a restricted // (#access=FALSE) button. $this->drupalPost($path . '/s', $edit, NULL, array(), array(), $form_html_id); $this->assertText('The clicked button is button1.', '$form_state[\'triggering_element\'] set to only button.'); $this->assertText('Submit handler for form_test_clicked_button executed.', 'Form submit handler executed.'); $this->drupalPost($path . '/s/s', $edit, NULL, array(), array(), $form_html_id); $this->assertText('The clicked button is button1.', '$form_state[\'triggering_element\'] set to first button.'); $this->assertText('Submit handler for form_test_clicked_button executed.', 'Form submit handler executed.'); $this->drupalPost($path . '/rs/s', $edit, NULL, array(), array(), $form_html_id); $this->assertText('The clicked button is button2.', '$form_state[\'triggering_element\'] set to first available button.'); $this->assertText('Submit handler for form_test_clicked_button executed.', 'Form submit handler executed.'); // Ensure submitting a form with buttons of different types results in // $form_state['triggering_element'] being set to the first button, // regardless of type. For the FAPI 'button' type, this should result in the // submit handler not executing. The types are 's'(ubmit), 'b'(utton), and // 'i'(mage_button). $this->drupalPost($path . '/s/b/i', $edit, NULL, array(), array(), $form_html_id); $this->assertText('The clicked button is button1.', '$form_state[\'triggering_element\'] set to first button.'); $this->assertText('Submit handler for form_test_clicked_button executed.', 'Form submit handler executed.'); $this->drupalPost($path . '/b/s/i', $edit, NULL, array(), array(), $form_html_id); $this->assertText('The clicked button is button1.', '$form_state[\'triggering_element\'] set to first button.'); $this->assertNoText('Submit handler for form_test_clicked_button executed.', 'Form submit handler did not execute.'); $this->drupalPost($path . '/i/s/b', $edit, NULL, array(), array(), $form_html_id); $this->assertText('The clicked button is button1.', '$form_state[\'triggering_element\'] set to first button.'); $this->assertText('Submit handler for form_test_clicked_button executed.', 'Form submit handler executed.'); } /** * Test that $form_state['triggering_element'] does not get set to a button * with #access=FALSE. */ function testAttemptAccessControlBypass() { $path = 'form-test/clicked-button'; $form_html_id = 'form-test-clicked-button'; // Retrieve a form where 'button1' has #access=FALSE and 'button2' doesn't. $this->drupalGet($path . '/rs/s'); // Submit the form with 'button1=button1' in the POST data, which someone // trying to get around security safeguards could easily do. We have to do // a little trickery here, to work around the safeguards in drupalPost(): by // renaming the text field that is in the form to 'button1', we can get the // data we want into $_POST. $elements = $this->xpath('//form[@id="' . $form_html_id . '"]//input[@name="text"]'); $elements[0]['name'] = 'button1'; $this->drupalPost(NULL, array('button1' => 'button1'), NULL, array(), array(), $form_html_id); // Ensure that $form_state['triggering_element'] was not set to the // restricted button. Do this with both a negative and positive assertion, // because negative assertions alone can be brittle. See // testNoButtonInfoInPost() for why the triggering element gets set to // 'button2'. $this->assertNoText('The clicked button is button1.', '$form_state[\'triggering_element\'] not set to a restricted button.'); $this->assertText('The clicked button is button2.', '$form_state[\'triggering_element\'] not set to a restricted button.'); } } /** * Tests rebuilding of arbitrary forms by altering them. */ class FormsArbitraryRebuildTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Rebuild arbitrary forms', 'description' => 'Tests altering forms to be rebuilt so there are multiple steps.', 'group' => 'Form API', ); } function setUp() { parent::setUp('form_test'); // Auto-create a field for testing. $field = array( 'field_name' => 'test_multiple', 'type' => 'text', 'cardinality' => -1, 'translatable' => FALSE, ); field_create_field($field); $instance = array( 'entity_type' => 'node', 'field_name' => 'test_multiple', 'bundle' => 'page', 'label' => 'Test a multiple valued field', 'widget' => array( 'type' => 'text_textfield', 'weight' => 0, ), ); field_create_instance($instance); variable_set('user_register', USER_REGISTER_VISITORS); } /** * Tests a basic rebuild with the user registration form. */ function testUserRegistrationRebuild() { $edit = array( 'name' => 'foo', 'mail' => 'bar@example.com', ); $this->drupalPost('user/register', $edit, 'Rebuild'); $this->assertText('Form rebuilt.'); $this->assertFieldByName('name', 'foo', 'Entered user name has been kept.'); $this->assertFieldByName('mail', 'bar@example.com', 'Entered mail address has been kept.'); } /** * Tests a rebuild caused by a multiple value field. */ function testUserRegistrationMultipleField() { $edit = array( 'name' => 'foo', 'mail' => 'bar@example.com', ); $this->drupalPost('user/register', $edit, t('Add another item'), array('query' => array('field' => TRUE))); $this->assertText('Test a multiple valued field', 'Form has been rebuilt.'); $this->assertFieldByName('name', 'foo', 'Entered user name has been kept.'); $this->assertFieldByName('mail', 'bar@example.com', 'Entered mail address has been kept.'); } } /** * Tests form API file inclusion. */ class FormsFileInclusionTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Form API file inclusion', 'description' => 'Tests form API file inclusion.', 'group' => 'Form API', ); } function setUp() { parent::setUp('form_test'); } /** * Tests loading an include specified in hook_menu(). */ function testLoadMenuInclude() { $this->drupalPostAJAX('form-test/load-include-menu', array(), array('op' => t('Save')), 'system/ajax', array(), array(), 'form-test-load-include-menu'); $this->assertText('Submit callback called.'); } /** * Tests loading a custom specified inlcude. */ function testLoadCustomInclude() { $this->drupalPost('form-test/load-include-custom', array(), t('Save')); $this->assertText('Submit callback called.'); } } /** * Tests checkbox element. */ class FormCheckboxTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Form API checkbox', 'description' => 'Tests form API checkbox handling of various combinations of #default_value and #return_value.', 'group' => 'Form API', ); } function setUp() { parent::setUp('form_test'); } function testFormCheckbox() { // Ensure that the checked state is determined and rendered correctly for // tricky combinations of default and return values. foreach (array(FALSE, NULL, TRUE, 0, '0', '', 1, '1', 'foobar', '1foobar') as $default_value) { // Only values that can be used for array indeces are supported for // #return_value, with the exception of integer 0, which is not supported. // @see form_process_checkbox(). foreach (array('0', '', 1, '1', 'foobar', '1foobar') as $return_value) { $form_array = drupal_get_form('form_test_checkbox_type_juggling', $default_value, $return_value); $form = drupal_render($form_array); if ($default_value === TRUE) { $checked = TRUE; } elseif ($return_value === '0') { $checked = ($default_value === '0'); } elseif ($return_value === '') { $checked = ($default_value === ''); } elseif ($return_value === 1 || $return_value === '1') { $checked = ($default_value === 1 || $default_value === '1'); } elseif ($return_value === 'foobar') { $checked = ($default_value === 'foobar'); } elseif ($return_value === '1foobar') { $checked = ($default_value === '1foobar'); } $checked_in_html = strpos($form, 'checked') !== FALSE; $message = format_string('#default_value is %default_value #return_value is %return_value.', array('%default_value' => var_export($default_value, TRUE), '%return_value' => var_export($return_value, TRUE))); $this->assertIdentical($checked, $checked_in_html, $message); } } // Ensure that $form_state['values'] is populated correctly for a checkboxes // group that includes a 0-indexed array of options. $results = json_decode($this->drupalPost('form-test/checkboxes-zero', array(), 'Save')); $this->assertIdentical($results->checkbox_off, array(0, 0, 0), 'All three in checkbox_off are zeroes: off.'); $this->assertIdentical($results->checkbox_zero_default, array('0', 0, 0), 'The first choice is on in checkbox_zero_default'); $this->assertIdentical($results->checkbox_string_zero_default, array('0', 0, 0), 'The first choice is on in checkbox_string_zero_default'); $edit = array('checkbox_off[0]' => '0'); $results = json_decode($this->drupalPost('form-test/checkboxes-zero', $edit, 'Save')); $this->assertIdentical($results->checkbox_off, array('0', 0, 0), 'The first choice is on in checkbox_off but the rest is not'); // Ensure that each checkbox is rendered correctly for a checkboxes group // that includes a 0-indexed array of options. $this->drupalPost('form-test/checkboxes-zero/0', array(), 'Save'); $checkboxes = $this->xpath('//input[@type="checkbox"]'); foreach ($checkboxes as $checkbox) { $checked = isset($checkbox['checked']); $name = (string) $checkbox['name']; $this->assertIdentical($checked, $name == 'checkbox_zero_default[0]' || $name == 'checkbox_string_zero_default[0]', format_string('Checkbox %name correctly checked', array('%name' => $name))); } $edit = array('checkbox_off[0]' => '0'); $this->drupalPost('form-test/checkboxes-zero/0', $edit, 'Save'); $checkboxes = $this->xpath('//input[@type="checkbox"]'); foreach ($checkboxes as $checkbox) { $checked = isset($checkbox['checked']); $name = (string) $checkbox['name']; $this->assertIdentical($checked, $name == 'checkbox_off[0]' || $name == 'checkbox_zero_default[0]' || $name == 'checkbox_string_zero_default[0]', format_string('Checkbox %name correctly checked', array('%name' => $name))); } } } /** * Tests uniqueness of generated HTML IDs. */ class HTMLIdTestCase extends DrupalWebTestCase { public static function getInfo() { return array( 'name' => 'Unique HTML IDs', 'description' => 'Tests functionality of drupal_html_id().', 'group' => 'Form API', ); } function setUp() { parent::setUp('form_test'); } /** * Tests that HTML IDs do not get duplicated when form validation fails. */ function testHTMLId() { $this->drupalGet('form-test/double-form'); $this->assertNoDuplicateIds('There are no duplicate IDs'); // Submit second form with empty title. $edit = array(); $this->drupalPost(NULL, $edit, 'Save', array(), array(), 'form-test-html-id--2'); $this->assertNoDuplicateIds('There are no duplicate IDs'); } } drupal-7.41/modules/simpletest/tests/ajax_forms_test.info0000644000000000000000000000041312611767501022506 0ustar rootrootname = "AJAX form test mock module" description = "Test for AJAX form calls." core = 7.x package = Testing version = VERSION hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/update_script_test.info0000644000000000000000000000042312611767501023224 0ustar rootrootname = "Update script test" description = "Support module for update script testing." package = Testing version = VERSION core = 7.x hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/registry.test0000644000000000000000000001124412611765734021224 0ustar rootroot 'Registry parse file test', 'description' => 'Parse a simple file and check that its resources are saved to the database.', 'group' => 'System' ); } function setUp() { $chrs = hash('sha256', microtime() . mt_rand()); $this->fileName = 'registry_test_' . substr($chrs, 0, 16); $this->className = 'registry_test_class' . substr($chrs, 16, 16); $this->interfaceName = 'registry_test_interface' . substr($chrs, 32, 16); parent::setUp(); } /** * testRegistryParseFile */ function testRegistryParseFile() { _registry_parse_file($this->fileName, $this->getFileContents()); foreach (array('className', 'interfaceName') as $resource) { $foundName = db_query('SELECT name FROM {registry} WHERE name = :name', array(':name' => $this->$resource))->fetchField(); $this->assertTrue($this->$resource == $foundName, t('Resource "@resource" found.', array('@resource' => $this->$resource))); } } /** * getFileContents */ function getFileContents() { $file_contents = <<className} {} interface {$this->interfaceName} {} CONTENTS; return $file_contents; } } class RegistryParseFilesTestCase extends DrupalWebTestCase { protected $fileTypes = array('new', 'existing_changed'); public static function getInfo() { return array( 'name' => 'Registry parse files test', 'description' => 'Read two a simple files from disc, and check that their resources are saved to the database.', 'group' => 'System' ); } function setUp() { parent::setUp(); // Create files with some php to parse - one 'new', one 'existing' so // we test all the important code paths in _registry_parse_files. foreach ($this->fileTypes as $fileType) { $chrs = hash('sha256', microtime() . mt_rand()); $this->$fileType = new stdClass(); $this->$fileType->fileName = 'public://registry_test_' . substr($chrs, 0, 16); $this->$fileType->className = 'registry_test_class' . substr($chrs, 16, 16); $this->$fileType->interfaceName = 'registry_test_interface' . substr($chrs, 32, 16); $this->$fileType->contents = $this->getFileContents($fileType); file_save_data($this->$fileType->contents, $this->$fileType->fileName); if ($fileType == 'existing_changed') { // Add a record with an incorrect hash. $this->$fileType->fakeHash = hash('sha256', mt_rand()); db_insert('registry_file') ->fields(array( 'hash' => $this->$fileType->fakeHash, 'filename' => $this->$fileType->fileName, )) ->execute(); // Insert some fake resource records. foreach (array('class', 'interface') as $type) { db_insert('registry') ->fields(array( 'name' => $type . hash('sha256', microtime() . mt_rand()), 'type' => $type, 'filename' => $this->$fileType->fileName, )) ->execute(); } } } } /** * testRegistryParseFiles */ function testRegistryParseFiles() { _registry_parse_files($this->getFiles()); foreach ($this->fileTypes as $fileType) { // Test that we have all the right resources. foreach (array('className', 'interfaceName') as $resource) { $foundName = db_query('SELECT name FROM {registry} WHERE name = :name', array(':name' => $this->$fileType->$resource))->fetchField(); $this->assertTrue($this->$fileType->$resource == $foundName, t('Resource "@resource" found.', array('@resource' => $this->$fileType->$resource))); } // Test that we have the right hash. $hash = db_query('SELECT hash FROM {registry_file} WHERE filename = :filename', array(':filename' => $this->$fileType->fileName))->fetchField(); $this->assertTrue(hash('sha256', $this->$fileType->contents) == $hash, t('sha-256 for "@filename" matched.' . $fileType . $hash, array('@filename' => $this->$fileType->fileName))); } } /** * getFiles */ function getFiles() { $files = array(); foreach ($this->fileTypes as $fileType) { $files[$this->$fileType->fileName] = array('module' => '', 'weight' => 0); if ($fileType == 'existing_changed') { $files[$this->$fileType->fileName]['hash'] = $this->$fileType->fakeHash; } } return $files; } /** * getFileContents */ function getFileContents($fileType) { $file_contents = <<$fileType->className} {} interface {$this->$fileType->interfaceName} {} CONTENTS; return $file_contents; } } drupal-7.41/modules/simpletest/tests/common_test.css0000644000000000000000000000011712611765734021511 0ustar rootroot /* This file is for testing CSS file inclusion, no contents are necessary. */ drupal-7.41/modules/simpletest/tests/url_alter_test.info0000644000000000000000000000042012611767501022344 0ustar rootrootname = Url_alter tests description = A support modules for url_alter hook testing. core = 7.x package = Testing version = VERSION hidden = TRUE ; Information added by Drupal.org packaging script on 2015-10-21 version = "7.41" project = "drupal" datestamp = "1445457729" drupal-7.41/modules/simpletest/tests/graph.test0000644000000000000000000001435112611765734020457 0ustar rootroot 'Graph', 'description' => 'Graph handling unit tests.', 'group' => 'System', ); } function setUp() { require_once DRUPAL_ROOT . '/includes/graph.inc'; parent::setUp(); } /** * Test depth-first-search features. */ function testDepthFirstSearch() { // The sample graph used is: // 1 --> 2 --> 3 5 ---> 6 // | ^ ^ // | | | // | | | // +---> 4 <-- 7 8 ---> 9 $graph = $this->normalizeGraph(array( 1 => array(2), 2 => array(3, 4), 3 => array(), 4 => array(3), 5 => array(6), 7 => array(4, 5), 8 => array(9), 9 => array(), )); drupal_depth_first_search($graph); $expected_paths = array( 1 => array(2, 3, 4), 2 => array(3, 4), 3 => array(), 4 => array(3), 5 => array(6), 7 => array(4, 3, 5, 6), 8 => array(9), 9 => array(), ); $this->assertPaths($graph, $expected_paths); $expected_reverse_paths = array( 1 => array(), 2 => array(1), 3 => array(2, 1, 4, 7), 4 => array(2, 1, 7), 5 => array(7), 7 => array(), 8 => array(), 9 => array(8), ); $this->assertReversePaths($graph, $expected_reverse_paths); // Assert that DFS didn't created "missing" vertexes automatically. $this->assertFALSE(isset($graph[6]), 'Vertex 6 has not been created'); $expected_components = array( array(1, 2, 3, 4, 5, 7), array(8, 9), ); $this->assertComponents($graph, $expected_components); $expected_weights = array( array(1, 2, 3), array(2, 4, 3), array(7, 4, 3), array(7, 5), array(8, 9), ); $this->assertWeights($graph, $expected_weights); } /** * Return a normalized version of a graph. */ function normalizeGraph($graph) { $normalized_graph = array(); foreach ($graph as $vertex => $edges) { // Create vertex even if it hasn't any edges. $normalized_graph[$vertex] = array(); foreach ($edges as $edge) { $normalized_graph[$vertex]['edges'][$edge] = TRUE; } } return $normalized_graph; } /** * Verify expected paths in a graph. * * @param $graph * A graph array processed by drupal_depth_first_search(). * @param $expected_paths * An associative array containing vertices with their expected paths. */ function assertPaths($graph, $expected_paths) { foreach ($expected_paths as $vertex => $paths) { // Build an array with keys = $paths and values = TRUE. $expected = array_fill_keys($paths, TRUE); $result = isset($graph[$vertex]['paths']) ? $graph[$vertex]['paths'] : array(); $this->assertEqual($expected, $result, format_string('Expected paths for vertex @vertex: @expected-paths, got @paths', array('@vertex' => $vertex, '@expected-paths' => $this->displayArray($expected, TRUE), '@paths' => $this->displayArray($result, TRUE)))); } } /** * Verify expected reverse paths in a graph. * * @param $graph * A graph array processed by drupal_depth_first_search(). * @param $expected_reverse_paths * An associative array containing vertices with their expected reverse * paths. */ function assertReversePaths($graph, $expected_reverse_paths) { foreach ($expected_reverse_paths as $vertex => $paths) { // Build an array with keys = $paths and values = TRUE. $expected = array_fill_keys($paths, TRUE); $result = isset($graph[$vertex]['reverse_paths']) ? $graph[$vertex]['reverse_paths'] : array(); $this->assertEqual($expected, $result, format_string('Expected reverse paths for vertex @vertex: @expected-paths, got @paths', array('@vertex' => $vertex, '@expected-paths' => $this->displayArray($expected, TRUE), '@paths' => $this->displayArray($result, TRUE)))); } } /** * Verify expected components in a graph. * * @param $graph * A graph array processed by drupal_depth_first_search(). * @param $expected_components * An array containing of components defined as a list of their vertices. */ function assertComponents($graph, $expected_components) { $unassigned_vertices = array_fill_keys(array_keys($graph), TRUE); foreach ($expected_components as $component) { $result_components = array(); foreach ($component as $vertex) { $result_components[] = $graph[$vertex]['component']; unset($unassigned_vertices[$vertex]); } $this->assertEqual(1, count(array_unique($result_components)), format_string('Expected one unique component for vertices @vertices, got @components', array('@vertices' => $this->displayArray($component), '@components' => $this->displayArray($result_components)))); } $this->assertEqual(array(), $unassigned_vertices, format_string('Vertices not assigned to a component: @vertices', array('@vertices' => $this->displayArray($unassigned_vertices, TRUE)))); } /** * Verify expected order in a graph. * * @param $graph * A graph array processed by drupal_depth_first_search(). * @param $expected_orders * An array containing lists of vertices in their expected order. */ function assertWeights($graph, $expected_orders) { foreach ($expected_orders as $order) { $previous_vertex = array_shift($order); foreach ($order as $vertex) { $this->assertTrue($graph[$previous_vertex]['weight'] < $graph[$vertex]['weight'], format_string('Weights of @previous-vertex and @vertex are correct relative to each other', array('@previous-vertex' => $previous_vertex, '@vertex' => $vertex))); } } } /** * Helper function to output vertices as comma-separated list. * * @param $paths * An array containing a list of vertices. * @param $keys * (optional) Whether to output the keys of $paths instead of the values. */ function displayArray($paths, $keys = FALSE) { if (!empty($paths)) { return implode(', ', $keys ? array_keys($paths) : $paths); } else { return '(empty)'; } } } drupal-7.41/modules/simpletest/tests/unicode.test0000644000000000000000000002561712611765734021013 0ustar rootroot 'Unicode handling', 'description' => 'Tests Drupal Unicode handling.', 'group' => 'System', ); } /** * Test full unicode features implemented using the mbstring extension. */ function testMbStringUnicode() { global $multibyte; // mbstring was not detected on this installation, there is no way to test // multibyte features. Treat that as an exception. if ($multibyte == UNICODE_SINGLEBYTE) { $this->error(t('Unable to test Multibyte features: mbstring extension was not detected.')); } $multibyte = UNICODE_MULTIBYTE; $this->extendedMode = TRUE; $this->pass(t('Testing in mbstring mode')); $this->helperTestStrToLower(); $this->helperTestStrToUpper(); $this->helperTestUcFirst(); $this->helperTestStrLen(); $this->helperTestSubStr(); $this->helperTestTruncate(); } /** * Test emulated unicode features. */ function testEmulatedUnicode() { global $multibyte; $multibyte = UNICODE_SINGLEBYTE; $this->extendedMode = FALSE; $this->pass(t('Testing in emulated (best-effort) mode')); $this->helperTestStrToLower(); $this->helperTestStrToUpper(); $this->helperTestUcFirst(); $this->helperTestStrLen(); $this->helperTestSubStr(); $this->helperTestTruncate(); } function helperTestStrToLower() { $testcase = array( 'tHe QUIcK bRoWn' => 'the quick brown', 'FrançAIS is ÜBER-åwesome' => 'français is über-åwesome', ); if ($this->extendedMode) { $testcase['ΑΒΓΔΕΖΗΘΙΚΛΜΝΞΟΣὨ'] = 'αβγδεζηθικλμνξοσὠ'; } foreach ($testcase as $input => $output) { $this->assertEqual(drupal_strtolower($input), $output, format_string('%input is lowercased as %output', array('%input' => $input, '%output' => $output))); } } function helperTestStrToUpper() { $testcase = array( 'tHe QUIcK bRoWn' => 'THE QUICK BROWN', 'FrançAIS is ÜBER-åwesome' => 'FRANÇAIS IS ÜBER-ÅWESOME', ); if ($this->extendedMode) { $testcase['αβγδεζηθικλμνξοσὠ'] = 'ΑΒΓΔΕΖΗΘΙΚΛΜΝΞΟΣὨ'; } foreach ($testcase as $input => $output) { $this->assertEqual(drupal_strtoupper($input), $output, format_string('%input is uppercased as %output', array('%input' => $input, '%output' => $output))); } } function helperTestUcFirst() { $testcase = array( 'tHe QUIcK bRoWn' => 'THe QUIcK bRoWn', 'françAIS' => 'FrançAIS', 'über' => 'Über', 'åwesome' => 'Åwesome' ); if ($this->extendedMode) { $testcase['σion'] = 'Σion'; } foreach ($testcase as $input => $output) { $this->assertEqual(drupal_ucfirst($input), $output, format_string('%input is ucfirst-ed as %output', array('%input' => $input, '%output' => $output))); } } function helperTestStrLen() { $testcase = array( 'tHe QUIcK bRoWn' => 15, 'ÜBER-åwesome' => 12, ); foreach ($testcase as $input => $output) { $this->assertEqual(drupal_strlen($input), $output, format_string('%input length is %output', array('%input' => $input, '%output' => $output))); } } function helperTestSubStr() { $testcase = array( // 012345678901234567890123 array('frànçAIS is über-åwesome', 0, 0, ''), array('frànçAIS is über-åwesome', 0, 1, 'f'), array('frànçAIS is über-åwesome', 0, 8, 'frànçAIS'), array('frànçAIS is über-åwesome', 0, 23, 'frànçAIS is über-åwesom'), array('frànçAIS is über-åwesome', 0, 24, 'frànçAIS is über-åwesome'), array('frànçAIS is über-åwesome', 0, 25, 'frànçAIS is über-åwesome'), array('frànçAIS is über-åwesome', 0, 100, 'frànçAIS is über-åwesome'), array('frànçAIS is über-åwesome', 4, 4, 'çAIS'), array('frànçAIS is über-åwesome', 1, 0, ''), array('frànçAIS is über-åwesome', 100, 0, ''), array('frànçAIS is über-åwesome', -4, 2, 'so'), array('frànçAIS is über-åwesome', -4, 3, 'som'), array('frànçAIS is über-åwesome', -4, 4, 'some'), array('frànçAIS is über-åwesome', -4, 5, 'some'), array('frànçAIS is über-åwesome', -7, 10, 'åwesome'), array('frànçAIS is über-åwesome', 5, -10, 'AIS is üb'), array('frànçAIS is über-åwesome', 0, -10, 'frànçAIS is üb'), array('frànçAIS is über-åwesome', 0, -1, 'frànçAIS is über-åwesom'), array('frànçAIS is über-åwesome', -7, -2, 'åweso'), array('frànçAIS is über-åwesome', -7, -6, 'å'), array('frànçAIS is über-åwesome', -7, -7, ''), array('frànçAIS is über-åwesome', -7, -8, ''), array('...', 0, 2, '..'), array('以呂波耳・ほへとち。リヌルヲ。', 1, 3, '呂波耳'), ); foreach ($testcase as $test) { list($input, $start, $length, $output) = $test; $result = drupal_substr($input, $start, $length); $this->assertEqual($result, $output, format_string('%input substring at offset %offset for %length characters is %output (got %result)', array('%input' => $input, '%offset' => $start, '%length' => $length, '%output' => $output, '%result' => $result))); } } /** * Test decode_entities(). */ function testDecodeEntities() { $testcase = array( 'Drupal' => 'Drupal', ' drupal-7.41/modules/simpletest/files/html-1.txt0000644000000000000000000000003012611765734020245 0ustar rootroot

                  SimpleTest HTML

                  drupal-7.41/modules/simpletest/files/image-test.gif0000644000000000000000000000026712611765734021144 0ustar rootrootGIF89a(!,(|80 lݵҍԇd gp,E Tl {Q1|ĩ^ޮ`L0er ^`7G{vnoyiV40zk*$ar ;drupal-7.41/modules/simpletest/files/README.txt0000644000000000000000000000036412611765734020112 0ustar rootrootThese files are useful in tests that upload files or otherwise need to manipulate files, in which case they are copied to the files directory as specified in the site settings. Dummy files can also be generated by tests in order to save space. drupal-7.41/modules/simpletest/files/image-test.png0000644000000000000000000000017512611765734021161 0ustar rootrootPNG  IHDR(FDIDATx1 @z4 d%0yRtֆ@7[ x8p@yaIENDB`drupal-7.41/modules/simpletest/files/image-test-transparent-out-of-range.gif0000644000000000000000000000026712611765734026004 0ustar rootrootGIF89a(!,(|80 lݵҍԇd gp,E Tl {Q1|ĩ^ޮ`L0er ^`7G{vnoyiV40zk*$ar ;drupal-7.41/modules/simpletest/files/html-2.html0000644000000000000000000000003012611765734020373 0ustar rootroot

                  SimpleTest HTML

                  drupal-7.41/modules/simpletest/files/php-1.txt0000644000000000000000000000005712611765734020101 0ustar rootroot drupal-7.41/modules/simpletest/files/sql-1.txt0000644000000000000000000000005112611765734020103 0ustar rootrootSELECT invalid_field FROM {invalid_table}drupal-7.41/modules/simpletest/files/javascript-2.script0000644000000000000000000000007112611765734022142 0ustar rootrootdrupal-7.41/modules/simpletest/files/image-2.jpg0000644000000000000000000000344712611765734020344 0ustar rootrootJFIFHHC   %# , #&')*)-0-(0%()(C   (((((((((((((((((((((((((((((((((((((((((((((((((((<P"8!1AQaq"#2B4Cb#!1"A4a ?E |US az>4~LS A:!b\%g8sЬTf`8S Wǂˆ#:!1rOp1  fAwfµr˶䒖Z@Ȏ:۪ᖤB9I\QbMC Yqaq~*1@jϳzheycbe .جZiҸ0 H鷎{?5JH3#r$N@Datq,pF K>2Ű32zAp@iDU. }xP5Dzs!PsN;km|ƅcs&VI:%92!|F"p]0GjUφF?}ctQ5Tj ƠU:cQsb]':u0M pE&NDgf_oN ZTGީif}Q].")̢|Ct t;m}|Έ8)Yi+bhnAd|ƌad</9fR?sK^%BS \rtt5+(x1klLr\YMi vupA<zXjj'$.1Ч_/uxk֖3n2GQ7 .yzTFrD3 l}B DMw ƚ}[ymQ$QH F7 `ȗX@ӂH3~Q>AJ] c軳S6?ԺCԿ tIp:fRA-\UAS$?v2gFq;tnwo zDNVU.Ĝw }l.~$RV0#n޸37;|7 \ R+xiKut Edn9x4sOc f|_~GF2TP<[o zx"2]䨅,SSͦgg5–EtIp]#؝0OnUUwo1wG.~l D %$G 0, '#fail' => 0, '#exception' => 0, '#debug' => 0, ); /** * Assertions thrown in that test case. * * @var Array */ protected $assertions = array(); /** * This class is skipped when looking for the source of an assertion. * * When displaying which function an assert comes from, it's not too useful * to see "drupalWebTestCase->drupalLogin()', we would like to see the test * that called it. So we need to skip the classes defining these helper * methods. */ protected $skipClasses = array(__CLASS__ => TRUE); /** * Flag to indicate whether the test has been set up. * * The setUp() method isolates the test from the parent Drupal site by * creating a random prefix for the database and setting up a clean file * storage directory. The tearDown() method then cleans up this test * environment. We must ensure that setUp() has been run. Otherwise, * tearDown() will act on the parent Drupal site rather than the test * environment, destroying live data. */ protected $setup = FALSE; protected $setupDatabasePrefix = FALSE; protected $setupEnvironment = FALSE; /** * Constructor for DrupalTestCase. * * @param $test_id * Tests with the same id are reported together. */ public function __construct($test_id = NULL) { $this->testId = $test_id; } /** * Internal helper: stores the assert. * * @param $status * Can be 'pass', 'fail', 'exception'. * TRUE is a synonym for 'pass', FALSE for 'fail'. * @param $message * The message string. * @param $group * Which group this assert belongs to. * @param $caller * By default, the assert comes from a function whose name starts with * 'test'. Instead, you can specify where this assert originates from * by passing in an associative array as $caller. Key 'file' is * the name of the source file, 'line' is the line number and 'function' * is the caller function itself. */ protected function assert($status, $message = '', $group = 'Other', array $caller = NULL) { // Convert boolean status to string status. if (is_bool($status)) { $status = $status ? 'pass' : 'fail'; } // Increment summary result counter. $this->results['#' . $status]++; // Get the function information about the call to the assertion method. if (!$caller) { $caller = $this->getAssertionCall(); } // Creation assertion array that can be displayed while tests are running. $this->assertions[] = $assertion = array( 'test_id' => $this->testId, 'test_class' => get_class($this), 'status' => $status, 'message' => $message, 'message_group' => $group, 'function' => $caller['function'], 'line' => $caller['line'], 'file' => $caller['file'], ); // Store assertion for display after the test has completed. self::getDatabaseConnection() ->insert('simpletest') ->fields($assertion) ->execute(); // We do not use a ternary operator here to allow a breakpoint on // test failure. if ($status == 'pass') { return TRUE; } else { return FALSE; } } /** * Returns the database connection to the site running Simpletest. * * @return DatabaseConnection * The database connection to use for inserting assertions. */ public static function getDatabaseConnection() { try { $connection = Database::getConnection('default', 'simpletest_original_default'); } catch (DatabaseConnectionNotDefinedException $e) { // If the test was not set up, the simpletest_original_default // connection does not exist. $connection = Database::getConnection('default', 'default'); } return $connection; } /** * Store an assertion from outside the testing context. * * This is useful for inserting assertions that can only be recorded after * the test case has been destroyed, such as PHP fatal errors. The caller * information is not automatically gathered since the caller is most likely * inserting the assertion on behalf of other code. In all other respects * the method behaves just like DrupalTestCase::assert() in terms of storing * the assertion. * * @return * Message ID of the stored assertion. * * @see DrupalTestCase::assert() * @see DrupalTestCase::deleteAssert() */ public static function insertAssert($test_id, $test_class, $status, $message = '', $group = 'Other', array $caller = array()) { // Convert boolean status to string status. if (is_bool($status)) { $status = $status ? 'pass' : 'fail'; } $caller += array( 'function' => t('Unknown'), 'line' => 0, 'file' => t('Unknown'), ); $assertion = array( 'test_id' => $test_id, 'test_class' => $test_class, 'status' => $status, 'message' => $message, 'message_group' => $group, 'function' => $caller['function'], 'line' => $caller['line'], 'file' => $caller['file'], ); return self::getDatabaseConnection() ->insert('simpletest') ->fields($assertion) ->execute(); } /** * Delete an assertion record by message ID. * * @param $message_id * Message ID of the assertion to delete. * @return * TRUE if the assertion was deleted, FALSE otherwise. * * @see DrupalTestCase::insertAssert() */ public static function deleteAssert($message_id) { return (bool) self::getDatabaseConnection() ->delete('simpletest') ->condition('message_id', $message_id) ->execute(); } /** * Cycles through backtrace until the first non-assertion method is found. * * @return * Array representing the true caller. */ protected function getAssertionCall() { $backtrace = debug_backtrace(); // The first element is the call. The second element is the caller. // We skip calls that occurred in one of the methods of our base classes // or in an assertion function. while (($caller = $backtrace[1]) && ((isset($caller['class']) && isset($this->skipClasses[$caller['class']])) || substr($caller['function'], 0, 6) == 'assert')) { // We remove that call. array_shift($backtrace); } return _drupal_get_last_caller($backtrace); } /** * Check to see if a value is not false (not an empty string, 0, NULL, or FALSE). * * @param $value * The value on which the assertion is to be done. * @param $message * The message to display along with the assertion. * @param $group * The type of assertion - examples are "Browser", "PHP". * @return * TRUE if the assertion succeeded, FALSE otherwise. */ protected function assertTrue($value, $message = '', $group = 'Other') { return $this->assert((bool) $value, $message ? $message : t('Value @value is TRUE.', array('@value' => var_export($value, TRUE))), $group); } /** * Check to see if a value is false (an empty string, 0, NULL, or FALSE). * * @param $value * The value on which the assertion is to be done. * @param $message * The message to display along with the assertion. * @param $group * The type of assertion - examples are "Browser", "PHP". * @return * TRUE if the assertion succeeded, FALSE otherwise. */ protected function assertFalse($value, $message = '', $group = 'Other') { return $this->assert(!$value, $message ? $message : t('Value @value is FALSE.', array('@value' => var_export($value, TRUE))), $group); } /** * Check to see if a value is NULL. * * @param $value * The value on which the assertion is to be done. * @param $message * The message to display along with the assertion. * @param $group * The type of assertion - examples are "Browser", "PHP". * @return * TRUE if the assertion succeeded, FALSE otherwise. */ protected function assertNull($value, $message = '', $group = 'Other') { return $this->assert(!isset($value), $message ? $message : t('Value @value is NULL.', array('@value' => var_export($value, TRUE))), $group); } /** * Check to see if a value is not NULL. * * @param $value * The value on which the assertion is to be done. * @param $message * The message to display along with the assertion. * @param $group * The type of assertion - examples are "Browser", "PHP". * @return * TRUE if the assertion succeeded, FALSE otherwise. */ protected function assertNotNull($value, $message = '', $group = 'Other') { return $this->assert(isset($value), $message ? $message : t('Value @value is not NULL.', array('@value' => var_export($value, TRUE))), $group); } /** * Check to see if two values are equal. * * @param $first * The first value to check. * @param $second * The second value to check. * @param $message * The message to display along with the assertion. * @param $group * The type of assertion - examples are "Browser", "PHP". * @return * TRUE if the assertion succeeded, FALSE otherwise. */ protected function assertEqual($first, $second, $message = '', $group = 'Other') { return $this->assert($first == $second, $message ? $message : t('Value @first is equal to value @second.', array('@first' => var_export($first, TRUE), '@second' => var_export($second, TRUE))), $group); } /** * Check to see if two values are not equal. * * @param $first * The first value to check. * @param $second * The second value to check. * @param $message * The message to display along with the assertion. * @param $group * The type of assertion - examples are "Browser", "PHP". * @return * TRUE if the assertion succeeded, FALSE otherwise. */ protected function assertNotEqual($first, $second, $message = '', $group = 'Other') { return $this->assert($first != $second, $message ? $message : t('Value @first is not equal to value @second.', array('@first' => var_export($first, TRUE), '@second' => var_export($second, TRUE))), $group); } /** * Check to see if two values are identical. * * @param $first * The first value to check. * @param $second * The second value to check. * @param $message * The message to display along with the assertion. * @param $group * The type of assertion - examples are "Browser", "PHP". * @return * TRUE if the assertion succeeded, FALSE otherwise. */ protected function assertIdentical($first, $second, $message = '', $group = 'Other') { return $this->assert($first === $second, $message ? $message : t('Value @first is identical to value @second.', array('@first' => var_export($first, TRUE), '@second' => var_export($second, TRUE))), $group); } /** * Check to see if two values are not identical. * * @param $first * The first value to check. * @param $second * The second value to check. * @param $message * The message to display along with the assertion. * @param $group * The type of assertion - examples are "Browser", "PHP". * @return * TRUE if the assertion succeeded, FALSE otherwise. */ protected function assertNotIdentical($first, $second, $message = '', $group = 'Other') { return $this->assert($first !== $second, $message ? $message : t('Value @first is not identical to value @second.', array('@first' => var_export($first, TRUE), '@second' => var_export($second, TRUE))), $group); } /** * Fire an assertion that is always positive. * * @param $message * The message to display along with the assertion. * @param $group * The type of assertion - examples are "Browser", "PHP". * @return * TRUE. */ protected function pass($message = NULL, $group = 'Other') { return $this->assert(TRUE, $message, $group); } /** * Fire an assertion that is always negative. * * @param $message * The message to display along with the assertion. * @param $group * The type of assertion - examples are "Browser", "PHP". * @return * FALSE. */ protected function fail($message = NULL, $group = 'Other') { return $this->assert(FALSE, $message, $group); } /** * Fire an error assertion. * * @param $message * The message to display along with the assertion. * @param $group * The type of assertion - examples are "Browser", "PHP". * @param $caller * The caller of the error. * @return * FALSE. */ protected function error($message = '', $group = 'Other', array $caller = NULL) { if ($group == 'User notice') { // Since 'User notice' is set by trigger_error() which is used for debug // set the message to a status of 'debug'. return $this->assert('debug', $message, 'Debug', $caller); } return $this->assert('exception', $message, $group, $caller); } /** * Logs a verbose message in a text file. * * The link to the verbose message will be placed in the test results as a * passing assertion with the text '[verbose message]'. * * @param $message * The verbose message to be stored. * * @see simpletest_verbose() */ protected function verbose($message) { if ($id = simpletest_verbose($message)) { $class_safe = str_replace('\\', '_', get_class($this)); $url = file_create_url($this->originalFileDirectory . '/simpletest/verbose/' . $class_safe . '-' . $id . '.html'); $this->error(l(t('Verbose message'), $url, array('attributes' => array('target' => '_blank'))), 'User notice'); } } /** * Run all tests in this class. * * Regardless of whether $methods are passed or not, only method names * starting with "test" are executed. * * @param $methods * (optional) A list of method names in the test case class to run; e.g., * array('testFoo', 'testBar'). By default, all methods of the class are * taken into account, but it can be useful to only run a few selected test * methods during debugging. */ public function run(array $methods = array()) { // Initialize verbose debugging. $class = get_class($this); simpletest_verbose(NULL, variable_get('file_public_path', conf_path() . '/files'), str_replace('\\', '_', $class)); // HTTP auth settings (:) for the simpletest browser // when sending requests to the test site. $this->httpauth_method = variable_get('simpletest_httpauth_method', CURLAUTH_BASIC); $username = variable_get('simpletest_httpauth_username', NULL); $password = variable_get('simpletest_httpauth_password', NULL); if ($username && $password) { $this->httpauth_credentials = $username . ':' . $password; } set_error_handler(array($this, 'errorHandler')); // Iterate through all the methods in this class, unless a specific list of // methods to run was passed. $class_methods = get_class_methods($class); if ($methods) { $class_methods = array_intersect($class_methods, $methods); } foreach ($class_methods as $method) { // If the current method starts with "test", run it - it's a test. if (strtolower(substr($method, 0, 4)) == 'test') { // Insert a fail record. This will be deleted on completion to ensure // that testing completed. $method_info = new ReflectionMethod($class, $method); $caller = array( 'file' => $method_info->getFileName(), 'line' => $method_info->getStartLine(), 'function' => $class . '->' . $method . '()', ); $completion_check_id = DrupalTestCase::insertAssert($this->testId, $class, FALSE, t('The test did not complete due to a fatal error.'), 'Completion check', $caller); $this->setUp(); if ($this->setup) { try { $this->$method(); // Finish up. } catch (Exception $e) { $this->exceptionHandler($e); } $this->tearDown(); } else { $this->fail(t("The test cannot be executed because it has not been set up properly.")); } // Remove the completion check record. DrupalTestCase::deleteAssert($completion_check_id); } } // Clear out the error messages and restore error handler. drupal_get_messages(); restore_error_handler(); } /** * Handle errors during test runs. * * Because this is registered in set_error_handler(), it has to be public. * @see set_error_handler */ public function errorHandler($severity, $message, $file = NULL, $line = NULL) { if ($severity & error_reporting()) { $error_map = array( E_STRICT => 'Run-time notice', E_WARNING => 'Warning', E_NOTICE => 'Notice', E_CORE_ERROR => 'Core error', E_CORE_WARNING => 'Core warning', E_USER_ERROR => 'User error', E_USER_WARNING => 'User warning', E_USER_NOTICE => 'User notice', E_RECOVERABLE_ERROR => 'Recoverable error', ); // PHP 5.3 adds new error logging constants. Add these conditionally for // backwards compatibility with PHP 5.2. if (defined('E_DEPRECATED')) { $error_map += array( E_DEPRECATED => 'Deprecated', E_USER_DEPRECATED => 'User deprecated', ); } $backtrace = debug_backtrace(); $this->error($message, $error_map[$severity], _drupal_get_last_caller($backtrace)); } return TRUE; } /** * Handle exceptions. * * @see set_exception_handler */ protected function exceptionHandler($exception) { $backtrace = $exception->getTrace(); // Push on top of the backtrace the call that generated the exception. array_unshift($backtrace, array( 'line' => $exception->getLine(), 'file' => $exception->getFile(), )); require_once DRUPAL_ROOT . '/includes/errors.inc'; // The exception message is run through check_plain() by _drupal_decode_exception(). $this->error(t('%type: !message in %function (line %line of %file).', _drupal_decode_exception($exception)), 'Uncaught exception', _drupal_get_last_caller($backtrace)); } /** * Generates a random string of ASCII characters of codes 32 to 126. * * The generated string includes alpha-numeric characters and common * miscellaneous characters. Use this method when testing general input * where the content is not restricted. * * Do not use this method when special characters are not possible (e.g., in * machine or file names that have already been validated); instead, * use DrupalWebTestCase::randomName(). * * @param $length * Length of random string to generate. * * @return * Randomly generated string. * * @see DrupalWebTestCase::randomName() */ public static function randomString($length = 8) { $str = ''; for ($i = 0; $i < $length; $i++) { $str .= chr(mt_rand(32, 126)); } return $str; } /** * Generates a random string containing letters and numbers. * * The string will always start with a letter. The letters may be upper or * lower case. This method is better for restricted inputs that do not * accept certain characters. For example, when testing input fields that * require machine readable values (i.e. without spaces and non-standard * characters) this method is best. * * Do not use this method when testing unvalidated user input. Instead, use * DrupalWebTestCase::randomString(). * * @param $length * Length of random string to generate. * * @return * Randomly generated string. * * @see DrupalWebTestCase::randomString() */ public static function randomName($length = 8) { $values = array_merge(range(65, 90), range(97, 122), range(48, 57)); $max = count($values) - 1; $str = chr(mt_rand(97, 122)); for ($i = 1; $i < $length; $i++) { $str .= chr($values[mt_rand(0, $max)]); } return $str; } /** * Converts a list of possible parameters into a stack of permutations. * * Takes a list of parameters containing possible values, and converts all of * them into a list of items containing every possible permutation. * * Example: * @code * $parameters = array( * 'one' => array(0, 1), * 'two' => array(2, 3), * ); * $permutations = DrupalTestCase::generatePermutations($parameters) * // Result: * $permutations == array( * array('one' => 0, 'two' => 2), * array('one' => 1, 'two' => 2), * array('one' => 0, 'two' => 3), * array('one' => 1, 'two' => 3), * ) * @endcode * * @param $parameters * An associative array of parameters, keyed by parameter name, and whose * values are arrays of parameter values. * * @return * A list of permutations, which is an array of arrays. Each inner array * contains the full list of parameters that have been passed, but with a * single value only. */ public static function generatePermutations($parameters) { $all_permutations = array(array()); foreach ($parameters as $parameter => $values) { $new_permutations = array(); // Iterate over all values of the parameter. foreach ($values as $value) { // Iterate over all existing permutations. foreach ($all_permutations as $permutation) { // Add the new parameter value to existing permutations. $new_permutations[] = $permutation + array($parameter => $value); } } // Replace the old permutations with the new permutations. $all_permutations = $new_permutations; } return $all_permutations; } } /** * Test case for Drupal unit tests. * * These tests can not access the database nor files. Calling any Drupal * function that needs the database will throw exceptions. These include * watchdog(), module_implements(), module_invoke_all() etc. */ class DrupalUnitTestCase extends DrupalTestCase { /** * Constructor for DrupalUnitTestCase. */ function __construct($test_id = NULL) { parent::__construct($test_id); $this->skipClasses[__CLASS__] = TRUE; } /** * Sets up unit test environment. * * Unlike DrupalWebTestCase::setUp(), DrupalUnitTestCase::setUp() does not * install modules because tests are performed without accessing the database. * Any required files must be explicitly included by the child class setUp() * method. */ protected function setUp() { global $conf; // Store necessary current values before switching to the test environment. $this->originalFileDirectory = variable_get('file_public_path', conf_path() . '/files'); // Reset all statics so that test is performed with a clean environment. drupal_static_reset(); // Generate temporary prefixed database to ensure that tests have a clean starting point. $this->databasePrefix = Database::getConnection()->prefixTables('{simpletest' . mt_rand(1000, 1000000) . '}'); // Create test directory. $public_files_directory = $this->originalFileDirectory . '/simpletest/' . substr($this->databasePrefix, 10); file_prepare_directory($public_files_directory, FILE_CREATE_DIRECTORY | FILE_MODIFY_PERMISSIONS); $conf['file_public_path'] = $public_files_directory; // Clone the current connection and replace the current prefix. $connection_info = Database::getConnectionInfo('default'); Database::renameConnection('default', 'simpletest_original_default'); foreach ($connection_info as $target => $value) { $connection_info[$target]['prefix'] = array( 'default' => $value['prefix']['default'] . $this->databasePrefix, ); } Database::addConnectionInfo('default', 'default', $connection_info['default']); // Set user agent to be consistent with web test case. $_SERVER['HTTP_USER_AGENT'] = $this->databasePrefix; // If locale is enabled then t() will try to access the database and // subsequently will fail as the database is not accessible. $module_list = module_list(); if (isset($module_list['locale'])) { // Transform the list into the format expected as input to module_list(). foreach ($module_list as &$module) { $module = array('filename' => drupal_get_filename('module', $module)); } $this->originalModuleList = $module_list; unset($module_list['locale']); module_list(TRUE, FALSE, FALSE, $module_list); } $this->setup = TRUE; } protected function tearDown() { global $conf; // Get back to the original connection. Database::removeConnection('default'); Database::renameConnection('simpletest_original_default', 'default'); $conf['file_public_path'] = $this->originalFileDirectory; // Restore modules if necessary. if (isset($this->originalModuleList)) { module_list(TRUE, FALSE, FALSE, $this->originalModuleList); } } } /** * Test case for typical Drupal tests. */ class DrupalWebTestCase extends DrupalTestCase { /** * The profile to install as a basis for testing. * * @var string */ protected $profile = 'standard'; /** * The URL currently loaded in the internal browser. * * @var string */ protected $url; /** * The handle of the current cURL connection. * * @var resource */ protected $curlHandle; /** * The headers of the page currently loaded in the internal browser. * * @var Array */ protected $headers; /** * The content of the page currently loaded in the internal browser. * * @var string */ protected $content; /** * The content of the page currently loaded in the internal browser (plain text version). * * @var string */ protected $plainTextContent; /** * The value of the Drupal.settings JavaScript variable for the page currently loaded in the internal browser. * * @var Array */ protected $drupalSettings; /** * The parsed version of the page. * * @var SimpleXMLElement */ protected $elements = NULL; /** * The current user logged in using the internal browser. * * @var bool */ protected $loggedInUser = FALSE; /** * The current cookie file used by cURL. * * We do not reuse the cookies in further runs, so we do not need a file * but we still need cookie handling, so we set the jar to NULL. */ protected $cookieFile = NULL; /** * Additional cURL options. * * DrupalWebTestCase itself never sets this but always obeys what is set. */ protected $additionalCurlOptions = array(); /** * The original user, before it was changed to a clean uid = 1 for testing purposes. * * @var object */ protected $originalUser = NULL; /** * The original shutdown handlers array, before it was cleaned for testing purposes. * * @var array */ protected $originalShutdownCallbacks = array(); /** * HTTP authentication method */ protected $httpauth_method = CURLAUTH_BASIC; /** * HTTP authentication credentials (:). */ protected $httpauth_credentials = NULL; /** * The current session name, if available. */ protected $session_name = NULL; /** * The current session ID, if available. */ protected $session_id = NULL; /** * Whether the files were copied to the test files directory. */ protected $generatedTestFiles = FALSE; /** * The number of redirects followed during the handling of a request. */ protected $redirect_count; /** * Constructor for DrupalWebTestCase. */ function __construct($test_id = NULL) { parent::__construct($test_id); $this->skipClasses[__CLASS__] = TRUE; } /** * Get a node from the database based on its title. * * @param $title * A node title, usually generated by $this->randomName(). * @param $reset * (optional) Whether to reset the internal node_load() cache. * * @return * A node object matching $title. */ function drupalGetNodeByTitle($title, $reset = FALSE) { $nodes = node_load_multiple(array(), array('title' => $title), $reset); // Load the first node returned from the database. $returned_node = reset($nodes); return $returned_node; } /** * Creates a node based on default settings. * * @param $settings * An associative array of settings to change from the defaults, keys are * node properties, for example 'title' => 'Hello, world!'. * @return * Created node object. */ protected function drupalCreateNode($settings = array()) { // Populate defaults array. $settings += array( 'body' => array(LANGUAGE_NONE => array(array())), 'title' => $this->randomName(8), 'comment' => 2, 'changed' => REQUEST_TIME, 'moderate' => 0, 'promote' => 0, 'revision' => 1, 'log' => '', 'status' => 1, 'sticky' => 0, 'type' => 'page', 'revisions' => NULL, 'language' => LANGUAGE_NONE, ); // Use the original node's created time for existing nodes. if (isset($settings['created']) && !isset($settings['date'])) { $settings['date'] = format_date($settings['created'], 'custom', 'Y-m-d H:i:s O'); } // If the node's user uid is not specified manually, use the currently // logged in user if available, or else the user running the test. if (!isset($settings['uid'])) { if ($this->loggedInUser) { $settings['uid'] = $this->loggedInUser->uid; } else { global $user; $settings['uid'] = $user->uid; } } // Merge body field value and format separately. $body = array( 'value' => $this->randomName(32), 'format' => filter_default_format(), ); $settings['body'][$settings['language']][0] += $body; $node = (object) $settings; node_save($node); // Small hack to link revisions to our test user. db_update('node_revision') ->fields(array('uid' => $node->uid)) ->condition('vid', $node->vid) ->execute(); return $node; } /** * Creates a custom content type based on default settings. * * @param $settings * An array of settings to change from the defaults. * Example: 'type' => 'foo'. * @return * Created content type. */ protected function drupalCreateContentType($settings = array()) { // Find a non-existent random type name. do { $name = strtolower($this->randomName(8)); } while (node_type_get_type($name)); // Populate defaults array. $defaults = array( 'type' => $name, 'name' => $name, 'base' => 'node_content', 'description' => '', 'help' => '', 'title_label' => 'Title', 'has_title' => 1, ); // Imposed values for a custom type. $forced = array( 'orig_type' => '', 'old_type' => '', 'module' => 'node', 'custom' => 1, 'modified' => 1, 'locked' => 0, ); $type = $forced + $settings + $defaults; $type = (object) $type; $saved_type = node_type_save($type); node_types_rebuild(); menu_rebuild(); node_add_body_field($type); $this->assertEqual($saved_type, SAVED_NEW, t('Created content type %type.', array('%type' => $type->type))); // Reset permissions so that permissions for this content type are available. $this->checkPermissions(array(), TRUE); return $type; } /** * Get a list files that can be used in tests. * * @param $type * File type, possible values: 'binary', 'html', 'image', 'javascript', 'php', 'sql', 'text'. * @param $size * File size in bytes to match. Please check the tests/files folder. * @return * List of files that match filter. */ protected function drupalGetTestFiles($type, $size = NULL) { if (empty($this->generatedTestFiles)) { // Generate binary test files. $lines = array(64, 1024); $count = 0; foreach ($lines as $line) { simpletest_generate_file('binary-' . $count++, 64, $line, 'binary'); } // Generate text test files. $lines = array(16, 256, 1024, 2048, 20480); $count = 0; foreach ($lines as $line) { simpletest_generate_file('text-' . $count++, 64, $line, 'text'); } // Copy other test files from simpletest. $original = drupal_get_path('module', 'simpletest') . '/files'; $files = file_scan_directory($original, '/(html|image|javascript|php|sql)-.*/'); foreach ($files as $file) { file_unmanaged_copy($file->uri, variable_get('file_public_path', conf_path() . '/files')); } $this->generatedTestFiles = TRUE; } $files = array(); // Make sure type is valid. if (in_array($type, array('binary', 'html', 'image', 'javascript', 'php', 'sql', 'text'))) { $files = file_scan_directory('public://', '/' . $type . '\-.*/'); // If size is set then remove any files that are not of that size. if ($size !== NULL) { foreach ($files as $file) { $stats = stat($file->uri); if ($stats['size'] != $size) { unset($files[$file->uri]); } } } } usort($files, array($this, 'drupalCompareFiles')); return $files; } /** * Compare two files based on size and file name. */ protected function drupalCompareFiles($file1, $file2) { $compare_size = filesize($file1->uri) - filesize($file2->uri); if ($compare_size) { // Sort by file size. return $compare_size; } else { // The files were the same size, so sort alphabetically. return strnatcmp($file1->name, $file2->name); } } /** * Create a user with a given set of permissions. * * @param array $permissions * Array of permission names to assign to user. Note that the user always * has the default permissions derived from the "authenticated users" role. * * @return object|false * A fully loaded user object with pass_raw property, or FALSE if account * creation fails. */ protected function drupalCreateUser(array $permissions = array()) { // Create a role with the given permission set, if any. $rid = FALSE; if ($permissions) { $rid = $this->drupalCreateRole($permissions); if (!$rid) { return FALSE; } } // Create a user assigned to that role. $edit = array(); $edit['name'] = $this->randomName(); $edit['mail'] = $edit['name'] . '@example.com'; $edit['pass'] = user_password(); $edit['status'] = 1; if ($rid) { $edit['roles'] = array($rid => $rid); } $account = user_save(drupal_anonymous_user(), $edit); $this->assertTrue(!empty($account->uid), t('User created with name %name and pass %pass', array('%name' => $edit['name'], '%pass' => $edit['pass'])), t('User login')); if (empty($account->uid)) { return FALSE; } // Add the raw password so that we can log in as this user. $account->pass_raw = $edit['pass']; return $account; } /** * Creates a role with specified permissions. * * @param $permissions * Array of permission names to assign to role. * @param $name * (optional) String for the name of the role. Defaults to a random string. * @return * Role ID of newly created role, or FALSE if role creation failed. */ protected function drupalCreateRole(array $permissions, $name = NULL) { // Generate random name if it was not passed. if (!$name) { $name = $this->randomName(); } // Check the all the permissions strings are valid. if (!$this->checkPermissions($permissions)) { return FALSE; } // Create new role. $role = new stdClass(); $role->name = $name; user_role_save($role); user_role_grant_permissions($role->rid, $permissions); $this->assertTrue(isset($role->rid), t('Created role of name: @name, id: @rid', array('@name' => $name, '@rid' => (isset($role->rid) ? $role->rid : t('-n/a-')))), t('Role')); if ($role && !empty($role->rid)) { $count = db_query('SELECT COUNT(*) FROM {role_permission} WHERE rid = :rid', array(':rid' => $role->rid))->fetchField(); $this->assertTrue($count == count($permissions), t('Created permissions: @perms', array('@perms' => implode(', ', $permissions))), t('Role')); return $role->rid; } else { return FALSE; } } /** * Check to make sure that the array of permissions are valid. * * @param $permissions * Permissions to check. * @param $reset * Reset cached available permissions. * @return * TRUE or FALSE depending on whether the permissions are valid. */ protected function checkPermissions(array $permissions, $reset = FALSE) { $available = &drupal_static(__FUNCTION__); if (!isset($available) || $reset) { $available = array_keys(module_invoke_all('permission')); } $valid = TRUE; foreach ($permissions as $permission) { if (!in_array($permission, $available)) { $this->fail(t('Invalid permission %permission.', array('%permission' => $permission)), t('Role')); $valid = FALSE; } } return $valid; } /** * Log in a user with the internal browser. * * If a user is already logged in, then the current user is logged out before * logging in the specified user. * * Please note that neither the global $user nor the passed-in user object is * populated with data of the logged in user. If you need full access to the * user object after logging in, it must be updated manually. If you also need * access to the plain-text password of the user (set by drupalCreateUser()), * e.g. to log in the same user again, then it must be re-assigned manually. * For example: * @code * // Create a user. * $account = $this->drupalCreateUser(array()); * $this->drupalLogin($account); * // Load real user object. * $pass_raw = $account->pass_raw; * $account = user_load($account->uid); * $account->pass_raw = $pass_raw; * @endcode * * @param $account * User object representing the user to log in. * * @see drupalCreateUser() */ protected function drupalLogin(stdClass $account) { if ($this->loggedInUser) { $this->drupalLogout(); } $edit = array( 'name' => $account->name, 'pass' => $account->pass_raw ); $this->drupalPost('user', $edit, t('Log in')); // If a "log out" link appears on the page, it is almost certainly because // the login was successful. $pass = $this->assertLink(t('Log out'), 0, t('User %name successfully logged in.', array('%name' => $account->name)), t('User login')); if ($pass) { $this->loggedInUser = $account; } } /** * Generate a token for the currently logged in user. */ protected function drupalGetToken($value = '') { $private_key = drupal_get_private_key(); return drupal_hmac_base64($value, $this->session_id . $private_key); } /* * Logs a user out of the internal browser, then check the login page to confirm logout. */ protected function drupalLogout() { // Make a request to the logout page, and redirect to the user page, the // idea being if you were properly logged out you should be seeing a login // screen. $this->drupalGet('user/logout'); $this->drupalGet('user'); $pass = $this->assertField('name', t('Username field found.'), t('Logout')); $pass = $pass && $this->assertField('pass', t('Password field found.'), t('Logout')); if ($pass) { $this->loggedInUser = FALSE; } } /** * Generates a database prefix for running tests. * * The generated database table prefix is used for the Drupal installation * being performed for the test. It is also used as user agent HTTP header * value by the cURL-based browser of DrupalWebTestCase, which is sent * to the Drupal installation of the test. During early Drupal bootstrap, the * user agent HTTP header is parsed, and if it matches, all database queries * use the database table prefix that has been generated here. * * @see DrupalWebTestCase::curlInitialize() * @see drupal_valid_test_ua() * @see DrupalWebTestCase::setUp() */ protected function prepareDatabasePrefix() { $this->databasePrefix = 'simpletest' . mt_rand(1000, 1000000); // As soon as the database prefix is set, the test might start to execute. // All assertions as well as the SimpleTest batch operations are associated // with the testId, so the database prefix has to be associated with it. db_update('simpletest_test_id') ->fields(array('last_prefix' => $this->databasePrefix)) ->condition('test_id', $this->testId) ->execute(); } /** * Changes the database connection to the prefixed one. * * @see DrupalWebTestCase::setUp() */ protected function changeDatabasePrefix() { if (empty($this->databasePrefix)) { $this->prepareDatabasePrefix(); // If $this->prepareDatabasePrefix() failed to work, return without // setting $this->setupDatabasePrefix to TRUE, so setUp() methods will // know to bail out. if (empty($this->databasePrefix)) { return; } } // Clone the current connection and replace the current prefix. $connection_info = Database::getConnectionInfo('default'); Database::renameConnection('default', 'simpletest_original_default'); foreach ($connection_info as $target => $value) { $connection_info[$target]['prefix'] = array( 'default' => $value['prefix']['default'] . $this->databasePrefix, ); } Database::addConnectionInfo('default', 'default', $connection_info['default']); // Indicate the database prefix was set up correctly. $this->setupDatabasePrefix = TRUE; } /** * Prepares the current environment for running the test. * * Backups various current environment variables and resets them, so they do * not interfere with the Drupal site installation in which tests are executed * and can be restored in tearDown(). * * Also sets up new resources for the testing environment, such as the public * filesystem and configuration directories. * * @see DrupalWebTestCase::setUp() * @see DrupalWebTestCase::tearDown() */ protected function prepareEnvironment() { global $user, $language, $conf; // Store necessary current values before switching to prefixed database. $this->originalLanguage = $language; $this->originalLanguageDefault = variable_get('language_default'); $this->originalFileDirectory = variable_get('file_public_path', conf_path() . '/files'); $this->originalProfile = drupal_get_profile(); $this->originalCleanUrl = variable_get('clean_url', 0); $this->originalUser = $user; // Set to English to prevent exceptions from utf8_truncate() from t() // during install if the current language is not 'en'. // The following array/object conversion is copied from language_default(). $language = (object) array('language' => 'en', 'name' => 'English', 'native' => 'English', 'direction' => 0, 'enabled' => 1, 'plurals' => 0, 'formula' => '', 'domain' => '', 'prefix' => '', 'weight' => 0, 'javascript' => ''); // Save and clean the shutdown callbacks array because it is static cached // and will be changed by the test run. Otherwise it will contain callbacks // from both environments and the testing environment will try to call the // handlers defined by the original one. $callbacks = &drupal_register_shutdown_function(); $this->originalShutdownCallbacks = $callbacks; $callbacks = array(); // Create test directory ahead of installation so fatal errors and debug // information can be logged during installation process. // Use temporary files directory with the same prefix as the database. $this->public_files_directory = $this->originalFileDirectory . '/simpletest/' . substr($this->databasePrefix, 10); $this->private_files_directory = $this->public_files_directory . '/private'; $this->temp_files_directory = $this->private_files_directory . '/temp'; // Create the directories file_prepare_directory($this->public_files_directory, FILE_CREATE_DIRECTORY | FILE_MODIFY_PERMISSIONS); file_prepare_directory($this->private_files_directory, FILE_CREATE_DIRECTORY); file_prepare_directory($this->temp_files_directory, FILE_CREATE_DIRECTORY); $this->generatedTestFiles = FALSE; // Log fatal errors. ini_set('log_errors', 1); ini_set('error_log', $this->public_files_directory . '/error.log'); // Set the test information for use in other parts of Drupal. $test_info = &$GLOBALS['drupal_test_info']; $test_info['test_run_id'] = $this->databasePrefix; $test_info['in_child_site'] = FALSE; // Indicate the environment was set up correctly. $this->setupEnvironment = TRUE; } /** * Sets up a Drupal site for running functional and integration tests. * * Generates a random database prefix and installs Drupal with the specified * installation profile in DrupalWebTestCase::$profile into the * prefixed database. Afterwards, installs any additional modules specified by * the test. * * After installation all caches are flushed and several configuration values * are reset to the values of the parent site executing the test, since the * default values may be incompatible with the environment in which tests are * being executed. * * @param ... * List of modules to enable for the duration of the test. This can be * either a single array or a variable number of string arguments. * * @see DrupalWebTestCase::prepareDatabasePrefix() * @see DrupalWebTestCase::changeDatabasePrefix() * @see DrupalWebTestCase::prepareEnvironment() */ protected function setUp() { global $user, $language, $conf; // Create the database prefix for this test. $this->prepareDatabasePrefix(); // Prepare the environment for running tests. $this->prepareEnvironment(); if (!$this->setupEnvironment) { return FALSE; } // Reset all statics and variables to perform tests in a clean environment. $conf = array(); drupal_static_reset(); // Change the database prefix. // All static variables need to be reset before the database prefix is // changed, since DrupalCacheArray implementations attempt to // write back to persistent caches when they are destructed. $this->changeDatabasePrefix(); if (!$this->setupDatabasePrefix) { return FALSE; } // Preset the 'install_profile' system variable, so the first call into // system_rebuild_module_data() (in drupal_install_system()) will register // the test's profile as a module. Without this, the installation profile of // the parent site (executing the test) is registered, and the test // profile's hook_install() and other hook implementations are never invoked. $conf['install_profile'] = $this->profile; // Perform the actual Drupal installation. include_once DRUPAL_ROOT . '/includes/install.inc'; drupal_install_system(); $this->preloadRegistry(); // Set path variables. variable_set('file_public_path', $this->public_files_directory); variable_set('file_private_path', $this->private_files_directory); variable_set('file_temporary_path', $this->temp_files_directory); // Set the 'simpletest_parent_profile' variable to add the parent profile's // search path to the child site's search paths. // @see drupal_system_listing() // @todo This may need to be primed like 'install_profile' above. variable_set('simpletest_parent_profile', $this->originalProfile); // Include the testing profile. variable_set('install_profile', $this->profile); $profile_details = install_profile_info($this->profile, 'en'); // Install the modules specified by the testing profile. module_enable($profile_details['dependencies'], FALSE); // Install modules needed for this test. This could have been passed in as // either a single array argument or a variable number of string arguments. // @todo Remove this compatibility layer in Drupal 8, and only accept // $modules as a single array argument. $modules = func_get_args(); if (isset($modules[0]) && is_array($modules[0])) { $modules = $modules[0]; } if ($modules) { $success = module_enable($modules, TRUE); $this->assertTrue($success, t('Enabled modules: %modules', array('%modules' => implode(', ', $modules)))); } // Run the profile tasks. $install_profile_module_exists = db_query("SELECT 1 FROM {system} WHERE type = 'module' AND name = :name", array( ':name' => $this->profile, ))->fetchField(); if ($install_profile_module_exists) { module_enable(array($this->profile), FALSE); } // Reset/rebuild all data structures after enabling the modules. $this->resetAll(); // Run cron once in that environment, as install.php does at the end of // the installation process. drupal_cron_run(); // Ensure that the session is not written to the new environment and replace // the global $user session with uid 1 from the new test site. drupal_save_session(FALSE); // Login as uid 1. $user = user_load(1); // Restore necessary variables. variable_set('install_task', 'done'); variable_set('clean_url', $this->originalCleanUrl); variable_set('site_mail', 'simpletest@example.com'); variable_set('date_default_timezone', date_default_timezone_get()); // Set up English language. unset($conf['language_default']); $language = language_default(); // Use the test mail class instead of the default mail handler class. variable_set('mail_system', array('default-system' => 'TestingMailSystem')); drupal_set_time_limit($this->timeLimit); $this->setup = TRUE; } /** * Preload the registry from the testing site. * * This method is called by DrupalWebTestCase::setUp(), and preloads the * registry from the testing site to cut down on the time it takes to * set up a clean environment for the current test run. */ protected function preloadRegistry() { // Use two separate queries, each with their own connections: copy the // {registry} and {registry_file} tables over from the parent installation // to the child installation. $original_connection = Database::getConnection('default', 'simpletest_original_default'); $test_connection = Database::getConnection(); foreach (array('registry', 'registry_file') as $table) { // Find the records from the parent database. $source_query = $original_connection ->select($table, array(), array('fetch' => PDO::FETCH_ASSOC)) ->fields($table); $dest_query = $test_connection->insert($table); $first = TRUE; foreach ($source_query->execute() as $row) { if ($first) { $dest_query->fields(array_keys($row)); $first = FALSE; } // Insert the records into the child database. $dest_query->values($row); } $dest_query->execute(); } } /** * Reset all data structures after having enabled new modules. * * This method is called by DrupalWebTestCase::setUp() after enabling * the requested modules. It must be called again when additional modules * are enabled later. */ protected function resetAll() { // Reset all static variables. drupal_static_reset(); // Reset the list of enabled modules. module_list(TRUE); // Reset cached schema for new database prefix. This must be done before // drupal_flush_all_caches() so rebuilds can make use of the schema of // modules enabled on the cURL side. drupal_get_schema(NULL, TRUE); // Perform rebuilds and flush remaining caches. drupal_flush_all_caches(); // Reload global $conf array and permissions. $this->refreshVariables(); $this->checkPermissions(array(), TRUE); } /** * Refresh the in-memory set of variables. Useful after a page request is made * that changes a variable in a different thread. * * In other words calling a settings page with $this->drupalPost() with a changed * value would update a variable to reflect that change, but in the thread that * made the call (thread running the test) the changed variable would not be * picked up. * * This method clears the variables cache and loads a fresh copy from the database * to ensure that the most up-to-date set of variables is loaded. */ protected function refreshVariables() { global $conf; cache_clear_all('variables', 'cache_bootstrap'); $conf = variable_initialize(); } /** * Delete created files and temporary files directory, delete the tables created by setUp(), * and reset the database prefix. */ protected function tearDown() { global $user, $language; // In case a fatal error occurred that was not in the test process read the // log to pick up any fatal errors. simpletest_log_read($this->testId, $this->databasePrefix, get_class($this), TRUE); $emailCount = count(variable_get('drupal_test_email_collector', array())); if ($emailCount) { $message = format_plural($emailCount, '1 e-mail was sent during this test.', '@count e-mails were sent during this test.'); $this->pass($message, t('E-mail')); } // Delete temporary files directory. file_unmanaged_delete_recursive($this->originalFileDirectory . '/simpletest/' . substr($this->databasePrefix, 10)); // Remove all prefixed tables. $tables = db_find_tables($this->databasePrefix . '%'); $connection_info = Database::getConnectionInfo('default'); $tables = db_find_tables($connection_info['default']['prefix']['default'] . '%'); if (empty($tables)) { $this->fail('Failed to find test tables to drop.'); } $prefix_length = strlen($connection_info['default']['prefix']['default']); foreach ($tables as $table) { if (db_drop_table(substr($table, $prefix_length))) { unset($tables[$table]); } } if (!empty($tables)) { $this->fail('Failed to drop all prefixed tables.'); } // Get back to the original connection. Database::removeConnection('default'); Database::renameConnection('simpletest_original_default', 'default'); // Restore original shutdown callbacks array to prevent original // environment of calling handlers from test run. $callbacks = &drupal_register_shutdown_function(); $callbacks = $this->originalShutdownCallbacks; // Return the user to the original one. $user = $this->originalUser; drupal_save_session(TRUE); // Ensure that internal logged in variable and cURL options are reset. $this->loggedInUser = FALSE; $this->additionalCurlOptions = array(); // Reload module list and implementations to ensure that test module hooks // aren't called after tests. module_list(TRUE); module_implements('', FALSE, TRUE); // Reset the Field API. field_cache_clear(); // Rebuild caches. $this->refreshVariables(); // Reset public files directory. $GLOBALS['conf']['file_public_path'] = $this->originalFileDirectory; // Reset language. $language = $this->originalLanguage; if ($this->originalLanguageDefault) { $GLOBALS['conf']['language_default'] = $this->originalLanguageDefault; } // Close the CURL handler. $this->curlClose(); } /** * Initializes the cURL connection. * * If the simpletest_httpauth_credentials variable is set, this function will * add HTTP authentication headers. This is necessary for testing sites that * are protected by login credentials from public access. * See the description of $curl_options for other options. */ protected function curlInitialize() { global $base_url; if (!isset($this->curlHandle)) { $this->curlHandle = curl_init(); // Some versions/configurations of cURL break on a NULL cookie jar, so // supply a real file. if (empty($this->cookieFile)) { $this->cookieFile = $this->public_files_directory . '/cookie.jar'; } $curl_options = array( CURLOPT_COOKIEJAR => $this->cookieFile, CURLOPT_URL => $base_url, CURLOPT_FOLLOWLOCATION => FALSE, CURLOPT_RETURNTRANSFER => TRUE, CURLOPT_SSL_VERIFYPEER => FALSE, // Required to make the tests run on HTTPS. CURLOPT_SSL_VERIFYHOST => FALSE, // Required to make the tests run on HTTPS. CURLOPT_HEADERFUNCTION => array(&$this, 'curlHeaderCallback'), CURLOPT_USERAGENT => $this->databasePrefix, ); if (isset($this->httpauth_credentials)) { $curl_options[CURLOPT_HTTPAUTH] = $this->httpauth_method; $curl_options[CURLOPT_USERPWD] = $this->httpauth_credentials; } // curl_setopt_array() returns FALSE if any of the specified options // cannot be set, and stops processing any further options. $result = curl_setopt_array($this->curlHandle, $this->additionalCurlOptions + $curl_options); if (!$result) { throw new Exception('One or more cURL options could not be set.'); } // By default, the child session name should be the same as the parent. $this->session_name = session_name(); } // We set the user agent header on each request so as to use the current // time and a new uniqid. if (preg_match('/simpletest\d+/', $this->databasePrefix, $matches)) { curl_setopt($this->curlHandle, CURLOPT_USERAGENT, drupal_generate_test_ua($matches[0])); } } /** * Initializes and executes a cURL request. * * @param $curl_options * An associative array of cURL options to set, where the keys are constants * defined by the cURL library. For a list of valid options, see * http://www.php.net/manual/function.curl-setopt.php * @param $redirect * FALSE if this is an initial request, TRUE if this request is the result * of a redirect. * * @return * The content returned from the call to curl_exec(). * * @see curlInitialize() */ protected function curlExec($curl_options, $redirect = FALSE) { $this->curlInitialize(); if (!empty($curl_options[CURLOPT_URL])) { // Forward XDebug activation if present. if (isset($_COOKIE['XDEBUG_SESSION'])) { $options = drupal_parse_url($curl_options[CURLOPT_URL]); $options += array('query' => array()); $options['query'] += array('XDEBUG_SESSION_START' => $_COOKIE['XDEBUG_SESSION']); $curl_options[CURLOPT_URL] = url($options['path'], $options); } // cURL incorrectly handles URLs with a fragment by including the // fragment in the request to the server, causing some web servers // to reject the request citing "400 - Bad Request". To prevent // this, we strip the fragment from the request. // TODO: Remove this for Drupal 8, since fixed in curl 7.20.0. if (strpos($curl_options[CURLOPT_URL], '#')) { $original_url = $curl_options[CURLOPT_URL]; $curl_options[CURLOPT_URL] = strtok($curl_options[CURLOPT_URL], '#'); } } $url = empty($curl_options[CURLOPT_URL]) ? curl_getinfo($this->curlHandle, CURLINFO_EFFECTIVE_URL) : $curl_options[CURLOPT_URL]; if (!empty($curl_options[CURLOPT_POST])) { // This is a fix for the Curl library to prevent Expect: 100-continue // headers in POST requests, that may cause unexpected HTTP response // codes from some webservers (like lighttpd that returns a 417 error // code). It is done by setting an empty "Expect" header field that is // not overwritten by Curl. $curl_options[CURLOPT_HTTPHEADER][] = 'Expect:'; } curl_setopt_array($this->curlHandle, $this->additionalCurlOptions + $curl_options); if (!$redirect) { // Reset headers, the session ID and the redirect counter. $this->session_id = NULL; $this->headers = array(); $this->redirect_count = 0; } $content = curl_exec($this->curlHandle); $status = curl_getinfo($this->curlHandle, CURLINFO_HTTP_CODE); // cURL incorrectly handles URLs with fragments, so instead of // letting cURL handle redirects we take of them ourselves to // to prevent fragments being sent to the web server as part // of the request. // TODO: Remove this for Drupal 8, since fixed in curl 7.20.0. if (in_array($status, array(300, 301, 302, 303, 305, 307)) && $this->redirect_count < variable_get('simpletest_maximum_redirects', 5)) { if ($this->drupalGetHeader('location')) { $this->redirect_count++; $curl_options = array(); $curl_options[CURLOPT_URL] = $this->drupalGetHeader('location'); $curl_options[CURLOPT_HTTPGET] = TRUE; return $this->curlExec($curl_options, TRUE); } } $this->drupalSetContent($content, isset($original_url) ? $original_url : curl_getinfo($this->curlHandle, CURLINFO_EFFECTIVE_URL)); $message_vars = array( '!method' => !empty($curl_options[CURLOPT_NOBODY]) ? 'HEAD' : (empty($curl_options[CURLOPT_POSTFIELDS]) ? 'GET' : 'POST'), '@url' => isset($original_url) ? $original_url : $url, '@status' => $status, '!length' => format_size(strlen($this->drupalGetContent())) ); $message = t('!method @url returned @status (!length).', $message_vars); $this->assertTrue($this->drupalGetContent() !== FALSE, $message, t('Browser')); return $this->drupalGetContent(); } /** * Reads headers and registers errors received from the tested site. * * @see _drupal_log_error(). * * @param $curlHandler * The cURL handler. * @param $header * An header. */ protected function curlHeaderCallback($curlHandler, $header) { // Header fields can be extended over multiple lines by preceding each // extra line with at least one SP or HT. They should be joined on receive. // Details are in RFC2616 section 4. if ($header[0] == ' ' || $header[0] == "\t") { // Normalize whitespace between chucks. $this->headers[] = array_pop($this->headers) . ' ' . trim($header); } else { $this->headers[] = $header; } // Errors are being sent via X-Drupal-Assertion-* headers, // generated by _drupal_log_error() in the exact form required // by DrupalWebTestCase::error(). if (preg_match('/^X-Drupal-Assertion-[0-9]+: (.*)$/', $header, $matches)) { // Call DrupalWebTestCase::error() with the parameters from the header. call_user_func_array(array(&$this, 'error'), unserialize(urldecode($matches[1]))); } // Save cookies. if (preg_match('/^Set-Cookie: ([^=]+)=(.+)/', $header, $matches)) { $name = $matches[1]; $parts = array_map('trim', explode(';', $matches[2])); $value = array_shift($parts); $this->cookies[$name] = array('value' => $value, 'secure' => in_array('secure', $parts)); if ($name == $this->session_name) { if ($value != 'deleted') { $this->session_id = $value; } else { $this->session_id = NULL; } } } // This is required by cURL. return strlen($header); } /** * Close the cURL handler and unset the handler. */ protected function curlClose() { if (isset($this->curlHandle)) { curl_close($this->curlHandle); unset($this->curlHandle); } } /** * Parse content returned from curlExec using DOM and SimpleXML. * * @return * A SimpleXMLElement or FALSE on failure. */ protected function parse() { if (!$this->elements) { // DOM can load HTML soup. But, HTML soup can throw warnings, suppress // them. $htmlDom = new DOMDocument(); @$htmlDom->loadHTML($this->drupalGetContent()); if ($htmlDom) { $this->pass(t('Valid HTML found on "@path"', array('@path' => $this->getUrl())), t('Browser')); // It's much easier to work with simplexml than DOM, luckily enough // we can just simply import our DOM tree. $this->elements = simplexml_import_dom($htmlDom); } } if (!$this->elements) { $this->fail(t('Parsed page successfully.'), t('Browser')); } return $this->elements; } /** * Retrieves a Drupal path or an absolute path. * * @param $path * Drupal path or URL to load into internal browser * @param $options * Options to be forwarded to url(). * @param $headers * An array containing additional HTTP request headers, each formatted as * "name: value". * @return * The retrieved HTML string, also available as $this->drupalGetContent() */ protected function drupalGet($path, array $options = array(), array $headers = array()) { $options['absolute'] = TRUE; // We re-using a CURL connection here. If that connection still has certain // options set, it might change the GET into a POST. Make sure we clear out // previous options. $out = $this->curlExec(array(CURLOPT_HTTPGET => TRUE, CURLOPT_URL => url($path, $options), CURLOPT_NOBODY => FALSE, CURLOPT_HTTPHEADER => $headers)); $this->refreshVariables(); // Ensure that any changes to variables in the other thread are picked up. // Replace original page output with new output from redirected page(s). if ($new = $this->checkForMetaRefresh()) { $out = $new; } $this->verbose('GET request to: ' . $path . '
                  Ending URL: ' . $this->getUrl() . '
                  ' . $out); return $out; } /** * Retrieve a Drupal path or an absolute path and JSON decode the result. */ protected function drupalGetAJAX($path, array $options = array(), array $headers = array()) { return drupal_json_decode($this->drupalGet($path, $options, $headers)); } /** * Execute a POST request on a Drupal page. * It will be done as usual POST request with SimpleBrowser. * * @param $path * Location of the post form. Either a Drupal path or an absolute path or * NULL to post to the current page. For multi-stage forms you can set the * path to NULL and have it post to the last received page. Example: * * @code * // First step in form. * $edit = array(...); * $this->drupalPost('some_url', $edit, t('Save')); * * // Second step in form. * $edit = array(...); * $this->drupalPost(NULL, $edit, t('Save')); * @endcode * @param $edit * Field data in an associative array. Changes the current input fields * (where possible) to the values indicated. A checkbox can be set to * TRUE to be checked and FALSE to be unchecked. Note that when a form * contains file upload fields, other fields cannot start with the '@' * character. * * Multiple select fields can be set using name[] and setting each of the * possible values. Example: * @code * $edit = array(); * $edit['name[]'] = array('value1', 'value2'); * @endcode * @param $submit * Value of the submit button whose click is to be emulated. For example, * t('Save'). The processing of the request depends on this value. For * example, a form may have one button with the value t('Save') and another * button with the value t('Delete'), and execute different code depending * on which one is clicked. * * This function can also be called to emulate an Ajax submission. In this * case, this value needs to be an array with the following keys: * - path: A path to submit the form values to for Ajax-specific processing, * which is likely different than the $path parameter used for retrieving * the initial form. Defaults to 'system/ajax'. * - triggering_element: If the value for the 'path' key is 'system/ajax' or * another generic Ajax processing path, this needs to be set to the name * of the element. If the name doesn't identify the element uniquely, then * this should instead be an array with a single key/value pair, * corresponding to the element name and value. The callback for the * generic Ajax processing path uses this to find the #ajax information * for the element, including which specific callback to use for * processing the request. * * This can also be set to NULL in order to emulate an Internet Explorer * submission of a form with a single text field, and pressing ENTER in that * textfield: under these conditions, no button information is added to the * POST data. * @param $options * Options to be forwarded to url(). * @param $headers * An array containing additional HTTP request headers, each formatted as * "name: value". * @param $form_html_id * (optional) HTML ID of the form to be submitted. On some pages * there are many identical forms, so just using the value of the submit * button is not enough. For example: 'trigger-node-presave-assign-form'. * Note that this is not the Drupal $form_id, but rather the HTML ID of the * form, which is typically the same thing but with hyphens replacing the * underscores. * @param $extra_post * (optional) A string of additional data to append to the POST submission. * This can be used to add POST data for which there are no HTML fields, as * is done by drupalPostAJAX(). This string is literally appended to the * POST data, so it must already be urlencoded and contain a leading "&" * (e.g., "&extra_var1=hello+world&extra_var2=you%26me"). */ protected function drupalPost($path, $edit, $submit, array $options = array(), array $headers = array(), $form_html_id = NULL, $extra_post = NULL) { $submit_matches = FALSE; $ajax = is_array($submit); if (isset($path)) { $this->drupalGet($path, $options); } if ($this->parse()) { $edit_save = $edit; // Let's iterate over all the forms. $xpath = "//form"; if (!empty($form_html_id)) { $xpath .= "[@id='" . $form_html_id . "']"; } $forms = $this->xpath($xpath); foreach ($forms as $form) { // We try to set the fields of this form as specified in $edit. $edit = $edit_save; $post = array(); $upload = array(); $submit_matches = $this->handleForm($post, $edit, $upload, $ajax ? NULL : $submit, $form); $action = isset($form['action']) ? $this->getAbsoluteUrl((string) $form['action']) : $this->getUrl(); if ($ajax) { $action = $this->getAbsoluteUrl(!empty($submit['path']) ? $submit['path'] : 'system/ajax'); // Ajax callbacks verify the triggering element if necessary, so while // we may eventually want extra code that verifies it in the // handleForm() function, it's not currently a requirement. $submit_matches = TRUE; } // We post only if we managed to handle every field in edit and the // submit button matches. if (!$edit && ($submit_matches || !isset($submit))) { $post_array = $post; if ($upload) { // TODO: cURL handles file uploads for us, but the implementation // is broken. This is a less than elegant workaround. Alternatives // are being explored at #253506. foreach ($upload as $key => $file) { $file = drupal_realpath($file); if ($file && is_file($file)) { // Use the new CurlFile class for file uploads when using PHP // 5.5 or higher. if (class_exists('CurlFile')) { $post[$key] = curl_file_create($file); } else { $post[$key] = '@' . $file; } } } } else { foreach ($post as $key => $value) { // Encode according to application/x-www-form-urlencoded // Both names and values needs to be urlencoded, according to // http://www.w3.org/TR/html4/interact/forms.html#h-17.13.4.1 $post[$key] = urlencode($key) . '=' . urlencode($value); } $post = implode('&', $post) . $extra_post; } $out = $this->curlExec(array(CURLOPT_URL => $action, CURLOPT_POST => TRUE, CURLOPT_POSTFIELDS => $post, CURLOPT_HTTPHEADER => $headers)); // Ensure that any changes to variables in the other thread are picked up. $this->refreshVariables(); // Replace original page output with new output from redirected page(s). if ($new = $this->checkForMetaRefresh()) { $out = $new; } $this->verbose('POST request to: ' . $path . '
                  Ending URL: ' . $this->getUrl() . '
                  Fields: ' . highlight_string('' . $out); return $out; } } // We have not found a form which contained all fields of $edit. foreach ($edit as $name => $value) { $this->fail(t('Failed to set field @name to @value', array('@name' => $name, '@value' => $value))); } if (!$ajax && isset($submit)) { $this->assertTrue($submit_matches, t('Found the @submit button', array('@submit' => $submit))); } $this->fail(t('Found the requested form fields at @path', array('@path' => $path))); } } /** * Execute an Ajax submission. * * This executes a POST as ajax.js does. It uses the returned JSON data, an * array of commands, to update $this->content using equivalent DOM * manipulation as is used by ajax.js. It also returns the array of commands. * * @param $path * Location of the form containing the Ajax enabled element to test. Can be * either a Drupal path or an absolute path or NULL to use the current page. * @param $edit * Field data in an associative array. Changes the current input fields * (where possible) to the values indicated. * @param $triggering_element * The name of the form element that is responsible for triggering the Ajax * functionality to test. May be a string or, if the triggering element is * a button, an associative array where the key is the name of the button * and the value is the button label. i.e.) array('op' => t('Refresh')). * @param $ajax_path * (optional) Override the path set by the Ajax settings of the triggering * element. In the absence of both the triggering element's Ajax path and * $ajax_path 'system/ajax' will be used. * @param $options * (optional) Options to be forwarded to url(). * @param $headers * (optional) An array containing additional HTTP request headers, each * formatted as "name: value". Forwarded to drupalPost(). * @param $form_html_id * (optional) HTML ID of the form to be submitted, use when there is more * than one identical form on the same page and the value of the triggering * element is not enough to identify the form. Note this is not the Drupal * ID of the form but rather the HTML ID of the form. * @param $ajax_settings * (optional) An array of Ajax settings which if specified will be used in * place of the Ajax settings of the triggering element. * * @return * An array of Ajax commands. * * @see drupalPost() * @see ajax.js */ protected function drupalPostAJAX($path, $edit, $triggering_element, $ajax_path = NULL, array $options = array(), array $headers = array(), $form_html_id = NULL, $ajax_settings = NULL) { // Get the content of the initial page prior to calling drupalPost(), since // drupalPost() replaces $this->content. if (isset($path)) { $this->drupalGet($path, $options); } $content = $this->content; $drupal_settings = $this->drupalSettings; // Get the Ajax settings bound to the triggering element. if (!isset($ajax_settings)) { if (is_array($triggering_element)) { $xpath = '//*[@name="' . key($triggering_element) . '" and @value="' . current($triggering_element) . '"]'; } else { $xpath = '//*[@name="' . $triggering_element . '"]'; } if (isset($form_html_id)) { $xpath = '//form[@id="' . $form_html_id . '"]' . $xpath; } $element = $this->xpath($xpath); $element_id = (string) $element[0]['id']; $ajax_settings = $drupal_settings['ajax'][$element_id]; } // Add extra information to the POST data as ajax.js does. $extra_post = ''; if (isset($ajax_settings['submit'])) { foreach ($ajax_settings['submit'] as $key => $value) { $extra_post .= '&' . urlencode($key) . '=' . urlencode($value); } } foreach ($this->xpath('//*[@id]') as $element) { $id = (string) $element['id']; $extra_post .= '&' . urlencode('ajax_html_ids[]') . '=' . urlencode($id); } if (isset($drupal_settings['ajaxPageState'])) { $extra_post .= '&' . urlencode('ajax_page_state[theme]') . '=' . urlencode($drupal_settings['ajaxPageState']['theme']); $extra_post .= '&' . urlencode('ajax_page_state[theme_token]') . '=' . urlencode($drupal_settings['ajaxPageState']['theme_token']); foreach ($drupal_settings['ajaxPageState']['css'] as $key => $value) { $extra_post .= '&' . urlencode("ajax_page_state[css][$key]") . '=1'; } foreach ($drupal_settings['ajaxPageState']['js'] as $key => $value) { $extra_post .= '&' . urlencode("ajax_page_state[js][$key]") . '=1'; } } // Unless a particular path is specified, use the one specified by the // Ajax settings, or else 'system/ajax'. if (!isset($ajax_path)) { $ajax_path = isset($ajax_settings['url']) ? $ajax_settings['url'] : 'system/ajax'; } // Submit the POST request. $return = drupal_json_decode($this->drupalPost(NULL, $edit, array('path' => $ajax_path, 'triggering_element' => $triggering_element), $options, $headers, $form_html_id, $extra_post)); $this->assertIdentical($this->drupalGetHeader('X-Drupal-Ajax-Token'), '1', 'Ajax response header found.'); // Change the page content by applying the returned commands. if (!empty($ajax_settings) && !empty($return)) { // ajax.js applies some defaults to the settings object, so do the same // for what's used by this function. $ajax_settings += array( 'method' => 'replaceWith', ); // DOM can load HTML soup. But, HTML soup can throw warnings, suppress // them. $dom = new DOMDocument(); @$dom->loadHTML($content); // XPath allows for finding wrapper nodes better than DOM does. $xpath = new DOMXPath($dom); foreach ($return as $command) { switch ($command['command']) { case 'settings': $drupal_settings = drupal_array_merge_deep($drupal_settings, $command['settings']); break; case 'insert': $wrapperNode = NULL; // When a command doesn't specify a selector, use the // #ajax['wrapper'] which is always an HTML ID. if (!isset($command['selector'])) { $wrapperNode = $xpath->query('//*[@id="' . $ajax_settings['wrapper'] . '"]')->item(0); } // @todo Ajax commands can target any jQuery selector, but these are // hard to fully emulate with XPath. For now, just handle 'head' // and 'body', since these are used by ajax_render(). elseif (in_array($command['selector'], array('head', 'body'))) { $wrapperNode = $xpath->query('//' . $command['selector'])->item(0); } if ($wrapperNode) { // ajax.js adds an enclosing DIV to work around a Safari bug. $newDom = new DOMDocument(); // DOM can load HTML soup. But, HTML soup can throw warnings, // suppress them. $newDom->loadHTML('
                  ' . $command['data'] . '
                  '); // Suppress warnings thrown when duplicate HTML IDs are // encountered. This probably means we are replacing an element // with the same ID. $newNode = @$dom->importNode($newDom->documentElement->firstChild->firstChild, TRUE); $method = isset($command['method']) ? $command['method'] : $ajax_settings['method']; // The "method" is a jQuery DOM manipulation function. Emulate // each one using PHP's DOMNode API. switch ($method) { case 'replaceWith': $wrapperNode->parentNode->replaceChild($newNode, $wrapperNode); break; case 'append': $wrapperNode->appendChild($newNode); break; case 'prepend': // If no firstChild, insertBefore() falls back to // appendChild(). $wrapperNode->insertBefore($newNode, $wrapperNode->firstChild); break; case 'before': $wrapperNode->parentNode->insertBefore($newNode, $wrapperNode); break; case 'after': // If no nextSibling, insertBefore() falls back to // appendChild(). $wrapperNode->parentNode->insertBefore($newNode, $wrapperNode->nextSibling); break; case 'html': foreach ($wrapperNode->childNodes as $childNode) { $wrapperNode->removeChild($childNode); } $wrapperNode->appendChild($newNode); break; } } break; case 'updateBuildId': $buildId = $xpath->query('//input[@name="form_build_id" and @value="' . $command['old'] . '"]')->item(0); if ($buildId) { $buildId->setAttribute('value', $command['new']); } break; // @todo Add suitable implementations for these commands in order to // have full test coverage of what ajax.js can do. case 'remove': break; case 'changed': break; case 'css': break; case 'data': break; case 'restripe': break; case 'add_css': break; } } $content = $dom->saveHTML(); } $this->drupalSetContent($content); $this->drupalSetSettings($drupal_settings); $verbose = 'AJAX POST request to: ' . $path; $verbose .= '
                  AJAX callback path: ' . $ajax_path; $verbose .= '
                  Ending URL: ' . $this->getUrl(); $verbose .= '
                  ' . $this->content; $this->verbose($verbose); return $return; } /** * Runs cron in the Drupal installed by Simpletest. */ protected function cronRun() { $this->drupalGet($GLOBALS['base_url'] . '/cron.php', array('external' => TRUE, 'query' => array('cron_key' => variable_get('cron_key', 'drupal')))); } /** * Check for meta refresh tag and if found call drupalGet() recursively. This * function looks for the http-equiv attribute to be set to "Refresh" * and is case-sensitive. * * @return * Either the new page content or FALSE. */ protected function checkForMetaRefresh() { if (strpos($this->drupalGetContent(), 'parse()) { $refresh = $this->xpath('//meta[@http-equiv="Refresh"]'); if (!empty($refresh)) { // Parse the content attribute of the meta tag for the format: // "[delay]: URL=[page_to_redirect_to]". if (preg_match('/\d+;\s*URL=(?P.*)/i', $refresh[0]['content'], $match)) { return $this->drupalGet($this->getAbsoluteUrl(decode_entities($match['url']))); } } } return FALSE; } /** * Retrieves only the headers for a Drupal path or an absolute path. * * @param $path * Drupal path or URL to load into internal browser * @param $options * Options to be forwarded to url(). * @param $headers * An array containing additional HTTP request headers, each formatted as * "name: value". * @return * The retrieved headers, also available as $this->drupalGetContent() */ protected function drupalHead($path, array $options = array(), array $headers = array()) { $options['absolute'] = TRUE; $out = $this->curlExec(array(CURLOPT_NOBODY => TRUE, CURLOPT_URL => url($path, $options), CURLOPT_HTTPHEADER => $headers)); $this->refreshVariables(); // Ensure that any changes to variables in the other thread are picked up. return $out; } /** * Handle form input related to drupalPost(). Ensure that the specified fields * exist and attempt to create POST data in the correct manner for the particular * field type. * * @param $post * Reference to array of post values. * @param $edit * Reference to array of edit values to be checked against the form. * @param $submit * Form submit button value. * @param $form * Array of form elements. * @return * Submit value matches a valid submit input in the form. */ protected function handleForm(&$post, &$edit, &$upload, $submit, $form) { // Retrieve the form elements. $elements = $form->xpath('.//input[not(@disabled)]|.//textarea[not(@disabled)]|.//select[not(@disabled)]'); $submit_matches = FALSE; foreach ($elements as $element) { // SimpleXML objects need string casting all the time. $name = (string) $element['name']; // This can either be the type of or the name of the tag itself // for '; $output .= ''; return $output; } /** * Returns HTML for a password form element. * * @param $variables * An associative array containing: * - element: An associative array containing the properties of the element. * Properties used: #title, #value, #description, #size, #maxlength, * #required, #attributes. * * @ingroup themeable */ function theme_password($variables) { $element = $variables['element']; $element['#attributes']['type'] = 'password'; element_set_attributes($element, array('id', 'name', 'size', 'maxlength')); _form_set_class($element, array('form-text')); return ''; } /** * Expands a weight element into a select element. */ function form_process_weight($element) { $element['#is_weight'] = TRUE; // If the number of options is small enough, use a select field. $max_elements = variable_get('drupal_weight_select_max', DRUPAL_WEIGHT_SELECT_MAX); if ($element['#delta'] <= $max_elements) { $element['#type'] = 'select'; for ($n = (-1 * $element['#delta']); $n <= $element['#delta']; $n++) { $weights[$n] = $n; } $element['#options'] = $weights; $element += element_info('select'); } // Otherwise, use a text field. else { $element['#type'] = 'textfield'; // Use a field big enough to fit most weights. $element['#size'] = 10; $element['#element_validate'] = array('element_validate_integer'); $element += element_info('textfield'); } return $element; } /** * Returns HTML for a file upload form element. * * For assistance with handling the uploaded file correctly, see the API * provided by file.inc. * * @param $variables * An associative array containing: * - element: An associative array containing the properties of the element. * Properties used: #title, #name, #size, #description, #required, * #attributes. * * @ingroup themeable */ function theme_file($variables) { $element = $variables['element']; $element['#attributes']['type'] = 'file'; element_set_attributes($element, array('id', 'name', 'size')); _form_set_class($element, array('form-file')); return ''; } /** * Returns HTML for a form element. * * Each form element is wrapped in a DIV container having the following CSS * classes: * - form-item: Generic for all form elements. * - form-type-#type: The internal element #type. * - form-item-#name: The internal form element #name (usually derived from the * $form structure and set via form_builder()). * - form-disabled: Only set if the form element is #disabled. * * In addition to the element itself, the DIV contains a label for the element * based on the optional #title_display property, and an optional #description. * * The optional #title_display property can have these values: * - before: The label is output before the element. This is the default. * The label includes the #title and the required marker, if #required. * - after: The label is output after the element. For example, this is used * for radio and checkbox #type elements as set in system_element_info(). * If the #title is empty but the field is #required, the label will * contain only the required marker. * - invisible: Labels are critical for screen readers to enable them to * properly navigate through forms but can be visually distracting. This * property hides the label for everyone except screen readers. * - attribute: Set the title attribute on the element to create a tooltip * but output no label element. This is supported only for checkboxes * and radios in form_pre_render_conditional_form_element(). It is used * where a visual label is not needed, such as a table of checkboxes where * the row and column provide the context. The tooltip will include the * title and required marker. * * If the #title property is not set, then the label and any required marker * will not be output, regardless of the #title_display or #required values. * This can be useful in cases such as the password_confirm element, which * creates children elements that have their own labels and required markers, * but the parent element should have neither. Use this carefully because a * field without an associated label can cause accessibility challenges. * * @param $variables * An associative array containing: * - element: An associative array containing the properties of the element. * Properties used: #title, #title_display, #description, #id, #required, * #children, #type, #name. * * @ingroup themeable */ function theme_form_element($variables) { $element = &$variables['element']; // This function is invoked as theme wrapper, but the rendered form element // may not necessarily have been processed by form_builder(). $element += array( '#title_display' => 'before', ); // Add element #id for #type 'item'. if (isset($element['#markup']) && !empty($element['#id'])) { $attributes['id'] = $element['#id']; } // Add element's #type and #name as class to aid with JS/CSS selectors. $attributes['class'] = array('form-item'); if (!empty($element['#type'])) { $attributes['class'][] = 'form-type-' . strtr($element['#type'], '_', '-'); } if (!empty($element['#name'])) { $attributes['class'][] = 'form-item-' . strtr($element['#name'], array(' ' => '-', '_' => '-', '[' => '-', ']' => '')); } // Add a class for disabled elements to facilitate cross-browser styling. if (!empty($element['#attributes']['disabled'])) { $attributes['class'][] = 'form-disabled'; } $output = '' . "\n"; // If #title is not set, we don't display any label or required marker. if (!isset($element['#title'])) { $element['#title_display'] = 'none'; } $prefix = isset($element['#field_prefix']) ? '' . $element['#field_prefix'] . ' ' : ''; $suffix = isset($element['#field_suffix']) ? ' ' . $element['#field_suffix'] . '' : ''; switch ($element['#title_display']) { case 'before': case 'invisible': $output .= ' ' . theme('form_element_label', $variables); $output .= ' ' . $prefix . $element['#children'] . $suffix . "\n"; break; case 'after': $output .= ' ' . $prefix . $element['#children'] . $suffix; $output .= ' ' . theme('form_element_label', $variables) . "\n"; break; case 'none': case 'attribute': // Output no label and no required marker, only the children. $output .= ' ' . $prefix . $element['#children'] . $suffix . "\n"; break; } if (!empty($element['#description'])) { $output .= '
                  ' . $element['#description'] . "
                  \n"; } $output .= "\n"; return $output; } /** * Returns HTML for a marker for required form elements. * * @param $variables * An associative array containing: * - element: An associative array containing the properties of the element. * * @ingroup themeable */ function theme_form_required_marker($variables) { // This is also used in the installer, pre-database setup. $t = get_t(); $attributes = array( 'class' => 'form-required', 'title' => $t('This field is required.'), ); return '*'; } /** * Returns HTML for a form element label and required marker. * * Form element labels include the #title and a #required marker. The label is * associated with the element itself by the element #id. Labels may appear * before or after elements, depending on theme_form_element() and * #title_display. * * This function will not be called for elements with no labels, depending on * #title_display. For elements that have an empty #title and are not required, * this function will output no label (''). For required elements that have an * empty #title, this will output the required marker alone within the label. * The label will use the #id to associate the marker with the field that is * required. That is especially important for screenreader users to know * which field is required. * * @param $variables * An associative array containing: * - element: An associative array containing the properties of the element. * Properties used: #required, #title, #id, #value, #description. * * @ingroup themeable */ function theme_form_element_label($variables) { $element = $variables['element']; // This is also used in the installer, pre-database setup. $t = get_t(); // If title and required marker are both empty, output no label. if ((!isset($element['#title']) || $element['#title'] === '') && empty($element['#required'])) { return ''; } // If the element is required, a required marker is appended to the label. $required = !empty($element['#required']) ? theme('form_required_marker', array('element' => $element)) : ''; $title = filter_xss_admin($element['#title']); $attributes = array(); // Style the label as class option to display inline with the element. if ($element['#title_display'] == 'after') { $attributes['class'] = 'option'; } // Show label only to screen readers to avoid disruption in visual flows. elseif ($element['#title_display'] == 'invisible') { $attributes['class'] = 'element-invisible'; } if (!empty($element['#id'])) { $attributes['for'] = $element['#id']; } // The leading whitespace helps visually separate fields from inline labels. return ' ' . $t('!title !required', array('!title' => $title, '!required' => $required)) . "\n"; } /** * Sets a form element's class attribute. * * Adds 'required' and 'error' classes as needed. * * @param $element * The form element. * @param $name * Array of new class names to be added. */ function _form_set_class(&$element, $class = array()) { if (!empty($class)) { if (!isset($element['#attributes']['class'])) { $element['#attributes']['class'] = array(); } $element['#attributes']['class'] = array_merge($element['#attributes']['class'], $class); } // This function is invoked from form element theme functions, but the // rendered form element may not necessarily have been processed by // form_builder(). if (!empty($element['#required'])) { $element['#attributes']['class'][] = 'required'; } if (isset($element['#parents']) && form_get_error($element) !== NULL && !empty($element['#validated'])) { $element['#attributes']['class'][] = 'error'; } } /** * Form element validation handler for integer elements. */ function element_validate_integer($element, &$form_state) { $value = $element['#value']; if ($value !== '' && (!is_numeric($value) || intval($value) != $value)) { form_error($element, t('%name must be an integer.', array('%name' => $element['#title']))); } } /** * Form element validation handler for integer elements that must be positive. */ function element_validate_integer_positive($element, &$form_state) { $value = $element['#value']; if ($value !== '' && (!is_numeric($value) || intval($value) != $value || $value <= 0)) { form_error($element, t('%name must be a positive integer.', array('%name' => $element['#title']))); } } /** * Form element validation handler for number elements. */ function element_validate_number($element, &$form_state) { $value = $element['#value']; if ($value != '' && !is_numeric($value)) { form_error($element, t('%name must be a number.', array('%name' => $element['#title']))); } } /** * @} End of "defgroup form_api". */ /** * @defgroup batch Batch operations * @{ * Creates and processes batch operations. * * Functions allowing forms processing to be spread out over several page * requests, thus ensuring that the processing does not get interrupted * because of a PHP timeout, while allowing the user to receive feedback * on the progress of the ongoing operations. * * The API is primarily designed to integrate nicely with the Form API * workflow, but can also be used by non-Form API scripts (like update.php) * or even simple page callbacks (which should probably be used sparingly). * * Example: * @code * $batch = array( * 'title' => t('Exporting'), * 'operations' => array( * array('my_function_1', array($account->uid, 'story')), * array('my_function_2', array()), * ), * 'finished' => 'my_finished_callback', * 'file' => 'path_to_file_containing_myfunctions', * ); * batch_set($batch); * // Only needed if not inside a form _submit handler. * // Setting redirect in batch_process. * batch_process('node/1'); * @endcode * * Note: if the batch 'title', 'init_message', 'progress_message', or * 'error_message' could contain any user input, it is the responsibility of * the code calling batch_set() to sanitize them first with a function like * check_plain() or filter_xss(). Furthermore, if the batch operation * returns any user input in the 'results' or 'message' keys of $context, * it must also sanitize them first. * * Sample callback_batch_operation(): * @code * // Simple and artificial: load a node of a given type for a given user * function my_function_1($uid, $type, &$context) { * // The $context array gathers batch context information about the execution (read), * // as well as 'return values' for the current operation (write) * // The following keys are provided : * // 'results' (read / write): The array of results gathered so far by * // the batch processing, for the current operation to append its own. * // 'message' (write): A text message displayed in the progress page. * // The following keys allow for multi-step operations : * // 'sandbox' (read / write): An array that can be freely used to * // store persistent data between iterations. It is recommended to * // use this instead of $_SESSION, which is unsafe if the user * // continues browsing in a separate window while the batch is processing. * // 'finished' (write): A float number between 0 and 1 informing * // the processing engine of the completion level for the operation. * // 1 (or no value explicitly set) means the operation is finished * // and the batch processing can continue to the next operation. * * $node = node_load(array('uid' => $uid, 'type' => $type)); * $context['results'][] = $node->nid . ' : ' . check_plain($node->title); * $context['message'] = check_plain($node->title); * } * * // More advanced example: multi-step operation - load all nodes, five by five * function my_function_2(&$context) { * if (empty($context['sandbox'])) { * $context['sandbox']['progress'] = 0; * $context['sandbox']['current_node'] = 0; * $context['sandbox']['max'] = db_query('SELECT COUNT(DISTINCT nid) FROM {node}')->fetchField(); * } * $limit = 5; * $result = db_select('node') * ->fields('node', array('nid')) * ->condition('nid', $context['sandbox']['current_node'], '>') * ->orderBy('nid') * ->range(0, $limit) * ->execute(); * foreach ($result as $row) { * $node = node_load($row->nid, NULL, TRUE); * $context['results'][] = $node->nid . ' : ' . check_plain($node->title); * $context['sandbox']['progress']++; * $context['sandbox']['current_node'] = $node->nid; * $context['message'] = check_plain($node->title); * } * if ($context['sandbox']['progress'] != $context['sandbox']['max']) { * $context['finished'] = $context['sandbox']['progress'] / $context['sandbox']['max']; * } * } * @endcode * * Sample callback_batch_finished(): * @code * function my_finished_callback($success, $results, $operations) { * // The 'success' parameter means no fatal PHP errors were detected. All * // other error management should be handled using 'results'. * if ($success) { * $message = format_plural(count($results), 'One post processed.', '@count posts processed.'); * } * else { * $message = t('Finished with an error.'); * } * drupal_set_message($message); * // Providing data for the redirected page is done through $_SESSION. * foreach ($results as $result) { * $items[] = t('Loaded node %title.', array('%title' => $result)); * } * $_SESSION['my_batch_results'] = $items; * } * @endcode */ /** * Adds a new batch. * * Batch operations are added as new batch sets. Batch sets are used to spread * processing (primarily, but not exclusively, forms processing) over several * page requests. This helps to ensure that the processing is not interrupted * due to PHP timeouts, while users are still able to receive feedback on the * progress of the ongoing operations. Combining related operations into * distinct batch sets provides clean code independence for each batch set, * ensuring that two or more batches, submitted independently, can be processed * without mutual interference. Each batch set may specify its own set of * operations and results, produce its own UI messages, and trigger its own * 'finished' callback. Batch sets are processed sequentially, with the progress * bar starting afresh for each new set. * * @param $batch_definition * An associative array defining the batch, with the following elements (all * are optional except as noted): * - operations: (required) Array of operations to be performed, where each * item is an array consisting of the name of an implementation of * callback_batch_operation() and an array of parameter. * Example: * @code * array( * array('callback_batch_operation_1', array($arg1)), * array('callback_batch_operation_2', array($arg2_1, $arg2_2)), * ) * @endcode * - title: A safe, translated string to use as the title for the progress * page. Defaults to t('Processing'). * - init_message: Message displayed while the processing is initialized. * Defaults to t('Initializing.'). * - progress_message: Message displayed while processing the batch. Available * placeholders are @current, @remaining, @total, @percentage, @estimate and * @elapsed. Defaults to t('Completed @current of @total.'). * - error_message: Message displayed if an error occurred while processing * the batch. Defaults to t('An error has occurred.'). * - finished: Name of an implementation of callback_batch_finished(). This is * executed after the batch has completed. This should be used to perform * any result massaging that may be needed, and possibly save data in * $_SESSION for display after final page redirection. * - file: Path to the file containing the definitions of the 'operations' and * 'finished' functions, for instance if they don't reside in the main * .module file. The path should be relative to base_path(), and thus should * be built using drupal_get_path(). * - css: Array of paths to CSS files to be used on the progress page. * - url_options: options passed to url() when constructing redirect URLs for * the batch. */ function batch_set($batch_definition) { if ($batch_definition) { $batch =& batch_get(); // Initialize the batch if needed. if (empty($batch)) { $batch = array( 'sets' => array(), 'has_form_submits' => FALSE, ); } // Base and default properties for the batch set. // Use get_t() to allow batches during installation. $t = get_t(); $init = array( 'sandbox' => array(), 'results' => array(), 'success' => FALSE, 'start' => 0, 'elapsed' => 0, ); $defaults = array( 'title' => $t('Processing'), 'init_message' => $t('Initializing.'), 'progress_message' => $t('Completed @current of @total.'), 'error_message' => $t('An error has occurred.'), 'css' => array(), ); $batch_set = $init + $batch_definition + $defaults; // Tweak init_message to avoid the bottom of the page flickering down after // init phase. $batch_set['init_message'] .= '
                   '; // The non-concurrent workflow of batch execution allows us to save // numberOfItems() queries by handling our own counter. $batch_set['total'] = count($batch_set['operations']); $batch_set['count'] = $batch_set['total']; // Add the set to the batch. if (empty($batch['id'])) { // The batch is not running yet. Simply add the new set. $batch['sets'][] = $batch_set; } else { // The set is being added while the batch is running. Insert the new set // right after the current one to ensure execution order, and store its // operations in a queue. $index = $batch['current_set'] + 1; $slice1 = array_slice($batch['sets'], 0, $index); $slice2 = array_slice($batch['sets'], $index); $batch['sets'] = array_merge($slice1, array($batch_set), $slice2); _batch_populate_queue($batch, $index); } } } /** * Processes the batch. * * Unless the batch has been marked with 'progressive' = FALSE, the function * issues a drupal_goto and thus ends page execution. * * This function is generally not needed in form submit handlers; * Form API takes care of batches that were set during form submission. * * @param $redirect * (optional) Path to redirect to when the batch has finished processing. * @param $url * (optional - should only be used for separate scripts like update.php) * URL of the batch processing page. * @param $redirect_callback * (optional) Specify a function to be called to redirect to the progressive * processing page. By default drupal_goto() will be used to redirect to a * page which will do the progressive page. Specifying another function will * allow the progressive processing to be processed differently. */ function batch_process($redirect = NULL, $url = 'batch', $redirect_callback = 'drupal_goto') { $batch =& batch_get(); drupal_theme_initialize(); if (isset($batch)) { // Add process information $process_info = array( 'current_set' => 0, 'progressive' => TRUE, 'url' => $url, 'url_options' => array(), 'source_url' => $_GET['q'], 'redirect' => $redirect, 'theme' => $GLOBALS['theme_key'], 'redirect_callback' => $redirect_callback, ); $batch += $process_info; // The batch is now completely built. Allow other modules to make changes // to the batch so that it is easier to reuse batch processes in other // environments. drupal_alter('batch', $batch); // Assign an arbitrary id: don't rely on a serial column in the 'batch' // table, since non-progressive batches skip database storage completely. $batch['id'] = db_next_id(); // Move operations to a job queue. Non-progressive batches will use a // memory-based queue. foreach ($batch['sets'] as $key => $batch_set) { _batch_populate_queue($batch, $key); } // Initiate processing. if ($batch['progressive']) { // Now that we have a batch id, we can generate the redirection link in // the generic error message. $t = get_t(); $batch['error_message'] = $t('Please continue to the error page', array('@error_url' => url($url, array('query' => array('id' => $batch['id'], 'op' => 'finished'))))); // Clear the way for the drupal_goto() redirection to the batch processing // page, by saving and unsetting the 'destination', if there is any. if (isset($_GET['destination'])) { $batch['destination'] = $_GET['destination']; unset($_GET['destination']); } // Store the batch. db_insert('batch') ->fields(array( 'bid' => $batch['id'], 'timestamp' => REQUEST_TIME, 'token' => drupal_get_token($batch['id']), 'batch' => serialize($batch), )) ->execute(); // Set the batch number in the session to guarantee that it will stay alive. $_SESSION['batches'][$batch['id']] = TRUE; // Redirect for processing. $function = $batch['redirect_callback']; if (function_exists($function)) { $function($batch['url'], array('query' => array('op' => 'start', 'id' => $batch['id']))); } } else { // Non-progressive execution: bypass the whole progressbar workflow // and execute the batch in one pass. require_once DRUPAL_ROOT . '/includes/batch.inc'; _batch_process(); } } } /** * Retrieves the current batch. */ function &batch_get() { // Not drupal_static(), because Batch API operates at a lower level than most // use-cases for resetting static variables, and we specifically do not want a // global drupal_static_reset() resetting the batch information. Functions // that are part of the Batch API and need to reset the batch information may // call batch_get() and manipulate the result by reference. Functions that are // not part of the Batch API can also do this, but shouldn't. static $batch = array(); return $batch; } /** * Populates a job queue with the operations of a batch set. * * Depending on whether the batch is progressive or not, the BatchQueue or * BatchMemoryQueue handler classes will be used. * * @param $batch * The batch array. * @param $set_id * The id of the set to process. * * @return * The name and class of the queue are added by reference to the batch set. */ function _batch_populate_queue(&$batch, $set_id) { $batch_set = &$batch['sets'][$set_id]; if (isset($batch_set['operations'])) { $batch_set += array( 'queue' => array( 'name' => 'drupal_batch:' . $batch['id'] . ':' . $set_id, 'class' => $batch['progressive'] ? 'BatchQueue' : 'BatchMemoryQueue', ), ); $queue = _batch_queue($batch_set); $queue->createQueue(); foreach ($batch_set['operations'] as $operation) { $queue->createItem($operation); } unset($batch_set['operations']); } } /** * Returns a queue object for a batch set. * * @param $batch_set * The batch set. * * @return * The queue object. */ function _batch_queue($batch_set) { static $queues; // The class autoloader is not available when running update.php, so make // sure the files are manually included. if (!isset($queues)) { $queues = array(); require_once DRUPAL_ROOT . '/modules/system/system.queue.inc'; require_once DRUPAL_ROOT . '/includes/batch.queue.inc'; } if (isset($batch_set['queue'])) { $name = $batch_set['queue']['name']; $class = $batch_set['queue']['class']; if (!isset($queues[$class][$name])) { $queues[$class][$name] = new $class($name); } return $queues[$class][$name]; } } /** * @} End of "defgroup batch". */ drupal-7.41/includes/session.inc0000644000000000000000000004366612611765734015451 0ustar rootroot $sid))->fetchObject(); if (!$user) { if (isset($_COOKIE[$insecure_session_name])) { $user = db_query("SELECT u.*, s.* FROM {users} u INNER JOIN {sessions} s ON u.uid = s.uid WHERE s.sid = :sid AND s.uid = 0", array( ':sid' => $_COOKIE[$insecure_session_name])) ->fetchObject(); } } } else { $user = db_query("SELECT u.*, s.* FROM {users} u INNER JOIN {sessions} s ON u.uid = s.uid WHERE s.sid = :sid", array(':sid' => $sid))->fetchObject(); } // We found the client's session record and they are an authenticated, // active user. if ($user && $user->uid > 0 && $user->status == 1) { // This is done to unserialize the data member of $user. $user->data = unserialize($user->data); // Add roles element to $user. $user->roles = array(); $user->roles[DRUPAL_AUTHENTICATED_RID] = 'authenticated user'; $user->roles += db_query("SELECT r.rid, r.name FROM {role} r INNER JOIN {users_roles} ur ON ur.rid = r.rid WHERE ur.uid = :uid", array(':uid' => $user->uid))->fetchAllKeyed(0, 1); } elseif ($user) { // The user is anonymous or blocked. Only preserve two fields from the // {sessions} table. $account = drupal_anonymous_user(); $account->session = $user->session; $account->timestamp = $user->timestamp; $user = $account; } else { // The session has expired. $user = drupal_anonymous_user(); $user->session = ''; } // Store the session that was read for comparison in _drupal_session_write(). $last_read = &drupal_static('drupal_session_last_read'); $last_read = array( 'sid' => $sid, 'value' => $user->session, ); return $user->session; } /** * Writes an entire session to the database (internal use only). * * This function is registered with session_set_save_handler() to support * database-backed sessions. * * This function is an internal function and must not be called directly. * Doing so may result in corrupted session data or other unexpected behavior. * Session data must always be accessed via the $_SESSION superglobal. * * @param $sid * The session ID of the session to write to. * @param $value * Session data to write as a serialized string. * * @return * Always returns TRUE. */ function _drupal_session_write($sid, $value) { global $user, $is_https; // The exception handler is not active at this point, so we need to do it // manually. try { if (!drupal_save_session()) { // We don't have anything to do if we are not allowed to save the session. return; } // Check whether $_SESSION has been changed in this request. $last_read = &drupal_static('drupal_session_last_read'); $is_changed = !isset($last_read) || $last_read['sid'] != $sid || $last_read['value'] !== $value; // For performance reasons, do not update the sessions table, unless // $_SESSION has changed or more than 180 has passed since the last update. if ($is_changed || !isset($user->timestamp) || REQUEST_TIME - $user->timestamp > variable_get('session_write_interval', 180)) { // Either ssid or sid or both will be added from $key below. $fields = array( 'uid' => $user->uid, 'cache' => isset($user->cache) ? $user->cache : 0, 'hostname' => ip_address(), 'session' => $value, 'timestamp' => REQUEST_TIME, ); // Use the session ID as 'sid' and an empty string as 'ssid' by default. // _drupal_session_read() does not allow empty strings so that's a safe // default. $key = array('sid' => $sid, 'ssid' => ''); // On HTTPS connections, use the session ID as both 'sid' and 'ssid'. if ($is_https) { $key['ssid'] = $sid; // The "secure pages" setting allows a site to simultaneously use both // secure and insecure session cookies. If enabled and both cookies are // presented then use both keys. if (variable_get('https', FALSE)) { $insecure_session_name = substr(session_name(), 1); if (isset($_COOKIE[$insecure_session_name])) { $key['sid'] = $_COOKIE[$insecure_session_name]; } } } elseif (variable_get('https', FALSE)) { unset($key['ssid']); } db_merge('sessions') ->key($key) ->fields($fields) ->execute(); } // Likewise, do not update access time more than once per 180 seconds. if ($user->uid && REQUEST_TIME - $user->access > variable_get('session_write_interval', 180)) { db_update('users') ->fields(array( 'access' => REQUEST_TIME )) ->condition('uid', $user->uid) ->execute(); } return TRUE; } catch (Exception $exception) { require_once DRUPAL_ROOT . '/includes/errors.inc'; // If we are displaying errors, then do so with no possibility of a further // uncaught exception being thrown. if (error_displayable()) { print '

                  Uncaught exception thrown in session handler.

                  '; print '

                  ' . _drupal_render_exception_safe($exception) . '

                  '; } return FALSE; } } /** * Initializes the session handler, starting a session if needed. */ function drupal_session_initialize() { global $user, $is_https; session_set_save_handler('_drupal_session_open', '_drupal_session_close', '_drupal_session_read', '_drupal_session_write', '_drupal_session_destroy', '_drupal_session_garbage_collection'); // We use !empty() in the following check to ensure that blank session IDs // are not valid. if (!empty($_COOKIE[session_name()]) || ($is_https && variable_get('https', FALSE) && !empty($_COOKIE[substr(session_name(), 1)]))) { // If a session cookie exists, initialize the session. Otherwise the // session is only started on demand in drupal_session_commit(), making // anonymous users not use a session cookie unless something is stored in // $_SESSION. This allows HTTP proxies to cache anonymous pageviews. drupal_session_start(); if (!empty($user->uid) || !empty($_SESSION)) { drupal_page_is_cacheable(FALSE); } } else { // Set a session identifier for this request. This is necessary because // we lazily start sessions at the end of this request, and some // processes (like drupal_get_token()) needs to know the future // session ID in advance. $GLOBALS['lazy_session'] = TRUE; $user = drupal_anonymous_user(); // Less random sessions (which are much faster to generate) are used for // anonymous users than are generated in drupal_session_regenerate() when // a user becomes authenticated. session_id(drupal_random_key()); if ($is_https && variable_get('https', FALSE)) { $insecure_session_name = substr(session_name(), 1); $session_id = drupal_random_key(); $_COOKIE[$insecure_session_name] = $session_id; } } date_default_timezone_set(drupal_get_user_timezone()); } /** * Starts a session forcefully, preserving already set session data. * * @ingroup php_wrappers */ function drupal_session_start() { // Command line clients do not support cookies nor sessions. if (!drupal_session_started() && !drupal_is_cli()) { // Save current session data before starting it, as PHP will destroy it. $session_data = isset($_SESSION) ? $_SESSION : NULL; session_start(); drupal_session_started(TRUE); // Restore session data. if (!empty($session_data)) { $_SESSION += $session_data; } } } /** * Commits the current session, if necessary. * * If an anonymous user already have an empty session, destroy it. */ function drupal_session_commit() { global $user, $is_https; if (!drupal_save_session()) { // We don't have anything to do if we are not allowed to save the session. return; } if (empty($user->uid) && empty($_SESSION)) { // There is no session data to store, destroy the session if it was // previously started. if (drupal_session_started()) { session_destroy(); } } else { // There is session data to store. Start the session if it is not already // started. if (!drupal_session_started()) { drupal_session_start(); if ($is_https && variable_get('https', FALSE)) { $insecure_session_name = substr(session_name(), 1); $params = session_get_cookie_params(); $expire = $params['lifetime'] ? REQUEST_TIME + $params['lifetime'] : 0; setcookie($insecure_session_name, $_COOKIE[$insecure_session_name], $expire, $params['path'], $params['domain'], FALSE, $params['httponly']); } } // Write the session data. session_write_close(); } } /** * Returns whether a session has been started. */ function drupal_session_started($set = NULL) { static $session_started = FALSE; if (isset($set)) { $session_started = $set; } return $session_started && session_id(); } /** * Called when an anonymous user becomes authenticated or vice-versa. * * @ingroup php_wrappers */ function drupal_session_regenerate() { global $user, $is_https; // Nothing to do if we are not allowed to change the session. if (!drupal_save_session()) { return; } if ($is_https && variable_get('https', FALSE)) { $insecure_session_name = substr(session_name(), 1); if (!isset($GLOBALS['lazy_session']) && isset($_COOKIE[$insecure_session_name])) { $old_insecure_session_id = $_COOKIE[$insecure_session_name]; } $params = session_get_cookie_params(); $session_id = drupal_random_key(); // If a session cookie lifetime is set, the session will expire // $params['lifetime'] seconds from the current request. If it is not set, // it will expire when the browser is closed. $expire = $params['lifetime'] ? REQUEST_TIME + $params['lifetime'] : 0; setcookie($insecure_session_name, $session_id, $expire, $params['path'], $params['domain'], FALSE, $params['httponly']); $_COOKIE[$insecure_session_name] = $session_id; } if (drupal_session_started()) { $old_session_id = session_id(); } session_id(drupal_random_key()); if (isset($old_session_id)) { $params = session_get_cookie_params(); $expire = $params['lifetime'] ? REQUEST_TIME + $params['lifetime'] : 0; setcookie(session_name(), session_id(), $expire, $params['path'], $params['domain'], $params['secure'], $params['httponly']); $fields = array('sid' => session_id()); if ($is_https) { $fields['ssid'] = session_id(); // If the "secure pages" setting is enabled, use the newly-created // insecure session identifier as the regenerated sid. if (variable_get('https', FALSE)) { $fields['sid'] = $session_id; } } db_update('sessions') ->fields($fields) ->condition($is_https ? 'ssid' : 'sid', $old_session_id) ->execute(); } elseif (isset($old_insecure_session_id)) { // If logging in to the secure site, and there was no active session on the // secure site but a session was active on the insecure site, update the // insecure session with the new session identifiers. db_update('sessions') ->fields(array('sid' => $session_id, 'ssid' => session_id())) ->condition('sid', $old_insecure_session_id) ->execute(); } else { // Start the session when it doesn't exist yet. // Preserve the logged in user, as it will be reset to anonymous // by _drupal_session_read. $account = $user; drupal_session_start(); $user = $account; } date_default_timezone_set(drupal_get_user_timezone()); } /** * Session handler assigned by session_set_save_handler(). * * Cleans up a specific session. * * @param $sid * Session ID. */ function _drupal_session_destroy($sid) { global $user, $is_https; // Nothing to do if we are not allowed to change the session. if (!drupal_save_session()) { return; } // Delete session data. db_delete('sessions') ->condition($is_https ? 'ssid' : 'sid', $sid) ->execute(); // Reset $_SESSION and $user to prevent a new session from being started // in drupal_session_commit(). $_SESSION = array(); $user = drupal_anonymous_user(); // Unset the session cookies. _drupal_session_delete_cookie(session_name()); if ($is_https) { _drupal_session_delete_cookie(substr(session_name(), 1), FALSE); } elseif (variable_get('https', FALSE)) { _drupal_session_delete_cookie('S' . session_name(), TRUE); } } /** * Deletes the session cookie. * * @param $name * Name of session cookie to delete. * @param boolean $secure * Force the secure value of the cookie. */ function _drupal_session_delete_cookie($name, $secure = NULL) { global $is_https; if (isset($_COOKIE[$name]) || (!$is_https && $secure === TRUE)) { $params = session_get_cookie_params(); if ($secure !== NULL) { $params['secure'] = $secure; } setcookie($name, '', REQUEST_TIME - 3600, $params['path'], $params['domain'], $params['secure'], $params['httponly']); unset($_COOKIE[$name]); } } /** * Ends a specific user's session(s). * * @param $uid * User ID. */ function drupal_session_destroy_uid($uid) { // Nothing to do if we are not allowed to change the session. if (!drupal_save_session()) { return; } db_delete('sessions') ->condition('uid', $uid) ->execute(); } /** * Session handler assigned by session_set_save_handler(). * * Cleans up stalled sessions. * * @param $lifetime * The value of session.gc_maxlifetime, passed by PHP. * Sessions not updated for more than $lifetime seconds will be removed. */ function _drupal_session_garbage_collection($lifetime) { // Be sure to adjust 'php_value session.gc_maxlifetime' to a large enough // value. For example, if you want user sessions to stay in your database // for three weeks before deleting them, you need to set gc_maxlifetime // to '1814400'. At that value, only after a user doesn't log in after // three weeks (1814400 seconds) will his/her session be removed. db_delete('sessions') ->condition('timestamp', REQUEST_TIME - $lifetime, '<') ->execute(); return TRUE; } /** * Determines whether to save session data of the current request. * * This function allows the caller to temporarily disable writing of * session data, should the request end while performing potentially * dangerous operations, such as manipulating the global $user object. * See http://drupal.org/node/218104 for usage. * * @param $status * Disables writing of session data when FALSE, (re-)enables * writing when TRUE. * * @return * FALSE if writing session data has been disabled. Otherwise, TRUE. */ function drupal_save_session($status = NULL) { // PHP session ID, session, and cookie handling happens in the global scope. // This value has to persist across calls to drupal_static_reset(), since a // potentially wrong or disallowed session would be written otherwise. static $save_session = TRUE; if (isset($status)) { $save_session = $status; } return $save_session; } drupal-7.41/includes/update.inc0000644000000000000000000016337612611765734015251 0ustar rootrootname, $row->type)) { $incompatible[] = $row->name; } } if (!empty($incompatible)) { db_update('system') ->fields(array('status' => 0)) ->condition('name', $incompatible, 'IN') ->execute(); } } /** * Tests the compatibility of a module or theme. */ function update_check_incompatibility($name, $type = 'module') { static $themes, $modules; // Store values of expensive functions for future use. if (empty($themes) || empty($modules)) { // We need to do a full rebuild here to make sure the database reflects any // code changes that were made in the filesystem before the update script // was initiated. $themes = system_rebuild_theme_data(); $modules = system_rebuild_module_data(); } if ($type == 'module' && isset($modules[$name])) { $file = $modules[$name]; } elseif ($type == 'theme' && isset($themes[$name])) { $file = $themes[$name]; } if (!isset($file) || !isset($file->info['core']) || $file->info['core'] != DRUPAL_CORE_COMPATIBILITY || version_compare(phpversion(), $file->info['php']) < 0) { return TRUE; } return FALSE; } /** * Performs extra steps required to bootstrap when using a Drupal 6 database. * * Users who still have a Drupal 6 database (and are in the process of * updating to Drupal 7) need extra help before a full bootstrap can be * achieved. This function does the necessary preliminary work that allows * the bootstrap to be successful. * * No access check has been performed when this function is called, so no * irreversible changes to the database are made here. */ function update_prepare_d7_bootstrap() { // Allow the bootstrap to proceed even if a Drupal 6 settings.php file is // still being used. include_once DRUPAL_ROOT . '/includes/install.inc'; drupal_bootstrap(DRUPAL_BOOTSTRAP_CONFIGURATION); global $databases, $db_url, $db_prefix, $update_rewrite_settings; if (empty($databases) && !empty($db_url)) { $databases = update_parse_db_url($db_url, $db_prefix); // Record the fact that the settings.php file will need to be rewritten. $update_rewrite_settings = TRUE; $settings_file = conf_path() . '/settings.php'; $writable = drupal_verify_install_file($settings_file, FILE_EXIST|FILE_READABLE|FILE_WRITABLE); $requirements = array( 'settings file' => array( 'title' => 'Settings file', 'value' => $writable ? 'The settings file is writable.' : 'The settings file is not writable.', 'severity' => $writable ? REQUIREMENT_OK : REQUIREMENT_ERROR, 'description' => $writable ? '' : 'Drupal requires write permissions to ' . $settings_file . ' during the update process. If you are unsure how to grant file permissions, consult the online handbook.', ), ); update_extra_requirements($requirements); } // The new {blocked_ips} table is used in Drupal 7 to store a list of // banned IP addresses. If this table doesn't exist then we are still // running on a Drupal 6 database, so we suppress the unavoidable errors // that occur by creating a static list. $GLOBALS['conf']['blocked_ips'] = array(); // Check that PDO is available and that the correct PDO database driver is // loaded. Bootstrapping to DRUPAL_BOOTSTRAP_DATABASE will result in a fatal // error otherwise. $message = ''; $pdo_link = 'http://drupal.org/requirements/pdo'; // Check that PDO is loaded. if (!extension_loaded('pdo')) { $message = '

                  PDO is required!

                  Drupal 7 requires PHP ' . DRUPAL_MINIMUM_PHP . ' or higher with the PHP Data Objects (PDO) extension enabled.

                  '; } // The PDO::ATTR_DEFAULT_FETCH_MODE constant is not available in the PECL // version of PDO. elseif (!defined('PDO::ATTR_DEFAULT_FETCH_MODE')) { $message = '

                  The wrong version of PDO is installed!

                  Drupal 7 requires the PHP Data Objects (PDO) extension from PHP core to be enabled. This system has the older PECL version installed.'; $pdo_link = 'http://drupal.org/requirements/pdo#pecl'; } // Check that the correct driver is loaded for the database being updated. // If we have no driver information (for example, if someone tried to create // the Drupal 7 $databases array themselves but did not do it correctly), // this message will be confusing, so do not perform the check; instead, just // let the database connection fail in the code that follows. elseif (isset($databases['default']['default']['driver']) && !in_array($databases['default']['default']['driver'], PDO::getAvailableDrivers())) { $message = '

                  A PDO database driver is required!

                  You need to enable the PDO_' . strtoupper($databases['default']['default']['driver']) . ' database driver for PHP ' . DRUPAL_MINIMUM_PHP . ' or higher so that Drupal 7 can access the database.

                  '; } if ($message) { print $message . '

                  See the system requirements page for more information.

                  '; exit(); } // Allow the database system to work even if the registry has not been // created yet. drupal_bootstrap(DRUPAL_BOOTSTRAP_DATABASE); // If the site has not updated to Drupal 7 yet, check to make sure that it is // running an up-to-date version of Drupal 6 before proceeding. Note this has // to happen AFTER the database bootstraps because of // drupal_get_installed_schema_version(). $system_schema = drupal_get_installed_schema_version('system'); if ($system_schema < 7000) { $has_required_schema = $system_schema >= REQUIRED_D6_SCHEMA_VERSION; $requirements = array( 'drupal 6 version' => array( 'title' => 'Drupal 6 version', 'value' => $has_required_schema ? 'You are running a current version of Drupal 6.' : 'You are not running a current version of Drupal 6', 'severity' => $has_required_schema ? REQUIREMENT_OK : REQUIREMENT_ERROR, 'description' => $has_required_schema ? '' : 'Please update your Drupal 6 installation to the most recent version before attempting to upgrade to Drupal 7', ), ); // Make sure that the database environment is properly set up. try { db_run_tasks(db_driver()); } catch (DatabaseTaskException $e) { $requirements['database tasks'] = array( 'title' => 'Database environment', 'value' => 'There is a problem with your database environment', 'severity' => REQUIREMENT_ERROR, 'description' => $e->getMessage(), ); } update_extra_requirements($requirements); // Allow a D6 session to work, since the upgrade has not been performed yet. $d6_session_name = update_get_d6_session_name(); if (!empty($_COOKIE[$d6_session_name])) { // Set the current sid to the one found in the D6 cookie. $sid = $_COOKIE[$d6_session_name]; $_COOKIE[session_name()] = $sid; session_id($sid); } // Upgrading from D6 to D7.{0,1,2,3,4,8,...} is different than upgrading // from D6 to D7.{5,6,7} which should be considered broken. To be able to // properly handle this difference in node_update_7012 we need to keep track // of whether a D6 > D7 upgrade or a D7 > D7 update is running. // Since variable_set() is not available here, the D6 status is being saved // in a local variable to be able to store it later. $update_d6 = TRUE; } // Create the registry tables. if (!db_table_exists('registry')) { $schema['registry'] = array( 'fields' => array( 'name' => array('type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => ''), 'type' => array('type' => 'varchar', 'length' => 9, 'not null' => TRUE, 'default' => ''), 'filename' => array('type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => ''), 'module' => array('type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => ''), 'weight' => array('type' => 'int', 'not null' => TRUE, 'default' => 0), ), 'primary key' => array('name', 'type'), 'indexes' => array( 'hook' => array('type', 'weight', 'module'), ), ); db_create_table('registry', $schema['registry']); } if (!db_table_exists('registry_file')) { $schema['registry_file'] = array( 'fields' => array( 'filename' => array('type' => 'varchar', 'length' => 255, 'not null' => TRUE), 'hash' => array('type' => 'varchar', 'length' => 64, 'not null' => TRUE), ), 'primary key' => array('filename'), ); db_create_table('registry_file', $schema['registry_file']); } // Older versions of Drupal 6 do not include the semaphore table, which is // required to bootstrap, so we add it now so that we can bootstrap and // provide a reasonable error message. if (!db_table_exists('semaphore')) { $semaphore = array( 'description' => 'Table for holding semaphores, locks, flags, etc. that cannot be stored as Drupal variables since they must not be cached.', 'fields' => array( 'name' => array( 'description' => 'Primary Key: Unique name.', 'type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => '' ), 'value' => array( 'description' => 'A value for the semaphore.', 'type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => '' ), 'expire' => array( 'description' => 'A Unix timestamp with microseconds indicating when the semaphore should expire.', 'type' => 'float', 'size' => 'big', 'not null' => TRUE ), ), 'indexes' => array( 'value' => array('value'), 'expire' => array('expire'), ), 'primary key' => array('name'), ); db_create_table('semaphore', $semaphore); } // The new cache_bootstrap bin is required to bootstrap to // DRUPAL_BOOTSTRAP_SESSION, so create it here rather than in // update_fix_d7_requirements(). if (!db_table_exists('cache_bootstrap')) { $cache_bootstrap = array( 'description' => 'Cache table for data required to bootstrap Drupal, may be routed to a shared memory cache.', 'fields' => array( 'cid' => array( 'description' => 'Primary Key: Unique cache ID.', 'type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => '', ), 'data' => array( 'description' => 'A collection of data to cache.', 'type' => 'blob', 'not null' => FALSE, 'size' => 'big', ), 'expire' => array( 'description' => 'A Unix timestamp indicating when the cache entry should expire, or 0 for never.', 'type' => 'int', 'not null' => TRUE, 'default' => 0, ), 'created' => array( 'description' => 'A Unix timestamp indicating when the cache entry was created.', 'type' => 'int', 'not null' => TRUE, 'default' => 0, ), 'serialized' => array( 'description' => 'A flag to indicate whether content is serialized (1) or not (0).', 'type' => 'int', 'size' => 'small', 'not null' => TRUE, 'default' => 0, ), ), 'indexes' => array( 'expire' => array('expire'), ), 'primary key' => array('cid'), ); db_create_table('cache_bootstrap', $cache_bootstrap); } // Set a valid timezone for 6 -> 7 upgrade process. drupal_bootstrap(DRUPAL_BOOTSTRAP_VARIABLES); $timezone_offset = variable_get('date_default_timezone', 0); if (is_numeric($timezone_offset)) { // Save the original offset. variable_set('date_temporary_timezone', $timezone_offset); // Set the timezone for this request only. $GLOBALS['conf']['date_default_timezone'] = 'UTC'; } // This allows update functions to tell if an upgrade from D6 is running. if (!empty($update_d6)) { variable_set('update_d6', TRUE); } } /** * A helper function that modules can use to assist with the transformation * from numeric block deltas to string block deltas during the 6.x -> 7.x * upgrade. * * @todo This function should be removed in 8.x. * * @param $sandbox * An array holding data for the batch process. * @param $renamed_deltas * An associative array. Keys are module names, values an associative array * mapping the old block deltas to the new block deltas for the module. * Example: * @code * $renamed_deltas = array( * 'mymodule' => * array( * 0 => 'mymodule-block-1', * 1 => 'mymodule-block-2', * ), * ); * @endcode * @param $moved_deltas * An associative array. Keys are source module names, values an associative * array mapping the (possibly renamed) block name to the new module name. * Example: * @code * $moved_deltas = array( * 'user' => * array( * 'navigation' => 'system', * ), * ); * @endcode */ function update_fix_d7_block_deltas(&$sandbox, $renamed_deltas, $moved_deltas) { // Loop through each block and make changes to the block tables. // Only run this the first time through the batch update. if (!isset($sandbox['progress'])) { // Determine whether to use the old or new block table names. $block_tables = db_table_exists('blocks') ? array('blocks', 'blocks_roles') : array('block', 'block_role'); foreach ($block_tables as $table) { foreach ($renamed_deltas as $module => $deltas) { foreach ($deltas as $old_delta => $new_delta) { // Only do the update if the old block actually exists. $block_exists = db_query("SELECT COUNT(*) FROM {" . $table . "} WHERE module = :module AND delta = :delta", array( ':module' => $module, ':delta' => $old_delta, )) ->fetchField(); if ($block_exists) { // Delete any existing blocks with the new module+delta. db_delete($table) ->condition('module', $module) ->condition('delta', $new_delta) ->execute(); // Rename the old block to the new module+delta. db_update($table) ->fields(array('delta' => $new_delta)) ->condition('module', $module) ->condition('delta', $old_delta) ->execute(); } } } foreach ($moved_deltas as $old_module => $deltas) { foreach ($deltas as $delta => $new_module) { // Only do the update if the old block actually exists. $block_exists = db_query("SELECT COUNT(*) FROM {" . $table . "} WHERE module = :module AND delta = :delta", array( ':module' => $old_module, ':delta' => $delta, )) ->fetchField(); if ($block_exists) { // Delete any existing blocks with the new module+delta. db_delete($table) ->condition('module', $new_module) ->condition('delta', $delta) ->execute(); // Rename the old block to the new module+delta. db_update($table) ->fields(array('module' => $new_module)) ->condition('module', $old_module) ->condition('delta', $delta) ->execute(); } } } } // Initialize batch update information. $sandbox['progress'] = 0; $sandbox['last_user_processed'] = -1; $sandbox['max'] = db_query("SELECT COUNT(*) FROM {users} WHERE data LIKE :block", array( ':block' => '%' . db_like(serialize('block')) . '%', )) ->fetchField(); } // Now do the batch update of the user-specific block visibility settings. $limit = 100; $result = db_select('users', 'u') ->fields('u', array('uid', 'data')) ->condition('uid', $sandbox['last_user_processed'], '>') ->condition('data', '%' . db_like(serialize('block')) . '%', 'LIKE') ->orderBy('uid', 'ASC') ->range(0, $limit) ->execute(); foreach ($result as $row) { $data = unserialize($row->data); $user_needs_update = FALSE; foreach ($renamed_deltas as $module => $deltas) { foreach ($deltas as $old_delta => $new_delta) { if (isset($data['block'][$module][$old_delta])) { // Transfer the old block visibility settings to the newly-renamed // block, and mark this user for a database update. $data['block'][$module][$new_delta] = $data['block'][$module][$old_delta]; unset($data['block'][$module][$old_delta]); $user_needs_update = TRUE; } } } foreach ($moved_deltas as $old_module => $deltas) { foreach ($deltas as $delta => $new_module) { if (isset($data['block'][$old_module][$delta])) { // Transfer the old block visibility settings to the moved // block, and mark this user for a database update. $data['block'][$new_module][$delta] = $data['block'][$old_module][$delta]; unset($data['block'][$old_module][$delta]); $user_needs_update = TRUE; } } } // Update the current user. if ($user_needs_update) { db_update('users') ->fields(array('data' => serialize($data))) ->condition('uid', $row->uid) ->execute(); } // Update our progress information for the batch update. $sandbox['progress']++; $sandbox['last_user_processed'] = $row->uid; } // Indicate our current progress to the batch update system. if ($sandbox['progress'] < $sandbox['max']) { $sandbox['#finished'] = $sandbox['progress'] / $sandbox['max']; } } /** * Perform Drupal 6.x to 7.x updates that are required for update.php * to function properly. * * This function runs when update.php is run the first time for 7.x, * even before updates are selected or performed. It is important * that if updates are not ultimately performed that no changes are * made which make it impossible to continue using the prior version. */ function update_fix_d7_requirements() { global $conf; // Rewrite the settings.php file if necessary, see // update_prepare_d7_bootstrap(). global $update_rewrite_settings, $db_url, $db_prefix; if (!empty($update_rewrite_settings)) { $databases = update_parse_db_url($db_url, $db_prefix); $salt = drupal_hash_base64(drupal_random_bytes(55)); file_put_contents(conf_path() . '/settings.php', "\n" . '$databases = ' . var_export($databases, TRUE) . ";\n\$drupal_hash_salt = '$salt';", FILE_APPEND); } if (drupal_get_installed_schema_version('system') < 7000 && !variable_get('update_d7_requirements', FALSE)) { // Change 6.x system table field values to 7.x equivalent. // Change field values. db_change_field('system', 'schema_version', 'schema_version', array( 'type' => 'int', 'size' => 'small', 'not null' => TRUE, 'default' => -1) ); db_change_field('system', 'status', 'status', array( 'type' => 'int', 'not null' => TRUE, 'default' => 0)); db_change_field('system', 'weight', 'weight', array( 'type' => 'int', 'not null' => TRUE, 'default' => 0)); db_change_field('system', 'bootstrap', 'bootstrap', array( 'type' => 'int', 'not null' => TRUE, 'default' => 0)); // Drop and recreate 6.x indexes. db_drop_index('system', 'bootstrap'); db_add_index('system', 'bootstrap', array( 'status', 'bootstrap', array('type', 12), 'weight', 'name')); db_drop_index('system' ,'modules'); db_add_index('system', 'modules', array(array( 'type', 12), 'status', 'weight', 'name')); db_drop_index('system', 'type_name'); db_add_index('system', 'type_name', array(array('type', 12), 'name')); // Add 7.x indexes. db_add_index('system', 'system_list', array('weight', 'name')); // Add the cache_path table. if (db_table_exists('cache_path')) { db_drop_table('cache_path'); } require_once('./modules/system/system.install'); $schema['cache_path'] = system_schema_cache_7054(); $schema['cache_path']['description'] = 'Cache table used for path alias lookups.'; db_create_table('cache_path', $schema['cache_path']); // system_update_7042() renames columns, but these are needed to bootstrap. // Add empty columns for now. db_add_field('url_alias', 'source', array('type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => '')); db_add_field('url_alias', 'alias', array('type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => '')); // Add new columns to {menu_router}. db_add_field('menu_router', 'delivery_callback', array('type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => '')); db_add_field('menu_router', 'context', array( 'description' => 'Only for local tasks (tabs) - the context of a local task to control its placement.', 'type' => 'int', 'not null' => TRUE, 'default' => 0, )); db_drop_index('menu_router', 'tab_parent'); db_add_index('menu_router', 'tab_parent', array(array('tab_parent', 64), 'weight', 'title')); db_add_field('menu_router', 'theme_callback', array('type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => '')); db_add_field('menu_router', 'theme_arguments', array('type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => '')); // Add the role_permission table. $schema['role_permission'] = array( 'fields' => array( 'rid' => array( 'type' => 'int', 'unsigned' => TRUE, 'not null' => TRUE, ), 'permission' => array( 'type' => 'varchar', 'length' => 128, 'not null' => TRUE, 'default' => '', ), ), 'primary key' => array('rid', 'permission'), 'indexes' => array( 'permission' => array('permission'), ), ); db_create_table('role_permission', $schema['role_permission']); // Drops and recreates semaphore value index. db_drop_index('semaphore', 'value'); db_add_index('semaphore', 'value', array('value')); $schema['date_format_type'] = array( 'description' => 'Stores configured date format types.', 'fields' => array( 'type' => array( 'description' => 'The date format type, e.g. medium.', 'type' => 'varchar', 'length' => 64, 'not null' => TRUE, ), 'title' => array( 'description' => 'The human readable name of the format type.', 'type' => 'varchar', 'length' => 255, 'not null' => TRUE, ), 'locked' => array( 'description' => 'Whether or not this is a system provided format.', 'type' => 'int', 'size' => 'tiny', 'default' => 0, 'not null' => TRUE, ), ), 'primary key' => array('type'), ); $schema['date_formats'] = array( 'description' => 'Stores configured date formats.', 'fields' => array( 'dfid' => array( 'description' => 'The date format identifier.', 'type' => 'serial', 'not null' => TRUE, 'unsigned' => TRUE, ), 'format' => array( 'description' => 'The date format string.', 'type' => 'varchar', 'length' => 100, 'not null' => TRUE, ), 'type' => array( 'description' => 'The date format type, e.g. medium.', 'type' => 'varchar', 'length' => 64, 'not null' => TRUE, ), 'locked' => array( 'description' => 'Whether or not this format can be modified.', 'type' => 'int', 'size' => 'tiny', 'default' => 0, 'not null' => TRUE, ), ), 'primary key' => array('dfid'), 'unique keys' => array('formats' => array('format', 'type')), ); $schema['date_format_locale'] = array( 'description' => 'Stores configured date formats for each locale.', 'fields' => array( 'format' => array( 'description' => 'The date format string.', 'type' => 'varchar', 'length' => 100, 'not null' => TRUE, ), 'type' => array( 'description' => 'The date format type, e.g. medium.', 'type' => 'varchar', 'length' => 64, 'not null' => TRUE, ), 'language' => array( 'description' => 'A {languages}.language for this format to be used with.', 'type' => 'varchar', 'length' => 12, 'not null' => TRUE, ), ), 'primary key' => array('type', 'language'), ); db_create_table('date_format_type', $schema['date_format_type']); // Sites that have the Drupal 6 Date module installed already have the // following tables. if (db_table_exists('date_formats')) { db_rename_table('date_formats', 'd6_date_formats'); } db_create_table('date_formats', $schema['date_formats']); if (db_table_exists('date_format_locale')) { db_rename_table('date_format_locale', 'd6_date_format_locale'); } db_create_table('date_format_locale', $schema['date_format_locale']); // Add the queue table. $schema['queue'] = array( 'description' => 'Stores items in queues.', 'fields' => array( 'item_id' => array( 'type' => 'serial', 'unsigned' => TRUE, 'not null' => TRUE, 'description' => 'Primary Key: Unique item ID.', ), 'name' => array( 'type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => '', 'description' => 'The queue name.', ), 'data' => array( 'type' => 'blob', 'not null' => FALSE, 'size' => 'big', 'serialize' => TRUE, 'description' => 'The arbitrary data for the item.', ), 'expire' => array( 'type' => 'int', 'not null' => TRUE, 'default' => 0, 'description' => 'Timestamp when the claim lease expires on the item.', ), 'created' => array( 'type' => 'int', 'not null' => TRUE, 'default' => 0, 'description' => 'Timestamp when the item was created.', ), ), 'primary key' => array('item_id'), 'indexes' => array( 'name_created' => array('name', 'created'), 'expire' => array('expire'), ), ); // Check for queue table that may remain from D5 or D6, if found //drop it. if (db_table_exists('queue')) { db_drop_table('queue'); } db_create_table('queue', $schema['queue']); // Create the sequences table. $schema['sequences'] = array( 'description' => 'Stores IDs.', 'fields' => array( 'value' => array( 'description' => 'The value of the sequence.', 'type' => 'serial', 'unsigned' => TRUE, 'not null' => TRUE, ), ), 'primary key' => array('value'), ); // Check for sequences table that may remain from D5 or D6, if found //drop it. if (db_table_exists('sequences')) { db_drop_table('sequences'); } db_create_table('sequences', $schema['sequences']); // Initialize the table with the maximum current increment of the tables // that will rely on it for their ids. $max_aid = db_query('SELECT MAX(aid) FROM {actions_aid}')->fetchField(); $max_uid = db_query('SELECT MAX(uid) FROM {users}')->fetchField(); $max_batch_id = db_query('SELECT MAX(bid) FROM {batch}')->fetchField(); db_insert('sequences')->fields(array('value' => max($max_aid, $max_uid, $max_batch_id)))->execute(); // Add column for locale context. if (db_table_exists('locales_source')) { db_add_field('locales_source', 'context', array('type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => '', 'description' => 'The context this string applies to.')); } // Rename 'site_offline_message' variable to 'maintenance_mode_message' // and 'site_offline' variable to 'maintenance_mode'. // Old variable is removed in update for system.module, see // system_update_7072(). if ($message = variable_get('site_offline_message', NULL)) { variable_set('maintenance_mode_message', $message); } // Old variable is removed in update for system.module, see // system_update_7069(). $site_offline = variable_get('site_offline', -1); if ($site_offline != -1) { variable_set('maintenance_mode', $site_offline); } // Add ssid column and index. db_add_field('sessions', 'ssid', array('description' => "Secure session ID. The value is generated by Drupal's session handlers.", 'type' => 'varchar', 'length' => 128, 'not null' => TRUE, 'default' => '')); db_add_index('sessions', 'ssid', array('ssid')); // Drop existing primary key. db_drop_primary_key('sessions'); // Add new primary key. db_add_primary_key('sessions', array('sid', 'ssid')); // Allow longer javascript file names. if (db_table_exists('languages')) { db_change_field('languages', 'javascript', 'javascript', array('type' => 'varchar', 'length' => 64, 'not null' => TRUE, 'default' => '')); } // Rename action description to label. db_change_field('actions', 'description', 'label', array('type' => 'varchar', 'length' => 255, 'not null' => TRUE, 'default' => '0')); variable_set('update_d7_requirements', TRUE); } update_fix_d7_install_profile(); } /** * Register the currently installed profile in the system table. * * Installation profiles are now treated as modules by Drupal, and have an * upgrade path based on their schema version in the system table. * * The installation profile will be set to schema_version 0, as it has already * been installed. Any other hook_update_N functions provided by the * installation profile will be run by update.php. */ function update_fix_d7_install_profile() { $profile = drupal_get_profile(); $results = db_select('system', 's') ->fields('s', array('name', 'schema_version')) ->condition('name', $profile) ->condition('type', 'module') ->execute() ->fetchAll(); if (empty($results)) { $filename = 'profiles/' . $profile . '/' . $profile . '.profile'; // Read profile info file $info = drupal_parse_info_file(dirname($filename) . '/' . $profile . '.info'); // Merge in defaults. $info = $info + array( 'dependencies' => array(), 'description' => '', 'package' => 'Other', 'version' => NULL, 'php' => DRUPAL_MINIMUM_PHP, 'files' => array(), ); $values = array( 'filename' => $filename, 'name' => $profile, 'info' => serialize($info), 'schema_version' => 0, 'type' => 'module', 'status' => 1, 'owner' => '', ); // Installation profile hooks are always executed last by the module system $values['weight'] = 1000; // Initializing the system table entry for the installation profile db_insert('system') ->fields(array_keys($values)) ->values($values) ->execute(); // Reset the cached schema version. drupal_get_installed_schema_version($profile, TRUE); // Load the updates again to make sure the installation profile updates // are loaded. drupal_load_updates(); } } /** * Parse pre-Drupal 7 database connection URLs and return D7 compatible array. * * @return * Drupal 7 DBTNG compatible array of database connection information. */ function update_parse_db_url($db_url, $db_prefix) { $databases = array(); if (!is_array($db_url)) { $db_url = array('default' => $db_url); } foreach ($db_url as $database => $url) { $url = parse_url($url); $databases[$database]['default'] = array( // MySQLi uses the mysql driver. 'driver' => $url['scheme'] == 'mysqli' ? 'mysql' : $url['scheme'], // Remove the leading slash to get the database name. 'database' => substr(urldecode($url['path']), 1), 'username' => urldecode($url['user']), 'password' => isset($url['pass']) ? urldecode($url['pass']) : '', 'host' => urldecode($url['host']), 'port' => isset($url['port']) ? urldecode($url['port']) : '', ); if (isset($db_prefix)) { $databases[$database]['default']['prefix'] = $db_prefix; } } return $databases; } /** * Constructs a session name compatible with a D6 environment. * * @return * D6-compatible session name string. * * @see drupal_settings_initialize() */ function update_get_d6_session_name() { global $base_url, $cookie_domain; $cookie_secure = ini_get('session.cookie_secure'); // If a custom cookie domain is set in settings.php, that variable forms // the basis of the session name. Re-compute the D7 hashing method to find // out if $cookie_domain was used as the session name. if (($cookie_secure ? 'SSESS' : 'SESS') . substr(hash('sha256', $cookie_domain), 0, 32) == session_name()) { $session_name = $cookie_domain; } else { // Otherwise use $base_url as session name, without the protocol // to use the same session identifiers across HTTP and HTTPS. list( , $session_name) = explode('://', $base_url, 2); } if ($cookie_secure) { $session_name .= 'SSL'; } return 'SESS' . md5($session_name); } /** * Implements callback_batch_operation(). * * Performs one update and stores the results for display on the results page. * * If an update function completes successfully, it should return a message * as a string indicating success, for example: * @code * return t('New index added successfully.'); * @endcode * * Alternatively, it may return nothing. In that case, no message * will be displayed at all. * * If it fails for whatever reason, it should throw an instance of * DrupalUpdateException with an appropriate error message, for example: * @code * throw new DrupalUpdateException(t('Description of what went wrong')); * @endcode * * If an exception is thrown, the current update and all updates that depend on * it will be aborted. The schema version will not be updated in this case, and * all the aborted updates will continue to appear on update.php as updates * that have not yet been run. * * If an update function needs to be re-run as part of a batch process, it * should accept the $sandbox array by reference as its first parameter * and set the #finished property to the percentage completed that it is, as a * fraction of 1. * * @param $module * The module whose update will be run. * @param $number * The update number to run. * @param $dependency_map * An array whose keys are the names of all update functions that will be * performed during this batch process, and whose values are arrays of other * update functions that each one depends on. * @param $context * The batch context array. * * @see update_resolve_dependencies() */ function update_do_one($module, $number, $dependency_map, &$context) { $function = $module . '_update_' . $number; // If this update was aborted in a previous step, or has a dependency that // was aborted in a previous step, go no further. if (!empty($context['results']['#abort']) && array_intersect($context['results']['#abort'], array_merge($dependency_map, array($function)))) { return; } $ret = array(); if (function_exists($function)) { try { $ret['results']['query'] = $function($context['sandbox']); $ret['results']['success'] = TRUE; } // @TODO We may want to do different error handling for different // exception types, but for now we'll just log the exception and // return the message for printing. catch (Exception $e) { watchdog_exception('update', $e); require_once DRUPAL_ROOT . '/includes/errors.inc'; $variables = _drupal_decode_exception($e); // The exception message is run through check_plain() by _drupal_decode_exception(). $ret['#abort'] = array('success' => FALSE, 'query' => t('%type: !message in %function (line %line of %file).', $variables)); } } if (isset($context['sandbox']['#finished'])) { $context['finished'] = $context['sandbox']['#finished']; unset($context['sandbox']['#finished']); } if (!isset($context['results'][$module])) { $context['results'][$module] = array(); } if (!isset($context['results'][$module][$number])) { $context['results'][$module][$number] = array(); } $context['results'][$module][$number] = array_merge($context['results'][$module][$number], $ret); if (!empty($ret['#abort'])) { // Record this function in the list of updates that were aborted. $context['results']['#abort'][] = $function; } // Record the schema update if it was completed successfully. if ($context['finished'] == 1 && empty($ret['#abort'])) { drupal_set_installed_schema_version($module, $number); } $context['message'] = 'Updating ' . check_plain($module) . ' module'; } /** * @class Exception class used to throw error if a module update fails. */ class DrupalUpdateException extends Exception { } /** * Starts the database update batch process. * * @param $start * An array whose keys contain the names of modules to be updated during the * current batch process, and whose values contain the number of the first * requested update for that module. The actual updates that are run (and the * order they are run in) will depend on the results of passing this data * through the update dependency system. * @param $redirect * Path to redirect to when the batch has finished processing. * @param $url * URL of the batch processing page (should only be used for separate * scripts like update.php). * @param $batch * Optional parameters to pass into the batch API. * @param $redirect_callback * (optional) Specify a function to be called to redirect to the progressive * processing page. * * @see update_resolve_dependencies() */ function update_batch($start, $redirect = NULL, $url = NULL, $batch = array(), $redirect_callback = 'drupal_goto') { // During the update, bring the site offline so that schema changes do not // affect visiting users. $_SESSION['maintenance_mode'] = variable_get('maintenance_mode', FALSE); if ($_SESSION['maintenance_mode'] == FALSE) { variable_set('maintenance_mode', TRUE); } // Resolve any update dependencies to determine the actual updates that will // be run and the order they will be run in. $updates = update_resolve_dependencies($start); // Store the dependencies for each update function in an array which the // batch API can pass in to the batch operation each time it is called. (We // do not store the entire update dependency array here because it is // potentially very large.) $dependency_map = array(); foreach ($updates as $function => $update) { $dependency_map[$function] = !empty($update['reverse_paths']) ? array_keys($update['reverse_paths']) : array(); } $operations = array(); foreach ($updates as $update) { if ($update['allowed']) { // Set the installed version of each module so updates will start at the // correct place. (The updates are already sorted, so we can simply base // this on the first one we come across in the above foreach loop.) if (isset($start[$update['module']])) { drupal_set_installed_schema_version($update['module'], $update['number'] - 1); unset($start[$update['module']]); } // Add this update function to the batch. $function = $update['module'] . '_update_' . $update['number']; $operations[] = array('update_do_one', array($update['module'], $update['number'], $dependency_map[$function])); } } $batch['operations'] = $operations; $batch += array( 'title' => 'Updating', 'init_message' => 'Starting updates', 'error_message' => 'An unrecoverable error has occurred. You can find the error message below. It is advised to copy it to the clipboard for reference.', 'finished' => 'update_finished', 'file' => 'includes/update.inc', ); batch_set($batch); batch_process($redirect, $url, $redirect_callback); } /** * Implements callback_batch_finished(). * * Finishes the update process and stores the results for eventual display. * * After the updates run, all caches are flushed. The update results are * stored into the session (for example, to be displayed on the update results * page in update.php). Additionally, if the site was off-line, now that the * update process is completed, the site is set back online. * * @param $success * Indicate that the batch API tasks were all completed successfully. * @param $results * An array of all the results that were updated in update_do_one(). * @param $operations * A list of all the operations that had not been completed by the batch API. * * @see update_batch() */ function update_finished($success, $results, $operations) { // Remove the D6 upgrade flag variable so that subsequent update runs do not // get the wrong context. variable_del('update_d6'); // Clear the caches in case the data has been updated. drupal_flush_all_caches(); $_SESSION['update_results'] = $results; $_SESSION['update_success'] = $success; $_SESSION['updates_remaining'] = $operations; // Now that the update is done, we can put the site back online if it was // previously in maintenance mode. if (isset($_SESSION['maintenance_mode']) && $_SESSION['maintenance_mode'] == FALSE) { variable_set('maintenance_mode', FALSE); unset($_SESSION['maintenance_mode']); } } /** * Returns a list of all the pending database updates. * * @return * An associative array keyed by module name which contains all information * about database updates that need to be run, and any updates that are not * going to proceed due to missing requirements. The system module will * always be listed first. * * The subarray for each module can contain the following keys: * - start: The starting update that is to be processed. If this does not * exist then do not process any updates for this module as there are * other requirements that need to be resolved. * - warning: Any warnings about why this module can not be updated. * - pending: An array of all the pending updates for the module including * the update number and the description from source code comment for * each update function. This array is keyed by the update number. */ function update_get_update_list() { // Make sure that the system module is first in the list of updates. $ret = array('system' => array()); $modules = drupal_get_installed_schema_version(NULL, FALSE, TRUE); foreach ($modules as $module => $schema_version) { // Skip uninstalled and incompatible modules. if ($schema_version == SCHEMA_UNINSTALLED || update_check_incompatibility($module)) { continue; } // Otherwise, get the list of updates defined by this module. $updates = drupal_get_schema_versions($module); if ($updates !== FALSE) { // module_invoke returns NULL for nonexisting hooks, so if no updates // are removed, it will == 0. $last_removed = module_invoke($module, 'update_last_removed'); if ($schema_version < $last_removed) { $ret[$module]['warning'] = '' . $module . ' module can not be updated. Its schema version is ' . $schema_version . '. Updates up to and including ' . $last_removed . ' have been removed in this release. In order to update ' . $module . ' module, you will first need to upgrade to the last version in which these updates were available.'; continue; } $updates = drupal_map_assoc($updates); foreach (array_keys($updates) as $update) { if ($update > $schema_version) { // The description for an update comes from its Doxygen. $func = new ReflectionFunction($module . '_update_' . $update); $description = str_replace(array("\n", '*', '/'), '', $func->getDocComment()); $ret[$module]['pending'][$update] = "$update - $description"; if (!isset($ret[$module]['start'])) { $ret[$module]['start'] = $update; } } } if (!isset($ret[$module]['start']) && isset($ret[$module]['pending'])) { $ret[$module]['start'] = $schema_version; } } } if (empty($ret['system'])) { unset($ret['system']); } return $ret; } /** * Resolves dependencies in a set of module updates, and orders them correctly. * * This function receives a list of requested module updates and determines an * appropriate order to run them in such that all update dependencies are met. * Any updates whose dependencies cannot be met are included in the returned * array but have the key 'allowed' set to FALSE; the calling function should * take responsibility for ensuring that these updates are ultimately not * performed. * * In addition, the returned array also includes detailed information about the * dependency chain for each update, as provided by the depth-first search * algorithm in drupal_depth_first_search(). * * @param $starting_updates * An array whose keys contain the names of modules with updates to be run * and whose values contain the number of the first requested update for that * module. * * @return * An array whose keys are the names of all update functions within the * provided modules that would need to be run in order to fulfill the * request, arranged in the order in which the update functions should be * run. (This includes the provided starting update for each module and all * subsequent updates that are available.) The values are themselves arrays * containing all the keys provided by the drupal_depth_first_search() * algorithm, which encode detailed information about the dependency chain * for this update function (for example: 'paths', 'reverse_paths', 'weight', * and 'component'), as well as the following additional keys: * - 'allowed': A boolean which is TRUE when the update function's * dependencies are met, and FALSE otherwise. Calling functions should * inspect this value before running the update. * - 'missing_dependencies': An array containing the names of any other * update functions that are required by this one but that are unavailable * to be run. This array will be empty when 'allowed' is TRUE. * - 'module': The name of the module that this update function belongs to. * - 'number': The number of this update function within that module. * * @see drupal_depth_first_search() */ function update_resolve_dependencies($starting_updates) { // Obtain a dependency graph for the requested update functions. $update_functions = update_get_update_function_list($starting_updates); $graph = update_build_dependency_graph($update_functions); // Perform the depth-first search and sort the results. require_once DRUPAL_ROOT . '/includes/graph.inc'; drupal_depth_first_search($graph); uasort($graph, 'drupal_sort_weight'); foreach ($graph as $function => &$data) { $module = $data['module']; $number = $data['number']; // If the update function is missing and has not yet been performed, mark // it and everything that ultimately depends on it as disallowed. if (update_is_missing($module, $number, $update_functions) && !update_already_performed($module, $number)) { $data['allowed'] = FALSE; foreach (array_keys($data['paths']) as $dependent) { $graph[$dependent]['allowed'] = FALSE; $graph[$dependent]['missing_dependencies'][] = $function; } } elseif (!isset($data['allowed'])) { $data['allowed'] = TRUE; $data['missing_dependencies'] = array(); } // Now that we have finished processing this function, remove it from the // graph if it was not part of the original list. This ensures that we // never try to run any updates that were not specifically requested. if (!isset($update_functions[$module][$number])) { unset($graph[$function]); } } return $graph; } /** * Returns an organized list of update functions for a set of modules. * * @param $starting_updates * An array whose keys contain the names of modules and whose values contain * the number of the first requested update for that module. * * @return * An array containing all the update functions that should be run for each * module, including the provided starting update and all subsequent updates * that are available. The keys of the array contain the module names, and * each value is an ordered array of update functions, keyed by the update * number. * * @see update_resolve_dependencies() */ function update_get_update_function_list($starting_updates) { // Go through each module and find all updates that we need (including the // first update that was requested and any updates that run after it). $update_functions = array(); foreach ($starting_updates as $module => $version) { $update_functions[$module] = array(); $updates = drupal_get_schema_versions($module); if ($updates !== FALSE) { $max_version = max($updates); if ($version <= $max_version) { foreach ($updates as $update) { if ($update >= $version) { $update_functions[$module][$update] = $module . '_update_' . $update; } } } } } return $update_functions; } /** * Constructs a graph which encodes the dependencies between module updates. * * This function returns an associative array which contains a "directed graph" * representation of the dependencies between a provided list of update * functions, as well as any outside update functions that they directly depend * on but that were not in the provided list. The vertices of the graph * represent the update functions themselves, and each edge represents a * requirement that the first update function needs to run before the second. * For example, consider this graph: * * system_update_7000 ---> system_update_7001 ---> system_update_7002 * * Visually, this indicates that system_update_7000() must run before * system_update_7001(), which in turn must run before system_update_7002(). * * The function takes into account standard dependencies within each module, as * shown above (i.e., the fact that each module's updates must run in numerical * order), but also finds any cross-module dependencies that are defined by * modules which implement hook_update_dependencies(), and builds them into the * graph as well. * * @param $update_functions * An organized array of update functions, in the format returned by * update_get_update_function_list(). * * @return * A multidimensional array representing the dependency graph, suitable for * passing in to drupal_depth_first_search(), but with extra information * about each update function also included. Each array key contains the name * of an update function, including all update functions from the provided * list as well as any outside update functions which they directly depend * on. Each value is an associative array containing the following keys: * - 'edges': A representation of any other update functions that immediately * depend on this one. See drupal_depth_first_search() for more details on * the format. * - 'module': The name of the module that this update function belongs to. * - 'number': The number of this update function within that module. * * @see drupal_depth_first_search() * @see update_resolve_dependencies() */ function update_build_dependency_graph($update_functions) { // Initialize an array that will define a directed graph representing the // dependencies between update functions. $graph = array(); // Go through each update function and build an initial list of dependencies. foreach ($update_functions as $module => $functions) { $previous_function = NULL; foreach ($functions as $number => $function) { // Add an edge to the directed graph representing the fact that each // update function in a given module must run after the update that // numerically precedes it. if ($previous_function) { $graph[$previous_function]['edges'][$function] = TRUE; } $previous_function = $function; // Define the module and update number associated with this function. $graph[$function]['module'] = $module; $graph[$function]['number'] = $number; } } // Now add any explicit update dependencies declared by modules. $update_dependencies = update_retrieve_dependencies(); foreach ($graph as $function => $data) { if (!empty($update_dependencies[$data['module']][$data['number']])) { foreach ($update_dependencies[$data['module']][$data['number']] as $module => $number) { $dependency = $module . '_update_' . $number; $graph[$dependency]['edges'][$function] = TRUE; $graph[$dependency]['module'] = $module; $graph[$dependency]['number'] = $number; } } } return $graph; } /** * Determines if a module update is missing or unavailable. * * @param $module * The name of the module. * @param $number * The number of the update within that module. * @param $update_functions * An organized array of update functions, in the format returned by * update_get_update_function_list(). This should represent all module * updates that are requested to run at the time this function is called. * * @return * TRUE if the provided module update is not installed or is not in the * provided list of updates to run; FALSE otherwise. */ function update_is_missing($module, $number, $update_functions) { return !isset($update_functions[$module][$number]) || !function_exists($update_functions[$module][$number]); } /** * Determines if a module update has already been performed. * * @param $module * The name of the module. * @param $number * The number of the update within that module. * * @return * TRUE if the database schema indicates that the update has already been * performed; FALSE otherwise. */ function update_already_performed($module, $number) { return $number <= drupal_get_installed_schema_version($module); } /** * Invokes hook_update_dependencies() in all installed modules. * * This function is similar to module_invoke_all(), with the main difference * that it does not require that a module be enabled to invoke its hook, only * that it be installed. This allows the update system to properly perform * updates even on modules that are currently disabled. * * @return * An array of return values obtained by merging the results of the * hook_update_dependencies() implementations in all installed modules. * * @see module_invoke_all() * @see hook_update_dependencies() */ function update_retrieve_dependencies() { $return = array(); // Get a list of installed modules, arranged so that we invoke their hooks in // the same order that module_invoke_all() does. $modules = db_query("SELECT name FROM {system} WHERE type = 'module' AND schema_version <> :schema ORDER BY weight ASC, name ASC", array(':schema' => SCHEMA_UNINSTALLED))->fetchCol(); foreach ($modules as $module) { $function = $module . '_update_dependencies'; if (function_exists($function)) { $result = $function(); // Each implementation of hook_update_dependencies() returns a // multidimensional, associative array containing some keys that // represent module names (which are strings) and other keys that // represent update function numbers (which are integers). We cannot use // array_merge_recursive() to properly merge these results, since it // treats strings and integers differently. Therefore, we have to // explicitly loop through the expected array structure here and perform // the merge manually. if (isset($result) && is_array($result)) { foreach ($result as $module => $module_data) { foreach ($module_data as $update => $update_data) { foreach ($update_data as $module_dependency => $update_dependency) { // If there are redundant dependencies declared for the same // update function (so that it is declared to depend on more than // one update from a particular module), record the dependency on // the highest numbered update here, since that automatically // implies the previous ones. For example, if one module's // implementation of hook_update_dependencies() required this // ordering: // // system_update_7001 ---> user_update_7000 // // but another module's implementation of the hook required this // one: // // system_update_7002 ---> user_update_7000 // // we record the second one, since system_update_7001() is always // guaranteed to run before system_update_7002() anyway (within // an individual module, updates are always run in numerical // order). if (!isset($return[$module][$update][$module_dependency]) || $update_dependency > $return[$module][$update][$module_dependency]) { $return[$module][$update][$module_dependency] = $update_dependency; } } } } } } } return $return; } drupal-7.41/includes/date.inc0000644000000000000000000001063212611765734014666 0ustar rootroot 'short', 'format' => 'Y-m-d H:i', 'locales' => array(), ); $formats[] = array( 'type' => 'short', 'format' => 'm/d/Y - H:i', 'locales' => array('en-us'), ); $formats[] = array( 'type' => 'short', 'format' => 'd/m/Y - H:i', 'locales' => array('en-gb', 'en-hk', 'en-ie', 'el-gr', 'es-es', 'fr-be', 'fr-fr', 'fr-lu', 'it-it', 'nl-be', 'pt-pt'), ); $formats[] = array( 'type' => 'short', 'format' => 'Y/m/d - H:i', 'locales' => array('en-ca', 'fr-ca', 'no-no', 'sv-se'), ); $formats[] = array( 'type' => 'short', 'format' => 'd.m.Y - H:i', 'locales' => array('de-ch', 'de-de', 'de-lu', 'fi-fi', 'fr-ch', 'is-is', 'pl-pl', 'ro-ro', 'ru-ru'), ); $formats[] = array( 'type' => 'short', 'format' => 'm/d/Y - g:ia', 'locales' => array(), ); $formats[] = array( 'type' => 'short', 'format' => 'd/m/Y - g:ia', 'locales' => array(), ); $formats[] = array( 'type' => 'short', 'format' => 'Y/m/d - g:ia', 'locales' => array(), ); $formats[] = array( 'type' => 'short', 'format' => 'M j Y - H:i', 'locales' => array(), ); $formats[] = array( 'type' => 'short', 'format' => 'j M Y - H:i', 'locales' => array(), ); $formats[] = array( 'type' => 'short', 'format' => 'Y M j - H:i', 'locales' => array(), ); $formats[] = array( 'type' => 'short', 'format' => 'M j Y - g:ia', 'locales' => array(), ); $formats[] = array( 'type' => 'short', 'format' => 'j M Y - g:ia', 'locales' => array(), ); $formats[] = array( 'type' => 'short', 'format' => 'Y M j - g:ia', 'locales' => array(), ); // Medium date formats. $formats[] = array( 'type' => 'medium', 'format' => 'D, Y-m-d H:i', 'locales' => array(), ); $formats[] = array( 'type' => 'medium', 'format' => 'D, m/d/Y - H:i', 'locales' => array('en-us'), ); $formats[] = array( 'type' => 'medium', 'format' => 'D, d/m/Y - H:i', 'locales' => array('en-gb', 'en-hk', 'en-ie', 'el-gr', 'es-es', 'fr-be', 'fr-fr', 'fr-lu', 'it-it', 'nl-be', 'pt-pt'), ); $formats[] = array( 'type' => 'medium', 'format' => 'D, Y/m/d - H:i', 'locales' => array('en-ca', 'fr-ca', 'no-no', 'sv-se'), ); $formats[] = array( 'type' => 'medium', 'format' => 'F j, Y - H:i', 'locales' => array(), ); $formats[] = array( 'type' => 'medium', 'format' => 'j F, Y - H:i', 'locales' => array(), ); $formats[] = array( 'type' => 'medium', 'format' => 'Y, F j - H:i', 'locales' => array(), ); $formats[] = array( 'type' => 'medium', 'format' => 'D, m/d/Y - g:ia', 'locales' => array(), ); $formats[] = array( 'type' => 'medium', 'format' => 'D, d/m/Y - g:ia', 'locales' => array(), ); $formats[] = array( 'type' => 'medium', 'format' => 'D, Y/m/d - g:ia', 'locales' => array(), ); $formats[] = array( 'type' => 'medium', 'format' => 'F j, Y - g:ia', 'locales' => array(), ); $formats[] = array( 'type' => 'medium', 'format' => 'j F Y - g:ia', 'locales' => array(), ); $formats[] = array( 'type' => 'medium', 'format' => 'Y, F j - g:ia', 'locales' => array(), ); $formats[] = array( 'type' => 'medium', 'format' => 'j. F Y - G:i', 'locales' => array(), ); // Long date formats. $formats[] = array( 'type' => 'long', 'format' => 'l, F j, Y - H:i', 'locales' => array(), ); $formats[] = array( 'type' => 'long', 'format' => 'l, j F, Y - H:i', 'locales' => array(), ); $formats[] = array( 'type' => 'long', 'format' => 'l, Y, F j - H:i', 'locales' => array(), ); $formats[] = array( 'type' => 'long', 'format' => 'l, F j, Y - g:ia', 'locales' => array(), ); $formats[] = array( 'type' => 'long', 'format' => 'l, j F Y - g:ia', 'locales' => array(), ); $formats[] = array( 'type' => 'long', 'format' => 'l, Y, F j - g:ia', 'locales' => array(), ); $formats[] = array( 'type' => 'long', 'format' => 'l, j. F Y - G:i', 'locales' => array(), ); return $formats; } drupal-7.41/includes/ajax.inc0000644000000000000000000014243512611765734014703 0ustar rootroot 'select', * '#options' => array( * 'one' => 'one', * 'two' => 'two', * 'three' => 'three', * ), * '#ajax' => array( * 'callback' => 'ajax_example_simplest_callback', * 'wrapper' => 'replace_textfield_div', * ), * ); * // This entire form element will be replaced with an updated value. * $form['replace_textfield'] = array( * '#type' => 'textfield', * '#title' => t("The default value will be changed"), * '#description' => t("Say something about why you chose") . "'" . * (!empty($form_state['values']['changethis']) * ? $form_state['values']['changethis'] : t("Not changed yet")) . "'", * '#prefix' => '
                  ', * '#suffix' => '
                  ', * ); * return $form; * } * * function ajax_example_simplest_callback($form, $form_state) { * // The form has already been submitted and updated. We can return the replaced * // item as it is. * return $form['replace_textfield']; * } * @endcode * * In the above example, the 'changethis' element is Ajax-enabled. The default * #ajax['event'] is 'change', so when the 'changethis' element changes, * an Ajax call is made. The form is submitted and reprocessed, and then the * callback is called. In this case, the form has been automatically * built changing $form['replace_textfield']['#description'], so the callback * just returns that part of the form. * * To implement Ajax handling in a form, add '#ajax' to the form * definition of a field. That field will trigger an Ajax event when it is * clicked (or changed, depending on the kind of field). #ajax supports * the following parameters (either 'path' or 'callback' is required at least): * - #ajax['callback']: The callback to invoke to handle the server side of the * Ajax event, which will receive a $form and $form_state as arguments, and * returns a renderable array (most often a form or form fragment), an HTML * string, or an array of Ajax commands. If returning a renderable array or * a string, the value will replace the original element named in * #ajax['wrapper'], and * theme_status_messages() * will be prepended to that * element. (If the status messages are not wanted, return an array * of Ajax commands instead.) * #ajax['wrapper']. If an array of Ajax commands is returned, it will be * executed by the calling code. * - #ajax['path']: The menu path to use for the request. This is often omitted * and the default is used. This path should map * to a menu page callback that returns data using ajax_render(). Defaults to * 'system/ajax', which invokes ajax_form_callback(), eventually calling * the function named in #ajax['callback']. If you use a custom * path, you must set up the menu entry and handle the entire callback in your * own code. * - #ajax['wrapper']: The CSS ID of the area to be replaced by the content * returned by the #ajax['callback'] function. The content returned from * the callback will replace the entire element named by #ajax['wrapper']. * The wrapper is usually created using #prefix and #suffix properties in the * form. Note that this is the wrapper ID, not a CSS selector. So to replace * the element referred to by the CSS selector #some-selector on the page, * use #ajax['wrapper'] = 'some-selector', not '#some-selector'. * - #ajax['effect']: The jQuery effect to use when placing the new HTML. * Defaults to no effect. Valid options are 'none', 'slide', or 'fade'. * - #ajax['speed']: The effect speed to use. Defaults to 'slow'. May be * 'slow', 'fast' or a number in milliseconds which represents the length * of time the effect should run. * - #ajax['event']: The JavaScript event to respond to. This is normally * selected automatically for the type of form widget being used, and * is only needed if you need to override the default behavior. * - #ajax['prevent']: A JavaScript event to prevent when 'event' is triggered. * Defaults to 'click' for #ajax on #type 'submit', 'button', and * 'image_button'. Multiple events may be specified separated by spaces. * For example, when binding #ajax behaviors to form buttons, pressing the * ENTER key within a textfield triggers the 'click' event of the form's first * submit button. Triggering Ajax in this situation leads to problems, like * breaking autocomplete textfields. Because of that, Ajax behaviors are bound * to the 'mousedown' event on form buttons by default. However, binding to * 'mousedown' rather than 'click' means that it is possible to trigger a * click by pressing the mouse, holding the mouse button down until the Ajax * request is complete and the button is re-enabled, and then releasing the * mouse button. For this case, 'prevent' can be set to 'click', so an * additional event handler is bound to prevent such a click from triggering a * non-Ajax form submission. This also prevents a textfield's ENTER press * triggering a button's non-Ajax form submission behavior. * - #ajax['method']: The jQuery method to use to place the new HTML. * Defaults to 'replaceWith'. May be: 'replaceWith', 'append', 'prepend', * 'before', 'after', or 'html'. See the * @link http://api.jquery.com/category/manipulation/ jQuery manipulators documentation @endlink * for more information on these methods. * - #ajax['progress']: Choose either a throbber or progress bar that is * displayed while awaiting a response from the callback, and add an optional * message. Possible keys: 'type', 'message', 'url', 'interval'. * More information is available in the * @link forms_api_reference.html Form API Reference @endlink * * In addition to using Form API for doing in-form modification, Ajax may be * enabled by adding classes to buttons and links. By adding the 'use-ajax' * class to a link, the link will be loaded via an Ajax call. When using this * method, the href of the link can contain '/nojs/' as part of the path. When * the Ajax framework makes the request, it will convert this to '/ajax/'. * The server is then able to easily tell if this request was made through an * actual Ajax request or in a degraded state, and respond appropriately. * * Similarly, submit buttons can be given the class 'use-ajax-submit'. The * form will then be submitted via Ajax to the path specified in the #action. * Like the ajax-submit class above, this path will have '/nojs/' replaced with * '/ajax/' so that the submit handler can tell if the form was submitted * in a degraded state or not. * * When responding to Ajax requests, the server should do what it needs to do * for that request, then create a commands array. This commands array will * be converted to a JSON object and returned to the client, which will then * iterate over the array and process it like a macro language. * * Each command item is an associative array which will be converted to a * command object on the JavaScript side. $command_item['command'] is the type * of command, e.g. 'alert' or 'replace', and will correspond to a method in the * Drupal.ajax[command] space. The command array may contain any other data that * the command needs to process, e.g. 'method', 'selector', 'settings', etc. * * Commands are usually created with a couple of helper functions, so they * look like this: * @code * $commands = array(); * // Replace the content of '#object-1' on the page with 'some html here'. * $commands[] = ajax_command_replace('#object-1', 'some html here'); * // Add a visual "changed" marker to the '#object-1' element. * $commands[] = ajax_command_changed('#object-1'); * // Menu 'page callback' and #ajax['callback'] functions are supposed to * // return render arrays. If returning an Ajax commands array, it must be * // encapsulated in a render array structure. * return array('#type' => 'ajax', '#commands' => $commands); * @endcode * * When returning an Ajax command array, it is often useful to have * status messages rendered along with other tasks in the command array. * In that case the Ajax commands array may be constructed like this: * @code * $commands = array(); * $commands[] = ajax_command_replace(NULL, $output); * $commands[] = ajax_command_prepend(NULL, theme('status_messages')); * return array('#type' => 'ajax', '#commands' => $commands); * @endcode * * See @link ajax_commands Ajax framework commands @endlink */ /** * Renders a commands array into JSON. * * @param $commands * A list of macro commands generated by the use of ajax_command_*() * functions. */ function ajax_render($commands = array()) { // Although ajax_deliver() does this, some contributed and custom modules // render Ajax responses without using that delivery callback. ajax_set_verification_header(); // Ajax responses aren't rendered with html.tpl.php, so we have to call // drupal_get_css() and drupal_get_js() here, in order to have new files added // during this request to be loaded by the page. We only want to send back // files that the page hasn't already loaded, so we implement simple diffing // logic using array_diff_key(). foreach (array('css', 'js') as $type) { // It is highly suspicious if $_POST['ajax_page_state'][$type] is empty, // since the base page ought to have at least one JS file and one CSS file // loaded. It probably indicates an error, and rather than making the page // reload all of the files, instead we return no new files. if (empty($_POST['ajax_page_state'][$type])) { $items[$type] = array(); } else { $function = 'drupal_add_' . $type; $items[$type] = $function(); drupal_alter($type, $items[$type]); // @todo Inline CSS and JS items are indexed numerically. These can't be // reliably diffed with array_diff_key(), since the number can change // due to factors unrelated to the inline content, so for now, we strip // the inline items from Ajax responses, and can add support for them // when drupal_add_css() and drupal_add_js() are changed to use a hash // of the inline content as the array key. foreach ($items[$type] as $key => $item) { if (is_numeric($key)) { unset($items[$type][$key]); } } // Ensure that the page doesn't reload what it already has. $items[$type] = array_diff_key($items[$type], $_POST['ajax_page_state'][$type]); } } // Render the HTML to load these files, and add AJAX commands to insert this // HTML in the page. We pass TRUE as the $skip_alter argument to prevent the // data from being altered again, as we already altered it above. Settings are // handled separately, afterwards. if (isset($items['js']['settings'])) { unset($items['js']['settings']); } $styles = drupal_get_css($items['css'], TRUE); $scripts_footer = drupal_get_js('footer', $items['js'], TRUE); $scripts_header = drupal_get_js('header', $items['js'], TRUE); $extra_commands = array(); if (!empty($styles)) { $extra_commands[] = ajax_command_add_css($styles); } if (!empty($scripts_header)) { $extra_commands[] = ajax_command_prepend('head', $scripts_header); } if (!empty($scripts_footer)) { $extra_commands[] = ajax_command_append('body', $scripts_footer); } if (!empty($extra_commands)) { $commands = array_merge($extra_commands, $commands); } // Now add a command to merge changes and additions to Drupal.settings. $scripts = drupal_add_js(); if (!empty($scripts['settings'])) { $settings = $scripts['settings']; array_unshift($commands, ajax_command_settings(drupal_array_merge_deep_array($settings['data']), TRUE)); } // Allow modules to alter any Ajax response. drupal_alter('ajax_render', $commands); return drupal_json_encode($commands); } /** * Gets a form submitted via #ajax during an Ajax callback. * * This will load a form from the form cache used during Ajax operations. It * pulls the form info from $_POST. * * @return * An array containing the $form, $form_state, $form_id, $form_build_id and an * initial list of Ajax $commands. Use the list() function to break these * apart: * @code * list($form, $form_state, $form_id, $form_build_id, $commands) = ajax_get_form(); * @endcode */ function ajax_get_form() { $form_state = form_state_defaults(); $form_build_id = $_POST['form_build_id']; // Get the form from the cache. $form = form_get_cache($form_build_id, $form_state); if (!$form) { // If $form cannot be loaded from the cache, the form_build_id in $_POST // must be invalid, which means that someone performed a POST request onto // system/ajax without actually viewing the concerned form in the browser. // This is likely a hacking attempt as it never happens under normal // circumstances, so we just do nothing. watchdog('ajax', 'Invalid form POST data.', array(), WATCHDOG_WARNING); drupal_exit(); } // When a page level cache is enabled, the form-build id might have been // replaced from within form_get_cache. If this is the case, it is also // necessary to update it in the browser by issuing an appropriate Ajax // command. $commands = array(); if (isset($form['#build_id_old']) && $form['#build_id_old'] != $form['#build_id']) { // If the form build ID has changed, issue an Ajax command to update it. $commands[] = ajax_command_update_build_id($form); $form_build_id = $form['#build_id']; } // Since some of the submit handlers are run, redirects need to be disabled. $form_state['no_redirect'] = TRUE; // When a form is rebuilt after Ajax processing, its #build_id and #action // should not change. // @see drupal_rebuild_form() $form_state['rebuild_info']['copy']['#build_id'] = TRUE; $form_state['rebuild_info']['copy']['#action'] = TRUE; // The form needs to be processed; prepare for that by setting a few internal // variables. $form_state['input'] = $_POST; $form_id = $form['#form_id']; return array($form, $form_state, $form_id, $form_build_id, $commands); } /** * Menu callback; handles Ajax requests for the #ajax Form API property. * * This rebuilds the form from cache and invokes the defined #ajax['callback'] * to return an Ajax command structure for JavaScript. In case no 'callback' has * been defined, nothing will happen. * * The Form API #ajax property can be set both for buttons and other input * elements. * * This function is also the canonical example of how to implement * #ajax['path']. If processing is required that cannot be accomplished with * a callback, re-implement this function and set #ajax['path'] to the * enhanced function. * * @see system_menu() */ function ajax_form_callback() { list($form, $form_state, $form_id, $form_build_id, $commands) = ajax_get_form(); drupal_process_form($form['#form_id'], $form, $form_state); // We need to return the part of the form (or some other content) that needs // to be re-rendered so the browser can update the page with changed content. // Since this is the generic menu callback used by many Ajax elements, it is // up to the #ajax['callback'] function of the element (may or may not be a // button) that triggered the Ajax request to determine what needs to be // rendered. if (!empty($form_state['triggering_element'])) { $callback = $form_state['triggering_element']['#ajax']['callback']; } if (!empty($callback) && function_exists($callback)) { $result = $callback($form, $form_state); if (!(is_array($result) && isset($result['#type']) && $result['#type'] == 'ajax')) { // Turn the response into a #type=ajax array if it isn't one already. $result = array( '#type' => 'ajax', '#commands' => ajax_prepare_response($result), ); } $result['#commands'] = array_merge($commands, $result['#commands']); return $result; } } /** * Theme callback for Ajax requests. * * Many different pages can invoke an Ajax request to system/ajax or another * generic Ajax path. It is almost always desired for an Ajax response to be * rendered using the same theme as the base page, because most themes are built * with the assumption that they control the entire page, so if the CSS for two * themes are both loaded for a given page, they may conflict with each other. * For example, Bartik is Drupal's default theme, and Seven is Drupal's default * administration theme. Depending on whether the "Use the administration theme * when editing or creating content" checkbox is checked, the node edit form may * be displayed in either theme, but the Ajax response to the Field module's * "Add another item" button should be rendered using the same theme as the rest * of the page. Therefore, system_menu() sets the 'theme callback' for * 'system/ajax' to this function, and it is recommended that modules * implementing other generic Ajax paths do the same. * * @see system_menu() * @see file_menu() */ function ajax_base_page_theme() { if (!empty($_POST['ajax_page_state']['theme']) && !empty($_POST['ajax_page_state']['theme_token'])) { $theme = $_POST['ajax_page_state']['theme']; $token = $_POST['ajax_page_state']['theme_token']; // Prevent a request forgery from giving a person access to a theme they // shouldn't be otherwise allowed to see. However, since everyone is allowed // to see the default theme, token validation isn't required for that, and // bypassing it allows most use-cases to work even when accessed from the // page cache. if ($theme === variable_get('theme_default', 'bartik') || drupal_valid_token($token, $theme)) { return $theme; } } } /** * Packages and sends the result of a page callback as an Ajax response. * * This function is the equivalent of drupal_deliver_html_page(), but for Ajax * requests. Like that function, it: * - Adds needed HTTP headers. * - Prints rendered output. * - Performs end-of-request tasks. * * @param $page_callback_result * The result of a page callback. Can be one of: * - NULL: to indicate no content. * - An integer menu status constant: to indicate an error condition. * - A string of HTML content. * - A renderable array of content. * * @see drupal_deliver_html_page() */ function ajax_deliver($page_callback_result) { // Browsers do not allow JavaScript to read the contents of a user's local // files. To work around that, the jQuery Form plugin submits forms containing // a file input element to an IFRAME, instead of using XHR. Browsers do not // normally expect JSON strings as content within an IFRAME, so the response // must be customized accordingly. // @see http://malsup.com/jquery/form/#file-upload // @see Drupal.ajax.prototype.beforeSend() $iframe_upload = !empty($_POST['ajax_iframe_upload']); // Emit a Content-Type HTTP header if none has been added by the page callback // or by a wrapping delivery callback. if (is_null(drupal_get_http_header('Content-Type'))) { if (!$iframe_upload) { // Standard JSON can be returned to a browser's XHR object, and to // non-browser user agents. // @see http://www.ietf.org/rfc/rfc4627.txt?number=4627 drupal_add_http_header('Content-Type', 'application/json; charset=utf-8'); } else { // Browser IFRAMEs expect HTML. With most other content types, Internet // Explorer presents the user with a download prompt. drupal_add_http_header('Content-Type', 'text/html; charset=utf-8'); } } // Let ajax.js know that this response is safe to process. ajax_set_verification_header(); // Print the response. $commands = ajax_prepare_response($page_callback_result); $json = ajax_render($commands); if (!$iframe_upload) { // Standard JSON can be returned to a browser's XHR object, and to // non-browser user agents. print $json; } else { // Browser IFRAMEs expect HTML. Browser extensions, such as Linkification // and Skype's Browser Highlighter, convert URLs, phone numbers, etc. into // links. This corrupts the JSON response. Protect the integrity of the // JSON data by making it the value of a textarea. // @see http://malsup.com/jquery/form/#file-upload // @see http://drupal.org/node/1009382 print ''; } // Perform end-of-request tasks. ajax_footer(); } /** * Converts the return value of a page callback into an Ajax commands array. * * @param $page_callback_result * The result of a page callback. Can be one of: * - NULL: to indicate no content. * - An integer menu status constant: to indicate an error condition. * - A string of HTML content. * - A renderable array of content. * * @return * An Ajax commands array that can be passed to ajax_render(). */ function ajax_prepare_response($page_callback_result) { $commands = array(); if (!isset($page_callback_result)) { // Simply delivering an empty commands array is sufficient. This results // in the Ajax request being completed, but nothing being done to the page. } elseif (is_int($page_callback_result)) { switch ($page_callback_result) { case MENU_NOT_FOUND: $commands[] = ajax_command_alert(t('The requested page could not be found.')); break; case MENU_ACCESS_DENIED: $commands[] = ajax_command_alert(t('You are not authorized to access this page.')); break; case MENU_SITE_OFFLINE: $commands[] = ajax_command_alert(filter_xss_admin(variable_get('maintenance_mode_message', t('@site is currently under maintenance. We should be back shortly. Thank you for your patience.', array('@site' => variable_get('site_name', 'Drupal')))))); break; } } elseif (is_array($page_callback_result) && isset($page_callback_result['#type']) && ($page_callback_result['#type'] == 'ajax')) { // Complex Ajax callbacks can return a result that contains an error message // or a specific set of commands to send to the browser. $page_callback_result += element_info('ajax'); $error = $page_callback_result['#error']; if (isset($error) && $error !== FALSE) { if ((empty($error) || $error === TRUE)) { $error = t('An error occurred while handling the request: The server received invalid input.'); } $commands[] = ajax_command_alert($error); } else { $commands = $page_callback_result['#commands']; } } else { // Like normal page callbacks, simple Ajax callbacks can return HTML // content, as a string or render array. This HTML is inserted in some // relationship to #ajax['wrapper'], as determined by which jQuery DOM // manipulation method is used. The method used is specified by // #ajax['method']. The default method is 'replaceWith', which completely // replaces the old wrapper element and its content with the new HTML. $html = is_string($page_callback_result) ? $page_callback_result : drupal_render($page_callback_result); $commands[] = ajax_command_insert(NULL, $html); // Add the status messages inside the new content's wrapper element, so that // on subsequent Ajax requests, it is treated as old content. $commands[] = ajax_command_prepend(NULL, theme('status_messages')); } return $commands; } /** * Sets a response header for ajax.js to trust the response body. * * It is not safe to invoke Ajax commands within user-uploaded files, so this * header protects against those being invoked. * * @see Drupal.ajax.options.success() */ function ajax_set_verification_header() { $added = &drupal_static(__FUNCTION__); // User-uploaded files cannot set any response headers, so a custom header is // used to indicate to ajax.js that this response is safe. Note that most // Ajax requests bound using the Form API will be protected by having the URL // flagged as trusted in Drupal.settings, so this header is used only for // things like custom markup that gets Ajax behaviors attached. if (empty($added)) { drupal_add_http_header('X-Drupal-Ajax-Token', '1'); // Avoid sending the header twice. $added = TRUE; } } /** * Performs end-of-Ajax-request tasks. * * This function is the equivalent of drupal_page_footer(), but for Ajax * requests. * * @see drupal_page_footer() */ function ajax_footer() { // Even for Ajax requests, invoke hook_exit() implementations. There may be // modules that need very fast Ajax responses, and therefore, run Ajax // requests with an early bootstrap. if (drupal_get_bootstrap_phase() == DRUPAL_BOOTSTRAP_FULL && (!defined('MAINTENANCE_MODE') || MAINTENANCE_MODE != 'update')) { module_invoke_all('exit'); } // Commit the user session. See above comment about the possibility of this // function running without session.inc loaded. if (function_exists('drupal_session_commit')) { drupal_session_commit(); } } /** * Form element processing handler for the #ajax form property. * * @param $element * An associative array containing the properties of the element. * * @return * The processed element. * * @see ajax_pre_render_element() */ function ajax_process_form($element, &$form_state) { $element = ajax_pre_render_element($element); if (!empty($element['#ajax_processed'])) { $form_state['cache'] = TRUE; } return $element; } /** * Adds Ajax information about an element to communicate with JavaScript. * * If #ajax['path'] is set on an element, this additional JavaScript is added * to the page header to attach the Ajax behaviors. See ajax.js for more * information. * * @param $element * An associative array containing the properties of the element. * Properties used: * - #ajax['event'] * - #ajax['prevent'] * - #ajax['path'] * - #ajax['options'] * - #ajax['wrapper'] * - #ajax['parameters'] * - #ajax['effect'] * * @return * The processed element with the necessary JavaScript attached to it. */ function ajax_pre_render_element($element) { // Skip already processed elements. if (isset($element['#ajax_processed'])) { return $element; } // Initialize #ajax_processed, so we do not process this element again. $element['#ajax_processed'] = FALSE; // Nothing to do if there is neither a callback nor a path. if (!(isset($element['#ajax']['callback']) || isset($element['#ajax']['path']))) { return $element; } // Add a reasonable default event handler if none was specified. if (isset($element['#ajax']) && !isset($element['#ajax']['event'])) { switch ($element['#type']) { case 'submit': case 'button': case 'image_button': // Pressing the ENTER key within a textfield triggers the click event of // the form's first submit button. Triggering Ajax in this situation // leads to problems, like breaking autocomplete textfields, so we bind // to mousedown instead of click. // @see http://drupal.org/node/216059 $element['#ajax']['event'] = 'mousedown'; // Retain keyboard accessibility by setting 'keypress'. This causes // ajax.js to trigger 'event' when SPACE or ENTER are pressed while the // button has focus. $element['#ajax']['keypress'] = TRUE; // Binding to mousedown rather than click means that it is possible to // trigger a click by pressing the mouse, holding the mouse button down // until the Ajax request is complete and the button is re-enabled, and // then releasing the mouse button. Set 'prevent' so that ajax.js binds // an additional handler to prevent such a click from triggering a // non-Ajax form submission. This also prevents a textfield's ENTER // press triggering this button's non-Ajax form submission behavior. if (!isset($element['#ajax']['prevent'])) { $element['#ajax']['prevent'] = 'click'; } break; case 'password': case 'textfield': case 'textarea': $element['#ajax']['event'] = 'blur'; break; case 'radio': case 'checkbox': case 'select': $element['#ajax']['event'] = 'change'; break; case 'link': $element['#ajax']['event'] = 'click'; break; default: return $element; } } // Attach JavaScript settings to the element. if (isset($element['#ajax']['event'])) { $element['#attached']['library'][] = array('system', 'jquery.form'); $element['#attached']['library'][] = array('system', 'drupal.ajax'); $settings = $element['#ajax']; // Assign default settings. $settings += array( 'path' => 'system/ajax', 'options' => array(), ); // @todo Legacy support. Remove in Drupal 8. if (isset($settings['method']) && $settings['method'] == 'replace') { $settings['method'] = 'replaceWith'; } // Change path to URL. $settings['url'] = url($settings['path'], $settings['options']); unset($settings['path'], $settings['options']); // Add special data to $settings['submit'] so that when this element // triggers an Ajax submission, Drupal's form processing can determine which // element triggered it. // @see _form_element_triggered_scripted_submission() if (isset($settings['trigger_as'])) { // An element can add a 'trigger_as' key within #ajax to make the element // submit as though another one (for example, a non-button can use this // to submit the form as though a button were clicked). When using this, // the 'name' key is always required to identify the element to trigger // as. The 'value' key is optional, and only needed when multiple elements // share the same name, which is commonly the case for buttons. $settings['submit']['_triggering_element_name'] = $settings['trigger_as']['name']; if (isset($settings['trigger_as']['value'])) { $settings['submit']['_triggering_element_value'] = $settings['trigger_as']['value']; } unset($settings['trigger_as']); } elseif (isset($element['#name'])) { // Most of the time, elements can submit as themselves, in which case the // 'trigger_as' key isn't needed, and the element's name is used. $settings['submit']['_triggering_element_name'] = $element['#name']; // If the element is a (non-image) button, its name may not identify it // uniquely, in which case a match on value is also needed. // @see _form_button_was_clicked() if (isset($element['#button_type']) && empty($element['#has_garbage_value'])) { $settings['submit']['_triggering_element_value'] = $element['#value']; } } // Convert a simple #ajax['progress'] string into an array. if (isset($settings['progress']) && is_string($settings['progress'])) { $settings['progress'] = array('type' => $settings['progress']); } // Change progress path to a full URL. if (isset($settings['progress']['path'])) { $settings['progress']['url'] = url($settings['progress']['path']); unset($settings['progress']['path']); } $element['#attached']['js'][] = array( 'type' => 'setting', 'data' => array( 'ajax' => array($element['#id'] => $settings), 'urlIsAjaxTrusted' => array( $settings['url'] => TRUE, ), ), ); // Indicate that Ajax processing was successful. $element['#ajax_processed'] = TRUE; } return $element; } /** * @} End of "defgroup ajax". */ /** * @defgroup ajax_commands Ajax framework commands * @{ * Functions to create various Ajax commands. * * These functions can be used to create arrays for use with the * ajax_render() function. */ /** * Creates a Drupal Ajax 'alert' command. * * The 'alert' command instructs the client to display a JavaScript alert * dialog box. * * This command is implemented by Drupal.ajax.prototype.commands.alert() * defined in misc/ajax.js. * * @param $text * The message string to display to the user. * * @return * An array suitable for use with the ajax_render() function. */ function ajax_command_alert($text) { return array( 'command' => 'alert', 'text' => $text, ); } /** * Creates a Drupal Ajax 'insert' command using the method in #ajax['method']. * * This command instructs the client to insert the given HTML using whichever * jQuery DOM manipulation method has been specified in the #ajax['method'] * variable of the element that triggered the request. * * This command is implemented by Drupal.ajax.prototype.commands.insert() * defined in misc/ajax.js. * * @param $selector * A jQuery selector string. If the command is a response to a request from * an #ajax form element then this value can be NULL. * @param $html * The data to use with the jQuery method. * @param $settings * An optional array of settings that will be used for this command only. * * @return * An array suitable for use with the ajax_render() function. */ function ajax_command_insert($selector, $html, $settings = NULL) { return array( 'command' => 'insert', 'method' => NULL, 'selector' => $selector, 'data' => $html, 'settings' => $settings, ); } /** * Creates a Drupal Ajax 'insert/replaceWith' command. * * The 'insert/replaceWith' command instructs the client to use jQuery's * replaceWith() method to replace each element matched matched by the given * selector with the given HTML. * * This command is implemented by Drupal.ajax.prototype.commands.insert() * defined in misc/ajax.js. * * @param $selector * A jQuery selector string. If the command is a response to a request from * an #ajax form element then this value can be NULL. * @param $html * The data to use with the jQuery replaceWith() method. * @param $settings * An optional array of settings that will be used for this command only. * * @return * An array suitable for use with the ajax_render() function. * * See * @link http://docs.jquery.com/Manipulation/replaceWith#content jQuery replaceWith command @endlink */ function ajax_command_replace($selector, $html, $settings = NULL) { return array( 'command' => 'insert', 'method' => 'replaceWith', 'selector' => $selector, 'data' => $html, 'settings' => $settings, ); } /** * Creates a Drupal Ajax 'insert/html' command. * * The 'insert/html' command instructs the client to use jQuery's html() * method to set the HTML content of each element matched by the given * selector while leaving the outer tags intact. * * This command is implemented by Drupal.ajax.prototype.commands.insert() * defined in misc/ajax.js. * * @param $selector * A jQuery selector string. If the command is a response to a request from * an #ajax form element then this value can be NULL. * @param $html * The data to use with the jQuery html() method. * @param $settings * An optional array of settings that will be used for this command only. * * @return * An array suitable for use with the ajax_render() function. * * @see http://docs.jquery.com/Attributes/html#val */ function ajax_command_html($selector, $html, $settings = NULL) { return array( 'command' => 'insert', 'method' => 'html', 'selector' => $selector, 'data' => $html, 'settings' => $settings, ); } /** * Creates a Drupal Ajax 'insert/prepend' command. * * The 'insert/prepend' command instructs the client to use jQuery's prepend() * method to prepend the given HTML content to the inside each element matched * by the given selector. * * This command is implemented by Drupal.ajax.prototype.commands.insert() * defined in misc/ajax.js. * * @param $selector * A jQuery selector string. If the command is a response to a request from * an #ajax form element then this value can be NULL. * @param $html * The data to use with the jQuery prepend() method. * @param $settings * An optional array of settings that will be used for this command only. * * @return * An array suitable for use with the ajax_render() function. * * @see http://docs.jquery.com/Manipulation/prepend#content */ function ajax_command_prepend($selector, $html, $settings = NULL) { return array( 'command' => 'insert', 'method' => 'prepend', 'selector' => $selector, 'data' => $html, 'settings' => $settings, ); } /** * Creates a Drupal Ajax 'insert/append' command. * * The 'insert/append' command instructs the client to use jQuery's append() * method to append the given HTML content to the inside of each element matched * by the given selector. * * This command is implemented by Drupal.ajax.prototype.commands.insert() * defined in misc/ajax.js. * * @param $selector * A jQuery selector string. If the command is a response to a request from * an #ajax form element then this value can be NULL. * @param $html * The data to use with the jQuery append() method. * @param $settings * An optional array of settings that will be used for this command only. * * @return * An array suitable for use with the ajax_render() function. * * @see http://docs.jquery.com/Manipulation/append#content */ function ajax_command_append($selector, $html, $settings = NULL) { return array( 'command' => 'insert', 'method' => 'append', 'selector' => $selector, 'data' => $html, 'settings' => $settings, ); } /** * Creates a Drupal Ajax 'insert/after' command. * * The 'insert/after' command instructs the client to use jQuery's after() * method to insert the given HTML content after each element matched by * the given selector. * * This command is implemented by Drupal.ajax.prototype.commands.insert() * defined in misc/ajax.js. * * @param $selector * A jQuery selector string. If the command is a response to a request from * an #ajax form element then this value can be NULL. * @param $html * The data to use with the jQuery after() method. * @param $settings * An optional array of settings that will be used for this command only. * * @return * An array suitable for use with the ajax_render() function. * * @see http://docs.jquery.com/Manipulation/after#content */ function ajax_command_after($selector, $html, $settings = NULL) { return array( 'command' => 'insert', 'method' => 'after', 'selector' => $selector, 'data' => $html, 'settings' => $settings, ); } /** * Creates a Drupal Ajax 'insert/before' command. * * The 'insert/before' command instructs the client to use jQuery's before() * method to insert the given HTML content before each of elements matched by * the given selector. * * This command is implemented by Drupal.ajax.prototype.commands.insert() * defined in misc/ajax.js. * * @param $selector * A jQuery selector string. If the command is a response to a request from * an #ajax form element then this value can be NULL. * @param $html * The data to use with the jQuery before() method. * @param $settings * An optional array of settings that will be used for this command only. * * @return * An array suitable for use with the ajax_render() function. * * @see http://docs.jquery.com/Manipulation/before#content */ function ajax_command_before($selector, $html, $settings = NULL) { return array( 'command' => 'insert', 'method' => 'before', 'selector' => $selector, 'data' => $html, 'settings' => $settings, ); } /** * Creates a Drupal Ajax 'remove' command. * * The 'remove' command instructs the client to use jQuery's remove() method * to remove each of elements matched by the given selector, and everything * within them. * * This command is implemented by Drupal.ajax.prototype.commands.remove() * defined in misc/ajax.js. * * @param $selector * A jQuery selector string. If the command is a response to a request from * an #ajax form element then this value can be NULL. * * @return * An array suitable for use with the ajax_render() function. * * @see http://docs.jquery.com/Manipulation/remove#expr */ function ajax_command_remove($selector) { return array( 'command' => 'remove', 'selector' => $selector, ); } /** * Creates a Drupal Ajax 'changed' command. * * This command instructs the client to mark each of the elements matched by the * given selector as 'ajax-changed'. * * This command is implemented by Drupal.ajax.prototype.commands.changed() * defined in misc/ajax.js. * * @param $selector * A jQuery selector string. If the command is a response to a request from * an #ajax form element then this value can be NULL. * @param $asterisk * An optional CSS selector which must be inside $selector. If specified, * an asterisk will be appended to the HTML inside the $asterisk selector. * * @return * An array suitable for use with the ajax_render() function. */ function ajax_command_changed($selector, $asterisk = '') { return array( 'command' => 'changed', 'selector' => $selector, 'asterisk' => $asterisk, ); } /** * Creates a Drupal Ajax 'css' command. * * The 'css' command will instruct the client to use the jQuery css() method * to apply the CSS arguments to elements matched by the given selector. * * This command is implemented by Drupal.ajax.prototype.commands.css() * defined in misc/ajax.js. * * @param $selector * A jQuery selector string. If the command is a response to a request from * an #ajax form element then this value can be NULL. * @param $argument * An array of key/value pairs to set in the CSS for the selector. * * @return * An array suitable for use with the ajax_render() function. * * @see http://docs.jquery.com/CSS/css#properties */ function ajax_command_css($selector, $argument) { return array( 'command' => 'css', 'selector' => $selector, 'argument' => $argument, ); } /** * Creates a Drupal Ajax 'settings' command. * * The 'settings' command instructs the client either to use the given array as * the settings for ajax-loaded content or to extend Drupal.settings with the * given array, depending on the value of the $merge parameter. * * This command is implemented by Drupal.ajax.prototype.commands.settings() * defined in misc/ajax.js. * * @param $argument * An array of key/value pairs to add to the settings. This will be utilized * for all commands after this if they do not include their own settings * array. * @param $merge * Whether or not the passed settings in $argument should be merged into the * global Drupal.settings on the page. By default (FALSE), the settings that * are passed to Drupal.attachBehaviors will not include the global * Drupal.settings. * * @return * An array suitable for use with the ajax_render() function. */ function ajax_command_settings($argument, $merge = FALSE) { return array( 'command' => 'settings', 'settings' => $argument, 'merge' => $merge, ); } /** * Creates a Drupal Ajax 'data' command. * * The 'data' command instructs the client to attach the name=value pair of * data to the selector via jQuery's data cache. * * This command is implemented by Drupal.ajax.prototype.commands.data() * defined in misc/ajax.js. * * @param $selector * A jQuery selector string. If the command is a response to a request from * an #ajax form element then this value can be NULL. * @param $name * The name or key (in the key value pair) of the data attached to this * selector. * @param $value * The value of the data. Not just limited to strings can be any format. * * @return * An array suitable for use with the ajax_render() function. * * @see http://docs.jquery.com/Core/data#namevalue */ function ajax_command_data($selector, $name, $value) { return array( 'command' => 'data', 'selector' => $selector, 'name' => $name, 'value' => $value, ); } /** * Creates a Drupal Ajax 'invoke' command. * * The 'invoke' command will instruct the client to invoke the given jQuery * method with the supplied arguments on the elements matched by the given * selector. Intended for simple jQuery commands, such as attr(), addClass(), * removeClass(), toggleClass(), etc. * * This command is implemented by Drupal.ajax.prototype.commands.invoke() * defined in misc/ajax.js. * * @param $selector * A jQuery selector string. If the command is a response to a request from * an #ajax form element then this value can be NULL. * @param $method * The jQuery method to invoke. * @param $arguments * (optional) A list of arguments to the jQuery $method, if any. * * @return * An array suitable for use with the ajax_render() function. */ function ajax_command_invoke($selector, $method, array $arguments = array()) { return array( 'command' => 'invoke', 'selector' => $selector, 'method' => $method, 'arguments' => $arguments, ); } /** * Creates a Drupal Ajax 'restripe' command. * * The 'restripe' command instructs the client to restripe a table. This is * usually used after a table has been modified by a replace or append command. * * This command is implemented by Drupal.ajax.prototype.commands.restripe() * defined in misc/ajax.js. * * @param $selector * A jQuery selector string. * * @return * An array suitable for use with the ajax_render() function. */ function ajax_command_restripe($selector) { return array( 'command' => 'restripe', 'selector' => $selector, ); } /** * Creates a Drupal Ajax 'update_build_id' command. * * This command updates the value of a hidden form_build_id input element on a * form. It requires the form passed in to have keys for both the old build ID * in #build_id_old and the new build ID in #build_id. * * The primary use case for this Ajax command is to serve a new build ID to a * form served from the cache to an anonymous user, preventing one anonymous * user from accessing the form state of another anonymous users on Ajax enabled * forms. * * @param $form * The form array representing the form whose build ID should be updated. */ function ajax_command_update_build_id($form) { return array( 'command' => 'updateBuildId', 'old' => $form['#build_id_old'], 'new' => $form['#build_id'], ); } /** * Creates a Drupal Ajax 'add_css' command. * * This method will add css via ajax in a cross-browser compatible way. * * This command is implemented by Drupal.ajax.prototype.commands.add_css() * defined in misc/ajax.js. * * @param $styles * A string that contains the styles to be added. * * @return * An array suitable for use with the ajax_render() function. * * @see misc/ajax.js */ function ajax_command_add_css($styles) { return array( 'command' => 'add_css', 'data' => $styles, ); } drupal-7.41/includes/actions.inc0000644000000000000000000003277012611765734015420 0ustar rootroot variable_get('actions_max_stack', 35)) { watchdog('actions', 'Stack overflow: too many calls to actions_do(). Aborting to prevent infinite recursion.', array(), WATCHDOG_ERROR); return; } $actions = array(); $available_actions = actions_list(); $actions_result = array(); if (is_array($action_ids)) { $conditions = array(); foreach ($action_ids as $action_id) { if (is_numeric($action_id)) { $conditions[] = $action_id; } elseif (isset($available_actions[$action_id])) { $actions[$action_id] = $available_actions[$action_id]; } } // When we have action instances we must go to the database to retrieve // instance data. if (!empty($conditions)) { $query = db_select('actions'); $query->addField('actions', 'aid'); $query->addField('actions', 'type'); $query->addField('actions', 'callback'); $query->addField('actions', 'parameters'); $query->condition('aid', $conditions, 'IN'); $result = $query->execute(); foreach ($result as $action) { $actions[$action->aid] = $action->parameters ? unserialize($action->parameters) : array(); $actions[$action->aid]['callback'] = $action->callback; $actions[$action->aid]['type'] = $action->type; } } // Fire actions, in no particular order. foreach ($actions as $action_id => $params) { // Configurable actions need parameters. if (is_numeric($action_id)) { $function = $params['callback']; if (function_exists($function)) { $context = array_merge($context, $params); $actions_result[$action_id] = $function($object, $context, $a1, $a2); } else { $actions_result[$action_id] = FALSE; } } // Singleton action; $action_id is the function name. else { $actions_result[$action_id] = $action_id($object, $context, $a1, $a2); } } } // Optimized execution of a single action. else { // If it's a configurable action, retrieve stored parameters. if (is_numeric($action_ids)) { $action = db_query("SELECT callback, parameters FROM {actions} WHERE aid = :aid", array(':aid' => $action_ids))->fetchObject(); $function = $action->callback; if (function_exists($function)) { $context = array_merge($context, unserialize($action->parameters)); $actions_result[$action_ids] = $function($object, $context, $a1, $a2); } else { $actions_result[$action_ids] = FALSE; } } // Singleton action; $action_ids is the function name. else { if (function_exists($action_ids)) { $actions_result[$action_ids] = $action_ids($object, $context, $a1, $a2); } else { // Set to avoid undefined index error messages later. $actions_result[$action_ids] = FALSE; } } } $stack--; return $actions_result; } /** * Discovers all available actions by invoking hook_action_info(). * * This function contrasts with actions_get_all_actions(); see the * documentation of actions_get_all_actions() for an explanation. * * @param $reset * Reset the action info static cache. * * @return * An associative array keyed on action function name, with the same format * as the return value of hook_action_info(), containing all * modules' hook_action_info() return values as modified by any * hook_action_info_alter() implementations. * * @see hook_action_info() */ function actions_list($reset = FALSE) { $actions = &drupal_static(__FUNCTION__); if (!isset($actions) || $reset) { $actions = module_invoke_all('action_info'); drupal_alter('action_info', $actions); } // See module_implements() for an explanation of this cast. return (array) $actions; } /** * Retrieves all action instances from the database. * * This function differs from the actions_list() function, which gathers * actions by invoking hook_action_info(). The actions returned by this * function and the actions returned by actions_list() are partially * synchronized. Non-configurable actions from hook_action_info() * implementations are put into the database when actions_synchronize() is * called, which happens when admin/config/system/actions is visited. * Configurable actions are not added to the database until they are configured * in the user interface, in which case a database row is created for each * configuration of each action. * * @return * Associative array keyed by numeric action ID. Each value is an associative * array with keys 'callback', 'label', 'type' and 'configurable'. */ function actions_get_all_actions() { $actions = db_query("SELECT aid, type, callback, parameters, label FROM {actions}")->fetchAllAssoc('aid', PDO::FETCH_ASSOC); foreach ($actions as &$action) { $action['configurable'] = (bool) $action['parameters']; unset($action['parameters']); unset($action['aid']); } return $actions; } /** * Creates an associative array keyed by hashes of function names or IDs. * * Hashes are used to prevent actual function names from going out into HTML * forms and coming back. * * @param $actions * An associative array with function names or action IDs as keys * and associative arrays with keys 'label', 'type', etc. as values. * This is usually the output of actions_list() or actions_get_all_actions(). * * @return * An associative array whose keys are hashes of the input array keys, and * whose corresponding values are associative arrays with components * 'callback', 'label', 'type', and 'configurable' from the input array. */ function actions_actions_map($actions) { $actions_map = array(); foreach ($actions as $callback => $array) { $key = drupal_hash_base64($callback); $actions_map[$key]['callback'] = isset($array['callback']) ? $array['callback'] : $callback; $actions_map[$key]['label'] = $array['label']; $actions_map[$key]['type'] = $array['type']; $actions_map[$key]['configurable'] = $array['configurable']; } return $actions_map; } /** * Returns an action array key (function or ID), given its hash. * * Faster than actions_actions_map() when you only need the function name or ID. * * @param $hash * Hash of a function name or action ID array key. The array key * is a key into the return value of actions_list() (array key is the action * function name) or actions_get_all_actions() (array key is the action ID). * * @return * The corresponding array key, or FALSE if no match is found. */ function actions_function_lookup($hash) { // Check for a function name match. $actions_list = actions_list(); foreach ($actions_list as $function => $array) { if (drupal_hash_base64($function) == $hash) { return $function; } } $aid = FALSE; // Must be a configurable action; check database. $result = db_query("SELECT aid FROM {actions} WHERE parameters <> ''")->fetchAll(PDO::FETCH_ASSOC); foreach ($result as $row) { if (drupal_hash_base64($row['aid']) == $hash) { $aid = $row['aid']; break; } } return $aid; } /** * Synchronizes actions that are provided by modules in hook_action_info(). * * Actions provided by modules in hook_action_info() implementations are * synchronized with actions that are stored in the actions database table. * This is necessary so that actions that do not require configuration can * receive action IDs. * * @param $delete_orphans * If TRUE, any actions that exist in the database but are no longer * found in the code (for example, because the module that provides them has * been disabled) will be deleted. */ function actions_synchronize($delete_orphans = FALSE) { $actions_in_code = actions_list(TRUE); $actions_in_db = db_query("SELECT aid, callback, label FROM {actions} WHERE parameters = ''")->fetchAllAssoc('callback', PDO::FETCH_ASSOC); // Go through all the actions provided by modules. foreach ($actions_in_code as $callback => $array) { // Ignore configurable actions since their instances get put in when the // user adds the action. if (!$array['configurable']) { // If we already have an action ID for this action, no need to assign aid. if (isset($actions_in_db[$callback])) { unset($actions_in_db[$callback]); } else { // This is a new singleton that we don't have an aid for; assign one. db_insert('actions') ->fields(array( 'aid' => $callback, 'type' => $array['type'], 'callback' => $callback, 'parameters' => '', 'label' => $array['label'], )) ->execute(); watchdog('actions', "Action '%action' added.", array('%action' => $array['label'])); } } } // Any actions that we have left in $actions_in_db are orphaned. if ($actions_in_db) { $orphaned = array_keys($actions_in_db); if ($delete_orphans) { $actions = db_query('SELECT aid, label FROM {actions} WHERE callback IN (:orphaned)', array(':orphaned' => $orphaned))->fetchAll(); foreach ($actions as $action) { actions_delete($action->aid); watchdog('actions', "Removed orphaned action '%action' from database.", array('%action' => $action->label)); } } else { $link = l(t('Remove orphaned actions'), 'admin/config/system/actions/orphan'); $count = count($actions_in_db); $orphans = implode(', ', $orphaned); watchdog('actions', '@count orphaned actions (%orphans) exist in the actions table. !link', array('@count' => $count, '%orphans' => $orphans, '!link' => $link), WATCHDOG_INFO); } } } /** * Saves an action and its user-supplied parameter values to the database. * * @param $function * The name of the function to be called when this action is performed. * @param $type * The type of action, to describe grouping and/or context, e.g., 'node', * 'user', 'comment', or 'system'. * @param $params * An associative array with parameter names as keys and parameter values as * values. * @param $label * A user-supplied label of this particular action, e.g., 'Send e-mail * to Jim'. * @param $aid * The ID of this action. If omitted, a new action is created. * * @return * The ID of the action. */ function actions_save($function, $type, $params, $label, $aid = NULL) { // aid is the callback for singleton actions so we need to keep a separate // table for numeric aids. if (!$aid) { $aid = db_next_id(); } db_merge('actions') ->key(array('aid' => $aid)) ->fields(array( 'callback' => $function, 'type' => $type, 'parameters' => serialize($params), 'label' => $label, )) ->execute(); watchdog('actions', 'Action %action saved.', array('%action' => $label)); return $aid; } /** * Retrieves a single action from the database. * * @param $aid * The ID of the action to retrieve. * * @return * The appropriate action row from the database as an object. */ function actions_load($aid) { return db_query("SELECT aid, type, callback, parameters, label FROM {actions} WHERE aid = :aid", array(':aid' => $aid))->fetchObject(); } /** * Deletes a single action from the database. * * @param $aid * The ID of the action to delete. */ function actions_delete($aid) { db_delete('actions') ->condition('aid', $aid) ->execute(); module_invoke_all('actions_delete', $aid); } drupal-7.41/includes/graph.inc0000644000000000000000000001133412611765734015052 0ustar rootroot array(), // The components of the graph. 'components' => array(), ); // Perform the actual search. foreach ($graph as $start => $data) { _drupal_depth_first_search($graph, $state, $start); } // We do such a numbering that every component starts with 0. This is useful // for module installs as we can install every 0 weighted module in one // request, and then every 1 weighted etc. $component_weights = array(); foreach ($state['last_visit_order'] as $vertex) { $component = $graph[$vertex]['component']; if (!isset($component_weights[$component])) { $component_weights[$component] = 0; } $graph[$vertex]['weight'] = $component_weights[$component]--; } } /** * Performs a depth-first search on a graph. * * @param $graph * A three dimensional associated graph array. * @param $state * An associative array. The key 'last_visit_order' stores a list of the * vertices visited. The key components stores list of vertices belonging * to the same the component. * @param $start * An arbitrary vertex where we started traversing the graph. * @param $component * The component of the last vertex. * * @see drupal_depth_first_search() */ function _drupal_depth_first_search(&$graph, &$state, $start, &$component = NULL) { // Assign new component for each new vertex, i.e. when not called recursively. if (!isset($component)) { $component = $start; } // Nothing to do, if we already visited this vertex. if (isset($graph[$start]['paths'])) { return; } // Mark $start as visited. $graph[$start]['paths'] = array(); // Assign $start to the current component. $graph[$start]['component'] = $component; $state['components'][$component][] = $start; // Visit edges of $start. if (isset($graph[$start]['edges'])) { foreach ($graph[$start]['edges'] as $end => $v) { // Mark that $start can reach $end. $graph[$start]['paths'][$end] = $v; if (isset($graph[$end]['component']) && $component != $graph[$end]['component']) { // This vertex already has a component, use that from now on and // reassign all the previously explored vertices. $new_component = $graph[$end]['component']; foreach ($state['components'][$component] as $vertex) { $graph[$vertex]['component'] = $new_component; $state['components'][$new_component][] = $vertex; } unset($state['components'][$component]); $component = $new_component; } // Only visit existing vertices. if (isset($graph[$end])) { // Visit the connected vertex. _drupal_depth_first_search($graph, $state, $end, $component); // All vertices reachable by $end are also reachable by $start. $graph[$start]['paths'] += $graph[$end]['paths']; } } } // Now that any other subgraph has been explored, add $start to all reverse // paths. foreach ($graph[$start]['paths'] as $end => $v) { if (isset($graph[$end])) { $graph[$end]['reverse_paths'][$start] = $v; } } // Record the order of the last visit. This is the reverse of the // topological order if the graph is acyclic. $state['last_visit_order'][] = $start; } drupal-7.41/includes/lock.inc0000644000000000000000000002232112611765734014677 0ustar rootrootfields(array('expire' => $expire)) ->condition('name', $name) ->condition('value', _lock_id()) ->execute(); if (!$success) { // The lock was broken. unset($locks[$name]); } return $success; } else { // Optimistically try to acquire the lock, then retry once if it fails. // The first time through the loop cannot be a retry. $retry = FALSE; // We always want to do this code at least once. do { try { db_insert('semaphore') ->fields(array( 'name' => $name, 'value' => _lock_id(), 'expire' => $expire, )) ->execute(); // We track all acquired locks in the global variable. $locks[$name] = TRUE; // We never need to try again. $retry = FALSE; } catch (PDOException $e) { // Suppress the error. If this is our first pass through the loop, // then $retry is FALSE. In this case, the insert must have failed // meaning some other request acquired the lock but did not release it. // We decide whether to retry by checking lock_may_be_available() // Since this will break the lock in case it is expired. $retry = $retry ? FALSE : lock_may_be_available($name); } // We only retry in case the first attempt failed, but we then broke // an expired lock. } while ($retry); } return isset($locks[$name]); } /** * Check if lock acquired by a different process may be available. * * If an existing lock has expired, it is removed. * * @param $name * The name of the lock. * * @return * TRUE if there is no lock or it was removed, FALSE otherwise. */ function lock_may_be_available($name) { $lock = db_query('SELECT expire, value FROM {semaphore} WHERE name = :name', array(':name' => $name))->fetchAssoc(); if (!$lock) { return TRUE; } $expire = (float) $lock['expire']; $now = microtime(TRUE); if ($now > $expire) { // We check two conditions to prevent a race condition where another // request acquired the lock and set a new expire time. We add a small // number to $expire to avoid errors with float to string conversion. return (bool) db_delete('semaphore') ->condition('name', $name) ->condition('value', $lock['value']) ->condition('expire', 0.0001 + $expire, '<=') ->execute(); } return FALSE; } /** * Wait for a lock to be available. * * This function may be called in a request that fails to acquire a desired * lock. This will block further execution until the lock is available or the * specified delay in seconds is reached. This should not be used with locks * that are acquired very frequently, since the lock is likely to be acquired * again by a different request while waiting. * * @param $name * The name of the lock. * @param $delay * The maximum number of seconds to wait, as an integer. * * @return * TRUE if the lock holds, FALSE if it is available. */ function lock_wait($name, $delay = 30) { // Pause the process for short periods between calling // lock_may_be_available(). This prevents hitting the database with constant // database queries while waiting, which could lead to performance issues. // However, if the wait period is too long, there is the potential for a // large number of processes to be blocked waiting for a lock, especially // if the item being rebuilt is commonly requested. To address both of these // concerns, begin waiting for 25ms, then add 25ms to the wait period each // time until it reaches 500ms. After this point polling will continue every // 500ms until $delay is reached. // $delay is passed in seconds, but we will be using usleep(), which takes // microseconds as a parameter. Multiply it by 1 million so that all // further numbers are equivalent. $delay = (int) $delay * 1000000; // Begin sleeping at 25ms. $sleep = 25000; while ($delay > 0) { // This function should only be called by a request that failed to get a // lock, so we sleep first to give the parallel request a chance to finish // and release the lock. usleep($sleep); // After each sleep, increase the value of $sleep until it reaches // 500ms, to reduce the potential for a lock stampede. $delay = $delay - $sleep; $sleep = min(500000, $sleep + 25000, $delay); if (lock_may_be_available($name)) { // No longer need to wait. return FALSE; } } // The caller must still wait longer to get the lock. return TRUE; } /** * Release a lock previously acquired by lock_acquire(). * * This will release the named lock if it is still held by the current request. * * @param $name * The name of the lock. */ function lock_release($name) { global $locks; unset($locks[$name]); db_delete('semaphore') ->condition('name', $name) ->condition('value', _lock_id()) ->execute(); } /** * Release all previously acquired locks. */ function lock_release_all($lock_id = NULL) { global $locks; $locks = array(); if (empty($lock_id)) { $lock_id = _lock_id(); } db_delete('semaphore') ->condition('value', $lock_id) ->execute(); } /** * @} End of "defgroup lock". */ drupal-7.41/includes/cache.inc0000644000000000000000000004772012611765734015024 0ustar rootrootget($cid); } /** * Returns data from the persistent cache when given an array of cache IDs. * * @param $cids * An array of cache IDs for the data to retrieve. This is passed by * reference, and will have the IDs successfully returned from cache removed. * @param $bin * The cache bin where the data is stored. * * @return * An array of the items successfully returned from cache indexed by cid. */ function cache_get_multiple(array &$cids, $bin = 'cache') { return _cache_get_object($bin)->getMultiple($cids); } /** * Stores data in the persistent cache. * * The persistent cache is split up into several cache bins. In the default * cache implementation, each cache bin corresponds to a database table by the * same name. Other implementations might want to store several bins in data * structures that get flushed together. While it is not a problem for most * cache bins if the entries in them are flushed before their expire time, some * might break functionality or are extremely expensive to recalculate. The * other bins are expired automatically by core. Contributed modules can add * additional bins and get them expired automatically by implementing * hook_flush_caches(). * * The reasons for having several bins are as follows: * - Smaller bins mean smaller database tables and allow for faster selects and * inserts. * - We try to put fast changing cache items and rather static ones into * different bins. The effect is that only the fast changing bins will need a * lot of writes to disk. The more static bins will also be better cacheable * with MySQL's query cache. * * @param $cid * The cache ID of the data to store. * @param $data * The data to store in the cache. Complex data types will be automatically * serialized before insertion. Strings will be stored as plain text and are * not serialized. Some storage engines only allow objects up to a maximum of * 1MB in size to be stored by default. When caching large arrays or similar, * take care to ensure $data does not exceed this size. * @param $bin * (optional) The cache bin to store the data in. Valid core values are: * - cache: (default) Generic cache storage bin (used for theme registry, * locale date, list of simpletest tests, etc.). * - cache_block: Stores the content of various blocks. * - cache_bootstrap: Stores the class registry, the system list of modules, * the list of which modules implement which hooks, and the Drupal variable * list. * - cache_field: Stores the field data belonging to a given object. * - cache_filter: Stores filtered pieces of content. * - cache_form: Stores multistep forms. Flushing this bin means that some * forms displayed to users lose their state and the data already submitted * to them. This bin should not be flushed before its expired time. * - cache_menu: Stores the structure of visible navigation menus per page. * - cache_page: Stores generated pages for anonymous users. It is flushed * very often, whenever a page changes, at least for every node and comment * submission. This is the only bin affected by the page cache setting on * the administrator panel. * - cache_path: Stores the system paths that have an alias. * @param $expire * (optional) One of the following values: * - CACHE_PERMANENT: Indicates that the item should never be removed unless * explicitly told to using cache_clear_all() with a cache ID. * - CACHE_TEMPORARY: Indicates that the item should be removed at the next * general cache wipe. * - A Unix timestamp: Indicates that the item should be kept at least until * the given time, after which it behaves like CACHE_TEMPORARY. * * @see _update_cache_set() * @see cache_get() */ function cache_set($cid, $data, $bin = 'cache', $expire = CACHE_PERMANENT) { return _cache_get_object($bin)->set($cid, $data, $expire); } /** * Expires data from the cache. * * If called with the arguments $cid and $bin set to NULL or omitted, then * expirable entries will be cleared from the cache_page and cache_block bins, * and the $wildcard argument is ignored. * * @param $cid * If set, the cache ID or an array of cache IDs. Otherwise, all cache entries * that can expire are deleted. The $wildcard argument will be ignored if set * to NULL. * @param $bin * If set, the cache bin to delete from. Mandatory argument if $cid is set. * @param $wildcard * If TRUE, the $cid argument must contain a string value and cache IDs * starting with $cid are deleted in addition to the exact cache ID specified * by $cid. If $wildcard is TRUE and $cid is '*', the entire cache is emptied. */ function cache_clear_all($cid = NULL, $bin = NULL, $wildcard = FALSE) { if (!isset($cid) && !isset($bin)) { // Clear the block cache first, so stale data will // not end up in the page cache. if (module_exists('block')) { cache_clear_all(NULL, 'cache_block'); } cache_clear_all(NULL, 'cache_page'); return; } return _cache_get_object($bin)->clear($cid, $wildcard); } /** * Checks if a cache bin is empty. * * A cache bin is considered empty if it does not contain any valid data for any * cache ID. * * @param $bin * The cache bin to check. * * @return * TRUE if the cache bin specified is empty. */ function cache_is_empty($bin) { return _cache_get_object($bin)->isEmpty(); } /** * Defines an interface for cache implementations. * * All cache implementations have to implement this interface. * DrupalDatabaseCache provides the default implementation, which can be * consulted as an example. * * To make Drupal use your implementation for a certain cache bin, you have to * set a variable with the name of the cache bin as its key and the name of * your class as its value. For example, if your implementation of * DrupalCacheInterface was called MyCustomCache, the following line would make * Drupal use it for the 'cache_page' bin: * @code * variable_set('cache_class_cache_page', 'MyCustomCache'); * @endcode * * Additionally, you can register your cache implementation to be used by * default for all cache bins by setting the variable 'cache_default_class' to * the name of your implementation of the DrupalCacheInterface, e.g. * @code * variable_set('cache_default_class', 'MyCustomCache'); * @endcode * * To implement a completely custom cache bin, use the same variable format: * @code * variable_set('cache_class_custom_bin', 'MyCustomCache'); * @endcode * To access your custom cache bin, specify the name of the bin when storing * or retrieving cached data: * @code * cache_set($cid, $data, 'custom_bin', $expire); * cache_get($cid, 'custom_bin'); * @endcode * * @see _cache_get_object() * @see DrupalDatabaseCache */ interface DrupalCacheInterface { /** * Returns data from the persistent cache. * * Data may be stored as either plain text or as serialized data. cache_get() * will automatically return unserialized objects and arrays. * * @param $cid * The cache ID of the data to retrieve. * * @return * The cache or FALSE on failure. */ function get($cid); /** * Returns data from the persistent cache when given an array of cache IDs. * * @param $cids * An array of cache IDs for the data to retrieve. This is passed by * reference, and will have the IDs successfully returned from cache * removed. * * @return * An array of the items successfully returned from cache indexed by cid. */ function getMultiple(&$cids); /** * Stores data in the persistent cache. * * @param $cid * The cache ID of the data to store. * @param $data * The data to store in the cache. Complex data types will be automatically * serialized before insertion. Strings will be stored as plain text and not * serialized. Some storage engines only allow objects up to a maximum of * 1MB in size to be stored by default. When caching large arrays or * similar, take care to ensure $data does not exceed this size. * @param $expire * (optional) One of the following values: * - CACHE_PERMANENT: Indicates that the item should never be removed unless * explicitly told to using cache_clear_all() with a cache ID. * - CACHE_TEMPORARY: Indicates that the item should be removed at the next * general cache wipe. * - A Unix timestamp: Indicates that the item should be kept at least until * the given time, after which it behaves like CACHE_TEMPORARY. */ function set($cid, $data, $expire = CACHE_PERMANENT); /** * Expires data from the cache. * * If called without arguments, expirable entries will be cleared from the * cache_page and cache_block bins. * * @param $cid * If set, the cache ID or an array of cache IDs. Otherwise, all cache * entries that can expire are deleted. The $wildcard argument will be * ignored if set to NULL. * @param $wildcard * If TRUE, the $cid argument must contain a string value and cache IDs * starting with $cid are deleted in addition to the exact cache ID * specified by $cid. If $wildcard is TRUE and $cid is '*', the entire * cache is emptied. */ function clear($cid = NULL, $wildcard = FALSE); /** * Checks if a cache bin is empty. * * A cache bin is considered empty if it does not contain any valid data for * any cache ID. * * @return * TRUE if the cache bin specified is empty. */ function isEmpty(); } /** * Defines a default cache implementation. * * This is Drupal's default cache implementation. It uses the database to store * cached data. Each cache bin corresponds to a database table by the same name. */ class DrupalDatabaseCache implements DrupalCacheInterface { protected $bin; /** * Constructs a DrupalDatabaseCache object. * * @param $bin * The cache bin for which the object is created. */ function __construct($bin) { $this->bin = $bin; } /** * Implements DrupalCacheInterface::get(). */ function get($cid) { $cids = array($cid); $cache = $this->getMultiple($cids); return reset($cache); } /** * Implements DrupalCacheInterface::getMultiple(). */ function getMultiple(&$cids) { try { // Garbage collection necessary when enforcing a minimum cache lifetime. $this->garbageCollection($this->bin); // When serving cached pages, the overhead of using db_select() was found // to add around 30% overhead to the request. Since $this->bin is a // variable, this means the call to db_query() here uses a concatenated // string. This is highly discouraged under any other circumstances, and // is used here only due to the performance overhead we would incur // otherwise. When serving an uncached page, the overhead of using // db_select() is a much smaller proportion of the request. $result = db_query('SELECT cid, data, created, expire, serialized FROM {' . db_escape_table($this->bin) . '} WHERE cid IN (:cids)', array(':cids' => $cids)); $cache = array(); foreach ($result as $item) { $item = $this->prepareItem($item); if ($item) { $cache[$item->cid] = $item; } } $cids = array_diff($cids, array_keys($cache)); return $cache; } catch (Exception $e) { // If the database is never going to be available, cache requests should // return FALSE in order to allow exception handling to occur. return array(); } } /** * Garbage collection for get() and getMultiple(). * * @param $bin * The bin being requested. */ protected function garbageCollection() { $cache_lifetime = variable_get('cache_lifetime', 0); // Clean-up the per-user cache expiration session data, so that the session // handler can properly clean-up the session data for anonymous users. if (isset($_SESSION['cache_expiration'])) { $expire = REQUEST_TIME - $cache_lifetime; foreach ($_SESSION['cache_expiration'] as $bin => $timestamp) { if ($timestamp < $expire) { unset($_SESSION['cache_expiration'][$bin]); } } if (!$_SESSION['cache_expiration']) { unset($_SESSION['cache_expiration']); } } // Garbage collection of temporary items is only necessary when enforcing // a minimum cache lifetime. if (!$cache_lifetime) { return; } // When cache lifetime is in force, avoid running garbage collection too // often since this will remove temporary cache items indiscriminately. $cache_flush = variable_get('cache_flush_' . $this->bin, 0); if ($cache_flush && ($cache_flush + $cache_lifetime <= REQUEST_TIME)) { // Reset the variable immediately to prevent a meltdown in heavy load situations. variable_set('cache_flush_' . $this->bin, 0); // Time to flush old cache data db_delete($this->bin) ->condition('expire', CACHE_PERMANENT, '<>') ->condition('expire', $cache_flush, '<=') ->execute(); } } /** * Prepares a cached item. * * Checks that items are either permanent or did not expire, and unserializes * data as appropriate. * * @param $cache * An item loaded from cache_get() or cache_get_multiple(). * * @return * The item with data unserialized as appropriate or FALSE if there is no * valid item to load. */ protected function prepareItem($cache) { global $user; if (!isset($cache->data)) { return FALSE; } // If the cached data is temporary and subject to a per-user minimum // lifetime, compare the cache entry timestamp with the user session // cache_expiration timestamp. If the cache entry is too old, ignore it. if ($cache->expire != CACHE_PERMANENT && variable_get('cache_lifetime', 0) && isset($_SESSION['cache_expiration'][$this->bin]) && $_SESSION['cache_expiration'][$this->bin] > $cache->created) { // Ignore cache data that is too old and thus not valid for this user. return FALSE; } // If the data is permanent or not subject to a minimum cache lifetime, // unserialize and return the cached data. if ($cache->serialized) { $cache->data = unserialize($cache->data); } return $cache; } /** * Implements DrupalCacheInterface::set(). */ function set($cid, $data, $expire = CACHE_PERMANENT) { $fields = array( 'serialized' => 0, 'created' => REQUEST_TIME, 'expire' => $expire, ); if (!is_string($data)) { $fields['data'] = serialize($data); $fields['serialized'] = 1; } else { $fields['data'] = $data; $fields['serialized'] = 0; } try { db_merge($this->bin) ->key(array('cid' => $cid)) ->fields($fields) ->execute(); } catch (Exception $e) { // The database may not be available, so we'll ignore cache_set requests. } } /** * Implements DrupalCacheInterface::clear(). */ function clear($cid = NULL, $wildcard = FALSE) { global $user; if (empty($cid)) { if (variable_get('cache_lifetime', 0)) { // We store the time in the current user's session. We then simulate // that the cache was flushed for this user by not returning cached // data that was cached before the timestamp. $_SESSION['cache_expiration'][$this->bin] = REQUEST_TIME; $cache_flush = variable_get('cache_flush_' . $this->bin, 0); if ($cache_flush == 0) { // This is the first request to clear the cache, start a timer. variable_set('cache_flush_' . $this->bin, REQUEST_TIME); } elseif (REQUEST_TIME > ($cache_flush + variable_get('cache_lifetime', 0))) { // Clear the cache for everyone, cache_lifetime seconds have // passed since the first request to clear the cache. db_delete($this->bin) ->condition('expire', CACHE_PERMANENT, '<>') ->condition('expire', REQUEST_TIME, '<') ->execute(); variable_set('cache_flush_' . $this->bin, 0); } } else { // No minimum cache lifetime, flush all temporary cache entries now. db_delete($this->bin) ->condition('expire', CACHE_PERMANENT, '<>') ->condition('expire', REQUEST_TIME, '<') ->execute(); } } else { if ($wildcard) { if ($cid == '*') { // Check if $this->bin is a cache table before truncating. Other // cache_clear_all() operations throw a PDO error in this situation, // so we don't need to verify them first. This ensures that non-cache // tables cannot be truncated accidentally. if ($this->isValidBin()) { db_truncate($this->bin)->execute(); } else { throw new Exception(t('Invalid or missing cache bin specified: %bin', array('%bin' => $this->bin))); } } else { db_delete($this->bin) ->condition('cid', db_like($cid) . '%', 'LIKE') ->execute(); } } elseif (is_array($cid)) { // Delete in chunks when a large array is passed. do { db_delete($this->bin) ->condition('cid', array_splice($cid, 0, 1000), 'IN') ->execute(); } while (count($cid)); } else { db_delete($this->bin) ->condition('cid', $cid) ->execute(); } } } /** * Implements DrupalCacheInterface::isEmpty(). */ function isEmpty() { $this->garbageCollection(); $query = db_select($this->bin); $query->addExpression('1'); $result = $query->range(0, 1) ->execute() ->fetchField(); return empty($result); } /** * Checks if $this->bin represents a valid cache table. * * This check is required to ensure that non-cache tables are not truncated * accidentally when calling cache_clear_all(). * * @return boolean */ function isValidBin() { if ($this->bin == 'cache' || substr($this->bin, 0, 6) == 'cache_') { // Skip schema check for bins with standard table names. return TRUE; } // These fields are required for any cache table. $fields = array('cid', 'data', 'expire', 'created', 'serialized'); // Load the table schema. $schema = drupal_get_schema($this->bin); // Confirm that all fields are present. return isset($schema['fields']) && !array_diff($fields, array_keys($schema['fields'])); } } drupal-7.41/includes/common.inc0000644000000000000000000114221112611765734015241 0ustar rootroot $uri) { $xml_rdf_namespaces[] = 'xmlns:' . $prefix . '="' . $uri . '"'; } } return count($xml_rdf_namespaces) ? "\n " . implode("\n ", $xml_rdf_namespaces) : ''; } /** * Adds output to the HEAD tag of the HTML page. * * This function can be called as long as the headers aren't sent. Pass no * arguments (or NULL for both) to retrieve the currently stored elements. * * @param $data * A renderable array. If the '#type' key is not set then 'html_tag' will be * added as the default '#type'. * @param $key * A unique string key to allow implementations of hook_html_head_alter() to * identify the element in $data. Required if $data is not NULL. * * @return * An array of all stored HEAD elements. * * @see theme_html_tag() */ function drupal_add_html_head($data = NULL, $key = NULL) { $stored_head = &drupal_static(__FUNCTION__); if (!isset($stored_head)) { // Make sure the defaults, including Content-Type, come first. $stored_head = _drupal_default_html_head(); } if (isset($data) && isset($key)) { if (!isset($data['#type'])) { $data['#type'] = 'html_tag'; } $stored_head[$key] = $data; } return $stored_head; } /** * Returns elements that are always displayed in the HEAD tag of the HTML page. */ function _drupal_default_html_head() { // Add default elements. Make sure the Content-Type comes first because the // IE browser may be vulnerable to XSS via encoding attacks from any content // that comes before this META tag, such as a TITLE tag. $elements['system_meta_content_type'] = array( '#type' => 'html_tag', '#tag' => 'meta', '#attributes' => array( 'http-equiv' => 'Content-Type', 'content' => 'text/html; charset=utf-8', ), // Security: This always has to be output first. '#weight' => -1000, ); // Show Drupal and the major version number in the META GENERATOR tag. // Get the major version. list($version, ) = explode('.', VERSION); $elements['system_meta_generator'] = array( '#type' => 'html_tag', '#tag' => 'meta', '#attributes' => array( 'name' => 'Generator', 'content' => 'Drupal ' . $version . ' (http://drupal.org)', ), ); // Also send the generator in the HTTP header. $elements['system_meta_generator']['#attached']['drupal_add_http_header'][] = array('X-Generator', $elements['system_meta_generator']['#attributes']['content']); return $elements; } /** * Retrieves output to be displayed in the HEAD tag of the HTML page. */ function drupal_get_html_head() { $elements = drupal_add_html_head(); drupal_alter('html_head', $elements); return drupal_render($elements); } /** * Adds a feed URL for the current page. * * This function can be called as long the HTML header hasn't been sent. * * @param $url * An internal system path or a fully qualified external URL of the feed. * @param $title * The title of the feed. */ function drupal_add_feed($url = NULL, $title = '') { $stored_feed_links = &drupal_static(__FUNCTION__, array()); if (isset($url)) { $stored_feed_links[$url] = theme('feed_icon', array('url' => $url, 'title' => $title)); drupal_add_html_head_link(array( 'rel' => 'alternate', 'type' => 'application/rss+xml', 'title' => $title, // Force the URL to be absolute, for consistency with other tags // output by Drupal. 'href' => url($url, array('absolute' => TRUE)), )); } return $stored_feed_links; } /** * Gets the feed URLs for the current page. * * @param $delimiter * A delimiter to split feeds by. */ function drupal_get_feeds($delimiter = "\n") { $feeds = drupal_add_feed(); return implode($feeds, $delimiter); } /** * @defgroup http_handling HTTP handling * @{ * Functions to properly handle HTTP responses. */ /** * Processes a URL query parameter array to remove unwanted elements. * * @param $query * (optional) An array to be processed. Defaults to $_GET. * @param $exclude * (optional) A list of $query array keys to remove. Use "parent[child]" to * exclude nested items. Defaults to array('q'). * @param $parent * Internal use only. Used to build the $query array key for nested items. * * @return * An array containing query parameters, which can be used for url(). */ function drupal_get_query_parameters(array $query = NULL, array $exclude = array('q'), $parent = '') { // Set defaults, if none given. if (!isset($query)) { $query = $_GET; } // If $exclude is empty, there is nothing to filter. if (empty($exclude)) { return $query; } elseif (!$parent) { $exclude = array_flip($exclude); } $params = array(); foreach ($query as $key => $value) { $string_key = ($parent ? $parent . '[' . $key . ']' : $key); if (isset($exclude[$string_key])) { continue; } if (is_array($value)) { $params[$key] = drupal_get_query_parameters($value, $exclude, $string_key); } else { $params[$key] = $value; } } return $params; } /** * Splits a URL-encoded query string into an array. * * @param $query * The query string to split. * * @return * An array of URL decoded couples $param_name => $value. */ function drupal_get_query_array($query) { $result = array(); if (!empty($query)) { foreach (explode('&', $query) as $param) { $param = explode('=', $param, 2); $result[$param[0]] = isset($param[1]) ? rawurldecode($param[1]) : ''; } } return $result; } /** * Parses an array into a valid, rawurlencoded query string. * * This differs from http_build_query() as we need to rawurlencode() (instead of * urlencode()) all query parameters. * * @param $query * The query parameter array to be processed, e.g. $_GET. * @param $parent * Internal use only. Used to build the $query array key for nested items. * * @return * A rawurlencoded string which can be used as or appended to the URL query * string. * * @see drupal_get_query_parameters() * @ingroup php_wrappers */ function drupal_http_build_query(array $query, $parent = '') { $params = array(); foreach ($query as $key => $value) { $key = ($parent ? $parent . '[' . rawurlencode($key) . ']' : rawurlencode($key)); // Recurse into children. if (is_array($value)) { $params[] = drupal_http_build_query($value, $key); } // If a query parameter value is NULL, only append its key. elseif (!isset($value)) { $params[] = $key; } else { // For better readability of paths in query strings, we decode slashes. $params[] = $key . '=' . str_replace('%2F', '/', rawurlencode($value)); } } return implode('&', $params); } /** * Prepares a 'destination' URL query parameter for use with drupal_goto(). * * Used to direct the user back to the referring page after completing a form. * By default the current URL is returned. If a destination exists in the * previous request, that destination is returned. As such, a destination can * persist across multiple pages. * * @return * An associative array containing the key: * - destination: The path provided via the destination query string or, if * not available, the current path. * * @see current_path() * @see drupal_goto() */ function drupal_get_destination() { $destination = &drupal_static(__FUNCTION__); if (isset($destination)) { return $destination; } if (isset($_GET['destination'])) { $destination = array('destination' => $_GET['destination']); } else { $path = $_GET['q']; $query = drupal_http_build_query(drupal_get_query_parameters()); if ($query != '') { $path .= '?' . $query; } $destination = array('destination' => $path); } return $destination; } /** * Parses a URL string into its path, query, and fragment components. * * This function splits both internal paths like @code node?b=c#d @endcode and * external URLs like @code https://example.com/a?b=c#d @endcode into their * component parts. See * @link http://tools.ietf.org/html/rfc3986#section-3 RFC 3986 @endlink for an * explanation of what the component parts are. * * Note that, unlike the RFC, when passed an external URL, this function * groups the scheme, authority, and path together into the path component. * * @param string $url * The internal path or external URL string to parse. * * @return array * An associative array containing: * - path: The path component of $url. If $url is an external URL, this * includes the scheme, authority, and path. * - query: An array of query parameters from $url, if they exist. * - fragment: The fragment component from $url, if it exists. * * @see drupal_goto() * @see l() * @see url() * @see http://tools.ietf.org/html/rfc3986 * * @ingroup php_wrappers */ function drupal_parse_url($url) { $options = array( 'path' => NULL, 'query' => array(), 'fragment' => '', ); // External URLs: not using parse_url() here, so we do not have to rebuild // the scheme, host, and path without having any use for it. if (strpos($url, '://') !== FALSE) { // Split off everything before the query string into 'path'. $parts = explode('?', $url); $options['path'] = $parts[0]; // If there is a query string, transform it into keyed query parameters. if (isset($parts[1])) { $query_parts = explode('#', $parts[1]); parse_str($query_parts[0], $options['query']); // Take over the fragment, if there is any. if (isset($query_parts[1])) { $options['fragment'] = $query_parts[1]; } } } // Internal URLs. else { // parse_url() does not support relative URLs, so make it absolute. E.g. the // relative URL "foo/bar:1" isn't properly parsed. $parts = parse_url('http://example.com/' . $url); // Strip the leading slash that was just added. $options['path'] = substr($parts['path'], 1); if (isset($parts['query'])) { parse_str($parts['query'], $options['query']); } if (isset($parts['fragment'])) { $options['fragment'] = $parts['fragment']; } } // The 'q' parameter contains the path of the current page if clean URLs are // disabled. It overrides the 'path' of the URL when present, even if clean // URLs are enabled, due to how Apache rewriting rules work. if (isset($options['query']['q'])) { $options['path'] = $options['query']['q']; unset($options['query']['q']); } return $options; } /** * Encodes a Drupal path for use in a URL. * * For aesthetic reasons slashes are not escaped. * * Note that url() takes care of calling this function, so a path passed to that * function should not be encoded in advance. * * @param $path * The Drupal path to encode. */ function drupal_encode_path($path) { return str_replace('%2F', '/', rawurlencode($path)); } /** * Sends the user to a different page. * * This issues an on-site HTTP redirect. The function makes sure the redirected * URL is formatted correctly. * * Usually the redirected URL is constructed from this function's input * parameters. However you may override that behavior by setting a * destination in either the $_REQUEST-array (i.e. by using * the query string of an URI) This is used to direct the user back to * the proper page after completing a form. For example, after editing * a post on the 'admin/content'-page or after having logged on using the * 'user login'-block in a sidebar. The function drupal_get_destination() * can be used to help set the destination URL. * * Drupal will ensure that messages set by drupal_set_message() and other * session data are written to the database before the user is redirected. * * This function ends the request; use it instead of a return in your menu * callback. * * @param $path * (optional) A Drupal path or a full URL, which will be passed to url() to * compute the redirect for the URL. * @param $options * (optional) An associative array of additional URL options to pass to url(). * @param $http_response_code * (optional) The HTTP status code to use for the redirection, defaults to * 302. The valid values for 3xx redirection status codes are defined in * @link http://www.w3.org/Protocols/rfc2616/rfc2616-sec10.html#sec10.3 RFC 2616 @endlink * and the * @link http://tools.ietf.org/html/draft-reschke-http-status-308-07 draft for the new HTTP status codes: @endlink * - 301: Moved Permanently (the recommended value for most redirects). * - 302: Found (default in Drupal and PHP, sometimes used for spamming search * engines). * - 303: See Other. * - 304: Not Modified. * - 305: Use Proxy. * - 307: Temporary Redirect. * * @see drupal_get_destination() * @see url() */ function drupal_goto($path = '', array $options = array(), $http_response_code = 302) { // A destination in $_GET always overrides the function arguments. // We do not allow absolute URLs to be passed via $_GET, as this can be an attack vector. if (isset($_GET['destination']) && !url_is_external($_GET['destination'])) { $destination = drupal_parse_url($_GET['destination']); $path = $destination['path']; $options['query'] = $destination['query']; $options['fragment'] = $destination['fragment']; } drupal_alter('drupal_goto', $path, $options, $http_response_code); // The 'Location' HTTP header must be absolute. $options['absolute'] = TRUE; $url = url($path, $options); header('Location: ' . $url, TRUE, $http_response_code); // The "Location" header sends a redirect status code to the HTTP daemon. In // some cases this can be wrong, so we make sure none of the code below the // drupal_goto() call gets executed upon redirection. drupal_exit($url); } /** * Delivers a "site is under maintenance" message to the browser. * * Page callback functions wanting to report a "site offline" message should * return MENU_SITE_OFFLINE instead of calling drupal_site_offline(). However, * functions that are invoked in contexts where that return value might not * bubble up to menu_execute_active_handler() should call drupal_site_offline(). */ function drupal_site_offline() { drupal_deliver_page(MENU_SITE_OFFLINE); } /** * Delivers a "page not found" error to the browser. * * Page callback functions wanting to report a "page not found" message should * return MENU_NOT_FOUND instead of calling drupal_not_found(). However, * functions that are invoked in contexts where that return value might not * bubble up to menu_execute_active_handler() should call drupal_not_found(). */ function drupal_not_found() { drupal_deliver_page(MENU_NOT_FOUND); } /** * Delivers an "access denied" error to the browser. * * Page callback functions wanting to report an "access denied" message should * return MENU_ACCESS_DENIED instead of calling drupal_access_denied(). However, * functions that are invoked in contexts where that return value might not * bubble up to menu_execute_active_handler() should call * drupal_access_denied(). */ function drupal_access_denied() { drupal_deliver_page(MENU_ACCESS_DENIED); } /** * Performs an HTTP request. * * This is a flexible and powerful HTTP client implementation. Correctly * handles GET, POST, PUT or any other HTTP requests. Handles redirects. * * @param $url * A string containing a fully qualified URI. * @param array $options * (optional) An array that can have one or more of the following elements: * - headers: An array containing request headers to send as name/value pairs. * - method: A string containing the request method. Defaults to 'GET'. * - data: A string containing the request body, formatted as * 'param=value¶m=value&...'. Defaults to NULL. * - max_redirects: An integer representing how many times a redirect * may be followed. Defaults to 3. * - timeout: A float representing the maximum number of seconds the function * call may take. The default is 30 seconds. If a timeout occurs, the error * code is set to the HTTP_REQUEST_TIMEOUT constant. * - context: A context resource created with stream_context_create(). * * @return object * An object that can have one or more of the following components: * - request: A string containing the request body that was sent. * - code: An integer containing the response status code, or the error code * if an error occurred. * - protocol: The response protocol (e.g. HTTP/1.1 or HTTP/1.0). * - status_message: The status message from the response, if a response was * received. * - redirect_code: If redirected, an integer containing the initial response * status code. * - redirect_url: If redirected, a string containing the URL of the redirect * target. * - error: If an error occurred, the error message. Otherwise not set. * - headers: An array containing the response headers as name/value pairs. * HTTP header names are case-insensitive (RFC 2616, section 4.2), so for * easy access the array keys are returned in lower case. * - data: A string containing the response body that was received. */ function drupal_http_request($url, array $options = array()) { // Allow an alternate HTTP client library to replace Drupal's default // implementation. $override_function = variable_get('drupal_http_request_function', FALSE); if (!empty($override_function) && function_exists($override_function)) { return $override_function($url, $options); } $result = new stdClass(); // Parse the URL and make sure we can handle the schema. $uri = @parse_url($url); if ($uri == FALSE) { $result->error = 'unable to parse URL'; $result->code = -1001; return $result; } if (!isset($uri['scheme'])) { $result->error = 'missing schema'; $result->code = -1002; return $result; } timer_start(__FUNCTION__); // Merge the default options. $options += array( 'headers' => array(), 'method' => 'GET', 'data' => NULL, 'max_redirects' => 3, 'timeout' => 30.0, 'context' => NULL, ); // Merge the default headers. $options['headers'] += array( 'User-Agent' => 'Drupal (+http://drupal.org/)', ); // stream_socket_client() requires timeout to be a float. $options['timeout'] = (float) $options['timeout']; // Use a proxy if one is defined and the host is not on the excluded list. $proxy_server = variable_get('proxy_server', ''); if ($proxy_server && _drupal_http_use_proxy($uri['host'])) { // Set the scheme so we open a socket to the proxy server. $uri['scheme'] = 'proxy'; // Set the path to be the full URL. $uri['path'] = $url; // Since the URL is passed as the path, we won't use the parsed query. unset($uri['query']); // Add in username and password to Proxy-Authorization header if needed. if ($proxy_username = variable_get('proxy_username', '')) { $proxy_password = variable_get('proxy_password', ''); $options['headers']['Proxy-Authorization'] = 'Basic ' . base64_encode($proxy_username . (!empty($proxy_password) ? ":" . $proxy_password : '')); } // Some proxies reject requests with any User-Agent headers, while others // require a specific one. $proxy_user_agent = variable_get('proxy_user_agent', ''); // The default value matches neither condition. if ($proxy_user_agent === NULL) { unset($options['headers']['User-Agent']); } elseif ($proxy_user_agent) { $options['headers']['User-Agent'] = $proxy_user_agent; } } switch ($uri['scheme']) { case 'proxy': // Make the socket connection to a proxy server. $socket = 'tcp://' . $proxy_server . ':' . variable_get('proxy_port', 8080); // The Host header still needs to match the real request. $options['headers']['Host'] = $uri['host']; $options['headers']['Host'] .= isset($uri['port']) && $uri['port'] != 80 ? ':' . $uri['port'] : ''; break; case 'http': case 'feed': $port = isset($uri['port']) ? $uri['port'] : 80; $socket = 'tcp://' . $uri['host'] . ':' . $port; // RFC 2616: "non-standard ports MUST, default ports MAY be included". // We don't add the standard port to prevent from breaking rewrite rules // checking the host that do not take into account the port number. $options['headers']['Host'] = $uri['host'] . ($port != 80 ? ':' . $port : ''); break; case 'https': // Note: Only works when PHP is compiled with OpenSSL support. $port = isset($uri['port']) ? $uri['port'] : 443; $socket = 'ssl://' . $uri['host'] . ':' . $port; $options['headers']['Host'] = $uri['host'] . ($port != 443 ? ':' . $port : ''); break; default: $result->error = 'invalid schema ' . $uri['scheme']; $result->code = -1003; return $result; } if (empty($options['context'])) { $fp = @stream_socket_client($socket, $errno, $errstr, $options['timeout']); } else { // Create a stream with context. Allows verification of a SSL certificate. $fp = @stream_socket_client($socket, $errno, $errstr, $options['timeout'], STREAM_CLIENT_CONNECT, $options['context']); } // Make sure the socket opened properly. if (!$fp) { // When a network error occurs, we use a negative number so it does not // clash with the HTTP status codes. $result->code = -$errno; $result->error = trim($errstr) ? trim($errstr) : t('Error opening socket @socket', array('@socket' => $socket)); // Mark that this request failed. This will trigger a check of the web // server's ability to make outgoing HTTP requests the next time that // requirements checking is performed. // See system_requirements(). variable_set('drupal_http_request_fails', TRUE); return $result; } // Construct the path to act on. $path = isset($uri['path']) ? $uri['path'] : '/'; if (isset($uri['query'])) { $path .= '?' . $uri['query']; } // Only add Content-Length if we actually have any content or if it is a POST // or PUT request. Some non-standard servers get confused by Content-Length in // at least HEAD/GET requests, and Squid always requires Content-Length in // POST/PUT requests. $content_length = strlen($options['data']); if ($content_length > 0 || $options['method'] == 'POST' || $options['method'] == 'PUT') { $options['headers']['Content-Length'] = $content_length; } // If the server URL has a user then attempt to use basic authentication. if (isset($uri['user'])) { $options['headers']['Authorization'] = 'Basic ' . base64_encode($uri['user'] . (isset($uri['pass']) ? ':' . $uri['pass'] : ':')); } // If the database prefix is being used by SimpleTest to run the tests in a copied // database then set the user-agent header to the database prefix so that any // calls to other Drupal pages will run the SimpleTest prefixed database. The // user-agent is used to ensure that multiple testing sessions running at the // same time won't interfere with each other as they would if the database // prefix were stored statically in a file or database variable. $test_info = &$GLOBALS['drupal_test_info']; if (!empty($test_info['test_run_id'])) { $options['headers']['User-Agent'] = drupal_generate_test_ua($test_info['test_run_id']); } $request = $options['method'] . ' ' . $path . " HTTP/1.0\r\n"; foreach ($options['headers'] as $name => $value) { $request .= $name . ': ' . trim($value) . "\r\n"; } $request .= "\r\n" . $options['data']; $result->request = $request; // Calculate how much time is left of the original timeout value. $timeout = $options['timeout'] - timer_read(__FUNCTION__) / 1000; if ($timeout > 0) { stream_set_timeout($fp, floor($timeout), floor(1000000 * fmod($timeout, 1))); fwrite($fp, $request); } // Fetch response. Due to PHP bugs like http://bugs.php.net/bug.php?id=43782 // and http://bugs.php.net/bug.php?id=46049 we can't rely on feof(), but // instead must invoke stream_get_meta_data() each iteration. $info = stream_get_meta_data($fp); $alive = !$info['eof'] && !$info['timed_out']; $response = ''; while ($alive) { // Calculate how much time is left of the original timeout value. $timeout = $options['timeout'] - timer_read(__FUNCTION__) / 1000; if ($timeout <= 0) { $info['timed_out'] = TRUE; break; } stream_set_timeout($fp, floor($timeout), floor(1000000 * fmod($timeout, 1))); $chunk = fread($fp, 1024); $response .= $chunk; $info = stream_get_meta_data($fp); $alive = !$info['eof'] && !$info['timed_out'] && $chunk; } fclose($fp); if ($info['timed_out']) { $result->code = HTTP_REQUEST_TIMEOUT; $result->error = 'request timed out'; return $result; } // Parse response headers from the response body. // Be tolerant of malformed HTTP responses that separate header and body with // \n\n or \r\r instead of \r\n\r\n. list($response, $result->data) = preg_split("/\r\n\r\n|\n\n|\r\r/", $response, 2); $response = preg_split("/\r\n|\n|\r/", $response); // Parse the response status line. $response_status_array = _drupal_parse_response_status(trim(array_shift($response))); $result->protocol = $response_status_array['http_version']; $result->status_message = $response_status_array['reason_phrase']; $code = $response_status_array['response_code']; $result->headers = array(); // Parse the response headers. while ($line = trim(array_shift($response))) { list($name, $value) = explode(':', $line, 2); $name = strtolower($name); if (isset($result->headers[$name]) && $name == 'set-cookie') { // RFC 2109: the Set-Cookie response header comprises the token Set- // Cookie:, followed by a comma-separated list of one or more cookies. $result->headers[$name] .= ',' . trim($value); } else { $result->headers[$name] = trim($value); } } $responses = array( 100 => 'Continue', 101 => 'Switching Protocols', 200 => 'OK', 201 => 'Created', 202 => 'Accepted', 203 => 'Non-Authoritative Information', 204 => 'No Content', 205 => 'Reset Content', 206 => 'Partial Content', 300 => 'Multiple Choices', 301 => 'Moved Permanently', 302 => 'Found', 303 => 'See Other', 304 => 'Not Modified', 305 => 'Use Proxy', 307 => 'Temporary Redirect', 400 => 'Bad Request', 401 => 'Unauthorized', 402 => 'Payment Required', 403 => 'Forbidden', 404 => 'Not Found', 405 => 'Method Not Allowed', 406 => 'Not Acceptable', 407 => 'Proxy Authentication Required', 408 => 'Request Time-out', 409 => 'Conflict', 410 => 'Gone', 411 => 'Length Required', 412 => 'Precondition Failed', 413 => 'Request Entity Too Large', 414 => 'Request-URI Too Large', 415 => 'Unsupported Media Type', 416 => 'Requested range not satisfiable', 417 => 'Expectation Failed', 500 => 'Internal Server Error', 501 => 'Not Implemented', 502 => 'Bad Gateway', 503 => 'Service Unavailable', 504 => 'Gateway Time-out', 505 => 'HTTP Version not supported', ); // RFC 2616 states that all unknown HTTP codes must be treated the same as the // base code in their class. if (!isset($responses[$code])) { $code = floor($code / 100) * 100; } $result->code = $code; switch ($code) { case 200: // OK case 201: // Created case 202: // Accepted case 203: // Non-Authoritative Information case 204: // No Content case 205: // Reset Content case 206: // Partial Content case 304: // Not modified break; case 301: // Moved permanently case 302: // Moved temporarily case 307: // Moved temporarily $location = $result->headers['location']; $options['timeout'] -= timer_read(__FUNCTION__) / 1000; if ($options['timeout'] <= 0) { $result->code = HTTP_REQUEST_TIMEOUT; $result->error = 'request timed out'; } elseif ($options['max_redirects']) { // Redirect to the new location. $options['max_redirects']--; $result = drupal_http_request($location, $options); $result->redirect_code = $code; } if (!isset($result->redirect_url)) { $result->redirect_url = $location; } break; default: $result->error = $result->status_message; } return $result; } /** * Splits an HTTP response status line into components. * * See the @link http://www.w3.org/Protocols/rfc2616/rfc2616-sec6.html status line definition @endlink * in RFC 2616. * * @param string $respone * The response status line, for example 'HTTP/1.1 500 Internal Server Error'. * * @return array * Keyed array containing the component parts. If the response is malformed, * all possible parts will be extracted. 'reason_phrase' could be empty. * Possible keys: * - 'http_version' * - 'response_code' * - 'reason_phrase' */ function _drupal_parse_response_status($response) { $response_array = explode(' ', trim($response), 3); // Set up empty values. $result = array( 'reason_phrase' => '', ); $result['http_version'] = $response_array[0]; $result['response_code'] = $response_array[1]; if (isset($response_array[2])) { $result['reason_phrase'] = $response_array[2]; } return $result; } /** * Helper function for determining hosts excluded from needing a proxy. * * @return * TRUE if a proxy should be used for this host. */ function _drupal_http_use_proxy($host) { $proxy_exceptions = variable_get('proxy_exceptions', array('localhost', '127.0.0.1')); return !in_array(strtolower($host), $proxy_exceptions, TRUE); } /** * @} End of "HTTP handling". */ /** * Strips slashes from a string or array of strings. * * Callback for array_walk() within fix_gpx_magic(). * * @param $item * An individual string or array of strings from superglobals. */ function _fix_gpc_magic(&$item) { if (is_array($item)) { array_walk($item, '_fix_gpc_magic'); } else { $item = stripslashes($item); } } /** * Strips slashes from $_FILES items. * * Callback for array_walk() within fix_gpc_magic(). * * The tmp_name key is skipped keys since PHP generates single backslashes for * file paths on Windows systems. * * @param $item * An item from $_FILES. * @param $key * The key for the item within $_FILES. * * @see http://php.net/manual/features.file-upload.php#42280 */ function _fix_gpc_magic_files(&$item, $key) { if ($key != 'tmp_name') { if (is_array($item)) { array_walk($item, '_fix_gpc_magic_files'); } else { $item = stripslashes($item); } } } /** * Fixes double-escaping caused by "magic quotes" in some PHP installations. * * @see _fix_gpc_magic() * @see _fix_gpc_magic_files() */ function fix_gpc_magic() { static $fixed = FALSE; if (!$fixed && ini_get('magic_quotes_gpc')) { array_walk($_GET, '_fix_gpc_magic'); array_walk($_POST, '_fix_gpc_magic'); array_walk($_COOKIE, '_fix_gpc_magic'); array_walk($_REQUEST, '_fix_gpc_magic'); array_walk($_FILES, '_fix_gpc_magic_files'); } $fixed = TRUE; } /** * @defgroup validation Input validation * @{ * Functions to validate user input. */ /** * Verifies the syntax of the given e-mail address. * * This uses the * @link http://php.net/manual/filter.filters.validate.php PHP e-mail validation filter. @endlink * * @param $mail * A string containing an e-mail address. * * @return * TRUE if the address is in a valid format. */ function valid_email_address($mail) { return (bool)filter_var($mail, FILTER_VALIDATE_EMAIL); } /** * Verifies the syntax of the given URL. * * This function should only be used on actual URLs. It should not be used for * Drupal menu paths, which can contain arbitrary characters. * Valid values per RFC 3986. * @param $url * The URL to verify. * @param $absolute * Whether the URL is absolute (beginning with a scheme such as "http:"). * * @return * TRUE if the URL is in a valid format. */ function valid_url($url, $absolute = FALSE) { if ($absolute) { return (bool)preg_match(" /^ # Start at the beginning of the text (?:ftp|https?|feed):\/\/ # Look for ftp, http, https or feed schemes (?: # Userinfo (optional) which is typically (?:(?:[\w\.\-\+!$&'\(\)*\+,;=]|%[0-9a-f]{2})+:)* # a username or a username and password (?:[\w\.\-\+%!$&'\(\)*\+,;=]|%[0-9a-f]{2})+@ # combination )? (?: (?:[a-z0-9\-\.]|%[0-9a-f]{2})+ # A domain name or a IPv4 address |(?:\[(?:[0-9a-f]{0,4}:)*(?:[0-9a-f]{0,4})\]) # or a well formed IPv6 address ) (?::[0-9]+)? # Server port number (optional) (?:[\/|\?] (?:[\w#!:\.\?\+=&@$'~*,;\/\(\)\[\]\-]|%[0-9a-f]{2}) # The path and query (optional) *)? $/xi", $url); } else { return (bool)preg_match("/^(?:[\w#!:\.\?\+=&@$'~*,;\/\(\)\[\]\-]|%[0-9a-f]{2})+$/i", $url); } } /** * @} End of "defgroup validation". */ /** * Registers an event for the current visitor to the flood control mechanism. * * @param $name * The name of an event. * @param $window * Optional number of seconds before this event expires. Defaults to 3600 (1 * hour). Typically uses the same value as the flood_is_allowed() $window * parameter. Expired events are purged on cron run to prevent the flood table * from growing indefinitely. * @param $identifier * Optional identifier (defaults to the current user's IP address). */ function flood_register_event($name, $window = 3600, $identifier = NULL) { if (!isset($identifier)) { $identifier = ip_address(); } db_insert('flood') ->fields(array( 'event' => $name, 'identifier' => $identifier, 'timestamp' => REQUEST_TIME, 'expiration' => REQUEST_TIME + $window, )) ->execute(); } /** * Makes the flood control mechanism forget an event for the current visitor. * * @param $name * The name of an event. * @param $identifier * Optional identifier (defaults to the current user's IP address). */ function flood_clear_event($name, $identifier = NULL) { if (!isset($identifier)) { $identifier = ip_address(); } db_delete('flood') ->condition('event', $name) ->condition('identifier', $identifier) ->execute(); } /** * Checks whether a user is allowed to proceed with the specified event. * * Events can have thresholds saying that each user can only do that event * a certain number of times in a time window. This function verifies that the * current user has not exceeded this threshold. * * @param $name * The unique name of the event. * @param $threshold * The maximum number of times each user can do this event per time window. * @param $window * Number of seconds in the time window for this event (default is 3600 * seconds, or 1 hour). * @param $identifier * Unique identifier of the current user. Defaults to their IP address. * * @return * TRUE if the user is allowed to proceed. FALSE if they have exceeded the * threshold and should not be allowed to proceed. */ function flood_is_allowed($name, $threshold, $window = 3600, $identifier = NULL) { if (!isset($identifier)) { $identifier = ip_address(); } $number = db_query("SELECT COUNT(*) FROM {flood} WHERE event = :event AND identifier = :identifier AND timestamp > :timestamp", array( ':event' => $name, ':identifier' => $identifier, ':timestamp' => REQUEST_TIME - $window)) ->fetchField(); return ($number < $threshold); } /** * @defgroup sanitization Sanitization functions * @{ * Functions to sanitize values. * * See http://drupal.org/writing-secure-code for information * on writing secure code. */ /** * Strips dangerous protocols (e.g. 'javascript:') from a URI. * * This function must be called for all URIs within user-entered input prior * to being output to an HTML attribute value. It is often called as part of * check_url() or filter_xss(), but those functions return an HTML-encoded * string, so this function can be called independently when the output needs to * be a plain-text string for passing to t(), l(), drupal_attributes(), or * another function that will call check_plain() separately. * * @param $uri * A plain-text URI that might contain dangerous protocols. * * @return * A plain-text URI stripped of dangerous protocols. As with all plain-text * strings, this return value must not be output to an HTML page without * check_plain() being called on it. However, it can be passed to functions * expecting plain-text strings. * * @see check_url() */ function drupal_strip_dangerous_protocols($uri) { static $allowed_protocols; if (!isset($allowed_protocols)) { $allowed_protocols = array_flip(variable_get('filter_allowed_protocols', array('ftp', 'http', 'https', 'irc', 'mailto', 'news', 'nntp', 'rtsp', 'sftp', 'ssh', 'tel', 'telnet', 'webcal'))); } // Iteratively remove any invalid protocol found. do { $before = $uri; $colonpos = strpos($uri, ':'); if ($colonpos > 0) { // We found a colon, possibly a protocol. Verify. $protocol = substr($uri, 0, $colonpos); // If a colon is preceded by a slash, question mark or hash, it cannot // possibly be part of the URL scheme. This must be a relative URL, which // inherits the (safe) protocol of the base document. if (preg_match('![/?#]!', $protocol)) { break; } // Check if this is a disallowed protocol. Per RFC2616, section 3.2.3 // (URI Comparison) scheme comparison must be case-insensitive. if (!isset($allowed_protocols[strtolower($protocol)])) { $uri = substr($uri, $colonpos + 1); } } } while ($before != $uri); return $uri; } /** * Strips dangerous protocols from a URI and encodes it for output to HTML. * * @param $uri * A plain-text URI that might contain dangerous protocols. * * @return * A URI stripped of dangerous protocols and encoded for output to an HTML * attribute value. Because it is already encoded, it should not be set as a * value within a $attributes array passed to drupal_attributes(), because * drupal_attributes() expects those values to be plain-text strings. To pass * a filtered URI to drupal_attributes(), call * drupal_strip_dangerous_protocols() instead. * * @see drupal_strip_dangerous_protocols() */ function check_url($uri) { return check_plain(drupal_strip_dangerous_protocols($uri)); } /** * Applies a very permissive XSS/HTML filter for admin-only use. * * Use only for fields where it is impractical to use the * whole filter system, but where some (mainly inline) mark-up * is desired (so check_plain() is not acceptable). * * Allows all tags that can be used inside an HTML body, save * for scripts and styles. */ function filter_xss_admin($string) { return filter_xss($string, array('a', 'abbr', 'acronym', 'address', 'article', 'aside', 'b', 'bdi', 'bdo', 'big', 'blockquote', 'br', 'caption', 'cite', 'code', 'col', 'colgroup', 'command', 'dd', 'del', 'details', 'dfn', 'div', 'dl', 'dt', 'em', 'figcaption', 'figure', 'footer', 'h1', 'h2', 'h3', 'h4', 'h5', 'h6', 'header', 'hgroup', 'hr', 'i', 'img', 'ins', 'kbd', 'li', 'mark', 'menu', 'meter', 'nav', 'ol', 'output', 'p', 'pre', 'progress', 'q', 'rp', 'rt', 'ruby', 's', 'samp', 'section', 'small', 'span', 'strong', 'sub', 'summary', 'sup', 'table', 'tbody', 'td', 'tfoot', 'th', 'thead', 'time', 'tr', 'tt', 'u', 'ul', 'var', 'wbr')); } /** * Filters HTML to prevent cross-site-scripting (XSS) vulnerabilities. * * Based on kses by Ulf Harnhammar, see http://sourceforge.net/projects/kses. * For examples of various XSS attacks, see: http://ha.ckers.org/xss.html. * * This code does four things: * - Removes characters and constructs that can trick browsers. * - Makes sure all HTML entities are well-formed. * - Makes sure all HTML tags and attributes are well-formed. * - Makes sure no HTML tags contain URLs with a disallowed protocol (e.g. * javascript:). * * @param $string * The string with raw HTML in it. It will be stripped of everything that can * cause an XSS attack. * @param $allowed_tags * An array of allowed tags. * * @return * An XSS safe version of $string, or an empty string if $string is not * valid UTF-8. * * @see drupal_validate_utf8() */ function filter_xss($string, $allowed_tags = array('a', 'em', 'strong', 'cite', 'blockquote', 'code', 'ul', 'ol', 'li', 'dl', 'dt', 'dd')) { // Only operate on valid UTF-8 strings. This is necessary to prevent cross // site scripting issues on Internet Explorer 6. if (!drupal_validate_utf8($string)) { return ''; } // Store the text format. _filter_xss_split($allowed_tags, TRUE); // Remove NULL characters (ignored by some browsers). $string = str_replace(chr(0), '', $string); // Remove Netscape 4 JS entities. $string = preg_replace('%&\s*\{[^}]*(\}\s*;?|$)%', '', $string); // Defuse all HTML entities. $string = str_replace('&', '&', $string); // Change back only well-formed entities in our whitelist: // Decimal numeric entities. $string = preg_replace('/&#([0-9]+;)/', '&#\1', $string); // Hexadecimal numeric entities. $string = preg_replace('/&#[Xx]0*((?:[0-9A-Fa-f]{2})+;)/', '&#x\1', $string); // Named entities. $string = preg_replace('/&([A-Za-z][A-Za-z0-9]*;)/', '&\1', $string); return preg_replace_callback('% ( <(?=[^a-zA-Z!/]) # a lone < | # or # a comment | # or <[^>]*(>|$) # a string that starts with a <, up until the > or the end of the string | # or > # just a > )%x', '_filter_xss_split', $string); } /** * Processes an HTML tag. * * @param $m * An array with various meaning depending on the value of $store. * If $store is TRUE then the array contains the allowed tags. * If $store is FALSE then the array has one element, the HTML tag to process. * @param $store * Whether to store $m. * * @return * If the element isn't allowed, an empty string. Otherwise, the cleaned up * version of the HTML element. */ function _filter_xss_split($m, $store = FALSE) { static $allowed_html; if ($store) { $allowed_html = array_flip($m); return; } $string = $m[1]; if (substr($string, 0, 1) != '<') { // We matched a lone ">" character. return '>'; } elseif (strlen($string) == 1) { // We matched a lone "<" character. return '<'; } if (!preg_match('%^<\s*(/\s*)?([a-zA-Z0-9\-]+)([^>]*)>?|()$%', $string, $matches)) { // Seriously malformed. return ''; } $slash = trim($matches[1]); $elem = &$matches[2]; $attrlist = &$matches[3]; $comment = &$matches[4]; if ($comment) { $elem = '!--'; } if (!isset($allowed_html[strtolower($elem)])) { // Disallowed HTML element. return ''; } if ($comment) { return $comment; } if ($slash != '') { return ""; } // Is there a closing XHTML slash at the end of the attributes? $attrlist = preg_replace('%(\s?)/\s*$%', '\1', $attrlist, -1, $count); $xhtml_slash = $count ? ' /' : ''; // Clean up attributes. $attr2 = implode(' ', _filter_xss_attributes($attrlist)); $attr2 = preg_replace('/[<>]/', '', $attr2); $attr2 = strlen($attr2) ? ' ' . $attr2 : ''; return "<$elem$attr2$xhtml_slash>"; } /** * Processes a string of HTML attributes. * * @return * Cleaned up version of the HTML attributes. */ function _filter_xss_attributes($attr) { $attrarr = array(); $mode = 0; $attrname = ''; while (strlen($attr) != 0) { // Was the last operation successful? $working = 0; switch ($mode) { case 0: // Attribute name, href for instance. if (preg_match('/^([-a-zA-Z]+)/', $attr, $match)) { $attrname = strtolower($match[1]); $skip = ($attrname == 'style' || substr($attrname, 0, 2) == 'on'); $working = $mode = 1; $attr = preg_replace('/^[-a-zA-Z]+/', '', $attr); } break; case 1: // Equals sign or valueless ("selected"). if (preg_match('/^\s*=\s*/', $attr)) { $working = 1; $mode = 2; $attr = preg_replace('/^\s*=\s*/', '', $attr); break; } if (preg_match('/^\s+/', $attr)) { $working = 1; $mode = 0; if (!$skip) { $attrarr[] = $attrname; } $attr = preg_replace('/^\s+/', '', $attr); } break; case 2: // Attribute value, a URL after href= for instance. if (preg_match('/^"([^"]*)"(\s+|$)/', $attr, $match)) { $thisval = filter_xss_bad_protocol($match[1]); if (!$skip) { $attrarr[] = "$attrname=\"$thisval\""; } $working = 1; $mode = 0; $attr = preg_replace('/^"[^"]*"(\s+|$)/', '', $attr); break; } if (preg_match("/^'([^']*)'(\s+|$)/", $attr, $match)) { $thisval = filter_xss_bad_protocol($match[1]); if (!$skip) { $attrarr[] = "$attrname='$thisval'"; } $working = 1; $mode = 0; $attr = preg_replace("/^'[^']*'(\s+|$)/", '', $attr); break; } if (preg_match("%^([^\s\"']+)(\s+|$)%", $attr, $match)) { $thisval = filter_xss_bad_protocol($match[1]); if (!$skip) { $attrarr[] = "$attrname=\"$thisval\""; } $working = 1; $mode = 0; $attr = preg_replace("%^[^\s\"']+(\s+|$)%", '', $attr); } break; } if ($working == 0) { // Not well formed; remove and try again. $attr = preg_replace('/ ^ ( "[^"]*("|$) # - a string that starts with a double quote, up until the next double quote or the end of the string | # or \'[^\']*(\'|$)| # - a string that starts with a quote, up until the next quote or the end of the string | # or \S # - a non-whitespace character )* # any number of the above three \s* # any number of whitespaces /x', '', $attr); $mode = 0; } } // The attribute list ends with a valueless attribute like "selected". if ($mode == 1 && !$skip) { $attrarr[] = $attrname; } return $attrarr; } /** * Processes an HTML attribute value and strips dangerous protocols from URLs. * * @param $string * The string with the attribute value. * @param $decode * (deprecated) Whether to decode entities in the $string. Set to FALSE if the * $string is in plain text, TRUE otherwise. Defaults to TRUE. This parameter * is deprecated and will be removed in Drupal 8. To process a plain-text URI, * call drupal_strip_dangerous_protocols() or check_url() instead. * * @return * Cleaned up and HTML-escaped version of $string. */ function filter_xss_bad_protocol($string, $decode = TRUE) { // Get the plain text representation of the attribute value (i.e. its meaning). // @todo Remove the $decode parameter in Drupal 8, and always assume an HTML // string that needs decoding. if ($decode) { if (!function_exists('decode_entities')) { require_once DRUPAL_ROOT . '/includes/unicode.inc'; } $string = decode_entities($string); } return check_plain(drupal_strip_dangerous_protocols($string)); } /** * @} End of "defgroup sanitization". */ /** * @defgroup format Formatting * @{ * Functions to format numbers, strings, dates, etc. */ /** * Formats an RSS channel. * * Arbitrary elements may be added using the $args associative array. */ function format_rss_channel($title, $link, $description, $items, $langcode = NULL, $args = array()) { global $language_content; $langcode = $langcode ? $langcode : $language_content->language; $output = "\n"; $output .= ' ' . check_plain($title) . "\n"; $output .= ' ' . check_url($link) . "\n"; // The RSS 2.0 "spec" doesn't indicate HTML can be used in the description. // We strip all HTML tags, but need to prevent double encoding from properly // escaped source data (such as & becoming &amp;). $output .= ' ' . check_plain(decode_entities(strip_tags($description))) . "\n"; $output .= ' ' . check_plain($langcode) . "\n"; $output .= format_xml_elements($args); $output .= $items; $output .= "\n"; return $output; } /** * Formats a single RSS item. * * Arbitrary elements may be added using the $args associative array. */ function format_rss_item($title, $link, $description, $args = array()) { $output = "\n"; $output .= ' ' . check_plain($title) . "\n"; $output .= ' ' . check_url($link) . "\n"; $output .= ' ' . check_plain($description) . "\n"; $output .= format_xml_elements($args); $output .= "\n"; return $output; } /** * Formats XML elements. * * @param $array * An array where each item represents an element and is either a: * - (key => value) pair (value) * - Associative array with fields: * - 'key': element name * - 'value': element contents * - 'attributes': associative array of element attributes * * In both cases, 'value' can be a simple string, or it can be another array * with the same format as $array itself for nesting. */ function format_xml_elements($array) { $output = ''; foreach ($array as $key => $value) { if (is_numeric($key)) { if ($value['key']) { $output .= ' <' . $value['key']; if (isset($value['attributes']) && is_array($value['attributes'])) { $output .= drupal_attributes($value['attributes']); } if (isset($value['value']) && $value['value'] != '') { $output .= '>' . (is_array($value['value']) ? format_xml_elements($value['value']) : check_plain($value['value'])) . '\n"; } else { $output .= " />\n"; } } } else { $output .= ' <' . $key . '>' . (is_array($value) ? format_xml_elements($value) : check_plain($value)) . "\n"; } } return $output; } /** * Formats a string containing a count of items. * * This function ensures that the string is pluralized correctly. Since t() is * called by this function, make sure not to pass already-localized strings to * it. * * For example: * @code * $output = format_plural($node->comment_count, '1 comment', '@count comments'); * @endcode * * Example with additional replacements: * @code * $output = format_plural($update_count, * 'Changed the content type of 1 post from %old-type to %new-type.', * 'Changed the content type of @count posts from %old-type to %new-type.', * array('%old-type' => $info->old_type, '%new-type' => $info->new_type)); * @endcode * * @param $count * The item count to display. * @param $singular * The string for the singular case. Make sure it is clear this is singular, * to ease translation (e.g. use "1 new comment" instead of "1 new"). Do not * use @count in the singular string. * @param $plural * The string for the plural case. Make sure it is clear this is plural, to * ease translation. Use @count in place of the item count, as in * "@count new comments". * @param $args * An associative array of replacements to make after translation. Instances * of any key in this array are replaced with the corresponding value. * Based on the first character of the key, the value is escaped and/or * themed. See format_string(). Note that you do not need to include @count * in this array; this replacement is done automatically for the plural case. * @param $options * An associative array of additional options. See t() for allowed keys. * * @return * A translated string. * * @see t() * @see format_string() */ function format_plural($count, $singular, $plural, array $args = array(), array $options = array()) { $args['@count'] = $count; if ($count == 1) { return t($singular, $args, $options); } // Get the plural index through the gettext formula. $index = (function_exists('locale_get_plural')) ? locale_get_plural($count, isset($options['langcode']) ? $options['langcode'] : NULL) : -1; // If the index cannot be computed, use the plural as a fallback (which // allows for most flexiblity with the replaceable @count value). if ($index < 0) { return t($plural, $args, $options); } else { switch ($index) { case "0": return t($singular, $args, $options); case "1": return t($plural, $args, $options); default: unset($args['@count']); $args['@count[' . $index . ']'] = $count; return t(strtr($plural, array('@count' => '@count[' . $index . ']')), $args, $options); } } } /** * Parses a given byte count. * * @param $size * A size expressed as a number of bytes with optional SI or IEC binary unit * prefix (e.g. 2, 3K, 5MB, 10G, 6GiB, 8 bytes, 9mbytes). * * @return * An integer representation of the size in bytes. */ function parse_size($size) { $unit = preg_replace('/[^bkmgtpezy]/i', '', $size); // Remove the non-unit characters from the size. $size = preg_replace('/[^0-9\.]/', '', $size); // Remove the non-numeric characters from the size. if ($unit) { // Find the position of the unit in the ordered string which is the power of magnitude to multiply a kilobyte by. return round($size * pow(DRUPAL_KILOBYTE, stripos('bkmgtpezy', $unit[0]))); } else { return round($size); } } /** * Generates a string representation for the given byte count. * * @param $size * A size in bytes. * @param $langcode * Optional language code to translate to a language other than what is used * to display the page. * * @return * A translated string representation of the size. */ function format_size($size, $langcode = NULL) { if ($size < DRUPAL_KILOBYTE) { return format_plural($size, '1 byte', '@count bytes', array(), array('langcode' => $langcode)); } else { $size = $size / DRUPAL_KILOBYTE; // Convert bytes to kilobytes. $units = array( t('@size KB', array(), array('langcode' => $langcode)), t('@size MB', array(), array('langcode' => $langcode)), t('@size GB', array(), array('langcode' => $langcode)), t('@size TB', array(), array('langcode' => $langcode)), t('@size PB', array(), array('langcode' => $langcode)), t('@size EB', array(), array('langcode' => $langcode)), t('@size ZB', array(), array('langcode' => $langcode)), t('@size YB', array(), array('langcode' => $langcode)), ); foreach ($units as $unit) { if (round($size, 2) >= DRUPAL_KILOBYTE) { $size = $size / DRUPAL_KILOBYTE; } else { break; } } return str_replace('@size', round($size, 2), $unit); } } /** * Formats a time interval with the requested granularity. * * @param $interval * The length of the interval in seconds. * @param $granularity * How many different units to display in the string. * @param $langcode * Optional language code to translate to a language other than * what is used to display the page. * * @return * A translated string representation of the interval. */ function format_interval($interval, $granularity = 2, $langcode = NULL) { $units = array( '1 year|@count years' => 31536000, '1 month|@count months' => 2592000, '1 week|@count weeks' => 604800, '1 day|@count days' => 86400, '1 hour|@count hours' => 3600, '1 min|@count min' => 60, '1 sec|@count sec' => 1 ); $output = ''; foreach ($units as $key => $value) { $key = explode('|', $key); if ($interval >= $value) { $output .= ($output ? ' ' : '') . format_plural(floor($interval / $value), $key[0], $key[1], array(), array('langcode' => $langcode)); $interval %= $value; $granularity--; } if ($granularity == 0) { break; } } return $output ? $output : t('0 sec', array(), array('langcode' => $langcode)); } /** * Formats a date, using a date type or a custom date format string. * * @param $timestamp * A UNIX timestamp to format. * @param $type * (optional) The format to use, one of: * - 'short', 'medium', or 'long' (the corresponding built-in date formats). * - The name of a date type defined by a module in hook_date_format_types(), * if it's been assigned a format. * - The machine name of an administrator-defined date format. * - 'custom', to use $format. * Defaults to 'medium'. * @param $format * (optional) If $type is 'custom', a PHP date format string suitable for * input to date(). Use a backslash to escape ordinary text, so it does not * get interpreted as date format characters. * @param $timezone * (optional) Time zone identifier, as described at * http://php.net/manual/timezones.php Defaults to the time zone used to * display the page. * @param $langcode * (optional) Language code to translate to. Defaults to the language used to * display the page. * * @return * A translated date string in the requested format. */ function format_date($timestamp, $type = 'medium', $format = '', $timezone = NULL, $langcode = NULL) { // Use the advanced drupal_static() pattern, since this is called very often. static $drupal_static_fast; if (!isset($drupal_static_fast)) { $drupal_static_fast['timezones'] = &drupal_static(__FUNCTION__); } $timezones = &$drupal_static_fast['timezones']; if (!isset($timezone)) { $timezone = date_default_timezone_get(); } // Store DateTimeZone objects in an array rather than repeatedly // constructing identical objects over the life of a request. if (!isset($timezones[$timezone])) { $timezones[$timezone] = timezone_open($timezone); } // Use the default langcode if none is set. global $language; if (empty($langcode)) { $langcode = isset($language->language) ? $language->language : 'en'; } switch ($type) { case 'short': $format = variable_get('date_format_short', 'm/d/Y - H:i'); break; case 'long': $format = variable_get('date_format_long', 'l, F j, Y - H:i'); break; case 'custom': // No change to format. break; case 'medium': default: // Retrieve the format of the custom $type passed. if ($type != 'medium') { $format = variable_get('date_format_' . $type, ''); } // Fall back to 'medium'. if ($format === '') { $format = variable_get('date_format_medium', 'D, m/d/Y - H:i'); } break; } // Create a DateTime object from the timestamp. $date_time = date_create('@' . $timestamp); // Set the time zone for the DateTime object. date_timezone_set($date_time, $timezones[$timezone]); // Encode markers that should be translated. 'A' becomes '\xEF\AA\xFF'. // xEF and xFF are invalid UTF-8 sequences, and we assume they are not in the // input string. // Paired backslashes are isolated to prevent errors in read-ahead evaluation. // The read-ahead expression ensures that A matches, but not \A. $format = preg_replace(array('/\\\\\\\\/', '/(? $langcode, ); if ($code == 'F') { $options['context'] = 'Long month name'; } if ($code == '') { $cache[$langcode][$code][$string] = $string; } else { $cache[$langcode][$code][$string] = t($string, array(), $options); } } return $cache[$langcode][$code][$string]; } /** * Format a username. * * This is also the label callback implementation of * callback_entity_info_label() for user_entity_info(). * * By default, the passed-in object's 'name' property is used if it exists, or * else, the site-defined value for the 'anonymous' variable. However, a module * may override this by implementing hook_username_alter(&$name, $account). * * @see hook_username_alter() * * @param $account * The account object for the user whose name is to be formatted. * * @return * An unsanitized string with the username to display. The code receiving * this result must ensure that check_plain() is called on it before it is * printed to the page. */ function format_username($account) { $name = !empty($account->name) ? $account->name : variable_get('anonymous', t('Anonymous')); drupal_alter('username', $name, $account); return $name; } /** * @} End of "defgroup format". */ /** * Generates an internal or external URL. * * When creating links in modules, consider whether l() could be a better * alternative than url(). * * @param $path * (optional) The internal path or external URL being linked to, such as * "node/34" or "http://example.com/foo". The default value is equivalent to * passing in ''. A few notes: * - If you provide a full URL, it will be considered an external URL. * - If you provide only the path (e.g. "node/34"), it will be * considered an internal link. In this case, it should be a system URL, * and it will be replaced with the alias, if one exists. Additional query * arguments for internal paths must be supplied in $options['query'], not * included in $path. * - If you provide an internal path and $options['alias'] is set to TRUE, the * path is assumed already to be the correct path alias, and the alias is * not looked up. * - The special string '' generates a link to the site's base URL. * - If your external URL contains a query (e.g. http://example.com/foo?a=b), * then you can either URL encode the query keys and values yourself and * include them in $path, or use $options['query'] to let this function * URL encode them. * @param $options * (optional) An associative array of additional options, with the following * elements: * - 'query': An array of query key/value-pairs (without any URL-encoding) to * append to the URL. * - 'fragment': A fragment identifier (named anchor) to append to the URL. * Do not include the leading '#' character. * - 'absolute': Defaults to FALSE. Whether to force the output to be an * absolute link (beginning with http:). Useful for links that will be * displayed outside the site, such as in an RSS feed. * - 'alias': Defaults to FALSE. Whether the given path is a URL alias * already. * - 'external': Whether the given path is an external URL. * - 'language': An optional language object. If the path being linked to is * internal to the site, $options['language'] is used to look up the alias * for the URL. If $options['language'] is omitted, the global $language_url * will be used. * - 'https': Whether this URL should point to a secure location. If not * defined, the current scheme is used, so the user stays on HTTP or HTTPS * respectively. TRUE enforces HTTPS and FALSE enforces HTTP, but HTTPS can * only be enforced when the variable 'https' is set to TRUE. * - 'base_url': Only used internally, to modify the base URL when a language * dependent URL requires so. * - 'prefix': Only used internally, to modify the path when a language * dependent URL requires so. * - 'script': The script filename in Drupal's root directory to use when * clean URLs are disabled, such as 'index.php'. Defaults to an empty * string, as most modern web servers automatically find 'index.php'. If * clean URLs are disabled, the value of $path is appended as query * parameter 'q' to $options['script'] in the returned URL. When deploying * Drupal on a web server that cannot be configured to automatically find * index.php, then hook_url_outbound_alter() can be implemented to force * this value to 'index.php'. * - 'entity_type': The entity type of the object that called url(). Only * set if url() is invoked by entity_uri(). * - 'entity': The entity object (such as a node) for which the URL is being * generated. Only set if url() is invoked by entity_uri(). * * @return * A string containing a URL to the given path. */ function url($path = NULL, array $options = array()) { // Merge in defaults. $options += array( 'fragment' => '', 'query' => array(), 'absolute' => FALSE, 'alias' => FALSE, 'prefix' => '' ); // A duplicate of the code from url_is_external() to avoid needing another // function call, since performance inside url() is critical. if (!isset($options['external'])) { // Return an external link if $path contains an allowed absolute URL. Avoid // calling drupal_strip_dangerous_protocols() if there is any slash (/), // hash (#) or question_mark (?) before the colon (:) occurrence - if any - // as this would clearly mean it is not a URL. If the path starts with 2 // slashes then it is always considered an external URL without an explicit // protocol part. $colonpos = strpos($path, ':'); $options['external'] = (strpos($path, '//') === 0) || ($colonpos !== FALSE && !preg_match('![/?#]!', substr($path, 0, $colonpos)) && drupal_strip_dangerous_protocols($path) == $path); } // Preserve the original path before altering or aliasing. $original_path = $path; // Allow other modules to alter the outbound URL and options. drupal_alter('url_outbound', $path, $options, $original_path); if (isset($options['fragment']) && $options['fragment'] !== '') { $options['fragment'] = '#' . $options['fragment']; } if ($options['external']) { // Split off the fragment. if (strpos($path, '#') !== FALSE) { list($path, $old_fragment) = explode('#', $path, 2); // If $options contains no fragment, take it over from the path. if (isset($old_fragment) && !$options['fragment']) { $options['fragment'] = '#' . $old_fragment; } } // Append the query. if ($options['query']) { $path .= (strpos($path, '?') !== FALSE ? '&' : '?') . drupal_http_build_query($options['query']); } if (isset($options['https']) && variable_get('https', FALSE)) { if ($options['https'] === TRUE) { $path = str_replace('http://', 'https://', $path); } elseif ($options['https'] === FALSE) { $path = str_replace('https://', 'http://', $path); } } // Reassemble. return $path . $options['fragment']; } // Strip leading slashes from internal paths to prevent them becoming external // URLs without protocol. /example.com should not be turned into // //example.com. $path = ltrim($path, '/'); global $base_url, $base_secure_url, $base_insecure_url; // The base_url might be rewritten from the language rewrite in domain mode. if (!isset($options['base_url'])) { if (isset($options['https']) && variable_get('https', FALSE)) { if ($options['https'] === TRUE) { $options['base_url'] = $base_secure_url; $options['absolute'] = TRUE; } elseif ($options['https'] === FALSE) { $options['base_url'] = $base_insecure_url; $options['absolute'] = TRUE; } } else { $options['base_url'] = $base_url; } } // The special path '' links to the default front page. if ($path == '') { $path = ''; } elseif (!empty($path) && !$options['alias']) { $language = isset($options['language']) && isset($options['language']->language) ? $options['language']->language : ''; $alias = drupal_get_path_alias($original_path, $language); if ($alias != $original_path) { $path = $alias; } } $base = $options['absolute'] ? $options['base_url'] . '/' : base_path(); $prefix = empty($path) ? rtrim($options['prefix'], '/') : $options['prefix']; // With Clean URLs. if (!empty($GLOBALS['conf']['clean_url'])) { $path = drupal_encode_path($prefix . $path); if ($options['query']) { return $base . $path . '?' . drupal_http_build_query($options['query']) . $options['fragment']; } else { return $base . $path . $options['fragment']; } } // Without Clean URLs. else { $path = $prefix . $path; $query = array(); if (!empty($path)) { $query['q'] = $path; } if ($options['query']) { // We do not use array_merge() here to prevent overriding $path via query // parameters. $query += $options['query']; } $query = $query ? ('?' . drupal_http_build_query($query)) : ''; $script = isset($options['script']) ? $options['script'] : ''; return $base . $script . $query . $options['fragment']; } } /** * Returns TRUE if a path is external to Drupal (e.g. http://example.com). * * If a path cannot be assessed by Drupal's menu handler, then we must * treat it as potentially insecure. * * @param $path * The internal path or external URL being linked to, such as "node/34" or * "http://example.com/foo". * * @return * Boolean TRUE or FALSE, where TRUE indicates an external path. */ function url_is_external($path) { $colonpos = strpos($path, ':'); // Avoid calling drupal_strip_dangerous_protocols() if there is any slash (/), // hash (#) or question_mark (?) before the colon (:) occurrence - if any - as // this would clearly mean it is not a URL. If the path starts with 2 slashes // then it is always considered an external URL without an explicit protocol // part. return (strpos($path, '//') === 0) || ($colonpos !== FALSE && !preg_match('![/?#]!', substr($path, 0, $colonpos)) && drupal_strip_dangerous_protocols($path) == $path); } /** * Formats an attribute string for an HTTP header. * * @param $attributes * An associative array of attributes such as 'rel'. * * @return * A ; separated string ready for insertion in a HTTP header. No escaping is * performed for HTML entities, so this string is not safe to be printed. * * @see drupal_add_http_header() */ function drupal_http_header_attributes(array $attributes = array()) { foreach ($attributes as $attribute => &$data) { if (is_array($data)) { $data = implode(' ', $data); } $data = $attribute . '="' . $data . '"'; } return $attributes ? ' ' . implode('; ', $attributes) : ''; } /** * Converts an associative array to an XML/HTML tag attribute string. * * Each array key and its value will be formatted into an attribute string. * If a value is itself an array, then its elements are concatenated to a single * space-delimited string (for example, a class attribute with multiple values). * * Attribute values are sanitized by running them through check_plain(). * Attribute names are not automatically sanitized. When using user-supplied * attribute names, it is strongly recommended to allow only white-listed names, * since certain attributes carry security risks and can be abused. * * Examples of security aspects when using drupal_attributes: * @code * // By running the value in the following statement through check_plain, * // the malicious script is neutralized. * drupal_attributes(array('title' => t(''))); * * // The statement below demonstrates dangerous use of drupal_attributes, and * // will return an onmouseout attribute with JavaScript code that, when used * // as attribute in a tag, will cause users to be redirected to another site. * // * // In this case, the 'onmouseout' attribute should not be whitelisted -- * // you don't want users to have the ability to add this attribute or others * // that take JavaScript commands. * drupal_attributes(array('onmouseout' => 'window.location="http://malicious.com/";'))); * @endcode * * @param $attributes * An associative array of key-value pairs to be converted to attributes. * * @return * A string ready for insertion in a tag (starts with a space). * * @ingroup sanitization */ function drupal_attributes(array $attributes = array()) { foreach ($attributes as $attribute => &$data) { $data = implode(' ', (array) $data); $data = $attribute . '="' . check_plain($data) . '"'; } return $attributes ? ' ' . implode(' ', $attributes) : ''; } /** * Formats an internal or external URL link as an HTML anchor tag. * * This function correctly handles aliased paths and adds an 'active' class * attribute to links that point to the current page (for theming), so all * internal links output by modules should be generated by this function if * possible. * * However, for links enclosed in translatable text you should use t() and * embed the HTML anchor tag directly in the translated string. For example: * @code * t('Visit the settings page', array('@url' => url('admin'))); * @endcode * This keeps the context of the link title ('settings' in the example) for * translators. * * @param string $text * The translated link text for the anchor tag. * @param string $path * The internal path or external URL being linked to, such as "node/34" or * "http://example.com/foo". After the url() function is called to construct * the URL from $path and $options, the resulting URL is passed through * check_plain() before it is inserted into the HTML anchor tag, to ensure * well-formed HTML. See url() for more information and notes. * @param array $options * An associative array of additional options. Defaults to an empty array. It * may contain the following elements. * - 'attributes': An associative array of HTML attributes to apply to the * anchor tag. If element 'class' is included, it must be an array; 'title' * must be a string; other elements are more flexible, as they just need * to work in a call to drupal_attributes($options['attributes']). * - 'html' (default FALSE): Whether $text is HTML or just plain-text. For * example, to make an image tag into a link, this must be set to TRUE, or * you will see the escaped HTML image tag. $text is not sanitized if * 'html' is TRUE. The calling function must ensure that $text is already * safe. * - 'language': An optional language object. If the path being linked to is * internal to the site, $options['language'] is used to determine whether * the link is "active", or pointing to the current page (the language as * well as the path must match). This element is also used by url(). * - Additional $options elements used by the url() function. * * @return string * An HTML string containing a link to the given path. * * @see url() */ function l($text, $path, array $options = array()) { global $language_url; static $use_theme = NULL; // Merge in defaults. $options += array( 'attributes' => array(), 'html' => FALSE, ); // Append active class. if (($path == $_GET['q'] || ($path == '' && drupal_is_front_page())) && (empty($options['language']) || $options['language']->language == $language_url->language)) { $options['attributes']['class'][] = 'active'; } // Remove all HTML and PHP tags from a tooltip. For best performance, we act only // if a quick strpos() pre-check gave a suspicion (because strip_tags() is expensive). if (isset($options['attributes']['title']) && strpos($options['attributes']['title'], '<') !== FALSE) { $options['attributes']['title'] = strip_tags($options['attributes']['title']); } // Determine if rendering of the link is to be done with a theme function // or the inline default. Inline is faster, but if the theme system has been // loaded and a module or theme implements a preprocess or process function // or overrides the theme_link() function, then invoke theme(). Preliminary // benchmarks indicate that invoking theme() can slow down the l() function // by 20% or more, and that some of the link-heavy Drupal pages spend more // than 10% of the total page request time in the l() function. if (!isset($use_theme) && function_exists('theme')) { // Allow edge cases to prevent theme initialization and force inline link // rendering. if (variable_get('theme_link', TRUE)) { drupal_theme_initialize(); $registry = theme_get_registry(FALSE); // We don't want to duplicate functionality that's in theme(), so any // hint of a module or theme doing anything at all special with the 'link' // theme hook should simply result in theme() being called. This includes // the overriding of theme_link() with an alternate function or template, // the presence of preprocess or process functions, or the presence of // include files. $use_theme = !isset($registry['link']['function']) || ($registry['link']['function'] != 'theme_link'); $use_theme = $use_theme || !empty($registry['link']['preprocess functions']) || !empty($registry['link']['process functions']) || !empty($registry['link']['includes']); } else { $use_theme = FALSE; } } if ($use_theme) { return theme('link', array('text' => $text, 'path' => $path, 'options' => $options)); } // The result of url() is a plain-text URL. Because we are using it here // in an HTML argument context, we need to encode it properly. return '' . ($options['html'] ? $text : check_plain($text)) . ''; } /** * Delivers a page callback result to the browser in the appropriate format. * * This function is most commonly called by menu_execute_active_handler(), but * can also be called by error conditions such as drupal_not_found(), * drupal_access_denied(), and drupal_site_offline(). * * When a user requests a page, index.php calls menu_execute_active_handler(), * which calls the 'page callback' function registered in hook_menu(). The page * callback function can return one of: * - NULL: to indicate no content. * - An integer menu status constant: to indicate an error condition. * - A string of HTML content. * - A renderable array of content. * Returning a renderable array rather than a string of HTML is preferred, * because that provides modules with more flexibility in customizing the final * result. * * When the page callback returns its constructed content to * menu_execute_active_handler(), this function gets called. The purpose of * this function is to determine the most appropriate 'delivery callback' * function to route the content to. The delivery callback function then * sends the content to the browser in the needed format. The default delivery * callback is drupal_deliver_html_page(), which delivers the content as an HTML * page, complete with blocks in addition to the content. This default can be * overridden on a per menu router item basis by setting 'delivery callback' in * hook_menu() or hook_menu_alter(), and can also be overridden on a per request * basis in hook_page_delivery_callback_alter(). * * For example, the same page callback function can be used for an HTML * version of the page and an Ajax version of the page. The page callback * function just needs to decide what content is to be returned and the * delivery callback function will send it as an HTML page or an Ajax * response, as appropriate. * * In order for page callbacks to be reusable in different delivery formats, * they should not issue any "print" or "echo" statements, but instead just * return content. * * Also note that this function does not perform access checks. The delivery * callback function specified in hook_menu(), hook_menu_alter(), or * hook_page_delivery_callback_alter() will be called even if the router item * access checks fail. This is intentional (it is needed for JSON and other * purposes), but it has security implications. Do not call this function * directly unless you understand the security implications, and be careful in * writing delivery callbacks, so that they do not violate security. See * drupal_deliver_html_page() for an example of a delivery callback that * respects security. * * @param $page_callback_result * The result of a page callback. Can be one of: * - NULL: to indicate no content. * - An integer menu status constant: to indicate an error condition. * - A string of HTML content. * - A renderable array of content. * @param $default_delivery_callback * (Optional) If given, it is the name of a delivery function most likely * to be appropriate for the page request as determined by the calling * function (e.g., menu_execute_active_handler()). If not given, it is * determined from the menu router information of the current page. * * @see menu_execute_active_handler() * @see hook_menu() * @see hook_menu_alter() * @see hook_page_delivery_callback_alter() */ function drupal_deliver_page($page_callback_result, $default_delivery_callback = NULL) { if (!isset($default_delivery_callback) && ($router_item = menu_get_item())) { $default_delivery_callback = $router_item['delivery_callback']; } $delivery_callback = !empty($default_delivery_callback) ? $default_delivery_callback : 'drupal_deliver_html_page'; // Give modules a chance to alter the delivery callback used, based on // request-time context (e.g., HTTP request headers). drupal_alter('page_delivery_callback', $delivery_callback); if (function_exists($delivery_callback)) { $delivery_callback($page_callback_result); } else { // If a delivery callback is specified, but doesn't exist as a function, // something is wrong, but don't print anything, since it's not known // what format the response needs to be in. watchdog('delivery callback not found', 'callback %callback not found: %q.', array('%callback' => $delivery_callback, '%q' => $_GET['q']), WATCHDOG_ERROR); } } /** * Packages and sends the result of a page callback to the browser as HTML. * * @param $page_callback_result * The result of a page callback. Can be one of: * - NULL: to indicate no content. * - An integer menu status constant: to indicate an error condition. * - A string of HTML content. * - A renderable array of content. * * @see drupal_deliver_page() */ function drupal_deliver_html_page($page_callback_result) { // Emit the correct charset HTTP header, but not if the page callback // result is NULL, since that likely indicates that it printed something // in which case, no further headers may be sent, and not if code running // for this page request has already set the content type header. if (isset($page_callback_result) && is_null(drupal_get_http_header('Content-Type'))) { drupal_add_http_header('Content-Type', 'text/html; charset=utf-8'); } // Send appropriate HTTP-Header for browsers and search engines. global $language; drupal_add_http_header('Content-Language', $language->language); // Menu status constants are integers; page content is a string or array. if (is_int($page_callback_result)) { // @todo: Break these up into separate functions? switch ($page_callback_result) { case MENU_NOT_FOUND: // Print a 404 page. drupal_add_http_header('Status', '404 Not Found'); watchdog('page not found', check_plain($_GET['q']), NULL, WATCHDOG_WARNING); // Check for and return a fast 404 page if configured. drupal_fast_404(); // Keep old path for reference, and to allow forms to redirect to it. if (!isset($_GET['destination'])) { // Make sure that the current path is not interpreted as external URL. if (!url_is_external($_GET['q'])) { $_GET['destination'] = $_GET['q']; } } $path = drupal_get_normal_path(variable_get('site_404', '')); if ($path && $path != $_GET['q']) { // Custom 404 handler. Set the active item in case there are tabs to // display, or other dependencies on the path. menu_set_active_item($path); $return = menu_execute_active_handler($path, FALSE); } if (empty($return) || $return == MENU_NOT_FOUND || $return == MENU_ACCESS_DENIED) { // Standard 404 handler. drupal_set_title(t('Page not found')); $return = t('The requested page "@path" could not be found.', array('@path' => request_uri())); } drupal_set_page_content($return); $page = element_info('page'); print drupal_render_page($page); break; case MENU_ACCESS_DENIED: // Print a 403 page. drupal_add_http_header('Status', '403 Forbidden'); watchdog('access denied', check_plain($_GET['q']), NULL, WATCHDOG_WARNING); // Keep old path for reference, and to allow forms to redirect to it. if (!isset($_GET['destination'])) { // Make sure that the current path is not interpreted as external URL. if (!url_is_external($_GET['q'])) { $_GET['destination'] = $_GET['q']; } } $path = drupal_get_normal_path(variable_get('site_403', '')); if ($path && $path != $_GET['q']) { // Custom 403 handler. Set the active item in case there are tabs to // display or other dependencies on the path. menu_set_active_item($path); $return = menu_execute_active_handler($path, FALSE); } if (empty($return) || $return == MENU_NOT_FOUND || $return == MENU_ACCESS_DENIED) { // Standard 403 handler. drupal_set_title(t('Access denied')); $return = t('You are not authorized to access this page.'); } print drupal_render_page($return); break; case MENU_SITE_OFFLINE: // Print a 503 page. drupal_maintenance_theme(); drupal_add_http_header('Status', '503 Service unavailable'); drupal_set_title(t('Site under maintenance')); print theme('maintenance_page', array('content' => filter_xss_admin(variable_get('maintenance_mode_message', t('@site is currently under maintenance. We should be back shortly. Thank you for your patience.', array('@site' => variable_get('site_name', 'Drupal'))))))); break; } } elseif (isset($page_callback_result)) { // Print anything besides a menu constant, assuming it's not NULL or // undefined. print drupal_render_page($page_callback_result); } // Perform end-of-request tasks. drupal_page_footer(); } /** * Performs end-of-request tasks. * * This function sets the page cache if appropriate, and allows modules to * react to the closing of the page by calling hook_exit(). */ function drupal_page_footer() { global $user; module_invoke_all('exit'); // Commit the user session, if needed. drupal_session_commit(); if (variable_get('cache', 0) && ($cache = drupal_page_set_cache())) { drupal_serve_page_from_cache($cache); } else { ob_flush(); } _registry_check_code(REGISTRY_WRITE_LOOKUP_CACHE); drupal_cache_system_paths(); module_implements_write_cache(); system_run_automated_cron(); } /** * Performs end-of-request tasks. * * In some cases page requests need to end without calling drupal_page_footer(). * In these cases, call drupal_exit() instead. There should rarely be a reason * to call exit instead of drupal_exit(); * * @param $destination * If this function is called from drupal_goto(), then this argument * will be a fully-qualified URL that is the destination of the redirect. * This should be passed along to hook_exit() implementations. */ function drupal_exit($destination = NULL) { if (drupal_get_bootstrap_phase() == DRUPAL_BOOTSTRAP_FULL) { if (!defined('MAINTENANCE_MODE') || MAINTENANCE_MODE != 'update') { module_invoke_all('exit', $destination); } drupal_session_commit(); } exit; } /** * Forms an associative array from a linear array. * * This function walks through the provided array and constructs an associative * array out of it. The keys of the resulting array will be the values of the * input array. The values will be the same as the keys unless a function is * specified, in which case the output of the function is used for the values * instead. * * @param $array * A linear array. * @param $function * A name of a function to apply to all values before output. * * @return * An associative array. */ function drupal_map_assoc($array, $function = NULL) { // array_combine() fails with empty arrays: // http://bugs.php.net/bug.php?id=34857. $array = !empty($array) ? array_combine($array, $array) : array(); if (is_callable($function)) { $array = array_map($function, $array); } return $array; } /** * Attempts to set the PHP maximum execution time. * * This function is a wrapper around the PHP function set_time_limit(). * When called, set_time_limit() restarts the timeout counter from zero. * In other words, if the timeout is the default 30 seconds, and 25 seconds * into script execution a call such as set_time_limit(20) is made, the * script will run for a total of 45 seconds before timing out. * * If the current time limit is not unlimited it is possible to decrease the * total time limit if the sum of the new time limit and the current time spent * running the script is inferior to the original time limit. It is inherent to * the way set_time_limit() works, it should rather be called with an * appropriate value every time you need to allocate a certain amount of time * to execute a task than only once at the beginning of the script. * * Before calling set_time_limit(), we check if this function is available * because it could be disabled by the server administrator. We also hide all * the errors that could occur when calling set_time_limit(), because it is * not possible to reliably ensure that PHP or a security extension will * not issue a warning/error if they prevent the use of this function. * * @param $time_limit * An integer specifying the new time limit, in seconds. A value of 0 * indicates unlimited execution time. * * @ingroup php_wrappers */ function drupal_set_time_limit($time_limit) { if (function_exists('set_time_limit')) { $current = ini_get('max_execution_time'); // Do not set time limit if it is currently unlimited. if ($current != 0) { @set_time_limit($time_limit); } } } /** * Returns the path to a system item (module, theme, etc.). * * @param $type * The type of the item (i.e. theme, theme_engine, module, profile). * @param $name * The name of the item for which the path is requested. * * @return * The path to the requested item or an empty string if the item is not found. */ function drupal_get_path($type, $name) { return dirname(drupal_get_filename($type, $name)); } /** * Returns the base URL path (i.e., directory) of the Drupal installation. * * base_path() adds a "/" to the beginning and end of the returned path if the * path is not empty. At the very least, this will return "/". * * Examples: * - http://example.com returns "/" because the path is empty. * - http://example.com/drupal/folder returns "/drupal/folder/". */ function base_path() { return $GLOBALS['base_path']; } /** * Adds a LINK tag with a distinct 'rel' attribute to the page's HEAD. * * This function can be called as long the HTML header hasn't been sent, which * on normal pages is up through the preprocess step of theme('html'). Adding * a link will overwrite a prior link with the exact same 'rel' and 'href' * attributes. * * @param $attributes * Associative array of element attributes including 'href' and 'rel'. * @param $header * Optional flag to determine if a HTTP 'Link:' header should be sent. */ function drupal_add_html_head_link($attributes, $header = FALSE) { $element = array( '#tag' => 'link', '#attributes' => $attributes, ); $href = $attributes['href']; if ($header) { // Also add a HTTP header "Link:". $href = '<' . check_plain($attributes['href']) . '>;'; unset($attributes['href']); $element['#attached']['drupal_add_http_header'][] = array('Link', $href . drupal_http_header_attributes($attributes), TRUE); } drupal_add_html_head($element, 'drupal_add_html_head_link:' . $attributes['rel'] . ':' . $href); } /** * Adds a cascading stylesheet to the stylesheet queue. * * Calling drupal_static_reset('drupal_add_css') will clear all cascading * stylesheets added so far. * * If CSS aggregation/compression is enabled, all cascading style sheets added * with $options['preprocess'] set to TRUE will be merged into one aggregate * file and compressed by removing all extraneous white space. * Preprocessed inline stylesheets will not be aggregated into this single file; * instead, they are just compressed upon output on the page. Externally hosted * stylesheets are never aggregated or compressed. * * The reason for aggregating the files is outlined quite thoroughly here: * http://www.die.net/musings/page_load_time/ "Load fewer external objects. Due * to request overhead, one bigger file just loads faster than two smaller ones * half its size." * * $options['preprocess'] should be only set to TRUE when a file is required for * all typical visitors and most pages of a site. It is critical that all * preprocessed files are added unconditionally on every page, even if the * files do not happen to be needed on a page. This is normally done by calling * drupal_add_css() in a hook_init() implementation. * * Non-preprocessed files should only be added to the page when they are * actually needed. * * @param $data * (optional) The stylesheet data to be added, depending on what is passed * through to the $options['type'] parameter: * - 'file': The path to the CSS file relative to the base_path(), or a * stream wrapper URI. For example: "modules/devel/devel.css" or * "public://generated_css/stylesheet_1.css". Note that Modules should * always prefix the names of their CSS files with the module name; for * example, system-menus.css rather than simply menus.css. Themes can * override module-supplied CSS files based on their filenames, and this * prefixing helps prevent confusing name collisions for theme developers. * See drupal_get_css() where the overrides are performed. Also, if the * direction of the current language is right-to-left (Hebrew, Arabic, * etc.), the function will also look for an RTL CSS file and append it to * the list. The name of this file should have an '-rtl.css' suffix. For * example, a CSS file called 'mymodule-name.css' will have a * 'mymodule-name-rtl.css' file added to the list, if exists in the same * directory. This CSS file should contain overrides for properties which * should be reversed or otherwise different in a right-to-left display. * - 'inline': A string of CSS that should be placed in the given scope. Note * that it is better practice to use 'file' stylesheets, rather than * 'inline', as the CSS would then be aggregated and cached. * - 'external': The absolute path to an external CSS file that is not hosted * on the local server. These files will not be aggregated if CSS * aggregation is enabled. * @param $options * (optional) A string defining the 'type' of CSS that is being added in the * $data parameter ('file', 'inline', or 'external'), or an array which can * have any or all of the following keys: * - 'type': The type of stylesheet being added. Available options are 'file', * 'inline' or 'external'. Defaults to 'file'. * - 'basename': Force a basename for the file being added. Modules are * expected to use stylesheets with unique filenames, but integration of * external libraries may make this impossible. The basename of * 'modules/node/node.css' is 'node.css'. If the external library "node.js" * ships with a 'node.css', then a different, unique basename would be * 'node.js.css'. * - 'group': A number identifying the group in which to add the stylesheet. * Available constants are: * - CSS_SYSTEM: Any system-layer CSS. * - CSS_DEFAULT: (default) Any module-layer CSS. * - CSS_THEME: Any theme-layer CSS. * The group number serves as a weight: the markup for loading a stylesheet * within a lower weight group is output to the page before the markup for * loading a stylesheet within a higher weight group, so CSS within higher * weight groups take precendence over CSS within lower weight groups. * - 'every_page': For optimal front-end performance when aggregation is * enabled, this should be set to TRUE if the stylesheet is present on every * page of the website for users for whom it is present at all. This * defaults to FALSE. It is set to TRUE for stylesheets added via module and * theme .info files. Modules that add stylesheets within hook_init() * implementations, or from other code that ensures that the stylesheet is * added to all website pages, should also set this flag to TRUE. All * stylesheets within the same group that have the 'every_page' flag set to * TRUE and do not have 'preprocess' set to FALSE are aggregated together * into a single aggregate file, and that aggregate file can be reused * across a user's entire site visit, leading to faster navigation between * pages. However, stylesheets that are only needed on pages less frequently * visited, can be added by code that only runs for those particular pages, * and that code should not set the 'every_page' flag. This minimizes the * size of the aggregate file that the user needs to download when first * visiting the website. Stylesheets without the 'every_page' flag are * aggregated into a separate aggregate file. This other aggregate file is * likely to change from page to page, and each new aggregate file needs to * be downloaded when first encountered, so it should be kept relatively * small by ensuring that most commonly needed stylesheets are added to * every page. * - 'weight': The weight of the stylesheet specifies the order in which the * CSS will appear relative to other stylesheets with the same group and * 'every_page' flag. The exact ordering of stylesheets is as follows: * - First by group. * - Then by the 'every_page' flag, with TRUE coming before FALSE. * - Then by weight. * - Then by the order in which the CSS was added. For example, all else * being the same, a stylesheet added by a call to drupal_add_css() that * happened later in the page request gets added to the page after one for * which drupal_add_css() happened earlier in the page request. * - 'media': The media type for the stylesheet, e.g., all, print, screen. * Defaults to 'all'. * - 'preprocess': If TRUE and CSS aggregation/compression is enabled, the * styles will be aggregated and compressed. Defaults to TRUE. * - 'browsers': An array containing information specifying which browsers * should load the CSS item. See drupal_pre_render_conditional_comments() * for details. * * @return * An array of queued cascading stylesheets. * * @see drupal_get_css() */ function drupal_add_css($data = NULL, $options = NULL) { $css = &drupal_static(__FUNCTION__, array()); // Construct the options, taking the defaults into consideration. if (isset($options)) { if (!is_array($options)) { $options = array('type' => $options); } } else { $options = array(); } // Create an array of CSS files for each media type first, since each type needs to be served // to the browser differently. if (isset($data)) { $options += array( 'type' => 'file', 'group' => CSS_DEFAULT, 'weight' => 0, 'every_page' => FALSE, 'media' => 'all', 'preprocess' => TRUE, 'data' => $data, 'browsers' => array(), ); $options['browsers'] += array( 'IE' => TRUE, '!IE' => TRUE, ); // Files with a query string cannot be preprocessed. if ($options['type'] === 'file' && $options['preprocess'] && strpos($options['data'], '?') !== FALSE) { $options['preprocess'] = FALSE; } // Always add a tiny value to the weight, to conserve the insertion order. $options['weight'] += count($css) / 1000; // Add the data to the CSS array depending on the type. switch ($options['type']) { case 'inline': // For inline stylesheets, we don't want to use the $data as the array // key as $data could be a very long string of CSS. $css[] = $options; break; default: // Local and external files must keep their name as the associative key // so the same CSS file is not be added twice. $css[$data] = $options; } } return $css; } /** * Returns a themed representation of all stylesheets to attach to the page. * * It loads the CSS in order, with 'module' first, then 'theme' afterwards. * This ensures proper cascading of styles so themes can easily override * module styles through CSS selectors. * * Themes may replace module-defined CSS files by adding a stylesheet with the * same filename. For example, themes/bartik/system-menus.css would replace * modules/system/system-menus.css. This allows themes to override complete * CSS files, rather than specific selectors, when necessary. * * If the original CSS file is being overridden by a theme, the theme is * responsible for supplying an accompanying RTL CSS file to replace the * module's. * * @param $css * (optional) An array of CSS files. If no array is provided, the default * stylesheets array is used instead. * @param $skip_alter * (optional) If set to TRUE, this function skips calling drupal_alter() on * $css, useful when the calling function passes a $css array that has already * been altered. * * @return * A string of XHTML CSS tags. * * @see drupal_add_css() */ function drupal_get_css($css = NULL, $skip_alter = FALSE) { if (!isset($css)) { $css = drupal_add_css(); } // Allow modules and themes to alter the CSS items. if (!$skip_alter) { drupal_alter('css', $css); } // Sort CSS items, so that they appear in the correct order. uasort($css, 'drupal_sort_css_js'); // Provide the page with information about the individual CSS files used, // information not otherwise available when CSS aggregation is enabled. The // setting is attached later in this function, but is set here, so that CSS // files removed below are still considered "used" and prevented from being // added in a later AJAX request. // Skip if no files were added to the page or jQuery.extend() will overwrite // the Drupal.settings.ajaxPageState.css object with an empty array. if (!empty($css)) { // Cast the array to an object to be on the safe side even if not empty. $setting['ajaxPageState']['css'] = (object) array_fill_keys(array_keys($css), 1); } // Remove the overridden CSS files. Later CSS files override former ones. $previous_item = array(); foreach ($css as $key => $item) { if ($item['type'] == 'file') { // If defined, force a unique basename for this file. $basename = isset($item['basename']) ? $item['basename'] : drupal_basename($item['data']); if (isset($previous_item[$basename])) { // Remove the previous item that shared the same base name. unset($css[$previous_item[$basename]]); } $previous_item[$basename] = $key; } } // Render the HTML needed to load the CSS. $styles = array( '#type' => 'styles', '#items' => $css, ); if (!empty($setting)) { $styles['#attached']['js'][] = array('type' => 'setting', 'data' => $setting); } return drupal_render($styles); } /** * Sorts CSS and JavaScript resources. * * Callback for uasort() within: * - drupal_get_css() * - drupal_get_js() * * This sort order helps optimize front-end performance while providing modules * and themes with the necessary control for ordering the CSS and JavaScript * appearing on a page. * * @param $a * First item for comparison. The compared items should be associative arrays * of member items from drupal_add_css() or drupal_add_js(). * @param $b * Second item for comparison. * * @see drupal_add_css() * @see drupal_add_js() */ function drupal_sort_css_js($a, $b) { // First order by group, so that, for example, all items in the CSS_SYSTEM // group appear before items in the CSS_DEFAULT group, which appear before // all items in the CSS_THEME group. Modules may create additional groups by // defining their own constants. if ($a['group'] < $b['group']) { return -1; } elseif ($a['group'] > $b['group']) { return 1; } // Within a group, order all infrequently needed, page-specific files after // common files needed throughout the website. Separating this way allows for // the aggregate file generated for all of the common files to be reused // across a site visit without being cut by a page using a less common file. elseif ($a['every_page'] && !$b['every_page']) { return -1; } elseif (!$a['every_page'] && $b['every_page']) { return 1; } // Finally, order by weight. elseif ($a['weight'] < $b['weight']) { return -1; } elseif ($a['weight'] > $b['weight']) { return 1; } else { return 0; } } /** * Default callback to group CSS items. * * This function arranges the CSS items that are in the #items property of the * styles element into groups. Arranging the CSS items into groups serves two * purposes. When aggregation is enabled, files within a group are aggregated * into a single file, significantly improving page loading performance by * minimizing network traffic overhead. When aggregation is disabled, grouping * allows multiple files to be loaded from a single STYLE tag, enabling sites * with many modules enabled or a complex theme being used to stay within IE's * 31 CSS inclusion tag limit: http://drupal.org/node/228818. * * This function puts multiple items into the same group if they are groupable * and if they are for the same 'media' and 'browsers'. Items of the 'file' type * are groupable if their 'preprocess' flag is TRUE, items of the 'inline' type * are always groupable, and items of the 'external' type are never groupable. * This function also ensures that the process of grouping items does not change * their relative order. This requirement may result in multiple groups for the * same type, media, and browsers, if needed to accommodate other items in * between. * * @param $css * An array of CSS items, as returned by drupal_add_css(), but after * alteration performed by drupal_get_css(). * * @return * An array of CSS groups. Each group contains the same keys (e.g., 'media', * 'data', etc.) as a CSS item from the $css parameter, with the value of * each key applying to the group as a whole. Each group also contains an * 'items' key, which is the subset of items from $css that are in the group. * * @see drupal_pre_render_styles() * @see system_element_info() */ function drupal_group_css($css) { $groups = array(); // If a group can contain multiple items, we track the information that must // be the same for each item in the group, so that when we iterate the next // item, we can determine if it can be put into the current group, or if a // new group needs to be made for it. $current_group_keys = NULL; // When creating a new group, we pre-increment $i, so by initializing it to // -1, the first group will have index 0. $i = -1; foreach ($css as $item) { // The browsers for which the CSS item needs to be loaded is part of the // information that determines when a new group is needed, but the order of // keys in the array doesn't matter, and we don't want a new group if all // that's different is that order. ksort($item['browsers']); // If the item can be grouped with other items, set $group_keys to an array // of information that must be the same for all items in its group. If the // item can't be grouped with other items, set $group_keys to FALSE. We // put items into a group that can be aggregated together: whether they will // be aggregated is up to the _drupal_css_aggregate() function or an // override of that function specified in hook_css_alter(), but regardless // of the details of that function, a group represents items that can be // aggregated. Since a group may be rendered with a single HTML tag, all // items in the group must share the same information that would need to be // part of that HTML tag. switch ($item['type']) { case 'file': // Group file items if their 'preprocess' flag is TRUE. // Help ensure maximum reuse of aggregate files by only grouping // together items that share the same 'group' value and 'every_page' // flag. See drupal_add_css() for details about that. $group_keys = $item['preprocess'] ? array($item['type'], $item['group'], $item['every_page'], $item['media'], $item['browsers']) : FALSE; break; case 'inline': // Always group inline items. $group_keys = array($item['type'], $item['media'], $item['browsers']); break; case 'external': // Do not group external items. $group_keys = FALSE; break; } // If the group keys don't match the most recent group we're working with, // then a new group must be made. if ($group_keys !== $current_group_keys) { $i++; // Initialize the new group with the same properties as the first item // being placed into it. The item's 'data' and 'weight' properties are // unique to the item and should not be carried over to the group. $groups[$i] = $item; unset($groups[$i]['data'], $groups[$i]['weight']); $groups[$i]['items'] = array(); $current_group_keys = $group_keys ? $group_keys : NULL; } // Add the item to the current group. $groups[$i]['items'][] = $item; } return $groups; } /** * Default callback to aggregate CSS files and inline content. * * Having the browser load fewer CSS files results in much faster page loads * than when it loads many small files. This function aggregates files within * the same group into a single file unless the site-wide setting to do so is * disabled (commonly the case during site development). To optimize download, * it also compresses the aggregate files by removing comments, whitespace, and * other unnecessary content. Additionally, this functions aggregates inline * content together, regardless of the site-wide aggregation setting. * * @param $css_groups * An array of CSS groups as returned by drupal_group_css(). This function * modifies the group's 'data' property for each group that is aggregated. * * @see drupal_group_css() * @see drupal_pre_render_styles() * @see system_element_info() */ function drupal_aggregate_css(&$css_groups) { $preprocess_css = (variable_get('preprocess_css', FALSE) && (!defined('MAINTENANCE_MODE') || MAINTENANCE_MODE != 'update')); // For each group that needs aggregation, aggregate its items. foreach ($css_groups as $key => $group) { switch ($group['type']) { // If a file group can be aggregated into a single file, do so, and set // the group's data property to the file path of the aggregate file. case 'file': if ($group['preprocess'] && $preprocess_css) { $css_groups[$key]['data'] = drupal_build_css_cache($group['items']); } break; // Aggregate all inline CSS content into the group's data property. case 'inline': $css_groups[$key]['data'] = ''; foreach ($group['items'] as $item) { $css_groups[$key]['data'] .= drupal_load_stylesheet_content($item['data'], $item['preprocess']); } break; } } } /** * #pre_render callback to add the elements needed for CSS tags to be rendered. * * For production websites, LINK tags are preferable to STYLE tags with @import * statements, because: * - They are the standard tag intended for linking to a resource. * - On Firefox 2 and perhaps other browsers, CSS files included with @import * statements don't get saved when saving the complete web page for offline * use: http://drupal.org/node/145218. * - On IE, if only LINK tags and no @import statements are used, all the CSS * files are downloaded in parallel, resulting in faster page load, but if * @import statements are used and span across multiple STYLE tags, all the * ones from one STYLE tag must be downloaded before downloading begins for * the next STYLE tag. Furthermore, IE7 does not support media declaration on * the @import statement, so multiple STYLE tags must be used when different * files are for different media types. Non-IE browsers always download in * parallel, so this is an IE-specific performance quirk: * http://www.stevesouders.com/blog/2009/04/09/dont-use-import/. * * However, IE has an annoying limit of 31 total CSS inclusion tags * (http://drupal.org/node/228818) and LINK tags are limited to one file per * tag, whereas STYLE tags can contain multiple @import statements allowing * multiple files to be loaded per tag. When CSS aggregation is disabled, a * Drupal site can easily have more than 31 CSS files that need to be loaded, so * using LINK tags exclusively would result in a site that would display * incorrectly in IE. Depending on different needs, different strategies can be * employed to decide when to use LINK tags and when to use STYLE tags. * * The strategy employed by this function is to use LINK tags for all aggregate * files and for all files that cannot be aggregated (e.g., if 'preprocess' is * set to FALSE or the type is 'external'), and to use STYLE tags for groups * of files that could be aggregated together but aren't (e.g., if the site-wide * aggregation setting is disabled). This results in all LINK tags when * aggregation is enabled, a guarantee that as many or only slightly more tags * are used with aggregation disabled than enabled (so that if the limit were to * be crossed with aggregation enabled, the site developer would also notice the * problem while aggregation is disabled), and an easy way for a developer to * view HTML source while aggregation is disabled and know what files will be * aggregated together when aggregation becomes enabled. * * This function evaluates the aggregation enabled/disabled condition on a group * by group basis by testing whether an aggregate file has been made for the * group rather than by testing the site-wide aggregation setting. This allows * this function to work correctly even if modules have implemented custom * logic for grouping and aggregating files. * * @param $element * A render array containing: * - '#items': The CSS items as returned by drupal_add_css() and altered by * drupal_get_css(). * - '#group_callback': A function to call to group #items to enable the use * of fewer tags by aggregating files and/or using multiple @import * statements within a single tag. * - '#aggregate_callback': A function to call to aggregate the items within * the groups arranged by the #group_callback function. * * @return * A render array that will render to a string of XHTML CSS tags. * * @see drupal_get_css() */ function drupal_pre_render_styles($elements) { // Group and aggregate the items. if (isset($elements['#group_callback'])) { $elements['#groups'] = $elements['#group_callback']($elements['#items']); } if (isset($elements['#aggregate_callback'])) { $elements['#aggregate_callback']($elements['#groups']); } // A dummy query-string is added to filenames, to gain control over // browser-caching. The string changes on every update or full cache // flush, forcing browsers to load a new copy of the files, as the // URL changed. $query_string = variable_get('css_js_query_string', '0'); // For inline CSS to validate as XHTML, all CSS containing XHTML needs to be // wrapped in CDATA. To make that backwards compatible with HTML 4, we need to // comment out the CDATA-tag. $embed_prefix = "\n\n"; // Defaults for LINK and STYLE elements. $link_element_defaults = array( '#type' => 'html_tag', '#tag' => 'link', '#attributes' => array( 'type' => 'text/css', 'rel' => 'stylesheet', ), ); $style_element_defaults = array( '#type' => 'html_tag', '#tag' => 'style', '#attributes' => array( 'type' => 'text/css', ), ); // Loop through each group. foreach ($elements['#groups'] as $group) { switch ($group['type']) { // For file items, there are three possibilites. // - The group has been aggregated: in this case, output a LINK tag for // the aggregate file. // - The group can be aggregated but has not been (most likely because // the site administrator disabled the site-wide setting): in this case, // output as few STYLE tags for the group as possible, using @import // statement for each file in the group. This enables us to stay within // IE's limit of 31 total CSS inclusion tags. // - The group contains items not eligible for aggregation (their // 'preprocess' flag has been set to FALSE): in this case, output a LINK // tag for each file. case 'file': // The group has been aggregated into a single file: output a LINK tag // for the aggregate file. if (isset($group['data'])) { $element = $link_element_defaults; $element['#attributes']['href'] = file_create_url($group['data']); $element['#attributes']['media'] = $group['media']; $element['#browsers'] = $group['browsers']; $elements[] = $element; } // The group can be aggregated, but hasn't been: combine multiple items // into as few STYLE tags as possible. elseif ($group['preprocess']) { $import = array(); foreach ($group['items'] as $item) { // A theme's .info file may have an entry for a file that doesn't // exist as a way of overriding a module or base theme CSS file from // being added to the page. Normally, file_exists() calls that need // to run for every page request should be minimized, but this one // is okay, because it only runs when CSS aggregation is disabled. // On a server under heavy enough load that file_exists() calls need // to be minimized, CSS aggregation should be enabled, in which case // this code is not run. When aggregation is enabled, // drupal_load_stylesheet() checks file_exists(), but only when // building the aggregate file, which is then reused for many page // requests. if (file_exists($item['data'])) { // The dummy query string needs to be added to the URL to control // browser-caching. IE7 does not support a media type on the // @import statement, so we instead specify the media for the // group on the STYLE tag. $import[] = '@import url("' . check_plain(file_create_url($item['data']) . '?' . $query_string) . '");'; } } // In addition to IE's limit of 31 total CSS inclusion tags, it also // has a limit of 31 @import statements per STYLE tag. while (!empty($import)) { $import_batch = array_slice($import, 0, 31); $import = array_slice($import, 31); $element = $style_element_defaults; // This simplifies the JavaScript regex, allowing each line // (separated by \n) to be treated as a completely different string. // This means that we can use ^ and $ on one line at a time, and not // worry about style tags since they'll never match the regex. $element['#value'] = "\n" . implode("\n", $import_batch) . "\n"; $element['#attributes']['media'] = $group['media']; $element['#browsers'] = $group['browsers']; $elements[] = $element; } } // The group contains items ineligible for aggregation: output a LINK // tag for each file. else { foreach ($group['items'] as $item) { $element = $link_element_defaults; // We do not check file_exists() here, because this code runs for // files whose 'preprocess' is set to FALSE, and therefore, even // when aggregation is enabled, and we want to avoid needlessly // taxing a server that may be under heavy load. The file_exists() // performed above for files whose 'preprocess' is TRUE is done for // the benefit of theme .info files, but code that deals with files // whose 'preprocess' is FALSE is responsible for ensuring the file // exists. // The dummy query string needs to be added to the URL to control // browser-caching. $query_string_separator = (strpos($item['data'], '?') !== FALSE) ? '&' : '?'; $element['#attributes']['href'] = file_create_url($item['data']) . $query_string_separator . $query_string; $element['#attributes']['media'] = $item['media']; $element['#browsers'] = $group['browsers']; $elements[] = $element; } } break; // For inline content, the 'data' property contains the CSS content. If // the group's 'data' property is set, then output it in a single STYLE // tag. Otherwise, output a separate STYLE tag for each item. case 'inline': if (isset($group['data'])) { $element = $style_element_defaults; $element['#value'] = $group['data']; $element['#value_prefix'] = $embed_prefix; $element['#value_suffix'] = $embed_suffix; $element['#attributes']['media'] = $group['media']; $element['#browsers'] = $group['browsers']; $elements[] = $element; } else { foreach ($group['items'] as $item) { $element = $style_element_defaults; $element['#value'] = $item['data']; $element['#value_prefix'] = $embed_prefix; $element['#value_suffix'] = $embed_suffix; $element['#attributes']['media'] = $item['media']; $element['#browsers'] = $group['browsers']; $elements[] = $element; } } break; // Output a LINK tag for each external item. The item's 'data' property // contains the full URL. case 'external': foreach ($group['items'] as $item) { $element = $link_element_defaults; $element['#attributes']['href'] = $item['data']; $element['#attributes']['media'] = $item['media']; $element['#browsers'] = $group['browsers']; $elements[] = $element; } break; } } return $elements; } /** * Aggregates and optimizes CSS files into a cache file in the files directory. * * The file name for the CSS cache file is generated from the hash of the * aggregated contents of the files in $css. This forces proxies and browsers * to download new CSS when the CSS changes. * * The cache file name is retrieved on a page load via a lookup variable that * contains an associative array. The array key is the hash of the file names * in $css while the value is the cache file name. The cache file is generated * in two cases. First, if there is no file name value for the key, which will * happen if a new file name has been added to $css or after the lookup * variable is emptied to force a rebuild of the cache. Second, the cache file * is generated if it is missing on disk. Old cache files are not deleted * immediately when the lookup variable is emptied, but are deleted after a set * period by drupal_delete_file_if_stale(). This ensures that files referenced * by a cached page will still be available. * * @param $css * An array of CSS files to aggregate and compress into one file. * * @return * The URI of the CSS cache file, or FALSE if the file could not be saved. */ function drupal_build_css_cache($css) { $data = ''; $uri = ''; $map = variable_get('drupal_css_cache_files', array()); // Create a new array so that only the file names are used to create the hash. // This prevents new aggregates from being created unnecessarily. $css_data = array(); foreach ($css as $css_file) { $css_data[] = $css_file['data']; } $key = hash('sha256', serialize($css_data)); if (isset($map[$key])) { $uri = $map[$key]; } if (empty($uri) || !file_exists($uri)) { // Build aggregate CSS file. foreach ($css as $stylesheet) { // Only 'file' stylesheets can be aggregated. if ($stylesheet['type'] == 'file') { $contents = drupal_load_stylesheet($stylesheet['data'], TRUE); // Build the base URL of this CSS file: start with the full URL. $css_base_url = file_create_url($stylesheet['data']); // Move to the parent. $css_base_url = substr($css_base_url, 0, strrpos($css_base_url, '/')); // Simplify to a relative URL if the stylesheet URL starts with the // base URL of the website. if (substr($css_base_url, 0, strlen($GLOBALS['base_root'])) == $GLOBALS['base_root']) { $css_base_url = substr($css_base_url, strlen($GLOBALS['base_root'])); } _drupal_build_css_path(NULL, $css_base_url . '/'); // Anchor all paths in the CSS with its base URL, ignoring external and absolute paths. $data .= preg_replace_callback('/url\(\s*[\'"]?(?![a-z]+:|\/+)([^\'")]+)[\'"]?\s*\)/i', '_drupal_build_css_path', $contents); } } // Per the W3C specification at http://www.w3.org/TR/REC-CSS2/cascade.html#at-import, // @import rules must proceed any other style, so we move those to the top. $regexp = '/@import[^;]+;/i'; preg_match_all($regexp, $data, $matches); $data = preg_replace($regexp, '', $data); $data = implode('', $matches[0]) . $data; // Prefix filename to prevent blocking by firewalls which reject files // starting with "ad*". $filename = 'css_' . drupal_hash_base64($data) . '.css'; // Create the css/ within the files folder. $csspath = 'public://css'; $uri = $csspath . '/' . $filename; // Create the CSS file. file_prepare_directory($csspath, FILE_CREATE_DIRECTORY); if (!file_exists($uri) && !file_unmanaged_save_data($data, $uri, FILE_EXISTS_REPLACE)) { return FALSE; } // If CSS gzip compression is enabled, clean URLs are enabled (which means // that rewrite rules are working) and the zlib extension is available then // create a gzipped version of this file. This file is served conditionally // to browsers that accept gzip using .htaccess rules. if (variable_get('css_gzip_compression', TRUE) && variable_get('clean_url', 0) && extension_loaded('zlib')) { if (!file_exists($uri . '.gz') && !file_unmanaged_save_data(gzencode($data, 9, FORCE_GZIP), $uri . '.gz', FILE_EXISTS_REPLACE)) { return FALSE; } } // Save the updated map. $map[$key] = $uri; variable_set('drupal_css_cache_files', $map); } return $uri; } /** * Prefixes all paths within a CSS file for drupal_build_css_cache(). */ function _drupal_build_css_path($matches, $base = NULL) { $_base = &drupal_static(__FUNCTION__); // Store base path for preg_replace_callback. if (isset($base)) { $_base = $base; } // Prefix with base and remove '../' segments where possible. $path = $_base . $matches[1]; $last = ''; while ($path != $last) { $last = $path; $path = preg_replace('`(^|/)(?!\.\./)([^/]+)/\.\./`', '$1', $path); } return 'url(' . $path . ')'; } /** * Loads the stylesheet and resolves all @import commands. * * Loads a stylesheet and replaces @import commands with the contents of the * imported file. Use this instead of file_get_contents when processing * stylesheets. * * The returned contents are compressed removing white space and comments only * when CSS aggregation is enabled. This optimization will not apply for * color.module enabled themes with CSS aggregation turned off. * * @param $file * Name of the stylesheet to be processed. * @param $optimize * Defines if CSS contents should be compressed or not. * @param $reset_basepath * Used internally to facilitate recursive resolution of @import commands. * * @return * Contents of the stylesheet, including any resolved @import commands. */ function drupal_load_stylesheet($file, $optimize = NULL, $reset_basepath = TRUE) { // These statics are not cache variables, so we don't use drupal_static(). static $_optimize, $basepath; if ($reset_basepath) { $basepath = ''; } // Store the value of $optimize for preg_replace_callback with nested // @import loops. if (isset($optimize)) { $_optimize = $optimize; } // Stylesheets are relative one to each other. Start by adding a base path // prefix provided by the parent stylesheet (if necessary). if ($basepath && !file_uri_scheme($file)) { $file = $basepath . '/' . $file; } // Store the parent base path to restore it later. $parent_base_path = $basepath; // Set the current base path to process possible child imports. $basepath = dirname($file); // Load the CSS stylesheet. We suppress errors because themes may specify // stylesheets in their .info file that don't exist in the theme's path, // but are merely there to disable certain module CSS files. $content = ''; if ($contents = @file_get_contents($file)) { // Return the processed stylesheet. $content = drupal_load_stylesheet_content($contents, $_optimize); } // Restore the parent base path as the file and its childen are processed. $basepath = $parent_base_path; return $content; } /** * Processes the contents of a stylesheet for aggregation. * * @param $contents * The contents of the stylesheet. * @param $optimize * (optional) Boolean whether CSS contents should be minified. Defaults to * FALSE. * * @return * Contents of the stylesheet including the imported stylesheets. */ function drupal_load_stylesheet_content($contents, $optimize = FALSE) { // Remove multiple charset declarations for standards compliance (and fixing Safari problems). $contents = preg_replace('/^@charset\s+[\'"](\S*?)\b[\'"];/i', '', $contents); if ($optimize) { // Perform some safe CSS optimizations. // Regexp to match comment blocks. $comment = '/\*[^*]*\*+(?:[^/*][^*]*\*+)*/'; // Regexp to match double quoted strings. $double_quot = '"[^"\\\\]*(?:\\\\.[^"\\\\]*)*"'; // Regexp to match single quoted strings. $single_quot = "'[^'\\\\]*(?:\\\\.[^'\\\\]*)*'"; // Strip all comment blocks, but keep double/single quoted strings. $contents = preg_replace( "<($double_quot|$single_quot)|$comment>Ss", "$1", $contents ); // Remove certain whitespace. // There are different conditions for removing leading and trailing // whitespace. // @see http://php.net/manual/regexp.reference.subpatterns.php $contents = preg_replace('< # Strip leading and trailing whitespace. \s*([@{};,])\s* # Strip only leading whitespace from: # - Closing parenthesis: Retain "@media (bar) and foo". | \s+([\)]) # Strip only trailing whitespace from: # - Opening parenthesis: Retain "@media (bar) and foo". # - Colon: Retain :pseudo-selectors. | ([\(:])\s+ >xS', // Only one of the three capturing groups will match, so its reference // will contain the wanted value and the references for the // two non-matching groups will be replaced with empty strings. '$1$2$3', $contents ); // End the file with a new line. $contents = trim($contents); $contents .= "\n"; } // Replaces @import commands with the actual stylesheet content. // This happens recursively but omits external files. $contents = preg_replace_callback('/@import\s*(?:url\(\s*)?[\'"]?(?![a-z]+:)(?!\/\/)([^\'"\()]+)[\'"]?\s*\)?\s*;/', '_drupal_load_stylesheet', $contents); return $contents; } /** * Loads stylesheets recursively and returns contents with corrected paths. * * This function is used for recursive loading of stylesheets and * returns the stylesheet content with all url() paths corrected. */ function _drupal_load_stylesheet($matches) { $filename = $matches[1]; // Load the imported stylesheet and replace @import commands in there as well. $file = drupal_load_stylesheet($filename, NULL, FALSE); // Determine the file's directory. $directory = dirname($filename); // If the file is in the current directory, make sure '.' doesn't appear in // the url() path. $directory = $directory == '.' ? '' : $directory .'/'; // Alter all internal url() paths. Leave external paths alone. We don't need // to normalize absolute paths here (i.e. remove folder/... segments) because // that will be done later. return preg_replace('/url\(\s*([\'"]?)(?![a-z]+:|\/+)([^\'")]+)([\'"]?)\s*\)/i', 'url(\1' . $directory . '\2\3)', $file); } /** * Deletes old cached CSS files. */ function drupal_clear_css_cache() { variable_del('drupal_css_cache_files'); file_scan_directory('public://css', '/.*/', array('callback' => 'drupal_delete_file_if_stale')); } /** * Callback to delete files modified more than a set time ago. */ function drupal_delete_file_if_stale($uri) { // Default stale file threshold is 30 days. if (REQUEST_TIME - filemtime($uri) > variable_get('drupal_stale_file_threshold', 2592000)) { file_unmanaged_delete($uri); } } /** * Prepares a string for use as a CSS identifier (element, class, or ID name). * * http://www.w3.org/TR/CSS21/syndata.html#characters shows the syntax for valid * CSS identifiers (including element names, classes, and IDs in selectors.) * * @param $identifier * The identifier to clean. * @param $filter * An array of string replacements to use on the identifier. * * @return * The cleaned identifier. */ function drupal_clean_css_identifier($identifier, $filter = array(' ' => '-', '_' => '-', '/' => '-', '[' => '-', ']' => '')) { // By default, we filter using Drupal's coding standards. $identifier = strtr($identifier, $filter); // Valid characters in a CSS identifier are: // - the hyphen (U+002D) // - a-z (U+0030 - U+0039) // - A-Z (U+0041 - U+005A) // - the underscore (U+005F) // - 0-9 (U+0061 - U+007A) // - ISO 10646 characters U+00A1 and higher // We strip out any character not in the above list. $identifier = preg_replace('/[^\x{002D}\x{0030}-\x{0039}\x{0041}-\x{005A}\x{005F}\x{0061}-\x{007A}\x{00A1}-\x{FFFF}]/u', '', $identifier); return $identifier; } /** * Prepares a string for use as a valid class name. * * Do not pass one string containing multiple classes as they will be * incorrectly concatenated with dashes, i.e. "one two" will become "one-two". * * @param $class * The class name to clean. * * @return * The cleaned class name. */ function drupal_html_class($class) { // The output of this function will never change, so this uses a normal // static instead of drupal_static(). static $classes = array(); if (!isset($classes[$class])) { $classes[$class] = drupal_clean_css_identifier(drupal_strtolower($class)); } return $classes[$class]; } /** * Prepares a string for use as a valid HTML ID and guarantees uniqueness. * * This function ensures that each passed HTML ID value only exists once on the * page. By tracking the already returned ids, this function enables forms, * blocks, and other content to be output multiple times on the same page, * without breaking (X)HTML validation. * * For already existing IDs, a counter is appended to the ID string. Therefore, * JavaScript and CSS code should not rely on any value that was generated by * this function and instead should rely on manually added CSS classes or * similarly reliable constructs. * * Two consecutive hyphens separate the counter from the original ID. To manage * uniqueness across multiple Ajax requests on the same page, Ajax requests * POST an array of all IDs currently present on the page, which are used to * prime this function's cache upon first invocation. * * To allow reverse-parsing of IDs submitted via Ajax, any multiple consecutive * hyphens in the originally passed $id are replaced with a single hyphen. * * @param $id * The ID to clean. * * @return * The cleaned ID. */ function drupal_html_id($id) { // If this is an Ajax request, then content returned by this page request will // be merged with content already on the base page. The HTML IDs must be // unique for the fully merged content. Therefore, initialize $seen_ids to // take into account IDs that are already in use on the base page. $seen_ids_init = &drupal_static(__FUNCTION__ . ':init'); if (!isset($seen_ids_init)) { // Ideally, Drupal would provide an API to persist state information about // prior page requests in the database, and we'd be able to add this // function's $seen_ids static variable to that state information in order // to have it properly initialized for this page request. However, no such // page state API exists, so instead, ajax.js adds all of the in-use HTML // IDs to the POST data of Ajax submissions. Direct use of $_POST is // normally not recommended as it could open up security risks, but because // the raw POST data is cast to a number before being returned by this // function, this usage is safe. if (empty($_POST['ajax_html_ids'])) { $seen_ids_init = array(); } else { // This function ensures uniqueness by appending a counter to the base id // requested by the calling function after the first occurrence of that // requested id. $_POST['ajax_html_ids'] contains the ids as they were // returned by this function, potentially with the appended counter, so // we parse that to reconstruct the $seen_ids array. if (isset($_POST['ajax_html_ids'][0]) && strpos($_POST['ajax_html_ids'][0], ',') === FALSE) { $ajax_html_ids = $_POST['ajax_html_ids']; } else { // jquery.form.js may send the server a comma-separated string as the // first element of an array (see http://drupal.org/node/1575060), so // we need to convert it to an array in that case. $ajax_html_ids = explode(',', $_POST['ajax_html_ids'][0]); } foreach ($ajax_html_ids as $seen_id) { // We rely on '--' being used solely for separating a base id from the // counter, which this function ensures when returning an id. $parts = explode('--', $seen_id, 2); if (!empty($parts[1]) && is_numeric($parts[1])) { list($seen_id, $i) = $parts; } else { $i = 1; } if (!isset($seen_ids_init[$seen_id]) || ($i > $seen_ids_init[$seen_id])) { $seen_ids_init[$seen_id] = $i; } } } } $seen_ids = &drupal_static(__FUNCTION__, $seen_ids_init); $id = strtr(drupal_strtolower($id), array(' ' => '-', '_' => '-', '[' => '-', ']' => '')); // As defined in http://www.w3.org/TR/html4/types.html#type-name, HTML IDs can // only contain letters, digits ([0-9]), hyphens ("-"), underscores ("_"), // colons (":"), and periods ("."). We strip out any character not in that // list. Note that the CSS spec doesn't allow colons or periods in identifiers // (http://www.w3.org/TR/CSS21/syndata.html#characters), so we strip those two // characters as well. $id = preg_replace('/[^A-Za-z0-9\-_]/', '', $id); // Removing multiple consecutive hyphens. $id = preg_replace('/\-+/', '-', $id); // Ensure IDs are unique by appending a counter after the first occurrence. // The counter needs to be appended with a delimiter that does not exist in // the base ID. Requiring a unique delimiter helps ensure that we really do // return unique IDs and also helps us re-create the $seen_ids array during // Ajax requests. if (isset($seen_ids[$id])) { $id = $id . '--' . ++$seen_ids[$id]; } else { $seen_ids[$id] = 1; } return $id; } /** * Provides a standard HTML class name that identifies a page region. * * It is recommended that template preprocess functions apply this class to any * page region that is output by the theme (Drupal core already handles this in * the standard template preprocess implementation). Standardizing the class * names in this way allows modules to implement certain features, such as * drag-and-drop or dynamic Ajax loading, in a theme-independent way. * * @param $region * The name of the page region (for example, 'page_top' or 'content'). * * @return * An HTML class that identifies the region (for example, 'region-page-top' * or 'region-content'). * * @see template_preprocess_region() */ function drupal_region_class($region) { return drupal_html_class("region-$region"); } /** * Adds a JavaScript file, setting, or inline code to the page. * * The behavior of this function depends on the parameters it is called with. * Generally, it handles the addition of JavaScript to the page, either as * reference to an existing file or as inline code. The following actions can be * performed using this function: * - Add a file ('file'): Adds a reference to a JavaScript file to the page. * - Add inline JavaScript code ('inline'): Executes a piece of JavaScript code * on the current page by placing the code directly in the page (for example, * to tell the user that a new message arrived, by opening a pop up, alert * box, etc.). This should only be used for JavaScript that cannot be executed * from a file. When adding inline code, make sure that you are not relying on * $() being the jQuery function. Wrap your code in * @code (function ($) {... })(jQuery); @endcode * or use jQuery() instead of $(). * - Add external JavaScript ('external'): Allows the inclusion of external * JavaScript files that are not hosted on the local server. Note that these * external JavaScript references do not get aggregated when preprocessing is * on. * - Add settings ('setting'): Adds settings to Drupal's global storage of * JavaScript settings. Per-page settings are required by some modules to * function properly. All settings will be accessible at Drupal.settings. * * Examples: * @code * drupal_add_js('misc/collapse.js'); * drupal_add_js('misc/collapse.js', 'file'); * drupal_add_js('jQuery(document).ready(function () { alert("Hello!"); });', 'inline'); * drupal_add_js('jQuery(document).ready(function () { alert("Hello!"); });', * array('type' => 'inline', 'scope' => 'footer', 'weight' => 5) * ); * drupal_add_js('http://example.com/example.js', 'external'); * drupal_add_js(array('myModule' => array('key' => 'value')), 'setting'); * @endcode * * Calling drupal_static_reset('drupal_add_js') will clear all JavaScript added * so far. * * If JavaScript aggregation is enabled, all JavaScript files added with * $options['preprocess'] set to TRUE will be merged into one aggregate file. * Preprocessed inline JavaScript will not be aggregated into this single file. * Externally hosted JavaScripts are never aggregated. * * The reason for aggregating the files is outlined quite thoroughly here: * http://www.die.net/musings/page_load_time/ "Load fewer external objects. Due * to request overhead, one bigger file just loads faster than two smaller ones * half its size." * * $options['preprocess'] should be only set to TRUE when a file is required for * all typical visitors and most pages of a site. It is critical that all * preprocessed files are added unconditionally on every page, even if the * files are not needed on a page. This is normally done by calling * drupal_add_js() in a hook_init() implementation. * * Non-preprocessed files should only be added to the page when they are * actually needed. * * @param $data * (optional) If given, the value depends on the $options parameter, or * $options['type'] if $options is passed as an associative array: * - 'file': Path to the file relative to base_path(). * - 'inline': The JavaScript code that should be placed in the given scope. * - 'external': The absolute path to an external JavaScript file that is not * hosted on the local server. These files will not be aggregated if * JavaScript aggregation is enabled. * - 'setting': An associative array with configuration options. The array is * merged directly into Drupal.settings. All modules should wrap their * actual configuration settings in another variable to prevent conflicts in * the Drupal.settings namespace. Items added with a string key will replace * existing settings with that key; items with numeric array keys will be * added to the existing settings array. * @param $options * (optional) A string defining the type of JavaScript that is being added in * the $data parameter ('file'/'setting'/'inline'/'external'), or an * associative array. JavaScript settings should always pass the string * 'setting' only. Other types can have the following elements in the array: * - type: The type of JavaScript that is to be added to the page. Allowed * values are 'file', 'inline', 'external' or 'setting'. Defaults * to 'file'. * - scope: The location in which you want to place the script. Possible * values are 'header' or 'footer'. If your theme implements different * regions, you can also use these. Defaults to 'header'. * - group: A number identifying the group in which to add the JavaScript. * Available constants are: * - JS_LIBRARY: Any libraries, settings, or jQuery plugins. * - JS_DEFAULT: Any module-layer JavaScript. * - JS_THEME: Any theme-layer JavaScript. * The group number serves as a weight: JavaScript within a lower weight * group is presented on the page before JavaScript within a higher weight * group. * - every_page: For optimal front-end performance when aggregation is * enabled, this should be set to TRUE if the JavaScript is present on every * page of the website for users for whom it is present at all. This * defaults to FALSE. It is set to TRUE for JavaScript files that are added * via module and theme .info files. Modules that add JavaScript within * hook_init() implementations, or from other code that ensures that the * JavaScript is added to all website pages, should also set this flag to * TRUE. All JavaScript files within the same group and that have the * 'every_page' flag set to TRUE and do not have 'preprocess' set to FALSE * are aggregated together into a single aggregate file, and that aggregate * file can be reused across a user's entire site visit, leading to faster * navigation between pages. However, JavaScript that is only needed on * pages less frequently visited, can be added by code that only runs for * those particular pages, and that code should not set the 'every_page' * flag. This minimizes the size of the aggregate file that the user needs * to download when first visiting the website. JavaScript without the * 'every_page' flag is aggregated into a separate aggregate file. This * other aggregate file is likely to change from page to page, and each new * aggregate file needs to be downloaded when first encountered, so it * should be kept relatively small by ensuring that most commonly needed * JavaScript is added to every page. * - weight: A number defining the order in which the JavaScript is added to * the page relative to other JavaScript with the same 'scope', 'group', * and 'every_page' value. In some cases, the order in which the JavaScript * is presented on the page is very important. jQuery, for example, must be * added to the page before any jQuery code is run, so jquery.js uses the * JS_LIBRARY group and a weight of -20, jquery.once.js (a library drupal.js * depends on) uses the JS_LIBRARY group and a weight of -19, drupal.js uses * the JS_LIBRARY group and a weight of -1, other libraries use the * JS_LIBRARY group and a weight of 0 or higher, and all other scripts use * one of the other group constants. The exact ordering of JavaScript is as * follows: * - First by scope, with 'header' first, 'footer' last, and any other * scopes provided by a custom theme coming in between, as determined by * the theme. * - Then by group. * - Then by the 'every_page' flag, with TRUE coming before FALSE. * - Then by weight. * - Then by the order in which the JavaScript was added. For example, all * else being the same, JavaScript added by a call to drupal_add_js() that * happened later in the page request gets added to the page after one for * which drupal_add_js() happened earlier in the page request. * - requires_jquery: Set this to FALSE if the JavaScript you are adding does * not have a dependency on jQuery. Defaults to TRUE, except for JavaScript * settings where it defaults to FALSE. This is used on sites that have the * 'javascript_always_use_jquery' variable set to FALSE; on those sites, if * all the JavaScript added to the page by drupal_add_js() does not have a * dependency on jQuery, then for improved front-end performance Drupal * will not add jQuery and related libraries and settings to the page. * - defer: If set to TRUE, the defer attribute is set on the