pax_global_header00006660000000000000000000000064145073632220014516gustar00rootroot0000000000000052 comment=79a6263d2208acebff58b672586e07eae0d29ea6 nageru-2.3.0/000077500000000000000000000000001450736322200130015ustar00rootroot00000000000000nageru-2.3.0/.gitignore000066400000000000000000000000301450736322200147620ustar00rootroot00000000000000obj/ .ycm_extra_conf.py nageru-2.3.0/.gitmodules000066400000000000000000000001131450736322200151510ustar00rootroot00000000000000[submodule "bmusb"] path = nageru/bmusb url = http://git.sesse.net/bmusb nageru-2.3.0/.mailmap000066400000000000000000000001141450736322200144160ustar00rootroot00000000000000Steinar H. Gunderson nageru-2.3.0/COPYING000066400000000000000000001045131450736322200140400ustar00rootroot00000000000000 GNU GENERAL PUBLIC LICENSE Version 3, 29 June 2007 Copyright (C) 2007 Free Software Foundation, Inc. Everyone is permitted to copy and distribute verbatim copies of this license document, but changing it is not allowed. Preamble The GNU General Public License is a free, copyleft license for software and other kinds of works. The licenses for most software and other practical works are designed to take away your freedom to share and change the works. By contrast, the GNU General Public License is intended to guarantee your freedom to share and change all versions of a program--to make sure it remains free software for all its users. We, the Free Software Foundation, use the GNU General Public License for most of our software; it applies also to any other work released this way by its authors. You can apply it to your programs, too. When we speak of free software, we are referring to freedom, not price. Our General Public Licenses are designed to make sure that you have the freedom to distribute copies of free software (and charge for them if you wish), that you receive source code or can get it if you want it, that you can change the software or use pieces of it in new free programs, and that you know you can do these things. To protect your rights, we need to prevent others from denying you these rights or asking you to surrender the rights. Therefore, you have certain responsibilities if you distribute copies of the software, or if you modify it: responsibilities to respect the freedom of others. For example, if you distribute copies of such a program, whether gratis or for a fee, you must pass on to the recipients the same freedoms that you received. You must make sure that they, too, receive or can get the source code. And you must show them these terms so they know their rights. Developers that use the GNU GPL protect your rights with two steps: (1) assert copyright on the software, and (2) offer you this License giving you legal permission to copy, distribute and/or modify it. For the developers' and authors' protection, the GPL clearly explains that there is no warranty for this free software. For both users' and authors' sake, the GPL requires that modified versions be marked as changed, so that their problems will not be attributed erroneously to authors of previous versions. Some devices are designed to deny users access to install or run modified versions of the software inside them, although the manufacturer can do so. This is fundamentally incompatible with the aim of protecting users' freedom to change the software. The systematic pattern of such abuse occurs in the area of products for individuals to use, which is precisely where it is most unacceptable. Therefore, we have designed this version of the GPL to prohibit the practice for those products. If such problems arise substantially in other domains, we stand ready to extend this provision to those domains in future versions of the GPL, as needed to protect the freedom of users. Finally, every program is threatened constantly by software patents. States should not allow patents to restrict development and use of software on general-purpose computers, but in those that do, we wish to avoid the special danger that patents applied to a free program could make it effectively proprietary. To prevent this, the GPL assures that patents cannot be used to render the program non-free. The precise terms and conditions for copying, distribution and modification follow. TERMS AND CONDITIONS 0. Definitions. "This License" refers to version 3 of the GNU General Public License. "Copyright" also means copyright-like laws that apply to other kinds of works, such as semiconductor masks. "The Program" refers to any copyrightable work licensed under this License. Each licensee is addressed as "you". "Licensees" and "recipients" may be individuals or organizations. To "modify" a work means to copy from or adapt all or part of the work in a fashion requiring copyright permission, other than the making of an exact copy. The resulting work is called a "modified version" of the earlier work or a work "based on" the earlier work. A "covered work" means either the unmodified Program or a work based on the Program. To "propagate" a work means to do anything with it that, without permission, would make you directly or secondarily liable for infringement under applicable copyright law, except executing it on a computer or modifying a private copy. Propagation includes copying, distribution (with or without modification), making available to the public, and in some countries other activities as well. To "convey" a work means any kind of propagation that enables other parties to make or receive copies. Mere interaction with a user through a computer network, with no transfer of a copy, is not conveying. An interactive user interface displays "Appropriate Legal Notices" to the extent that it includes a convenient and prominently visible feature that (1) displays an appropriate copyright notice, and (2) tells the user that there is no warranty for the work (except to the extent that warranties are provided), that licensees may convey the work under this License, and how to view a copy of this License. If the interface presents a list of user commands or options, such as a menu, a prominent item in the list meets this criterion. 1. Source Code. The "source code" for a work means the preferred form of the work for making modifications to it. "Object code" means any non-source form of a work. A "Standard Interface" means an interface that either is an official standard defined by a recognized standards body, or, in the case of interfaces specified for a particular programming language, one that is widely used among developers working in that language. The "System Libraries" of an executable work include anything, other than the work as a whole, that (a) is included in the normal form of packaging a Major Component, but which is not part of that Major Component, and (b) serves only to enable use of the work with that Major Component, or to implement a Standard Interface for which an implementation is available to the public in source code form. A "Major Component", in this context, means a major essential component (kernel, window system, and so on) of the specific operating system (if any) on which the executable work runs, or a compiler used to produce the work, or an object code interpreter used to run it. The "Corresponding Source" for a work in object code form means all the source code needed to generate, install, and (for an executable work) run the object code and to modify the work, including scripts to control those activities. However, it does not include the work's System Libraries, or general-purpose tools or generally available free programs which are used unmodified in performing those activities but which are not part of the work. For example, Corresponding Source includes interface definition files associated with source files for the work, and the source code for shared libraries and dynamically linked subprograms that the work is specifically designed to require, such as by intimate data communication or control flow between those subprograms and other parts of the work. The Corresponding Source need not include anything that users can regenerate automatically from other parts of the Corresponding Source. The Corresponding Source for a work in source code form is that same work. 2. Basic Permissions. All rights granted under this License are granted for the term of copyright on the Program, and are irrevocable provided the stated conditions are met. This License explicitly affirms your unlimited permission to run the unmodified Program. The output from running a covered work is covered by this License only if the output, given its content, constitutes a covered work. This License acknowledges your rights of fair use or other equivalent, as provided by copyright law. You may make, run and propagate covered works that you do not convey, without conditions so long as your license otherwise remains in force. You may convey covered works to others for the sole purpose of having them make modifications exclusively for you, or provide you with facilities for running those works, provided that you comply with the terms of this License in conveying all material for which you do not control copyright. Those thus making or running the covered works for you must do so exclusively on your behalf, under your direction and control, on terms that prohibit them from making any copies of your copyrighted material outside their relationship with you. Conveying under any other circumstances is permitted solely under the conditions stated below. Sublicensing is not allowed; section 10 makes it unnecessary. 3. Protecting Users' Legal Rights From Anti-Circumvention Law. No covered work shall be deemed part of an effective technological measure under any applicable law fulfilling obligations under article 11 of the WIPO copyright treaty adopted on 20 December 1996, or similar laws prohibiting or restricting circumvention of such measures. When you convey a covered work, you waive any legal power to forbid circumvention of technological measures to the extent such circumvention is effected by exercising rights under this License with respect to the covered work, and you disclaim any intention to limit operation or modification of the work as a means of enforcing, against the work's users, your or third parties' legal rights to forbid circumvention of technological measures. 4. Conveying Verbatim Copies. You may convey verbatim copies of the Program's source code as you receive it, in any medium, provided that you conspicuously and appropriately publish on each copy an appropriate copyright notice; keep intact all notices stating that this License and any non-permissive terms added in accord with section 7 apply to the code; keep intact all notices of the absence of any warranty; and give all recipients a copy of this License along with the Program. You may charge any price or no price for each copy that you convey, and you may offer support or warranty protection for a fee. 5. Conveying Modified Source Versions. You may convey a work based on the Program, or the modifications to produce it from the Program, in the form of source code under the terms of section 4, provided that you also meet all of these conditions: a) The work must carry prominent notices stating that you modified it, and giving a relevant date. b) The work must carry prominent notices stating that it is released under this License and any conditions added under section 7. This requirement modifies the requirement in section 4 to "keep intact all notices". c) You must license the entire work, as a whole, under this License to anyone who comes into possession of a copy. This License will therefore apply, along with any applicable section 7 additional terms, to the whole of the work, and all its parts, regardless of how they are packaged. This License gives no permission to license the work in any other way, but it does not invalidate such permission if you have separately received it. d) If the work has interactive user interfaces, each must display Appropriate Legal Notices; however, if the Program has interactive interfaces that do not display Appropriate Legal Notices, your work need not make them do so. A compilation of a covered work with other separate and independent works, which are not by their nature extensions of the covered work, and which are not combined with it such as to form a larger program, in or on a volume of a storage or distribution medium, is called an "aggregate" if the compilation and its resulting copyright are not used to limit the access or legal rights of the compilation's users beyond what the individual works permit. Inclusion of a covered work in an aggregate does not cause this License to apply to the other parts of the aggregate. 6. Conveying Non-Source Forms. You may convey a covered work in object code form under the terms of sections 4 and 5, provided that you also convey the machine-readable Corresponding Source under the terms of this License, in one of these ways: a) Convey the object code in, or embodied in, a physical product (including a physical distribution medium), accompanied by the Corresponding Source fixed on a durable physical medium customarily used for software interchange. b) Convey the object code in, or embodied in, a physical product (including a physical distribution medium), accompanied by a written offer, valid for at least three years and valid for as long as you offer spare parts or customer support for that product model, to give anyone who possesses the object code either (1) a copy of the Corresponding Source for all the software in the product that is covered by this License, on a durable physical medium customarily used for software interchange, for a price no more than your reasonable cost of physically performing this conveying of source, or (2) access to copy the Corresponding Source from a network server at no charge. c) Convey individual copies of the object code with a copy of the written offer to provide the Corresponding Source. This alternative is allowed only occasionally and noncommercially, and only if you received the object code with such an offer, in accord with subsection 6b. d) Convey the object code by offering access from a designated place (gratis or for a charge), and offer equivalent access to the Corresponding Source in the same way through the same place at no further charge. You need not require recipients to copy the Corresponding Source along with the object code. If the place to copy the object code is a network server, the Corresponding Source may be on a different server (operated by you or a third party) that supports equivalent copying facilities, provided you maintain clear directions next to the object code saying where to find the Corresponding Source. Regardless of what server hosts the Corresponding Source, you remain obligated to ensure that it is available for as long as needed to satisfy these requirements. e) Convey the object code using peer-to-peer transmission, provided you inform other peers where the object code and Corresponding Source of the work are being offered to the general public at no charge under subsection 6d. A separable portion of the object code, whose source code is excluded from the Corresponding Source as a System Library, need not be included in conveying the object code work. A "User Product" is either (1) a "consumer product", which means any tangible personal property which is normally used for personal, family, or household purposes, or (2) anything designed or sold for incorporation into a dwelling. In determining whether a product is a consumer product, doubtful cases shall be resolved in favor of coverage. For a particular product received by a particular user, "normally used" refers to a typical or common use of that class of product, regardless of the status of the particular user or of the way in which the particular user actually uses, or expects or is expected to use, the product. A product is a consumer product regardless of whether the product has substantial commercial, industrial or non-consumer uses, unless such uses represent the only significant mode of use of the product. "Installation Information" for a User Product means any methods, procedures, authorization keys, or other information required to install and execute modified versions of a covered work in that User Product from a modified version of its Corresponding Source. The information must suffice to ensure that the continued functioning of the modified object code is in no case prevented or interfered with solely because modification has been made. If you convey an object code work under this section in, or with, or specifically for use in, a User Product, and the conveying occurs as part of a transaction in which the right of possession and use of the User Product is transferred to the recipient in perpetuity or for a fixed term (regardless of how the transaction is characterized), the Corresponding Source conveyed under this section must be accompanied by the Installation Information. But this requirement does not apply if neither you nor any third party retains the ability to install modified object code on the User Product (for example, the work has been installed in ROM). The requirement to provide Installation Information does not include a requirement to continue to provide support service, warranty, or updates for a work that has been modified or installed by the recipient, or for the User Product in which it has been modified or installed. Access to a network may be denied when the modification itself materially and adversely affects the operation of the network or violates the rules and protocols for communication across the network. Corresponding Source conveyed, and Installation Information provided, in accord with this section must be in a format that is publicly documented (and with an implementation available to the public in source code form), and must require no special password or key for unpacking, reading or copying. 7. Additional Terms. "Additional permissions" are terms that supplement the terms of this License by making exceptions from one or more of its conditions. Additional permissions that are applicable to the entire Program shall be treated as though they were included in this License, to the extent that they are valid under applicable law. If additional permissions apply only to part of the Program, that part may be used separately under those permissions, but the entire Program remains governed by this License without regard to the additional permissions. When you convey a copy of a covered work, you may at your option remove any additional permissions from that copy, or from any part of it. (Additional permissions may be written to require their own removal in certain cases when you modify the work.) You may place additional permissions on material, added by you to a covered work, for which you have or can give appropriate copyright permission. Notwithstanding any other provision of this License, for material you add to a covered work, you may (if authorized by the copyright holders of that material) supplement the terms of this License with terms: a) Disclaiming warranty or limiting liability differently from the terms of sections 15 and 16 of this License; or b) Requiring preservation of specified reasonable legal notices or author attributions in that material or in the Appropriate Legal Notices displayed by works containing it; or c) Prohibiting misrepresentation of the origin of that material, or requiring that modified versions of such material be marked in reasonable ways as different from the original version; or d) Limiting the use for publicity purposes of names of licensors or authors of the material; or e) Declining to grant rights under trademark law for use of some trade names, trademarks, or service marks; or f) Requiring indemnification of licensors and authors of that material by anyone who conveys the material (or modified versions of it) with contractual assumptions of liability to the recipient, for any liability that these contractual assumptions directly impose on those licensors and authors. All other non-permissive additional terms are considered "further restrictions" within the meaning of section 10. If the Program as you received it, or any part of it, contains a notice stating that it is governed by this License along with a term that is a further restriction, you may remove that term. If a license document contains a further restriction but permits relicensing or conveying under this License, you may add to a covered work material governed by the terms of that license document, provided that the further restriction does not survive such relicensing or conveying. If you add terms to a covered work in accord with this section, you must place, in the relevant source files, a statement of the additional terms that apply to those files, or a notice indicating where to find the applicable terms. Additional terms, permissive or non-permissive, may be stated in the form of a separately written license, or stated as exceptions; the above requirements apply either way. 8. Termination. You may not propagate or modify a covered work except as expressly provided under this License. Any attempt otherwise to propagate or modify it is void, and will automatically terminate your rights under this License (including any patent licenses granted under the third paragraph of section 11). However, if you cease all violation of this License, then your license from a particular copyright holder is reinstated (a) provisionally, unless and until the copyright holder explicitly and finally terminates your license, and (b) permanently, if the copyright holder fails to notify you of the violation by some reasonable means prior to 60 days after the cessation. Moreover, your license from a particular copyright holder is reinstated permanently if the copyright holder notifies you of the violation by some reasonable means, this is the first time you have received notice of violation of this License (for any work) from that copyright holder, and you cure the violation prior to 30 days after your receipt of the notice. Termination of your rights under this section does not terminate the licenses of parties who have received copies or rights from you under this License. If your rights have been terminated and not permanently reinstated, you do not qualify to receive new licenses for the same material under section 10. 9. Acceptance Not Required for Having Copies. You are not required to accept this License in order to receive or run a copy of the Program. Ancillary propagation of a covered work occurring solely as a consequence of using peer-to-peer transmission to receive a copy likewise does not require acceptance. However, nothing other than this License grants you permission to propagate or modify any covered work. These actions infringe copyright if you do not accept this License. Therefore, by modifying or propagating a covered work, you indicate your acceptance of this License to do so. 10. Automatic Licensing of Downstream Recipients. Each time you convey a covered work, the recipient automatically receives a license from the original licensors, to run, modify and propagate that work, subject to this License. You are not responsible for enforcing compliance by third parties with this License. An "entity transaction" is a transaction transferring control of an organization, or substantially all assets of one, or subdividing an organization, or merging organizations. If propagation of a covered work results from an entity transaction, each party to that transaction who receives a copy of the work also receives whatever licenses to the work the party's predecessor in interest had or could give under the previous paragraph, plus a right to possession of the Corresponding Source of the work from the predecessor in interest, if the predecessor has it or can get it with reasonable efforts. You may not impose any further restrictions on the exercise of the rights granted or affirmed under this License. For example, you may not impose a license fee, royalty, or other charge for exercise of rights granted under this License, and you may not initiate litigation (including a cross-claim or counterclaim in a lawsuit) alleging that any patent claim is infringed by making, using, selling, offering for sale, or importing the Program or any portion of it. 11. Patents. A "contributor" is a copyright holder who authorizes use under this License of the Program or a work on which the Program is based. The work thus licensed is called the contributor's "contributor version". A contributor's "essential patent claims" are all patent claims owned or controlled by the contributor, whether already acquired or hereafter acquired, that would be infringed by some manner, permitted by this License, of making, using, or selling its contributor version, but do not include claims that would be infringed only as a consequence of further modification of the contributor version. For purposes of this definition, "control" includes the right to grant patent sublicenses in a manner consistent with the requirements of this License. Each contributor grants you a non-exclusive, worldwide, royalty-free patent license under the contributor's essential patent claims, to make, use, sell, offer for sale, import and otherwise run, modify and propagate the contents of its contributor version. In the following three paragraphs, a "patent license" is any express agreement or commitment, however denominated, not to enforce a patent (such as an express permission to practice a patent or covenant not to sue for patent infringement). To "grant" such a patent license to a party means to make such an agreement or commitment not to enforce a patent against the party. If you convey a covered work, knowingly relying on a patent license, and the Corresponding Source of the work is not available for anyone to copy, free of charge and under the terms of this License, through a publicly available network server or other readily accessible means, then you must either (1) cause the Corresponding Source to be so available, or (2) arrange to deprive yourself of the benefit of the patent license for this particular work, or (3) arrange, in a manner consistent with the requirements of this License, to extend the patent license to downstream recipients. "Knowingly relying" means you have actual knowledge that, but for the patent license, your conveying the covered work in a country, or your recipient's use of the covered work in a country, would infringe one or more identifiable patents in that country that you have reason to believe are valid. If, pursuant to or in connection with a single transaction or arrangement, you convey, or propagate by procuring conveyance of, a covered work, and grant a patent license to some of the parties receiving the covered work authorizing them to use, propagate, modify or convey a specific copy of the covered work, then the patent license you grant is automatically extended to all recipients of the covered work and works based on it. A patent license is "discriminatory" if it does not include within the scope of its coverage, prohibits the exercise of, or is conditioned on the non-exercise of one or more of the rights that are specifically granted under this License. You may not convey a covered work if you are a party to an arrangement with a third party that is in the business of distributing software, under which you make payment to the third party based on the extent of your activity of conveying the work, and under which the third party grants, to any of the parties who would receive the covered work from you, a discriminatory patent license (a) in connection with copies of the covered work conveyed by you (or copies made from those copies), or (b) primarily for and in connection with specific products or compilations that contain the covered work, unless you entered into that arrangement, or that patent license was granted, prior to 28 March 2007. Nothing in this License shall be construed as excluding or limiting any implied license or other defenses to infringement that may otherwise be available to you under applicable patent law. 12. No Surrender of Others' Freedom. If conditions are imposed on you (whether by court order, agreement or otherwise) that contradict the conditions of this License, they do not excuse you from the conditions of this License. If you cannot convey a covered work so as to satisfy simultaneously your obligations under this License and any other pertinent obligations, then as a consequence you may not convey it at all. For example, if you agree to terms that obligate you to collect a royalty for further conveying from those to whom you convey the Program, the only way you could satisfy both those terms and this License would be to refrain entirely from conveying the Program. 13. Use with the GNU Affero General Public License. Notwithstanding any other provision of this License, you have permission to link or combine any covered work with a work licensed under version 3 of the GNU Affero General Public License into a single combined work, and to convey the resulting work. The terms of this License will continue to apply to the part which is the covered work, but the special requirements of the GNU Affero General Public License, section 13, concerning interaction through a network will apply to the combination as such. 14. Revised Versions of this License. The Free Software Foundation may publish revised and/or new versions of the GNU General Public License from time to time. Such new versions will be similar in spirit to the present version, but may differ in detail to address new problems or concerns. Each version is given a distinguishing version number. If the Program specifies that a certain numbered version of the GNU General Public License "or any later version" applies to it, you have the option of following the terms and conditions either of that numbered version or of any later version published by the Free Software Foundation. If the Program does not specify a version number of the GNU General Public License, you may choose any version ever published by the Free Software Foundation. If the Program specifies that a proxy can decide which future versions of the GNU General Public License can be used, that proxy's public statement of acceptance of a version permanently authorizes you to choose that version for the Program. Later license versions may give you additional or different permissions. However, no additional obligations are imposed on any author or copyright holder as a result of your choosing to follow a later version. 15. Disclaimer of Warranty. THERE IS NO WARRANTY FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU. SHOULD THE PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING, REPAIR OR CORRECTION. 16. Limitation of Liability. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MODIFIES AND/OR CONVEYS THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH DAMAGES. 17. Interpretation of Sections 15 and 16. If the disclaimer of warranty and limitation of liability provided above cannot be given local legal effect according to their terms, reviewing courts shall apply local law that most closely approximates an absolute waiver of all civil liability in connection with the Program, unless a warranty or assumption of liability accompanies a copy of the Program in return for a fee. END OF TERMS AND CONDITIONS How to Apply These Terms to Your New Programs If you develop a new program, and you want it to be of the greatest possible use to the public, the best way to achieve this is to make it free software which everyone can redistribute and change under these terms. To do so, attach the following notices to the program. It is safest to attach them to the start of each source file to most effectively state the exclusion of warranty; and each file should have at least the "copyright" line and a pointer to where the full notice is found. Copyright (C) This program is free software: you can redistribute it and/or modify it under the terms of the GNU General Public License as published by the Free Software Foundation, either version 3 of the License, or (at your option) any later version. This program is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details. You should have received a copy of the GNU General Public License along with this program. If not, see . Also add information on how to contact you by electronic and paper mail. If the program does terminal interaction, make it output a short notice like this when it starts in an interactive mode: Copyright (C) This program comes with ABSOLUTELY NO WARRANTY; for details type `show w'. This is free software, and you are welcome to redistribute it under certain conditions; type `show c' for details. The hypothetical commands `show w' and `show c' should show the appropriate parts of the General Public License. Of course, your program's commands might be different; for a GUI interface, you would use an "about box". You should also get your employer (if you work as a programmer) or school, if any, to sign a "copyright disclaimer" for the program, if necessary. For more information on this, and how to apply and follow the GNU GPL, see . The GNU General Public License does not permit incorporating your program into proprietary programs. If your program is a subroutine library, you may consider it more useful to permit linking proprietary applications with the library. If this is what you want to do, use the GNU Lesser General Public License instead of this License. But first, please read . nageru-2.3.0/NEWS000066400000000000000000000626141450736322200135110ustar00rootroot00000000000000Nageru and Futatabi 2.3.0, October 5th, 2023 - Support SRT output of the encoded stream, including output to YouTube if your account is enabled for this (beta testers only as of this release). This is useful for push, and for bad networks (e.g. 4G). - Fix various deprecation warnings with newer FFmpeg (Nageru should now be warning-free with FFmpeg 6.0). This also means that Nageru now requires FFmpeg 5.1 or newer. - Fix crashes with newer SVT-AV1. Nageru and Futatabi 2.2.3, July 24th, 2023 - Fix startup crashes with newer libsrt. - Fix an issue where checkable theme menus would get the wrong starting state. Reported by Stefano Rivera. Nageru and Futatabi 2.2.2, July 15th, 2023 - Fix build breaks with newer GCC and SVT-AV1. Nageru and Futatabi 2.2.1, April 17th, 2023 - Work around an issue with OpenGL on Wayland, causing all displays to be blank. - Several fixes related to video inputs; in particular: - Fix crashes when the master clock goes faster than 60 Hz (which could happen primarily if an SRT input is the master). - Be more resilient to errors in hardware video decoding when the stream starts out broken (e.g., not on a key frame) but recovers. - Multiple fixes related to hardware acceleration on nVidia. - Incoming frames of too high resolution (larger than 8 MB) will be refused instead of crashing. Such videos may be supported better in the future. Nageru and Futatabi 2.2.0, November 15th, 2022 - Support AV1 output, via SVT-AV1. Note that this is still somewhat experimental, not the least because SVT-AV1's streaming support is not as mature as x264. - Remove the dependency on QCustomPlot. - Expose BlurEffect and UnsharpMaskEffect to the theme. - Clean up several rarely-unused command-line flags: - All the 10-bit flags are now collapsed to --10-bit. - Remove --http-uncompressed-video. - Remove the x264 VBV flags. - Hide --x264-speedcontrol-verbose. - Hide --no-flush-pbos. - Make a workaround for audio monitoring output under PipeWire. - Update CEF compatibility (tested with CEF 107). Nageru and Futatabi 2.1.0, February 6th, 2022 - Support unsynchronized HDMI/SDI output. This is for if you want just a monitor output without synchronizing your entire stream chain to the output card (ie., you want to keep some other camera as the master). Sound support is untested, and is probably going to crackle a fair bit. There's no GUI support for changing this currently (you enable it by using --output-card-unsynchronized and then using HDMI/SDI output as usual). - Support sending a separate x264 encode to disk (--separate-x264-disk-encode and associated --x264-separate-disk-* flags). This is useful for machines that don't have Quick Sync, but where you want to have an archival copy on disk in higher quality than what you streamed out. - Fix compilation issues with FFmpeg 5.0. Nageru and Futatabi 2.0.2, September 3rd, 2021 - Fix issues with various upstream software: DeckLink 11.7 (and newer) drivers, FFmpeg 4.4, newer CEF. - Add a --no-transcode-video flag to Kaeru. This is useful primarily if you want Kaeru to rewrap the stream into Metacube (for Cubemap) and do nothing else with it. Only H.264 is supported for now, since everything else assumes that. Nageru and Futatabi 2.0.1, July 9th, 2020 - Upgrade DeckLink SDK to 10.11.4. - Various bugfixes. Nageru and Futatabi 2.0.0, June 2nd, 2020 - Native support for SRT inputs; by default, Nageru will listen for incoming connections on port 9710 and treat them as hotplugged cameras. They do not need any special handling in the theme, and can pick up e.g. the SRT stream ID to be used in the UI. They generally have fewer limitations than using an srt:// URL on an FFmpeg capture; e.g., there is no forced scaling, and they can be used as master clock (although this is not generally recommended). For license reaseons, please be sure that libsrt does not link to OpenSSL when building Nageru. - You do no longer need to set up a fixed amount of capture cards at startup; by default, at least two will be created for you (fake capture cards) as before, but if you have more, or hotplug more, more slots will be automatically available, and will go away (not take up any resources like fake capture cards do) when unplugged. If you wish to artificially limit the maximum number of cards like before, you can use the new switch --max-num-cards. - MJPEG handling now includes 4:2:0 support in both Nageru and Futatabi, as SRT inputs are often 4:2:0 and not 4:2:2. - FFmpeg capture cards (including SRT cards) now use VA-API hardware acceleration for decoding whenever available. Nageru and Futatabi 1.9.3, April 12th, 2020 - Support (video-only) V4L2 output. The intended use case is output into v4l2loopback to get into videoconferencing or the likes: sudo apt install v4l2loopback-dkms sudo modprobe v4l2loopback video_nr=2 card_label='Nageru loopback' max_width=1280 max_height=720 exclusive_caps=1 nageru --v4l-output /dev/video2 Start Nageru before any readers. Nageru and Futatabi 1.9.2, March 29th, 2020 - Support handling white balance directly in Nageru, without themes manually inserting a WhiteBalanceEffect or handling set_wb(). To use it, call scene:add_white_balance() instead of scene:add_effect(WhiteBalanceEffect.new()). If using this functionality, white balance will be properly propagated to the MJPEG feed and through Futatabi, so that replays get the correct white balance. Futatabi's UI will still be uncorrected, though. - Make it possible to siphon out a single MJPEG stream, for remote debugging, single-camera recording, single-camera streaming via Kaeru or probably other things. The URL for this is /feeds/N.mp4 where N is the card index (starting from zero). - The theme can now access some audio settings; it can get (not set) number of buses and names, get/set fader volume, get/set mute, and get/set EQ parameters. - In Futatabi, it is now possible to set custom source labels, with the parameter --source-label NUM:LABEL (or -l NUM:LABEL). - When the playback speed changes in Futatabi, ease into the new speed. The easing period is nominally 200 ms, but it will be automatically shortened or lengthened (up to as much as two seconds in extreme cases, especially involving very slight speed change) if this helps getting back into a cadence of hitting the original frames. This can mean significant performance improvements when ramping from higher speeds back into 100%. - Updates for newer versions of CEF (tested with Chrome 80). - Various bugfixes and performance improvements. Nageru and Futatabi 1.9.1, November 17th, 2019 - Support disabling optional effects if a given other effect is _enabled_ (typically for mutually exclusive effects). - Make it possible for the theme to override the status line, by declaring a function format_status_line() in the theme. Inspired by a C++ patch by Alex Thomazo in the Breizhcamp repository. - Various bugfixes. Nageru and Futatabi 1.9.0, July 20th, 2019 - Significant reworking of the theme engine: Chains (now called scenes) can now instantiate different versions behind-the-scenes instead of the user having to worry about input types, low/high quality, or replacing effects with others. Menus can have submenus and checkboxes. Finally, some callbacks, such as num_channels(), have been replaced with easier-to-use imperative functions, ie., an explicit call to Nageru.set_num_channels(N). See the documentation for more information, or the included themes, which have been ported to the new interfaces. Existing themes will continue to run without modification, but the old interfaces are deprecated. Martin Sandsmark contributed a bugfix to this work. - Support cross-compilation. Patch from Helmut Grohne. - Kaeru now has a parameter --disable-audio for transcoding streams with no audio. - Various bugfixes. In particular, work around an issue where Mesa's shader cache interacts with Qt's EGL support to create a confusing crash with “vertex shader lacks `main'”. Nageru and Futatabi 1.8.6, April 19th, 2019 - Filenames for the recordings are now without colons; it caused too much problems with various software, including most players. - Various bugfixes. Nageru and Futatabi 1.8.5, March 30th, 2019 - Experimental support for audio in Futatabi: The MJPEG export from Nageru now supports audio, and Futatabi will store it and play it back. Audio is currently only supported when playing at 100% speed (no pitch shift or time stretching), and there is no audio output to the Futatabi operator. - Significant optimizations to MJPEG encoding, both when in use and when not in use. - Various bugfixes. Nageru and Futatabi 1.8.4, March 11th, 2019 - Various bugfixes, in particular for 32-bit platforms. Nageru and Futatabi 1.8.3, March 10th, 2019 - Allow controlling video mixing from MIDI events. Adapted from a patch by Yann Dubreuil, from the BreizhCamp repository. - Use ALSA hardware timestamps for input; gives more stable delay. Patch by Yann Dubreuil, from the BreizhCamp repository. - For FFmpeg inputs, add an option for playing as fast as possible (set rate >= 10.0). - In Futatabi, support queueing and playing clips with no cue-out point. This opens up for new and even faster UI workflows. - Many bugfixes. Nageru and Futatabi 1.8.2, January 19th, 2019 - Futatabi now supports MIDI controllers like Nageru, including an editor and a sample mapping for the Behringer CMD PL-1. - Futatabi now supports changing master speed during play, both via a MIDI controller and the GUI. - Various bugfixes. Nageru and Futatabi 1.8.1, December 30th, 2018 - Futatabi can now communicate its queue status through a subtitle track, and Nageru can consume it. This allows Nageru themes to get precise information programmatically, e.g. to show status or automatically switch away when the queue is about to end. - Futatabi can now reuse the computed flow across successive frames when interpolating between the same frame pair. This significantly reduces the GPU load when doing super-slow motion (slower than 0.5x). - Various smaller fixes. Nageru and Futatabi 1.8.0, December 20th, 2018 - Initial release of Futatabi, a multicamera slow motion video server designed to be used with Nageru. Futatabi is currently in alpha stage and largely undocumented. - Add support for multi-camera export from Nageru. A multi-camera stream contains all frames from all camera inputs (unless overridden by --mjpeg-export-cards), unprocessed except for MJPEG encoding. MJPEG encoding is done in hardware (via VA-API) on Skylake or newer, or using libjpeg otherwise. The intended user of this stream is Futatabi. Nageru 1.7.5, November 11th, 2018 - Fix a bug where --record-x264-video would not work when VA-API was not present, making the option rather useless (broken in 1.7.2). Bug reported by Peter De Schrijver. - The build system has been switched to Meson; see the README for new build instructions. - Various smaller fixes. Nageru 1.7.4, August 31st, 2018 - Rework the x264 speedcontrol presets, again. (They earlier assumed we could control B-frame settings on the fly, which we cannot with threaded lookahead.) Also support x264 >= 153, which can support multiple bit depths in the same library. - Default to SDI inputs instead of HDMI. - Add a mode to run in full screen (--fullscreen). Adapted from a patch by Yoann Dubreuil. - Add support for lift/gamma/gain in the theme. Patch by Alexandre Thomazo. Nageru 1.7.3, May 22nd, 2018 - When using multichannel audio, add a control for adjusting the stereo width (from normal stereo to mono, all the way to inverted stereo). - Removed --http-coarse-timebase (it is now always on). - Various bugfixes. Nageru 1.7.2, April 28th, 2018 - Several improvements to video (FFmpeg) inputs: You can now use them as audio sources, you can right-click on video channels to change URL/filename on-the-fly, themes can ask for forced disconnection (useful for network sources that are hanging), and various other improvements. Be aware that the audio support may still be somewhat rough, as A/V sync of arbitrary video playout is a hard problem. - The included themes have been fixed to properly make the returned chain preparation functions independent of global state (e.g. if the white balance for a channel was changed before the frame was actually rendered). If you are using a custom theme, you may want to apply similar fixes to it. - In Metacube stream output, mark each keyframe with a pts metadata block. This allows Cubemap 1.4.0 or newer to serve fMP4 fragments for HLS from Nageru's output, without any further remuxing or transcoding. - If needed, Nageru will now automatically try to autodetect a usable --va-display parameter by probing all DRM nodes for H.264 encoders. This removes the need to set --va-display in almost all cases, and also removes the dependency on libpci. - For GPUs that support querying available memory (in practice only NVIDIA GPUs at the current time), expose the amount of used/total GPU memory both on standard output and in the Prometheus metrics (as well as included Grafana dashboard). - The Grafana dashboard now supports heatmaps for the chosen x264 speedcontrol preset (requires Grafana 5.1 or newer). (There used to be a heatmap earlier, but it was all broken.) - Various bugfixes. Nageru 1.7.1, March 26th, 2018 - Various bugfixes, mostly related to HTML and video inputs. Nageru 1.7.0, March 8th, 2018 - Support for HTML5 graphics directly in Nageru, through CEF (Chromium Embedded Framework). This performs better and is more flexible than integrating with CasparCG over a socket. Note that CEF is an optional component; see the documentation for more information. - Add an HTTP endpoint for enumerating channels and one for getting only their colors. Intended for remote tally applications; set the documentation. - Add a video grid display that removes the audio controls and shows the video channels only, potentially in multiple rows if that makes for a larger viewing area. - Themes can now present simple menus in the Nageru UI. See the documentation for more information. - Various bugfixes. Nageru 1.6.4, January 25th, 2018 - Fix compilation with the upcoming FFmpeg 3.5. - Switch to LuaJIT for the theme engine, which is faster. - Various bugfixes and smaller optimizations. Nageru 1.6.3, November 8th, 2017 - Add quick-cut keys (Q, W, E, etc.) below the preview keys. Since it's easy to hit these by accident and put up a signal you didn't want, they are disabled by default (they can be enabled in the video menu, or with the command line flag --quick-cut-keys). - Rework the x264 speedcontrol presets to better match newer x264 versions. - Add an option for changing the HTTP port (--http-port). - Various smaller bug and integration fixes. Nageru 1.6.2, July 16th, 2017 - Various smaller Kaeru fixes, mostly around metrics. Also, you can now adjust the x264 bitrate in Kaeru (in 100 kbit/sec increments) by sending SIGUSR1 (higher) or SIGUSR2 (lower). Nageru 1.6.1, July 9th, 2017 - Add native export of Prometheus metrics. - Rework the frame queue drop algorithm. The new one should handle tricky situations much better, especially when a card is drifting very slowly against the master timer. - Add Kaeru, an experimental transcoding tool based on Nageru code. Kaeru can run headless on a server without a GPU to transcode a Nageru stream into a lower-bitrate one, replacing VLC. - Work around a bug in some versions of NVIDIA's OpenGL drivers that would crash Nageru after about three hours (fix in cooperation with Movit). - Fix a crash with i965-va-driver 1.8.x. - Reduce mutex contention in certain critical places, causing lower tail latency in the mixer. Nageru 1.6.0, May 29th, 2017 - Add support for having videos (from file or from URL) as a separate input channels, albeit with some limitations. Apart from the obvious use of looping pause clips or similar, this can be used to integrate with CasparCG; see the manual for more details. - Add a frame analyzer (accessible from the Video menu) containing an RGB histogram and a color dropped tool. This is useful in calibrating video chains by playing back a known signal. Note that this adds a dependency on QCustomPlot. - Allow overriding Y'CbCr input interpretation, for inputs that don't use the correct settings. Also, Rec. 601 is now used by default instead of Rec. 709 for SD resolutions. - Support other sample rates than 48000 Hz from bmusb. Nageru 1.5.0, April 5th, 2017 - Support for low-latency HDMI/SDI output in addition to (or instead of) the stream. This currently only works with DeckLink cards, not bmusb. See the manual for more information. - Support changing the resolution from the command line, instead of locking everything to 1280x720. - The A/V sync code has been rewritten to be more in line with Fons Adriaensen's original paper. It handles several cases much better, in particular when trying to match 59.94 and 60 Hz sources to each other. However, it might occasionally need a few extra seconds on startup to lock properly if startup is slow. - Add support for using x264 for the disk recording. This makes it possible, among other things, to run Nageru on a machine entirely without VA-API support. - Support for 10-bit Y'CbCr, both on input and output. (Output requires x264 disk recording, as Quick Sync Video does not support 10-bit H.264.) This requires compute shader support, and is in general a little bit slower on input and output, due to the extra amount of data being shuffled around. Intermediate precision is 16-bit floating-point or better, as before. - Enable input mode autodetection for DeckLink cards that support it. (bmusb mode has always been autodetected.) - Add functionality to add a time code to the stream; useful for debugging latency. - The live display is now both more performant and of higher image quality. - Fix a long-standing issue where the preview displays would be too bright when using an NVIDIA GPU. (This did not affect the finished stream.) - Many other bugfixes and small improvements. Nageru 1.4.2, November 24th, 2016 - Fix a thread race that would sometimes cause x264 streaming to go awry. Nageru 1.4.1, November 6th, 2016 - Various bugfixes. Nageru 1.4.0, October 26th, 2016 - Support for multichannel (or more accurately, multi-bus) audio, choosable from the UI or using the --multichannel command-line flag. In multichannel mode, you can take in inputs from multiple different sources (or different channels on the same source, for multichannel sound cards), apply effects to them separately and then mix them together. This includes both audio from the video cards as well as ALSA inputs, including hotplug. Ola Gundelsby contributed invaluable feedback on this feature throughout the entire development cycle. - Support for having MIDI controllers control various aspects of the audio UI, with relatively flexible mapping. Note that different MIDI controllers can vary significantly in what protocol they speak, so Nageru will not necessarily work with all. (The primary testing controller has been the Akai MIDImix, and a pre-made mapping for that is included. The Korg nanoKONTROL2 has also been tested and works, but it requires some Korg-specific SysEx commands to make the buttons and lights work.) - Add a disk space indicator to the main window. - Various bugfixes. In particular, an issue where the audio would pitch up sharply after a series of many dropped frames has been fixed. Nageru 1.3.4, August 2nd, 2016 - Various bugfixes. Nageru 1.3.3, July 27th, 2016 - Various changes to make distribution packaging easier; in particular, theme data can be picked up from /usr/local/share/nageru. - Fix various FFmpeg deprecation warnings, now that we need FFmpeg 3.1 for other reasons anyway. Nageru 1.3.2, July 23rd, 2016 - Allow limited hotplugging (unplugging and replugging) of USB cards. You can use the new command-line option --num-fake-cards (-C) to add fake cards that show only a single color and that will be replaced by real cards as you plug them in; you can also unplug cards and have them be replaced by fake cards. Fake cards can also be used for testing Nageru without actually having any video cards available. - Add Metacube timestamping of every keyframe, for easier detection of streams not keeping up. Works with the new timestamp feature of Cubemap 1.3.1. Will be ignored (save for some logging) in older Cubemap versions. - The included default theme has been reworked and cleaned up to be more understandable and extensible. - Add more command-line options for initial audio setup. Nageru 1.3.1, July 1st, 2016 - Various display bugfixes. Nageru 1.3.0, June 26th, 2016 - It is now possible, given enough CPU power (e.g., a quad-core Haswell or faster desktop CPU), to output a stream that is suitable for streaming directly to end users without further transcoding. In particular, this includes support for encoding the network stream with x264 (the stream saved to disk is still done using Quick Sync), for Metacube framing (for streaming to the Cubemap reflector), and for choosing the network stream mux. For more information, see the README. - Add a flag (--disable-alsa-output) to disable ALSA monitoring output. - Do texture uploads from the main thread instead of from separate threads; may or may not improve stability with NVIDIA's proprietary drivers. - When beginning a new video segment, the shutdown of the old encoder is now done in a background thread, in order to not disturb the external stream. The audio still goes into a somewhat random stream, though. - You can now override the default stream-to-card mapping with --map-signal= on the command line. - Nageru now tries to lock itself into RAM if it has the permissions to do so, for better realtime behavior. (Writing the stream to disk tends to fill the buffer cache, eventually paging less-used parts of Nageru out.) - Various fixes for deadlocks, memory leaks, and many other errors. Nageru 1.2.1, April 15th, 2016 - Images are now updated from disk about every second, so that it is possible to update e.g. overlays during streaming, although somewhat slowly. - Fix support for PNG images. - You can now send SIGHUP to start a new cut instead of using the menu. - Added a --help option. - Various tweaks to OpenGL fence handling. Nageru 1.2.0, April 6th, 2016 - Support for Blackmagic's PCI and Thunderbolt cards, using the official (closed-source) Blackmagic drivers. (You do not need the SDK installed, though.) You can use PCI and USB cards pretty much interchangeably. - Much more stable handling of frame queues on non-master cards. In particular, you can have a master card on 50 Hz and another card on 60 Hz without getting lots of warning messages and a 10+ frame latency on the second card. - Many new options in the right click menu on cards: Adjustable video inputs, adjustable audio inputs, adjustable resolutions, ability to select card for master clock. - Add support for starting with almost all audio processing turned off (--flat-audio). - The UI now marks inputs with red or green to mark them as participating in the live or preview signal, respectively. Red takes priority. (Actually, it merely asks the theme for a color for each input; the theme contains the logic.) - Add support for uncompressed video instead of H.264 on the HTTP server, while still storing H.264 to files (--http-uncompressed-video). Note that depending on your client, this might not actually be more CPU efficient even on localhost, so be sure to check. - Add a simpler, less featureful theme (simple.lua) that should be easier to understand for beginners. Themes are now also choosable with -t on the command line. - Too many bugfixes and small tweaks to list. In particular, many memory leaks in the streaming part have been identified and fixed. Nageru 1.1.0, February 24th, 2016 - Support doing the H.264 encoding on a different graphics device from the one doing the mixing. In particular, this makes it possible to use Nageru on an NVIDIA GPU while still encoding H.264 video using Intel Quick Sync (NVENC is not supported yet) -- it is less efficient since the data needs to be read back via the CPU, but the NVIDIA cards and drivers are so much faster that it doesn't really matter. Tested on a GTX 950 with the proprietary drivers. - In the included example theme, fix fading to/from deinterlaced sources. - Various smaller compilation, distribution and documentation fixes. Nageru 1.0.0, January 30th, 2016 - Initial release. nageru-2.3.0/README000066400000000000000000000271571450736322200136750ustar00rootroot00000000000000Nageru is a live video mixer, based around the standard M/E workflow. Futatabi is a multicamera slow motion video server. Nageru features: - High performance on modest hardware (720p60 with two input streams on my Thinkpad X240[1]); almost all pixel processing is done on the GPU. - High output quality; Lanczos3 scaling, subpixel precision everywhere, white balance adjustment, mix of 16- and 32-bit floating point for intermediate calculations, dithered output, optional 10-bit input and output support. - Proper sound support: Syncing of multiple unrelated sources through high-quality resampling, multichannel mixing with separate effects per-bus, cue out for headphones, dynamic range compression, three-band graphical EQ (pluss a fixed low-cut), level meters conforming to EBU R128, automation via MIDI controllers. - Theme engine encapsulating the design demands of each individual event; Lua code is responsible for setting up the pixel processing pipelines, running transitions etc., so that the visual look is consistent between operators. - HTML rendering (through Chromium Embedded Framework), for high-quality and flexible overlay or other graphics. - Comprehensive monitoring through Prometheus metrics. [1] For reference, that is: Core i7 4600U (dualcore 2.10GHz, clocks down to 800 MHz after 30 seconds due to thermal constraints), Intel HD Graphics 4400 (ie., without the extra L4 cache from Iris Pro), single-channel DDR3 RAM (so 12.8 GB/sec theoretical memory bandwidth, shared between CPU and GPU). Nageru currently needs: - Some sort of video capture cards; typically two or more Blackmagic USB3 or PCI cards, either HDMI or SDI (V4L2 is not generally supported). The PCI cards need Blackmagic's own drivers installed. The USB3 cards are driven through the “bmusb” driver, using libusb-1.0. - Movit, my GPU-based video filter library (https://movit.sesse.net). You will need at least version 1.5.2. - Qt 5.5 or newer for the GUI. - libmicrohttpd for the embedded web server. - x264 for encoding high-quality video suitable for streaming to end users. - FFmpeg for muxing, and for encoding audio. You will need at least version 5.1. - Working OpenGL; Movit works with almost any modern OpenGL implementation. Nageru has been tested with Intel on Mesa, and with NVIDIA's proprietary drivers. The status of AMD's proprietary drivers is currently unknown. - libzita-resampler, for resampling sound sources so that they are in sync between sources, and also for oversampling for the peak meter. - LuaJIT, for driving the theme engine. You will need at least version 2.1. - libjpeg, for encoding MJPEG streams when VA-API JPEG support is not available. - Protocol Buffers (protobuf), for storing various forms of settings and state. - Meson, for building. - Optional: CEF (Chromium Embedded Framework), for HTML graphics. If you build without CEF, the HTMLInput class will not be available from the theme. You can get binary downloads of CEF from http://opensource.spotify.com/cefbuilds/index.html Simply download the right build for your platform (the “minimal” build is fine) and add -Dcef_dir=/cef_binary_X.XXXX.XXXX.XXXXXXXX_linux64 on the meson command line (substituting X with the real version as required). - Optional: libsrt, for SRT inputs (by default, Nageru will listen on port 9710, although you can change this port on the command line, turn it off with --srt-port -1, or turn it off live in the UI). SRT can also be used for output in addition to listening for HTTP (see --srt-destination). If you build with libsrt, make sure it is not linked to OpenSSL, for license reasons. - Optional: SVT-AV1, for encoding high-quality video suitable for streaming to end users (higher quality than using x264, but not nearly as mature). You will need at least version 1.5.0. Futatabi also needs: - A fast GPU with OpenGL 4.5 support (GTX 1080 or similar recommended for best quality at HD resolutions, although 950 should work). - SQLite, for storing state. If on Debian bullseye or something similar, you can install everything you need with: apt install qtbase5-dev libqt5opengl5-dev qt5-default \ pkg-config libmicrohttpd-dev libusb-1.0-0-dev libluajit-5.1-dev \ libzita-resampler-dev libva-dev libavcodec-dev libavformat-dev \ libswscale-dev libavresample-dev libmovit-dev libegl1-mesa-dev \ libasound2-dev libx264-dev libbmusb-dev protobuf-compiler \ libprotobuf-dev libsqlite3-dev meson libjpeg-dev libsrt-gnutls-dev Exceptions as of September 2023: - Debian does not carry CEF (but it is optional). You can get experimental (and not security-supported) CEF Debian packages built for unstable at http://storage.sesse.net/cef/, and then configure Nageru with meson obj -Dcef_dir=/usr/lib/x86_64-linux-gnu/cef -Dcef_build_type=system -Dcef_no_icudtl=true The patches/ directory contains a patch that helps zita-resampler performance. It is meant for upstream, but was not in at the time Nageru was released. It is taken to be by Steinar H. Gunderson (ie., my ex-work email), and under the same license as zita-resampler itself. Nageru and Futatabi use Meson to build. For a default build (building both), type meson obj && cd obj && ninja To start Nageru, hook up your equipment, and then type “./nageru”. For Futatabi documentation, please see https://nageru.sesse.net/doc/. It is strongly recommended to have the rights to run at real-time priority; it will make the USB3 threads do so, which will make them a lot more stable. (A reasonable hack for testing is probably just to run it as root using sudo, although you might not want to do that in production.) Note also that if you are running a desktop compositor, it will steal significant amounts of GPU performance. The same goes for PulseAudio. Nageru will open a HTTP server at port 9095, where you can extract a live H264+PCM signal in nut mux (e.g. http://127.0.0.1:9095/stream.nut). It is probably too high bitrate (~25 Mbit/sec depending on content) to send to users, but you can easily send it around in your internal network and then transcode it in e.g. VLC. A copy of the stream (separately muxed) will also be saved live to local disk. If you have a fast CPU (typically a quadcore desktop; most laptops will spend most of their CPU on running Nageru itself), you can use x264 for the outgoing stream instead of Quick Sync; it is much better quality for the same bitrate, and also has proper bitrate controls. Simply add --http-x264-video on the command line. (You may also need to add something like "--x264-preset veryfast", since the default "medium" preset might be too CPU-intensive, but YMMV.) The stream saved to disk will still be the Quick Sync-encoded stream, as it is typically higher bitrate and thus also higher quality. Note that if you add ".metacube" at the end of the URL (e.g. "http://127.0.0.1:9095/stream.ts.metacube"), you will get a stream suitable for streaming through the Cubemap video reflector (cubemap.sesse.net). A typical example would be: ./nageru --http-x264-video --x264-preset veryfast --x264-tune film \ --http-mux mp4 --http-audio-codec libfdk_aac --http-audio-bitrate 128 If you are comfortable with using all your remaining CPU power on the machine for x264, try --x264-speedcontrol, which will try to adjust the preset dynamically for maximum quality, at the expense of somewhat higher delay. See --help for more information on options in general. The name “Nageru” is a play on the Japanese verb 投げる (nageru), which means to throw or cast. (I also later learned that it could mean to face defeat or give up, but that's not the intended meaning.) The name “Futatabi” comes from the Japanese adverb 再び (futatabi), which means “again” or “for the second time”. Nageru's home page is at https://nageru.sesse.net/, where you can also find contact information, full documentation and link to the latest version. Legalese: TL;DR: Everything is GPLv3-or-newer compatible, and see Intel's copyright license at quicksync_encoder.h. Nageru is Copyright (C) 2015 Steinar H. Gunderson . Portions Copyright (C) 2003 Rune Holm. Portions Copyright (C) 2010-2015 Fons Adriaensen . Portions Copyright (C) 2012-2015 Fons Adriaensen . Portions Copyright (C) 2008-2015 Fons Adriaensen . Portions Copyright (c) 2007-2013 Intel Corporation. All Rights Reserved. Portions Copyright (C) 2019 Yngve Molnes. This program is free software: you can redistribute it and/or modify it under the terms of the GNU General Public License as published by the Free Software Foundation, either version 3 of the License, or (at your option) any later version. This program is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details. You should have received a copy of the GNU General Public License along with this program. If not, see . Portions of quicksync_encoder.h and quicksync_encoder.cpp: Copyright (c) 2007-2013 Intel Corporation. All Rights Reserved. Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sub license, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice (including the next paragraph) shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NON-INFRINGEMENT. IN NO EVENT SHALL PRECISION INSIGHT AND/OR ITS SUPPLIERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. All files in decklink/: Copyright (c) 2009 Blackmagic Design Copyright (c) 2015 Blackmagic Design Permission is hereby granted, free of charge, to any person or organization obtaining a copy of the software and accompanying documentation covered by this license (the "Software") to use, reproduce, display, distribute, execute, and transmit the Software, and to prepare derivative works of the Software, and to permit third-parties to whom the Software is furnished to do so, all subject to the following: The copyright notices in the Software and this entire statement, including the above license grant, this restriction and the following disclaimer, must be included in all copies of the Software, in whole or in part, and all derivative works of the Software, unless such copies or derivative works are solely in the form of machine-executable object code generated by a source language processor. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE, TITLE AND NON-INFRINGEMENT. IN NO EVENT SHALL THE COPYRIGHT HOLDERS OR ANYONE DISTRIBUTING THE SOFTWARE BE LIABLE FOR ANY DAMAGES OR OTHER LIABILITY, WHETHER IN CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. nageru-2.3.0/futatabi/000077500000000000000000000000001450736322200146005ustar00rootroot00000000000000nageru-2.3.0/futatabi/add_base_flow.frag000066400000000000000000000002271450736322200202130ustar00rootroot00000000000000#version 450 core in vec3 tc; out vec2 diff_flow; uniform sampler2DArray diff_flow_tex; void main() { diff_flow = texture(diff_flow_tex, tc).xy; } nageru-2.3.0/futatabi/behringer_cmd_pl1.midimapping000066400000000000000000000042101450736322200223610ustar00rootroot00000000000000# Example mapping for the Behringer CMD PL-1. Like akai_midimix.midimapping # for nageru, this one is written by hand, and serves as a simple example # of the basic features. The PL-1 is a DJ controller, not a dedicated slow # motion controller, but it's also something like 1/20th the price of one. # Thus, while the mappings may be slightly confusing, it has basically # everything we need to do efficient slow motion control. # The jog wheel. jog: { controller_number: 31 } # 1-8 buttons logically switch camera. camera: { button: { note_number: 16 } is_current: { note_number: 16 } } camera: { button: { note_number: 17 } is_current: { note_number: 17 } } camera: { button: { note_number: 18 } is_current: { note_number: 18 } } camera: { button: { note_number: 19 } is_current: { note_number: 19 } } camera: { button: { note_number: 20 } is_current: { note_number: 20 } } camera: { button: { note_number: 21 } is_current: { note_number: 21 } } camera: { button: { note_number: 22 } is_current: { note_number: 22 } } camera: { button: { note_number: 23 } is_current: { note_number: 23 } } # Play is naturally mapped to the play button. play: { note_number: 35 } play_ready: { note_number: 35 velocity: 2 } playing: { note_number: 35 } # Next is mapped to fast-forward. next: { note_number: 37 } next_ready: { note_number: 37 } # Queue is marked to Cue; close enough. queue: { note_number: 34 } queue_enabled: { note_number: 34 } # Cue in and out are mapped to Sync and Tap. cue_in: { note_number: 32 } cue_in_enabled: { note_number: 32 } cue_out: { note_number: 33 } cue_out_enabled: { note_number: 33 } # Preview is mapped to Scratch. It doesn't really feel right, # but it's also unclear where else it would be. preview: { note_number: 27 } preview_playing: { note_number: 27 } preview_ready: { note_number: 27 velocity: 2 } # The slider (pitch bend) is mapped to master speed. master_speed: { controller_number: 128 } master_speed_light: { controller_number: 10 } master_speed_light_min: 1 master_speed_light_max: 15 # Master speed lock is mapped to lock. toggle_lock: { note_number: 25 } locked: { note_number: 25 } locked_blinking: { note_number: 25 velocity: 2 } nageru-2.3.0/futatabi/blend.frag000066400000000000000000000023121450736322200165230ustar00rootroot00000000000000#version 450 core in vec3 tc; #ifdef SPLIT_YCBCR_OUTPUT out float Y; out vec2 CbCr; #else out vec4 rgba; #endif uniform sampler2DArray image_tex; uniform sampler2D flow_tex; uniform float alpha; void main() { vec2 flow = texture(flow_tex, tc.xy).xy; vec4 I_0 = texture(image_tex, vec3(tc.xy - alpha * flow, 0)); vec4 I_1 = texture(image_tex, vec3(tc.xy + (1.0f - alpha) * flow, 1)); // Occlusion reasoning: vec2 size = textureSize(image_tex, 0).xy; // Follow the flow back to the initial point (where we sample I_0 from), then forward again. // See how well we match the point we started at, which is out flow consistency. float d0 = alpha * length(size * (texture(flow_tex, vec2(tc.xy - alpha * flow)).xy - flow)); // Same for d1. float d1 = (1.0f - alpha) * length(size * (texture(flow_tex, vec2(tc.xy + (1.0f - alpha) * flow)).xy - flow)); vec4 result; if (max(d0, d1) < 3.0f) { // Arbitrary constant, not all that tuned. The UW paper says 1.0 is fine for ground truth. // Both are visible, so blend. result = I_0 + alpha * (I_1 - I_0); } else if (d0 < d1) { result = I_0; } else { result = I_1; } #ifdef SPLIT_YCBCR_OUTPUT Y = result.r; CbCr = result.gb; #else rgba = result; #endif } nageru-2.3.0/futatabi/chroma_subsample.frag000066400000000000000000000003211450736322200207610ustar00rootroot00000000000000#version 450 core in vec2 tc0, tc1; uniform sampler2D cbcr_tex; out float Cb, Cr; void main() { vec2 result = 0.5 * (texture(cbcr_tex, tc0).rg + texture(cbcr_tex, tc1).rg); Cb = result.r; Cr = result.g; } nageru-2.3.0/futatabi/chroma_subsample.vert000066400000000000000000000010241450736322200210230ustar00rootroot00000000000000#version 450 core layout(location=0) in vec2 position; out vec2 tc0, tc1; uniform vec2 chroma_offset_0; uniform vec2 chroma_offset_1; void main() { // The result of glOrtho(0.0, 1.0, 0.0, 1.0, 0.0, 1.0) is: // // 2.000 0.000 0.000 -1.000 // 0.000 2.000 0.000 -1.000 // 0.000 0.000 -2.000 -1.000 // 0.000 0.000 0.000 1.000 gl_Position = vec4(2.0 * position.x - 1.0, 2.0 * position.y - 1.0, -1.0, 1.0); vec2 flipped_tc = position; tc0 = flipped_tc + chroma_offset_0; tc1 = flipped_tc + chroma_offset_1; } nageru-2.3.0/futatabi/chroma_subsampler.cpp000066400000000000000000000103131450736322200210100ustar00rootroot00000000000000#include "chroma_subsampler.h" #include "embedded_files.h" #include #include #define BUFFER_OFFSET(i) ((char *)nullptr + (i)) using namespace std; string read_file(const string &filename, const unsigned char *start = nullptr, const size_t size = 0); GLuint compile_shader(const string &shader_src, GLenum type); GLuint link_program(GLuint vs_obj, GLuint fs_obj); void bind_sampler(GLuint program, GLint location, GLuint texture_unit, GLuint tex, GLuint sampler); extern GLuint linear_sampler; ChromaSubsampler::ChromaSubsampler() { // Set up stuff for 4:2:2 conversion. // // Note: Due to the horizontally co-sited chroma/luma samples in H.264 // (chroma position is left for horizontal), // we need to be a bit careful in our subsampling. A diagram will make // this clearer, showing some luma and chroma samples: // // a b c d // +---+---+---+---+ // | | | | | // | Y | Y | Y | Y | // | | | | | // +---+---+---+---+ // // +-------+-------+ // | | | // | C | C | // | | | // +-------+-------+ // // Clearly, the rightmost chroma sample here needs to be equivalent to // b/4 + c/2 + d/4. (We could also implement more sophisticated filters, // of course, but as long as the upsampling is not going to be equally // sophisticated, it's probably not worth it.) If we sample once with // no mipmapping, we get just c, ie., no actual filtering in the // horizontal direction. (For the vertical direction, we can just // sample in the middle to get the right filtering.) One could imagine // we could use mipmapping (assuming we can create mipmaps cheaply), // but then, what we'd get is this: // // (a+b)/2 (c+d)/2 // +-------+-------+ // | | | // | Y | Y | // | | | // +-------+-------+ // // +-------+-------+ // | | | // | C | C | // | | | // +-------+-------+ // // which ends up sampling equally from a and b, which clearly isn't right. Instead, // we need to do two (non-mipmapped) chroma samples, both hitting exactly in-between // source pixels. // // Sampling in-between b and c gives us the sample (b+c)/2, and similarly for c and d. // Taking the average of these gives of (b+c)/4 + (c+d)/4 = b/4 + c/2 + d/4, which is // exactly what we want. // // See also http://www.poynton.com/PDFs/Merging_RGB_and_422.pdf, pages 6–7. cbcr_vs_obj = compile_shader(read_file("chroma_subsample.vert", _binary_chroma_subsample_vert_data, _binary_chroma_subsample_vert_size), GL_VERTEX_SHADER); cbcr_fs_obj = compile_shader(read_file("chroma_subsample.frag", _binary_chroma_subsample_frag_data, _binary_chroma_subsample_frag_size), GL_FRAGMENT_SHADER); cbcr_program = link_program(cbcr_vs_obj, cbcr_fs_obj); // Set up the VAO containing all the required position data. glCreateVertexArrays(1, &vao); glBindVertexArray(vao); float vertices[] = { 0.0f, 2.0f, 0.0f, 0.0f, 2.0f, 0.0f }; glCreateBuffers(1, &vbo); glNamedBufferData(vbo, sizeof(vertices), vertices, GL_STATIC_DRAW); glBindBuffer(GL_ARRAY_BUFFER, vbo); GLint position_attrib = 0; // Hard-coded in every vertex shader. glEnableVertexArrayAttrib(vao, position_attrib); glVertexAttribPointer(position_attrib, 2, GL_FLOAT, GL_FALSE, 0, BUFFER_OFFSET(0)); uniform_cbcr_tex = glGetUniformLocation(cbcr_program, "cbcr_tex"); uniform_chroma_offset_0 = glGetUniformLocation(cbcr_program, "chroma_offset_0"); uniform_chroma_offset_1 = glGetUniformLocation(cbcr_program, "chroma_offset_1"); } ChromaSubsampler::~ChromaSubsampler() { glDeleteProgram(cbcr_program); check_error(); glDeleteBuffers(1, &vbo); check_error(); glDeleteVertexArrays(1, &vao); check_error(); } void ChromaSubsampler::subsample_chroma(GLuint cbcr_tex, unsigned width, unsigned height, GLuint cb_tex, GLuint cr_tex) { glUseProgram(cbcr_program); bind_sampler(cbcr_program, uniform_cbcr_tex, 0, cbcr_tex, linear_sampler); glProgramUniform2f(cbcr_program, uniform_chroma_offset_0, -1.0f / width, 0.0f); glProgramUniform2f(cbcr_program, uniform_chroma_offset_1, -0.0f / width, 0.0f); glViewport(0, 0, width / 2, height); fbos.render_to(cb_tex, cr_tex); glBindVertexArray(vao); glDrawArrays(GL_TRIANGLES, 0, 3); } nageru-2.3.0/futatabi/chroma_subsampler.h000066400000000000000000000013751450736322200204650ustar00rootroot00000000000000#ifndef _CHROMA_SUBSAMPLER_H #define _CHROMA_SUBSAMPLER_H 1 #include "flow.h" #include class ChromaSubsampler { public: ChromaSubsampler(); ~ChromaSubsampler(); // Subsamples chroma (packed Cb and Cr) 2x1 to yield chroma suitable for // planar 4:2:2. Chroma positioning is left (H.264 convention). // width and height are the dimensions (in pixels) of the input texture. void subsample_chroma(GLuint cbcr_tex, unsigned width, unsigned height, GLuint cb_tex, GLuint cr_tex); private: PersistentFBOSet<2> fbos; GLuint vao; GLuint vbo; // Holds position data. GLuint cbcr_vs_obj, cbcr_fs_obj, cbcr_program; GLuint uniform_cbcr_tex; GLuint uniform_chroma_offset_0, uniform_chroma_offset_1; }; #endif // !defined(_CHROMA_SUBSAMPLER_H) nageru-2.3.0/futatabi/clip_list.cpp000066400000000000000000000321731450736322200172740ustar00rootroot00000000000000#include "clip_list.h" #include "mainwindow.h" #include "shared/timebase.h" #include "ui_mainwindow.h" #include #include #include using namespace std; string pts_to_string(int64_t pts) { int64_t t = lrint((pts / double(TIMEBASE)) * 1e3); // In milliseconds. int ms = t % 1000; t /= 1000; int sec = t % 60; t /= 60; int min = t % 60; t /= 60; int hour = t; char buf[256]; snprintf(buf, sizeof(buf), "%d:%02d:%02d.%03d", hour, min, sec, ms); return buf; } string duration_to_string(int64_t pts_diff) { int64_t t = lrint((pts_diff / double(TIMEBASE)) * 1e3); // In milliseconds. int ms = t % 1000; t /= 1000; int sec = t % 60; t /= 60; int min = t; char buf[256]; snprintf(buf, sizeof(buf), "%d:%02d.%03d", min, sec, ms); return buf; } int ClipList::rowCount(const QModelIndex &parent) const { if (parent.isValid()) return 0; return clips.size(); } int PlayList::rowCount(const QModelIndex &parent) const { if (parent.isValid()) return 0; return clips.size(); } int ClipList::columnCount(const QModelIndex &parent) const { if (parent.isValid()) return 0; return int(Column::NUM_NON_CAMERA_COLUMNS) + num_cameras; } int PlayList::columnCount(const QModelIndex &parent) const { if (parent.isValid()) return 0; return int(Column::NUM_COLUMNS); } QVariant ClipList::data(const QModelIndex &parent, int role) const { if (!parent.isValid()) return QVariant(); const int row = parent.row(), column = parent.column(); if (size_t(row) >= clips.size()) return QVariant(); if (role == Qt::TextAlignmentRole) { switch (Column(column)) { case Column::IN: case Column::OUT: case Column::DURATION: return Qt::AlignRight + Qt::AlignVCenter; default: return Qt::AlignLeft + Qt::AlignVCenter; } } if (role != Qt::DisplayRole && role != Qt::EditRole) return QVariant(); switch (Column(column)) { case Column::IN: return QString::fromStdString(pts_to_string(clips[row].pts_in)); case Column::OUT: if (clips[row].pts_out >= 0) { return QString::fromStdString(pts_to_string(clips[row].pts_out)); } else { return QVariant(); } case Column::DURATION: if (clips[row].pts_out >= 0) { return QString::fromStdString(duration_to_string(clips[row].pts_out - clips[row].pts_in)); } else { return QVariant(); } default: if (is_camera_column(column)) { unsigned stream_idx = column - int(Column::CAMERA_1); return QString::fromStdString(clips[row].descriptions[stream_idx]); } else { return ""; } } } QVariant PlayList::data(const QModelIndex &parent, int role) const { if (!parent.isValid()) return QVariant(); const int row = parent.row(), column = parent.column(); if (size_t(row) >= clips.size()) return QVariant(); if (role == Qt::TextAlignmentRole) { switch (Column(column)) { case Column::PLAYING: return Qt::AlignCenter; case Column::IN: case Column::OUT: case Column::DURATION: case Column::FADE_TIME: case Column::SPEED: return Qt::AlignRight + Qt::AlignVCenter; case Column::CAMERA: return Qt::AlignCenter; default: return Qt::AlignLeft + Qt::AlignVCenter; } } if (role == Qt::BackgroundRole) { if (Column(column) == Column::PLAYING) { auto it = current_progress.find(clips[row].id); if (it != current_progress.end()) { double play_progress = it->second; // This only really works well for the first column, for whatever odd Qt reason. QLinearGradient grad(QPointF(0, 0), QPointF(1, 0)); grad.setCoordinateMode(grad.QGradient::ObjectBoundingMode); grad.setColorAt(0.0f, QColor::fromRgbF(0.0f, 0.0f, 1.0f, 0.2f)); grad.setColorAt(play_progress, QColor::fromRgbF(0.0f, 0.0f, 1.0f, 0.2f)); if (play_progress + 0.01f <= 1.0f) { grad.setColorAt(play_progress + 0.01f, QColor::fromRgbF(0.0f, 0.0f, 1.0f, 0.0f)); } return QBrush(grad); } else { return QVariant(); } } else { return QVariant(); } } if (role != Qt::DisplayRole && role != Qt::EditRole) return QVariant(); switch (Column(column)) { case Column::PLAYING: return current_progress.count(clips[row].id) ? "→" : ""; case Column::IN: return QString::fromStdString(pts_to_string(clips[row].clip.pts_in)); case Column::OUT: if (clips[row].clip.pts_out >= 0) { return QString::fromStdString(pts_to_string(clips[row].clip.pts_out)); } else { return QVariant(); } case Column::DURATION: if (clips[row].clip.pts_out >= 0) { return QString::fromStdString(duration_to_string(clips[row].clip.pts_out - clips[row].clip.pts_in)); } else { return QVariant(); } case Column::CAMERA: return qlonglong(clips[row].clip.stream_idx + 1); case Column::DESCRIPTION: return QString::fromStdString(clips[row].clip.descriptions[clips[row].clip.stream_idx]); case Column::FADE_TIME: { stringstream ss; ss.imbue(locale("C")); ss.precision(3); ss << fixed << clips[row].clip.fade_time_seconds; return QString::fromStdString(ss.str()); } case Column::SPEED: { stringstream ss; ss.imbue(locale("C")); ss.precision(3); ss << fixed << clips[row].clip.speed; return QString::fromStdString(ss.str()); } default: return ""; } } QVariant ClipList::headerData(int section, Qt::Orientation orientation, int role) const { if (role != Qt::DisplayRole) return QVariant(); if (orientation != Qt::Horizontal) return QVariant(); switch (Column(section)) { case Column::IN: return "In"; case Column::OUT: return "Out"; case Column::DURATION: return "Duration"; default: if (is_camera_column(section)) { return QString::fromStdString("Camera " + to_string(section - int(Column::CAMERA_1) + 1)); } else { return ""; } } } QVariant PlayList::headerData(int section, Qt::Orientation orientation, int role) const { if (role != Qt::DisplayRole) return QVariant(); if (orientation != Qt::Horizontal) return QVariant(); switch (Column(section)) { case Column::PLAYING: return ""; case Column::IN: return "In"; case Column::OUT: return "Out"; case Column::DURATION: return "Duration"; case Column::CAMERA: return "Camera"; case Column::DESCRIPTION: return "Description"; case Column::FADE_TIME: return "Fade time"; case Column::SPEED: return "Speed"; default: return ""; } } Qt::ItemFlags ClipList::flags(const QModelIndex &index) const { if (!index.isValid()) return Qt::ItemIsEnabled | Qt::ItemIsSelectable; const int row = index.row(), column = index.column(); if (size_t(row) >= clips.size()) return Qt::ItemIsEnabled | Qt::ItemIsSelectable; if (is_camera_column(column)) { return Qt::ItemIsEnabled | Qt::ItemIsSelectable | Qt::ItemIsEditable | Qt::ItemIsDragEnabled; } else { return Qt::ItemIsEnabled | Qt::ItemIsSelectable; } } Qt::ItemFlags PlayList::flags(const QModelIndex &index) const { if (!index.isValid()) return Qt::ItemIsEnabled | Qt::ItemIsSelectable; const int row = index.row(), column = index.column(); if (size_t(row) >= clips.size()) return Qt::ItemIsEnabled | Qt::ItemIsSelectable; switch (Column(column)) { case Column::DESCRIPTION: case Column::CAMERA: case Column::FADE_TIME: case Column::SPEED: return Qt::ItemIsEnabled | Qt::ItemIsSelectable | Qt::ItemIsEditable; default: return Qt::ItemIsEnabled | Qt::ItemIsSelectable; } } bool ClipList::setData(const QModelIndex &index, const QVariant &value, int role) { if (!index.isValid() || role != Qt::EditRole) { return false; } const int row = index.row(), column = index.column(); if (size_t(row) >= clips.size()) return false; if (is_camera_column(column)) { unsigned stream_idx = column - int(Column::CAMERA_1); clips[row].descriptions[stream_idx] = value.toString().toStdString(); emit_data_changed(row); return true; } else { return false; } } bool PlayList::setData(const QModelIndex &index, const QVariant &value, int role) { if (!index.isValid() || role != Qt::EditRole) { return false; } const int row = index.row(), column = index.column(); if (size_t(row) >= clips.size()) return false; switch (Column(column)) { case Column::DESCRIPTION: clips[row].clip.descriptions[clips[row].clip.stream_idx] = value.toString().toStdString(); emit_data_changed(row); return true; case Column::CAMERA: { bool ok; int camera_idx = value.toInt(&ok); if (!ok || camera_idx < 1 || camera_idx > int(num_cameras)) { return false; } clips[row].clip.stream_idx = camera_idx - 1; emit_data_changed(row); return true; } case Column::FADE_TIME: { bool ok; double val = value.toDouble(&ok); if (!ok || !(val >= 0.0)) { return false; } clips[row].clip.fade_time_seconds = val; emit_data_changed(row); return true; } case Column::SPEED: { bool ok; double val = value.toDouble(&ok); if (!ok || !(val >= 0.001)) { return false; } clips[row].clip.speed = val; emit_data_changed(row); return true; } default: return false; } } void ClipList::add_clip(const Clip &clip) { beginInsertRows(QModelIndex(), clips.size(), clips.size()); clips.push_back(clip); endInsertRows(); emit any_content_changed(); } void PlayList::add_clip(const Clip &clip) { beginInsertRows(QModelIndex(), clips.size(), clips.size()); clips.emplace_back(ClipWithID{ clip, clip_counter++ }); endInsertRows(); emit any_content_changed(); } void PlayList::duplicate_clips(size_t first, size_t last) { beginInsertRows(QModelIndex(), last + 1, last + 1 + (last - first)); vector new_clips; for (auto it = clips.begin() + first; it <= clips.begin() + last; ++it) { new_clips.emplace_back(ClipWithID{ it->clip, clip_counter++ }); // Give them new IDs. } clips.insert(clips.begin() + last + 1, new_clips.begin(), new_clips.end()); // Note: The new elements are inserted after the old ones. endInsertRows(); emit any_content_changed(); } void PlayList::erase_clips(size_t first, size_t last) { beginRemoveRows(QModelIndex(), first, last); clips.erase(clips.begin() + first, clips.begin() + last + 1); endRemoveRows(); emit any_content_changed(); } void PlayList::move_clips(size_t first, size_t last, int delta) { if (delta == -1) { beginMoveRows(QModelIndex(), first, last, QModelIndex(), first - 1); rotate(clips.begin() + first - 1, clips.begin() + first, clips.begin() + last + 1); } else { beginMoveRows(QModelIndex(), first, last, QModelIndex(), first + (last - first + 1) + 1); first = clips.size() - first - 1; last = clips.size() - last - 1; rotate(clips.rbegin() + last - 1, clips.rbegin() + last, clips.rbegin() + first + 1); } endMoveRows(); emit any_content_changed(); } void ClipList::emit_data_changed(size_t row) { emit dataChanged(index(row, 0), index(row, int(Column::NUM_NON_CAMERA_COLUMNS) + num_cameras)); emit any_content_changed(); } void PlayList::emit_data_changed(size_t row) { emit dataChanged(index(row, 0), index(row, int(Column::NUM_COLUMNS))); emit any_content_changed(); } void ClipList::change_num_cameras(size_t num_cameras) { assert(num_cameras >= this->num_cameras); if (num_cameras == this->num_cameras) { return; } beginInsertColumns(QModelIndex(), int(Column::NUM_NON_CAMERA_COLUMNS) + this->num_cameras, int(Column::NUM_NON_CAMERA_COLUMNS) + num_cameras - 1); this->num_cameras = num_cameras; endInsertColumns(); emit any_content_changed(); } void PlayList::set_progress(const map &progress) { const int column = int(Column::PLAYING); map old_progress = move(this->current_progress); this->current_progress = progress; for (size_t row = 0; row < clips.size(); ++row) { uint64_t id = clips[row].id; if (current_progress.count(id) || old_progress.count(id)) { emit dataChanged(this->index(row, column), this->index(row, column)); } } } namespace { Clip deserialize_clip(const ClipProto &clip_proto) { Clip clip; clip.pts_in = clip_proto.pts_in(); clip.pts_out = clip_proto.pts_out(); for (int camera_idx = 0; camera_idx < min(clip_proto.description_size(), MAX_STREAMS); ++camera_idx) { clip.descriptions[camera_idx] = clip_proto.description(camera_idx); } clip.stream_idx = clip_proto.stream_idx(); clip.fade_time_seconds = clip_proto.fade_time_seconds(); if (clip_proto.speed() < 0.001) { clip.speed = 0.5; // Default. } else { clip.speed = clip_proto.speed(); } return clip; } void serialize_clip(const Clip &clip, ClipProto *clip_proto) { clip_proto->set_pts_in(clip.pts_in); clip_proto->set_pts_out(clip.pts_out); for (int camera_idx = 0; camera_idx < MAX_STREAMS; ++camera_idx) { *clip_proto->add_description() = clip.descriptions[camera_idx]; } clip_proto->set_stream_idx(clip.stream_idx); clip_proto->set_fade_time_seconds(clip.fade_time_seconds); clip_proto->set_speed(clip.speed); } } // namespace ClipList::ClipList(const ClipListProto &serialized) { for (const ClipProto &clip_proto : serialized.clip()) { clips.push_back(deserialize_clip(clip_proto)); } } ClipListProto ClipList::serialize() const { ClipListProto ret; for (const Clip &clip : clips) { serialize_clip(clip, ret.add_clip()); } return ret; } PlayList::PlayList(const ClipListProto &serialized) { for (const ClipProto &clip_proto : serialized.clip()) { clips.emplace_back(ClipWithID{ deserialize_clip(clip_proto), clip_counter++ }); } } ClipListProto PlayList::serialize() const { ClipListProto ret; for (const ClipWithID &clip : clips) { serialize_clip(clip.clip, ret.add_clip()); } return ret; } nageru-2.3.0/futatabi/clip_list.h000066400000000000000000000112421450736322200167330ustar00rootroot00000000000000#ifndef _CLIP_LIST_H #define _CLIP_LIST_H 1 #include "defs.h" #include "state.pb.h" #include #include #include #include #include struct Clip { int64_t pts_in = -1, pts_out = -1; // pts_in is inclusive, pts_out is exclusive. std::string descriptions[MAX_STREAMS]; // These are for the playlist only. unsigned stream_idx = 0; double fade_time_seconds = 0.5; double speed = 0.5; }; struct ClipWithID { Clip clip; uint64_t id; // Used for progress callback only. Immutable. }; class DataChangedReceiver { public: virtual ~DataChangedReceiver() {} virtual void emit_data_changed(size_t row) = 0; }; // Like a smart pointer to a Clip, but emits dataChanged when it goes out of scope. struct ClipProxy { public: ClipProxy(Clip &clip, DataChangedReceiver *clip_list, size_t row) : clip(clip), clip_list(clip_list), row(row) {} ~ClipProxy() { if (clip_list != nullptr) { clip_list->emit_data_changed(row); } } Clip *operator->() { return &clip; } Clip &operator*() { return clip; } private: Clip &clip; DataChangedReceiver *clip_list; size_t row; }; class ClipList : public QAbstractTableModel, public DataChangedReceiver { Q_OBJECT public: ClipList(const ClipListProto &serialized); enum class Column { IN, OUT, DURATION, CAMERA_1, // Then CAMERA_2, CAMERA_3, etc. as needed. NUM_NON_CAMERA_COLUMNS = CAMERA_1 }; int rowCount(const QModelIndex &parent) const override; int columnCount(const QModelIndex &parent) const override; QVariant data(const QModelIndex &parent, int role) const override; QVariant headerData(int section, Qt::Orientation orientation, int role = Qt::DisplayRole) const override; Qt::ItemFlags flags(const QModelIndex &index) const override; bool setData(const QModelIndex &index, const QVariant &value, int role = Qt::EditRole) override; void add_clip(const Clip &clip); size_t size() const { return clips.size(); } bool empty() const { return clips.empty(); } ClipProxy mutable_clip(size_t index) { return ClipProxy(clips[index], this, index); } const Clip *clip(size_t index) const { return &clips[index]; } ClipProxy mutable_back() { return mutable_clip(size() - 1); } const Clip *back() const { return clip(size() - 1); } ClipListProto serialize() const; void change_num_cameras(size_t num_cameras); // Defaults to 2. Cannot decrease. void emit_data_changed(size_t row) override; bool is_camera_column(int column) const { return (column >= int(Column::CAMERA_1) && column < int(Column::CAMERA_1) + int(num_cameras)); } signals: void any_content_changed(); private: std::vector clips; size_t num_cameras = 2; }; class PlayList : public QAbstractTableModel, public DataChangedReceiver { Q_OBJECT public: explicit PlayList(const ClipListProto &serialized); enum class Column { PLAYING, IN, OUT, DURATION, CAMERA, DESCRIPTION, FADE_TIME, SPEED, NUM_COLUMNS }; int rowCount(const QModelIndex &parent) const override; int columnCount(const QModelIndex &parent) const override; QVariant data(const QModelIndex &parent, int role) const override; QVariant headerData(int section, Qt::Orientation orientation, int role = Qt::DisplayRole) const override; Qt::ItemFlags flags(const QModelIndex &index) const override; bool setData(const QModelIndex &index, const QVariant &value, int role = Qt::EditRole) override; void add_clip(const Clip &clip); // is inclusive in all of these. void duplicate_clips(size_t first, size_t last); void erase_clips(size_t first, size_t last); // is -1 to move upwards, +1 to move downwards. void move_clips(size_t first, size_t last, int delta); size_t size() const { return clips.size(); } bool empty() const { return clips.empty(); } ClipProxy mutable_clip(size_t index) { return ClipProxy(clips[index].clip, this, index); } const Clip *clip(size_t index) const { return &clips[index].clip; } const ClipWithID *clip_with_id(size_t index) const { return &clips[index]; } ClipProxy mutable_back() { return mutable_clip(size() - 1); } const Clip *back() const { return clip(size() - 1); } void set_progress(const std::map &progress); ClipListProto serialize() const; void change_num_cameras(size_t num_cameras) // Defaults to 2. Cannot decrease. { this->num_cameras = num_cameras; } void emit_data_changed(size_t row) override; signals: void any_content_changed(); private: std::vector clips; double play_progress = 0.0; std::map current_progress; size_t num_cameras = 2; uint64_t clip_counter = 1000000; // Used for generating IDs. Starting at a high number to avoid any kind of bugs treating IDs as rows. }; #endif // !defined (_CLIP_LIST_H) nageru-2.3.0/futatabi/db.cpp000066400000000000000000000253061450736322200156770ustar00rootroot00000000000000#include "db.h" #include "frame.pb.h" #include #include using namespace std; DB::DB(const string &filename) { int ret = sqlite3_open(filename.c_str(), &db); if (ret != SQLITE_OK) { fprintf(stderr, "%s: %s\n", filename.c_str(), sqlite3_errmsg(db)); abort(); } // Set an effectively infinite timeout for waiting for write locks; // if we get SQLITE_LOCKED, we just exit out, so this is much better. ret = sqlite3_busy_timeout(db, 3600000); if (ret != SQLITE_OK) { fprintf(stderr, "sqlite3_busy_timeout: %s\n", sqlite3_errmsg(db)); abort(); } sqlite3_exec(db, R"( CREATE TABLE IF NOT EXISTS state (state BLOB); )", nullptr, nullptr, nullptr); // Ignore errors. sqlite3_exec(db, "CREATE UNIQUE INDEX only_one_state ON state (1);", nullptr, nullptr, nullptr); // Ignore errors. sqlite3_exec(db, R"( CREATE TABLE IF NOT EXISTS settings (settings BLOB); )", nullptr, nullptr, nullptr); // Ignore errors. sqlite3_exec(db, "CREATE UNIQUE INDEX only_one_settings ON settings (1);", nullptr, nullptr, nullptr); // Ignore errors. sqlite3_exec(db, R"( DROP TABLE file; )", nullptr, nullptr, nullptr); // Ignore errors. sqlite3_exec(db, R"( DROP TABLE frame; )", nullptr, nullptr, nullptr); // Ignore errors. sqlite3_exec(db, R"( CREATE TABLE IF NOT EXISTS filev2 ( file INTEGER NOT NULL PRIMARY KEY, filename VARCHAR NOT NULL UNIQUE, size BIGINT NOT NULL, frames BLOB NOT NULL ); )", nullptr, nullptr, nullptr); // Ignore errors. sqlite3_exec(db, "PRAGMA journal_mode=WAL", nullptr, nullptr, nullptr); // Ignore errors. sqlite3_exec(db, "PRAGMA synchronous=NORMAL", nullptr, nullptr, nullptr); // Ignore errors. } StateProto DB::get_state() { StateProto state; sqlite3_stmt *stmt; int ret = sqlite3_prepare_v2(db, "SELECT state FROM state", -1, &stmt, 0); if (ret != SQLITE_OK) { fprintf(stderr, "SELECT prepare: %s\n", sqlite3_errmsg(db)); abort(); } ret = sqlite3_step(stmt); if (ret == SQLITE_ROW) { bool ok = state.ParseFromArray(sqlite3_column_blob(stmt, 0), sqlite3_column_bytes(stmt, 0)); if (!ok) { fprintf(stderr, "State in database is corrupted!\n"); abort(); } } else if (ret != SQLITE_DONE) { fprintf(stderr, "SELECT step: %s\n", sqlite3_errmsg(db)); abort(); } ret = sqlite3_finalize(stmt); if (ret != SQLITE_OK) { fprintf(stderr, "SELECT finalize: %s\n", sqlite3_errmsg(db)); abort(); } return state; } void DB::store_state(const StateProto &state) { string serialized; state.SerializeToString(&serialized); int ret = sqlite3_exec(db, "BEGIN", nullptr, nullptr, nullptr); if (ret != SQLITE_OK) { fprintf(stderr, "BEGIN: %s\n", sqlite3_errmsg(db)); abort(); } sqlite3_stmt *stmt; ret = sqlite3_prepare_v2(db, "REPLACE INTO state VALUES (?)", -1, &stmt, 0); if (ret != SQLITE_OK) { fprintf(stderr, "REPLACE prepare: %s\n", sqlite3_errmsg(db)); abort(); } sqlite3_bind_blob(stmt, 1, serialized.data(), serialized.size(), SQLITE_STATIC); ret = sqlite3_step(stmt); if (ret == SQLITE_ROW) { fprintf(stderr, "REPLACE step: %s\n", sqlite3_errmsg(db)); abort(); } ret = sqlite3_finalize(stmt); if (ret != SQLITE_OK) { fprintf(stderr, "REPLACE finalize: %s\n", sqlite3_errmsg(db)); abort(); } ret = sqlite3_exec(db, "COMMIT", nullptr, nullptr, nullptr); if (ret != SQLITE_OK) { fprintf(stderr, "COMMIT: %s\n", sqlite3_errmsg(db)); abort(); } } SettingsProto DB::get_settings() { SettingsProto settings; sqlite3_stmt *stmt; int ret = sqlite3_prepare_v2(db, "SELECT settings FROM settings", -1, &stmt, 0); if (ret != SQLITE_OK) { fprintf(stderr, "SELECT prepare: %s\n", sqlite3_errmsg(db)); abort(); } ret = sqlite3_step(stmt); if (ret == SQLITE_ROW) { bool ok = settings.ParseFromArray(sqlite3_column_blob(stmt, 0), sqlite3_column_bytes(stmt, 0)); if (!ok) { fprintf(stderr, "State in database is corrupted!\n"); abort(); } } else if (ret != SQLITE_DONE) { fprintf(stderr, "SELECT step: %s\n", sqlite3_errmsg(db)); abort(); } ret = sqlite3_finalize(stmt); if (ret != SQLITE_OK) { fprintf(stderr, "SELECT finalize: %s\n", sqlite3_errmsg(db)); abort(); } return settings; } void DB::store_settings(const SettingsProto &settings) { string serialized; settings.SerializeToString(&serialized); int ret = sqlite3_exec(db, "BEGIN", nullptr, nullptr, nullptr); if (ret != SQLITE_OK) { fprintf(stderr, "BEGIN: %s\n", sqlite3_errmsg(db)); abort(); } sqlite3_stmt *stmt; ret = sqlite3_prepare_v2(db, "REPLACE INTO settings VALUES (?)", -1, &stmt, 0); if (ret != SQLITE_OK) { fprintf(stderr, "REPLACE prepare: %s\n", sqlite3_errmsg(db)); abort(); } sqlite3_bind_blob(stmt, 1, serialized.data(), serialized.size(), SQLITE_STATIC); ret = sqlite3_step(stmt); if (ret == SQLITE_ROW) { fprintf(stderr, "REPLACE step: %s\n", sqlite3_errmsg(db)); abort(); } ret = sqlite3_finalize(stmt); if (ret != SQLITE_OK) { fprintf(stderr, "REPLACE finalize: %s\n", sqlite3_errmsg(db)); abort(); } ret = sqlite3_exec(db, "COMMIT", nullptr, nullptr, nullptr); if (ret != SQLITE_OK) { fprintf(stderr, "COMMIT: %s\n", sqlite3_errmsg(db)); abort(); } } vector DB::load_frame_file(const string &filename, size_t size, unsigned filename_idx) { FileContentsProto file_contents; sqlite3_stmt *stmt; int ret = sqlite3_prepare_v2(db, "SELECT frames FROM filev2 WHERE filename=? AND size=?", -1, &stmt, 0); if (ret != SQLITE_OK) { fprintf(stderr, "SELECT prepare: %s\n", sqlite3_errmsg(db)); abort(); } sqlite3_bind_text(stmt, 1, filename.data(), filename.size(), SQLITE_STATIC); sqlite3_bind_int64(stmt, 2, size); ret = sqlite3_step(stmt); if (ret == SQLITE_ROW) { bool ok = file_contents.ParseFromArray(sqlite3_column_blob(stmt, 0), sqlite3_column_bytes(stmt, 0)); if (!ok) { fprintf(stderr, "Frame list in database is corrupted!\n"); abort(); } } else if (ret != SQLITE_DONE) { fprintf(stderr, "SELECT step: %s\n", sqlite3_errmsg(db)); abort(); } ret = sqlite3_finalize(stmt); if (ret != SQLITE_OK) { fprintf(stderr, "SELECT finalize: %s\n", sqlite3_errmsg(db)); abort(); } vector frames; for (const StreamContentsProto &stream : file_contents.stream()) { FrameOnDiskAndStreamIdx frame; frame.stream_idx = stream.stream_idx(); for (int i = 0; i < stream.pts_size(); ++i) { frame.frame.filename_idx = filename_idx; frame.frame.pts = stream.pts(i); frame.frame.offset = stream.offset(i); frame.frame.size = stream.file_size(i); if (i < stream.audio_size_size()) { frame.frame.audio_size = stream.audio_size(i); } else { frame.frame.audio_size = 0; } frames.push_back(frame); } } return frames; } void DB::store_frame_file(const string &filename, size_t size, const vector &frames) { int ret = sqlite3_exec(db, "BEGIN", nullptr, nullptr, nullptr); if (ret != SQLITE_OK) { fprintf(stderr, "BEGIN: %s\n", sqlite3_errmsg(db)); abort(); } // Delete any existing instances with this filename. sqlite3_stmt *stmt; // Create the protobuf blob for the new row. FileContentsProto file_contents; unordered_set seen_stream_idx; // Usually only one. for (const FrameOnDiskAndStreamIdx &frame : frames) { seen_stream_idx.insert(frame.stream_idx); } for (unsigned stream_idx : seen_stream_idx) { StreamContentsProto *stream = file_contents.add_stream(); stream->set_stream_idx(stream_idx); stream->mutable_pts()->Reserve(frames.size()); stream->mutable_offset()->Reserve(frames.size()); stream->mutable_file_size()->Reserve(frames.size()); stream->mutable_audio_size()->Reserve(frames.size()); for (const FrameOnDiskAndStreamIdx &frame : frames) { if (frame.stream_idx != stream_idx) { continue; } stream->add_pts(frame.frame.pts); stream->add_offset(frame.frame.offset); stream->add_file_size(frame.frame.size); stream->add_audio_size(frame.frame.audio_size); } } string serialized; file_contents.SerializeToString(&serialized); // Insert the new row. ret = sqlite3_prepare_v2(db, "REPLACE INTO filev2 (filename, size, frames) VALUES (?, ?, ?)", -1, &stmt, 0); if (ret != SQLITE_OK) { fprintf(stderr, "INSERT prepare: %s\n", sqlite3_errmsg(db)); abort(); } sqlite3_bind_text(stmt, 1, filename.data(), filename.size(), SQLITE_STATIC); sqlite3_bind_int64(stmt, 2, size); sqlite3_bind_blob(stmt, 3, serialized.data(), serialized.size(), SQLITE_STATIC); ret = sqlite3_step(stmt); if (ret == SQLITE_ROW) { fprintf(stderr, "REPLACE step: %s\n", sqlite3_errmsg(db)); abort(); } ret = sqlite3_finalize(stmt); if (ret != SQLITE_OK) { fprintf(stderr, "REPLACE finalize: %s\n", sqlite3_errmsg(db)); abort(); } // Commit. ret = sqlite3_exec(db, "COMMIT", nullptr, nullptr, nullptr); if (ret != SQLITE_OK) { fprintf(stderr, "COMMIT: %s\n", sqlite3_errmsg(db)); abort(); } } void DB::clean_unused_frame_files(const vector &used_filenames) { int ret = sqlite3_exec(db, "BEGIN", nullptr, nullptr, nullptr); if (ret != SQLITE_OK) { fprintf(stderr, "BEGIN: %s\n", sqlite3_errmsg(db)); abort(); } ret = sqlite3_exec(db, R"( CREATE TEMPORARY TABLE used_filenames ( filename VARCHAR NOT NULL PRIMARY KEY ) )", nullptr, nullptr, nullptr); if (ret != SQLITE_OK) { fprintf(stderr, "CREATE TEMPORARY TABLE: %s\n", sqlite3_errmsg(db)); abort(); } // Insert the new rows. sqlite3_stmt *stmt; ret = sqlite3_prepare_v2(db, "INSERT INTO used_filenames (filename) VALUES (?)", -1, &stmt, 0); if (ret != SQLITE_OK) { fprintf(stderr, "INSERT prepare: %s\n", sqlite3_errmsg(db)); abort(); } for (const string &filename : used_filenames) { sqlite3_bind_text(stmt, 1, filename.data(), filename.size(), SQLITE_STATIC); ret = sqlite3_step(stmt); if (ret == SQLITE_ROW) { fprintf(stderr, "INSERT step: %s\n", sqlite3_errmsg(db)); abort(); } ret = sqlite3_reset(stmt); if (ret == SQLITE_ROW) { fprintf(stderr, "INSERT reset: %s\n", sqlite3_errmsg(db)); abort(); } } ret = sqlite3_finalize(stmt); if (ret != SQLITE_OK) { fprintf(stderr, "INSERT finalize: %s\n", sqlite3_errmsg(db)); abort(); } ret = sqlite3_exec(db, R"( DELETE FROM filev2 WHERE filename NOT IN ( SELECT filename FROM used_filenames ) )", nullptr, nullptr, nullptr); if (ret != SQLITE_OK) { fprintf(stderr, "DELETE: %s\n", sqlite3_errmsg(db)); abort(); } ret = sqlite3_exec(db, R"( DROP TABLE used_filenames )", nullptr, nullptr, nullptr); if (ret != SQLITE_OK) { fprintf(stderr, "DROP TABLE: %s\n", sqlite3_errmsg(db)); abort(); } // Commit. ret = sqlite3_exec(db, "COMMIT", nullptr, nullptr, nullptr); if (ret != SQLITE_OK) { fprintf(stderr, "COMMIT: %s\n", sqlite3_errmsg(db)); abort(); } } nageru-2.3.0/futatabi/db.h000066400000000000000000000016041450736322200153370ustar00rootroot00000000000000#ifndef DB_H #define DB_H 1 #include "frame_on_disk.h" #include "state.pb.h" #include #include #include class DB { public: explicit DB(const std::string &filename); DB(const DB &) = delete; StateProto get_state(); void store_state(const StateProto &state); SettingsProto get_settings(); void store_settings(const SettingsProto &settings); struct FrameOnDiskAndStreamIdx { FrameOnDisk frame; unsigned stream_idx; }; std::vector load_frame_file(const std::string &filename, size_t size, unsigned frame_idx); // Empty = none found, or there were no frames. void store_frame_file(const std::string &filename, size_t size, const std::vector &frames); void clean_unused_frame_files(const std::vector &used_filenames); private: StateProto state; sqlite3 *db; }; #endif // !defined(DB_H) nageru-2.3.0/futatabi/defs.h000066400000000000000000000003221450736322200156670ustar00rootroot00000000000000#ifndef _DEFS_H #define _DEFS_H 1 #define MAX_STREAMS 16 #define CACHE_SIZE_MB 2048 #define MUX_BUFFER_SIZE 10485760 #define FRAMES_PER_FILE 1000 #define DEFAULT_HTTPD_PORT 9096 #endif // !defined(_DEFS_H) nageru-2.3.0/futatabi/densify.frag000066400000000000000000000015351450736322200171060ustar00rootroot00000000000000#version 450 core in vec2 image_pos; flat in int image0_layer, image1_layer; flat in vec2 flow_du; flat in float mean_diff; out vec3 flow_contribution; uniform sampler2DArray image_tex; void main() { // Equation (3) from the paper. We're using additive blending, so the // sum will happen automatically for us, and normalization happens on // next read. // // Note that equation (2) says 1 for the minimum error, but the code says 2.0. // And it says L2 norm, but really, the code does absolute value even for // L2 error norm (it uses a square root formula for L1 norm). float diff = texture(image_tex, vec3(image_pos, image0_layer)).x - texture(image_tex, vec3(image_pos + flow_du, image1_layer)).x; diff -= mean_diff; float weight = 1.0 / max(abs(diff), 2.0 / 255.0); flow_contribution = vec3(flow_du.x * weight, flow_du.y * weight, weight); } nageru-2.3.0/futatabi/densify.vert000066400000000000000000000041231450736322200171430ustar00rootroot00000000000000#version 450 core #extension GL_ARB_shader_viewport_layer_array : require layout(location=0) in vec2 position; out vec2 image_pos; flat out vec2 flow_du; flat out float mean_diff; flat out int image0_layer, image1_layer; uniform vec2 patch_size; // In 0..1 coordinates. uniform sampler2DArray flow_tex; void main() { int num_patches = textureSize(flow_tex, 0).x * textureSize(flow_tex, 0).y; int patch_layer = gl_InstanceID / num_patches; int patch_x = gl_InstanceID % textureSize(flow_tex, 0).x; int patch_y = (gl_InstanceID % num_patches) / textureSize(flow_tex, 0).x; // Convert the patch index to being the full 0..1 range, to match where // the motion search puts the patches. We don't bother with the locking // to texel centers, though. vec2 patch_center = ivec2(patch_x, patch_y) / (textureSize(flow_tex, 0).xy - 1.0); // Increase the patch size a bit; since patch spacing is not necessarily // an integer number of pixels, and we don't use conservative rasterization, // we could be missing the outer edges of the patch. And it seemingly helps // a little bit in general to have some more candidates as well -- although // this is measured without variational refinement, so it might be moot // with it. // // This maps [0.0,1.0] to [-0.25,1.25], ie. extends the patch by 25% in // all directions. vec2 grown_pos = (position * 1.5) - 0.25; image_pos = patch_center + patch_size * (grown_pos - 0.5f); // Find the flow value for this patch, and send it on to the fragment shader. vec3 flow_du_and_mean_diff = texelFetch(flow_tex, ivec3(patch_x, patch_y, patch_layer), 0).xyz; flow_du = flow_du_and_mean_diff.xy; mean_diff = flow_du_and_mean_diff.z; // The result of glOrtho(0.0, 1.0, 0.0, 1.0, 0.0, 1.0) is: // // 2.000 0.000 0.000 -1.000 // 0.000 2.000 0.000 -1.000 // 0.000 0.000 -2.000 -1.000 // 0.000 0.000 0.000 1.000 gl_Position = vec4(2.0 * image_pos.x - 1.0, 2.0 * image_pos.y - 1.0, -1.0, 1.0); gl_Layer = patch_layer; // Forward flow (0) goes from 0 to 1. Backward flow (1) goes from 1 to 0. image0_layer = patch_layer; image1_layer = 1 - patch_layer; } nageru-2.3.0/futatabi/derivatives.frag000066400000000000000000000024401450736322200177660ustar00rootroot00000000000000#version 450 core in vec3 tc; out vec2 derivatives; out float beta_0; uniform sampler2DArray tex; void main() { float x_m2 = textureOffset(tex, tc, ivec2(-2, 0)).x; float x_m1 = textureOffset(tex, tc, ivec2(-1, 0)).x; float x_p1 = textureOffset(tex, tc, ivec2( 1, 0)).x; float x_p2 = textureOffset(tex, tc, ivec2( 2, 0)).x; float y_m2 = textureOffset(tex, tc, ivec2( 0, -2)).x; float y_m1 = textureOffset(tex, tc, ivec2( 0, -1)).x; float y_p1 = textureOffset(tex, tc, ivec2( 0, 1)).x; float y_p2 = textureOffset(tex, tc, ivec2( 0, 2)).x; derivatives.x = (x_p1 - x_m1) * (2.0/3.0) + (x_m2 - x_p2) * (1.0/12.0); derivatives.y = (y_p1 - y_m1) * (2.0/3.0) + (y_m2 - y_p2) * (1.0/12.0); // The nudge term in the square root in the DeepFlow paper is ζ² = 0.1² = 0.01. // But this is assuming a 0..255 level. Given the nonlinearities in the expression // where β_0 appears, there's no 100% equivalent way to adjust this // constant that I can see, but taking it to (0.1/255)² ~= 1.53e-7 ~= // 1e-7 ought to be good enough. I guess the basic idea is that it // will only matter for near-zero derivatives anyway. I am a tiny // bit worried about fp16 precision when storing these numbers, but OK. beta_0 = 1.0 / (derivatives.x * derivatives.x + derivatives.y * derivatives.y + 1e-7); } nageru-2.3.0/futatabi/diffusivity.frag000066400000000000000000000022231450736322200200050ustar00rootroot00000000000000#version 450 core in vec3 tc; out float g; const float eps_sq = 0.001 * 0.001; uniform sampler2DArray flow_tex, diff_flow_tex; // Relative weighting of smoothness term. uniform float alpha; uniform bool zero_diff_flow; // This must be a macro, since the offset needs to be a constant expression. #define get_flow(x_offs, y_offs) \ (textureOffset(flow_tex, tc, ivec2((x_offs), (y_offs))).xy + \ textureOffset(diff_flow_tex, tc, ivec2((x_offs), (y_offs))).xy) #define get_flow_no_diff(x_offs, y_offs) \ textureOffset(flow_tex, tc, ivec2((x_offs), (y_offs))).xy float diffusivity(float u_x, float u_y, float v_x, float v_y) { return alpha * inversesqrt(u_x * u_x + u_y * u_y + v_x * v_x + v_y * v_y + eps_sq); } void main() { // Find diffusivity (g) for this pixel, using central differences. if (zero_diff_flow) { vec2 uv_x = get_flow_no_diff(1, 0) - get_flow_no_diff(-1, 0); vec2 uv_y = get_flow_no_diff(0, 1) - get_flow_no_diff( 0, -1); g = diffusivity(uv_x.x, uv_y.x, uv_x.y, uv_y.y); } else { vec2 uv_x = get_flow(1, 0) - get_flow(-1, 0); vec2 uv_y = get_flow(0, 1) - get_flow( 0, -1); g = diffusivity(uv_x.x, uv_y.x, uv_x.y, uv_y.y); } } nageru-2.3.0/futatabi/embedded_files.h000066400000000000000000000055051450736322200176710ustar00rootroot00000000000000#ifndef _EMBEDDED_FILES_H #define _EMBEDDED_FILES_H 1 // Files that are embedded into the binary as part of the build process. // They are used as a backup if the files are not available on disk // (which is typically the case if the program is installed, as opposed to // being run during development). #include extern const unsigned char *_binary_add_base_flow_frag_data; extern const size_t _binary_add_base_flow_frag_size; extern const unsigned char *_binary_blend_frag_data; extern const size_t _binary_blend_frag_size; extern const unsigned char *_binary_chroma_subsample_frag_data; extern const size_t _binary_chroma_subsample_frag_size; extern const unsigned char *_binary_chroma_subsample_vert_data; extern const size_t _binary_chroma_subsample_vert_size; extern const unsigned char *_binary_densify_frag_data; extern const size_t _binary_densify_frag_size; extern const unsigned char *_binary_densify_vert_data; extern const size_t _binary_densify_vert_size; extern const unsigned char *_binary_derivatives_frag_data; extern const size_t _binary_derivatives_frag_size; extern const unsigned char *_binary_diffusivity_frag_data; extern const size_t _binary_diffusivity_frag_size; extern const unsigned char *_binary_equations_frag_data; extern const size_t _binary_equations_frag_size; extern const unsigned char *_binary_equations_vert_data; extern const size_t _binary_equations_vert_size; extern const unsigned char *_binary_gray_frag_data; extern const size_t _binary_gray_frag_size; extern const unsigned char *_binary_hole_blend_frag_data; extern const size_t _binary_hole_blend_frag_size; extern const unsigned char *_binary_hole_fill_frag_data; extern const size_t _binary_hole_fill_frag_size; extern const unsigned char *_binary_hole_fill_vert_data; extern const size_t _binary_hole_fill_vert_size; extern const unsigned char *_binary_motion_search_frag_data; extern const size_t _binary_motion_search_frag_size; extern const unsigned char *_binary_motion_search_vert_data; extern const size_t _binary_motion_search_vert_size; extern const unsigned char *_binary_prewarp_frag_data; extern const size_t _binary_prewarp_frag_size; extern const unsigned char *_binary_resize_flow_frag_data; extern const size_t _binary_resize_flow_frag_size; extern const unsigned char *_binary_sobel_frag_data; extern const size_t _binary_sobel_frag_size; extern const unsigned char *_binary_sor_frag_data; extern const size_t _binary_sor_frag_size; extern const unsigned char *_binary_sor_vert_data; extern const size_t _binary_sor_vert_size; extern const unsigned char *_binary_splat_frag_data; extern const size_t _binary_splat_frag_size; extern const unsigned char *_binary_splat_vert_data; extern const size_t _binary_splat_vert_size; extern const unsigned char *_binary_vs_vert_data; extern const size_t _binary_vs_vert_size; #endif // !defined(_EMBEDDED_FILES_H) nageru-2.3.0/futatabi/equations.frag000066400000000000000000000153171450736322200174600ustar00rootroot00000000000000#version 450 core in vec3 tc0, tc_left0, tc_down0; in vec3 tc1, tc_left1, tc_down1; in float line_offset; out uvec4 equation_red, equation_black; uniform sampler2DArray I_x_y_tex, I_t_tex; uniform sampler2DArray diff_flow_tex, base_flow_tex; uniform sampler2DArray beta_0_tex; uniform sampler2DArray diffusivity_tex; // Relative weighting of intensity term. uniform float delta; // Relative weighting of gradient term. uniform float gamma; uniform bool zero_diff_flow; // Similar to packHalf2x16, but the two values share exponent, and are stored // as 12-bit fixed point numbers multiplied by that exponent (the leading one // can't be implicit in this kind of format). This allows us to store a much // greater range of numbers (8-bit, ie., full fp32 range), and also gives us an // extra mantissa bit. (Well, ostensibly two, but because the numbers have to // be stored denormalized, we only really gain one.) // // The price we pay is that if the numbers are of very different magnitudes, // the smaller number gets less precision. uint pack_floats_shared(float a, float b) { float greatest = max(abs(a), abs(b)); // Find the exponent, increase it by one, and negate it. // E.g., if the nonbiased exponent is 3, the number is between // 2^3 and 2^4, so our normalization factor to get within -1..1 // is going to be 2^-4. // // exponent -= 127; // exponent = -(exponent + 1); // exponent += 127; // // is the same as // // exponent = 252 - exponent; uint e = floatBitsToUint(greatest) & 0x7f800000u; float normalizer = uintBitsToFloat((252 << 23) - e); // The exponent is the same range as fp32, so just copy it // verbatim, shifted up to where the sign bit used to be. e <<= 1; // Quantize to 12 bits. uint qa = uint(int(round(a * (normalizer * 2047.0)))); uint qb = uint(int(round(b * (normalizer * 2047.0)))); return (qa & 0xfffu) | ((qb & 0xfffu) << 12) | e; } float zero_if_outside_border(vec4 val) { if (val.w < 1.0f) { // We hit the border (or more like half-way to it), so zero smoothness. return 0.0f; } else { return val.x; } } uvec4 compute_equation(vec3 tc, vec3 tc_left, vec3 tc_down) { // Read the flow (on top of the u0/v0 flow). float du, dv; if (zero_diff_flow) { du = dv = 0.0f; } else { vec2 diff_flow = texture(diff_flow_tex, tc).xy; du = diff_flow.x; dv = diff_flow.y; } // Read the first derivatives. vec2 I_x_y = texture(I_x_y_tex, tc).xy; float I_x = I_x_y.x; float I_y = I_x_y.y; float I_t = texture(I_t_tex, tc).x; // E_I term. Note that we don't square β_0, in line with DeepFlow; // it's probably an error (see variational_refinement.txt), // but squaring it seems to give worse results. float beta_0 = texture(beta_0_tex, tc).x; float k1 = delta * beta_0 * inversesqrt(beta_0 * (I_x * du + I_y * dv + I_t) * (I_x * du + I_y * dv + I_t) + 1e-6); float A11 = k1 * I_x * I_x; float A12 = k1 * I_x * I_y; float A22 = k1 * I_y * I_y; float b1 = -k1 * I_t * I_x; float b2 = -k1 * I_t * I_y; // Compute the second derivatives. First I_xx and I_xy. vec2 I_x_y_m2 = textureOffset(I_x_y_tex, tc, ivec2(-2, 0)).xy; vec2 I_x_y_m1 = textureOffset(I_x_y_tex, tc, ivec2(-1, 0)).xy; vec2 I_x_y_p1 = textureOffset(I_x_y_tex, tc, ivec2( 1, 0)).xy; vec2 I_x_y_p2 = textureOffset(I_x_y_tex, tc, ivec2( 2, 0)).xy; vec2 I_xx_yx = (I_x_y_p1 - I_x_y_m1) * (2.0/3.0) + (I_x_y_m2 - I_x_y_p2) * (1.0/12.0); float I_xx = I_xx_yx.x; float I_xy = I_xx_yx.y; // And now I_yy; I_yx = I_xy, bar rounding differences, so we don't // bother computing it. We still have to sample the x component, // though, but we can throw it away immediately. float I_y_m2 = textureOffset(I_x_y_tex, tc, ivec2(0, -2)).y; float I_y_m1 = textureOffset(I_x_y_tex, tc, ivec2(0, -1)).y; float I_y_p1 = textureOffset(I_x_y_tex, tc, ivec2(0, 1)).y; float I_y_p2 = textureOffset(I_x_y_tex, tc, ivec2(0, 2)).y; float I_yy = (I_y_p1 - I_y_m1) * (2.0/3.0) + (I_y_m2 - I_y_p2) * (1.0/12.0); // Finally I_xt and I_yt. (We compute these as I_tx and I_yt.) vec2 I_t_m2 = textureOffset(I_t_tex, tc, ivec2(-2, 0)).xy; vec2 I_t_m1 = textureOffset(I_t_tex, tc, ivec2(-1, 0)).xy; vec2 I_t_p1 = textureOffset(I_t_tex, tc, ivec2( 1, 0)).xy; vec2 I_t_p2 = textureOffset(I_t_tex, tc, ivec2( 2, 0)).xy; vec2 I_tx_ty = (I_t_p1 - I_t_m1) * (2.0/3.0) + (I_t_m2 - I_t_p2) * (1.0/12.0); float I_xt = I_tx_ty.x; float I_yt = I_tx_ty.y; // E_G term. Same normalization as beta_0 (see derivatives.frag). float beta_x = 1.0 / (I_xx * I_xx + I_xy * I_xy + 1e-7); float beta_y = 1.0 / (I_xy * I_xy + I_yy * I_yy + 1e-7); float k2 = gamma * inversesqrt( beta_x * (I_xx * du + I_xy * dv + I_xt) * (I_xx * du + I_xy * dv + I_xt) + beta_y * (I_xy * du + I_yy * dv + I_yt) * (I_xy * du + I_yy * dv + I_yt) + 1e-6); float k_x = k2 * beta_x; float k_y = k2 * beta_y; A11 += k_x * I_xx * I_xx + k_y * I_xy * I_xy; A12 += k_x * I_xx * I_xy + k_y * I_xy * I_yy; A22 += k_x * I_xy * I_xy + k_y * I_yy * I_yy; b1 -= k_x * I_xx * I_xt + k_y * I_xy * I_yt; b2 -= k_x * I_xy * I_xt + k_y * I_yy * I_yt; // E_S term, sans the part on the right-hand side that deals with // the neighboring pixels. The gamma is multiplied in in smoothness.frag. // // Note that we sample in-between two texels, which gives us the 0.5 * // (x[-1] + x[0]) part for free. If one of the texels is a border // texel, it will have zero alpha, and zero_if_outside_border() will // set smoothness to zero. float smooth_l = zero_if_outside_border(texture(diffusivity_tex, tc_left)); float smooth_r = zero_if_outside_border(textureOffset(diffusivity_tex, tc_left, ivec2(1, 0))); float smooth_d = zero_if_outside_border(texture(diffusivity_tex, tc_down)); float smooth_u = zero_if_outside_border(textureOffset(diffusivity_tex, tc_down, ivec2(0, 1))); A11 += smooth_l + smooth_r + smooth_d + smooth_u; A22 += smooth_l + smooth_r + smooth_d + smooth_u; // Laplacian of (u0, v0). vec2 laplacian = smooth_l * textureOffset(base_flow_tex, tc, ivec2(-1, 0)).xy + smooth_r * textureOffset(base_flow_tex, tc, ivec2( 1, 0)).xy + smooth_d * textureOffset(base_flow_tex, tc, ivec2( 0, -1)).xy + smooth_u * textureOffset(base_flow_tex, tc, ivec2( 0, 1)).xy - (smooth_l + smooth_r + smooth_d + smooth_u) * texture(base_flow_tex, tc).xy; b1 += laplacian.x; b2 += laplacian.y; // Encode the equation down into four uint32s. uvec4 ret; ret.x = floatBitsToUint(1.0 / A11); ret.y = floatBitsToUint(A12); ret.z = floatBitsToUint(1.0 / A22); ret.w = pack_floats_shared(b1, b2); return ret; } void main() { uvec4 eq0 = compute_equation(tc0, tc_left0, tc_down0); uvec4 eq1 = compute_equation(tc1, tc_left1, tc_down1); if ((int(round(line_offset)) & 1) == 1) { // Odd line, so the right value is red. equation_red = eq1; equation_black = eq0; } else { equation_red = eq0; equation_black = eq1; } } nageru-2.3.0/futatabi/equations.vert000066400000000000000000000023501450736322200175120ustar00rootroot00000000000000#version 450 core #extension GL_ARB_shader_viewport_layer_array : require layout(location=0) in vec2 position; out vec3 tc0, tc_left0, tc_down0; out vec3 tc1, tc_left1, tc_down1; out float line_offset; uniform sampler2DArray diffusivity_tex; void main() { // The result of glOrtho(0.0, 1.0, 0.0, 1.0, 0.0, 1.0) is: // // 2.000 0.000 0.000 -1.000 // 0.000 2.000 0.000 -1.000 // 0.000 0.000 -2.000 -1.000 // 0.000 0.000 0.000 1.000 gl_Position = vec4(2.0 * position.x - 1.0, 2.0 * position.y - 1.0, -1.0, 1.0); gl_Layer = gl_InstanceID; const vec2 half_texel = 0.5f / textureSize(diffusivity_tex, 0).xy; vec2 tc = position; vec2 tc_left = vec2(tc.x - half_texel.x, tc.y); vec2 tc_down = vec2(tc.x, tc.y - half_texel.y); // Adjust for different texel centers. tc0 = vec3(tc.x - half_texel.x, tc.y, gl_InstanceID); tc_left0 = vec3(tc_left.x - half_texel.x, tc_left.y, gl_InstanceID); tc_down0 = vec3(tc_down.x - half_texel.x, tc_down.y, gl_InstanceID); tc1 = vec3(tc.x + half_texel.x, tc.y, gl_InstanceID); tc_left1 = vec3(tc_left.x + half_texel.x, tc_left.y, gl_InstanceID); tc_down1 = vec3(tc_down.x + half_texel.x, tc_down.y, gl_InstanceID); line_offset = position.y * textureSize(diffusivity_tex, 0).y - 0.5f; } nageru-2.3.0/futatabi/eval.cpp000066400000000000000000000020261450736322200162330ustar00rootroot00000000000000// Evaluate a .flo file against ground truth, // outputting the average end-point error. #include "util.h" #include #include #include using namespace std; double eval_flow(const char *filename1, const char *filename2); int main(int argc, char **argv) { double sum_epe = 0.0; int num_flows = 0; for (int i = 1; i < argc; i += 2) { sum_epe += eval_flow(argv[i], argv[i + 1]); ++num_flows; } printf("Average EPE: %.2f pixels\n", sum_epe / num_flows); } double eval_flow(const char *filename1, const char *filename2) { Flow flow = read_flow(filename1); Flow gt = read_flow(filename2); double sum = 0.0; for (unsigned y = 0; y < unsigned(flow.height); ++y) { for (unsigned x = 0; x < unsigned(flow.width); ++x) { float du = flow.flow[y * flow.width + x].du; float dv = flow.flow[y * flow.width + x].dv; float gt_du = gt.flow[y * flow.width + x].du; float gt_dv = gt.flow[y * flow.width + x].dv; sum += hypot(du - gt_du, dv - gt_dv); } } return sum / (flow.width * flow.height); } nageru-2.3.0/futatabi/exif_parser.cpp000066400000000000000000000062021450736322200176130ustar00rootroot00000000000000#include "exif_parser.h" #include #include #include #include using namespace Eigen; using namespace movit; using namespace std; uint32_t read32be(const uint8_t *data) { return (uint32_t(data[0]) << 24) | (uint32_t(data[1]) << 16) | (uint32_t(data[2]) << 8) | uint32_t(data[3]); } uint16_t read16be(const uint8_t *data) { return (uint16_t(data[0]) << 8) | uint16_t(data[1]); } RGBTriplet get_neutral_color(const string &exif) { if (exif.empty()) { return {1.0f, 1.0f, 1.0f}; } const uint8_t *data = reinterpret_cast(exif.data()); // Very rudimentary Exif parser (and probably integer-overflowable); // we really only care about what Nageru sends us (MJPEGEncoder::init_jpeg_422()), // but it would be nice to have a little bit of future-proofing, just in case. if (exif.size() < 14 || memcmp(data, "Exif\0\0MM\0\x2a", 10) != 0) { fprintf(stderr, "WARNING: Truncated or malformed Exif header, ignoring.\n"); return {1.0f, 1.0f, 1.0f}; } // We only care about the first IFD. uint32_t ifd_offset = read32be(data + 10); ifd_offset += 6; // Relative to the MM. if (ifd_offset < 14 || ifd_offset >= exif.size()) { fprintf(stderr, "WARNING: Truncated or malformed Exif IFD, ignoring.\n"); return {1.0f, 1.0f, 1.0f}; } // Skip over number of tags (16 bits); if the white point is not the first one, // we're bailing anyway. if (ifd_offset + 2 > exif.size() || ifd_offset + 2 < ifd_offset) { fprintf(stderr, "WARNING: Exif IFD has no rom for number of tags, ignoring.\n"); return {1.0f, 1.0f, 1.0f}; } if (ifd_offset + 4 > exif.size() || ifd_offset + 4 < ifd_offset) { fprintf(stderr, "WARNING: Exif IFD has no rom for tag, ignoring.\n"); return {1.0f, 1.0f, 1.0f}; } uint16_t tag = read16be(data + ifd_offset + 2); if (tag != 0x13e) { // WhitePoint. fprintf(stderr, "WARNING: Unexpected first Exif tag, ignoring.\n"); return {1.0f, 1.0f, 1.0f}; } if (ifd_offset + 14 > exif.size() || ifd_offset + 14 < ifd_offset) { fprintf(stderr, "WARNING: WhitePoint Exif tag was truncated, ignoring.\n"); return {1.0f, 1.0f, 1.0f}; } // Just assume we're rational type and two values... uint32_t white_point_offset = read32be(data + ifd_offset + 10); white_point_offset += 6; // Relative to the MM. if (white_point_offset >= exif.size()) { fprintf(stderr, "WARNING: WhitePoint Exif tag was out of bounds, ignoring.\n"); return {1.0f, 1.0f, 1.0f}; } if (white_point_offset + 16 > exif.size()) { fprintf(stderr, "WARNING: WhitePoint Exif tag was truncated, ignoring.\n"); return {1.0f, 1.0f, 1.0f}; } uint32_t x_nom = read32be(data + white_point_offset); uint32_t x_den = read32be(data + white_point_offset + 4); uint32_t y_nom = read32be(data + white_point_offset + 8); uint32_t y_den = read32be(data + white_point_offset + 12); double x = double(x_nom) / x_den; double y = double(y_nom) / y_den; double z = 1.0 - x - y; Matrix3d rgb_to_xyz_matrix = movit::ColorspaceConversionEffect::get_xyz_matrix(COLORSPACE_sRGB); Vector3d rgb = rgb_to_xyz_matrix.inverse() * Vector3d(x, y, z); return RGBTriplet(rgb[0], rgb[1], rgb[2]); } nageru-2.3.0/futatabi/exif_parser.h000066400000000000000000000007141450736322200172620ustar00rootroot00000000000000#ifndef _EXIF_PARSER_H #define _EXIF_PARSER_H #include #include class Frame; // Try to parse the WhitePoint tag in the given Exif data. // If the string is empty, or the tag is corrupted, or if it was // just more complicated than our makeshift parser could deal with, // returns (1.0, 1.0, 1.0), giving a regular D65 white point. movit::RGBTriplet get_neutral_color(const std::string &exif); #endif // !defined(_EXIF_PARSER_H) nageru-2.3.0/futatabi/export.cpp000066400000000000000000000235711450736322200166350ustar00rootroot00000000000000#include "export.h" #include "clip_list.h" #include "defs.h" #include "flags.h" #include "frame_on_disk.h" #include "player.h" #include "shared/ffmpeg_raii.h" #include "shared/shared_defs.h" #include "shared/timebase.h" #include #include #include #include #include extern "C" { #include #include } using namespace std; namespace { // Only used in export_cliplist_clip_multitrack_triggered. struct BufferedFrame { int64_t pts; unsigned video_stream_idx; string data; }; bool write_buffered_frames(AVFormatContext *avctx, const vector &buffered_frames) { for (const BufferedFrame &frame : buffered_frames) { AVPacketWithDeleter pkt = av_packet_alloc_unique(); pkt->stream_index = frame.video_stream_idx; pkt->data = (uint8_t *)frame.data.data(); pkt->size = frame.data.size(); pkt->pts = frame.pts; pkt->dts = frame.pts; pkt->flags = AV_PKT_FLAG_KEY; if (av_write_frame(avctx, pkt.get()) < 0) { return false; } } return true; } } // namespace void export_multitrack_clip(const string &filename, const Clip &clip) { AVFormatContext *avctx = nullptr; avformat_alloc_output_context2(&avctx, NULL, NULL, filename.c_str()); if (avctx == nullptr) { QMessageBox msgbox; msgbox.setText("Could not allocate FFmpeg context"); msgbox.exec(); return; } AVFormatContextWithCloser closer(avctx); int ret = avio_open(&avctx->pb, filename.c_str(), AVIO_FLAG_WRITE); if (ret < 0) { QMessageBox msgbox; msgbox.setText(QString::fromStdString("Could not open output file '" + filename + "'")); msgbox.exec(); return; } // Find the first frame for each stream. size_t num_frames = 0; size_t num_streams_with_frames_left = 0; size_t last_stream_idx = 0; FrameReader readers[MAX_STREAMS]; bool has_frames[MAX_STREAMS]; size_t first_frame_idx[MAX_STREAMS], last_frame_idx[MAX_STREAMS]; // Inclusive, exclusive. { lock_guard lock(frame_mu); for (size_t stream_idx = 0; stream_idx < MAX_STREAMS; ++stream_idx) { // Find the first frame such that frame.pts <= pts_in. auto it = find_first_frame_at_or_after(frames[stream_idx], clip.pts_in); first_frame_idx[stream_idx] = distance(frames[stream_idx].begin(), it); has_frames[stream_idx] = (it != frames[stream_idx].end()); // Find the first frame such that frame.pts >= pts_out. it = find_first_frame_at_or_after(frames[stream_idx], clip.pts_out); last_frame_idx[stream_idx] = distance(frames[stream_idx].begin(), it); num_frames += last_frame_idx[stream_idx] - first_frame_idx[stream_idx]; if (has_frames[stream_idx]) { ++num_streams_with_frames_left; last_stream_idx = stream_idx; } } } // Create the streams. Note that some of them could be without frames // (we try to maintain the stream indexes in the export). vector video_streams; for (unsigned stream_idx = 0; stream_idx <= last_stream_idx; ++stream_idx) { AVStream *avstream_video = avformat_new_stream(avctx, nullptr); if (avstream_video == nullptr) { fprintf(stderr, "avformat_new_stream() failed\n"); abort(); } avstream_video->time_base = AVRational{ 1, TIMEBASE }; avstream_video->codecpar->codec_type = AVMEDIA_TYPE_VIDEO; avstream_video->codecpar->codec_id = AV_CODEC_ID_MJPEG; avstream_video->codecpar->width = global_flags.width; // Might be wrong, but doesn't matter all that much. avstream_video->codecpar->height = global_flags.height; // TODO: Deduplicate this against Mux. avstream_video->codecpar->color_primaries = AVCOL_PRI_BT709; // RGB colorspace (inout_format.color_space). avstream_video->codecpar->color_trc = AVCOL_TRC_IEC61966_2_1; // Gamma curve (inout_format.gamma_curve). // YUV colorspace (output_ycbcr_format.luma_coefficients). avstream_video->codecpar->color_space = AVCOL_SPC_BT709; avstream_video->codecpar->color_range = AVCOL_RANGE_MPEG; // Full vs. limited range (output_ycbcr_format.full_range). avstream_video->codecpar->chroma_location = AVCHROMA_LOC_LEFT; // Chroma sample location. See chroma_offset_0[] in Mixer::subsample_chroma(). avstream_video->codecpar->field_order = AV_FIELD_PROGRESSIVE; video_streams.push_back(avstream_video); } // Similar, for audio streams. vector audio_streams; for (unsigned stream_idx = 0; stream_idx <= last_stream_idx; ++stream_idx) { AVStream *avstream_audio = avformat_new_stream(avctx, nullptr); if (avstream_audio == nullptr) { fprintf(stderr, "avformat_new_stream() failed\n"); abort(); } avstream_audio->time_base = AVRational{ 1, TIMEBASE }; avstream_audio->codecpar->codec_type = AVMEDIA_TYPE_AUDIO; avstream_audio->codecpar->codec_id = AV_CODEC_ID_PCM_S32LE; avstream_audio->codecpar->ch_layout.order = AV_CHANNEL_ORDER_NATIVE; avstream_audio->codecpar->ch_layout.nb_channels = 2; avstream_audio->codecpar->ch_layout.u.mask = AV_CH_LAYOUT_STEREO; avstream_audio->codecpar->sample_rate = OUTPUT_FREQUENCY; audio_streams.push_back(avstream_audio); } if (avformat_write_header(avctx, nullptr) < 0) { QMessageBox msgbox; msgbox.setText("Writing header failed"); msgbox.exec(); unlink(filename.c_str()); return; } QProgressDialog progress(QString::fromStdString("Exporting to " + filename + "..."), "Abort", 0, 1); progress.setWindowTitle("Futatabi"); progress.setWindowModality(Qt::WindowModal); progress.setMinimumDuration(1000); progress.setMaximum(num_frames); progress.setValue(0); // We buffer up to 1000 frames at a time, in a hope that we can reduce // the amount of seeking needed on rotational media. vector buffered_frames; size_t frames_written = 0; while (num_streams_with_frames_left > 0) { // Find the stream with the lowest frame. Lower stream indexes win. FrameOnDisk first_frame; unsigned first_frame_stream_idx = 0; { lock_guard lock(frame_mu); for (size_t stream_idx = 0; stream_idx < MAX_STREAMS; ++stream_idx) { if (!has_frames[stream_idx]) { continue; } if (first_frame.pts == -1 || frames[stream_idx][first_frame_idx[stream_idx]].pts < first_frame.pts) { first_frame = frames[stream_idx][first_frame_idx[stream_idx]]; first_frame_stream_idx = stream_idx; } } ++first_frame_idx[first_frame_stream_idx]; if (first_frame_idx[first_frame_stream_idx] >= last_frame_idx[first_frame_stream_idx]) { has_frames[first_frame_stream_idx] = false; --num_streams_with_frames_left; } } FrameReader::Frame frame = readers[first_frame_stream_idx].read_frame(first_frame, /*read_video=*/true, /*read_audio=*/true); // Write audio. (Before video, since that's what we expect on input.) if (!frame.audio.empty()) { unsigned audio_stream_idx = first_frame_stream_idx + video_streams.size(); int64_t scaled_audio_pts = av_rescale_q(first_frame.pts, AVRational{ 1, TIMEBASE }, audio_streams[first_frame_stream_idx]->time_base); buffered_frames.emplace_back(BufferedFrame{ scaled_audio_pts, audio_stream_idx, std::move(frame.audio) }); } // Write video. unsigned video_stream_idx = first_frame_stream_idx; int64_t scaled_video_pts = av_rescale_q(first_frame.pts, AVRational{ 1, TIMEBASE }, video_streams[first_frame_stream_idx]->time_base); buffered_frames.emplace_back(BufferedFrame{ scaled_video_pts, video_stream_idx, std::move(frame.video) }); // Flush to disk if required. if (buffered_frames.size() >= 1000) { if (!write_buffered_frames(avctx, buffered_frames)) { QMessageBox msgbox; msgbox.setText("Writing frames failed"); msgbox.exec(); unlink(filename.c_str()); return; } frames_written += buffered_frames.size(); progress.setValue(frames_written); buffered_frames.clear(); } if (progress.wasCanceled()) { unlink(filename.c_str()); return; } } if (!write_buffered_frames(avctx, buffered_frames)) { QMessageBox msgbox; msgbox.setText("Writing frames failed"); msgbox.exec(); unlink(filename.c_str()); return; } frames_written += buffered_frames.size(); progress.setValue(frames_written); } void export_interpolated_clip(const string &filename, const vector &clips) { AVFormatContext *avctx = nullptr; avformat_alloc_output_context2(&avctx, NULL, NULL, filename.c_str()); if (avctx == nullptr) { QMessageBox msgbox; msgbox.setText("Could not allocate FFmpeg context"); msgbox.exec(); return; } AVFormatContextWithCloser closer(avctx); int ret = avio_open(&avctx->pb, filename.c_str(), AVIO_FLAG_WRITE); if (ret < 0) { QMessageBox msgbox; msgbox.setText(QString::fromStdString("Could not open output file '" + filename + "'")); msgbox.exec(); return; } QProgressDialog progress(QString::fromStdString("Exporting to " + filename + "..."), "Abort", 0, 1); progress.setWindowTitle("Futatabi"); progress.setWindowModality(Qt::WindowModal); progress.setMinimumDuration(1000); progress.setMaximum(100000); progress.setValue(0); vector clips_with_id; for (const Clip &clip : clips) { clips_with_id.emplace_back(ClipWithID{ clip, 0 }); } TimeRemaining total_length = compute_total_time(clips_with_id); promise done_promise; future done = done_promise.get_future(); std::atomic current_value{ 0.0 }; Player player(/*destination=*/nullptr, Player::FILE_STREAM_OUTPUT, closer.release()); player.set_done_callback([&done_promise] { done_promise.set_value(); }); player.set_progress_callback([¤t_value, total_length](const std::map &player_progress, TimeRemaining time_remaining) { current_value = 1.0 - time_remaining.t / total_length.t; // Nothing to do about the infinite clips. }); player.play(clips_with_id); while (done.wait_for(std::chrono::milliseconds(100)) != future_status::ready && !progress.wasCanceled()) { progress.setValue(lrint(100000.0 * current_value)); } if (progress.wasCanceled()) { unlink(filename.c_str()); // Destroying player on scope exit will abort the render job. } } nageru-2.3.0/futatabi/export.h000066400000000000000000000004241450736322200162720ustar00rootroot00000000000000#ifndef _EXPORT_H #define _EXPORT_H 1 #include "clip_list.h" #include #include void export_multitrack_clip(const std::string &filename, const Clip &clip); void export_interpolated_clip(const std::string &filename, const std::vector &clips); #endif nageru-2.3.0/futatabi/flags.cpp000066400000000000000000000127231450736322200164050ustar00rootroot00000000000000#include "flags.h" #include #include #include #include #include using namespace std; Flags global_flags; int flow_initialized_interpolation_quality; // Long options that have no corresponding short option. enum LongOption { OPTION_HELP = 1000, OPTION_SLOW_DOWN_INPUT = 1001, OPTION_HTTP_PORT = 1002, OPTION_TALLY_URL = 1003, OPTION_CUE_IN_POINT_PADDING = 1004, OPTION_CUE_OUT_POINT_PADDING = 1005, OPTION_MIDI_MAPPING = 1006 }; void usage() { fprintf(stderr, "Usage: futatabi [OPTION]... SOURCE_URL\n"); fprintf(stderr, "\n"); fprintf(stderr, " --help print usage information\n"); fprintf(stderr, " -w, --width output width in pixels (default 1280)\n"); fprintf(stderr, " -h, --height output height in pixels (default 720)\n"); fprintf(stderr, " -r, --frame-rate NUM[/NUM] output frame rate, as a float or fraction\n"); fprintf(stderr, " (default 60000/1001 ~= 59.94)\n"); fprintf(stderr, " --slow-down-input slow down input to realtime (default on if no\n"); fprintf(stderr, " source URL given)\n"); fprintf(stderr, " -q, --interpolation-quality N 0 = off\n"); fprintf(stderr, " 1 = fastest\n"); fprintf(stderr, " 2 = default (realtime 720p on fast embedded GPUs)\n"); fprintf(stderr, " 3 = good (realtime 720p on GTX 970 or so)\n"); fprintf(stderr, " 4 = best (not realtime on any current GPU)\n"); fprintf(stderr, " --cue-in-point-padding SECS move cue-in N seconds earlier on set\n"); fprintf(stderr, " --cue-out-point-padding SECS move cue-out N seconds later on set\n"); fprintf(stderr, " -d, --working-directory DIR where to store frames and database\n"); fprintf(stderr, " --http-port PORT which port to listen on for output\n"); fprintf(stderr, " --tally-url URL URL to get tally color from (polled every 100 ms)\n"); fprintf(stderr, " --midi-mapping=FILE start with the given MIDI controller mapping\n"); fprintf(stderr, " -l --source-label NUM:LABEL label source NUM as LABEL, if visible\n"); } void parse_flags(int argc, char *const argv[]) { static const option long_options[] = { { "help", no_argument, 0, OPTION_HELP }, { "width", required_argument, 0, 'w' }, { "height", required_argument, 0, 'h' }, { "frame-rate", required_argument, 0, 'r' }, { "slow-down-input", no_argument, 0, OPTION_SLOW_DOWN_INPUT }, { "interpolation-quality", required_argument, 0, 'q' }, { "working-directory", required_argument, 0, 'd' }, { "http-port", required_argument, 0, OPTION_HTTP_PORT }, { "tally-url", required_argument, 0, OPTION_TALLY_URL }, { "cue-in-point-padding", required_argument, 0, OPTION_CUE_IN_POINT_PADDING }, { "cue-out-point-padding", required_argument, 0, OPTION_CUE_OUT_POINT_PADDING }, { "midi-mapping", required_argument, 0, OPTION_MIDI_MAPPING }, { "source-label", required_argument, 0, 'l' }, { 0, 0, 0, 0 } }; for (;;) { int option_index = 0; int c = getopt_long(argc, argv, "w:h:r:q:d:l:", long_options, &option_index); if (c == -1) { break; } switch (c) { case 'w': global_flags.width = atoi(optarg); break; case 'h': global_flags.height = atoi(optarg); break; case 'r': { double num, den; if (sscanf(optarg, "%lf/%lf", &num, &den) == 2) { global_flags.output_framerate = num / den; } else if (sscanf(optarg, "%lf", &num) == 1) { global_flags.output_framerate = num; } else { fprintf(stderr, "Invalid frame rate given (must be on the form N or N/M)\n"); exit(1); } break; } case OPTION_SLOW_DOWN_INPUT: global_flags.slow_down_input = true; break; case 'q': global_flags.interpolation_quality = atoi(optarg); global_flags.interpolation_quality_set = true; break; case 'd': global_flags.working_directory = optarg; break; case 'l': { int prefix_len; unsigned channel_idx; if (sscanf(optarg, "%u:%n", &channel_idx, &prefix_len) == 1) { const char *label = optarg + prefix_len; global_flags.source_labels[channel_idx] = label; } else { fprintf(stderr, "Invalid source label format (must be on the form NUM:LABEL)\n"); exit(1); } break; } case OPTION_HTTP_PORT: global_flags.http_port = atoi(optarg); break; case OPTION_TALLY_URL: global_flags.tally_url = optarg; break; case OPTION_CUE_IN_POINT_PADDING: global_flags.cue_in_point_padding_seconds = atof(optarg); global_flags.cue_in_point_padding_set = true; break; case OPTION_CUE_OUT_POINT_PADDING: global_flags.cue_out_point_padding_seconds = atof(optarg); global_flags.cue_out_point_padding_set = true; break; case OPTION_MIDI_MAPPING: global_flags.midi_mapping_filename = optarg; break; case OPTION_HELP: usage(); exit(0); default: fprintf(stderr, "Unknown option '%s'\n", argv[option_index]); fprintf(stderr, "\n"); usage(); exit(1); } } if (global_flags.interpolation_quality < 0 || global_flags.interpolation_quality > 4) { fprintf(stderr, "Interpolation quality must be 0, 1, 2, 3 or 4.\n"); usage(); exit(1); } if (global_flags.cue_in_point_padding_seconds < 0.0 || global_flags.cue_out_point_padding_seconds < 0.0) { fprintf(stderr, "Cue point padding cannot be negative.\n"); usage(); exit(1); } } nageru-2.3.0/futatabi/flags.h000066400000000000000000000022641450736322200160510ustar00rootroot00000000000000#ifndef _FLAGS_H #define _FLAGS_H #include "defs.h" #include #include #include struct Flags { int width = 1280, height = 720; std::string stream_source; std::string working_directory = "."; bool slow_down_input = false; int interpolation_quality = 2; // Can be changed in the menus. bool interpolation_quality_set = false; uint16_t http_port = DEFAULT_HTTPD_PORT; double output_framerate = 60000.0 / 1001.0; std::string tally_url; double cue_in_point_padding_seconds = 0.0; // Can be changed in the menus. bool cue_in_point_padding_set = false; double cue_out_point_padding_seconds = 0.0; // Can be changed in the menus. bool cue_out_point_padding_set = false; std::string midi_mapping_filename; // Empty for none. std::unordered_map source_labels; }; extern Flags global_flags; // The quality setting that VideoStream was initialized to. The quality cannot // currently be changed, except turning interpolation completely off, so we compare // against this to give a warning. extern int flow_initialized_interpolation_quality; void usage(); void parse_flags(int argc, char *const argv[]); #endif // !defined(_FLAGS_H) nageru-2.3.0/futatabi/flow.cpp000066400000000000000000001253601450736322200162620ustar00rootroot00000000000000#define NO_SDL_GLEXT 1 #include "flow.h" #include "embedded_files.h" #include "gpu_timers.h" #include "shared/read_file.h" #include "util.h" #include #include #include #include #include #include #include #include #include #include #include #include #define BUFFER_OFFSET(i) ((char *)nullptr + (i)) using namespace std; // Weighting constants for the different parts of the variational refinement. // These don't correspond 1:1 to the values given in the DIS paper, // since we have different normalizations and ranges in some cases. // These are found through a simple grid search on some MPI-Sintel data, // although the error (EPE) seems to be fairly insensitive to the precise values. // Only the relative values matter, so we fix alpha (the smoothness constant) // at unity and tweak the others. // // TODO: Maybe this should not be global. float vr_alpha = 1.0f, vr_delta = 0.25f, vr_gamma = 0.25f; // Some global OpenGL objects. // TODO: These should really be part of DISComputeFlow. GLuint nearest_sampler, linear_sampler, zero_border_sampler; GLuint vertex_vbo; int find_num_levels(int width, int height) { int levels = 1; for (int w = width, h = height; w > 1 || h > 1;) { w >>= 1; h >>= 1; ++levels; } return levels; } GLuint compile_shader(const string &shader_src, GLenum type) { GLuint obj = glCreateShader(type); const GLchar *source[] = { shader_src.data() }; const GLint length[] = { (GLint)shader_src.size() }; glShaderSource(obj, 1, source, length); glCompileShader(obj); GLchar info_log[4096]; GLsizei log_length = sizeof(info_log) - 1; glGetShaderInfoLog(obj, log_length, &log_length, info_log); info_log[log_length] = 0; if (strlen(info_log) > 0) { fprintf(stderr, "Shader compile log: %s\n", info_log); } GLint status; glGetShaderiv(obj, GL_COMPILE_STATUS, &status); if (status == GL_FALSE) { // Add some line numbers to easier identify compile errors. string src_with_lines = "/* 1 */ "; size_t lineno = 1; for (char ch : shader_src) { src_with_lines.push_back(ch); if (ch == '\n') { char buf[32]; snprintf(buf, sizeof(buf), "/* %3zu */ ", ++lineno); src_with_lines += buf; } } fprintf(stderr, "Failed to compile shader:\n%s\n", src_with_lines.c_str()); abort(); } return obj; } GLuint link_program(GLuint vs_obj, GLuint fs_obj) { GLuint program = glCreateProgram(); glAttachShader(program, vs_obj); glAttachShader(program, fs_obj); glLinkProgram(program); GLint success; glGetProgramiv(program, GL_LINK_STATUS, &success); if (success == GL_FALSE) { GLchar error_log[1024] = { 0 }; glGetProgramInfoLog(program, 1024, nullptr, error_log); fprintf(stderr, "Error linking program: %s\n", error_log); abort(); } return program; } void bind_sampler(GLuint program, GLint location, GLuint texture_unit, GLuint tex, GLuint sampler) { if (location == -1) { return; } glBindTextureUnit(texture_unit, tex); glBindSampler(texture_unit, sampler); glProgramUniform1i(program, location, texture_unit); } template void PersistentFBOSet::render_to(const array &textures) { auto it = fbos.find(textures); if (it != fbos.end()) { glBindFramebuffer(GL_FRAMEBUFFER, it->second); return; } GLuint fbo; glCreateFramebuffers(1, &fbo); GLenum bufs[num_elements]; for (size_t i = 0; i < num_elements; ++i) { glNamedFramebufferTexture(fbo, GL_COLOR_ATTACHMENT0 + i, textures[i], 0); bufs[i] = GL_COLOR_ATTACHMENT0 + i; } glNamedFramebufferDrawBuffers(fbo, num_elements, bufs); fbos[textures] = fbo; glBindFramebuffer(GL_FRAMEBUFFER, fbo); } template void PersistentFBOSetWithDepth::render_to(GLuint depth_rb, const array &textures) { auto key = make_pair(depth_rb, textures); auto it = fbos.find(key); if (it != fbos.end()) { glBindFramebuffer(GL_FRAMEBUFFER, it->second); return; } GLuint fbo; glCreateFramebuffers(1, &fbo); GLenum bufs[num_elements]; glNamedFramebufferRenderbuffer(fbo, GL_DEPTH_ATTACHMENT, GL_RENDERBUFFER, depth_rb); for (size_t i = 0; i < num_elements; ++i) { glNamedFramebufferTexture(fbo, GL_COLOR_ATTACHMENT0 + i, textures[i], 0); bufs[i] = GL_COLOR_ATTACHMENT0 + i; } glNamedFramebufferDrawBuffers(fbo, num_elements, bufs); fbos[key] = fbo; glBindFramebuffer(GL_FRAMEBUFFER, fbo); } GrayscaleConversion::GrayscaleConversion() { gray_vs_obj = compile_shader(read_file("vs.vert", _binary_vs_vert_data, _binary_vs_vert_size), GL_VERTEX_SHADER); gray_fs_obj = compile_shader(read_file("gray.frag", _binary_gray_frag_data, _binary_gray_frag_size), GL_FRAGMENT_SHADER); gray_program = link_program(gray_vs_obj, gray_fs_obj); // Set up the VAO containing all the required position/texcoord data. glCreateVertexArrays(1, &gray_vao); glBindVertexArray(gray_vao); GLint position_attrib = glGetAttribLocation(gray_program, "position"); glEnableVertexArrayAttrib(gray_vao, position_attrib); glVertexAttribPointer(position_attrib, 2, GL_FLOAT, GL_FALSE, 0, BUFFER_OFFSET(0)); uniform_tex = glGetUniformLocation(gray_program, "tex"); } void GrayscaleConversion::exec(GLint tex, GLint gray_tex, int width, int height, int num_layers) { glUseProgram(gray_program); bind_sampler(gray_program, uniform_tex, 0, tex, nearest_sampler); glViewport(0, 0, width, height); fbos.render_to(gray_tex); glBindVertexArray(gray_vao); glDisable(GL_BLEND); glDrawArraysInstanced(GL_TRIANGLE_STRIP, 0, 4, num_layers); } Sobel::Sobel() { sobel_vs_obj = compile_shader(read_file("vs.vert", _binary_vs_vert_data, _binary_vs_vert_size), GL_VERTEX_SHADER); sobel_fs_obj = compile_shader(read_file("sobel.frag", _binary_sobel_frag_data, _binary_sobel_frag_size), GL_FRAGMENT_SHADER); sobel_program = link_program(sobel_vs_obj, sobel_fs_obj); uniform_tex = glGetUniformLocation(sobel_program, "tex"); } void Sobel::exec(GLint tex_view, GLint grad_tex, int level_width, int level_height, int num_layers) { glUseProgram(sobel_program); bind_sampler(sobel_program, uniform_tex, 0, tex_view, nearest_sampler); glViewport(0, 0, level_width, level_height); fbos.render_to(grad_tex); glDisable(GL_BLEND); glDrawArraysInstanced(GL_TRIANGLE_STRIP, 0, 4, num_layers); } MotionSearch::MotionSearch(const OperatingPoint &op) : op(op) { motion_vs_obj = compile_shader(read_file("motion_search.vert", _binary_motion_search_vert_data, _binary_motion_search_vert_size), GL_VERTEX_SHADER); motion_fs_obj = compile_shader(read_file("motion_search.frag", _binary_motion_search_frag_data, _binary_motion_search_frag_size), GL_FRAGMENT_SHADER); motion_search_program = link_program(motion_vs_obj, motion_fs_obj); uniform_inv_image_size = glGetUniformLocation(motion_search_program, "inv_image_size"); uniform_inv_prev_level_size = glGetUniformLocation(motion_search_program, "inv_prev_level_size"); uniform_out_flow_size = glGetUniformLocation(motion_search_program, "out_flow_size"); uniform_image_tex = glGetUniformLocation(motion_search_program, "image_tex"); uniform_grad_tex = glGetUniformLocation(motion_search_program, "grad_tex"); uniform_flow_tex = glGetUniformLocation(motion_search_program, "flow_tex"); uniform_patch_size = glGetUniformLocation(motion_search_program, "patch_size"); uniform_num_iterations = glGetUniformLocation(motion_search_program, "num_iterations"); } void MotionSearch::exec(GLuint tex_view, GLuint grad_tex, GLuint flow_tex, GLuint flow_out_tex, int level_width, int level_height, int prev_level_width, int prev_level_height, int width_patches, int height_patches, int num_layers) { glUseProgram(motion_search_program); bind_sampler(motion_search_program, uniform_image_tex, 0, tex_view, linear_sampler); bind_sampler(motion_search_program, uniform_grad_tex, 1, grad_tex, nearest_sampler); bind_sampler(motion_search_program, uniform_flow_tex, 2, flow_tex, linear_sampler); glProgramUniform2f(motion_search_program, uniform_inv_image_size, 1.0f / level_width, 1.0f / level_height); glProgramUniform2f(motion_search_program, uniform_inv_prev_level_size, 1.0f / prev_level_width, 1.0f / prev_level_height); glProgramUniform2f(motion_search_program, uniform_out_flow_size, width_patches, height_patches); glProgramUniform1ui(motion_search_program, uniform_patch_size, op.patch_size_pixels); glProgramUniform1ui(motion_search_program, uniform_num_iterations, op.search_iterations); glViewport(0, 0, width_patches, height_patches); fbos.render_to(flow_out_tex); glDrawArraysInstanced(GL_TRIANGLE_STRIP, 0, 4, num_layers); } Densify::Densify(const OperatingPoint &op) : op(op) { densify_vs_obj = compile_shader(read_file("densify.vert", _binary_densify_vert_data, _binary_densify_vert_size), GL_VERTEX_SHADER); densify_fs_obj = compile_shader(read_file("densify.frag", _binary_densify_frag_data, _binary_densify_frag_size), GL_FRAGMENT_SHADER); densify_program = link_program(densify_vs_obj, densify_fs_obj); uniform_patch_size = glGetUniformLocation(densify_program, "patch_size"); uniform_image_tex = glGetUniformLocation(densify_program, "image_tex"); uniform_flow_tex = glGetUniformLocation(densify_program, "flow_tex"); } void Densify::exec(GLuint tex_view, GLuint flow_tex, GLuint dense_flow_tex, int level_width, int level_height, int width_patches, int height_patches, int num_layers) { glUseProgram(densify_program); bind_sampler(densify_program, uniform_image_tex, 0, tex_view, linear_sampler); bind_sampler(densify_program, uniform_flow_tex, 1, flow_tex, nearest_sampler); glProgramUniform2f(densify_program, uniform_patch_size, float(op.patch_size_pixels) / level_width, float(op.patch_size_pixels) / level_height); glViewport(0, 0, level_width, level_height); glEnable(GL_BLEND); glBlendFunc(GL_ONE, GL_ONE); fbos.render_to(dense_flow_tex); glClearColor(0.0f, 0.0f, 0.0f, 0.0f); glClear(GL_COLOR_BUFFER_BIT); glDrawArraysInstanced(GL_TRIANGLE_STRIP, 0, 4, width_patches * height_patches * num_layers); } Prewarp::Prewarp() { prewarp_vs_obj = compile_shader(read_file("vs.vert", _binary_vs_vert_data, _binary_vs_vert_size), GL_VERTEX_SHADER); prewarp_fs_obj = compile_shader(read_file("prewarp.frag", _binary_prewarp_frag_data, _binary_prewarp_frag_size), GL_FRAGMENT_SHADER); prewarp_program = link_program(prewarp_vs_obj, prewarp_fs_obj); uniform_image_tex = glGetUniformLocation(prewarp_program, "image_tex"); uniform_flow_tex = glGetUniformLocation(prewarp_program, "flow_tex"); } void Prewarp::exec(GLuint tex_view, GLuint flow_tex, GLuint I_tex, GLuint I_t_tex, GLuint normalized_flow_tex, int level_width, int level_height, int num_layers) { glUseProgram(prewarp_program); bind_sampler(prewarp_program, uniform_image_tex, 0, tex_view, linear_sampler); bind_sampler(prewarp_program, uniform_flow_tex, 1, flow_tex, nearest_sampler); glViewport(0, 0, level_width, level_height); glDisable(GL_BLEND); fbos.render_to(I_tex, I_t_tex, normalized_flow_tex); glDrawArraysInstanced(GL_TRIANGLE_STRIP, 0, 4, num_layers); } Derivatives::Derivatives() { derivatives_vs_obj = compile_shader(read_file("vs.vert", _binary_vs_vert_data, _binary_vs_vert_size), GL_VERTEX_SHADER); derivatives_fs_obj = compile_shader(read_file("derivatives.frag", _binary_derivatives_frag_data, _binary_derivatives_frag_size), GL_FRAGMENT_SHADER); derivatives_program = link_program(derivatives_vs_obj, derivatives_fs_obj); uniform_tex = glGetUniformLocation(derivatives_program, "tex"); } void Derivatives::exec(GLuint input_tex, GLuint I_x_y_tex, GLuint beta_0_tex, int level_width, int level_height, int num_layers) { glUseProgram(derivatives_program); bind_sampler(derivatives_program, uniform_tex, 0, input_tex, nearest_sampler); glViewport(0, 0, level_width, level_height); glDisable(GL_BLEND); fbos.render_to(I_x_y_tex, beta_0_tex); glDrawArraysInstanced(GL_TRIANGLE_STRIP, 0, 4, num_layers); } ComputeDiffusivity::ComputeDiffusivity() { diffusivity_vs_obj = compile_shader(read_file("vs.vert", _binary_vs_vert_data, _binary_vs_vert_size), GL_VERTEX_SHADER); diffusivity_fs_obj = compile_shader(read_file("diffusivity.frag", _binary_diffusivity_frag_data, _binary_diffusivity_frag_size), GL_FRAGMENT_SHADER); diffusivity_program = link_program(diffusivity_vs_obj, diffusivity_fs_obj); uniform_flow_tex = glGetUniformLocation(diffusivity_program, "flow_tex"); uniform_diff_flow_tex = glGetUniformLocation(diffusivity_program, "diff_flow_tex"); uniform_alpha = glGetUniformLocation(diffusivity_program, "alpha"); uniform_zero_diff_flow = glGetUniformLocation(diffusivity_program, "zero_diff_flow"); } void ComputeDiffusivity::exec(GLuint flow_tex, GLuint diff_flow_tex, GLuint diffusivity_tex, int level_width, int level_height, bool zero_diff_flow, int num_layers) { glUseProgram(diffusivity_program); bind_sampler(diffusivity_program, uniform_flow_tex, 0, flow_tex, nearest_sampler); bind_sampler(diffusivity_program, uniform_diff_flow_tex, 1, diff_flow_tex, nearest_sampler); glProgramUniform1f(diffusivity_program, uniform_alpha, vr_alpha); glProgramUniform1i(diffusivity_program, uniform_zero_diff_flow, zero_diff_flow); glViewport(0, 0, level_width, level_height); glDisable(GL_BLEND); fbos.render_to(diffusivity_tex); glDrawArraysInstanced(GL_TRIANGLE_STRIP, 0, 4, num_layers); } SetupEquations::SetupEquations() { equations_vs_obj = compile_shader(read_file("equations.vert", _binary_equations_vert_data, _binary_equations_vert_size), GL_VERTEX_SHADER); equations_fs_obj = compile_shader(read_file("equations.frag", _binary_equations_frag_data, _binary_equations_frag_size), GL_FRAGMENT_SHADER); equations_program = link_program(equations_vs_obj, equations_fs_obj); uniform_I_x_y_tex = glGetUniformLocation(equations_program, "I_x_y_tex"); uniform_I_t_tex = glGetUniformLocation(equations_program, "I_t_tex"); uniform_diff_flow_tex = glGetUniformLocation(equations_program, "diff_flow_tex"); uniform_base_flow_tex = glGetUniformLocation(equations_program, "base_flow_tex"); uniform_beta_0_tex = glGetUniformLocation(equations_program, "beta_0_tex"); uniform_diffusivity_tex = glGetUniformLocation(equations_program, "diffusivity_tex"); uniform_gamma = glGetUniformLocation(equations_program, "gamma"); uniform_delta = glGetUniformLocation(equations_program, "delta"); uniform_zero_diff_flow = glGetUniformLocation(equations_program, "zero_diff_flow"); } void SetupEquations::exec(GLuint I_x_y_tex, GLuint I_t_tex, GLuint diff_flow_tex, GLuint base_flow_tex, GLuint beta_0_tex, GLuint diffusivity_tex, GLuint equation_red_tex, GLuint equation_black_tex, int level_width, int level_height, bool zero_diff_flow, int num_layers) { glUseProgram(equations_program); bind_sampler(equations_program, uniform_I_x_y_tex, 0, I_x_y_tex, nearest_sampler); bind_sampler(equations_program, uniform_I_t_tex, 1, I_t_tex, nearest_sampler); bind_sampler(equations_program, uniform_diff_flow_tex, 2, diff_flow_tex, nearest_sampler); bind_sampler(equations_program, uniform_base_flow_tex, 3, base_flow_tex, nearest_sampler); bind_sampler(equations_program, uniform_beta_0_tex, 4, beta_0_tex, nearest_sampler); bind_sampler(equations_program, uniform_diffusivity_tex, 5, diffusivity_tex, zero_border_sampler); glProgramUniform1f(equations_program, uniform_delta, vr_delta); glProgramUniform1f(equations_program, uniform_gamma, vr_gamma); glProgramUniform1i(equations_program, uniform_zero_diff_flow, zero_diff_flow); glViewport(0, 0, (level_width + 1) / 2, level_height); glDisable(GL_BLEND); fbos.render_to(equation_red_tex, equation_black_tex); glDrawArraysInstanced(GL_TRIANGLE_STRIP, 0, 4, num_layers); } SOR::SOR() { sor_vs_obj = compile_shader(read_file("sor.vert", _binary_sor_vert_data, _binary_sor_vert_size), GL_VERTEX_SHADER); sor_fs_obj = compile_shader(read_file("sor.frag", _binary_sor_frag_data, _binary_sor_frag_size), GL_FRAGMENT_SHADER); sor_program = link_program(sor_vs_obj, sor_fs_obj); uniform_diff_flow_tex = glGetUniformLocation(sor_program, "diff_flow_tex"); uniform_equation_red_tex = glGetUniformLocation(sor_program, "equation_red_tex"); uniform_equation_black_tex = glGetUniformLocation(sor_program, "equation_black_tex"); uniform_diffusivity_tex = glGetUniformLocation(sor_program, "diffusivity_tex"); uniform_phase = glGetUniformLocation(sor_program, "phase"); uniform_num_nonzero_phases = glGetUniformLocation(sor_program, "num_nonzero_phases"); } void SOR::exec(GLuint diff_flow_tex, GLuint equation_red_tex, GLuint equation_black_tex, GLuint diffusivity_tex, int level_width, int level_height, int num_iterations, bool zero_diff_flow, int num_layers, ScopedTimer *sor_timer) { glUseProgram(sor_program); bind_sampler(sor_program, uniform_diff_flow_tex, 0, diff_flow_tex, nearest_sampler); bind_sampler(sor_program, uniform_diffusivity_tex, 1, diffusivity_tex, zero_border_sampler); bind_sampler(sor_program, uniform_equation_red_tex, 2, equation_red_tex, nearest_sampler); bind_sampler(sor_program, uniform_equation_black_tex, 3, equation_black_tex, nearest_sampler); if (!zero_diff_flow) { glProgramUniform1i(sor_program, uniform_num_nonzero_phases, 2); } // NOTE: We bind to the texture we are rendering from, but we never write any value // that we read in the same shader pass (we call discard for red values when we compute // black, and vice versa), and we have barriers between the passes, so we're fine // as per the spec. glViewport(0, 0, level_width, level_height); glDisable(GL_BLEND); fbos.render_to(diff_flow_tex); for (int i = 0; i < num_iterations; ++i) { { ScopedTimer timer("Red pass", sor_timer); if (zero_diff_flow && i == 0) { glProgramUniform1i(sor_program, uniform_num_nonzero_phases, 0); } glProgramUniform1i(sor_program, uniform_phase, 0); glDrawArraysInstanced(GL_TRIANGLE_STRIP, 0, 4, num_layers); glTextureBarrier(); } { ScopedTimer timer("Black pass", sor_timer); if (zero_diff_flow && i == 0) { glProgramUniform1i(sor_program, uniform_num_nonzero_phases, 1); } glProgramUniform1i(sor_program, uniform_phase, 1); glDrawArraysInstanced(GL_TRIANGLE_STRIP, 0, 4, num_layers); if (zero_diff_flow && i == 0) { glProgramUniform1i(sor_program, uniform_num_nonzero_phases, 2); } if (i != num_iterations - 1) { glTextureBarrier(); } } } } AddBaseFlow::AddBaseFlow() { add_flow_vs_obj = compile_shader(read_file("vs.vert", _binary_vs_vert_data, _binary_vs_vert_size), GL_VERTEX_SHADER); add_flow_fs_obj = compile_shader(read_file("add_base_flow.frag", _binary_add_base_flow_frag_data, _binary_add_base_flow_frag_size), GL_FRAGMENT_SHADER); add_flow_program = link_program(add_flow_vs_obj, add_flow_fs_obj); uniform_diff_flow_tex = glGetUniformLocation(add_flow_program, "diff_flow_tex"); } void AddBaseFlow::exec(GLuint base_flow_tex, GLuint diff_flow_tex, int level_width, int level_height, int num_layers) { glUseProgram(add_flow_program); bind_sampler(add_flow_program, uniform_diff_flow_tex, 0, diff_flow_tex, nearest_sampler); glViewport(0, 0, level_width, level_height); glEnable(GL_BLEND); glBlendFunc(GL_ONE, GL_ONE); fbos.render_to(base_flow_tex); glDrawArraysInstanced(GL_TRIANGLE_STRIP, 0, 4, num_layers); } ResizeFlow::ResizeFlow() { resize_flow_vs_obj = compile_shader(read_file("vs.vert", _binary_vs_vert_data, _binary_vs_vert_size), GL_VERTEX_SHADER); resize_flow_fs_obj = compile_shader(read_file("resize_flow.frag", _binary_resize_flow_frag_data, _binary_resize_flow_frag_size), GL_FRAGMENT_SHADER); resize_flow_program = link_program(resize_flow_vs_obj, resize_flow_fs_obj); uniform_flow_tex = glGetUniformLocation(resize_flow_program, "flow_tex"); uniform_scale_factor = glGetUniformLocation(resize_flow_program, "scale_factor"); } void ResizeFlow::exec(GLuint flow_tex, GLuint out_tex, int input_width, int input_height, int output_width, int output_height, int num_layers) { glUseProgram(resize_flow_program); bind_sampler(resize_flow_program, uniform_flow_tex, 0, flow_tex, nearest_sampler); glProgramUniform2f(resize_flow_program, uniform_scale_factor, float(output_width) / input_width, float(output_height) / input_height); glViewport(0, 0, output_width, output_height); glDisable(GL_BLEND); fbos.render_to(out_tex); glDrawArraysInstanced(GL_TRIANGLE_STRIP, 0, 4, num_layers); } DISComputeFlow::DISComputeFlow(int width, int height, const OperatingPoint &op) : width(width), height(height), op(op), motion_search(op), densify(op) { // Make some samplers. glCreateSamplers(1, &nearest_sampler); glSamplerParameteri(nearest_sampler, GL_TEXTURE_MIN_FILTER, GL_NEAREST); glSamplerParameteri(nearest_sampler, GL_TEXTURE_MAG_FILTER, GL_NEAREST); glSamplerParameteri(nearest_sampler, GL_TEXTURE_WRAP_S, GL_CLAMP_TO_EDGE); glSamplerParameteri(nearest_sampler, GL_TEXTURE_WRAP_T, GL_CLAMP_TO_EDGE); glCreateSamplers(1, &linear_sampler); glSamplerParameteri(linear_sampler, GL_TEXTURE_MIN_FILTER, GL_LINEAR); glSamplerParameteri(linear_sampler, GL_TEXTURE_MAG_FILTER, GL_LINEAR); glSamplerParameteri(linear_sampler, GL_TEXTURE_WRAP_S, GL_CLAMP_TO_EDGE); glSamplerParameteri(linear_sampler, GL_TEXTURE_WRAP_T, GL_CLAMP_TO_EDGE); // The smoothness is sampled so that once we get to a smoothness involving // a value outside the border, the diffusivity between the two becomes zero. // Similarly, gradients are zero outside the border, since the edge is taken // to be constant. glCreateSamplers(1, &zero_border_sampler); glSamplerParameteri(zero_border_sampler, GL_TEXTURE_MIN_FILTER, GL_LINEAR); glSamplerParameteri(zero_border_sampler, GL_TEXTURE_MAG_FILTER, GL_LINEAR); glSamplerParameteri(zero_border_sampler, GL_TEXTURE_WRAP_S, GL_CLAMP_TO_BORDER); glSamplerParameteri(zero_border_sampler, GL_TEXTURE_WRAP_T, GL_CLAMP_TO_BORDER); float zero[] = { 0.0f, 0.0f, 0.0f, 0.0f }; // Note that zero alpha means we can also see whether we sampled outside the border or not. glSamplerParameterfv(zero_border_sampler, GL_TEXTURE_BORDER_COLOR, zero); // Initial flow is zero, 1x1. glCreateTextures(GL_TEXTURE_2D_ARRAY, 1, &initial_flow_tex); glTextureStorage3D(initial_flow_tex, 1, GL_RG16F, 1, 1, 1); glClearTexImage(initial_flow_tex, 0, GL_RG, GL_FLOAT, nullptr); // Set up the vertex data that will be shared between all passes. float vertices[] = { 0.0f, 1.0f, 0.0f, 0.0f, 1.0f, 1.0f, 1.0f, 0.0f, }; glCreateBuffers(1, &vertex_vbo); glNamedBufferData(vertex_vbo, sizeof(vertices), vertices, GL_STATIC_DRAW); glCreateVertexArrays(1, &vao); glBindVertexArray(vao); glBindBuffer(GL_ARRAY_BUFFER, vertex_vbo); GLint position_attrib = 0; // Hard-coded in every vertex shader. glEnableVertexArrayAttrib(vao, position_attrib); glVertexAttribPointer(position_attrib, 2, GL_FLOAT, GL_FALSE, 0, BUFFER_OFFSET(0)); } GLuint DISComputeFlow::exec(GLuint tex, FlowDirection flow_direction, ResizeStrategy resize_strategy) { int num_layers = (flow_direction == FORWARD_AND_BACKWARD) ? 2 : 1; int prev_level_width = 1, prev_level_height = 1; GLuint prev_level_flow_tex = initial_flow_tex; GPUTimers timers; glBindVertexArray(vao); glDisable(GL_DITHER); ScopedTimer total_timer("Compute flow", &timers); for (int level = op.coarsest_level; level >= int(op.finest_level); --level) { char timer_name[256]; snprintf(timer_name, sizeof(timer_name), "Level %d (%d x %d)", level, width >> level, height >> level); ScopedTimer level_timer(timer_name, &total_timer); int level_width = width >> level; int level_height = height >> level; float patch_spacing_pixels = op.patch_size_pixels * (1.0f - op.patch_overlap_ratio); // Make sure we have patches at least every Nth pixel, e.g. for width=9 // and patch_spacing=3 (the default), we put out patch centers in // x=0, x=3, x=6, x=9, which is four patches. The fragment shader will // lock all the centers to integer coordinates if needed. int width_patches = 1 + ceil(level_width / patch_spacing_pixels); int height_patches = 1 + ceil(level_height / patch_spacing_pixels); // Make sure we always read from the correct level; the chosen // mipmapping could otherwise be rather unpredictable, especially // during motion search. GLuint tex_view; glGenTextures(1, &tex_view); glTextureView(tex_view, GL_TEXTURE_2D_ARRAY, tex, GL_R8, level, 1, 0, 2); // Create a new texture to hold the gradients. GLuint grad_tex = pool.get_texture(GL_R32UI, level_width, level_height, num_layers); // Find the derivative. { ScopedTimer timer("Sobel", &level_timer); sobel.exec(tex_view, grad_tex, level_width, level_height, num_layers); } // Motion search to find the initial flow. We use the flow from the previous // level (sampled bilinearly; no fancy tricks) as a guide, then search from there. // Create an output flow texture. GLuint flow_out_tex = pool.get_texture(GL_RGB16F, width_patches, height_patches, num_layers); // And draw. { ScopedTimer timer("Motion search", &level_timer); motion_search.exec(tex_view, grad_tex, prev_level_flow_tex, flow_out_tex, level_width, level_height, prev_level_width, prev_level_height, width_patches, height_patches, num_layers); } pool.release_texture(grad_tex); // Densification. // Set up an output texture (cleared in Densify). GLuint dense_flow_tex = pool.get_texture(GL_RGB16F, level_width, level_height, num_layers); // And draw. { ScopedTimer timer("Densification", &level_timer); densify.exec(tex_view, flow_out_tex, dense_flow_tex, level_width, level_height, width_patches, height_patches, num_layers); } pool.release_texture(flow_out_tex); // Everything below here in the loop belongs to variational refinement. ScopedTimer varref_timer("Variational refinement", &level_timer); // Prewarping; create I and I_t, and a normalized base flow (so we don't // have to normalize it over and over again, and also save some bandwidth). // // During the entire rest of the variational refinement, flow will be measured // in pixels, not 0..1 normalized OpenGL texture coordinates. // This is because variational refinement depends so heavily on derivatives, // which are measured in intensity levels per pixel. GLuint I_tex = pool.get_texture(GL_R16F, level_width, level_height, num_layers); GLuint I_t_tex = pool.get_texture(GL_R16F, level_width, level_height, num_layers); GLuint base_flow_tex = pool.get_texture(GL_RG16F, level_width, level_height, num_layers); { ScopedTimer timer("Prewarping", &varref_timer); prewarp.exec(tex_view, dense_flow_tex, I_tex, I_t_tex, base_flow_tex, level_width, level_height, num_layers); } pool.release_texture(dense_flow_tex); glDeleteTextures(1, &tex_view); // TODO: If we don't have variational refinement, we don't need I and I_t, // so computing them is a waste. if (op.variational_refinement) { // Calculate I_x and I_y. We're only calculating first derivatives; // the others will be taken on-the-fly in order to sample from fewer // textures overall, since sampling from the L1 cache is cheap. // (TODO: Verify that this is indeed faster than making separate // double-derivative textures.) GLuint I_x_y_tex = pool.get_texture(GL_RG16F, level_width, level_height, num_layers); GLuint beta_0_tex = pool.get_texture(GL_R16F, level_width, level_height, num_layers); { ScopedTimer timer("First derivatives", &varref_timer); derivatives.exec(I_tex, I_x_y_tex, beta_0_tex, level_width, level_height, num_layers); } pool.release_texture(I_tex); // We need somewhere to store du and dv (the flow increment, relative // to the non-refined base flow u0 and v0). It's initially garbage, // but not read until we've written something sane to it. GLuint diff_flow_tex = pool.get_texture(GL_RG16F, level_width, level_height, num_layers); // And for diffusivity. GLuint diffusivity_tex = pool.get_texture(GL_R16F, level_width, level_height, num_layers); // And finally for the equation set. See SetupEquations for // the storage format. GLuint equation_red_tex = pool.get_texture(GL_RGBA32UI, (level_width + 1) / 2, level_height, num_layers); GLuint equation_black_tex = pool.get_texture(GL_RGBA32UI, (level_width + 1) / 2, level_height, num_layers); for (int outer_idx = 0; outer_idx < level + 1; ++outer_idx) { // Calculate the diffusivity term for each pixel. { ScopedTimer timer("Compute diffusivity", &varref_timer); compute_diffusivity.exec(base_flow_tex, diff_flow_tex, diffusivity_tex, level_width, level_height, outer_idx == 0, num_layers); } // Set up the 2x2 equation system for each pixel. { ScopedTimer timer("Set up equations", &varref_timer); setup_equations.exec(I_x_y_tex, I_t_tex, diff_flow_tex, base_flow_tex, beta_0_tex, diffusivity_tex, equation_red_tex, equation_black_tex, level_width, level_height, outer_idx == 0, num_layers); } // Run a few SOR iterations. Note that these are to/from the same texture. { ScopedTimer timer("SOR", &varref_timer); sor.exec(diff_flow_tex, equation_red_tex, equation_black_tex, diffusivity_tex, level_width, level_height, 5, outer_idx == 0, num_layers, &timer); } } pool.release_texture(I_t_tex); pool.release_texture(I_x_y_tex); pool.release_texture(beta_0_tex); pool.release_texture(diffusivity_tex); pool.release_texture(equation_red_tex); pool.release_texture(equation_black_tex); // Add the differential flow found by the variational refinement to the base flow, // giving the final flow estimate for this level. // The output is in base_flow_tex; we don't need to make a new texture. { ScopedTimer timer("Add differential flow", &varref_timer); add_base_flow.exec(base_flow_tex, diff_flow_tex, level_width, level_height, num_layers); } pool.release_texture(diff_flow_tex); } if (prev_level_flow_tex != initial_flow_tex) { pool.release_texture(prev_level_flow_tex); } prev_level_flow_tex = base_flow_tex; prev_level_width = level_width; prev_level_height = level_height; } total_timer.end(); if (!in_warmup) { timers.print(); } // Scale up the flow to the final size (if needed). if (op.finest_level == 0 || resize_strategy == DO_NOT_RESIZE_FLOW) { return prev_level_flow_tex; } else { GLuint final_tex = pool.get_texture(GL_RG16F, width, height, num_layers); resize_flow.exec(prev_level_flow_tex, final_tex, prev_level_width, prev_level_height, width, height, num_layers); pool.release_texture(prev_level_flow_tex); return final_tex; } } Splat::Splat(const OperatingPoint &op) : op(op) { splat_vs_obj = compile_shader(read_file("splat.vert", _binary_splat_vert_data, _binary_splat_vert_size), GL_VERTEX_SHADER); splat_fs_obj = compile_shader(read_file("splat.frag", _binary_splat_frag_data, _binary_splat_frag_size), GL_FRAGMENT_SHADER); splat_program = link_program(splat_vs_obj, splat_fs_obj); uniform_splat_size = glGetUniformLocation(splat_program, "splat_size"); uniform_alpha = glGetUniformLocation(splat_program, "alpha"); uniform_gray_tex = glGetUniformLocation(splat_program, "gray_tex"); uniform_flow_tex = glGetUniformLocation(splat_program, "flow_tex"); uniform_inv_flow_size = glGetUniformLocation(splat_program, "inv_flow_size"); } void Splat::exec(GLuint gray_tex, GLuint bidirectional_flow_tex, GLuint flow_tex, GLuint depth_rb, int width, int height, float alpha) { glUseProgram(splat_program); bind_sampler(splat_program, uniform_gray_tex, 0, gray_tex, linear_sampler); bind_sampler(splat_program, uniform_flow_tex, 1, bidirectional_flow_tex, nearest_sampler); glProgramUniform2f(splat_program, uniform_splat_size, op.splat_size / width, op.splat_size / height); glProgramUniform1f(splat_program, uniform_alpha, alpha); glProgramUniform2f(splat_program, uniform_inv_flow_size, 1.0f / width, 1.0f / height); glViewport(0, 0, width, height); glDisable(GL_BLEND); glEnable(GL_DEPTH_TEST); glDepthMask(GL_TRUE); glDepthFunc(GL_LESS); // We store the difference between I_0 and I_1, where less difference is good. (Default 1.0 is effectively +inf, which always loses.) fbos.render_to(depth_rb, flow_tex); // Evidently NVIDIA doesn't use fast clears for glClearTexImage, so clear now that // we've got it bound. glClearColor(1000.0f, 1000.0f, 0.0f, 1.0f); // Invalid flow. glClearDepth(1.0f); // Effectively infinity. glClear(GL_COLOR_BUFFER_BIT | GL_DEPTH_BUFFER_BIT); glDrawArraysInstanced(GL_TRIANGLE_STRIP, 0, 4, width * height * 2); glDisable(GL_DEPTH_TEST); } HoleFill::HoleFill() { fill_vs_obj = compile_shader(read_file("hole_fill.vert", _binary_hole_fill_vert_data, _binary_hole_fill_vert_size), GL_VERTEX_SHADER); fill_fs_obj = compile_shader(read_file("hole_fill.frag", _binary_hole_fill_frag_data, _binary_hole_fill_frag_size), GL_FRAGMENT_SHADER); fill_program = link_program(fill_vs_obj, fill_fs_obj); uniform_tex = glGetUniformLocation(fill_program, "tex"); uniform_z = glGetUniformLocation(fill_program, "z"); uniform_sample_offset = glGetUniformLocation(fill_program, "sample_offset"); } void HoleFill::exec(GLuint flow_tex, GLuint depth_rb, GLuint temp_tex[3], int width, int height) { glUseProgram(fill_program); bind_sampler(fill_program, uniform_tex, 0, flow_tex, nearest_sampler); glProgramUniform1f(fill_program, uniform_z, 1.0f - 1.0f / 1024.0f); glViewport(0, 0, width, height); glDisable(GL_BLEND); glEnable(GL_DEPTH_TEST); glDepthFunc(GL_LESS); // Only update the values > 0.999f (ie., only invalid pixels). fbos.render_to(depth_rb, flow_tex); // NOTE: Reading and writing to the same texture. // Fill holes from the left, by shifting 1, 2, 4, 8, etc. pixels to the right. for (int offs = 1; offs < width; offs *= 2) { glProgramUniform2f(fill_program, uniform_sample_offset, -offs / float(width), 0.0f); glDrawArrays(GL_TRIANGLE_STRIP, 0, 4); glTextureBarrier(); } glCopyImageSubData(flow_tex, GL_TEXTURE_2D, 0, 0, 0, 0, temp_tex[0], GL_TEXTURE_2D, 0, 0, 0, 0, width, height, 1); // Similar to the right; adjust Z a bit down, so that we re-fill the pixels that // were overwritten in the last algorithm. glProgramUniform1f(fill_program, uniform_z, 1.0f - 2.0f / 1024.0f); for (int offs = 1; offs < width; offs *= 2) { glProgramUniform2f(fill_program, uniform_sample_offset, offs / float(width), 0.0f); glDrawArrays(GL_TRIANGLE_STRIP, 0, 4); glTextureBarrier(); } glCopyImageSubData(flow_tex, GL_TEXTURE_2D, 0, 0, 0, 0, temp_tex[1], GL_TEXTURE_2D, 0, 0, 0, 0, width, height, 1); // Up. glProgramUniform1f(fill_program, uniform_z, 1.0f - 3.0f / 1024.0f); for (int offs = 1; offs < height; offs *= 2) { glProgramUniform2f(fill_program, uniform_sample_offset, 0.0f, -offs / float(height)); glDrawArrays(GL_TRIANGLE_STRIP, 0, 4); glTextureBarrier(); } glCopyImageSubData(flow_tex, GL_TEXTURE_2D, 0, 0, 0, 0, temp_tex[2], GL_TEXTURE_2D, 0, 0, 0, 0, width, height, 1); // Down. glProgramUniform1f(fill_program, uniform_z, 1.0f - 4.0f / 1024.0f); for (int offs = 1; offs < height; offs *= 2) { glProgramUniform2f(fill_program, uniform_sample_offset, 0.0f, offs / float(height)); glDrawArrays(GL_TRIANGLE_STRIP, 0, 4); glTextureBarrier(); } glDisable(GL_DEPTH_TEST); } HoleBlend::HoleBlend() { blend_vs_obj = compile_shader(read_file("hole_fill.vert", _binary_hole_fill_vert_data, _binary_hole_fill_vert_size), GL_VERTEX_SHADER); // Reuse the vertex shader from the fill. blend_fs_obj = compile_shader(read_file("hole_blend.frag", _binary_hole_blend_frag_data, _binary_hole_blend_frag_size), GL_FRAGMENT_SHADER); blend_program = link_program(blend_vs_obj, blend_fs_obj); uniform_left_tex = glGetUniformLocation(blend_program, "left_tex"); uniform_right_tex = glGetUniformLocation(blend_program, "right_tex"); uniform_up_tex = glGetUniformLocation(blend_program, "up_tex"); uniform_down_tex = glGetUniformLocation(blend_program, "down_tex"); uniform_z = glGetUniformLocation(blend_program, "z"); uniform_sample_offset = glGetUniformLocation(blend_program, "sample_offset"); } void HoleBlend::exec(GLuint flow_tex, GLuint depth_rb, GLuint temp_tex[3], int width, int height) { glUseProgram(blend_program); bind_sampler(blend_program, uniform_left_tex, 0, temp_tex[0], nearest_sampler); bind_sampler(blend_program, uniform_right_tex, 1, temp_tex[1], nearest_sampler); bind_sampler(blend_program, uniform_up_tex, 2, temp_tex[2], nearest_sampler); bind_sampler(blend_program, uniform_down_tex, 3, flow_tex, nearest_sampler); glProgramUniform1f(blend_program, uniform_z, 1.0f - 4.0f / 1024.0f); glProgramUniform2f(blend_program, uniform_sample_offset, 0.0f, 0.0f); glViewport(0, 0, width, height); glDisable(GL_BLEND); glEnable(GL_DEPTH_TEST); glDepthFunc(GL_LEQUAL); // Skip over all of the pixels that were never holes to begin with. fbos.render_to(depth_rb, flow_tex); // NOTE: Reading and writing to the same texture. glDrawArrays(GL_TRIANGLE_STRIP, 0, 4); glDisable(GL_DEPTH_TEST); } Blend::Blend(bool split_ycbcr_output) : split_ycbcr_output(split_ycbcr_output) { string frag_shader = read_file("blend.frag", _binary_blend_frag_data, _binary_blend_frag_size); if (split_ycbcr_output) { // Insert after the first #version line. size_t offset = frag_shader.find('\n'); assert(offset != string::npos); frag_shader = frag_shader.substr(0, offset + 1) + "#define SPLIT_YCBCR_OUTPUT 1\n" + frag_shader.substr(offset + 1); } blend_vs_obj = compile_shader(read_file("vs.vert", _binary_vs_vert_data, _binary_vs_vert_size), GL_VERTEX_SHADER); blend_fs_obj = compile_shader(frag_shader, GL_FRAGMENT_SHADER); blend_program = link_program(blend_vs_obj, blend_fs_obj); uniform_image_tex = glGetUniformLocation(blend_program, "image_tex"); uniform_flow_tex = glGetUniformLocation(blend_program, "flow_tex"); uniform_alpha = glGetUniformLocation(blend_program, "alpha"); uniform_flow_consistency_tolerance = glGetUniformLocation(blend_program, "flow_consistency_tolerance"); } void Blend::exec(GLuint image_tex, GLuint flow_tex, GLuint output_tex, GLuint output2_tex, int level_width, int level_height, float alpha) { glUseProgram(blend_program); bind_sampler(blend_program, uniform_image_tex, 0, image_tex, linear_sampler); bind_sampler(blend_program, uniform_flow_tex, 1, flow_tex, linear_sampler); // May be upsampled. glProgramUniform1f(blend_program, uniform_alpha, alpha); glViewport(0, 0, level_width, level_height); if (split_ycbcr_output) { fbos_split.render_to(output_tex, output2_tex); } else { fbos.render_to(output_tex); } glDisable(GL_BLEND); // A bit ironic, perhaps. glDrawArrays(GL_TRIANGLE_STRIP, 0, 4); } Interpolate::Interpolate(const OperatingPoint &op, bool split_ycbcr_output) : flow_level(op.finest_level), split_ycbcr_output(split_ycbcr_output), splat(op), blend(split_ycbcr_output) { // Set up the vertex data that will be shared between all passes. float vertices[] = { 0.0f, 1.0f, 0.0f, 0.0f, 1.0f, 1.0f, 1.0f, 0.0f, }; glCreateBuffers(1, &vertex_vbo); glNamedBufferData(vertex_vbo, sizeof(vertices), vertices, GL_STATIC_DRAW); glCreateVertexArrays(1, &vao); glBindVertexArray(vao); glBindBuffer(GL_ARRAY_BUFFER, vertex_vbo); GLint position_attrib = 0; // Hard-coded in every vertex shader. glEnableVertexArrayAttrib(vao, position_attrib); glVertexAttribPointer(position_attrib, 2, GL_FLOAT, GL_FALSE, 0, BUFFER_OFFSET(0)); } pair Interpolate::exec(GLuint image_tex, GLuint gray_tex, GLuint bidirectional_flow_tex, GLuint width, GLuint height, float alpha) { GPUTimers timers; ScopedTimer total_timer("Interpolate", &timers); glBindVertexArray(vao); glDisable(GL_DITHER); // Pick out the right level to test splatting results on. GLuint tex_view; glGenTextures(1, &tex_view); glTextureView(tex_view, GL_TEXTURE_2D_ARRAY, gray_tex, GL_R8, flow_level, 1, 0, 2); int flow_width = width >> flow_level; int flow_height = height >> flow_level; GLuint flow_tex = pool.get_texture(GL_RG16F, flow_width, flow_height); GLuint depth_rb = pool.get_renderbuffer(GL_DEPTH_COMPONENT16, flow_width, flow_height); // Used for ranking flows. { ScopedTimer timer("Splat", &total_timer); splat.exec(tex_view, bidirectional_flow_tex, flow_tex, depth_rb, flow_width, flow_height, alpha); } glDeleteTextures(1, &tex_view); GLuint temp_tex[3]; temp_tex[0] = pool.get_texture(GL_RG16F, flow_width, flow_height); temp_tex[1] = pool.get_texture(GL_RG16F, flow_width, flow_height); temp_tex[2] = pool.get_texture(GL_RG16F, flow_width, flow_height); { ScopedTimer timer("Fill holes", &total_timer); hole_fill.exec(flow_tex, depth_rb, temp_tex, flow_width, flow_height); hole_blend.exec(flow_tex, depth_rb, temp_tex, flow_width, flow_height); } pool.release_texture(temp_tex[0]); pool.release_texture(temp_tex[1]); pool.release_texture(temp_tex[2]); pool.release_renderbuffer(depth_rb); GLuint output_tex, output2_tex = 0; if (split_ycbcr_output) { output_tex = pool.get_texture(GL_R8, width, height); output2_tex = pool.get_texture(GL_RG8, width, height); { ScopedTimer timer("Blend", &total_timer); blend.exec(image_tex, flow_tex, output_tex, output2_tex, width, height, alpha); } } else { output_tex = pool.get_texture(GL_RGBA8, width, height); { ScopedTimer timer("Blend", &total_timer); blend.exec(image_tex, flow_tex, output_tex, 0, width, height, alpha); } } pool.release_texture(flow_tex); total_timer.end(); if (!in_warmup) { timers.print(); } return make_pair(output_tex, output2_tex); } GLuint TexturePool::get_texture(GLenum format, GLuint width, GLuint height, GLuint num_layers) { { lock_guard lock(mu); for (Texture &tex : textures) { if (!tex.in_use && !tex.is_renderbuffer && tex.format == format && tex.width == width && tex.height == height && tex.num_layers == num_layers) { tex.in_use = true; return tex.tex_num; } } } Texture tex; if (num_layers == 0) { glCreateTextures(GL_TEXTURE_2D, 1, &tex.tex_num); glTextureStorage2D(tex.tex_num, 1, format, width, height); } else { glCreateTextures(GL_TEXTURE_2D_ARRAY, 1, &tex.tex_num); glTextureStorage3D(tex.tex_num, 1, format, width, height, num_layers); } tex.format = format; tex.width = width; tex.height = height; tex.num_layers = num_layers; tex.in_use = true; tex.is_renderbuffer = false; { lock_guard lock(mu); textures.push_back(tex); } return tex.tex_num; } GLuint TexturePool::get_renderbuffer(GLenum format, GLuint width, GLuint height) { { lock_guard lock(mu); for (Texture &tex : textures) { if (!tex.in_use && tex.is_renderbuffer && tex.format == format && tex.width == width && tex.height == height) { tex.in_use = true; return tex.tex_num; } } } Texture tex; glCreateRenderbuffers(1, &tex.tex_num); glNamedRenderbufferStorage(tex.tex_num, format, width, height); tex.format = format; tex.width = width; tex.height = height; tex.in_use = true; tex.is_renderbuffer = true; { lock_guard lock(mu); textures.push_back(tex); } return tex.tex_num; } void TexturePool::release_texture(GLuint tex_num) { lock_guard lock(mu); for (Texture &tex : textures) { if (!tex.is_renderbuffer && tex.tex_num == tex_num) { assert(tex.in_use); tex.in_use = false; return; } } assert(false); } void TexturePool::release_renderbuffer(GLuint tex_num) { lock_guard lock(mu); for (Texture &tex : textures) { if (tex.is_renderbuffer && tex.tex_num == tex_num) { assert(tex.in_use); tex.in_use = false; return; } } //assert(false); } nageru-2.3.0/futatabi/flow.h000066400000000000000000000433261450736322200157300ustar00rootroot00000000000000#ifndef _FLOW_H #define _FLOW_H 1 // Code for computing optical flow between two images, and using it to interpolate // in-between frames. The main user interface is the DISComputeFlow and Interpolate // classes (also GrayscaleConversion can be useful). #include #include #include #include #include #include #include class ScopedTimer; // Predefined operating points from the paper. struct OperatingPoint { unsigned coarsest_level; // TODO: Adjust dynamically based on the resolution? unsigned finest_level; unsigned search_iterations; // Halved from the paper. unsigned patch_size_pixels; float patch_overlap_ratio; bool variational_refinement; // Not part of the original paper; used for interpolation. // NOTE: Values much larger than 1.0 seems to trigger Haswell's “PMA stall”; // the problem is not present on Broadwell and higher (there's a mitigation // in the hardware, but Mesa doesn't enable it at the time of writing). // Since we have hole filling, the holes from 1.0 are not critical, // but larger values seem to do better than hole filling for large // motion, blurs etc. since we have more candidates. float splat_size; }; // Operating point 1 (600 Hz on CPU, excluding preprocessing). static constexpr OperatingPoint operating_point1 = { 5, // Coarsest level. 3, // Finest level. 8, // Search iterations. 8, // Patch size (pixels). 0.30f, // Overlap ratio. false, // Variational refinement. 1.0f // Splat size (pixels). }; // Operating point 2 (300 Hz on CPU, excluding preprocessing). static constexpr OperatingPoint operating_point2 = { 5, // Coarsest level. 3, // Finest level. 6, // Search iterations. 8, // Patch size (pixels). 0.40f, // Overlap ratio. true, // Variational refinement. 1.0f // Splat size (pixels). }; // Operating point 3 (10 Hz on CPU, excluding preprocessing). // This is the only one that has been thorougly tested. static constexpr OperatingPoint operating_point3 = { 5, // Coarsest level. 1, // Finest level. 8, // Search iterations. 12, // Patch size (pixels). 0.75f, // Overlap ratio. true, // Variational refinement. 4.0f // Splat size (pixels). }; // Operating point 4 (0.5 Hz on CPU, excluding preprocessing). static constexpr OperatingPoint operating_point4 = { 5, // Coarsest level. 0, // Finest level. 128, // Search iterations. 12, // Patch size (pixels). 0.75f, // Overlap ratio. true, // Variational refinement. 8.0f // Splat size (pixels). }; int find_num_levels(int width, int height); // A class that caches FBOs that render to a given set of textures. // It never frees anything, so it is only suitable for rendering to // the same (small) set of textures over and over again. template class PersistentFBOSet { public: void render_to(const std::array &textures); // Convenience wrappers. void render_to(GLuint texture0) { render_to({ { texture0 } }); } void render_to(GLuint texture0, GLuint texture1) { render_to({ { texture0, texture1 } }); } void render_to(GLuint texture0, GLuint texture1, GLuint texture2) { render_to({ { texture0, texture1, texture2 } }); } void render_to(GLuint texture0, GLuint texture1, GLuint texture2, GLuint texture3) { render_to({ { texture0, texture1, texture2, texture3 } }); } private: // TODO: Delete these on destruction. std::map, GLuint> fbos; }; // Same, but with a depth texture. template class PersistentFBOSetWithDepth { public: void render_to(GLuint depth_rb, const std::array &textures); // Convenience wrappers. void render_to(GLuint depth_rb, GLuint texture0) { render_to(depth_rb, { { texture0 } }); } void render_to(GLuint depth_rb, GLuint texture0, GLuint texture1) { render_to(depth_rb, { { texture0, texture1 } }); } void render_to(GLuint depth_rb, GLuint texture0, GLuint texture1, GLuint texture2) { render_to(depth_rb, { { texture0, texture1, texture2 } }); } void render_to(GLuint depth_rb, GLuint texture0, GLuint texture1, GLuint texture2, GLuint texture3) { render_to(depth_rb, { { texture0, texture1, texture2, texture3 } }); } private: // TODO: Delete these on destruction. std::map>, GLuint> fbos; }; // Convert RGB to grayscale, using Rec. 709 coefficients. class GrayscaleConversion { public: GrayscaleConversion(); void exec(GLint tex, GLint gray_tex, int width, int height, int num_layers); private: PersistentFBOSet<1> fbos; GLuint gray_vs_obj; GLuint gray_fs_obj; GLuint gray_program; GLuint gray_vao; GLuint uniform_tex; }; // Compute gradients in every point, used for the motion search. // The DIS paper doesn't actually mention how these are computed, // but seemingly, a 3x3 Sobel operator is used here (at least in // later versions of the code), while a [1 -8 0 8 -1] kernel is // used for all the derivatives in the variational refinement part // (which borrows code from DeepFlow). This is inconsistent, // but I guess we're better off with staying with the original // decisions until we actually know having different ones would be better. class Sobel { public: Sobel(); void exec(GLint tex_view, GLint grad_tex, int level_width, int level_height, int num_layers); private: PersistentFBOSet<1> fbos; GLuint sobel_vs_obj; GLuint sobel_fs_obj; GLuint sobel_program; GLuint uniform_tex; }; // Motion search to find the initial flow. See motion_search.frag for documentation. class MotionSearch { public: MotionSearch(const OperatingPoint &op); void exec(GLuint tex_view, GLuint grad_tex, GLuint flow_tex, GLuint flow_out_tex, int level_width, int level_height, int prev_level_width, int prev_level_height, int width_patches, int height_patches, int num_layers); private: const OperatingPoint op; PersistentFBOSet<1> fbos; GLuint motion_vs_obj; GLuint motion_fs_obj; GLuint motion_search_program; GLuint uniform_inv_image_size, uniform_inv_prev_level_size, uniform_out_flow_size; GLuint uniform_image_tex, uniform_grad_tex, uniform_flow_tex; GLuint uniform_patch_size, uniform_num_iterations; }; // Do “densification”, ie., upsampling of the flow patches to the flow field // (the same size as the image at this level). We draw one quad per patch // over its entire covered area (using instancing in the vertex shader), // and then weight the contributions in the pixel shader by post-warp difference. // This is equation (3) in the paper. // // We accumulate the flow vectors in the R/G channels (for u/v) and the total // weight in the B channel. Dividing R and G by B gives the normalized values. class Densify { public: Densify(const OperatingPoint &op); void exec(GLuint tex_view, GLuint flow_tex, GLuint dense_flow_tex, int level_width, int level_height, int width_patches, int height_patches, int num_layers); private: OperatingPoint op; PersistentFBOSet<1> fbos; GLuint densify_vs_obj; GLuint densify_fs_obj; GLuint densify_program; GLuint uniform_patch_size; GLuint uniform_image_tex, uniform_flow_tex; }; // Warp I_1 to I_w, and then compute the mean (I) and difference (I_t) of // I_0 and I_w. The prewarping is what enables us to solve the variational // flow for du,dv instead of u,v. // // Also calculates the normalized flow, ie. divides by z (this is needed because // Densify works by additive blending) and multiplies by the image size. // // See variational_refinement.txt for more information. class Prewarp { public: Prewarp(); void exec(GLuint tex_view, GLuint flow_tex, GLuint normalized_flow_tex, GLuint I_tex, GLuint I_t_tex, int level_width, int level_height, int num_layers); private: PersistentFBOSet<3> fbos; GLuint prewarp_vs_obj; GLuint prewarp_fs_obj; GLuint prewarp_program; GLuint uniform_image_tex, uniform_flow_tex; }; // From I, calculate the partial derivatives I_x and I_y. We use a four-tap // central difference filter, since apparently, that's tradition (I haven't // measured quality versus a more normal 0.5 (I[x+1] - I[x-1]).) // The coefficients come from // // https://en.wikipedia.org/wiki/Finite_difference_coefficient // // Also computes β_0, since it depends only on I_x and I_y. class Derivatives { public: Derivatives(); void exec(GLuint input_tex, GLuint I_x_y_tex, GLuint beta_0_tex, int level_width, int level_height, int num_layers); private: PersistentFBOSet<2> fbos; GLuint derivatives_vs_obj; GLuint derivatives_fs_obj; GLuint derivatives_program; GLuint uniform_tex; }; // Calculate the diffusivity for each pixels, g(x,y). Smoothness (s) will // be calculated in the shaders on-the-fly by sampling in-between two // neighboring g(x,y) pixels, plus a border tweak to make sure we get // zero smoothness at the border. // // See variational_refinement.txt for more information. class ComputeDiffusivity { public: ComputeDiffusivity(); void exec(GLuint flow_tex, GLuint diff_flow_tex, GLuint diffusivity_tex, int level_width, int level_height, bool zero_diff_flow, int num_layers); private: PersistentFBOSet<1> fbos; GLuint diffusivity_vs_obj; GLuint diffusivity_fs_obj; GLuint diffusivity_program; GLuint uniform_flow_tex, uniform_diff_flow_tex; GLuint uniform_alpha, uniform_zero_diff_flow; }; // Set up the equations set (two equations in two unknowns, per pixel). // We store five floats; the three non-redundant elements of the 2x2 matrix (A) // as 32-bit floats, and the two elements on the right-hand side (b) as 16-bit // floats. (Actually, we store the inverse of the diagonal elements, because // we only ever need to divide by them.) This fits into four u32 values; // R, G, B for the matrix (the last element is symmetric) and A for the two b values. // All the values of the energy term (E_I, E_G, E_S), except the smoothness // terms that depend on other pixels, are calculated in one pass. // // The equation set is split in two; one contains only the pixels needed for // the red pass, and one only for the black pass (see sor.frag). This reduces // the amount of data the SOR shader has to pull in, at the cost of some // complexity when the equation texture ends up with half the size and we need // to adjust texture coordinates. The contraction is done along the horizontal // axis, so that on even rows (0, 2, 4, ...), the “red” texture will contain // pixels 0, 2, 4, 6, etc., and on odd rows 1, 3, 5, etc.. // // See variational_refinement.txt for more information about the actual // equations in use. class SetupEquations { public: SetupEquations(); void exec(GLuint I_x_y_tex, GLuint I_t_tex, GLuint diff_flow_tex, GLuint flow_tex, GLuint beta_0_tex, GLuint diffusivity_tex, GLuint equation_red_tex, GLuint equation_black_tex, int level_width, int level_height, bool zero_diff_flow, int num_layers); private: PersistentFBOSet<2> fbos; GLuint equations_vs_obj; GLuint equations_fs_obj; GLuint equations_program; GLuint uniform_I_x_y_tex, uniform_I_t_tex; GLuint uniform_diff_flow_tex, uniform_base_flow_tex; GLuint uniform_beta_0_tex; GLuint uniform_diffusivity_tex; GLuint uniform_gamma, uniform_delta, uniform_zero_diff_flow; }; // Actually solve the equation sets made by SetupEquations, by means of // successive over-relaxation (SOR). // // See variational_refinement.txt for more information. class SOR { public: SOR(); void exec(GLuint diff_flow_tex, GLuint equation_red_tex, GLuint equation_black_tex, GLuint diffusivity_tex, int level_width, int level_height, int num_iterations, bool zero_diff_flow, int num_layers, ScopedTimer *sor_timer); private: PersistentFBOSet<1> fbos; GLuint sor_vs_obj; GLuint sor_fs_obj; GLuint sor_program; GLuint uniform_diff_flow_tex; GLuint uniform_equation_red_tex, uniform_equation_black_tex; GLuint uniform_diffusivity_tex; GLuint uniform_phase, uniform_num_nonzero_phases; }; // Simply add the differential flow found by the variational refinement to the base flow. // The output is in base_flow_tex; we don't need to make a new texture. class AddBaseFlow { public: AddBaseFlow(); void exec(GLuint base_flow_tex, GLuint diff_flow_tex, int level_width, int level_height, int num_layers); private: PersistentFBOSet<1> fbos; GLuint add_flow_vs_obj; GLuint add_flow_fs_obj; GLuint add_flow_program; GLuint uniform_diff_flow_tex; }; // Take a copy of the flow, bilinearly interpolated and scaled up. class ResizeFlow { public: ResizeFlow(); void exec(GLuint in_tex, GLuint out_tex, int input_width, int input_height, int output_width, int output_height, int num_layers); private: PersistentFBOSet<1> fbos; GLuint resize_flow_vs_obj; GLuint resize_flow_fs_obj; GLuint resize_flow_program; GLuint uniform_flow_tex; GLuint uniform_scale_factor; }; // All operations, except construction and destruction, are thread-safe. class TexturePool { public: GLuint get_texture(GLenum format, GLuint width, GLuint height, GLuint num_layers = 0); void release_texture(GLuint tex_num); GLuint get_renderbuffer(GLenum format, GLuint width, GLuint height); void release_renderbuffer(GLuint tex_num); private: struct Texture { GLuint tex_num; GLenum format; GLuint width, height, num_layers; bool in_use = false; bool is_renderbuffer = false; }; std::mutex mu; std::vector textures; // Under mu. }; class DISComputeFlow { public: DISComputeFlow(int width, int height, const OperatingPoint &op); enum FlowDirection { FORWARD, FORWARD_AND_BACKWARD }; enum ResizeStrategy { DO_NOT_RESIZE_FLOW, RESIZE_FLOW_TO_FULL_SIZE }; // The texture must have two layers (first and second frame). // Returns a texture that must be released with release_texture() // after use. GLuint exec(GLuint tex, FlowDirection flow_direction, ResizeStrategy resize_strategy); void release_texture(GLuint tex) { pool.release_texture(tex); } private: int width, height; GLuint initial_flow_tex; GLuint vertex_vbo, vao; TexturePool pool; const OperatingPoint op; // The various passes. Sobel sobel; MotionSearch motion_search; Densify densify; Prewarp prewarp; Derivatives derivatives; ComputeDiffusivity compute_diffusivity; SetupEquations setup_equations; SOR sor; AddBaseFlow add_base_flow; ResizeFlow resize_flow; }; // Forward-warp the flow half-way (or rather, by alpha). A non-zero “splatting” // radius fills most of the holes. class Splat { public: Splat(const OperatingPoint &op); // alpha is the time of the interpolated frame (0..1). void exec(GLuint gray_tex, GLuint bidirectional_flow_tex, GLuint flow_tex, GLuint depth_rb, int width, int height, float alpha); private: const OperatingPoint op; PersistentFBOSetWithDepth<1> fbos; GLuint splat_vs_obj; GLuint splat_fs_obj; GLuint splat_program; GLuint uniform_splat_size, uniform_alpha; GLuint uniform_gray_tex, uniform_flow_tex; GLuint uniform_inv_flow_size; }; // Doing good and fast hole-filling on a GPU is nontrivial. We choose an option // that's fairly simple (given that most holes are really small) and also hopefully // cheap should the holes not be so small. Conceptually, we look for the first // non-hole to the left of us (ie., shoot a ray until we hit something), then // the first non-hole to the right of us, then up and down, and then average them // all together. It's going to create “stars” if the holes are big, but OK, that's // a tradeoff. // // Our implementation here is efficient assuming that the hierarchical Z-buffer is // on even for shaders that do discard (this typically kills early Z, but hopefully // not hierarchical Z); we set up Z so that only holes are written to, which means // that as soon as a hole is filled, the rasterizer should just skip it. Most of the // fullscreen quads should just be discarded outright, really. class HoleFill { public: HoleFill(); // Output will be in flow_tex, temp_tex[0, 1, 2], representing the filling // from the down, left, right and up, respectively. Use HoleBlend to merge // them into one. void exec(GLuint flow_tex, GLuint depth_rb, GLuint temp_tex[3], int width, int height); private: PersistentFBOSetWithDepth<1> fbos; GLuint fill_vs_obj; GLuint fill_fs_obj; GLuint fill_program; GLuint uniform_tex; GLuint uniform_z, uniform_sample_offset; }; // Blend the four directions from HoleFill into one pixel, so that single-pixel // holes become the average of their four neighbors. class HoleBlend { public: HoleBlend(); void exec(GLuint flow_tex, GLuint depth_rb, GLuint temp_tex[3], int width, int height); private: PersistentFBOSetWithDepth<1> fbos; GLuint blend_vs_obj; GLuint blend_fs_obj; GLuint blend_program; GLuint uniform_left_tex, uniform_right_tex, uniform_up_tex, uniform_down_tex; GLuint uniform_z, uniform_sample_offset; }; class Blend { public: Blend(bool split_ycbcr_output); // output2_tex is only used if split_ycbcr_output was true. void exec(GLuint image_tex, GLuint flow_tex, GLuint output_tex, GLuint output2_tex, int width, int height, float alpha); private: bool split_ycbcr_output; PersistentFBOSet<1> fbos; PersistentFBOSet<2> fbos_split; GLuint blend_vs_obj; GLuint blend_fs_obj; GLuint blend_program; GLuint uniform_image_tex, uniform_flow_tex; GLuint uniform_alpha, uniform_flow_consistency_tolerance; }; class Interpolate { public: Interpolate(const OperatingPoint &op, bool split_ycbcr_output); // Returns a texture (or two, if split_ycbcr_output is true) that must // be released with release_texture() after use. image_tex must be a // two-layer RGBA8 texture with mipmaps (unless flow_level == 0). std::pair exec(GLuint image_tex, GLuint gray_tex, GLuint bidirectional_flow_tex, GLuint width, GLuint height, float alpha); void release_texture(GLuint tex) { pool.release_texture(tex); } private: int flow_level; GLuint vertex_vbo, vao; TexturePool pool; const bool split_ycbcr_output; Splat splat; HoleFill hole_fill; HoleBlend hole_blend; Blend blend; }; #endif // !defined(_FLOW_H) nageru-2.3.0/futatabi/flow_main.cpp000066400000000000000000000405611450736322200172650ustar00rootroot00000000000000#define NO_SDL_GLEXT 1 #include "flow.h" #include "gpu_timers.h" #include "util.h" #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #define BUFFER_OFFSET(i) ((char *)nullptr + (i)) using namespace std; SDL_Window *window; bool enable_warmup = false; bool enable_variational_refinement = true; // Just for debugging. bool enable_interpolation = false; extern float vr_alpha, vr_delta, vr_gamma; // Structures for asynchronous readback. We assume everything is the same size (and GL_RG16F). struct ReadInProgress { GLuint pbo; string filename0, filename1; string flow_filename, ppm_filename; // Either may be empty for no write. }; stack spare_pbos; deque reads_in_progress; enum MipmapPolicy { WITHOUT_MIPMAPS, WITH_MIPMAPS }; GLuint load_texture(const char *filename, unsigned *width_ret, unsigned *height_ret, MipmapPolicy mipmaps) { SDL_Surface *surf = IMG_Load(filename); if (surf == nullptr) { fprintf(stderr, "IMG_Load(%s): %s\n", filename, IMG_GetError()); abort(); } // For whatever reason, SDL doesn't support converting to YUV surfaces // nor grayscale, so we'll do it ourselves. SDL_Surface *rgb_surf = SDL_ConvertSurfaceFormat(surf, SDL_PIXELFORMAT_RGBA32, /*flags=*/0); if (rgb_surf == nullptr) { fprintf(stderr, "SDL_ConvertSurfaceFormat(%s): %s\n", filename, SDL_GetError()); abort(); } SDL_FreeSurface(surf); unsigned width = rgb_surf->w, height = rgb_surf->h; const uint8_t *sptr = (uint8_t *)rgb_surf->pixels; unique_ptr pix(new uint8_t[width * height * 4]); // Extract the Y component, and convert to bottom-left origin. for (unsigned y = 0; y < height; ++y) { unsigned y2 = height - 1 - y; memcpy(pix.get() + y * width * 4, sptr + y2 * rgb_surf->pitch, width * 4); } SDL_FreeSurface(rgb_surf); int num_levels = (mipmaps == WITH_MIPMAPS) ? find_num_levels(width, height) : 1; GLuint tex; glCreateTextures(GL_TEXTURE_2D, 1, &tex); glTextureStorage2D(tex, num_levels, GL_RGBA8, width, height); glTextureSubImage2D(tex, 0, 0, 0, width, height, GL_RGBA, GL_UNSIGNED_BYTE, pix.get()); if (mipmaps == WITH_MIPMAPS) { glGenerateTextureMipmap(tex); } *width_ret = width; *height_ret = height; return tex; } // OpenGL uses a bottom-left coordinate system, .flo files use a top-left coordinate system. void flip_coordinate_system(float *dense_flow, unsigned width, unsigned height) { for (unsigned i = 0; i < width * height; ++i) { dense_flow[i * 2 + 1] = -dense_flow[i * 2 + 1]; } } // Not relevant for RGB. void flip_coordinate_system(uint8_t *dense_flow, unsigned width, unsigned height) { } void write_flow(const char *filename, const float *dense_flow, unsigned width, unsigned height) { FILE *flowfp = fopen(filename, "wb"); fprintf(flowfp, "FEIH"); fwrite(&width, 4, 1, flowfp); fwrite(&height, 4, 1, flowfp); for (unsigned y = 0; y < height; ++y) { int yy = height - y - 1; fwrite(&dense_flow[yy * width * 2], width * 2 * sizeof(float), 1, flowfp); } fclose(flowfp); } // Not relevant for RGB. void write_flow(const char *filename, const uint8_t *dense_flow, unsigned width, unsigned height) { assert(false); } void write_ppm(const char *filename, const float *dense_flow, unsigned width, unsigned height) { FILE *fp = fopen(filename, "wb"); fprintf(fp, "P6\n%d %d\n255\n", width, height); for (unsigned y = 0; y < unsigned(height); ++y) { int yy = height - y - 1; for (unsigned x = 0; x < unsigned(width); ++x) { float du = dense_flow[(yy * width + x) * 2 + 0]; float dv = dense_flow[(yy * width + x) * 2 + 1]; uint8_t r, g, b; flow2rgb(du, dv, &r, &g, &b); putc(r, fp); putc(g, fp); putc(b, fp); } } fclose(fp); } void write_ppm(const char *filename, const uint8_t *rgba, unsigned width, unsigned height) { unique_ptr rgb_line(new uint8_t[width * 3 + 1]); FILE *fp = fopen(filename, "wb"); fprintf(fp, "P6\n%d %d\n255\n", width, height); for (unsigned y = 0; y < height; ++y) { unsigned y2 = height - 1 - y; for (size_t x = 0; x < width; ++x) { memcpy(&rgb_line[x * 3], &rgba[(y2 * width + x) * 4], 4); } fwrite(rgb_line.get(), width * 3, 1, fp); } fclose(fp); } struct FlowType { using type = float; static constexpr GLenum gl_format = GL_RG; static constexpr GLenum gl_type = GL_FLOAT; static constexpr int num_channels = 2; }; struct RGBAType { using type = uint8_t; static constexpr GLenum gl_format = GL_RGBA; static constexpr GLenum gl_type = GL_UNSIGNED_BYTE; static constexpr int num_channels = 4; }; template void finish_one_read(GLuint width, GLuint height) { using T = typename Type::type; constexpr int bytes_per_pixel = Type::num_channels * sizeof(T); assert(!reads_in_progress.empty()); ReadInProgress read = reads_in_progress.front(); reads_in_progress.pop_front(); unique_ptr flow(new typename Type::type[width * height * Type::num_channels]); void *buf = glMapNamedBufferRange(read.pbo, 0, width * height * bytes_per_pixel, GL_MAP_READ_BIT); // Blocks if the read isn't done yet. memcpy(flow.get(), buf, width * height * bytes_per_pixel); // TODO: Unneeded for RGBType, since flip_coordinate_system() does nothing.: glUnmapNamedBuffer(read.pbo); spare_pbos.push(read.pbo); flip_coordinate_system(flow.get(), width, height); if (!read.flow_filename.empty()) { write_flow(read.flow_filename.c_str(), flow.get(), width, height); fprintf(stderr, "%s %s -> %s\n", read.filename0.c_str(), read.filename1.c_str(), read.flow_filename.c_str()); } if (!read.ppm_filename.empty()) { write_ppm(read.ppm_filename.c_str(), flow.get(), width, height); } } template void schedule_read(GLuint tex, GLuint width, GLuint height, const char *filename0, const char *filename1, const char *flow_filename, const char *ppm_filename) { using T = typename Type::type; constexpr int bytes_per_pixel = Type::num_channels * sizeof(T); if (spare_pbos.empty()) { finish_one_read(width, height); } assert(!spare_pbos.empty()); reads_in_progress.emplace_back(ReadInProgress{ spare_pbos.top(), filename0, filename1, flow_filename, ppm_filename }); glBindBuffer(GL_PIXEL_PACK_BUFFER, spare_pbos.top()); spare_pbos.pop(); glGetTextureImage(tex, 0, Type::gl_format, Type::gl_type, width * height * bytes_per_pixel, nullptr); glBindBuffer(GL_PIXEL_PACK_BUFFER, 0); } void compute_flow_only(int argc, char **argv, int optind) { const char *filename0 = argc >= (optind + 1) ? argv[optind] : "test1499.png"; const char *filename1 = argc >= (optind + 2) ? argv[optind + 1] : "test1500.png"; const char *flow_filename = argc >= (optind + 3) ? argv[optind + 2] : "flow.flo"; // Load pictures. unsigned width1, height1, width2, height2; GLuint tex0 = load_texture(filename0, &width1, &height1, WITHOUT_MIPMAPS); GLuint tex1 = load_texture(filename1, &width2, &height2, WITHOUT_MIPMAPS); if (width1 != width2 || height1 != height2) { fprintf(stderr, "Image dimensions don't match (%dx%d versus %dx%d)\n", width1, height1, width2, height2); abort(); } // Move them into an array texture, since that's how the rest of the code // would like them. GLuint image_tex; glCreateTextures(GL_TEXTURE_2D_ARRAY, 1, &image_tex); glTextureStorage3D(image_tex, 1, GL_RGBA8, width1, height1, 2); glCopyImageSubData(tex0, GL_TEXTURE_2D, 0, 0, 0, 0, image_tex, GL_TEXTURE_2D_ARRAY, 0, 0, 0, 0, width1, height1, 1); glCopyImageSubData(tex1, GL_TEXTURE_2D, 0, 0, 0, 0, image_tex, GL_TEXTURE_2D_ARRAY, 0, 0, 0, 1, width1, height1, 1); glDeleteTextures(1, &tex0); glDeleteTextures(1, &tex1); // Set up some PBOs to do asynchronous readback. GLuint pbos[5]; glCreateBuffers(5, pbos); for (int i = 0; i < 5; ++i) { glNamedBufferData(pbos[i], width1 * height1 * 2 * 2 * sizeof(float), nullptr, GL_STREAM_READ); spare_pbos.push(pbos[i]); } int levels = find_num_levels(width1, height1); GLuint tex_gray; glCreateTextures(GL_TEXTURE_2D_ARRAY, 1, &tex_gray); glTextureStorage3D(tex_gray, levels, GL_R8, width1, height1, 2); OperatingPoint op = operating_point3; if (!enable_variational_refinement) { op.variational_refinement = false; } DISComputeFlow compute_flow(width1, height1, op); // Must be initialized before gray. GrayscaleConversion gray; gray.exec(image_tex, tex_gray, width1, height1, /*num_layers=*/2); glGenerateTextureMipmap(tex_gray); if (enable_warmup) { in_warmup = true; for (int i = 0; i < 10; ++i) { GLuint final_tex = compute_flow.exec(tex_gray, DISComputeFlow::FORWARD, DISComputeFlow::RESIZE_FLOW_TO_FULL_SIZE); compute_flow.release_texture(final_tex); } in_warmup = false; } GLuint final_tex = compute_flow.exec(tex_gray, DISComputeFlow::FORWARD, DISComputeFlow::RESIZE_FLOW_TO_FULL_SIZE); //GLuint final_tex = compute_flow.exec(tex_gray, DISComputeFlow::FORWARD_AND_BACKWARD, DISComputeFlow::RESIZE_FLOW_TO_FULL_SIZE); schedule_read(final_tex, width1, height1, filename0, filename1, flow_filename, "flow.ppm"); compute_flow.release_texture(final_tex); // See if there are more flows on the command line (ie., more than three arguments), // and if so, process them. int num_flows = (argc - optind) / 3; for (int i = 1; i < num_flows; ++i) { const char *filename0 = argv[optind + i * 3 + 0]; const char *filename1 = argv[optind + i * 3 + 1]; const char *flow_filename = argv[optind + i * 3 + 2]; GLuint width, height; GLuint tex0 = load_texture(filename0, &width, &height, WITHOUT_MIPMAPS); if (width != width1 || height != height1) { fprintf(stderr, "%s: Image dimensions don't match (%dx%d versus %dx%d)\n", filename0, width, height, width1, height1); abort(); } glCopyImageSubData(tex0, GL_TEXTURE_2D, 0, 0, 0, 0, image_tex, GL_TEXTURE_2D_ARRAY, 0, 0, 0, 0, width1, height1, 1); glDeleteTextures(1, &tex0); GLuint tex1 = load_texture(filename1, &width, &height, WITHOUT_MIPMAPS); if (width != width1 || height != height1) { fprintf(stderr, "%s: Image dimensions don't match (%dx%d versus %dx%d)\n", filename1, width, height, width1, height1); abort(); } glCopyImageSubData(tex1, GL_TEXTURE_2D, 0, 0, 0, 0, image_tex, GL_TEXTURE_2D_ARRAY, 0, 0, 0, 1, width1, height1, 1); glDeleteTextures(1, &tex1); gray.exec(image_tex, tex_gray, width1, height1, /*num_layers=*/2); glGenerateTextureMipmap(tex_gray); GLuint final_tex = compute_flow.exec(tex_gray, DISComputeFlow::FORWARD, DISComputeFlow::RESIZE_FLOW_TO_FULL_SIZE); schedule_read(final_tex, width1, height1, filename0, filename1, flow_filename, ""); compute_flow.release_texture(final_tex); } glDeleteTextures(1, &tex_gray); while (!reads_in_progress.empty()) { finish_one_read(width1, height1); } } // Interpolate images based on // // Herbst, Seitz, Baker: “Occlusion Reasoning for Temporal Interpolation // Using Optical Flow” // // or at least a reasonable subset thereof. Unfinished. void interpolate_image(int argc, char **argv, int optind) { const char *filename0 = argc >= (optind + 1) ? argv[optind] : "test1499.png"; const char *filename1 = argc >= (optind + 2) ? argv[optind + 1] : "test1500.png"; //const char *out_filename = argc >= (optind + 3) ? argv[optind + 2] : "interpolated.png"; // Load pictures. unsigned width1, height1, width2, height2; GLuint tex0 = load_texture(filename0, &width1, &height1, WITH_MIPMAPS); GLuint tex1 = load_texture(filename1, &width2, &height2, WITH_MIPMAPS); if (width1 != width2 || height1 != height2) { fprintf(stderr, "Image dimensions don't match (%dx%d versus %dx%d)\n", width1, height1, width2, height2); abort(); } // Move them into an array texture, since that's how the rest of the code // would like them. int levels = find_num_levels(width1, height1); GLuint image_tex; glCreateTextures(GL_TEXTURE_2D_ARRAY, 1, &image_tex); glTextureStorage3D(image_tex, levels, GL_RGBA8, width1, height1, 2); glCopyImageSubData(tex0, GL_TEXTURE_2D, 0, 0, 0, 0, image_tex, GL_TEXTURE_2D_ARRAY, 0, 0, 0, 0, width1, height1, 1); glCopyImageSubData(tex1, GL_TEXTURE_2D, 0, 0, 0, 0, image_tex, GL_TEXTURE_2D_ARRAY, 0, 0, 0, 1, width1, height1, 1); glDeleteTextures(1, &tex0); glDeleteTextures(1, &tex1); glGenerateTextureMipmap(image_tex); // Set up some PBOs to do asynchronous readback. GLuint pbos[5]; glCreateBuffers(5, pbos); for (int i = 0; i < 5; ++i) { glNamedBufferData(pbos[i], width1 * height1 * 4 * sizeof(uint8_t), nullptr, GL_STREAM_READ); spare_pbos.push(pbos[i]); } OperatingPoint op = operating_point3; if (!enable_variational_refinement) { op.variational_refinement = false; } DISComputeFlow compute_flow(width1, height1, op); GrayscaleConversion gray; Interpolate interpolate(op, /*split_ycbcr_output=*/false); GLuint tex_gray; glCreateTextures(GL_TEXTURE_2D_ARRAY, 1, &tex_gray); glTextureStorage3D(tex_gray, levels, GL_R8, width1, height1, 2); gray.exec(image_tex, tex_gray, width1, height1, /*num_layers=*/2); glGenerateTextureMipmap(tex_gray); if (enable_warmup) { in_warmup = true; for (int i = 0; i < 10; ++i) { GLuint bidirectional_flow_tex = compute_flow.exec(tex_gray, DISComputeFlow::FORWARD_AND_BACKWARD, DISComputeFlow::DO_NOT_RESIZE_FLOW); GLuint interpolated_tex = interpolate.exec(image_tex, tex_gray, bidirectional_flow_tex, width1, height1, 0.5f).first; compute_flow.release_texture(bidirectional_flow_tex); interpolate.release_texture(interpolated_tex); } in_warmup = false; } GLuint bidirectional_flow_tex = compute_flow.exec(tex_gray, DISComputeFlow::FORWARD_AND_BACKWARD, DISComputeFlow::DO_NOT_RESIZE_FLOW); for (int frameno = 1; frameno < 60; ++frameno) { char ppm_filename[256]; snprintf(ppm_filename, sizeof(ppm_filename), "interp%04d.ppm", frameno); float alpha = frameno / 60.0f; GLuint interpolated_tex = interpolate.exec(image_tex, tex_gray, bidirectional_flow_tex, width1, height1, alpha).first; schedule_read(interpolated_tex, width1, height1, filename0, filename1, "", ppm_filename); interpolate.release_texture(interpolated_tex); } while (!reads_in_progress.empty()) { finish_one_read(width1, height1); } } int main(int argc, char **argv) { static const option long_options[] = { { "smoothness-relative-weight", required_argument, 0, 's' }, // alpha. { "intensity-relative-weight", required_argument, 0, 'i' }, // delta. { "gradient-relative-weight", required_argument, 0, 'g' }, // gamma. { "disable-timing", no_argument, 0, 1000 }, { "detailed-timing", no_argument, 0, 1003 }, { "disable-variational-refinement", no_argument, 0, 1001 }, { "interpolate", no_argument, 0, 1002 }, { "warmup", no_argument, 0, 1004 } }; enable_timing = true; for (;;) { int option_index = 0; int c = getopt_long(argc, argv, "s:i:g:", long_options, &option_index); if (c == -1) { break; } switch (c) { case 's': vr_alpha = atof(optarg); break; case 'i': vr_delta = atof(optarg); break; case 'g': vr_gamma = atof(optarg); break; case 1000: enable_timing = false; break; case 1001: enable_variational_refinement = false; break; case 1002: enable_interpolation = true; break; case 1003: detailed_timing = true; break; case 1004: enable_warmup = true; break; default: fprintf(stderr, "Unknown option '%s'\n", argv[option_index]); abort(); }; } if (SDL_Init(SDL_INIT_EVERYTHING) == -1) { fprintf(stderr, "SDL_Init failed: %s\n", SDL_GetError()); abort(); } SDL_GL_SetAttribute(SDL_GL_ALPHA_SIZE, 8); SDL_GL_SetAttribute(SDL_GL_DEPTH_SIZE, 0); SDL_GL_SetAttribute(SDL_GL_STENCIL_SIZE, 0); SDL_GL_SetAttribute(SDL_GL_DOUBLEBUFFER, 1); SDL_GL_SetAttribute(SDL_GL_CONTEXT_PROFILE_MASK, SDL_GL_CONTEXT_PROFILE_CORE); SDL_GL_SetAttribute(SDL_GL_CONTEXT_MAJOR_VERSION, 4); SDL_GL_SetAttribute(SDL_GL_CONTEXT_MINOR_VERSION, 5); // SDL_GL_SetAttribute(SDL_GL_CONTEXT_FLAGS, SDL_GL_CONTEXT_DEBUG_FLAG); window = SDL_CreateWindow("OpenGL window", SDL_WINDOWPOS_UNDEFINED, SDL_WINDOWPOS_UNDEFINED, 64, 64, SDL_WINDOW_OPENGL | SDL_WINDOW_HIDDEN); SDL_GLContext context = SDL_GL_CreateContext(window); assert(context != nullptr); if (enable_interpolation) { interpolate_image(argc, argv, optind); } else { compute_flow_only(argc, argv, optind); } } nageru-2.3.0/futatabi/frame.proto000066400000000000000000000015031450736322200167560ustar00rootroot00000000000000syntax = "proto3"; // Used as header before each frame in a .frames file: // // 1. "Ftbifrm0" (8 bytes, ASCII -- note that no byte repeats) // 2. Length of upcoming FrameHeaderProto (uint32, binary, big endian) // 3. The FrameHeaderProto itself // 4. The actual frame message FrameHeaderProto { int32 stream_idx = 1; int64 pts = 2; int64 file_size = 3; // In bytes of compressed frame. TODO: rename to size. int32 audio_size = 4; // In bytes of uncompressed 32-bit 48kHz stereo PCM. Can be zero. } message StreamContentsProto { int32 stream_idx = 1; repeated int64 pts = 2 [packed=true]; repeated int64 file_size = 3 [packed=true]; repeated int64 offset = 4 [packed=true]; repeated int32 audio_size = 5 [packed=true]; } message FileContentsProto { repeated StreamContentsProto stream = 1; // Typically only one. } nageru-2.3.0/futatabi/frame_on_disk.cpp000066400000000000000000000052611450736322200201100ustar00rootroot00000000000000#include "frame_on_disk.h" #include "shared/metrics.h" #include #include #include #include #include #include using namespace std; using namespace std::chrono; namespace { // There can be multiple FrameReader classes, so make all the metrics static. once_flag frame_metrics_inited; atomic metric_frame_opened_files{ 0 }; atomic metric_frame_closed_files{ 0 }; atomic metric_frame_read_bytes{ 0 }; atomic metric_frame_read_frames{ 0 }; Summary metric_frame_read_time_seconds; } // namespace FrameReader::FrameReader() { call_once(frame_metrics_inited, [] { global_metrics.add("frame_opened_files", &metric_frame_opened_files); global_metrics.add("frame_closed_files", &metric_frame_closed_files); global_metrics.add("frame_read_bytes", &metric_frame_read_bytes); global_metrics.add("frame_read_frames", &metric_frame_read_frames); vector quantiles{ 0.01, 0.1, 0.25, 0.5, 0.75, 0.9, 0.99 }; metric_frame_read_time_seconds.init(quantiles, 60.0); global_metrics.add("frame_read_time_seconds", &metric_frame_read_time_seconds); }); } FrameReader::~FrameReader() { if (fd != -1) { close(fd); ++metric_frame_closed_files; } } namespace { string read_string(int fd, size_t size, off_t offset) { string str; str.resize(size); size_t str_offset = 0; while (str_offset < size) { int ret = pread(fd, &str[str_offset], size - str_offset, offset + str_offset); if (ret <= 0) { perror("pread"); abort(); } str_offset += ret; } return str; } } // namespace FrameReader::Frame FrameReader::read_frame(FrameOnDisk frame, bool read_video, bool read_audio) { assert(read_video || read_audio); steady_clock::time_point start = steady_clock::now(); if (int(frame.filename_idx) != last_filename_idx) { if (fd != -1) { close(fd); // Ignore errors. ++metric_frame_closed_files; } string filename; { lock_guard lock(frame_mu); filename = frame_filenames[frame.filename_idx]; } fd = open(filename.c_str(), O_RDONLY); if (fd == -1) { perror(filename.c_str()); abort(); } // We want readahead. (Ignore errors.) posix_fadvise(fd, 0, 0, POSIX_FADV_SEQUENTIAL); last_filename_idx = frame.filename_idx; ++metric_frame_opened_files; } Frame ret; if (read_video) { ret.video = read_string(fd, frame.size, frame.offset); } if (read_audio) { ret.audio = read_string(fd, frame.audio_size, frame.offset + frame.size); } steady_clock::time_point stop = steady_clock::now(); metric_frame_read_time_seconds.count_event(duration(stop - start).count()); metric_frame_read_bytes += frame.size; ++metric_frame_read_frames; return ret; } nageru-2.3.0/futatabi/frame_on_disk.h000066400000000000000000000053231450736322200175540ustar00rootroot00000000000000#ifndef _FRAME_ON_DISK_H #define _FRAME_ON_DISK_H 1 #include "defs.h" #include #include #include #include #include extern std::mutex frame_mu; struct FrameOnDisk { int64_t pts = -1; // -1 means empty. off_t offset; unsigned filename_idx; uint32_t size; // Not using size_t saves a few bytes; we can have so many frames. TODO: Not anymore due to audio_size. uint32_t audio_size; // Unfortunately, 32 bits wasted in padding here. }; extern std::vector frames[MAX_STREAMS]; // Under frame_mu. extern std::vector frame_filenames; // Under frame_mu. static bool inline operator==(const FrameOnDisk &a, const FrameOnDisk &b) { return a.pts == b.pts && a.offset == b.offset && a.filename_idx == b.filename_idx && a.size == b.size && a.audio_size == b.audio_size; } // A helper class to read frames from disk. It caches the file descriptor // so that the kernel has a better chance of doing readahead when it sees // the sequential reads. (For this reason, each display has a private // FrameReader. Thus, we can easily keep multiple open file descriptors around // for a single .frames file.) // // Thread-compatible, but not thread-safe. class FrameReader { public: FrameReader(); ~FrameReader(); struct Frame { std::string video; std::string audio; }; Frame read_frame(FrameOnDisk frame, bool read_video, bool read_audio); private: int fd = -1; int last_filename_idx = -1; }; // Utility functions for dealing with binary search. inline std::vector::iterator find_last_frame_before(std::vector &frames, int64_t pts_origin) { return std::lower_bound(frames.begin(), frames.end(), pts_origin, [](const FrameOnDisk &frame, int64_t pts) { return frame.pts < pts; }); } inline std::vector::const_iterator find_last_frame_before(const std::vector &frames, int64_t pts_origin) { return std::lower_bound(frames.begin(), frames.end(), pts_origin, [](const FrameOnDisk &frame, int64_t pts) { return frame.pts < pts; }); } inline std::vector::iterator find_first_frame_at_or_after(std::vector &frames, int64_t pts_origin) { return std::upper_bound(frames.begin(), frames.end(), pts_origin - 1, [](int64_t pts, const FrameOnDisk &frame) { return pts < frame.pts; }); } inline std::vector::const_iterator find_first_frame_at_or_after(const std::vector &frames, int64_t pts_origin) { return std::upper_bound(frames.begin(), frames.end(), pts_origin - 1, [](int64_t pts, const FrameOnDisk &frame) { return pts < frame.pts; }); } #endif // !defined(_FRAME_ON_DISK_H) nageru-2.3.0/futatabi/futatabi_midi_mapping.proto000066400000000000000000000045071450736322200222070ustar00rootroot00000000000000syntax = "proto2"; import "midi_mapping.proto"; message CameraMIDIMappingProto { optional MIDIButtonProto button = 1; optional int32 bank = 2; optional MIDILightProto is_current = 3; } message MIDIMappingProto { optional int32 num_controller_banks = 1 [default = 0]; // Max 5. // Bank switching. optional MIDIButtonProto prev_bank = 2; optional MIDIButtonProto next_bank = 3; optional MIDIButtonProto select_bank_1 = 4; optional MIDIButtonProto select_bank_2 = 5; optional MIDIButtonProto select_bank_3 = 6; optional MIDIButtonProto select_bank_4 = 7; optional MIDIButtonProto select_bank_5 = 8; optional MIDILightProto bank_1_is_selected = 9; optional MIDILightProto bank_2_is_selected = 10; optional MIDILightProto bank_3_is_selected = 11; optional MIDILightProto bank_4_is_selected = 12; optional MIDILightProto bank_5_is_selected = 13; // Controllers. optional MIDIControllerProto jog = 16; optional int32 jog_bank = 17; optional MIDIControllerProto master_speed = 34; optional int32 master_speed_bank = 35; optional MIDIControllerProto master_speed_light = 42; // NOTE: Controller, not light. optional int32 master_speed_light_min = 43; optional int32 master_speed_light_max = 44 [default=127]; // Inclusive. // Buttons. optional MIDIButtonProto preview = 18; optional int32 preview_bank = 19; optional MIDILightProto preview_playing = 41; optional MIDILightProto preview_ready = 20; optional MIDIButtonProto queue = 21; optional int32 queue_bank = 22; optional MIDILightProto queue_enabled = 23; optional MIDIButtonProto play = 24; optional int32 play_bank = 25; optional MIDILightProto playing = 26; optional MIDILightProto play_ready = 40; optional MIDIButtonProto next = 45; optional int32 next_button_bank = 46; optional MIDILightProto next_ready = 47; optional MIDIButtonProto toggle_lock = 36; optional int32 toggle_lock_bank = 37; optional MIDILightProto locked = 38; optional MIDILightProto locked_blinking = 39; optional MIDIButtonProto cue_in = 27; optional int32 cue_in_bank = 28; optional MIDILightProto cue_in_enabled = 29; // In practice always true currently. optional MIDIButtonProto cue_out = 30; optional int32 cue_out_bank = 31; optional MIDILightProto cue_out_enabled = 32; // In practice always true currently. // Camera buttons. repeated CameraMIDIMappingProto camera = 33; } nageru-2.3.0/futatabi/gpu_timers.cpp000066400000000000000000000037231450736322200174670ustar00rootroot00000000000000#include "gpu_timers.h" #include using namespace std; bool enable_timing = false; bool detailed_timing = false; bool in_warmup = false; pair GPUTimers::begin_timer(const string &name, int level) { if (!enable_timing) { return make_pair(0, 0); } GLuint queries[2]; glGenQueries(2, queries); glQueryCounter(queries[0], GL_TIMESTAMP); Timer timer; timer.name = name; timer.level = level; timer.query.first = queries[0]; timer.query.second = queries[1]; timers.push_back(timer); return timer.query; } GLint64 find_elapsed(pair queries) { // NOTE: This makes the CPU wait for the GPU. GLuint64 time_start, time_end; glGetQueryObjectui64v(queries.first, GL_QUERY_RESULT, &time_start); glGetQueryObjectui64v(queries.second, GL_QUERY_RESULT, &time_end); return time_end - time_start; } void GPUTimers::print() { for (size_t i = 0; i < timers.size(); ++i) { if (timers[i].level >= 4 && !detailed_timing) { // In practice, only affects the SOR sub-timers. continue; } GLint64 time_elapsed = find_elapsed(timers[i].query); for (int j = 0; j < timers[i].level * 2; ++j) { fprintf(stderr, " "); } if (detailed_timing) { // Look for any immediate subtimers, and see if they sum to the large one. size_t num_subtimers = 0; GLint64 sum_subtimers = 0; for (size_t j = i + 1; j < timers.size() && timers[j].level > timers[i].level; ++j) { if (timers[j].level != timers[i].level + 1) continue; ++num_subtimers; sum_subtimers += find_elapsed(timers[j].query); } if (num_subtimers > 0 && (time_elapsed - sum_subtimers) / 1e6 >= 0.01) { fprintf(stderr, "%-30s %4.3f ms [%4.3f ms unaccounted for]\n", timers[i].name.c_str(), time_elapsed / 1e6, (time_elapsed - sum_subtimers) / 1e6); } else { fprintf(stderr, "%-30s %4.3f ms\n", timers[i].name.c_str(), time_elapsed / 1e6); } } else { fprintf(stderr, "%-30s %4.1f ms\n", timers[i].name.c_str(), time_elapsed / 1e6); } } } nageru-2.3.0/futatabi/gpu_timers.h000066400000000000000000000021771450736322200171360ustar00rootroot00000000000000#ifndef _GPU_TIMERS_H #define _GPU_TIMERS_H 1 #include #include #include #include extern bool enable_timing; extern bool detailed_timing; extern bool in_warmup; class GPUTimers { public: void print(); std::pair begin_timer(const std::string &name, int level); private: struct Timer { std::string name; int level; std::pair query; }; std::vector timers; }; // A simple RAII class for timing until the end of the scope. class ScopedTimer { public: ScopedTimer(const std::string &name, GPUTimers *timers) : timers(timers), level(0) { query = timers->begin_timer(name, level); } ScopedTimer(const std::string &name, ScopedTimer *parent_timer) : timers(parent_timer->timers), level(parent_timer->level + 1) { query = timers->begin_timer(name, level); } ~ScopedTimer() { end(); } void end() { if (enable_timing && !ended) { glQueryCounter(query.second, GL_TIMESTAMP); ended = true; } } private: GPUTimers *timers; int level; std::pair query; bool ended = false; }; #endif // !defined(_GPU_TIMERS_H) nageru-2.3.0/futatabi/gray.frag000066400000000000000000000003401450736322200164000ustar00rootroot00000000000000#version 450 core in vec3 tc; out vec4 gray; uniform sampler2DArray tex; void main() { vec4 color = texture(tex, tc); gray.rgb = vec3(dot(color.rgb, vec3(0.2126f, 0.7152f, 0.0722f))); // Rec. 709. gray.a = color.a; } nageru-2.3.0/futatabi/hole_blend.frag000066400000000000000000000022631450736322200175370ustar00rootroot00000000000000#version 450 core in vec2 tc; out vec2 out_flow; uniform sampler2D left_tex, right_tex, up_tex, down_tex; void main() { // Some of these may contain “junk”, in the sense that they were // not written in the given pass, if they came from an edge. // Most of the time, this is benign, since it means we'll get // the previous value (left/right/up) again. However, if it were // bogus on the very first pass, we need to exclude it. // Thus the test for 100.0f (invalid flows are initialized to 1000, // all valid ones are less than 1). vec2 left = texture(left_tex, tc).xy; vec2 right = texture(right_tex, tc).xy; vec2 up = texture(up_tex, tc).xy; vec2 down = texture(down_tex, tc).xy; vec2 sum = vec2(0.0f); float num = 0.0f; if (left.x < 100.0f) { sum = left; num = 1.0f; } if (right.x < 100.0f) { sum += right; num += 1.0f; } if (up.x < 100.0f) { sum += up; num += 1.0f; } if (down.x < 100.0f) { sum += down; num += 1.0f; } // If _all_ of them were 0, this would mean the entire row _and_ column // would be devoid of flow. If so, the zero flow is fine for our purposes. if (num == 0.0f) { out_flow = vec2(0.0f); } else { out_flow = sum / num; } } nageru-2.3.0/futatabi/hole_fill.frag000066400000000000000000000003311450736322200173730ustar00rootroot00000000000000#version 450 core in vec2 tc; out vec2 out_flow; uniform sampler2D tex; void main() { vec2 flow = texture(tex, tc).xy; if (flow.x > 100.0f) { // Don't copy unset flows around. discard; } out_flow = flow; } nageru-2.3.0/futatabi/hole_fill.vert000066400000000000000000000012061450736322200174360ustar00rootroot00000000000000#version 450 core layout(location=0) in vec2 position; out vec2 tc; uniform float z; uniform vec2 sample_offset; void main() { // Moving the position is equivalent to moving the texture coordinate, // but cheaper -- as it means some of the fullscreen quad can be clipped away. vec2 adjusted_pos = position - sample_offset; // The result of glOrtho(0.0, 1.0, 0.0, 1.0, 0.0, 1.0) is: // // 2.000 0.000 0.000 -1.000 // 0.000 2.000 0.000 -1.000 // 0.000 0.000 -2.000 -1.000 // 0.000 0.000 0.000 1.000 gl_Position = vec4(2.0 * adjusted_pos.x - 1.0, 2.0 * adjusted_pos.y - 1.0, 2.0f * (z - 0.5f), 1.0); tc = position; } nageru-2.3.0/futatabi/jpeg_destroyer.h000066400000000000000000000004751450736322200200040ustar00rootroot00000000000000#ifndef _JPEG_DESTROYER_H #define _JPEG_DESTROYER_H 1 #include class JPEGDestroyer { public: JPEGDestroyer(jpeg_decompress_struct *dinfo) : dinfo(dinfo) {} ~JPEGDestroyer() { jpeg_destroy_decompress(dinfo); } private: jpeg_decompress_struct *dinfo; }; #endif // !defined(_JPEG_DESTROYER_H) nageru-2.3.0/futatabi/jpeg_frame.h000066400000000000000000000010351450736322200170470ustar00rootroot00000000000000#ifndef _JPEG_FRAME_H #define _JPEG_FRAME_H 1 #include #include #include "shared/ref_counted_gl_sync.h" #include "shared/ref_counted_texture.h" struct Frame { bool is_semiplanar = false; RefCountedTexture y; RefCountedTexture cb, cr; // For planar. RefCountedTexture cbcr; // For semiplanar. unsigned width, height; unsigned chroma_subsampling_x, chroma_subsampling_y; std::string exif_data; RefCountedGLsync uploaded_ui_thread; RefCountedGLsync uploaded_interpolation; }; #endif // !defined(_JPEG_FRAME_H) nageru-2.3.0/futatabi/jpeg_frame_view.cpp000066400000000000000000000471241450736322200204450ustar00rootroot00000000000000#include "jpeg_frame_view.h" #include "defs.h" #include "flags.h" #include "jpeg_destroyer.h" #include "jpeglib_error_wrapper.h" #include "pbo_pool.h" #include "shared/context.h" #include "shared/metrics.h" #include "shared/post_to_main_thread.h" #include "video_stream.h" #include "ycbcr_converter.h" #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include // Must come after the Qt stuff. #include "vaapi_jpeg_decoder.h" using namespace movit; using namespace std; using namespace std::chrono; namespace { // Just an arbitrary order for std::map. struct FrameOnDiskLexicalOrder { bool operator()(const FrameOnDisk &a, const FrameOnDisk &b) const { if (a.pts != b.pts) return a.pts < b.pts; if (a.offset != b.offset) return a.offset < b.offset; if (a.filename_idx != b.filename_idx) return a.filename_idx < b.filename_idx; assert(a.size == b.size); return false; } }; inline size_t frame_size(const Frame &frame) { size_t y_size = frame.width * frame.height; size_t cbcr_size = y_size / frame.chroma_subsampling_x / frame.chroma_subsampling_y; return y_size + cbcr_size * 2; } struct LRUFrame { shared_ptr frame; size_t last_used; }; // There can be multiple JPEGFrameView instances, so make all the metrics static. once_flag jpeg_metrics_inited; atomic metric_jpeg_cache_used_bytes{ 0 }; // Same value as cache_bytes_used. atomic metric_jpeg_cache_limit_bytes{ size_t(CACHE_SIZE_MB) * 1024 * 1024 }; atomic metric_jpeg_cache_given_up_frames{ 0 }; atomic metric_jpeg_cache_hit_frames{ 0 }; atomic metric_jpeg_cache_miss_frames{ 0 }; atomic metric_jpeg_software_decode_frames{ 0 }; atomic metric_jpeg_software_fail_frames{ 0 }; atomic metric_jpeg_vaapi_decode_frames{ 0 }; atomic metric_jpeg_vaapi_fail_frames{ 0 }; atomic metric_jpeg_prepared_frames{ 0 }; atomic metric_jpeg_displayed_frames{ 0 }; Summary metric_jpeg_decode_time_seconds; } // namespace mutex cache_mu; map cache; // Under cache_mu. size_t cache_bytes_used = 0; // Under cache_mu. atomic event_counter{ 0 }; extern QGLWidget *global_share_widget; extern atomic should_quit; shared_ptr decode_jpeg(const string &jpeg) { steady_clock::time_point start = steady_clock::now(); shared_ptr frame; if (vaapi_jpeg_decoding_usable) { frame = decode_jpeg_vaapi(jpeg); if (frame != nullptr) { ++metric_jpeg_vaapi_decode_frames; steady_clock::time_point stop = steady_clock::now(); metric_jpeg_decode_time_seconds.count_event(duration(stop - start).count()); return frame; } fprintf(stderr, "VA-API hardware decoding failed; falling back to software.\n"); ++metric_jpeg_vaapi_fail_frames; } frame.reset(new Frame); jpeg_decompress_struct dinfo; JPEGWrapErrorManager error_mgr(&dinfo); if (!error_mgr.run([&dinfo] { jpeg_create_decompress(&dinfo); })) { return get_black_frame(); } JPEGDestroyer destroy_dinfo(&dinfo); jpeg_save_markers(&dinfo, JPEG_APP0 + 1, 0xFFFF); if (!error_mgr.run([&dinfo, &jpeg] { jpeg_mem_src(&dinfo, reinterpret_cast(jpeg.data()), jpeg.size()); jpeg_read_header(&dinfo, true); })) { return get_black_frame(); } if (dinfo.num_components != 3) { fprintf(stderr, "Not a color JPEG. (%d components, Y=%dx%d, Cb=%dx%d, Cr=%dx%d)\n", dinfo.num_components, dinfo.comp_info[0].h_samp_factor, dinfo.comp_info[0].v_samp_factor, dinfo.comp_info[1].h_samp_factor, dinfo.comp_info[1].v_samp_factor, dinfo.comp_info[2].h_samp_factor, dinfo.comp_info[2].v_samp_factor); return get_black_frame(); } if (dinfo.comp_info[0].h_samp_factor != dinfo.max_h_samp_factor || dinfo.comp_info[0].v_samp_factor != dinfo.max_v_samp_factor || // Y' must not be subsampled. dinfo.comp_info[1].h_samp_factor != dinfo.comp_info[2].h_samp_factor || dinfo.comp_info[1].v_samp_factor != dinfo.comp_info[2].v_samp_factor || // Cb and Cr must be identically subsampled. (dinfo.max_h_samp_factor % dinfo.comp_info[1].h_samp_factor) != 0 || (dinfo.max_v_samp_factor % dinfo.comp_info[1].v_samp_factor) != 0) { // No 2:3 subsampling or other weirdness. fprintf(stderr, "Unsupported subsampling scheme. (Y=%dx%d, Cb=%dx%d, Cr=%dx%d)\n", dinfo.comp_info[0].h_samp_factor, dinfo.comp_info[0].v_samp_factor, dinfo.comp_info[1].h_samp_factor, dinfo.comp_info[1].v_samp_factor, dinfo.comp_info[2].h_samp_factor, dinfo.comp_info[2].v_samp_factor); abort(); } dinfo.raw_data_out = true; if (!error_mgr.run([&dinfo] { jpeg_start_decompress(&dinfo); })) { return get_black_frame(); } frame->width = dinfo.output_width; frame->height = dinfo.output_height; frame->chroma_subsampling_x = dinfo.max_h_samp_factor / dinfo.comp_info[1].h_samp_factor; frame->chroma_subsampling_y = dinfo.max_v_samp_factor / dinfo.comp_info[1].v_samp_factor; unsigned h_mcu_size = DCTSIZE * dinfo.max_h_samp_factor; unsigned v_mcu_size = DCTSIZE * dinfo.max_v_samp_factor; unsigned mcu_width_blocks = (dinfo.output_width + h_mcu_size - 1) / h_mcu_size; unsigned mcu_height_blocks = (dinfo.output_height + v_mcu_size - 1) / v_mcu_size; unsigned luma_width_blocks = mcu_width_blocks * dinfo.comp_info[0].h_samp_factor; unsigned chroma_width_blocks = mcu_width_blocks * dinfo.comp_info[1].h_samp_factor; PBO pbo = global_pbo_pool->alloc_pbo(); const size_t chroma_width = dinfo.image_width / frame->chroma_subsampling_x; const size_t chroma_height = dinfo.image_height / frame->chroma_subsampling_y; size_t cb_offset = dinfo.image_width * dinfo.image_height; size_t cr_offset = cb_offset + chroma_width * chroma_height; uint8_t *y_pix = pbo.ptr; uint8_t *cb_pix = pbo.ptr + cb_offset; uint8_t *cr_pix = pbo.ptr + cr_offset; unsigned pitch_y = luma_width_blocks * DCTSIZE; unsigned pitch_chroma = chroma_width_blocks * DCTSIZE; if (dinfo.marker_list != nullptr && dinfo.marker_list->marker == JPEG_APP0 + 1 && dinfo.marker_list->data_length >= 4 && memcmp(dinfo.marker_list->data, "Exif", 4) == 0) { frame->exif_data.assign(reinterpret_cast(dinfo.marker_list->data), dinfo.marker_list->data_length); } if (!error_mgr.run([&dinfo, &y_pix, &cb_pix, &cr_pix, pitch_y, pitch_chroma, v_mcu_size, mcu_height_blocks] { JSAMPROW yptr[v_mcu_size], cbptr[v_mcu_size], crptr[v_mcu_size]; JSAMPARRAY data[3] = { yptr, cbptr, crptr }; for (unsigned y = 0; y < mcu_height_blocks; ++y) { // NOTE: The last elements of cbptr/crptr will be unused for vertically subsampled chroma. for (unsigned yy = 0; yy < v_mcu_size; ++yy) { yptr[yy] = y_pix + (y * DCTSIZE * dinfo.max_v_samp_factor + yy) * pitch_y; cbptr[yy] = cb_pix + (y * DCTSIZE * dinfo.comp_info[1].v_samp_factor + yy) * pitch_chroma; crptr[yy] = cr_pix + (y * DCTSIZE * dinfo.comp_info[1].v_samp_factor + yy) * pitch_chroma; } jpeg_read_raw_data(&dinfo, data, v_mcu_size); } (void)jpeg_finish_decompress(&dinfo); })) { return get_black_frame(); } // FIXME: what about resolutions that are not divisible by the block factor? glBindBuffer(GL_PIXEL_UNPACK_BUFFER, pbo.pbo); frame->y = create_texture_2d(frame->width, frame->height, GL_R8, GL_RED, GL_UNSIGNED_BYTE, BUFFER_OFFSET(0)); frame->cb = create_texture_2d(chroma_width, chroma_height, GL_R8, GL_RED, GL_UNSIGNED_BYTE, BUFFER_OFFSET(cb_offset)); frame->cr = create_texture_2d(chroma_width, chroma_height, GL_R8, GL_RED, GL_UNSIGNED_BYTE, BUFFER_OFFSET(cr_offset)); glBindBuffer(GL_PIXEL_UNPACK_BUFFER, 0); glFlushMappedNamedBufferRange(pbo.pbo, 0, dinfo.image_width * dinfo.image_height + chroma_width * chroma_height * 2); glMemoryBarrier(GL_PIXEL_BUFFER_BARRIER_BIT); pbo.upload_done = RefCountedGLsync(GL_SYNC_GPU_COMMANDS_COMPLETE, /*flags=*/0); glFlush(); frame->uploaded_ui_thread = pbo.upload_done; frame->uploaded_interpolation = pbo.upload_done; global_pbo_pool->release_pbo(move(pbo)); ++metric_jpeg_software_decode_frames; steady_clock::time_point stop = steady_clock::now(); metric_jpeg_decode_time_seconds.count_event(duration(stop - start).count()); return frame; } void prune_cache() { // Assumes cache_mu is held. int64_t bytes_still_to_remove = cache_bytes_used - (size_t(CACHE_SIZE_MB) * 1024 * 1024) * 9 / 10; if (bytes_still_to_remove <= 0) return; vector> lru_timestamps_and_size; for (const auto &key_and_value : cache) { lru_timestamps_and_size.emplace_back( key_and_value.second.last_used, frame_size(*key_and_value.second.frame)); } sort(lru_timestamps_and_size.begin(), lru_timestamps_and_size.end()); // Remove the oldest ones until we are below 90% of the cache used. size_t lru_cutoff_point = 0; for (const pair &it : lru_timestamps_and_size) { lru_cutoff_point = it.first; bytes_still_to_remove -= it.second; if (bytes_still_to_remove <= 0) break; } for (auto it = cache.begin(); it != cache.end();) { if (it->second.last_used <= lru_cutoff_point) { cache_bytes_used -= frame_size(*it->second.frame); metric_jpeg_cache_used_bytes = cache_bytes_used; it = cache.erase(it); } else { ++it; } } } shared_ptr decode_jpeg_with_cache(FrameOnDisk frame_spec, CacheMissBehavior cache_miss_behavior, FrameReader *frame_reader, bool *did_decode) { *did_decode = false; { lock_guard lock(cache_mu); auto it = cache.find(frame_spec); if (it != cache.end()) { ++metric_jpeg_cache_hit_frames; it->second.last_used = event_counter++; return it->second.frame; } } if (cache_miss_behavior == RETURN_NULLPTR_IF_NOT_IN_CACHE) { ++metric_jpeg_cache_given_up_frames; return nullptr; } ++metric_jpeg_cache_miss_frames; *did_decode = true; shared_ptr frame = decode_jpeg(frame_reader->read_frame(frame_spec, /*read_video=*/true, /*read_audio=*/false).video); lock_guard lock(cache_mu); cache_bytes_used += frame_size(*frame); metric_jpeg_cache_used_bytes = cache_bytes_used; cache[frame_spec] = LRUFrame{ frame, event_counter++ }; if (cache_bytes_used > size_t(CACHE_SIZE_MB) * 1024 * 1024) { prune_cache(); } return frame; } void JPEGFrameView::jpeg_decoder_thread_func() { size_t num_decoded = 0, num_dropped = 0; pthread_setname_np(pthread_self(), "JPEGDecoder"); QSurface *surface = create_surface(); QOpenGLContext *context = create_context(surface); bool ok = make_current(context, surface); if (!ok) { fprintf(stderr, "Video stream couldn't get an OpenGL context\n"); abort(); } while (!should_quit.load()) { PendingDecode decode; CacheMissBehavior cache_miss_behavior = DECODE_IF_NOT_IN_CACHE; { unique_lock lock(cache_mu); // TODO: Perhaps under another lock? any_pending_decodes.wait(lock, [this] { return !pending_decodes.empty() || should_quit.load(); }); if (should_quit.load()) break; decode = pending_decodes.front(); pending_decodes.pop_front(); if (pending_decodes.size() > 3) { cache_miss_behavior = RETURN_NULLPTR_IF_NOT_IN_CACHE; } } if (decode.frame != nullptr) { // Already decoded, so just show it. setDecodedFrame(decode.frame, nullptr, 1.0f); continue; } shared_ptr primary_frame, secondary_frame; bool drop = false; for (int subframe_idx = 0; subframe_idx < 2; ++subframe_idx) { const FrameOnDisk &frame_spec = (subframe_idx == 0 ? decode.primary : decode.secondary); if (frame_spec.pts == -1) { // No secondary frame. continue; } bool found_in_cache; shared_ptr frame = decode_jpeg_with_cache(frame_spec, cache_miss_behavior, &frame_reader, &found_in_cache); if (frame == nullptr) { assert(cache_miss_behavior == RETURN_NULLPTR_IF_NOT_IN_CACHE); drop = true; break; } if (!found_in_cache) { ++num_decoded; if (num_decoded % 1000 == 0) { fprintf(stderr, "Decoded %zu images, dropped %zu (%.2f%% dropped)\n", num_decoded, num_dropped, (100.0 * num_dropped) / (num_decoded + num_dropped)); } } if (subframe_idx == 0) { primary_frame = std::move(frame); } else { secondary_frame = std::move(frame); } } if (drop) { ++num_dropped; continue; } // TODO: Could we get jitter between non-interpolated and interpolated frames here? setDecodedFrame(primary_frame, secondary_frame, decode.fade_alpha); } } JPEGFrameView::~JPEGFrameView() { any_pending_decodes.notify_all(); jpeg_decoder_thread.join(); } JPEGFrameView::JPEGFrameView(QWidget *parent) : QGLWidget(parent, global_share_widget) { call_once(jpeg_metrics_inited, [] { global_metrics.add("jpeg_cache_used_bytes", &metric_jpeg_cache_used_bytes, Metrics::TYPE_GAUGE); global_metrics.add("jpeg_cache_limit_bytes", &metric_jpeg_cache_limit_bytes, Metrics::TYPE_GAUGE); global_metrics.add("jpeg_cache_frames", { { "action", "given_up" } }, &metric_jpeg_cache_given_up_frames); global_metrics.add("jpeg_cache_frames", { { "action", "hit" } }, &metric_jpeg_cache_hit_frames); global_metrics.add("jpeg_cache_frames", { { "action", "miss" } }, &metric_jpeg_cache_miss_frames); global_metrics.add("jpeg_decode_frames", { { "decoder", "software" }, { "result", "decode" } }, &metric_jpeg_software_decode_frames); global_metrics.add("jpeg_decode_frames", { { "decoder", "software" }, { "result", "fail" } }, &metric_jpeg_software_fail_frames); global_metrics.add("jpeg_decode_frames", { { "decoder", "vaapi" }, { "result", "decode" } }, &metric_jpeg_vaapi_decode_frames); global_metrics.add("jpeg_decode_frames", { { "decoder", "vaapi" }, { "result", "fail" } }, &metric_jpeg_vaapi_fail_frames); global_metrics.add("jpeg_frames", { { "action", "prepared" } }, &metric_jpeg_prepared_frames); global_metrics.add("jpeg_frames", { { "action", "displayed" } }, &metric_jpeg_displayed_frames); vector quantiles{ 0.01, 0.1, 0.25, 0.5, 0.75, 0.9, 0.99 }; metric_jpeg_decode_time_seconds.init(quantiles, 60.0); global_metrics.add("jpeg_decode_time_seconds", &metric_jpeg_decode_time_seconds); }); } void JPEGFrameView::setFrame(unsigned stream_idx, FrameOnDisk frame, FrameOnDisk secondary_frame, float fade_alpha) { current_stream_idx = stream_idx; // TODO: Does this interact with fades? lock_guard lock(cache_mu); PendingDecode decode; decode.primary = frame; decode.secondary = secondary_frame; decode.fade_alpha = fade_alpha; pending_decodes.push_back(decode); any_pending_decodes.notify_all(); } void JPEGFrameView::setFrame(shared_ptr frame) { lock_guard lock(cache_mu); PendingDecode decode; decode.frame = std::move(frame); decode.fade_alpha = 0.0f; pending_decodes.push_back(decode); any_pending_decodes.notify_all(); } void JPEGFrameView::initializeGL() { init_pbo_pool(); glDisable(GL_BLEND); glDisable(GL_DEPTH_TEST); check_error(); resource_pool = new ResourcePool; jpeg_decoder_thread = std::thread(&JPEGFrameView::jpeg_decoder_thread_func, this); ycbcr_converter.reset(new YCbCrConverter(YCbCrConverter::OUTPUT_TO_RGBA, resource_pool)); ImageFormat inout_format; inout_format.color_space = COLORSPACE_sRGB; inout_format.gamma_curve = GAMMA_sRGB; overlay_chain.reset(new EffectChain(overlay_base_width, overlay_base_height, resource_pool)); overlay_input = (movit::FlatInput *)overlay_chain->add_input(new FlatInput(inout_format, FORMAT_GRAYSCALE, GL_UNSIGNED_BYTE, overlay_base_width, overlay_base_height)); overlay_chain->add_output(inout_format, OUTPUT_ALPHA_FORMAT_POSTMULTIPLIED); overlay_chain->finalize(); } void JPEGFrameView::resizeGL(int width, int height) { check_error(); glViewport(0, 0, width, height); check_error(); // Save these, as width() and height() will lie with DPI scaling. gl_width = width; gl_height = height; } void JPEGFrameView::paintGL() { glViewport(0, 0, gl_width, gl_height); if (current_frame == nullptr) { glClearColor(0.0f, 0.0f, 0.0f, 1.0f); glClear(GL_COLOR_BUFFER_BIT); return; } if (!displayed_this_frame) { ++metric_jpeg_displayed_frames; displayed_this_frame = true; } if (current_frame->uploaded_ui_thread != nullptr) { glWaitSync(current_frame->uploaded_ui_thread.get(), /*flags=*/0, GL_TIMEOUT_IGNORED); current_frame->uploaded_ui_thread.reset(); } if (current_secondary_frame != nullptr && current_secondary_frame->uploaded_ui_thread != nullptr) { glWaitSync(current_secondary_frame->uploaded_ui_thread.get(), /*flags=*/0, GL_TIMEOUT_IGNORED); current_secondary_frame->uploaded_ui_thread.reset(); } check_error(); current_chain->render_to_screen(); if (overlay_image != nullptr) { if (overlay_input_needs_refresh) { overlay_input->set_width(overlay_width); overlay_input->set_height(overlay_height); overlay_input->set_pixel_data(overlay_image->bits()); overlay_input_needs_refresh = false; } glViewport(gl_width - overlay_width, 0, overlay_width, overlay_height); overlay_chain->render_to_screen(); } } namespace { } // namespace void JPEGFrameView::setDecodedFrame(shared_ptr frame, shared_ptr secondary_frame, float fade_alpha) { post_to_main_thread([this, frame, secondary_frame, fade_alpha] { current_frame = frame; current_secondary_frame = secondary_frame; if (secondary_frame != nullptr) { current_chain = ycbcr_converter->prepare_chain_for_fade(frame, secondary_frame, fade_alpha); } else { current_chain = ycbcr_converter->prepare_chain_for_conversion(frame); } ++metric_jpeg_prepared_frames; displayed_this_frame = false; update(); }); } void JPEGFrameView::mousePressEvent(QMouseEvent *event) { if (event->type() == QEvent::MouseButtonPress && event->button() == Qt::LeftButton) { emit clicked(); } } void JPEGFrameView::set_overlay(const string &text) { if (text.empty()) { overlay_image.reset(); return; } // Figure out how large the texture needs to be. { QImage img(overlay_width, overlay_height, QImage::Format_Grayscale8); QPainter painter(&img); QFont font = painter.font(); font.setPointSize(12); QFontMetrics metrics(font); overlay_base_width = lrint(metrics.boundingRect(QString::fromStdString(text)).width() + 8.0); overlay_base_height = lrint(metrics.height()); } float dpr = QGuiApplication::primaryScreen()->devicePixelRatio(); overlay_width = lrint(overlay_base_width * dpr); overlay_height = lrint(overlay_base_height * dpr); // Work around OpenGL alignment issues. while (overlay_width % 4 != 0) ++overlay_width; // Now do the actual drawing. overlay_image.reset(new QImage(overlay_width, overlay_height, QImage::Format_Grayscale8)); overlay_image->setDevicePixelRatio(dpr); overlay_image->fill(0); QPainter painter(overlay_image.get()); painter.setPen(Qt::white); QFont font = painter.font(); font.setPointSize(12); painter.setFont(font); painter.drawText(QRectF(0, 0, overlay_base_width, overlay_base_height), Qt::AlignCenter, QString::fromStdString(text)); // Don't refresh immediately; we might not have an OpenGL context here. overlay_input_needs_refresh = true; } shared_ptr get_black_frame() { static shared_ptr black_frame; static once_flag flag; call_once(flag, [] { // Not really black, but whatever. :-) uint8_t black[] = { 0, 0, 0, 255 }; RefCountedTexture black_tex = create_texture_2d(1, 1, GL_RGBA8, GL_RGBA, GL_UNSIGNED_BYTE, black); black_frame->y = black_tex; black_frame->cb = black_tex; black_frame->cr = move(black_tex); black_frame->width = 1; black_frame->height = 1; black_frame->chroma_subsampling_x = 1; black_frame->chroma_subsampling_y = 1; }); ++metric_jpeg_software_fail_frames; return black_frame; } nageru-2.3.0/futatabi/jpeg_frame_view.h000066400000000000000000000056571450736322200201170ustar00rootroot00000000000000#ifndef _JPEG_FRAME_VIEW_H #define _JPEG_FRAME_VIEW_H 1 #include "frame_on_disk.h" #include "jpeg_frame.h" #include "ycbcr_converter.h" #include #include #include #include #include #include #include #include #include #include #include enum CacheMissBehavior { DECODE_IF_NOT_IN_CACHE, RETURN_NULLPTR_IF_NOT_IN_CACHE }; std::shared_ptr decode_jpeg(const std::string &jpeg); std::shared_ptr decode_jpeg_with_cache(FrameOnDisk id, CacheMissBehavior cache_miss_behavior, FrameReader *frame_reader, bool *did_decode); std::shared_ptr get_black_frame(); class JPEGFrameView : public QGLWidget { Q_OBJECT public: JPEGFrameView(QWidget *parent); ~JPEGFrameView(); void setFrame(unsigned stream_idx, FrameOnDisk frame, FrameOnDisk secondary_frame = {}, float fade_alpha = 0.0f); void setFrame(std::shared_ptr frame); void mousePressEvent(QMouseEvent *event) override; unsigned get_stream_idx() const { return current_stream_idx; } void setDecodedFrame(std::shared_ptr frame, std::shared_ptr secondary_frame, float fade_alpha); void set_overlay(const std::string &text); // Blank for none. signals: void clicked(); protected: void initializeGL() override; void resizeGL(int width, int height) override; void paintGL() override; private: void jpeg_decoder_thread_func(); FrameReader frame_reader; // The stream index of the latest frame we displayed. unsigned current_stream_idx = 0; std::unique_ptr ycbcr_converter; movit::EffectChain *current_chain = nullptr; // Owned by ycbcr_converter. bool displayed_this_frame = false; // Owned by the UI frame. std::shared_ptr current_frame; // So that we hold on to the textures. std::shared_ptr current_secondary_frame; // Same. int overlay_base_width = 16, overlay_base_height = 16; int overlay_width = overlay_base_width, overlay_height = overlay_base_height; std::unique_ptr overlay_image; // If nullptr, no overlay. std::unique_ptr overlay_chain; // Just to get the overlay on screen in the easiest way possible. movit::FlatInput *overlay_input; bool overlay_input_needs_refresh = false; int gl_width, gl_height; std::thread jpeg_decoder_thread; movit::ResourcePool *resource_pool = nullptr; struct PendingDecode { // For actual decodes (only if frame below is nullptr). FrameOnDisk primary, secondary; float fade_alpha; // Irrelevant if secondary.stream_idx == -1. // Already-decoded frames are also sent through PendingDecode, // so that they get drawn in the right order. If frame is nullptr, // it's a real decode. std::shared_ptr frame; }; std::condition_variable any_pending_decodes; std::deque pending_decodes; // Under cache_mu. }; #endif // !defined(_JPEG_FRAME_VIEW_H) nageru-2.3.0/futatabi/jpeglib_error_wrapper.h000066400000000000000000000040711450736322200213400ustar00rootroot00000000000000#ifndef _JPEGLIB_ERROR_WRAPPER #define _JPEGLIB_ERROR_WRAPPER 1 /* A wrapper class for libjpeg's very cumbersome error handling. By default, any error will simply exit(); you can set your own error handler, but it can't return. You can't throw exceptions through C code legally, so the only real choice is setjmp/longjmp, which is also what libjpeg recommends. However, longjmp has undefined behavior if a similar try/catch pair would invoke running any nontrivial destructors, so it's better to wrap it into a common class where we know for sure there are no such destructors; we choose to simply convert it into a normal true/false idiom for success/failure. Use as: JPEGWrapErrorManager error_mgr(&cinfo); if (!error_mgr.run([&cinfo]{ jpeg_read_header(&cinfo, true); })) { // Something went wrong. return nullptr; } if (!error_mgr.run([&cinfo]{ jpeg_start_decompress(&cinfo); })) { // Something went wrong. return nullptr; } // etc. If you call libjpeg calls outside of run() and they fail, or if you declare objects with nontrivial destructors in your lambda (including in the capture), you end up in undefined behavior. */ #include #include struct JPEGWrapErrorManager { struct jpeg_error_mgr pub; jmp_buf setjmp_buffer; explicit JPEGWrapErrorManager(jpeg_compress_struct *cinfo) // Does not take ownership. { cinfo->err = jpeg_std_error(&pub); pub.error_exit = error_exit_thunk; } explicit JPEGWrapErrorManager(jpeg_decompress_struct *dinfo) // Does not take ownership. { dinfo->err = jpeg_std_error(&pub); pub.error_exit = error_exit_thunk; } static void error_exit_thunk(jpeg_common_struct *cinfo) { ((JPEGWrapErrorManager *)cinfo->err)->error_exit(cinfo); } void error_exit(jpeg_common_struct *cinfo) { (pub.output_message)(cinfo); longjmp(setjmp_buffer, 1); } // Returns false if and only if the call failed. template inline bool run(T &&func) { if (setjmp(setjmp_buffer)) { return false; } func(); return true; } }; #endif nageru-2.3.0/futatabi/lock.svg000066400000000000000000000025361450736322200162570ustar00rootroot00000000000000 lock https://www.gnu.org/licenses/gpl-3.0.txt nageru-2.3.0/futatabi/main.cpp000066400000000000000000000403601450736322200162330ustar00rootroot00000000000000#include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include extern "C" { #include } #include "clip_list.h" #include "defs.h" #include "flags.h" #include "frame.pb.h" #include "frame_on_disk.h" #include "mainwindow.h" #include "player.h" #include "shared/context.h" #include "shared/disk_space_estimator.h" #include "shared/ffmpeg_raii.h" #include "shared/httpd.h" #include "shared/metrics.h" #include "shared/post_to_main_thread.h" #include "shared/ref_counted_gl_sync.h" #include "shared/timebase.h" #include "ui_mainwindow.h" #include "vaapi_jpeg_decoder.h" #include #include #include #include #include #include using namespace std; using namespace std::chrono; constexpr char frame_magic[] = "Ftbifrm0"; constexpr size_t frame_magic_len = 8; mutex RefCountedGLsync::fence_lock; atomic should_quit{ false }; int64_t start_pts = -1; // TODO: Replace by some sort of GUI control, I guess. int64_t current_pts = 0; struct FrameFile { FILE *fp = nullptr; unsigned filename_idx; size_t frames_written_so_far = 0; }; std::map open_frame_files; mutex frame_mu; vector frames[MAX_STREAMS]; // Under frame_mu. vector frame_filenames; // Under frame_mu. atomic metric_received_frames[MAX_STREAMS]{ { 0 } }; Summary metric_received_frame_size_bytes; namespace { FrameOnDisk write_frame(int stream_idx, int64_t pts, const uint8_t *data, size_t size, vector audio, DB *db) { if (open_frame_files.count(stream_idx) == 0) { char filename[256]; snprintf(filename, sizeof(filename), "%s/frames/cam%d-pts%09" PRId64 ".frames", global_flags.working_directory.c_str(), stream_idx, pts); FILE *fp = fopen(filename, "wb"); if (fp == nullptr) { perror(filename); abort(); } lock_guard lock(frame_mu); unsigned filename_idx = frame_filenames.size(); frame_filenames.push_back(filename); open_frame_files[stream_idx] = FrameFile{ fp, filename_idx, 0 }; } FrameFile &file = open_frame_files[stream_idx]; unsigned filename_idx = file.filename_idx; string filename; { lock_guard lock(frame_mu); filename = frame_filenames[filename_idx]; } FrameHeaderProto hdr; hdr.set_stream_idx(stream_idx); hdr.set_pts(pts); hdr.set_file_size(size); hdr.set_audio_size(audio.size() * sizeof(audio[0])); string serialized; if (!hdr.SerializeToString(&serialized)) { fprintf(stderr, "Frame header serialization failed.\n"); abort(); } uint32_t len = htonl(serialized.size()); if (fwrite(frame_magic, frame_magic_len, 1, file.fp) != 1) { perror("fwrite"); abort(); } if (fwrite(&len, sizeof(len), 1, file.fp) != 1) { perror("fwrite"); abort(); } if (fwrite(serialized.data(), serialized.size(), 1, file.fp) != 1) { perror("fwrite"); abort(); } off_t offset = ftell(file.fp); if (fwrite(data, size, 1, file.fp) != 1) { perror("fwrite"); abort(); } if (audio.size() > 0) { if (fwrite(audio.data(), hdr.audio_size(), 1, file.fp) != 1) { perror("fwrite"); exit(1); } } fflush(file.fp); // No fsync(), though. We can accept losing a few frames. global_disk_space_estimator->report_write(filename, 8 + sizeof(len) + serialized.size() + size, pts); FrameOnDisk frame; frame.pts = pts; frame.filename_idx = filename_idx; frame.offset = offset; frame.size = size; frame.audio_size = audio.size() * sizeof(audio[0]); { lock_guard lock(frame_mu); assert(stream_idx < MAX_STREAMS); frames[stream_idx].push_back(frame); } if (++file.frames_written_so_far >= FRAMES_PER_FILE) { size_t size = ftell(file.fp); // Start a new file next time. if (fclose(file.fp) != 0) { perror("fclose"); abort(); } open_frame_files.erase(stream_idx); // Write information about all frames in the finished file to SQLite. // (If we crash before getting to do this, we'll be scanning through // the file on next startup, and adding it to the database then.) // NOTE: Since we don't fsync(), we could in theory get broken data // but with the right size, but it would seem unlikely. vector frames_this_file; { lock_guard lock(frame_mu); for (size_t stream_idx = 0; stream_idx < MAX_STREAMS; ++stream_idx) { for (const FrameOnDisk &frame : frames[stream_idx]) { if (frame.filename_idx == filename_idx) { frames_this_file.emplace_back(DB::FrameOnDiskAndStreamIdx{ frame, unsigned(stream_idx) }); } } } } const char *basename = filename.c_str(); while (strchr(basename, '/') != nullptr) { basename = strchr(basename, '/') + 1; } db->store_frame_file(basename, size, frames_this_file); } return frame; } } // namespace HTTPD *global_httpd; void load_existing_frames(); void record_thread_func(); int main(int argc, char **argv) { parse_flags(argc, argv); if (optind == argc) { global_flags.stream_source = "multicam.mp4"; global_flags.slow_down_input = true; } else if (optind + 1 == argc) { global_flags.stream_source = argv[optind]; } else { usage(); abort(); } string frame_dir = global_flags.working_directory + "/frames"; if (mkdir(frame_dir.c_str(), 0777) == 0) { fprintf(stderr, "%s does not exist, creating it.\n", frame_dir.c_str()); } else if (errno != EEXIST) { perror(global_flags.working_directory.c_str()); abort(); } avformat_network_init(); global_metrics.set_prefix("futatabi"); global_httpd = new HTTPD; global_metrics.remove("num_connected_multicam_clients"); QCoreApplication::setAttribute(Qt::AA_ShareOpenGLContexts, true); QSurfaceFormat fmt; fmt.setDepthBufferSize(0); fmt.setStencilBufferSize(0); fmt.setProfile(QSurfaceFormat::CoreProfile); fmt.setMajorVersion(4); fmt.setMinorVersion(5); // Turn off vsync, since Qt generally gives us at most frame rate // (display frequency) / (number of QGLWidgets active). fmt.setSwapInterval(0); QSurfaceFormat::setDefaultFormat(fmt); QGLFormat::setDefaultFormat(QGLFormat::fromSurfaceFormat(fmt)); QApplication app(argc, argv); global_share_widget = new QGLWidget(); if (!global_share_widget->isValid()) { fprintf(stderr, "Failed to initialize OpenGL. Futatabi needs at least OpenGL 4.5 to function properly.\n"); abort(); } // Initialize Movit. { QSurface *surface = create_surface(); QOpenGLContext *context = create_context(surface); if (!make_current(context, surface)) { printf("oops\n"); abort(); } CHECK(movit::init_movit(MOVIT_SHADER_DIR, movit::MOVIT_DEBUG_OFF)); delete_context(context); // TODO: Delete the surface, too. } load_existing_frames(); for (int stream_idx = 0; stream_idx < MAX_STREAMS; ++stream_idx) { if (!frames[stream_idx].empty()) { assert(start_pts > frames[stream_idx].back().pts); } } MainWindow main_window; main_window.show(); global_httpd->add_endpoint("/queue_status", bind(&MainWindow::get_queue_status, &main_window), HTTPD::NO_CORS_POLICY); global_httpd->start(global_flags.http_port); init_jpeg_vaapi(); thread record_thread(record_thread_func); int ret = app.exec(); should_quit = true; record_thread.join(); return ret; } void load_frame_file(const char *filename, const string &basename, unsigned filename_idx, DB *db) { struct stat st; if (stat(filename, &st) == -1) { perror(filename); abort(); } vector all_frames = db->load_frame_file(basename, st.st_size, filename_idx); if (!all_frames.empty()) { // We already had this cached in the database, so no need to look in the file. for (const DB::FrameOnDiskAndStreamIdx &frame : all_frames) { if (frame.stream_idx < MAX_STREAMS) { frames[frame.stream_idx].push_back(frame.frame); start_pts = max(start_pts, frame.frame.pts); } } return; } FILE *fp = fopen(filename, "rb"); if (fp == nullptr) { perror(filename); abort(); } // Find the actual length of the file, since fseek() past the end of the file // will succeed without an error. if (fseek(fp, 0, SEEK_END) == -1) { perror("fseek(SEEK_END)"); abort(); } off_t file_len = ftell(fp); if (fseek(fp, 0, SEEK_SET) == -1) { perror("fseek(SEEK_SET)"); abort(); } size_t magic_offset = 0; size_t skipped_bytes = 0; while (!feof(fp) && !ferror(fp)) { int ch = getc(fp); if (ch == -1) { break; } if (ch != frame_magic[magic_offset++]) { skipped_bytes += magic_offset; magic_offset = 0; continue; } if (magic_offset < frame_magic_len) { // Still reading the magic (hopefully). continue; } // OK, found the magic. Try to parse the frame header. magic_offset = 0; if (skipped_bytes > 0) { fprintf(stderr, "WARNING: %s: Skipped %zu garbage bytes in the middle.\n", filename, skipped_bytes); skipped_bytes = 0; } uint32_t len; if (fread(&len, sizeof(len), 1, fp) != 1) { fprintf(stderr, "WARNING: %s: Short read when getting length.\n", filename); break; } string serialized; serialized.resize(ntohl(len)); if (fread(&serialized[0], serialized.size(), 1, fp) != 1) { fprintf(stderr, "WARNING: %s: Short read when reading frame header (%zu bytes).\n", filename, serialized.size()); break; } FrameHeaderProto hdr; if (!hdr.ParseFromString(serialized)) { fprintf(stderr, "WARNING: %s: Corrupted frame header.\n", filename); continue; } FrameOnDisk frame; frame.pts = hdr.pts(); frame.offset = ftell(fp); if (frame.offset == -1) { fprintf(stderr, "WARNING: %s: ftell() failed (%s).\n", filename, strerror(errno)); break; } frame.filename_idx = filename_idx; frame.size = hdr.file_size(); frame.audio_size = hdr.audio_size(); if (frame.offset + frame.size + frame.audio_size > file_len || fseek(fp, frame.offset + frame.size + frame.audio_size, SEEK_SET) == -1) { fprintf(stderr, "WARNING: %s: Could not seek past frame (probably truncated).\n", filename); break; } if (hdr.stream_idx() >= 0 && hdr.stream_idx() < MAX_STREAMS) { frames[hdr.stream_idx()].push_back(frame); start_pts = max(start_pts, hdr.pts()); } all_frames.emplace_back(DB::FrameOnDiskAndStreamIdx{ frame, unsigned(hdr.stream_idx()) }); } if (skipped_bytes > 0) { fprintf(stderr, "WARNING: %s: Skipped %zu garbage bytes at the end.\n", filename, skipped_bytes); } off_t size = ftell(fp); fclose(fp); if (size == -1) { fprintf(stderr, "WARNING: %s: ftell() failed (%s).\n", filename, strerror(errno)); return; } db->store_frame_file(basename, size, all_frames); } void load_existing_frames() { QProgressDialog progress("Scanning frame directory...", "Abort", 0, 1); progress.setWindowTitle("Futatabi"); progress.setWindowModality(Qt::WindowModal); progress.setMinimumDuration(1000); progress.setMaximum(1); progress.setValue(0); string frame_dir = global_flags.working_directory + "/frames"; DIR *dir = opendir(frame_dir.c_str()); if (dir == nullptr) { perror("frames/"); start_pts = 0; return; } vector frame_basenames; for (;;) { errno = 0; dirent *de = readdir(dir); if (de == nullptr) { if (errno != 0) { perror("readdir"); abort(); } break; } if (de->d_type == DT_REG || de->d_type == DT_LNK) { string filename = frame_dir + "/" + de->d_name; frame_filenames.push_back(filename); frame_basenames.push_back(de->d_name); } if (progress.wasCanceled()) { abort(); } } closedir(dir); progress.setMaximum(frame_filenames.size() + 2); progress.setValue(1); progress.setLabelText("Opening database..."); DB db(global_flags.working_directory + "/futatabi.db"); progress.setLabelText("Reading frame files..."); progress.setValue(2); for (size_t i = 0; i < frame_filenames.size(); ++i) { load_frame_file(frame_filenames[i].c_str(), frame_basenames[i], i, &db); progress.setValue(i + 3); if (progress.wasCanceled()) { abort(); } } if (start_pts == -1) { start_pts = 0; } else { // Add a gap of one second from the old frames to the new ones. start_pts += TIMEBASE; } current_pts = start_pts; for (int stream_idx = 0; stream_idx < MAX_STREAMS; ++stream_idx) { sort(frames[stream_idx].begin(), frames[stream_idx].end(), [](const auto &a, const auto &b) { return a.pts < b.pts; }); } db.clean_unused_frame_files(frame_basenames); } void record_thread_func() { for (unsigned i = 0; i < MAX_STREAMS; ++i) { global_metrics.add("received_frames", { { "stream", to_string(i) } }, &metric_received_frames[i]); } global_metrics.add("received_frame_size_bytes", &metric_received_frame_size_bytes); if (global_flags.stream_source.empty() || global_flags.stream_source == "/dev/null") { // Save the user from some repetitive messages. return; } pthread_setname_np(pthread_self(), "ReceiveFrames"); int64_t pts_offset = 0; // Needs to be initialized due to a spurious GCC warning. DB db(global_flags.working_directory + "/futatabi.db"); while (!should_quit.load()) { auto format_ctx = avformat_open_input_unique(global_flags.stream_source.c_str(), nullptr, nullptr); if (format_ctx == nullptr) { fprintf(stderr, "%s: Error opening file. Waiting one second and trying again...\n", global_flags.stream_source.c_str()); sleep(1); continue; } // Match any audio streams to video streams, sequentially. vector video_stream_idx, audio_stream_idx; for (unsigned i = 0; i < format_ctx->nb_streams; ++i) { if (format_ctx->streams[i]->codecpar->codec_type == AVMEDIA_TYPE_VIDEO) { video_stream_idx.push_back(i); } else if (format_ctx->streams[i]->codecpar->codec_type == AVMEDIA_TYPE_AUDIO) { audio_stream_idx.push_back(i); } } unordered_map audio_stream_to_video_stream_idx; for (size_t i = 0; i < min(video_stream_idx.size(), audio_stream_idx.size()); ++i) { audio_stream_to_video_stream_idx[audio_stream_idx[i]] = video_stream_idx[i]; } vector pending_audio[MAX_STREAMS]; int64_t last_pts = -1; while (!should_quit.load()) { AVPacketWithDeleter pkt = av_packet_alloc_unique(); pkt->data = nullptr; pkt->size = 0; // TODO: Make it possible to abort av_read_frame() (use an interrupt callback); // right now, should_quit will be ignored if it's hung on I/O. if (av_read_frame(format_ctx.get(), pkt.get()) != 0) { break; } AVStream *stream = format_ctx->streams[pkt->stream_index]; if (stream->codecpar->codec_type == AVMEDIA_TYPE_AUDIO && audio_stream_to_video_stream_idx.count(pkt->stream_index)) { if ((pkt->size % (sizeof(uint32_t) * 2)) != 0) { fprintf(stderr, "Audio stream %u had a packet of strange length %d, ignoring.\n", pkt->stream_index, pkt->size); } else { // TODO: Endianness? const uint32_t *begin = (const uint32_t *)pkt->data; const uint32_t *end = (const uint32_t *)(pkt->data + pkt->size); pending_audio[audio_stream_to_video_stream_idx[pkt->stream_index]].assign(begin, end); } } if (pkt->stream_index >= MAX_STREAMS || stream->codecpar->codec_type != AVMEDIA_TYPE_VIDEO) { continue; } ++metric_received_frames[pkt->stream_index]; metric_received_frame_size_bytes.count_event(pkt->size); // Convert pts to our own timebase. AVRational stream_timebase = stream->time_base; int64_t pts = av_rescale_q(pkt->pts, stream_timebase, AVRational{ 1, TIMEBASE }); // Translate offset into our stream. if (last_pts == -1) { pts_offset = start_pts - pts; } pts = std::max(pts + pts_offset, start_pts); //fprintf(stderr, "Got a frame from camera %d, pts = %ld, size = %d\n", // pkt->stream_index, pts, pkt->size); FrameOnDisk frame = write_frame(pkt->stream_index, pts, pkt->data, pkt->size, move(pending_audio[pkt->stream_index]), &db); post_to_main_thread([stream_index{pkt->stream_index}, frame] { global_mainwindow->display_frame(stream_index, frame); }); if (last_pts != -1 && global_flags.slow_down_input) { this_thread::sleep_for(microseconds((pts - last_pts) * 1000000 / TIMEBASE)); } last_pts = pts; current_pts = pts; } if (!should_quit.load()) { fprintf(stderr, "%s: Hit EOF. Waiting one second and trying again...\n", global_flags.stream_source.c_str()); sleep(1); } start_pts = last_pts + TIMEBASE; } } nageru-2.3.0/futatabi/mainwindow.cpp000066400000000000000000001404601450736322200174650ustar00rootroot00000000000000#include "mainwindow.h" #include "clip_list.h" #include "export.h" #include "flags.h" #include "frame_on_disk.h" #include "player.h" #include "futatabi_midi_mapping.pb.h" #include "midi_mapping_dialog.h" #include "pbo_pool.h" #include "shared/aboutdialog.h" #include "shared/disk_space_estimator.h" #include "shared/post_to_main_thread.h" #include "shared/timebase.h" #include "ui_mainwindow.h" #include #include #include #include #include #include #include #include #include #include #include #include using namespace std; using namespace std::placeholders; MainWindow *global_mainwindow = nullptr; static ClipList *cliplist_clips; static PlayList *playlist_clips; extern int64_t current_pts; namespace { void set_pts_in(int64_t pts, int64_t current_pts, ClipProxy &clip) { pts = std::max(pts, 0); if (clip->pts_out == -1) { pts = std::min(pts, current_pts); } else { pts = std::min(pts, clip->pts_out); } clip->pts_in = pts; } } // namespace MainWindow::MainWindow() : ui(new Ui::MainWindow), db(global_flags.working_directory + "/futatabi.db"), midi_mapper(this) { global_mainwindow = this; ui->setupUi(this); // Load settings from database. SettingsProto settings = db.get_settings(); if (!global_flags.interpolation_quality_set) { if (settings.interpolation_quality() != 0) { global_flags.interpolation_quality = settings.interpolation_quality() - 1; } } if (!global_flags.cue_in_point_padding_set) { global_flags.cue_in_point_padding_seconds = settings.cue_in_point_padding_seconds(); // Default 0 is fine. } if (!global_flags.cue_out_point_padding_set) { global_flags.cue_out_point_padding_seconds = settings.cue_out_point_padding_seconds(); // Default 0 is fine. } if (global_flags.interpolation_quality == 0) { // Allocate something just for simplicity; we won't be using it // unless the user changes runtime, in which case 1 is fine. flow_initialized_interpolation_quality = 1; } else { flow_initialized_interpolation_quality = global_flags.interpolation_quality; } save_settings(); // The menus. connect(ui->midi_mapping_action, &QAction::triggered, this, &MainWindow::midi_mapping_triggered); connect(ui->exit_action, &QAction::triggered, this, &MainWindow::exit_triggered); connect(ui->export_cliplist_clip_multitrack_action, &QAction::triggered, this, &MainWindow::export_cliplist_clip_multitrack_triggered); connect(ui->export_playlist_clip_interpolated_action, &QAction::triggered, this, &MainWindow::export_playlist_clip_interpolated_triggered); connect(ui->manual_action, &QAction::triggered, this, &MainWindow::manual_triggered); connect(ui->about_action, &QAction::triggered, this, &MainWindow::about_triggered); connect(ui->undo_action, &QAction::triggered, this, &MainWindow::undo_triggered); connect(ui->redo_action, &QAction::triggered, this, &MainWindow::redo_triggered); ui->undo_action->setEnabled(false); ui->redo_action->setEnabled(false); // The quality group. QActionGroup *quality_group = new QActionGroup(ui->interpolation_menu); quality_group->addAction(ui->quality_0_action); quality_group->addAction(ui->quality_1_action); quality_group->addAction(ui->quality_2_action); quality_group->addAction(ui->quality_3_action); quality_group->addAction(ui->quality_4_action); if (global_flags.interpolation_quality == 0) { ui->quality_0_action->setChecked(true); } else if (global_flags.interpolation_quality == 1) { ui->quality_1_action->setChecked(true); } else if (global_flags.interpolation_quality == 2) { ui->quality_2_action->setChecked(true); } else if (global_flags.interpolation_quality == 3) { ui->quality_3_action->setChecked(true); } else if (global_flags.interpolation_quality == 4) { ui->quality_4_action->setChecked(true); } else { assert(false); } connect(ui->quality_0_action, &QAction::toggled, bind(&MainWindow::quality_toggled, this, 0, _1)); connect(ui->quality_1_action, &QAction::toggled, bind(&MainWindow::quality_toggled, this, 1, _1)); connect(ui->quality_2_action, &QAction::toggled, bind(&MainWindow::quality_toggled, this, 2, _1)); connect(ui->quality_3_action, &QAction::toggled, bind(&MainWindow::quality_toggled, this, 3, _1)); connect(ui->quality_4_action, &QAction::toggled, bind(&MainWindow::quality_toggled, this, 4, _1)); // The cue-in point padding group. QActionGroup *in_padding_group = new QActionGroup(ui->in_padding_menu); in_padding_group->addAction(ui->in_padding_0_action); in_padding_group->addAction(ui->in_padding_1_action); in_padding_group->addAction(ui->in_padding_2_action); in_padding_group->addAction(ui->in_padding_5_action); if (global_flags.cue_in_point_padding_seconds <= 1e-3) { ui->in_padding_0_action->setChecked(true); } else if (fabs(global_flags.cue_in_point_padding_seconds - 1.0) < 1e-3) { ui->in_padding_1_action->setChecked(true); } else if (fabs(global_flags.cue_in_point_padding_seconds - 2.0) < 1e-3) { ui->in_padding_2_action->setChecked(true); } else if (fabs(global_flags.cue_in_point_padding_seconds - 5.0) < 1e-3) { ui->in_padding_5_action->setChecked(true); } else { // Nothing to check, which is fine. } connect(ui->in_padding_0_action, &QAction::toggled, bind(&MainWindow::in_padding_toggled, this, 0.0, _1)); connect(ui->in_padding_1_action, &QAction::toggled, bind(&MainWindow::in_padding_toggled, this, 1.0, _1)); connect(ui->in_padding_2_action, &QAction::toggled, bind(&MainWindow::in_padding_toggled, this, 2.0, _1)); connect(ui->in_padding_5_action, &QAction::toggled, bind(&MainWindow::in_padding_toggled, this, 5.0, _1)); // Same for the cue-out padding. QActionGroup *out_padding_group = new QActionGroup(ui->out_padding_menu); out_padding_group->addAction(ui->out_padding_0_action); out_padding_group->addAction(ui->out_padding_1_action); out_padding_group->addAction(ui->out_padding_2_action); out_padding_group->addAction(ui->out_padding_5_action); if (global_flags.cue_out_point_padding_seconds <= 1e-3) { ui->out_padding_0_action->setChecked(true); } else if (fabs(global_flags.cue_out_point_padding_seconds - 1.0) < 1e-3) { ui->out_padding_1_action->setChecked(true); } else if (fabs(global_flags.cue_out_point_padding_seconds - 2.0) < 1e-3) { ui->out_padding_2_action->setChecked(true); } else if (fabs(global_flags.cue_out_point_padding_seconds - 5.0) < 1e-3) { ui->out_padding_5_action->setChecked(true); } else { // Nothing to check, which is fine. } connect(ui->out_padding_0_action, &QAction::toggled, bind(&MainWindow::out_padding_toggled, this, 0.0, _1)); connect(ui->out_padding_1_action, &QAction::toggled, bind(&MainWindow::out_padding_toggled, this, 1.0, _1)); connect(ui->out_padding_2_action, &QAction::toggled, bind(&MainWindow::out_padding_toggled, this, 2.0, _1)); connect(ui->out_padding_5_action, &QAction::toggled, bind(&MainWindow::out_padding_toggled, this, 5.0, _1)); global_disk_space_estimator = new DiskSpaceEstimator(bind(&MainWindow::report_disk_space, this, _1, _2)); disk_free_label = new QLabel(this); disk_free_label->setStyleSheet("QLabel {padding-right: 5px;}"); ui->menuBar->setCornerWidget(disk_free_label); StateProto state = db.get_state(); undo_stack.push_back(state); // The undo stack always has the current state on top. cliplist_clips = new ClipList(state.clip_list()); ui->clip_list->setModel(cliplist_clips); connect(cliplist_clips, &ClipList::any_content_changed, this, &MainWindow::content_changed); playlist_clips = new PlayList(state.play_list()); ui->playlist->setModel(playlist_clips); connect(playlist_clips, &PlayList::any_content_changed, this, &MainWindow::content_changed); // For un-highlighting when we lose focus. ui->clip_list->installEventFilter(this); // For scrubbing in the pts columns. ui->clip_list->viewport()->installEventFilter(this); ui->playlist->viewport()->installEventFilter(this); QShortcut *cue_in = new QShortcut(QKeySequence(Qt::Key_A), this); connect(cue_in, &QShortcut::activated, ui->cue_in_btn, &QPushButton::click); connect(ui->cue_in_btn, &QPushButton::clicked, this, &MainWindow::cue_in_clicked); QShortcut *cue_out = new QShortcut(QKeySequence(Qt::Key_S), this); connect(cue_out, &QShortcut::activated, ui->cue_out_btn, &QPushButton::click); connect(ui->cue_out_btn, &QPushButton::clicked, this, &MainWindow::cue_out_clicked); QShortcut *queue = new QShortcut(QKeySequence(Qt::Key_Q), this); connect(queue, &QShortcut::activated, ui->queue_btn, &QPushButton::click); connect(ui->queue_btn, &QPushButton::clicked, this, &MainWindow::queue_clicked); QShortcut *preview = new QShortcut(QKeySequence(Qt::Key_W), this); connect(preview, &QShortcut::activated, ui->preview_btn, &QPushButton::click); connect(ui->preview_btn, &QPushButton::clicked, this, &MainWindow::preview_clicked); QShortcut *play = new QShortcut(QKeySequence(Qt::Key_Space), this); connect(play, &QShortcut::activated, ui->play_btn, &QPushButton::click); connect(ui->play_btn, &QPushButton::clicked, this, &MainWindow::play_clicked); QShortcut *next = new QShortcut(QKeySequence(Qt::Key_N), this); connect(next, &QShortcut::activated, ui->next_btn, &QPushButton::click); connect(ui->next_btn, &QPushButton::clicked, this, &MainWindow::next_clicked); connect(ui->stop_btn, &QPushButton::clicked, this, &MainWindow::stop_clicked); ui->stop_btn->setEnabled(false); connect(ui->speed_slider, &QAbstractSlider::valueChanged, this, &MainWindow::speed_slider_changed); connect(ui->speed_lock_btn, &QPushButton::clicked, this, &MainWindow::speed_lock_clicked); connect(ui->playlist_duplicate_btn, &QPushButton::clicked, this, &MainWindow::playlist_duplicate); connect(ui->playlist_remove_btn, &QPushButton::clicked, this, &MainWindow::playlist_remove); QShortcut *delete_key = new QShortcut(QKeySequence(Qt::Key_Delete), ui->playlist); connect(delete_key, &QShortcut::activated, [this] { if (ui->playlist->hasFocus()) { playlist_remove(); } }); // TODO: support drag-and-drop. connect(ui->playlist_move_up_btn, &QPushButton::clicked, [this] { playlist_move(-1); }); connect(ui->playlist_move_down_btn, &QPushButton::clicked, [this] { playlist_move(1); }); connect(ui->playlist->selectionModel(), &QItemSelectionModel::selectionChanged, this, &MainWindow::playlist_selection_changed); playlist_selection_changed(); // First time set-up. preview_player.reset(new Player(ui->preview_display, Player::NO_STREAM_OUTPUT)); preview_player->set_done_callback([this] { post_to_main_thread([this] { preview_player_done(); }); }); live_player.reset(new Player(ui->live_display, Player::HTTPD_STREAM_OUTPUT)); live_player->set_done_callback([this] { post_to_main_thread([this] { live_player_done(); }); }); live_player->set_progress_callback([this](const map &progress, TimeRemaining time_remaining) { post_to_main_thread([this, progress, time_remaining] { live_player_clip_progress(progress, time_remaining); }); }); set_output_status("paused"); enable_or_disable_queue_button(); defer_timeout = new QTimer(this); defer_timeout->setSingleShot(true); connect(defer_timeout, &QTimer::timeout, this, &MainWindow::defer_timer_expired); ui->undo_action->setEnabled(true); lock_blink_timeout = new QTimer(this); lock_blink_timeout->setSingleShot(true); connect(lock_blink_timeout, &QTimer::timeout, this, &MainWindow::lock_blink_timer_expired); connect(ui->clip_list->selectionModel(), &QItemSelectionModel::currentChanged, this, &MainWindow::clip_list_selection_changed); enable_or_disable_queue_button(); // Find out how many cameras we have in the existing frames; // if none, we start with two cameras. num_cameras = 2; { lock_guard lock(frame_mu); for (size_t stream_idx = 2; stream_idx < MAX_STREAMS; ++stream_idx) { if (!frames[stream_idx].empty()) { num_cameras = stream_idx + 1; } } } change_num_cameras(); if (!global_flags.tally_url.empty()) { start_tally(); } if (!global_flags.midi_mapping_filename.empty()) { MIDIMappingProto midi_mapping; if (!load_midi_mapping_from_file(global_flags.midi_mapping_filename, &midi_mapping)) { fprintf(stderr, "Couldn't load MIDI mapping '%s'; exiting.\n", global_flags.midi_mapping_filename.c_str()); abort(); } midi_mapper.set_midi_mapping(midi_mapping); } midi_mapper.refresh_lights(); midi_mapper.start_thread(); } void MainWindow::change_num_cameras() { assert(num_cameras >= displays.size()); // We only add, never remove. // Make new entries to hide the displays. for (unsigned i = displays.size(); i < num_cameras; ++i) { char title[256]; snprintf(title, sizeof(title), "Camera %u", i + 1); QAction *hide_action = ui->hide_camera_menu->addAction(title); hide_action->setCheckable(true); hide_action->setChecked(false); connect(hide_action, &QAction::toggled, bind(&MainWindow::hide_camera_toggled, this, i, _1)); } // Make new display rows. for (unsigned i = displays.size(); i < num_cameras; ++i) { QFrame *frame = new QFrame(this); frame->setAutoFillBackground(true); QLayout *layout = new QGridLayout(frame); frame->setLayout(layout); layout->setContentsMargins(3, 3, 3, 3); JPEGFrameView *display = new JPEGFrameView(frame); display->setAutoFillBackground(true); layout->addWidget(display); if (global_flags.source_labels.count(i + 1)) { display->set_overlay(global_flags.source_labels[i + 1]); } else { display->set_overlay(to_string(i + 1)); } QPushButton *preview_btn = new QPushButton(this); preview_btn->setMaximumSize(20, 17); preview_btn->setText(QString::fromStdString(to_string(i + 1))); ui->preview_layout->addWidget(preview_btn); displays.emplace_back(FrameAndDisplay{ frame, display, preview_btn, /*hidden=*/false }); connect(display, &JPEGFrameView::clicked, preview_btn, &QPushButton::click); QShortcut *shortcut = new QShortcut(QKeySequence(Qt::Key_1 + i), this); connect(shortcut, &QShortcut::activated, preview_btn, &QPushButton::click); connect(preview_btn, &QPushButton::clicked, [this, i] { preview_angle_clicked(i); }); } relayout_displays(); cliplist_clips->change_num_cameras(num_cameras); playlist_clips->change_num_cameras(num_cameras); QMetaObject::invokeMethod(this, "relayout", Qt::QueuedConnection); } void MainWindow::relayout_displays() { while (ui->input_displays->count() > 0) { QLayoutItem *item = ui->input_displays->takeAt(0); ui->input_displays->removeWidget(item->widget()); } unsigned cell_idx = 0; for (unsigned i = 0; i < displays.size(); ++i) { if (displays[i].hidden) { displays[i].frame->setVisible(false); } else { displays[i].frame->setVisible(true); ui->input_displays->addWidget(displays[i].frame, cell_idx / 2, cell_idx % 2); ++cell_idx; } } ui->video_displays->setStretch(1, (cell_idx + 1) / 2); QMetaObject::invokeMethod(this, "relayout", Qt::QueuedConnection); } MainWindow::~MainWindow() { // We don't have a context to release Player's OpenGL resources in here, // so instead of crashing on exit, leak it. live_player.release(); preview_player.release(); } void MainWindow::cue_in_clicked() { if (!cliplist_clips->empty() && cliplist_clips->back()->pts_out < 0) { cliplist_clips->mutable_back()->pts_in = current_pts; } else { Clip clip; clip.pts_in = max(current_pts - lrint(global_flags.cue_in_point_padding_seconds * TIMEBASE), 0); cliplist_clips->add_clip(clip); playlist_selection_changed(); } // Show the clip in the preview. unsigned stream_idx = ui->preview_display->get_stream_idx(); preview_single_frame(cliplist_clips->mutable_back()->pts_in, stream_idx, FIRST_AT_OR_AFTER); // Select the item so that we can jog it. ui->clip_list->setFocus(); QModelIndex index = cliplist_clips->index(cliplist_clips->size() - 1, int(ClipList::Column::IN)); ui->clip_list->selectionModel()->setCurrentIndex(index, QItemSelectionModel::ClearAndSelect); ui->clip_list->scrollToBottom(); enable_or_disable_queue_button(); } void MainWindow::cue_out_clicked() { if (cliplist_clips->empty()) { return; } cliplist_clips->mutable_back()->pts_out = current_pts + lrint(global_flags.cue_out_point_padding_seconds * TIMEBASE); // Show the clip in the preview. (TODO: This won't take padding into account.) unsigned stream_idx = ui->preview_display->get_stream_idx(); preview_single_frame(cliplist_clips->mutable_back()->pts_out, stream_idx, LAST_BEFORE); // Select the item so that we can jog it. ui->clip_list->setFocus(); QModelIndex index = cliplist_clips->index(cliplist_clips->size() - 1, int(ClipList::Column::OUT)); ui->clip_list->selectionModel()->setCurrentIndex(index, QItemSelectionModel::ClearAndSelect); ui->clip_list->scrollToBottom(); enable_or_disable_queue_button(); } void MainWindow::queue_clicked() { // See also enable_or_disable_queue_button(). if (cliplist_clips->empty()) { return; } QItemSelectionModel *selected = ui->clip_list->selectionModel(); if (!selected->hasSelection()) { Clip clip = *cliplist_clips->back(); clip.stream_idx = 0; playlist_clips->add_clip(clip); playlist_selection_changed(); ui->playlist->scrollToBottom(); return; } QModelIndex index = selected->currentIndex(); Clip clip = *cliplist_clips->clip(index.row()); if (cliplist_clips->is_camera_column(index.column())) { clip.stream_idx = index.column() - int(ClipList::Column::CAMERA_1); } else { clip.stream_idx = ui->preview_display->get_stream_idx(); } playlist_clips->add_clip(clip); playlist_selection_changed(); ui->playlist->scrollToBottom(); if (!ui->playlist->selectionModel()->hasSelection()) { // TODO: Figure out why this doesn't always seem to actually select the row. QModelIndex bottom = playlist_clips->index(playlist_clips->size() - 1, 0); ui->playlist->setCurrentIndex(bottom); } } void MainWindow::preview_clicked() { // See also enable_or_disable_preview_button(). if (ui->playlist->hasFocus()) { // Allow the playlist as preview iff it has focus and something is selected. QItemSelectionModel *selected = ui->playlist->selectionModel(); if (selected->hasSelection()) { QModelIndex index = selected->currentIndex(); const Clip &clip = *playlist_clips->clip(index.row()); preview_player->play(clip); preview_playing = true; enable_or_disable_preview_button(); return; } } if (cliplist_clips->empty()) return; QItemSelectionModel *selected = ui->clip_list->selectionModel(); if (!selected->hasSelection()) { preview_player->play(*cliplist_clips->back()); preview_playing = true; enable_or_disable_preview_button(); return; } QModelIndex index = selected->currentIndex(); Clip clip = *cliplist_clips->clip(index.row()); if (cliplist_clips->is_camera_column(index.column())) { clip.stream_idx = index.column() - int(ClipList::Column::CAMERA_1); } else { clip.stream_idx = ui->preview_display->get_stream_idx(); } if (clip.pts_out == -1) { clip.pts_out = clip.pts_in + int64_t(TIMEBASE) * 86400 * 7; // One week; effectively infinite, but without overflow issues. } preview_player->play(clip); preview_playing = true; enable_or_disable_preview_button(); } void MainWindow::preview_angle_clicked(unsigned stream_idx) { preview_player->override_angle(stream_idx); // Change the selection if we were previewing a clip from the clip list. // (The only other thing we could be showing is a pts scrub, and if so, // that would be selected.) QItemSelectionModel *selected = ui->clip_list->selectionModel(); if (selected->hasSelection()) { QModelIndex cell = selected->selectedIndexes()[0]; int column = int(ClipList::Column::CAMERA_1) + stream_idx; selected->setCurrentIndex(cell.sibling(cell.row(), column), QItemSelectionModel::ClearAndSelect); } } void MainWindow::playlist_duplicate() { QItemSelectionModel *selected = ui->playlist->selectionModel(); if (!selected->hasSelection()) { // Should have been grayed out, but OK. return; } QModelIndexList rows = selected->selectedRows(); int first = rows.front().row(), last = rows.back().row(); playlist_clips->duplicate_clips(first, last); playlist_selection_changed(); } void MainWindow::playlist_remove() { QItemSelectionModel *selected = ui->playlist->selectionModel(); if (!selected->hasSelection()) { // Should have been grayed out, but OK. return; } QModelIndexList rows = selected->selectedRows(); int first = rows.front().row(), last = rows.back().row(); playlist_clips->erase_clips(first, last); // TODO: select the next one in the list? playlist_selection_changed(); } void MainWindow::playlist_move(int delta) { QItemSelectionModel *selected = ui->playlist->selectionModel(); if (!selected->hasSelection()) { // Should have been grayed out, but OK. return; } QModelIndexList rows = selected->selectedRows(); int first = rows.front().row(), last = rows.back().row(); if ((delta == -1 && first == 0) || (delta == 1 && size_t(last) == playlist_clips->size() - 1)) { // Should have been grayed out, but OK. return; } playlist_clips->move_clips(first, last, delta); playlist_selection_changed(); } void MainWindow::jog_internal(JogDestination jog_destination, int row, int column, int stream_idx, int pts_delta) { constexpr int camera_pts_per_pixel = 1500; // One click of most mice (15 degrees), multiplied by the default wheel_sensitivity. int in_column, out_column, camera_column; if (jog_destination == JOG_CLIP_LIST) { in_column = int(ClipList::Column::IN); out_column = int(ClipList::Column::OUT); camera_column = -1; } else if (jog_destination == JOG_PLAYLIST) { in_column = int(PlayList::Column::IN); out_column = int(PlayList::Column::OUT); camera_column = int(PlayList::Column::CAMERA); } else { assert(false); } currently_deferring_model_changes = true; { current_change_id = (jog_destination == JOG_CLIP_LIST) ? "cliplist:" : "playlist:"; ClipProxy clip = (jog_destination == JOG_CLIP_LIST) ? cliplist_clips->mutable_clip(row) : playlist_clips->mutable_clip(row); if (jog_destination == JOG_PLAYLIST) { stream_idx = clip->stream_idx; } if (column == in_column) { current_change_id += "in:" + to_string(row); int64_t pts = clip->pts_in + pts_delta; set_pts_in(pts, current_pts, clip); preview_single_frame(pts, stream_idx, FIRST_AT_OR_AFTER); } else if (column == out_column) { current_change_id += "out:" + to_string(row); int64_t pts = clip->pts_out + pts_delta; pts = std::max(pts, clip->pts_in); pts = std::min(pts, current_pts); clip->pts_out = pts; preview_single_frame(pts, stream_idx, LAST_BEFORE); } else if (column == camera_column) { current_change_id += "camera:" + to_string(row); int angle_degrees = pts_delta; if (last_mousewheel_camera_row == row) { angle_degrees += leftover_angle_degrees; } int stream_idx = clip->stream_idx + angle_degrees / camera_pts_per_pixel; stream_idx = std::max(stream_idx, 0); stream_idx = std::min(stream_idx, num_cameras - 1); clip->stream_idx = stream_idx; last_mousewheel_camera_row = row; leftover_angle_degrees = angle_degrees % camera_pts_per_pixel; // Don't update the live view, that's rarely what the operator wants. } } currently_deferring_model_changes = false; } void MainWindow::defer_timer_expired() { state_changed(deferred_state); } void MainWindow::content_changed() { // If we are playing, update the part of the playlist that's not playing yet. vector clips = get_playlist(0, playlist_clips->size()); live_player->splice_play(clips); // Serialize the state. if (defer_timeout->isActive() && (!currently_deferring_model_changes || deferred_change_id != current_change_id)) { // There's some deferred event waiting, but this event is unrelated. // So it's time to short-circuit that timer and do the work it wanted to do. defer_timeout->stop(); state_changed(deferred_state); } StateProto state; *state.mutable_clip_list() = cliplist_clips->serialize(); *state.mutable_play_list() = playlist_clips->serialize(); if (currently_deferring_model_changes) { deferred_change_id = current_change_id; deferred_state = std::move(state); defer_timeout->start(200); return; } state_changed(state); } void MainWindow::state_changed(const StateProto &state) { db.store_state(state); redo_stack.clear(); ui->redo_action->setEnabled(false); undo_stack.push_back(state); ui->undo_action->setEnabled(undo_stack.size() > 1); // Make sure it doesn't grow without bounds. while (undo_stack.size() >= 100) { undo_stack.pop_front(); } } void MainWindow::save_settings() { SettingsProto settings; settings.set_interpolation_quality(global_flags.interpolation_quality + 1); settings.set_cue_in_point_padding_seconds(global_flags.cue_in_point_padding_seconds); settings.set_cue_out_point_padding_seconds(global_flags.cue_out_point_padding_seconds); db.store_settings(settings); } void MainWindow::lock_blink_timer_expired() { midi_mapper.set_locked(MIDIMapper::LightState(ui->speed_lock_btn->isChecked())); // Presumably On, or the timer should have been canceled. } void MainWindow::play_clicked() { QItemSelectionModel *selected = ui->playlist->selectionModel(); if (!selected->hasSelection()) { return; } unsigned start_row = selected->selectedRows(0)[0].row(); vector clips = get_playlist(start_row, playlist_clips->size()); live_player->play(clips); playlist_clips->set_progress({ { start_row, 0.0f } }); ui->playlist->selectionModel()->clear(); ui->stop_btn->setEnabled(true); playlist_selection_changed(); } void MainWindow::next_clicked() { live_player->skip_to_next(); } void MainWindow::stop_clicked() { Clip fake_clip; fake_clip.pts_in = 0; fake_clip.pts_out = 0; playlist_clips->set_progress({}); live_player->play(fake_clip); ui->stop_btn->setEnabled(false); playlist_selection_changed(); } void MainWindow::speed_slider_changed(int percent) { float speed = percent / 100.0f; ui->speed_lock_btn->setText(QString::fromStdString(" " + to_string(percent) + "%")); live_player->set_master_speed(speed); midi_mapper.set_speed_light(speed); } void MainWindow::speed_lock_clicked() { // TODO: Make for a less abrupt transition if we're not already at 100%. ui->speed_slider->setValue(100); // Also actually sets the master speed and updates the label. ui->speed_slider->setEnabled(!ui->speed_lock_btn->isChecked()); midi_mapper.set_locked(MIDIMapper::LightState(ui->speed_lock_btn->isChecked())); lock_blink_timeout->stop(); } void MainWindow::preview_player_done() { preview_playing = false; enable_or_disable_preview_button(); } void MainWindow::live_player_done() { playlist_clips->set_progress({}); ui->stop_btn->setEnabled(false); playlist_selection_changed(); } void MainWindow::live_player_clip_progress(const map &progress, TimeRemaining time_remaining) { playlist_clips->set_progress(progress); set_output_status(format_duration(time_remaining) + " left"); } void MainWindow::resizeEvent(QResizeEvent *event) { QMainWindow::resizeEvent(event); // Ask for a relayout, but only after the event loop is done doing relayout // on everything else. QMetaObject::invokeMethod(this, "relayout", Qt::QueuedConnection); } void MainWindow::relayout() { ui->live_display->setMinimumWidth(ui->live_display->height() * 16 / 9); ui->preview_display->setMinimumWidth(ui->preview_display->height() * 16 / 9); } bool MainWindow::eventFilter(QObject *watched, QEvent *event) { constexpr int dead_zone_pixels = 3; // To avoid that simple clicks get misinterpreted. int scrub_sensitivity = 100; // pts units per pixel. int wheel_sensitivity = 100; // pts units per degree. if (event->type() == QEvent::FocusIn || event->type() == QEvent::FocusOut) { enable_or_disable_preview_button(); playlist_selection_changed(); hidden_jog_column = -1; } unsigned stream_idx = ui->preview_display->get_stream_idx(); if (watched == ui->clip_list) { if (event->type() == QEvent::FocusOut) { highlight_camera_input(-1); } return false; } if (event->type() != QEvent::Wheel) { last_mousewheel_camera_row = -1; } if (event->type() == QEvent::MouseButtonPress) { QMouseEvent *mouse = (QMouseEvent *)event; QTableView *destination; ScrubType type; if (watched == ui->clip_list->viewport()) { destination = ui->clip_list; type = SCRUBBING_CLIP_LIST; } else if (watched == ui->playlist->viewport()) { destination = ui->playlist; type = SCRUBBING_PLAYLIST; } else { return false; } int column = destination->columnAt(mouse->x()); int row = destination->rowAt(mouse->y()); if (column == -1 || row == -1) return false; if (type == SCRUBBING_CLIP_LIST) { if (ClipList::Column(column) == ClipList::Column::IN) { scrub_pts_origin = cliplist_clips->clip(row)->pts_in; preview_single_frame(scrub_pts_origin, stream_idx, FIRST_AT_OR_AFTER); } else if (ClipList::Column(column) == ClipList::Column::OUT) { scrub_pts_origin = cliplist_clips->clip(row)->pts_out; preview_single_frame(scrub_pts_origin, stream_idx, LAST_BEFORE); } else { return false; } } else { if (PlayList::Column(column) == PlayList::Column::IN) { scrub_pts_origin = playlist_clips->clip(row)->pts_in; preview_single_frame(scrub_pts_origin, stream_idx, FIRST_AT_OR_AFTER); } else if (PlayList::Column(column) == PlayList::Column::OUT) { scrub_pts_origin = playlist_clips->clip(row)->pts_out; preview_single_frame(scrub_pts_origin, stream_idx, LAST_BEFORE); } else { return false; } } scrubbing = true; scrub_row = row; scrub_column = column; scrub_x_origin = mouse->x(); scrub_type = type; } else if (event->type() == QEvent::MouseMove) { QMouseEvent *mouse = (QMouseEvent *)event; if (mouse->modifiers() & Qt::KeyboardModifier::ShiftModifier) { scrub_sensitivity *= 10; wheel_sensitivity *= 10; if (mouse->modifiers() & Qt::KeyboardModifier::ControlModifier) { // Ctrl+Shift is a super-modifier, meant only for things like “go back two hours”. scrub_sensitivity *= 100; wheel_sensitivity *= 100; } } if (mouse->modifiers() & Qt::KeyboardModifier::AltModifier) { // Note: Shift + Alt cancel each other out. scrub_sensitivity /= 10; wheel_sensitivity /= 10; } if (scrubbing) { int offset = mouse->x() - scrub_x_origin; int adjusted_offset; if (offset >= dead_zone_pixels) { adjusted_offset = offset - dead_zone_pixels; } else if (offset < -dead_zone_pixels) { adjusted_offset = offset + dead_zone_pixels; } else { adjusted_offset = 0; } int64_t pts = scrub_pts_origin + adjusted_offset * scrub_sensitivity; currently_deferring_model_changes = true; if (scrub_type == SCRUBBING_CLIP_LIST) { ClipProxy clip = cliplist_clips->mutable_clip(scrub_row); if (scrub_column == int(ClipList::Column::IN)) { current_change_id = "cliplist:in:" + to_string(scrub_row); set_pts_in(pts, current_pts, clip); preview_single_frame(pts, stream_idx, FIRST_AT_OR_AFTER); } else { current_change_id = "cliplist:out" + to_string(scrub_row); pts = std::max(pts, clip->pts_in); pts = std::min(pts, current_pts); clip->pts_out = pts; preview_single_frame(pts, stream_idx, LAST_BEFORE); } } else { ClipProxy clip = playlist_clips->mutable_clip(scrub_row); if (scrub_column == int(PlayList::Column::IN)) { current_change_id = "playlist:in:" + to_string(scrub_row); set_pts_in(pts, current_pts, clip); preview_single_frame(pts, clip->stream_idx, FIRST_AT_OR_AFTER); } else { current_change_id = "playlist:out:" + to_string(scrub_row); pts = std::max(pts, clip->pts_in); pts = std::min(pts, current_pts); clip->pts_out = pts; preview_single_frame(pts, clip->stream_idx, LAST_BEFORE); } } currently_deferring_model_changes = false; return true; // Don't use this mouse movement for selecting things. } } else if (event->type() == QEvent::Wheel) { QWheelEvent *wheel = (QWheelEvent *)event; int angle_delta = wheel->angleDelta().y(); if (wheel->modifiers() & Qt::KeyboardModifier::ShiftModifier) { scrub_sensitivity *= 10; wheel_sensitivity *= 10; if (wheel->modifiers() & Qt::KeyboardModifier::ControlModifier) { // Ctrl+Shift is a super-modifier, meant only for things like “go back two hours”. scrub_sensitivity *= 100; wheel_sensitivity *= 100; } } if (wheel->modifiers() & Qt::KeyboardModifier::AltModifier) { // Note: Shift + Alt cancel each other out. scrub_sensitivity /= 10; wheel_sensitivity /= 10; angle_delta = wheel->angleDelta().x(); // Qt ickiness. } QTableView *destination; JogDestination jog_destination; if (watched == ui->clip_list->viewport()) { destination = ui->clip_list; jog_destination = JOG_CLIP_LIST; last_mousewheel_camera_row = -1; } else if (watched == ui->playlist->viewport()) { destination = ui->playlist; jog_destination = JOG_PLAYLIST; if (destination->columnAt(wheel->position().x()) != int(PlayList::Column::CAMERA)) { last_mousewheel_camera_row = -1; } } else { last_mousewheel_camera_row = -1; return false; } int column = destination->columnAt(wheel->position().x()); int row = destination->rowAt(wheel->position().y()); if (column == -1 || row == -1) return false; // Only adjust pts with the wheel if the given row is selected. if (!destination->hasFocus() || row != destination->selectionModel()->currentIndex().row()) { return false; } jog_internal(jog_destination, row, column, stream_idx, angle_delta * wheel_sensitivity); return true; // Don't scroll. } else if (event->type() == QEvent::MouseButtonRelease) { scrubbing = false; } return false; } void MainWindow::preview_single_frame(int64_t pts, unsigned stream_idx, MainWindow::Rounding rounding) { if (rounding == LAST_BEFORE) { lock_guard lock(frame_mu); if (frames[stream_idx].empty()) return; auto it = find_last_frame_before(frames[stream_idx], pts); if (it != frames[stream_idx].end()) { pts = it->pts; } } else { assert(rounding == FIRST_AT_OR_AFTER); lock_guard lock(frame_mu); if (frames[stream_idx].empty()) return; auto it = find_first_frame_at_or_after(frames[stream_idx], pts); if (it != frames[stream_idx].end()) { pts = it->pts; } } Clip fake_clip; fake_clip.pts_in = pts; fake_clip.pts_out = pts + 1; fake_clip.stream_idx = stream_idx; preview_player->play(fake_clip); } void MainWindow::playlist_selection_changed() { enable_or_disable_preview_button(); QItemSelectionModel *selected = ui->playlist->selectionModel(); bool any_selected = selected->hasSelection(); ui->playlist_duplicate_btn->setEnabled(any_selected); ui->playlist_remove_btn->setEnabled(any_selected); ui->playlist_move_up_btn->setEnabled( any_selected && selected->selectedRows().front().row() > 0); ui->playlist_move_down_btn->setEnabled( any_selected && selected->selectedRows().back().row() < int(playlist_clips->size()) - 1); ui->play_btn->setEnabled(any_selected); ui->next_btn->setEnabled(ui->stop_btn->isEnabled()); // TODO: Perhaps not if we're on the last clip? midi_mapper.set_next_ready(ui->next_btn->isEnabled() ? MIDIMapper::On : MIDIMapper::Off); // NOTE: The hidden button is still reachable by keyboard or MIDI. if (any_selected) { ui->play_btn->setVisible(true); } else if (ui->stop_btn->isEnabled()) { // Playing. ui->play_btn->setVisible(false); } else { ui->play_btn->setVisible(true); } ui->next_btn->setVisible(!ui->play_btn->isVisible()); if (ui->stop_btn->isEnabled()) { // Playing. midi_mapper.set_play_enabled(MIDIMapper::On); } else if (any_selected) { midi_mapper.set_play_enabled(MIDIMapper::Blinking); } else { midi_mapper.set_play_enabled(MIDIMapper::Off); } if (!any_selected) { set_output_status("paused"); } else { vector clips; for (size_t row = selected->selectedRows().front().row(); row < playlist_clips->size(); ++row) { clips.emplace_back(*playlist_clips->clip_with_id(row)); } TimeRemaining remaining = compute_total_time(clips); set_output_status(format_duration(remaining) + " ready"); } } void MainWindow::clip_list_selection_changed(const QModelIndex ¤t, const QModelIndex &previous) { int camera_selected = -1; if (cliplist_clips->is_camera_column(current.column())) { camera_selected = current.column() - int(ClipList::Column::CAMERA_1); // See the comment on hidden_jog_column. if (current.row() != previous.row()) { hidden_jog_column = -1; } else if (hidden_jog_column == -1) { hidden_jog_column = previous.column(); } } else { hidden_jog_column = -1; } highlight_camera_input(camera_selected); enable_or_disable_queue_button(); } vector MainWindow::get_playlist(size_t start_row, size_t end_row) { vector clips; for (unsigned row = start_row; row < end_row; ++row) { ClipWithID clip = *playlist_clips->clip_with_id(row); if (clip.clip.pts_out == -1) { clip.clip.pts_out = clip.clip.pts_in + int64_t(TIMEBASE) * 86400 * 7; // One week; effectively infinite, but without overflow issues. } clips.emplace_back(clip); } return clips; } void MainWindow::report_disk_space(off_t free_bytes, double estimated_seconds_left) { char time_str[256]; if (estimated_seconds_left < 60.0) { strcpy(time_str, "Less than a minute"); } else if (estimated_seconds_left < 1800.0) { // Less than half an hour: Xm Ys (red). int s = lrintf(estimated_seconds_left); int m = s / 60; s %= 60; snprintf(time_str, sizeof(time_str), "%dm %ds", m, s); } else if (estimated_seconds_left < 3600.0) { // Less than an hour: Xm. int m = lrintf(estimated_seconds_left / 60.0); snprintf(time_str, sizeof(time_str), "%dm", m); } else if (estimated_seconds_left < 36000.0) { // Less than ten hours: Xh Ym. int m = lrintf(estimated_seconds_left / 60.0); int h = m / 60; m %= 60; snprintf(time_str, sizeof(time_str), "%dh %dm", h, m); } else { // More than ten hours: Xh. int h = lrintf(estimated_seconds_left / 3600.0); snprintf(time_str, sizeof(time_str), "%dh", h); } char buf[256]; snprintf(buf, sizeof(buf), "Disk free: %'.0f MB (approx. %s)", free_bytes / 1048576.0, time_str); std::string label = buf; post_to_main_thread([this, label] { disk_free_label->setText(QString::fromStdString(label)); ui->menuBar->setCornerWidget(disk_free_label); // Need to set this again for the sizing to get right. }); } void MainWindow::midi_mapping_triggered() { MIDIMappingDialog(&midi_mapper).exec(); } void MainWindow::exit_triggered() { close(); } void MainWindow::export_cliplist_clip_multitrack_triggered() { QItemSelectionModel *selected = ui->clip_list->selectionModel(); if (!selected->hasSelection()) { QMessageBox msgbox; msgbox.setText("No clip selected in the clip list. Select one and try exporting again."); msgbox.exec(); return; } QModelIndex index = selected->currentIndex(); Clip clip = *cliplist_clips->clip(index.row()); QString filename = QFileDialog::getSaveFileName(this, "Export multitrack clip", QString(), tr("Matroska video files (*.mkv)")); if (filename.isNull()) { // Cancel. return; } if (!filename.endsWith(".mkv")) { filename += ".mkv"; } export_multitrack_clip(filename.toStdString(), clip); } void MainWindow::export_playlist_clip_interpolated_triggered() { QItemSelectionModel *selected = ui->playlist->selectionModel(); if (!selected->hasSelection()) { QMessageBox msgbox; msgbox.setText("No clip selected in the playlist. Select one and try exporting again."); msgbox.exec(); return; } QString filename = QFileDialog::getSaveFileName(this, "Export interpolated clip", QString(), tr("Matroska video files (*.mkv)")); if (filename.isNull()) { // Cancel. return; } if (!filename.endsWith(".mkv")) { filename += ".mkv"; } vector clips; QModelIndexList rows = selected->selectedRows(); for (QModelIndex index : rows) { clips.push_back(*playlist_clips->clip(index.row())); } export_interpolated_clip(filename.toStdString(), clips); } void MainWindow::manual_triggered() { if (!QDesktopServices::openUrl(QUrl("https://nageru.sesse.net/doc/"))) { QMessageBox msgbox; msgbox.setText("Could not launch manual in web browser.\nPlease see https://nageru.sesse.net/doc/ manually."); msgbox.exec(); } } void MainWindow::about_triggered() { AboutDialog("Futatabi", "Multicamera slow motion video server").exec(); } void MainWindow::undo_triggered() { // Finish any deferred action. if (defer_timeout->isActive()) { defer_timeout->stop(); state_changed(deferred_state); } StateProto redo_state; *redo_state.mutable_clip_list() = cliplist_clips->serialize(); *redo_state.mutable_play_list() = playlist_clips->serialize(); redo_stack.push_back(std::move(redo_state)); ui->redo_action->setEnabled(true); assert(undo_stack.size() > 1); // Pop off the current state, which is always at the top of the stack. undo_stack.pop_back(); StateProto state = undo_stack.back(); ui->undo_action->setEnabled(undo_stack.size() > 1); replace_model(ui->clip_list, &cliplist_clips, new ClipList(state.clip_list())); replace_model(ui->playlist, &playlist_clips, new PlayList(state.play_list())); db.store_state(state); } void MainWindow::redo_triggered() { assert(!redo_stack.empty()); ui->undo_action->setEnabled(true); ui->redo_action->setEnabled(true); undo_stack.push_back(std::move(redo_stack.back())); redo_stack.pop_back(); ui->undo_action->setEnabled(true); ui->redo_action->setEnabled(!redo_stack.empty()); const StateProto &state = undo_stack.back(); replace_model(ui->clip_list, &cliplist_clips, new ClipList(state.clip_list())); replace_model(ui->playlist, &playlist_clips, new PlayList(state.play_list())); db.store_state(state); } void MainWindow::quality_toggled(int quality, bool checked) { if (!checked) { return; } global_flags.interpolation_quality = quality; if (quality != 0 && // Turning interpolation off is always possible. quality != flow_initialized_interpolation_quality) { QMessageBox msgbox; msgbox.setText(QString::fromStdString( "The interpolation quality for the main output cannot be changed at runtime, " "except being turned completely off; it will take effect for exported files " "only until next restart. The live output quality thus remains at " + to_string(flow_initialized_interpolation_quality) + ".")); msgbox.exec(); } save_settings(); } void MainWindow::in_padding_toggled(double seconds, bool checked) { if (!checked) { return; } global_flags.cue_in_point_padding_seconds = seconds; save_settings(); } void MainWindow::out_padding_toggled(double seconds, bool checked) { if (!checked) { return; } global_flags.cue_out_point_padding_seconds = seconds; save_settings(); } void MainWindow::hide_camera_toggled(unsigned camera_idx, bool checked) { displays[camera_idx].hidden = checked; relayout_displays(); } void MainWindow::highlight_camera_input(int stream_idx) { for (unsigned i = 0; i < num_cameras; ++i) { if (unsigned(stream_idx) == i) { displays[i].frame->setStyleSheet("background: rgb(0,255,0)"); } else { displays[i].frame->setStyleSheet(""); } } midi_mapper.highlight_camera_input(stream_idx); } void MainWindow::enable_or_disable_preview_button() { // Follows the logic in preview_clicked(). if (ui->playlist->hasFocus()) { // Allow the playlist as preview iff it has focus and something is selected. // TODO: Is this part really relevant? QItemSelectionModel *selected = ui->playlist->selectionModel(); if (selected->hasSelection()) { ui->preview_btn->setEnabled(true); midi_mapper.set_preview_enabled(preview_playing ? MIDIMapper::On : MIDIMapper::Blinking); return; } } // TODO: Perhaps only enable this if something is actually selected. ui->preview_btn->setEnabled(!cliplist_clips->empty()); if (preview_playing) { midi_mapper.set_preview_enabled(MIDIMapper::On); } else { midi_mapper.set_preview_enabled(cliplist_clips->empty() ? MIDIMapper::Off : MIDIMapper::Blinking); } } void MainWindow::enable_or_disable_queue_button() { // Follows the logic in queue_clicked(). // TODO: Perhaps only enable this if something is actually selected. bool enabled; if (cliplist_clips->empty()) { enabled = false; } else { enabled = true; } ui->queue_btn->setEnabled(enabled); midi_mapper.set_queue_enabled(enabled); } void MainWindow::set_output_status(const string &status) { ui->live_label->setText(QString::fromStdString("Current output (" + status + ")")); if (live_player != nullptr) { live_player->set_pause_status(status); } lock_guard lock(queue_status_mu); queue_status = status; } pair MainWindow::get_queue_status() const { lock_guard lock(queue_status_mu); return { queue_status, "text/plain" }; } void MainWindow::display_frame(unsigned stream_idx, const FrameOnDisk &frame) { if (stream_idx >= MAX_STREAMS) { fprintf(stderr, "WARNING: Ignoring too-high stream index %u.\n", stream_idx); return; } if (stream_idx >= num_cameras) { post_to_main_thread_and_wait([this, stream_idx] { num_cameras = stream_idx + 1; change_num_cameras(); }); } displays[stream_idx].display->setFrame(stream_idx, frame); } void MainWindow::preview() { post_to_main_thread([this] { preview_clicked(); }); } void MainWindow::queue() { post_to_main_thread([this] { queue_clicked(); }); } void MainWindow::play() { post_to_main_thread([this] { play_clicked(); }); } void MainWindow::next() { post_to_main_thread([this] { next_clicked(); }); } void MainWindow::toggle_lock() { post_to_main_thread([this] { ui->speed_lock_btn->setChecked(!ui->speed_lock_btn->isChecked()); speed_lock_clicked(); }); } void MainWindow::jog(int delta) { post_to_main_thread([this, delta] { int64_t pts_delta = delta * (TIMEBASE / 60); // One click = frame at 60 fps. if (ui->playlist->hasFocus()) { QModelIndex selected = ui->playlist->selectionModel()->currentIndex(); if (selected.column() != -1 && selected.row() != -1) { jog_internal(JOG_PLAYLIST, selected.row(), selected.column(), /*stream_idx=*/-1, pts_delta); } } else if (ui->clip_list->hasFocus()) { QModelIndex selected = ui->clip_list->selectionModel()->currentIndex(); if (cliplist_clips->is_camera_column(selected.column()) && hidden_jog_column != -1) { // See the definition on hidden_jog_column. selected = selected.sibling(selected.row(), hidden_jog_column); ui->clip_list->selectionModel()->setCurrentIndex(selected, QItemSelectionModel::ClearAndSelect); hidden_jog_column = -1; } if (selected.column() != -1 && selected.row() != -1) { jog_internal(JOG_CLIP_LIST, selected.row(), selected.column(), ui->preview_display->get_stream_idx(), pts_delta); } } }); } void MainWindow::switch_camera(unsigned camera_idx) { post_to_main_thread([this, camera_idx] { if (camera_idx < num_cameras) { // TODO: Also make this change a highlighted clip? preview_angle_clicked(camera_idx); } }); } void MainWindow::set_master_speed(float speed) { speed = min(max(speed, 0.1f), 2.0f); post_to_main_thread([this, speed] { if (ui->speed_lock_btn->isChecked()) { midi_mapper.set_locked(MIDIMapper::Blinking); lock_blink_timeout->start(1000); return; } int percent = lrintf(speed * 100.0f); ui->speed_slider->blockSignals(true); ui->speed_slider->setValue(percent); ui->speed_slider->blockSignals(false); ui->speed_lock_btn->setText(QString::fromStdString(" " + to_string(percent) + "%")); live_player->set_master_speed(speed); midi_mapper.set_speed_light(speed); }); } void MainWindow::cue_in() { post_to_main_thread([this] { cue_in_clicked(); }); } void MainWindow::cue_out() { post_to_main_thread([this] { cue_out_clicked(); }); } template void MainWindow::replace_model(QTableView *view, Model **model, Model *new_model) { QItemSelectionModel *old_selection_model = view->selectionModel(); view->setModel(new_model); delete *model; delete old_selection_model; *model = new_model; connect(new_model, &Model::any_content_changed, this, &MainWindow::content_changed); } void MainWindow::start_tally() { http_reply = http.get(QNetworkRequest(QString::fromStdString(global_flags.tally_url))); connect(http_reply, &QNetworkReply::finished, this, &MainWindow::tally_received); } void MainWindow::tally_received() { unsigned time_to_next_tally_ms; if (http_reply->error()) { fprintf(stderr, "HTTP get of '%s' failed: %s\n", global_flags.tally_url.c_str(), http_reply->errorString().toStdString().c_str()); ui->live_frame->setStyleSheet(""); time_to_next_tally_ms = 1000; } else { string contents = http_reply->readAll().toStdString(); ui->live_frame->setStyleSheet(QString::fromStdString("background: " + contents)); time_to_next_tally_ms = 100; } http_reply->deleteLater(); http_reply = nullptr; QTimer::singleShot(time_to_next_tally_ms, this, &MainWindow::start_tally); } nageru-2.3.0/futatabi/mainwindow.h000066400000000000000000000146711450736322200171360ustar00rootroot00000000000000#ifndef MAINWINDOW_H #define MAINWINDOW_H #include "clip_list.h" #include "db.h" #include "midi_mapper.h" #include "player.h" #include "state.pb.h" #include #include #include #include #include #include #include #include #include #include namespace Ui { class MainWindow; } // namespace Ui struct FrameOnDisk; class JPEGFrameView; class Player; class QPushButton; class QTableView; class MainWindow : public QMainWindow, public ControllerReceiver { Q_OBJECT public: MainWindow(); ~MainWindow(); // HTTP callback. TODO: Does perhaps not belong to MainWindow? std::pair get_queue_status() const; void display_frame(unsigned stream_idx, const FrameOnDisk &frame); // ControllerReceiver interface. void preview() override; void queue() override; void play() override; void next() override; void toggle_lock() override; void jog(int delta) override; void switch_camera(unsigned camera_idx) override; void set_master_speed(float speed) override; void cue_in() override; void cue_out() override; // Raw receivers are not used. void controller_changed(unsigned controller) override {} void note_on(unsigned note) override {} private: Ui::MainWindow *ui; QLabel *disk_free_label; std::unique_ptr preview_player, live_player; bool preview_playing = false; DB db; unsigned num_cameras; // State when doing a scrub operation on a timestamp with the mouse. bool scrubbing = false; int scrub_x_origin; // In pixels on the viewport. int64_t scrub_pts_origin; // Which element (e.g. pts_in on clip 4) we are scrubbing. enum ScrubType { SCRUBBING_CLIP_LIST, SCRUBBING_PLAYLIST } scrub_type; int scrub_row; int scrub_column; // Used to keep track of small mouse wheel motions on the camera index in the playlist. int last_mousewheel_camera_row = -1; int leftover_angle_degrees = 0; // Normally, jog is only allowed if in the focus (well, selection) is // on the in or out pts columns. However, changing camera (even when // using a MIDI button) on the clip list changes the highlight, // and we'd like to keep on jogging. Thus, as a special case, if you // change to a camera column on the clip list (and don't change which // clip you're looking at), the last column you were at will be stored here. // If you then try to jog, we'll fetch the value from here and highlight it. // Doing pretty much anything else is going to reset it back to -1, though. int hidden_jog_column = -1; // Some operations, notably scrubbing and scrolling, happen in so large increments // that we want to group them instead of saving to disk every single time. // If they happen (ie., we get a callback from the model that it's changed) while // currently_deferring_model_changes, we fire off this timer. If it manages to elapse // before some other event happens, we count the event. (If the other event is of the // same kind, we just fire off the timer anew instead of taking any action.) QTimer *defer_timeout; std::string deferred_change_id; StateProto deferred_state; // NOTE: The undo stack always has the current state on top. std::deque undo_stack, redo_stack; // If we need to blink the lock light, we do so for only a second. // This timer signals that we should end it. QTimer *lock_blink_timeout; // Before a change that should be deferred (see above), currently_deferring_model_changes // must be set to true, and current_change_id must be given contents describing what's // changed to avoid accidental grouping. bool currently_deferring_model_changes = false; std::string current_change_id; mutable std::mutex queue_status_mu; std::string queue_status; // Under queue_status_mu. struct FrameAndDisplay { QFrame *frame; JPEGFrameView *display; QPushButton *preview_btn; bool hidden = false; }; std::vector displays; // Used to get tally information, if a tally URL is set. QNetworkAccessManager http; QNetworkReply *http_reply = nullptr; MIDIMapper midi_mapper; void change_num_cameras(); void relayout_displays(); void cue_in_clicked(); void cue_out_clicked(); void queue_clicked(); void preview_clicked(); void preview_angle_clicked(unsigned stream_idx); void play_clicked(); void next_clicked(); void stop_clicked(); void speed_slider_changed(int percent); void speed_lock_clicked(); void preview_player_done(); void live_player_done(); void live_player_clip_progress(const std::map &progress, TimeRemaining time_remaining); void set_output_status(const std::string &status); void playlist_duplicate(); void playlist_remove(); void playlist_move(int delta); enum JogDestination { JOG_CLIP_LIST, JOG_PLAYLIST }; void jog_internal(JogDestination jog_destination, int column, int row, int stream_idx, int pts_delta); void defer_timer_expired(); void content_changed(); // In clip_list or play_list. void state_changed(const StateProto &state); // Called post-filtering. void save_settings(); void lock_blink_timer_expired(); enum Rounding { FIRST_AT_OR_AFTER, LAST_BEFORE }; void preview_single_frame(int64_t pts, unsigned stream_idx, Rounding rounding); // Also covers when the playlist itself changes. void playlist_selection_changed(); void clip_list_selection_changed(const QModelIndex ¤t, const QModelIndex &previous); std::vector get_playlist(size_t start_row, size_t end_row); void resizeEvent(QResizeEvent *event) override; bool eventFilter(QObject *watched, QEvent *event) override; void report_disk_space(off_t free_bytes, double estimated_seconds_left); void midi_mapping_triggered(); void exit_triggered(); void export_cliplist_clip_multitrack_triggered(); void export_playlist_clip_interpolated_triggered(); void manual_triggered(); void about_triggered(); void undo_triggered(); void redo_triggered(); void quality_toggled(int quality, bool checked); void in_padding_toggled(double seconds, bool checked); void out_padding_toggled(double seconds, bool checked); void hide_camera_toggled(unsigned camera_idx, bool checked); void highlight_camera_input(int stream_idx); void enable_or_disable_preview_button(); void enable_or_disable_queue_button(); template void replace_model(QTableView *view, Model **model, Model *new_model); void start_tally(); void tally_received(); private slots: void relayout(); }; extern MainWindow *global_mainwindow; #endif nageru-2.3.0/futatabi/mainwindow.qrc000066400000000000000000000001341450736322200174610ustar00rootroot00000000000000 lock.svg nageru-2.3.0/futatabi/mainwindow.ui000066400000000000000000000450321450736322200173170ustar00rootroot00000000000000 MainWindow 0 0 1061 600 Futatabi Qt::Horizontal Queue (&Q) .. Preview (&W) .. Cue in (&A) Cue out (&S) Qt::Horizontal 40 20 QAbstractItemView::ContiguousSelection QAbstractItemView::SelectRows Duplicate .. 0 0 Remove .. Move up .. Move down .. false 10 200 100 Qt::Horizontal 0 0 72 0 100% :/lock.svg true true Stop .. Play (space) .. Next (N) .. 3 true QFrame::NoFrame QFrame::Plain 0 3 3 3 3 Preview output Qt::AlignCenter true QFrame::NoFrame QFrame::Plain 0 3 3 3 3 Current output (paused) Qt::AlignCenter 0 Current inputs Qt::AlignCenter 0 0 1061 22 &Video &Export Interpolation &quality Cue &in point padding Cue &out point padding &Help &Edit V&iew &Hide camera E&xit Online &manual… &About Futatabi… Selected clip list clip as raw &multitrack… Selected playlist clip(s) as &interpolated single track… &Undo Ctrl+Z &Redo Ctrl+Y true No interpolation (&0) true Fastest (&1) true Default (&2) (realtime 720p on fast embedded GPUs) true Good (&3) (realtime 720p on GTX 970 or so) true Best (&4) (not realtime on any current GPU) true &0 seconds true &1 second true &2 seconds true &5 seconds Setup MIDI controller… true &0 seconds true &1 seconds true &2 seconds true &5 seconds JPEGFrameView QWidget
jpeg_frame_view.h
nageru-2.3.0/futatabi/make-example-video.sh000066400000000000000000000010771450736322200206130ustar00rootroot00000000000000youtube-dl 'https://www.youtube.com/watch?v=Wa2fBiCEzTc' FILE='MULTI ANGLE _ George Evans pops up with a 92nd-minute winner in Blackburn!-Wa2fBiCEzTc.mp4' ffmpeg -y -ss 0:03.290 -t 0:37 -i "$FILE" -c:v mjpeg -an angle1.mp4 ffmpeg -y -ss 0:40 -t 0:40 -i "$FILE" -c:v mjpeg -an angle2.mp4 ffmpeg -y -ss 1:12.880 -i "$FILE" -c:v mjpeg -an angle3.mp4 ffmpeg -y -ss 0:07 -i ./angle3.mp4 -c:v copy -copyts -start_at_zero angle3-cut.mp4 ffmpeg -y -copyts -i angle1.mp4 -i angle2.mp4 -i angle3-cut.mp4 -map 0:0 -map 1:0 -map 2:0 -c:v copy multiangle.mp4 nageru-2.3.0/futatabi/midi_mapper.cpp000066400000000000000000000230711450736322200175750ustar00rootroot00000000000000#include "midi_mapper.h" #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include "defs.h" #include "futatabi_midi_mapping.pb.h" #include "shared/midi_mapper_util.h" #include "shared/text_proto.h" using namespace google::protobuf; using namespace std; using namespace std::placeholders; MIDIMapper::MIDIMapper(ControllerReceiver *receiver) : receiver(receiver), mapping_proto(new MIDIMappingProto), midi_device(this) { } MIDIMapper::~MIDIMapper() {} bool load_midi_mapping_from_file(const string &filename, MIDIMappingProto *new_mapping) { return load_proto_from_file(filename, new_mapping); } bool save_midi_mapping_to_file(const MIDIMappingProto &mapping_proto, const string &filename) { return save_proto_to_file(mapping_proto, filename); } void MIDIMapper::set_midi_mapping(const MIDIMappingProto &new_mapping) { lock_guard lock(mu); if (mapping_proto) { mapping_proto->CopyFrom(new_mapping); } else { mapping_proto.reset(new MIDIMappingProto(new_mapping)); } num_controller_banks = min(max(mapping_proto->num_controller_banks(), 1), 5); current_controller_bank = 0; } void MIDIMapper::start_thread() { midi_device.start_thread(); } const MIDIMappingProto &MIDIMapper::get_current_mapping() const { lock_guard lock(mu); return *mapping_proto; } ControllerReceiver *MIDIMapper::set_receiver(ControllerReceiver *new_receiver) { lock_guard lock(mu); swap(receiver, new_receiver); return new_receiver; // Now old receiver. } void MIDIMapper::controller_received(int controller, int value_int) { int delta_value = value_int - 64; // For infinite controllers such as jog. float value = map_controller_to_float(controller, value_int); receiver->controller_changed(controller); match_controller(controller, MIDIMappingProto::kJogFieldNumber, MIDIMappingProto::kJogBankFieldNumber, delta_value, bind(&ControllerReceiver::jog, receiver, _1)); // Speed goes from 0.0 to 2.0 (the receiver will clamp). match_controller(controller, MIDIMappingProto::kMasterSpeedFieldNumber, MIDIMappingProto::kMasterSpeedBankFieldNumber, value * 2.0, bind(&ControllerReceiver::set_master_speed, receiver, _1)); } void MIDIMapper::note_on_received(int note) { lock_guard lock(mu); receiver->note_on(note); if (mapping_proto->has_prev_bank() && mapping_proto->prev_bank().note_number() == note) { current_controller_bank = (current_controller_bank + num_controller_banks - 1) % num_controller_banks; update_lights_lock_held(); } if (mapping_proto->has_next_bank() && mapping_proto->next_bank().note_number() == note) { current_controller_bank = (current_controller_bank + 1) % num_controller_banks; update_lights_lock_held(); } if (mapping_proto->has_select_bank_1() && mapping_proto->select_bank_1().note_number() == note) { current_controller_bank = 0; update_lights_lock_held(); } if (mapping_proto->has_select_bank_2() && mapping_proto->select_bank_2().note_number() == note && num_controller_banks >= 2) { current_controller_bank = 1; update_lights_lock_held(); } if (mapping_proto->has_select_bank_3() && mapping_proto->select_bank_3().note_number() == note && num_controller_banks >= 3) { current_controller_bank = 2; update_lights_lock_held(); } if (mapping_proto->has_select_bank_4() && mapping_proto->select_bank_4().note_number() == note && num_controller_banks >= 4) { current_controller_bank = 3; update_lights_lock_held(); } if (mapping_proto->has_select_bank_5() && mapping_proto->select_bank_5().note_number() == note && num_controller_banks >= 5) { current_controller_bank = 4; update_lights_lock_held(); } match_button(note, MIDIMappingProto::kPreviewFieldNumber, MIDIMappingProto::kPreviewBankFieldNumber, bind(&ControllerReceiver::preview, receiver)); match_button(note, MIDIMappingProto::kQueueFieldNumber, MIDIMappingProto::kQueueBankFieldNumber, bind(&ControllerReceiver::queue, receiver)); match_button(note, MIDIMappingProto::kPlayFieldNumber, MIDIMappingProto::kPlayBankFieldNumber, bind(&ControllerReceiver::play, receiver)); match_button(note, MIDIMappingProto::kNextFieldNumber, MIDIMappingProto::kNextButtonBankFieldNumber, bind(&ControllerReceiver::next, receiver)); match_button(note, MIDIMappingProto::kToggleLockFieldNumber, MIDIMappingProto::kToggleLockBankFieldNumber, bind(&ControllerReceiver::toggle_lock, receiver)); unsigned num_cameras = std::min(MAX_STREAMS, mapping_proto->camera_size()); for (unsigned camera_idx = 0; camera_idx < num_cameras; ++camera_idx) { const CameraMIDIMappingProto &camera = mapping_proto->camera(camera_idx); if (match_bank_helper(camera, CameraMIDIMappingProto::kBankFieldNumber, current_controller_bank) && match_button_helper(camera, CameraMIDIMappingProto::kButtonFieldNumber, note)) { receiver->switch_camera(camera_idx); } } match_button(note, MIDIMappingProto::kCueInFieldNumber, MIDIMappingProto::kCueInBankFieldNumber, bind(&ControllerReceiver::cue_in, receiver)); match_button(note, MIDIMappingProto::kCueOutFieldNumber, MIDIMappingProto::kCueOutBankFieldNumber, bind(&ControllerReceiver::cue_out, receiver)); } void MIDIMapper::match_controller(int controller, int field_number, int bank_field_number, float value, function func) { if (bank_mismatch(bank_field_number)) { return; } if (match_controller_helper(*mapping_proto, field_number, controller)) { func(value); } } void MIDIMapper::match_button(int note, int field_number, int bank_field_number, function func) { if (bank_mismatch(bank_field_number)) { return; } if (match_button_helper(*mapping_proto, field_number, note)) { func(); } } bool MIDIMapper::has_active_controller(int field_number, int bank_field_number) { if (bank_mismatch(bank_field_number)) { return false; } const FieldDescriptor *descriptor = mapping_proto->GetDescriptor()->FindFieldByNumber(field_number); const Reflection *reflection = mapping_proto->GetReflection(); return reflection->HasField(*mapping_proto, descriptor); } bool MIDIMapper::bank_mismatch(int bank_field_number) { return !match_bank_helper(*mapping_proto, bank_field_number, current_controller_bank); } void MIDIMapper::refresh_lights() { lock_guard lock(mu); update_lights_lock_held(); } void MIDIMapper::update_lights_lock_held() { map active_lights; // Desired state. if (current_controller_bank == 0) { activate_mapped_light(*mapping_proto, MIDIMappingProto::kBank1IsSelectedFieldNumber, &active_lights); } if (current_controller_bank == 1) { activate_mapped_light(*mapping_proto, MIDIMappingProto::kBank2IsSelectedFieldNumber, &active_lights); } if (current_controller_bank == 2) { activate_mapped_light(*mapping_proto, MIDIMappingProto::kBank3IsSelectedFieldNumber, &active_lights); } if (current_controller_bank == 3) { activate_mapped_light(*mapping_proto, MIDIMappingProto::kBank4IsSelectedFieldNumber, &active_lights); } if (current_controller_bank == 4) { activate_mapped_light(*mapping_proto, MIDIMappingProto::kBank5IsSelectedFieldNumber, &active_lights); } if (preview_enabled_light == On) { // Playing. activate_mapped_light(*mapping_proto, MIDIMappingProto::kPreviewPlayingFieldNumber, &active_lights); } else if (preview_enabled_light == Blinking) { // Preview ready. activate_mapped_light(*mapping_proto, MIDIMappingProto::kPreviewReadyFieldNumber, &active_lights); } if (queue_enabled_light) { activate_mapped_light(*mapping_proto, MIDIMappingProto::kQueueEnabledFieldNumber, &active_lights); } if (play_enabled_light == On) { // Playing. activate_mapped_light(*mapping_proto, MIDIMappingProto::kPlayingFieldNumber, &active_lights); } else if (play_enabled_light == Blinking) { // Play ready. activate_mapped_light(*mapping_proto, MIDIMappingProto::kPlayReadyFieldNumber, &active_lights); } if (next_ready_light == On) { activate_mapped_light(*mapping_proto, MIDIMappingProto::kNextReadyFieldNumber, &active_lights); } if (locked_light == On) { activate_mapped_light(*mapping_proto, MIDIMappingProto::kLockedFieldNumber, &active_lights); } else if (locked_light == Blinking) { activate_mapped_light(*mapping_proto, MIDIMappingProto::kLockedBlinkingFieldNumber, &active_lights); } if (current_highlighted_camera >= 0 && current_highlighted_camera < mapping_proto->camera_size()) { const CameraMIDIMappingProto &camera = mapping_proto->camera(current_highlighted_camera); activate_mapped_light(camera, CameraMIDIMappingProto::kIsCurrentFieldNumber, &active_lights); } // Master speed light. if (mapping_proto->has_master_speed_light()) { unsigned controller = mapping_proto->master_speed_light().controller_number(); unsigned min = mapping_proto->master_speed_light_min(); unsigned max = mapping_proto->master_speed_light_max(); int speed_light_value = lrintf((max - min) * current_speed / 2.0f) + min; active_lights[MIDIDevice::LightKey{MIDIDevice::LightKey::CONTROLLER, controller}] = speed_light_value; } // These are always enabled right now. activate_mapped_light(*mapping_proto, MIDIMappingProto::kCueInEnabledFieldNumber, &active_lights); activate_mapped_light(*mapping_proto, MIDIMappingProto::kCueOutEnabledFieldNumber, &active_lights); midi_device.update_lights(active_lights); } nageru-2.3.0/futatabi/midi_mapper.h000066400000000000000000000101041450736322200172330ustar00rootroot00000000000000#ifndef _MIDI_MAPPER_H #define _MIDI_MAPPER_H 1 // MIDIMapper in Futatabi is much the same as MIDIMapper in Nageru // (it incoming MIDI messages from mixer controllers interprets them // according to a user-defined mapping, and calls back into a receiver), // and shares a fair amount of support code with it. However, it is // also somewhat different; there are no audio buses, in particular. // Also, DJ controllers typically have more buttons than audio controllers // since there's only one (or maybe two) channels, so banks are less // important, and thus, there's no highlighting. Also, the controllers // are somewhat different, e.g., you have jog to deal with. #include #include #include #include #include #include #include "defs.h" #include "shared/midi_device.h" class MIDIMappingProto; // Interface for receiving interpreted controller messages. class ControllerReceiver { public: virtual ~ControllerReceiver() {} virtual void preview() = 0; virtual void queue() = 0; virtual void play() = 0; virtual void next() = 0; virtual void toggle_lock() = 0; virtual void jog(int delta) = 0; virtual void switch_camera(unsigned camera_idx) = 0; virtual void set_master_speed(float speed) = 0; virtual void cue_in() = 0; virtual void cue_out() = 0; // Raw events; used for the editor dialog only. virtual void controller_changed(unsigned controller) = 0; virtual void note_on(unsigned note) = 0; }; class MIDIMapper : public MIDIReceiver { public: // Converts conveniently from a bool. enum LightState { Off = 0, On = 1, Blinking = 2 }; MIDIMapper(ControllerReceiver *receiver); virtual ~MIDIMapper(); void set_midi_mapping(const MIDIMappingProto &new_mapping); void start_thread(); const MIDIMappingProto &get_current_mapping() const; // Overwrites and returns the previous value. ControllerReceiver *set_receiver(ControllerReceiver *new_receiver); void refresh_lights(); void set_preview_enabled(LightState enabled) { preview_enabled_light = enabled; refresh_lights(); } void set_queue_enabled(bool enabled) { queue_enabled_light = enabled; refresh_lights(); } void set_play_enabled(LightState enabled) { play_enabled_light = enabled; refresh_lights(); } void set_next_ready(LightState enabled) { next_ready_light = enabled; refresh_lights(); } void set_locked(LightState locked) { locked_light = locked; refresh_lights(); } void highlight_camera_input(int stream_idx) { // -1 for none. current_highlighted_camera = stream_idx; refresh_lights(); } void set_speed_light(float speed) { // Goes from 0.0 to 2.0. current_speed = speed; refresh_lights(); } // MIDIReceiver. void controller_received(int controller, int value) override; void note_on_received(int note) override; void update_num_subscribers(unsigned num_subscribers) override {} private: void match_controller(int controller, int field_number, int bank_field_number, float value, std::function func); void match_button(int note, int field_number, int bank_field_number, std::function func); bool has_active_controller(int field_number, int bank_field_number); // Also works for buttons. bool bank_mismatch(int bank_field_number); void update_lights_lock_held(); std::atomic should_quit{false}; mutable std::mutex mu; ControllerReceiver *receiver; // Under . std::unique_ptr mapping_proto; // Under . int num_controller_banks; // Under . std::atomic current_controller_bank{0}; std::atomic preview_enabled_light{Off}; std::atomic queue_enabled_light{false}; std::atomic play_enabled_light{Off}; std::atomic next_ready_light{Off}; std::atomic locked_light{On}; std::atomic current_highlighted_camera{-1}; std::atomic current_speed{1.0f}; MIDIDevice midi_device; }; bool load_midi_mapping_from_file(const std::string &filename, MIDIMappingProto *new_mapping); bool save_midi_mapping_to_file(const MIDIMappingProto &mapping_proto, const std::string &filename); #endif // !defined(_MIDI_MAPPER_H) nageru-2.3.0/futatabi/midi_mapping.ui000066400000000000000000000040111450736322200175700ustar00rootroot00000000000000 MIDIMappingDialog 0 0 879 583 MIDI controller setup 1 Add or change a mapping by clicking in the cell, then moving the corresponding control on your MIDI device. &Save… &Load… Qt::Horizontal 40 20 Qt::Horizontal QDialogButtonBox::Cancel|QDialogButtonBox::Ok nageru-2.3.0/futatabi/midi_mapping_dialog.cpp000066400000000000000000000457601450736322200212740ustar00rootroot00000000000000#include "midi_mapping_dialog.h" #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include "shared/controller_spin_box.h" #include "midi_mapper.h" #include "futatabi_midi_mapping.pb.h" #include "shared/midi_mapper_util.h" #include "shared/post_to_main_thread.h" #include "ui_midi_mapping.h" class QObject; using namespace google::protobuf; using namespace std; vector controllers = { { "Jog", MIDIMappingProto::kJogFieldNumber, MIDIMappingProto::kJogBankFieldNumber }, { "Master speed", MIDIMappingProto::kMasterSpeedFieldNumber, MIDIMappingProto::kMasterSpeedBankFieldNumber }, }; vector controller_lights = { { "Master speed light", MIDIMappingProto::kMasterSpeedLightFieldNumber, 0 }, }; vector buttons = { { "Preview", MIDIMappingProto::kPreviewFieldNumber, MIDIMappingProto::kPreviewBankFieldNumber }, { "Queue", MIDIMappingProto::kQueueFieldNumber, MIDIMappingProto::kQueueBankFieldNumber }, { "Play", MIDIMappingProto::kPlayFieldNumber, MIDIMappingProto::kPlayBankFieldNumber }, { "Next", MIDIMappingProto::kNextFieldNumber, MIDIMappingProto::kNextButtonBankFieldNumber }, { "Lock master speed", MIDIMappingProto::kToggleLockFieldNumber, MIDIMappingProto::kToggleLockBankFieldNumber }, { "Cue in", MIDIMappingProto::kCueInFieldNumber, MIDIMappingProto::kCueInBankFieldNumber }, { "Cue out", MIDIMappingProto::kCueOutFieldNumber, MIDIMappingProto::kCueOutBankFieldNumber }, { "Previous bank", MIDIMappingProto::kPrevBankFieldNumber, 0 }, { "Next bank", MIDIMappingProto::kNextBankFieldNumber, 0 }, { "Select bank 1", MIDIMappingProto::kSelectBank1FieldNumber, 0 }, { "Select bank 2", MIDIMappingProto::kSelectBank2FieldNumber, 0 }, { "Select bank 3", MIDIMappingProto::kSelectBank3FieldNumber, 0 }, { "Select bank 4", MIDIMappingProto::kSelectBank4FieldNumber, 0 }, { "Select bank 5", MIDIMappingProto::kSelectBank5FieldNumber, 0 }, }; vector button_lights = { { "Preview playing", MIDIMappingProto::kPreviewPlayingFieldNumber, 0 }, { "Preview ready", MIDIMappingProto::kPreviewReadyFieldNumber, 0 }, { "Queue button enabled", MIDIMappingProto::kQueueEnabledFieldNumber, 0 }, { "Playing", MIDIMappingProto::kPlayingFieldNumber, 0 }, { "Play ready", MIDIMappingProto::kPlayReadyFieldNumber, 0 }, { "Next ready", MIDIMappingProto::kNextReadyFieldNumber, 0 }, { "Master speed locked", MIDIMappingProto::kLockedFieldNumber, 0 }, { "Master speed locked (blinking)", MIDIMappingProto::kLockedBlinkingFieldNumber, 0 }, { "Cue in enabled", MIDIMappingProto::kCueInEnabledFieldNumber, 0 }, { "Cue out enabled", MIDIMappingProto::kCueOutEnabledFieldNumber, 0 }, { "Bank 1 is selected", MIDIMappingProto::kBank1IsSelectedFieldNumber, 0 }, { "Bank 2 is selected", MIDIMappingProto::kBank2IsSelectedFieldNumber, 0 }, { "Bank 3 is selected", MIDIMappingProto::kBank3IsSelectedFieldNumber, 0 }, { "Bank 4 is selected", MIDIMappingProto::kBank4IsSelectedFieldNumber, 0 }, { "Bank 5 is selected", MIDIMappingProto::kBank5IsSelectedFieldNumber, 0 }, }; namespace { int get_bank(const MIDIMappingProto &mapping_proto, int bank_field_number, int default_value) { const FieldDescriptor *bank_descriptor = mapping_proto.GetDescriptor()->FindFieldByNumber(bank_field_number); const Reflection *reflection = mapping_proto.GetReflection(); if (!reflection->HasField(mapping_proto, bank_descriptor)) { return default_value; } return reflection->GetInt32(mapping_proto, bank_descriptor); } } // namespace MIDIMappingDialog::MIDIMappingDialog(MIDIMapper *mapper) : ui(new Ui::MIDIMappingDialog), mapper(mapper) { ui->setupUi(this); const MIDIMappingProto mapping_proto = mapper->get_current_mapping(); // Take a copy. old_receiver = mapper->set_receiver(this); QStringList labels; labels << ""; labels << "Controller bank"; labels << ""; labels << ""; labels << ""; labels << ""; ui->treeWidget->setColumnCount(6); ui->treeWidget->setHeaderLabels(labels); vector camera_select_buttons; vector camera_is_selected_lights; for (size_t camera_idx = 0; camera_idx < MAX_STREAMS; ++camera_idx) { char str[256]; snprintf(str, sizeof(str), "Switch to camera %zu", camera_idx + 1); camera_select_buttons.emplace_back(Control{ str, CameraMIDIMappingProto::kButtonFieldNumber, 0 }); snprintf(str, sizeof(str), "Camera %zu is current", camera_idx + 1); camera_is_selected_lights.emplace_back(Control{ str, CameraMIDIMappingProto::kIsCurrentFieldNumber, 0 }); } add_controls("Controllers", ControlType::CONTROLLER, mapping_proto, controllers); add_controls("Controller lights", ControlType::CONTROLLER_LIGHT, mapping_proto, controller_lights); add_controls("Buttons", ControlType::BUTTON, mapping_proto, buttons); add_controls("Button lights", ControlType::BUTTON_LIGHT, mapping_proto, button_lights); add_controls("Camera select buttons", ControlType::CAMERA_BUTTON, mapping_proto, camera_select_buttons); add_controls("Camera is selected lights", ControlType::CAMERA_BUTTON_LIGHT, mapping_proto, camera_is_selected_lights); fill_controls_from_mapping(mapping_proto); // Auto-resize every column but the last. for (unsigned column_idx = 0; column_idx < 5; ++column_idx) { ui->treeWidget->resizeColumnToContents(column_idx); } connect(ui->ok_cancel_buttons, &QDialogButtonBox::accepted, this, &MIDIMappingDialog::ok_clicked); connect(ui->ok_cancel_buttons, &QDialogButtonBox::rejected, this, &MIDIMappingDialog::cancel_clicked); connect(ui->save_button, &QPushButton::clicked, this, &MIDIMappingDialog::save_clicked); connect(ui->load_button, &QPushButton::clicked, this, &MIDIMappingDialog::load_clicked); } MIDIMappingDialog::~MIDIMappingDialog() { mapper->set_receiver(old_receiver); } void MIDIMappingDialog::ok_clicked() { unique_ptr new_mapping = construct_mapping_proto_from_ui(); mapper->set_midi_mapping(*new_mapping); mapper->set_receiver(old_receiver); accept(); } void MIDIMappingDialog::cancel_clicked() { mapper->set_receiver(old_receiver); reject(); } void MIDIMappingDialog::save_clicked() { QFileDialog::Options options; unique_ptr new_mapping = construct_mapping_proto_from_ui(); QString filename = QFileDialog::getSaveFileName(this, "Save MIDI mapping", QString(), tr("Mapping files (*.midimapping)"), /*selectedFilter=*/nullptr, options); if (!filename.endsWith(".midimapping")) { filename += ".midimapping"; } if (!save_midi_mapping_to_file(*new_mapping, filename.toStdString())) { QMessageBox box; box.setText("Could not save mapping to '" + filename + "'. Check that you have the right permissions and try again."); box.exec(); } } void MIDIMappingDialog::load_clicked() { QFileDialog::Options options; QString filename = QFileDialog::getOpenFileName(this, "Load MIDI mapping", QString(), tr("Mapping files (*.midimapping)"), /*selectedFilter=*/nullptr, options); MIDIMappingProto new_mapping; if (!load_midi_mapping_from_file(filename.toStdString(), &new_mapping)) { QMessageBox box; box.setText("Could not load mapping from '" + filename + "'. Check that the file exists, has the right permissions and is valid."); box.exec(); return; } fill_controls_from_mapping(new_mapping); } namespace { template T *get_mutable_message(Proto *proto, int field_number) { const FieldDescriptor *descriptor = proto->GetDescriptor()->FindFieldByNumber(field_number); const Reflection *bus_reflection = proto->GetReflection(); return static_cast(bus_reflection->MutableMessage(proto, descriptor)); } } // namespace unique_ptr MIDIMappingDialog::construct_mapping_proto_from_ui() { unique_ptr mapping_proto(new MIDIMappingProto); for (const InstantiatedSpinner &is : controller_spinners) { const int val = is.spinner->value(); if (val == -1) { continue; } MIDIControllerProto *controller_proto = get_mutable_message(mapping_proto.get(), is.field_number); controller_proto->set_controller_number(val); } for (const InstantiatedSpinner &is : controller_light_spinners) { const int val = is.spinner->value(); if (val == -1) { continue; } MIDIControllerProto *controller_proto = get_mutable_message(mapping_proto.get(), is.field_number); controller_proto->set_controller_number(val); // HACK: We only have one of these right now, so min/max is a given; // no need to store proto field numbers. int val2 = is.spinner2->value(); if (val2 != -1) { mapping_proto->set_master_speed_light_min(val2); } int val3 = is.spinner3->value(); if (val3 != -1) { mapping_proto->set_master_speed_light_max(val3); } } for (const InstantiatedSpinner &is : button_spinners) { const int val = is.spinner->value(); if (val == -1) { continue; } MIDIButtonProto *button_proto = get_mutable_message(mapping_proto.get(), is.field_number); button_proto->set_note_number(val); } for (const InstantiatedSpinner &is : button_light_spinners) { const int val = is.spinner->value(); if (val == -1) { continue; } MIDILightProto *light_proto = get_mutable_message(mapping_proto.get(), is.field_number); light_proto->set_note_number(val); int val2 = is.spinner2->value(); if (val2 != -1) { light_proto->set_velocity(val2); } } int highest_bank_used = 0; // 1-indexed. for (const InstantiatedComboBox &ic : bank_combo_boxes) { const int val = ic.combo_box->currentIndex(); highest_bank_used = std::max(highest_bank_used, val); if (val == 0) { continue; } const FieldDescriptor *descriptor = mapping_proto->GetDescriptor()->FindFieldByNumber(ic.field_number); const Reflection *bus_reflection = mapping_proto->GetReflection(); bus_reflection->SetInt32(mapping_proto.get(), descriptor, val - 1); } mapping_proto->set_num_controller_banks(highest_bank_used); size_t num_cameras_used = 0; for (size_t camera_idx = 0; camera_idx < MAX_STREAMS; ++camera_idx) { if (camera_button_spinners[camera_idx].spinner->value() != -1) { num_cameras_used = camera_idx + 1; } else if (camera_button_light_spinners[camera_idx].spinner->value() != -1) { num_cameras_used = camera_idx + 1; } } for (size_t camera_idx = 0; camera_idx < num_cameras_used; ++camera_idx) { CameraMIDIMappingProto *camera_proto = mapping_proto->add_camera(); { const InstantiatedSpinner &is = camera_button_spinners[camera_idx]; int val = is.spinner->value(); if (val != -1) { MIDIButtonProto *button_proto = get_mutable_message(camera_proto, is.field_number); button_proto->set_note_number(val); } } { const InstantiatedSpinner &is = camera_button_light_spinners[camera_idx]; int val = is.spinner->value(); int val2 = is.spinner2->value(); if (val == -1 && val2 == -1) continue; MIDILightProto *light_proto = get_mutable_message(camera_proto, is.field_number); if (val != -1) { light_proto->set_note_number(val); } if (val2 != -1) { light_proto->set_velocity(val2); } } } return mapping_proto; } void MIDIMappingDialog::add_bank_selector(QTreeWidgetItem *item, const MIDIMappingProto &mapping_proto, int bank_field_number) { if (bank_field_number == 0) { return; } QComboBox *bank_selector = new QComboBox(this); bank_selector->addItems(QStringList() << "" << "Bank 1" << "Bank 2" << "Bank 3" << "Bank 4" << "Bank 5"); bank_selector->setAutoFillBackground(true); bank_combo_boxes.push_back(InstantiatedComboBox{ bank_selector, bank_field_number }); ui->treeWidget->setItemWidget(item, 1, bank_selector); } void MIDIMappingDialog::add_controls(const string &heading, MIDIMappingDialog::ControlType control_type, const MIDIMappingProto &mapping_proto, const vector &controls) { QTreeWidgetItem *heading_item = new QTreeWidgetItem(ui->treeWidget); heading_item->setText(0, QString::fromStdString(heading)); if (control_type == ControlType::BUTTON_LIGHT) { heading_item->setText(3, "Velocity"); } else if (control_type == ControlType::CONTROLLER_LIGHT) { heading_item->setText(3, "Min"); heading_item->setText(4, "Max"); } else { heading_item->setFirstColumnSpanned(true); } heading_item->setExpanded(true); for (const Control &control : controls) { QTreeWidgetItem *item = new QTreeWidgetItem(heading_item); heading_item->addChild(item); add_bank_selector(item, mapping_proto, control.bank_field_number); item->setText(0, QString::fromStdString(control.label + " ")); QSpinBox *spinner; if (control_type == ControlType::CONTROLLER) { spinner = new ControllerSpinBox(this); spinner->setRange(-1, 128); // 128 for pitch bend. } else { spinner = new QSpinBox(this); spinner->setRange(-1, 127); } spinner->setAutoFillBackground(true); spinner->setSpecialValueText("\u200d"); // Zero-width joiner (ie., empty). ui->treeWidget->setItemWidget(item, 2, spinner); if (control_type == ControlType::CONTROLLER) { controller_spinners.push_back(InstantiatedSpinner{ spinner, nullptr, nullptr, control.field_number }); } else if (control_type == ControlType::CONTROLLER_LIGHT) { QSpinBox *spinner2 = new QSpinBox(this); spinner2->setRange(-1, 127); spinner2->setAutoFillBackground(true); spinner2->setSpecialValueText("\u200d"); // Zero-width joiner (ie., empty). QSpinBox *spinner3 = new QSpinBox(this); spinner3->setRange(-1, 127); spinner3->setAutoFillBackground(true); spinner3->setSpecialValueText("\u200d"); // Zero-width joiner (ie., empty). ui->treeWidget->setItemWidget(item, 3, spinner2); ui->treeWidget->setItemWidget(item, 4, spinner3); controller_light_spinners.push_back(InstantiatedSpinner{ spinner, spinner2, spinner3, control.field_number }); } else if (control_type == ControlType::BUTTON) { button_spinners.push_back(InstantiatedSpinner{ spinner, nullptr, nullptr, control.field_number }); } else if (control_type == ControlType::CAMERA_BUTTON) { camera_button_spinners.push_back(InstantiatedSpinner{ spinner, nullptr, nullptr, control.field_number }); } else { assert(control_type == ControlType::BUTTON_LIGHT || control_type == ControlType::CAMERA_BUTTON_LIGHT); QSpinBox *spinner2 = new QSpinBox(this); spinner2->setRange(-1, 127); spinner2->setAutoFillBackground(true); spinner2->setSpecialValueText("\u200d"); // Zero-width joiner (ie., empty). ui->treeWidget->setItemWidget(item, 3, spinner2); if (control_type == ControlType::BUTTON_LIGHT) { button_light_spinners.push_back(InstantiatedSpinner{ spinner, spinner2, nullptr, control.field_number }); } else { assert(control_type == ControlType::CAMERA_BUTTON_LIGHT); camera_button_light_spinners.push_back(InstantiatedSpinner{ spinner, spinner2, nullptr, control.field_number }); } } spinners[control.field_number] = spinner; } ui->treeWidget->addTopLevelItem(heading_item); } void MIDIMappingDialog::fill_controls_from_mapping(const MIDIMappingProto &mapping_proto) { for (const InstantiatedSpinner &is : controller_spinners) { is.spinner->setValue(get_controller_mapping_helper(mapping_proto, is.field_number, -1)); } for (const InstantiatedSpinner &is : controller_light_spinners) { is.spinner->setValue(get_controller_mapping_helper(mapping_proto, is.field_number, -1)); // HACK: We only have one of these right now, so min/max is a given; // no need to store proto field numbers. if (mapping_proto.has_master_speed_light_min()) { is.spinner2->setValue(mapping_proto.master_speed_light_min()); } if (mapping_proto.has_master_speed_light_max()) { is.spinner3->setValue(mapping_proto.master_speed_light_max()); } } for (const InstantiatedSpinner &is : button_spinners) { is.spinner->setValue(get_button_mapping_helper(mapping_proto, is.field_number, -1)); } for (const InstantiatedSpinner &is : button_light_spinners) { MIDILightProto light_proto = get_light_mapping_helper(mapping_proto, is.field_number); if (light_proto.has_note_number()) { is.spinner->setValue(light_proto.note_number()); } else { is.spinner->setValue(-1); } if (light_proto.has_velocity()) { is.spinner2->setValue(light_proto.velocity()); } else { is.spinner2->setValue(-1); } } for (size_t camera_idx = 0; camera_idx < MAX_STREAMS; ++camera_idx) { CameraMIDIMappingProto camera_proto; if (camera_idx < size_t(mapping_proto.camera_size())) { camera_proto = mapping_proto.camera(camera_idx); } { const InstantiatedSpinner &is = camera_button_spinners[camera_idx]; is.spinner->setValue(get_button_mapping_helper(camera_proto, is.field_number, -1)); } { const InstantiatedSpinner &is = camera_button_light_spinners[camera_idx]; const MIDILightProto &light_proto = get_light_mapping_helper(camera_proto, is.field_number); if (light_proto.has_note_number()) { is.spinner->setValue(light_proto.note_number()); } else { is.spinner->setValue(-1); } if (light_proto.has_velocity()) { is.spinner2->setValue(light_proto.velocity()); } else { is.spinner2->setValue(-1); } } } for (const InstantiatedComboBox &ic : bank_combo_boxes) { ic.combo_box->setCurrentIndex(get_bank(mapping_proto, ic.field_number, -1) + 1); } } void MIDIMappingDialog::controller_changed(unsigned controller) { post_to_main_thread([=]{ for (const InstantiatedSpinner &is : controller_spinners) { if (is.spinner->hasFocus()) { is.spinner->setValue(controller); is.spinner->selectAll(); } } for (const InstantiatedSpinner &is : controller_light_spinners) { if (is.spinner->hasFocus()) { is.spinner->setValue(controller); is.spinner->selectAll(); } } }); } void MIDIMappingDialog::note_on(unsigned note) { post_to_main_thread([=]{ for (const auto &spinners : { button_spinners, camera_button_spinners }) { for (const InstantiatedSpinner &is : spinners) { if (is.spinner->hasFocus()) { is.spinner->setValue(note); is.spinner->selectAll(); } } } for (const auto &light_spinners : { button_light_spinners, camera_button_light_spinners }) { for (const InstantiatedSpinner &is : light_spinners) { if (is.spinner->hasFocus()) { is.spinner->setValue(note); is.spinner->selectAll(); } } } }); } nageru-2.3.0/futatabi/midi_mapping_dialog.h000066400000000000000000000060301450736322200207240ustar00rootroot00000000000000#ifndef _MIDI_MAPPING_DIALOG_H #define _MIDI_MAPPING_DIALOG_H #include #include #include #include #include #include #include #include #include "midi_mapper.h" class QEvent; class QObject; namespace Ui { class MIDIMappingDialog; } // namespace Ui class MIDIMappingProto; class QComboBox; class QSpinBox; class QTreeWidgetItem; class MIDIMappingDialog : public QDialog, public ControllerReceiver { Q_OBJECT public: MIDIMappingDialog(MIDIMapper *mapper); ~MIDIMappingDialog(); // For use in midi_mapping_dialog.cpp only. struct Control { std::string label; int field_number; // In MIDIMappingBusProto. int bank_field_number; // In MIDIMappingProto. }; // ControllerReceiver interface. We only implement the raw events. void preview() override {} void queue() override {} void play() override {} void next() override {} void toggle_lock() override {} void jog(int delta) override {} void switch_camera(unsigned camera_idx) override {} void set_master_speed(float speed) override {} void cue_in() override {} void cue_out() override {} // Raw events; used for the editor dialog only. void controller_changed(unsigned controller) override; void note_on(unsigned note) override; private: void ok_clicked(); void cancel_clicked(); void save_clicked(); void load_clicked(); void add_bank_selector(QTreeWidgetItem *item, const MIDIMappingProto &mapping_proto, int bank_field_number); enum class ControlType { CONTROLLER, CONTROLLER_LIGHT, BUTTON, BUTTON_LIGHT, CAMERA_BUTTON, CAMERA_BUTTON_LIGHT }; void add_controls(const std::string &heading, ControlType control_type, const MIDIMappingProto &mapping_proto, const std::vector &controls); void fill_controls_from_mapping(const MIDIMappingProto &mapping_proto); std::unique_ptr construct_mapping_proto_from_ui(); Ui::MIDIMappingDialog *ui; MIDIMapper *mapper; ControllerReceiver *old_receiver; // All controllers actually laid out on the grid (we need to store them // so that we can move values back and forth between the controls and // the protobuf on save/load). struct InstantiatedSpinner { QSpinBox *spinner; QSpinBox *spinner2; // Value for button lights, min value for controller lights. QSpinBox *spinner3; // Max value for controller lights. int field_number; // In MIDIMappingBusProto. }; struct InstantiatedComboBox { QComboBox *combo_box; int field_number; // In MIDIMappingProto. }; std::vector controller_spinners; std::vector controller_light_spinners; std::vector button_spinners; std::vector button_light_spinners; std::vector camera_button_spinners; // One per camera. std::vector camera_button_light_spinners; // One per camera. std::vector bank_combo_boxes; // Keyed on field number. std::map spinners; }; #endif // !defined(_MIDI_MAPPING_DIALOG_H) nageru-2.3.0/futatabi/motion_search.frag000066400000000000000000000156501450736322200203020ustar00rootroot00000000000000#version 450 core /* The motion search is one of the two major components of DIS. It works more or less like you'd expect; there's a bunch of overlapping patches (8x8 or 12x12 pixels) in a grid, and for each patch, there's a search to try to find the most similar patch in the other frame. Unlike in a typical video codec, the DIS patch search is based on gradient descent; conceptually, you start with an initial guess (the value from the previous level, or the zero flow for the very first level), subtract the reference (“template”) patch from the candidate, look at the gradient to see in what direction there is a lower difference, and then inch a bit toward that direction. (There is seemingly nothing like AdaM, Momentum or similar, but the searched value is only in two dimensions, so perhaps it doesn't matter as much then.) DIS does a tweak to this concept. Since the procedure as outlined above requires computing the gradient of the candidate patch, it uses the reference patch as candidate (thus the “inverse” name), and thus uses _its_ gradient to understand in which direction to move. (This is a bit dodgy, but not _that_ dodgy; after all, the two patches are supposed to be quite similar, so their surroundings and thus also gradients should also be quite similar.) It's not entirely clear whether this is still a win on GPU, where calculations are much cheaper, especially the way we parallelize the search, but we've kept it around for now. The inverse search is explained and derived in the supplementary material of the paper, section A. Do note that there's a typo; the text under equation 9 claims that the matrix H is n x n (where presumably n is the patch size), while in reality, it's 2x2. Our GPU parallellization is fairly dumb right now; we do one patch per fragment (ie., parallellize only over patches, not within each patch), which may not be optimal. In particular, in the initial level, we only have 40 patches, which is on the low side for a GPU, and the memory access patterns may also not be ideal. */ in vec3 flow_tc; in vec2 patch_center; flat in int ref_layer, search_layer; out vec3 out_flow; uniform sampler2DArray flow_tex, image_tex; uniform usampler2DArray grad_tex; // Also contains the corresponding reference image. uniform vec2 inv_image_size, inv_prev_level_size; uniform uint patch_size; uniform uint num_iterations; vec3 unpack_gradients(uint v) { uint vi = v & 0xffu; uint xi = (v >> 8) & 0xfffu; uint yi = v >> 20; vec3 r = vec3(xi * (1.0f / 4095.0f) - 0.5f, yi * (1.0f / 4095.0f) - 0.5f, vi * (1.0f / 255.0f)); return r; } // Note: The third variable is the actual pixel value. vec3 get_gradients(vec3 tc) { vec3 grad = unpack_gradients(texture(grad_tex, tc).x); // Zero gradients outside the image. (We'd do this with a sampler, // but we want the repeat behavior for the actual texels, in the // z channel.) if (any(lessThan(tc.xy, vec2(0.0f))) || any(greaterThan(tc.xy, vec2(1.0f)))) { grad.xy = vec2(0.0f); } return grad; } void main() { vec2 image_size = textureSize(grad_tex, 0).xy; // Lock the patch center to an integer, so that we never get // any bilinear artifacts for the gradient. (NOTE: This assumes an // even patch size.) Then calculate the bottom-left texel of the patch. vec2 base = (round(patch_center * image_size) - (0.5f * patch_size - 0.5f)) * inv_image_size; // First, precompute the pseudo-Hessian for the template patch. // This is the part where we really save by the inverse search // (ie., we can compute it up-front instead of anew for each // patch). // // H = sum(S^T S) // // where S is the gradient at each point in the patch. Note that // this is an outer product, so we get a (symmetric) 2x2 matrix, // not a scalar. mat2 H = mat2(0.0f); vec2 grad_sum = vec2(0.0f); // Used for patch normalization. float template_sum = 0.0f; for (uint y = 0; y < patch_size; ++y) { for (uint x = 0; x < patch_size; ++x) { vec2 tc = base + uvec2(x, y) * inv_image_size; vec3 grad = get_gradients(vec3(tc, ref_layer)); H[0][0] += grad.x * grad.x; H[1][1] += grad.y * grad.y; H[0][1] += grad.x * grad.y; template_sum += grad.z; // The actual template pixel value. grad_sum += grad.xy; } } H[1][0] = H[0][1]; // Make sure we don't get a singular matrix even if e.g. the picture is // all black. (The paper doesn't mention this, but the reference code // does it, and it seems like a reasonable hack to avoid NaNs. With such // a H, we'll go out-of-bounds pretty soon, though.) if (determinant(H) < 1e-6) { H[0][0] += 1e-6; H[1][1] += 1e-6; } mat2 H_inv = inverse(H); // Fetch the initial guess for the flow, and convert from the previous size to this one. vec2 initial_u = texture(flow_tex, flow_tc).xy * (image_size * inv_prev_level_size); vec2 u = initial_u; float mean_diff, first_mean_diff; for (uint i = 0; i < num_iterations; ++i) { vec2 du = vec2(0.0, 0.0); float warped_sum = 0.0f; vec2 u_norm = u * inv_image_size; // In [0..1] coordinates instead of pixels. for (uint y = 0; y < patch_size; ++y) { for (uint x = 0; x < patch_size; ++x) { vec2 tc = base + uvec2(x, y) * inv_image_size; vec3 grad = get_gradients(vec3(tc, ref_layer)); float t = grad.z; float warped = texture(image_tex, vec3(tc + u_norm, search_layer)).x; du += grad.xy * (warped - t); warped_sum += warped; } } // Subtract the mean for patch normalization. We've done our // sums without subtracting the means (because we didn't know them // beforehand), ie.: // // sum(S^T * ((x + µ1) - (y + µ2))) = sum(S^T * (x - y)) + (µ1 – µ2) sum(S^T) // // which gives trivially // // sum(S^T * (x - y)) = [what we calculated] - (µ1 - µ2) sum(S^T) // // so we can just subtract away the mean difference here. mean_diff = (warped_sum - template_sum) * (1.0 / float(patch_size * patch_size)); du -= grad_sum * mean_diff; if (i == 0) { first_mean_diff = mean_diff; } // Do the actual update. u -= H_inv * du; } // Reject if we moved too far. Note that the paper says “too far” is the // patch size, but the DIS code uses half of a patch size. The latter seems // to give much better overall results. // // Also reject if the patch goes out-of-bounds (the paper does not mention this, // but the code does, and it seems to be critical to avoid really bad behavior // at the edges). vec2 patch_center = (base * image_size - 0.5f) + patch_size * 0.5f + u; if (length(u - initial_u) > (patch_size * 0.5f) || patch_center.x < -(patch_size * 0.5f) || image_size.x - patch_center.x < -(patch_size * 0.5f) || patch_center.y < -(patch_size * 0.5f) || image_size.y - patch_center.y < -(patch_size * 0.5f)) { u = initial_u; mean_diff = first_mean_diff; } // NOTE: The mean patch diff will be for the second-to-last patch, // not the true position of du. But hopefully, it will be very close. u *= inv_image_size; out_flow = vec3(u.x, u.y, mean_diff); } nageru-2.3.0/futatabi/motion_search.vert000066400000000000000000000026541450736322200203430ustar00rootroot00000000000000#version 450 core #extension GL_ARB_shader_viewport_layer_array : require layout(location=0) in vec2 position; out vec3 flow_tc; out vec2 patch_center; flat out int ref_layer, search_layer; uniform sampler2DArray flow_tex; uniform vec2 out_flow_size; void main() { // Patch placement: We want the outermost patches to have centers exactly in the // image corners, so that the bottom-left patch has centre (0,0) and the // upper-right patch has center (1,1). The position we get in is _almost_ there; // since the quad's corners are in (0,0) and (1,1), the fragment shader will get // centers in x=0.5/w, x=1.5/w and so on (and similar for y). // // In other words, find some f(x) = ax + b so that // // a 0.5 / w + b = 0 // a (1.0 - 0.5 / w) + b = 1 // // which gives // // a = 1 / (w - 1) // b = w / 2 (w - 1) vec2 a = out_flow_size / (out_flow_size - 1); vec2 b = -1.0 / (2 * (out_flow_size - 1.0)); patch_center = a * position + b; // The result of glOrtho(0.0, 1.0, 0.0, 1.0, 0.0, 1.0) is: // // 2.000 0.000 0.000 -1.000 // 0.000 2.000 0.000 -1.000 // 0.000 0.000 -2.000 -1.000 // 0.000 0.000 0.000 1.000 gl_Position = vec4(2.0 * position.x - 1.0, 2.0 * position.y - 1.0, -1.0, 1.0); flow_tc = vec3(position, gl_InstanceID); gl_Layer = gl_InstanceID; // Forward flow (0) goes from 0 to 1. Backward flow (1) goes from 1 to 0. ref_layer = gl_InstanceID; search_layer = 1 - gl_InstanceID; } nageru-2.3.0/futatabi/pbo_pool.cpp000066400000000000000000000035361450736322200171240ustar00rootroot00000000000000#include "pbo_pool.h" #include #include #include using namespace std; using namespace std::chrono; once_flag global_pbo_pool_inited; PBOPool *global_pbo_pool = nullptr; void init_pbo_pool() { call_once(global_pbo_pool_inited, []{ global_pbo_pool = new PBOPool; }); } PBOPool::PBOPool(size_t pbo_size, size_t num_pbos, GLenum buffer, GLenum permissions, GLenum map_bits) : pbo_size(pbo_size), buffer(buffer), permissions(permissions), map_bits(map_bits) { for (size_t i = 0; i < num_pbos; ++i) { freelist.push(create_pbo()); } } PBO PBOPool::alloc_pbo() { PBO pbo; bool found_pbo = false; { lock_guard lock(freelist_mutex); if (!freelist.empty()) { pbo = move(freelist.front()); freelist.pop(); found_pbo = true; } } if (!found_pbo) { fprintf(stderr, "WARNING: Out of PBOs for texture upload, creating a new one\n"); pbo = create_pbo(); } if (pbo.upload_done != nullptr) { if (glClientWaitSync(pbo.upload_done.get(), 0, 0) == GL_TIMEOUT_EXPIRED) { steady_clock::time_point start = steady_clock::now(); glClientWaitSync(pbo.upload_done.get(), /*flags=*/0, GL_TIMEOUT_IGNORED); steady_clock::time_point stop = steady_clock::now(); fprintf(stderr, "WARNING: PBO was not ready after previous upload, had to wait %.1f ms before reusing\n", 1e3 * duration(stop - start).count()); } pbo.upload_done.reset(); } return pbo; } void PBOPool::release_pbo(PBO pbo) { lock_guard lock(freelist_mutex); freelist.push(move(pbo)); } PBO PBOPool::create_pbo() { PBO pbo; glCreateBuffers(1, &pbo.pbo); check_error(); glNamedBufferStorage(pbo.pbo, pbo_size, nullptr, permissions | GL_MAP_PERSISTENT_BIT); check_error(); pbo.ptr = (uint8_t *)glMapNamedBufferRange(pbo.pbo, 0, pbo_size, permissions | map_bits | GL_MAP_PERSISTENT_BIT); check_error(); return pbo; } nageru-2.3.0/futatabi/pbo_pool.h000066400000000000000000000026641450736322200165720ustar00rootroot00000000000000#ifndef _PBO_POOL_H #define _PBO_POOL_H 1 // Keeps a pool of persistently mapped PBOs around that can be used as staging // buffers for texture uploads. (Uploading from a PBO is asynchronous and done // by the GPU, so assuming we don't need an extra copy into the PBO, this is a // significant win over uploading from regular malloc-ed RAM.) // // Unlike Nageru's PBOFrameAllocator, these are not connected to // a given frame, since we can have thousands of frames in the cache // at any given time. Thus, we need to have separate fences for each PBO // to know that the upload is done. #include #include #include #include "shared/ref_counted_gl_sync.h" struct PBO { GLuint pbo; uint8_t *ptr; // Mapped memory. RefCountedGLsync upload_done; }; class PBOPool { public: PBOPool(size_t pbo_size = 8 << 20, // 8 MB, large enough for 1080p 4:2:2. size_t num_pbos = 8, GLenum buffer = GL_PIXEL_UNPACK_BUFFER_ARB, GLenum permissions = GL_MAP_WRITE_BIT, GLenum map_bits = GL_MAP_FLUSH_EXPLICIT_BIT); PBO alloc_pbo(); void release_pbo(PBO pbo); // Set a fence on upload_done if the PBO may still be in use. private: PBO create_pbo(); std::mutex freelist_mutex; std::queue freelist; size_t pbo_size; GLenum buffer, permissions, map_bits; }; extern PBOPool *global_pbo_pool; void init_pbo_pool(); // Idempotent. #endif // !defined(_PBO_POOL_H) nageru-2.3.0/futatabi/player.cpp000066400000000000000000001022671450736322200166100ustar00rootroot00000000000000#include "player.h" #include "clip_list.h" #include "defs.h" #include "flags.h" #include "frame_on_disk.h" #include "jpeg_frame_view.h" #include "shared/context.h" #include "shared/ffmpeg_raii.h" #include "shared/httpd.h" #include "shared/metrics.h" #include "shared/mux.h" #include "shared/timebase.h" #include "video_stream.h" #include #include #include #include #include #include #include #include using namespace std; using namespace std::chrono; extern HTTPD *global_httpd; void Player::thread_func(AVFormatContext *file_avctx) { pthread_setname_np(pthread_self(), "Player"); QSurface *surface = create_surface(); QOpenGLContext *context = create_context(surface); if (!make_current(context, surface)) { printf("oops\n"); abort(); } check_error(); // Create the VideoStream object, now that we have an OpenGL context. if (stream_output != NO_STREAM_OUTPUT) { video_stream.reset(new VideoStream(file_avctx)); video_stream->start(); } check_error(); while (!should_quit) { play_playlist_once(); } } namespace { double calc_progress(const Clip &clip, int64_t pts) { return double(pts - clip.pts_in) / (clip.pts_out - clip.pts_in); } void do_splice(const vector &new_list, size_t playing_index1, ssize_t playing_index2, vector *old_list) { assert(playing_index2 == -1 || size_t(playing_index2) == playing_index1 + 1); // First see if we can do the simple thing; find an element in the new // list that we are already playing, which will serve as our splice point. int splice_start_new_list = -1; for (size_t clip_idx = 0; clip_idx < new_list.size(); ++clip_idx) { if (new_list[clip_idx].id == (*old_list)[playing_index1].id) { splice_start_new_list = clip_idx + 1; } else if (playing_index2 != -1 && new_list[clip_idx].id == (*old_list)[playing_index2].id) { splice_start_new_list = clip_idx + 1; } } if (splice_start_new_list == -1) { // OK, so the playing items are no longer in the new list. Most likely, // that means we deleted some range that included them. But the ones // before should stay put -- and we don't want to play them. So find // the ones that we've already played, and ignore them. Hopefully, // they're contiguous; the last one that's not seen will be our cut point. // // Keeping track of the playlist range explicitly in the UI would remove // the need for these heuristics, but it would probably also mean we'd // have to lock the playing clip, which sounds annoying. unordered_map played_ids; for (size_t clip_idx = 0; clip_idx < playing_index1; ++old_list) { played_ids.emplace((*old_list)[clip_idx].id, clip_idx); } for (size_t clip_idx = 0; clip_idx < new_list.size(); ++clip_idx) { if (played_ids.count(new_list[clip_idx].id)) { splice_start_new_list = clip_idx + 1; } } if (splice_start_new_list == -1) { // OK, we didn't find any matches; the lists are totally distinct. // So probably the entire thing was deleted; leave it alone. return; } } size_t splice_start_old_list = ((playing_index2 == -1) ? playing_index1 : playing_index2) + 1; old_list->erase(old_list->begin() + splice_start_old_list, old_list->end()); old_list->insert(old_list->end(), new_list.begin() + splice_start_new_list, new_list.end()); } // Keeps track of the various timelines (wall clock time, output pts, // position in the clip we are playing). Generally we keep an origin // and assume we increase linearly from there; the intention is to // avoid getting compounded accuracy errors, although with double, // that is perhaps overkill. (Whenever we break the linear assumption, // we need to reset said origin.) class TimelineTracker { public: struct Instant { steady_clock::time_point wallclock_time; int64_t in_pts; int64_t out_pts; int64_t frameno; }; TimelineTracker(double master_speed, int64_t out_pts_origin) : master_speed(master_speed), last_out_pts(out_pts_origin) { origin.out_pts = out_pts_origin; master_speed_ease_target = master_speed; // Keeps GCC happy. } void new_clip(steady_clock::time_point wallclock_origin, const Clip *clip, int64_t start_pts_offset) { this->clip = clip; origin.wallclock_time = wallclock_origin; origin.in_pts = clip->pts_in + start_pts_offset; origin.out_pts = last_out_pts; origin.frameno = 0; } // Returns the current time for said frame. Instant advance_to_frame(int64_t frameno); int64_t get_in_pts_origin() const { return origin.in_pts; } bool playing_at_normal_speed() const { if (in_easing) return false; const double effective_speed = clip->speed * master_speed; return effective_speed >= 0.999 && effective_speed <= 1.001; } void snap_by(int64_t offset) { if (in_easing) { // Easing will normally aim for a snap at the very end, // so don't disturb it by jittering during the ease. return; } origin.in_pts += offset; } void change_master_speed(double new_master_speed, Instant now); float in_master_speed(float speed) const { return (!in_easing && fabs(master_speed - speed) < 1e-6); } // Instead of changing the speed instantly, change it over the course of // about 200 ms. This is a simple linear ramp; I tried various forms of // Bézier curves for more elegant/dramatic changing, but it seemed linear // looked just as good in practical video. void start_easing(double new_master_speed, int64_t length_out_pts, Instant now); int64_t find_easing_length(double master_speed_target, int64_t length_out_pts, const vector &frames, Instant now); private: // Find out how far we are into the easing curve (0..1). // We use this to adjust the input pts. double find_ease_t(double out_pts) const; double easing_out_pts_adjustment(double out_pts) const; double master_speed; const Clip *clip = nullptr; Instant origin; int64_t last_out_pts; // If easing between new and old master speeds. bool in_easing = false; int64_t ease_started_pts = 0; double master_speed_ease_target; int64_t ease_length_out_pts = 0; }; TimelineTracker::Instant TimelineTracker::advance_to_frame(int64_t frameno) { Instant ret; double in_pts_double = origin.in_pts + TIMEBASE * clip->speed * (frameno - origin.frameno) * master_speed / global_flags.output_framerate; double out_pts_double = origin.out_pts + TIMEBASE * (frameno - origin.frameno) / global_flags.output_framerate; if (in_easing) { double in_pts_adjustment = easing_out_pts_adjustment(out_pts_double) * clip->speed; in_pts_double += in_pts_adjustment; } ret.in_pts = lrint(in_pts_double); ret.out_pts = lrint(out_pts_double); ret.wallclock_time = origin.wallclock_time + microseconds(lrint((out_pts_double - origin.out_pts) * 1e6 / TIMEBASE)); ret.frameno = frameno; last_out_pts = ret.out_pts; if (in_easing && ret.out_pts >= ease_started_pts + ease_length_out_pts) { // We have ended easing. Add what we need for the entire easing period, // then _actually_ change the speed as we go back into normal mode. origin.out_pts += easing_out_pts_adjustment(out_pts_double); change_master_speed(master_speed_ease_target, ret); in_easing = false; } return ret; } void TimelineTracker::change_master_speed(double new_master_speed, Instant now) { master_speed = new_master_speed; // Reset the origins, since the calculations depend on linear interpolation // based on the master speed. origin = now; } void TimelineTracker::start_easing(double new_master_speed, int64_t length_out_pts, Instant now) { if (in_easing) { // Apply whatever we managed to complete of the previous easing. origin.out_pts += easing_out_pts_adjustment(now.out_pts); double reached_speed = master_speed + (master_speed_ease_target - master_speed) * find_ease_t(now.out_pts); change_master_speed(reached_speed, now); } in_easing = true; ease_started_pts = now.out_pts; master_speed_ease_target = new_master_speed; ease_length_out_pts = length_out_pts; } double TimelineTracker::find_ease_t(double out_pts) const { return (out_pts - ease_started_pts) / double(ease_length_out_pts); } double TimelineTracker::easing_out_pts_adjustment(double out_pts) const { double t = find_ease_t(out_pts); double area_factor = (master_speed_ease_target - master_speed) * ease_length_out_pts; double val = 0.5 * min(t, 1.0) * min(t, 1.0) * area_factor; if (t > 1.0) { val += area_factor * (t - 1.0); } return val; } int64_t TimelineTracker::find_easing_length(double master_speed_target, int64_t desired_length_out_pts, const vector &frames, Instant now) { // Find out what frame we would have hit (approximately) with the given ease length. double in_pts_length = 0.5 * (master_speed_target + master_speed) * desired_length_out_pts * clip->speed; const int input_frame_num = distance( frames.begin(), find_first_frame_at_or_after(frames, lrint(now.in_pts + in_pts_length))); // Round length_out_pts to the nearest amount of whole frames. const double frame_length = TIMEBASE / global_flags.output_framerate; const int length_out_frames = lrint(desired_length_out_pts / frame_length); // Time the easing so that we aim at 200 ms (or whatever length_out_pts // was), but adjust it so that we hit exactly on a frame. Unless we are // somehow unlucky and run in the middle of a bad fade, this should // lock us nicely into a cadence where we hit original frames (of course // assuming the new speed is a reasonable ratio). // // Assume for a moment that we are easing into a slowdown, and that // we're slightly too late to hit the frame we want to. This means that // we can shorten the ease a bit; this chops some of the total integrated // velocity and arrive at the frame a bit sooner. Solve for the time // we want to shorten the ease by (let's call it x, where the original // length of the ease is called len) such that we hit exactly the in // pts at the right time: // // 0.5 * (mst + ms) * (len - x) * cs + mst * x * cs = desired_len_in_pts // // gives // // x = (2 * desired_len_in_pts / cs - (mst + ms) * len) / (mst - ms) // // Conveniently, this holds even if we are too early; a negative x // (surprisingly!) gives a lenghtening such that we don't hit the desired // frame, but hit one slightly later. (x larger than len means that // it's impossible to hit the desired frame, even if we dropped the ease // altogether and just changed speeds instantly.) We also have sign invariance, // so that these properties hold even if we are speeding up, not slowing // down. Together, these two properties mean that we can cast a fairly // wide net, trying various input and output frames and seeing which ones // can be matched up with a minimal change to easing time. (This lets us // e.g. end the ease close to the midpoint between two endpoint frames // even if we don't know the frame rate, or deal fairly robustly with // dropped input frames.) Many of these will give us the same answer, // but that's fine, because the ease length is the only output. int64_t best_length_out_pts = TIMEBASE * 10; // Infinite. for (int output_frame_offset = -2; output_frame_offset <= 2; ++output_frame_offset) { int64_t aim_length_out_pts = lrint((length_out_frames + output_frame_offset) * frame_length); if (aim_length_out_pts < 0) { continue; } for (int input_frame_offset = -2; input_frame_offset <= 2; ++input_frame_offset) { if (input_frame_num + input_frame_offset < 0 || input_frame_num + input_frame_offset >= int(frames.size())) { continue; } const int64_t in_pts = frames[input_frame_num + input_frame_offset].pts; double shorten_by_out_pts = (2.0 * (in_pts - now.in_pts) / clip->speed - (master_speed_target + master_speed) * aim_length_out_pts) / (master_speed_target - master_speed); int64_t length_out_pts = lrint(aim_length_out_pts - shorten_by_out_pts); if (length_out_pts >= 0 && abs(length_out_pts - desired_length_out_pts) < abs(best_length_out_pts - desired_length_out_pts)) { best_length_out_pts = length_out_pts; } } } // If we need more than two seconds of easing, we give up -- // this can happen if we're e.g. going from 101% to 100%. // If so, it would be better to let other mechanisms, such as the switch // to the next clip, deal with getting us back into sync. if (best_length_out_pts > TIMEBASE * 2) { return desired_length_out_pts; } else { return best_length_out_pts; } } } // namespace void Player::play_playlist_once() { vector clip_list; bool clip_ready; steady_clock::time_point before_sleep = steady_clock::now(); string pause_status; // Wait until we're supposed to play something. { unique_lock lock(queue_state_mu); playing = false; clip_ready = new_clip_changed.wait_for(lock, milliseconds(100), [this] { return should_quit || new_clip_ready; }); if (should_quit) { return; } if (clip_ready) { new_clip_ready = false; playing = true; clip_list = move(queued_clip_list); queued_clip_list.clear(); assert(!clip_list.empty()); assert(!splice_ready); // This corner case should have been handled in splice_play(). } else { pause_status = this->pause_status; } } steady_clock::duration time_slept = steady_clock::now() - before_sleep; int64_t slept_pts = duration_cast>(time_slept).count(); if (slept_pts > 0) { if (video_stream != nullptr) { // Add silence for the time we're waiting. video_stream->schedule_silence(steady_clock::now(), pts, slept_pts, QueueSpotHolder()); } pts += slept_pts; } if (!clip_ready) { if (video_stream != nullptr) { ++metric_refresh_frame; string subtitle = "Futatabi " NAGERU_VERSION ";PAUSED;0.000;" + pause_status; video_stream->schedule_refresh_frame(steady_clock::now(), pts, /*display_func=*/nullptr, QueueSpotHolder(), subtitle); } return; } should_skip_to_next = false; // To make sure we don't have a lingering click from before play. steady_clock::time_point origin = steady_clock::now(); // TODO: Add a 100 ms buffer for ramp-up? TimelineTracker timeline(start_master_speed, pts); timeline.new_clip(origin, &clip_list[0].clip, /*pts_offset=*/0); for (size_t clip_idx = 0; clip_idx < clip_list.size(); ++clip_idx) { const Clip *clip = &clip_list[clip_idx].clip; const Clip *next_clip = (clip_idx + 1 < clip_list.size()) ? &clip_list[clip_idx + 1].clip : nullptr; double next_clip_fade_time = -1.0; if (next_clip != nullptr) { double duration_this_clip = double(clip->pts_out - timeline.get_in_pts_origin()) / TIMEBASE / clip->speed; double duration_next_clip = double(next_clip->pts_out - next_clip->pts_in) / TIMEBASE / clip->speed; next_clip_fade_time = min(min(duration_this_clip, duration_next_clip), clip->fade_time_seconds); } int stream_idx = clip->stream_idx; // Start playing exactly at a frame. // TODO: Snap secondary (fade-to) clips in the same fashion // so that we don't get jank here). { lock_guard lock(frame_mu); // Find the first frame such that frame.pts <= in_pts. auto it = find_last_frame_before(frames[stream_idx], timeline.get_in_pts_origin()); if (it != frames[stream_idx].end()) { timeline.snap_by(it->pts - timeline.get_in_pts_origin()); } } steady_clock::time_point next_frame_start; for (int64_t frameno = 0; !should_quit; ++frameno) { // Ends when the clip ends. TimelineTracker::Instant instant = timeline.advance_to_frame(frameno); int64_t in_pts = instant.in_pts; pts = instant.out_pts; next_frame_start = instant.wallclock_time; float new_master_speed = change_master_speed.exchange(0.0f / 0.0f); if (!std::isnan(new_master_speed) && !timeline.in_master_speed(new_master_speed)) { int64_t ease_length_out_pts = TIMEBASE / 5; // 200 ms. int64_t recommended_pts_length = timeline.find_easing_length(new_master_speed, ease_length_out_pts, frames[clip->stream_idx], instant); timeline.start_easing(new_master_speed, recommended_pts_length, instant); } if (should_skip_to_next.exchange(false)) { // Test and clear. Clip *clip = &clip_list[clip_idx].clip; // Get a non-const pointer. clip->pts_out = std::min(clip->pts_out, llrint(in_pts + clip->fade_time_seconds * clip->speed * TIMEBASE)); } if (in_pts >= clip->pts_out) { break; } // Only play audio if we're within 0.1% of normal speed. We could do // stretching or pitch shift later if it becomes needed. const bool play_audio = timeline.playing_at_normal_speed(); { lock_guard lock(queue_state_mu); if (splice_ready) { if (next_clip == nullptr) { do_splice(to_splice_clip_list, clip_idx, -1, &clip_list); } else { do_splice(to_splice_clip_list, clip_idx, clip_idx + 1, &clip_list); } to_splice_clip_list.clear(); splice_ready = false; // Refresh the clip pointer, since the clip list may have been reallocated. clip = &clip_list[clip_idx].clip; // Recompute next_clip and any needed fade times, since the next clip may have changed // (or we may have gone from no new clip to having one, or the other way). next_clip = (clip_idx + 1 < clip_list.size()) ? &clip_list[clip_idx + 1].clip : nullptr; if (next_clip != nullptr) { double duration_this_clip = double(clip->pts_out - timeline.get_in_pts_origin()) / TIMEBASE / clip->speed; double duration_next_clip = double(next_clip->pts_out - next_clip->pts_in) / TIMEBASE / clip->speed; next_clip_fade_time = min(min(duration_this_clip, duration_next_clip), clip->fade_time_seconds); } } } steady_clock::duration time_behind = steady_clock::now() - next_frame_start; metric_player_ahead_seconds.count_event(-duration(time_behind).count()); if (stream_output != FILE_STREAM_OUTPUT && time_behind >= milliseconds(200)) { fprintf(stderr, "WARNING: %ld ms behind, dropping a frame (no matter the type).\n", lrint(1e3 * duration(time_behind).count())); ++metric_dropped_unconditional_frame; continue; } // pts not affected by the swapping below. int64_t in_pts_for_progress = in_pts, in_pts_secondary_for_progress = -1; int primary_stream_idx = stream_idx; FrameOnDisk secondary_frame; int secondary_stream_idx = -1; float fade_alpha = 0.0f; double time_left_this_clip = double(clip->pts_out - in_pts) / TIMEBASE / clip->speed; if (next_clip != nullptr && time_left_this_clip <= next_clip_fade_time) { // We're in a fade to the next clip-> secondary_stream_idx = next_clip->stream_idx; int64_t in_pts_secondary = lrint(next_clip->pts_in + (next_clip_fade_time - time_left_this_clip) * TIMEBASE * clip->speed); in_pts_secondary_for_progress = in_pts_secondary; fade_alpha = 1.0f - time_left_this_clip / next_clip_fade_time; // If more than half-way through the fade, interpolate the next clip // instead of the current one, since it's more visible. if (fade_alpha >= 0.5f) { swap(primary_stream_idx, secondary_stream_idx); swap(in_pts, in_pts_secondary); fade_alpha = 1.0f - fade_alpha; } FrameOnDisk frame_lower, frame_upper; bool ok = find_surrounding_frames(in_pts_secondary, secondary_stream_idx, &frame_lower, &frame_upper); if (ok) { secondary_frame = frame_lower; } else { secondary_stream_idx = -1; } } // NOTE: None of this will take into account any snapping done below. double clip_progress = calc_progress(*clip, in_pts_for_progress); map progress{ { clip_list[clip_idx].id, clip_progress } }; TimeRemaining time_remaining; if (next_clip != nullptr && time_left_this_clip <= next_clip_fade_time) { double next_clip_progress = calc_progress(*next_clip, in_pts_secondary_for_progress); progress[clip_list[clip_idx + 1].id] = next_clip_progress; time_remaining = compute_time_left(clip_list, clip_idx + 1, next_clip_progress); } else { time_remaining = compute_time_left(clip_list, clip_idx, clip_progress); } if (progress_callback != nullptr) { progress_callback(progress, time_remaining); } FrameOnDisk frame_lower, frame_upper; bool ok = find_surrounding_frames(in_pts, primary_stream_idx, &frame_lower, &frame_upper); if (!ok) { break; } // Wait until we should, or (given buffering) can, output the frame. { unique_lock lock(queue_state_mu); if (video_stream == nullptr) { // No queue, just wait until the right time and then show the frame. new_clip_changed.wait_until(lock, next_frame_start, [this] { return should_quit || new_clip_ready || override_stream_idx != -1; }); if (should_quit) { return; } } else { // If the queue is full (which is really the state we'd like to be in), // wait until there's room for one more frame (ie., one was output from // VideoStream), or until or until there's a new clip we're supposed to play. // // In this case, we don't sleep until next_frame_start; the displaying is // done by the queue. new_clip_changed.wait(lock, [this] { if (num_queued_frames < max_queued_frames) { return true; } return should_quit || new_clip_ready || override_stream_idx != -1; }); } if (should_quit) { return; } if (new_clip_ready) { if (video_stream != nullptr) { lock.unlock(); // Urg. video_stream->clear_queue(); lock.lock(); } return; } // Honor if we got an override request for the camera. if (override_stream_idx != -1) { stream_idx = override_stream_idx; override_stream_idx = -1; continue; } } string subtitle; { stringstream ss; ss.imbue(locale("C")); ss.precision(3); ss << "Futatabi " NAGERU_VERSION ";PLAYING;"; ss << fixed << (time_remaining.num_infinite * 86400.0 + time_remaining.t); ss << ";" << format_duration(time_remaining) << " left"; subtitle = ss.str(); } // Snap to input frame: If we can do so with less than 1% jitter // (ie., move less than 1% of an _output_ frame), do so. // TODO: Snap secondary (fade-to) clips in the same fashion. double pts_snap_tolerance = 0.01 * double(TIMEBASE) * clip->speed / global_flags.output_framerate; bool snapped = false; for (FrameOnDisk snap_frame : { frame_lower, frame_upper }) { if (fabs(snap_frame.pts - in_pts) < pts_snap_tolerance) { display_single_frame(primary_stream_idx, snap_frame, secondary_stream_idx, secondary_frame, fade_alpha, next_frame_start, /*snapped=*/true, subtitle, play_audio); timeline.snap_by(snap_frame.pts - in_pts); snapped = true; break; } } if (snapped) { continue; } // If there's nothing to interpolate between, or if interpolation is turned off, // or we're a preview, then just display the frame. if (frame_lower.pts == frame_upper.pts || global_flags.interpolation_quality == 0 || video_stream == nullptr) { display_single_frame(primary_stream_idx, frame_lower, secondary_stream_idx, secondary_frame, fade_alpha, next_frame_start, /*snapped=*/false, subtitle, play_audio); continue; } // The snapping above makes us lock to the input framerate, even in the presence // of pts drift, for most typical cases where it's needed, like converting 60 → 2x60 // or 60 → 2x59.94. However, there are some corner cases like 25 → 2x59.94, where we'd // get a snap very rarely (in the given case, once every 24 output frames), and by // that time, we'd have drifted out. We could have solved this by changing the overall // speed ever so slightly, but it requires that we know the actual frame rate (which // is difficult in the presence of jitter and missed frames), or at least do some kind // of matching/clustering. Instead, we take the opportunity to lock to in-between rational // points if we can. E.g., if we are converting 60 → 2x60, we would not only snap to // an original frame every other frame; we would also snap to exactly alpha=0.5 every // in-between frame. Of course, we will still need to interpolate, but we get a lot // closer when we actually get close to an original frame. In other words: Snap more // often, but snap less each time. Unless the input and output frame rates are completely // decorrelated with no common factor, of course (e.g. 12.345 → 34.567, which we should // really never see in practice). for (double fraction : { 1.0 / 2.0, 1.0 / 3.0, 2.0 / 3.0, 1.0 / 4.0, 3.0 / 4.0, 1.0 / 5.0, 2.0 / 5.0, 3.0 / 5.0, 4.0 / 5.0 }) { double subsnap_pts = frame_lower.pts + fraction * (frame_upper.pts - frame_lower.pts); if (fabs(subsnap_pts - in_pts) < pts_snap_tolerance) { timeline.snap_by(lrint(subsnap_pts) - in_pts); in_pts = lrint(subsnap_pts); break; } } if (stream_output != FILE_STREAM_OUTPUT && time_behind >= milliseconds(100)) { fprintf(stderr, "WARNING: %ld ms behind, dropping an interpolated frame.\n", lrint(1e3 * duration(time_behind).count())); ++metric_dropped_interpolated_frame; continue; } double alpha = double(in_pts - frame_lower.pts) / (frame_upper.pts - frame_lower.pts); auto display_func = [this](shared_ptr frame) { if (destination != nullptr) { destination->setFrame(frame); } }; if (secondary_stream_idx == -1) { ++metric_interpolated_frame; } else { ++metric_interpolated_faded_frame; } video_stream->schedule_interpolated_frame( next_frame_start, pts, display_func, QueueSpotHolder(this), frame_lower, frame_upper, alpha, secondary_frame, fade_alpha, subtitle, play_audio); last_pts_played = in_pts; // Not really needed; only previews use last_pts_played. } // The clip ended. if (should_quit) { return; } // Start the next clip from the point where the fade went out. if (next_clip != nullptr) { timeline.new_clip(next_frame_start, next_clip, /*pts_start_offset=*/lrint(next_clip_fade_time * TIMEBASE * clip->speed)); } } if (done_callback != nullptr) { done_callback(); } } void Player::display_single_frame(int primary_stream_idx, const FrameOnDisk &primary_frame, int secondary_stream_idx, const FrameOnDisk &secondary_frame, double fade_alpha, steady_clock::time_point frame_start, bool snapped, const std::string &subtitle, bool play_audio) { auto display_func = [this, primary_stream_idx, primary_frame, secondary_frame, fade_alpha] { if (destination != nullptr) { destination->setFrame(primary_stream_idx, primary_frame, secondary_frame, fade_alpha); } }; if (video_stream == nullptr) { display_func(); } else { if (secondary_stream_idx == -1) { // NOTE: We could be increasing unused metrics for previews, but that's harmless. if (snapped) { ++metric_original_snapped_frame; } else { ++metric_original_frame; } video_stream->schedule_original_frame( frame_start, pts, display_func, QueueSpotHolder(this), primary_frame, subtitle, play_audio); } else { assert(secondary_frame.pts != -1); // NOTE: We could be increasing unused metrics for previews, but that's harmless. if (snapped) { ++metric_faded_snapped_frame; } else { ++metric_faded_frame; } video_stream->schedule_faded_frame(frame_start, pts, display_func, QueueSpotHolder(this), primary_frame, secondary_frame, fade_alpha, subtitle); } } last_pts_played = primary_frame.pts; } // Find the frame immediately before and after this point. // If we have an exact match, return it immediately. bool Player::find_surrounding_frames(int64_t pts, int stream_idx, FrameOnDisk *frame_lower, FrameOnDisk *frame_upper) { lock_guard lock(frame_mu); // Find the first frame such that frame.pts >= pts. auto it = find_last_frame_before(frames[stream_idx], pts); if (it == frames[stream_idx].end()) { return false; } *frame_upper = *it; // If we have an exact match, return it immediately. if (frame_upper->pts == pts) { *frame_lower = *it; return true; } // Find the last frame such that in_pts <= frame.pts (if any). if (it == frames[stream_idx].begin()) { *frame_lower = *it; } else { *frame_lower = *(it - 1); } assert(pts >= frame_lower->pts); assert(pts <= frame_upper->pts); return true; } Player::Player(JPEGFrameView *destination, Player::StreamOutput stream_output, AVFormatContext *file_avctx) : destination(destination), stream_output(stream_output) { player_thread = thread(&Player::thread_func, this, file_avctx); if (stream_output == HTTPD_STREAM_OUTPUT) { global_metrics.add("http_output_frames", { { "type", "original" }, { "reason", "edge_frame_or_no_interpolation" } }, &metric_original_frame); global_metrics.add("http_output_frames", { { "type", "faded" }, { "reason", "edge_frame_or_no_interpolation" } }, &metric_faded_frame); global_metrics.add("http_output_frames", { { "type", "original" }, { "reason", "snapped" } }, &metric_original_snapped_frame); global_metrics.add("http_output_frames", { { "type", "faded" }, { "reason", "snapped" } }, &metric_faded_snapped_frame); global_metrics.add("http_output_frames", { { "type", "interpolated" } }, &metric_interpolated_frame); global_metrics.add("http_output_frames", { { "type", "interpolated_faded" } }, &metric_interpolated_faded_frame); global_metrics.add("http_output_frames", { { "type", "refresh" } }, &metric_refresh_frame); global_metrics.add("http_dropped_frames", { { "type", "interpolated" } }, &metric_dropped_interpolated_frame); global_metrics.add("http_dropped_frames", { { "type", "unconditional" } }, &metric_dropped_unconditional_frame); vector quantiles{ 0.01, 0.1, 0.25, 0.5, 0.75, 0.9, 0.99 }; metric_player_ahead_seconds.init(quantiles, 60.0); global_metrics.add("player_ahead_seconds", &metric_player_ahead_seconds); } } Player::~Player() { should_quit = true; new_clip_changed.notify_all(); player_thread.join(); if (video_stream != nullptr) { video_stream->stop(); } } void Player::play(const vector &clips) { lock_guard lock(queue_state_mu); new_clip_ready = true; queued_clip_list = clips; splice_ready = false; override_stream_idx = -1; new_clip_changed.notify_all(); } void Player::splice_play(const vector &clips) { lock_guard lock(queue_state_mu); if (new_clip_ready) { queued_clip_list = clips; assert(!splice_ready); return; } splice_ready = true; to_splice_clip_list = clips; // Overwrite any queued but not executed splice. } void Player::override_angle(unsigned stream_idx) { int64_t last_pts; // Corner case: If a new clip is waiting to be played, change its stream and then we're done. { lock_guard lock(queue_state_mu); if (new_clip_ready) { assert(queued_clip_list.size() == 1); queued_clip_list[0].clip.stream_idx = stream_idx; return; } // If we are playing a clip, set override_stream_idx, and the player thread will // pick it up and change its internal index. if (playing) { override_stream_idx = stream_idx; new_clip_changed.notify_all(); return; } // OK, so we're standing still, presumably at the end of a clip. // Look at the last frame played (if it exists), and show the closest // thing we've got. if (last_pts_played < 0) { return; } last_pts = last_pts_played; } lock_guard lock(frame_mu); auto it = find_first_frame_at_or_after(frames[stream_idx], last_pts); if (it == frames[stream_idx].end()) { return; } destination->setFrame(stream_idx, *it); } void Player::take_queue_spot() { lock_guard lock(queue_state_mu); ++num_queued_frames; } void Player::release_queue_spot() { lock_guard lock(queue_state_mu); assert(num_queued_frames > 0); --num_queued_frames; new_clip_changed.notify_all(); } TimeRemaining compute_time_left(const vector &clips, size_t currently_playing_idx, double progress_currently_playing) { // Look at the last clip and then start counting from there. TimeRemaining remaining { 0, 0.0 }; double last_fade_time_seconds = 0.0; for (size_t row = currently_playing_idx; row < clips.size(); ++row) { const Clip &clip = clips[row].clip; double clip_length = double(clip.pts_out - clip.pts_in) / TIMEBASE / clip.speed; if (clip_length >= 86400.0 || clip.pts_out == -1) { // More than one day. ++remaining.num_infinite; } else { if (row == currently_playing_idx) { // A clip we're playing: Subtract the part we've already played. remaining.t = clip_length * (1.0 - progress_currently_playing); } else { // A clip we haven't played yet: Subtract the part that's overlapping // with a previous clip (due to fade). remaining.t += max(clip_length - last_fade_time_seconds, 0.0); } } last_fade_time_seconds = min(clip_length, clip.fade_time_seconds); } return remaining; } string format_duration(TimeRemaining t) { int t_ms = lrint(t.t * 1e3); int ms = t_ms % 1000; t_ms /= 1000; int s = t_ms % 60; t_ms /= 60; int m = t_ms; char buf[256]; if (t.num_infinite > 1 && t.t > 0.0) { snprintf(buf, sizeof(buf), "%zu clips + %d:%02d.%03d", t.num_infinite, m, s, ms); } else if (t.num_infinite > 1) { snprintf(buf, sizeof(buf), "%zu clips", t.num_infinite); } else if (t.num_infinite == 1 && t.t > 0.0) { snprintf(buf, sizeof(buf), "%zu clip + %d:%02d.%03d", t.num_infinite, m, s, ms); } else if (t.num_infinite == 1) { snprintf(buf, sizeof(buf), "%zu clip", t.num_infinite); } else { snprintf(buf, sizeof(buf), "%d:%02d.%03d", m, s, ms); } return buf; } nageru-2.3.0/futatabi/player.h000066400000000000000000000134241450736322200162510ustar00rootroot00000000000000#ifndef _PLAYER_H #define _PLAYER_H 1 #include "clip_list.h" #include "frame_on_disk.h" #include "queue_spot_holder.h" #include "shared/metrics.h" extern "C" { #include #include } #include #include #include #include class JPEGFrameView; class VideoStream; class QSurface; class QSurfaceFormat; struct TimeRemaining { size_t num_infinite; double t; }; class Player : public QueueInterface { public: enum StreamOutput { NO_STREAM_OUTPUT, HTTPD_STREAM_OUTPUT, // Output to global_httpd. FILE_STREAM_OUTPUT // Output to file_avctx. }; Player(JPEGFrameView *destination, StreamOutput stream_output, AVFormatContext *file_avctx = nullptr); ~Player(); void play(const Clip &clip) { play({ ClipWithID{ clip, 0 } }); } void play(const std::vector &clips); void override_angle(unsigned stream_idx); // Assumes one-clip playlist only. // Replace the part of the playlist that we haven't started playing yet // (ie., from the point immediately after the last current playing clip // and to the end) with the given one. // // E.g., if we have the playlist A, B, C, D, E, F, we're currently in a fade // from B to C and run splice_play() with the list G, C, H, I, the resulting // list will be A, B, C, H, I. (If the new list doesn't contain B nor C, // there will be some heuristics.) Note that we always compare on ID only; // changes will be ignored for the purposes of setting the split point, // although the newly-spliced entries will of course get the new in/out points // etc., which is the main reason for going through this exercise in the first // place. // // If nothing is playing, the call will be ignored. void splice_play(const std::vector &clips); // Set the status string that will be used for the video stream's status subtitles // whenever we are not playing anything. void set_pause_status(const std::string &status) { std::lock_guard lock(queue_state_mu); pause_status = status; } void skip_to_next() { should_skip_to_next = true; } void set_master_speed(float speed) { start_master_speed = speed; change_master_speed = speed; } // Not thread-safe to set concurrently with playing. // Will be called back from the player thread. using done_callback_func = std::function; void set_done_callback(done_callback_func cb) { done_callback = cb; } // Not thread-safe to set concurrently with playing. // Will be called back from the player thread. // The keys in the given map are row members in the vector given to play(). using progress_callback_func = std::function &progress, TimeRemaining time_remaining)>; void set_progress_callback(progress_callback_func cb) { progress_callback = cb; } // QueueInterface. void take_queue_spot() override; void release_queue_spot() override; private: void thread_func(AVFormatContext *file_avctx); void play_playlist_once(); void display_single_frame(int primary_stream_idx, const FrameOnDisk &primary_frame, int secondary_stream_idx, const FrameOnDisk &secondary_frame, double fade_alpha, std::chrono::steady_clock::time_point frame_start, bool snapped, const std::string &subtitle, bool play_audio); void open_output_stream(); static int write_packet2_thunk(void *opaque, uint8_t *buf, int buf_size, AVIODataMarkerType type, int64_t time); int write_packet2(uint8_t *buf, int buf_size, AVIODataMarkerType type, int64_t time); // Find the frame immediately before and after this point. // Returns false if pts is after the last frame. bool find_surrounding_frames(int64_t pts, int stream_idx, FrameOnDisk *frame_lower, FrameOnDisk *frame_upper); std::thread player_thread; std::atomic should_quit{ false }; std::atomic should_skip_to_next{ false }; std::atomic start_master_speed{ 1.0f }; std::atomic change_master_speed{ 0.0f / 0.0f }; JPEGFrameView *destination; done_callback_func done_callback; progress_callback_func progress_callback; std::mutex queue_state_mu; std::condition_variable new_clip_changed; std::vector queued_clip_list; // Under queue_state_mu. bool new_clip_ready = false; // Under queue_state_mu. bool playing = false; // Under queue_state_mu. int override_stream_idx = -1; // Under queue_state_mu. int64_t last_pts_played = -1; // Under queue_state_mu. Used by previews only. bool splice_ready = false; // Under queue_state_mu. std::vector to_splice_clip_list; // Under queue_state_mu. std::string pause_status = "paused"; // Under queue_state_mu. std::unique_ptr video_stream; // Can be nullptr. std::atomic metric_dropped_interpolated_frame{ 0 }; std::atomic metric_dropped_unconditional_frame{ 0 }; std::atomic metric_faded_frame{ 0 }; std::atomic metric_faded_snapped_frame{ 0 }; std::atomic metric_original_frame{ 0 }; std::atomic metric_original_snapped_frame{ 0 }; std::atomic metric_refresh_frame{ 0 }; std::atomic metric_interpolated_frame{ 0 }; std::atomic metric_interpolated_faded_frame{ 0 }; Summary metric_player_ahead_seconds; // under queue_state_mu. Part of this instead of VideoStream so that we own // its lock and can sleep on it. size_t num_queued_frames = 0; static constexpr size_t max_queued_frames = 10; // State private to the player thread. int64_t pts = 0; const StreamOutput stream_output; }; TimeRemaining compute_time_left(const std::vector &clips, size_t currently_playing_idx, double progress_currently_playing); static inline TimeRemaining compute_total_time(const std::vector &clips) { return compute_time_left(clips, 0, 0.0); } std::string format_duration(TimeRemaining t); #endif // !defined(_PLAYER_H) nageru-2.3.0/futatabi/prewarp.frag000066400000000000000000000012321450736322200171170ustar00rootroot00000000000000#version 450 core // Warps I_1 according to the flow, then computes the mean and difference to I_0. in vec3 tc; out float I, I_t; out vec2 normalized_flow; uniform sampler2DArray image_tex, flow_tex; void main() { vec3 flow = texture(flow_tex, tc).xyz; flow.xy /= flow.z; // Normalize the sum coming out of the densification. float I_0 = texture(image_tex, tc).x; float I_w = texture(image_tex, vec3(tc.xy + flow.xy, 1.0f - tc.z)).x; // NOTE: This is effectively a reverse warp since texture() is a gather operation and flow is conceptually scatter. I = 0.5f * (I_0 + I_w); I_t = I_w - I_0; normalized_flow = flow.xy * textureSize(image_tex, 0).xy; } nageru-2.3.0/futatabi/queue_spot_holder.h000066400000000000000000000017741450736322200205100ustar00rootroot00000000000000#ifndef _QUEUE_SPOT_HOLDER #define _QUEUE_SPOT_HOLDER 1 // A RAII class to hold a shared resource, in our case an (unordered!) spot in a queue, // for as long as a frame is under computation. class QueueInterface { public: virtual ~QueueInterface() {} virtual void take_queue_spot() = 0; virtual void release_queue_spot() = 0; }; class QueueSpotHolder { public: QueueSpotHolder() : queue(nullptr) {} explicit QueueSpotHolder(QueueInterface *queue) : queue(queue) { queue->take_queue_spot(); } QueueSpotHolder(QueueSpotHolder &&other) : queue(other.queue) { other.queue = nullptr; } QueueSpotHolder &operator=(QueueSpotHolder &&other) { queue = other.queue; other.queue = nullptr; return *this; } ~QueueSpotHolder() { if (queue != nullptr) { queue->release_queue_spot(); } } // Movable only. QueueSpotHolder(QueueSpotHolder &) = delete; QueueSpotHolder &operator=(QueueSpotHolder &) = delete; private: QueueInterface *queue; }; #endif // !defined(_QUEUE_SPOT_HOLDER) nageru-2.3.0/futatabi/resize_flow.frag000066400000000000000000000002551450736322200177730ustar00rootroot00000000000000#version 450 core in vec3 tc; out vec2 flow; uniform sampler2DArray flow_tex; uniform vec2 scale_factor; void main() { flow = texture(flow_tex, tc).xy * scale_factor; } nageru-2.3.0/futatabi/sobel.frag000066400000000000000000000044331450736322200165510ustar00rootroot00000000000000#version 450 core in vec3 tc; out uint packed_gradients; uniform sampler2DArray tex; uint pack_gradients(float x, float y, float v) { x = clamp(x, -0.5f, 0.5f); y = clamp(y, -0.5f, 0.5f); uint vi = uint(round(v * 255.0f)); uint xi = uint(round((x + 0.5f) * 4095.0f)); uint yi = uint(round((y + 0.5f) * 4095.0f)); return vi | (xi << 8) | (yi << 20); } void main() { // There are two common Sobel filters, horizontal and vertical // (see e.g. Wikipedia, or the OpenCV documentation): // // [1 0 -1] [-1 -2 -1] // [2 0 -2] [ 0 0 0] // [1 0 -1] [ 1 2 1] // Horizontal Vertical // // Note that Wikipedia and OpenCV gives entirely opposite definitions // with regards to sign! This appears to be an error in the OpenCV // documentation, forgetting that for convolution, the filters must be // flipped. We have to flip the vertical matrix again comparing to // Wikipedia, though, since we have bottom-left origin (y = up) // and they define y as pointing downwards. // // Computing both directions at once allows us to get away with eight // texture samples instead of twelve. float top_left = textureOffset(tex, tc, ivec2(-1, 1)).x; // Note the bottom-left coordinate system. float left = textureOffset(tex, tc, ivec2(-1, 0)).x; float bottom_left = textureOffset(tex, tc, ivec2(-1, -1)).x; float top = textureOffset(tex, tc, ivec2( 0, 1)).x; float bottom = textureOffset(tex, tc, ivec2( 0, -1)).x; float top_right = textureOffset(tex, tc, ivec2( 1, 1)).x; float right = textureOffset(tex, tc, ivec2( 1, 0)).x; float bottom_right = textureOffset(tex, tc, ivec2( 1, -1)).x; vec2 gradients; gradients.x = (top_right + 2.0f * right + bottom_right) - (top_left + 2.0f * left + bottom_left); gradients.y = (top_left + 2.0 * top + top_right) - (bottom_left + 2.0f * bottom + bottom_right); // Normalize so that we have a normalized unit of intensity levels per pixel. gradients.x *= 0.125; gradients.y *= 0.125; // Also store the actual pixel value, so that we get it “for free” // when we sample the gradients in motion_search.frag later. float center = texture(tex, tc).x; // Pack everything into a single 32-bit value, using simple fixed-point. packed_gradients = pack_gradients(gradients.x, gradients.y, center); } nageru-2.3.0/futatabi/sor.frag000066400000000000000000000074751450736322200162610ustar00rootroot00000000000000#version 450 core in vec3 tc, tc_left, tc_down; in vec3 equation_tc_assuming_left, equation_tc_assuming_right; in float element_x_idx, element_sum_idx; out vec2 diff_flow; uniform sampler2DArray diff_flow_tex, diffusivity_tex; uniform usampler2DArray equation_red_tex, equation_black_tex; uniform int phase; uniform int num_nonzero_phases; // See pack_floats_shared() in equations.frag. vec2 unpack_floats_shared(uint c) { // Recover the exponent, and multiply it in. Add one because // we have denormalized mantissas, then another one because we // already reduced the exponent by one. Then subtract 20, because // we are going to shift up the number by 20 below to recover the sign bits. float normalizer = uintBitsToFloat(((c >> 1) & 0x7f800000u) - (18 << 23)); normalizer *= (1.0 / 2047.0); // Shift the values up so that we recover the sign bit, then normalize. float a = int(uint(c & 0x000fffu) << 20) * normalizer; float b = int(uint(c & 0xfff000u) << 8) * normalizer; return vec2(a, b); } float zero_if_outside_border(vec4 val) { if (val.w < 1.0f) { // We hit the border (or more like half-way to it), so zero smoothness. return 0.0f; } else { return val.x; } } void main() { // Red-black SOR: Every other pass, we update every other element in a // checkerboard pattern. This is rather suboptimal for the GPU, as it // just immediately throws away half of the warp, but it helps convergence // a _lot_ (rough testing indicates that five iterations of SOR is as good // as ~50 iterations of Jacobi). We could probably do better by reorganizing // the data into two-values-per-pixel, so-called “twinned buffering”; // seemingly, it helps Haswell by ~15% on the SOR code, but GTX 950 not at all // (at least not on 720p). Presumably the latter is already bandwidth bound. int color = int(round(element_sum_idx)) & 1; if (color != phase) discard; uvec4 equation; vec3 equation_tc; if ((int(round(element_x_idx)) & 1) == 0) { equation_tc = equation_tc_assuming_left; } else { equation_tc = equation_tc_assuming_right; } if (phase == 0) { equation = texture(equation_red_tex, equation_tc); } else { equation = texture(equation_black_tex, equation_tc); } float inv_A11 = uintBitsToFloat(equation.x); float A12 = uintBitsToFloat(equation.y); float inv_A22 = uintBitsToFloat(equation.z); vec2 b = unpack_floats_shared(equation.w); const float omega = 1.8; // Marginally better than 1.6, it seems. if (num_nonzero_phases == 0) { // Simplified version of the code below, assuming diff_flow == 0.0f everywhere. diff_flow.x = omega * b.x * inv_A11; diff_flow.y = omega * b.y * inv_A22; } else { // Subtract the missing terms from the right-hand side // (it couldn't be done earlier, because we didn't know // the values of the neighboring pixels; they change for // each SOR iteration). float smooth_l = zero_if_outside_border(texture(diffusivity_tex, tc_left)); float smooth_r = zero_if_outside_border(textureOffset(diffusivity_tex, tc_left, ivec2(1, 0))); float smooth_d = zero_if_outside_border(texture(diffusivity_tex, tc_down)); float smooth_u = zero_if_outside_border(textureOffset(diffusivity_tex, tc_down, ivec2(0, 1))); b += smooth_l * textureOffset(diff_flow_tex, tc, ivec2(-1, 0)).xy; b += smooth_r * textureOffset(diff_flow_tex, tc, ivec2( 1, 0)).xy; b += smooth_d * textureOffset(diff_flow_tex, tc, ivec2( 0, -1)).xy; b += smooth_u * textureOffset(diff_flow_tex, tc, ivec2( 0, 1)).xy; if (num_nonzero_phases == 1) { diff_flow = vec2(0.0f); } else { diff_flow = texture(diff_flow_tex, tc).xy; } // From https://en.wikipedia.org/wiki/Successive_over-relaxation. float sigma_u = A12 * diff_flow.y; diff_flow.x += omega * ((b.x - sigma_u) * inv_A11 - diff_flow.x); float sigma_v = A12 * diff_flow.x; diff_flow.y += omega * ((b.y - sigma_v) * inv_A22 - diff_flow.y); } } nageru-2.3.0/futatabi/sor.vert000066400000000000000000000034351450736322200163120ustar00rootroot00000000000000#version 450 core #extension GL_ARB_shader_viewport_layer_array : require layout(location=0) in vec2 position; out vec3 tc, tc_left, tc_down; out vec3 equation_tc_assuming_left, equation_tc_assuming_right; out float element_x_idx; out float element_sum_idx; uniform sampler2DArray diff_flow_tex, diffusivity_tex; uniform usampler2DArray equation_red_tex; void main() { // The result of glOrtho(0.0, 1.0, 0.0, 1.0, 0.0, 1.0) is: // // 2.000 0.000 0.000 -1.000 // 0.000 2.000 0.000 -1.000 // 0.000 0.000 -2.000 -1.000 // 0.000 0.000 0.000 1.000 gl_Position = vec4(2.0 * position.x - 1.0, 2.0 * position.y - 1.0, -1.0, 1.0); gl_Layer = gl_InstanceID; tc = vec3(position, gl_InstanceID); tc_left = vec3(tc.x - 0.5f / textureSize(diffusivity_tex, 0).x, tc.y, gl_InstanceID); tc_down = vec3(tc.x, tc.y - 0.5f / textureSize(diffusivity_tex, 0).y, gl_InstanceID); // The equation textures have half the horizontal width, so we need to adjust the texel centers. // It becomes extra tricky since the SOR texture might be of odd size, and then // the equation texture is not exactly half the size. vec2 element_idx = position * textureSize(diff_flow_tex, 0).xy - 0.5f; float equation_texel_number_assuming_left = element_idx.x / 2.0f; float equation_texel_number_assuming_right = (element_idx.x - 1.0f) / 2.0f; equation_tc_assuming_left.x = (equation_texel_number_assuming_left + 0.5f) / textureSize(equation_red_tex, 0).x; equation_tc_assuming_right.x = (equation_texel_number_assuming_right + 0.5f) / textureSize(equation_red_tex, 0).x; equation_tc_assuming_left.y = tc.y; equation_tc_assuming_right.y = tc.y; equation_tc_assuming_left.z = gl_InstanceID; equation_tc_assuming_right.z = gl_InstanceID; element_x_idx = element_idx.x; element_sum_idx = element_idx.x + element_idx.y; } nageru-2.3.0/futatabi/splat.frag000066400000000000000000000007511450736322200165670ustar00rootroot00000000000000#version 450 core in vec2 image_pos; flat in vec2 flow, I_0_check_offset, I_1_check_offset; out vec2 out_flow; uniform sampler2DArray gray_tex; void main() { out_flow = flow; // TODO: Check if we are sampling out-of-image. float I_0 = texture(gray_tex, vec3(image_pos + I_0_check_offset, 0)).r; float I_1 = texture(gray_tex, vec3(image_pos + I_1_check_offset, 1)).r; float diff = abs(I_1 - I_0); gl_FragDepth = 0.125 * diff.x; // Make sure we stay well under the 1.0 maximum. } nageru-2.3.0/futatabi/splat.vert000066400000000000000000000027311450736322200166300ustar00rootroot00000000000000#version 450 core layout(location=0) in vec2 position; out vec2 image_pos; flat out vec2 flow, I_0_check_offset, I_1_check_offset; uniform vec2 splat_size; // In 0..1 coordinates. uniform vec2 inv_flow_size; uniform float alpha; uniform sampler2DArray flow_tex; // 0 = forward flow, 1 = backward flow. void main() { int instance = gl_InstanceID; int num_pixels_per_layer = textureSize(flow_tex, 0).x * textureSize(flow_tex, 0).y; int src_layer; if (instance >= num_pixels_per_layer) { instance -= num_pixels_per_layer; src_layer = 1; } else { src_layer = 0; } int x = instance % textureSize(flow_tex, 0).x; int y = instance / textureSize(flow_tex, 0).x; // Find out where to splat this to. vec2 full_flow = texelFetch(flow_tex, ivec3(x, y, src_layer), 0).xy; float splat_alpha; if (src_layer == 1) { // Reverse flow. full_flow = -full_flow; splat_alpha = 1.0f - alpha; } else { splat_alpha = alpha; } full_flow *= inv_flow_size; vec2 patch_center = (ivec2(x, y) + 0.5) * inv_flow_size + full_flow * splat_alpha; image_pos = patch_center + splat_size * (position - 0.5); flow = full_flow; I_0_check_offset = full_flow * -alpha; I_1_check_offset = full_flow * (1.0f - alpha); // The result of glOrtho(0.0, 1.0, 0.0, 1.0, 0.0, 1.0) is: // // 2.000 0.000 0.000 -1.000 // 0.000 2.000 0.000 -1.000 // 0.000 0.000 -2.000 -1.000 // 0.000 0.000 0.000 1.000 gl_Position = vec4(2.0 * image_pos.x - 1.0, 2.0 * image_pos.y - 1.0, -1.0, 1.0); } nageru-2.3.0/futatabi/state.proto000066400000000000000000000010541450736322200170050ustar00rootroot00000000000000syntax = "proto3"; // Corresponds to struct Clip. message ClipProto { int64 pts_in = 1; int64 pts_out = 2; repeated string description = 3; int64 stream_idx = 4; double fade_time_seconds = 5; double speed = 6; } message ClipListProto { repeated ClipProto clip = 1; } message StateProto { ClipListProto clip_list = 1; ClipListProto play_list = 2; } message SettingsProto { int32 interpolation_quality = 1; // 0 = unset, 1 = quality 0, 2 = quality 1, etc. double cue_in_point_padding_seconds = 2; double cue_out_point_padding_seconds = 3; } nageru-2.3.0/futatabi/util.cpp000066400000000000000000000010541450736322200162610ustar00rootroot00000000000000#include "util.h" #include #include #include using namespace std; Flow read_flow(const char *filename) { FILE *flowfp = fopen(filename, "rb"); uint32_t hdr, width, height; fread(&hdr, sizeof(hdr), 1, flowfp); fread(&width, sizeof(width), 1, flowfp); fread(&height, sizeof(height), 1, flowfp); unique_ptr flow(new Vec2[width * height]); fread(flow.get(), width * height * sizeof(Vec2), 1, flowfp); fclose(flowfp); Flow ret; ret.width = width; ret.height = height; ret.flow = move(flow); return ret; } nageru-2.3.0/futatabi/util.h000066400000000000000000000023351450736322200157310ustar00rootroot00000000000000#ifndef _UTIL_H #define _UTIL_H 1 #include #include #include #include struct Vec2 { float du, dv; }; struct Flow { uint32_t width, height; std::unique_ptr flow; }; Flow read_flow(const char *filename); // du and dv are in pixels. inline void flow2rgb(float du, float dv, uint8_t *rr, uint8_t *gg, uint8_t *bb) { float angle = atan2(dv, du); float magnitude = std::min(hypot(du, dv) / 20.0, 1.0); // HSV to RGB (from Wikipedia). Saturation is 1. float c = magnitude; float h = (angle + M_PI) * 6.0 / (2.0 * M_PI); float X = c * (1.0 - fabs(fmod(h, 2.0) - 1.0)); float r = 0.0f, g = 0.0f, b = 0.0f; if (h <= 1.0f) { r = c; g = X; } else if (h <= 2.0f) { r = X; g = c; } else if (h <= 3.0f) { g = c; b = X; } else if (h <= 4.0f) { g = X; b = c; } else if (h <= 5.0f) { r = X; b = c; } else if (h <= 6.0f) { r = c; b = X; } else { // h is NaN, so black is fine. } float m = magnitude - c; r += m; g += m; b += m; r = std::max(std::min(r, 1.0f), 0.0f); g = std::max(std::min(g, 1.0f), 0.0f); b = std::max(std::min(b, 1.0f), 0.0f); *rr = lrintf(r * 255.0f); *gg = lrintf(g * 255.0f); *bb = lrintf(b * 255.0f); } #endif // !defined(_UTIL_H) nageru-2.3.0/futatabi/vaapi_jpeg_decoder.cpp000066400000000000000000000412511450736322200211010ustar00rootroot00000000000000#include "vaapi_jpeg_decoder.h" #include "jpeg_destroyer.h" #include "jpeg_frame.h" #include "jpeglib_error_wrapper.h" #include "pbo_pool.h" #include "shared/memcpy_interleaved.h" #include "shared/va_display.h" #include "shared/va_resource_pool.h" #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #define BUFFER_OFFSET(i) ((char *)nullptr + (i)) using namespace std; // TODO: Deduplicate between Nageru and this. static void memcpy_with_pitch(uint8_t *dst, const uint8_t *src, size_t src_width, size_t dst_pitch, size_t height) { if (src_width == dst_pitch) { memcpy(dst, src, src_width * height); } else { for (size_t y = 0; y < height; ++y) { const uint8_t *sptr = src + y * src_width; uint8_t *dptr = dst + y * dst_pitch; memcpy(dptr, sptr, src_width); } } } static unique_ptr va_dpy; static unique_ptr va_pool; bool vaapi_jpeg_decoding_usable = false; // From libjpeg (although it's of course identical between implementations). static const int jpeg_natural_order[DCTSIZE2] = { 0, 1, 8, 16, 9, 2, 3, 10, 17, 24, 32, 25, 18, 11, 4, 5, 12, 19, 26, 33, 40, 48, 41, 34, 27, 20, 13, 6, 7, 14, 21, 28, 35, 42, 49, 56, 57, 50, 43, 36, 29, 22, 15, 23, 30, 37, 44, 51, 58, 59, 52, 45, 38, 31, 39, 46, 53, 60, 61, 54, 47, 55, 62, 63, }; static unique_ptr try_open_va_mjpeg(const string &va_display) { VAConfigID config_id_422, config_id_420; VAImageFormat uyvy_format, nv12_format; // Seemingly VA_FOURCC_422H is no good for vaGetImage(). :-/ unique_ptr va_dpy = try_open_va(va_display, { VAProfileJPEGBaseline }, VAEntrypointVLD, { { "4:2:2", VA_RT_FORMAT_YUV422, VA_FOURCC_UYVY, &config_id_422, &uyvy_format }, { "4:2:0", VA_RT_FORMAT_YUV420, VA_FOURCC_NV12, &config_id_420, &nv12_format } }, /*chosen_profile=*/nullptr, /*error=*/nullptr); if (va_dpy == nullptr) { return va_dpy; } va_pool.reset(new VAResourcePool(va_dpy->va_dpy, uyvy_format, nv12_format, config_id_422, config_id_420, /*with_data_buffer=*/false)); return va_dpy; } string get_usable_va_display() { // Reduce the amount of chatter while probing, // unless the user has specified otherwise. bool need_env_reset = false; if (getenv("LIBVA_MESSAGING_LEVEL") == nullptr) { setenv("LIBVA_MESSAGING_LEVEL", "0", true); need_env_reset = true; } // First try the default (ie., whatever $DISPLAY is set to). unique_ptr va_dpy = try_open_va_mjpeg(""); if (va_dpy != nullptr) { if (need_env_reset) { unsetenv("LIBVA_MESSAGING_LEVEL"); } return ""; } fprintf(stderr, "The X11 display did not expose a VA-API JPEG decoder.\n"); // Try all /dev/dri/render* in turn. TODO: Accept /dev/dri/card*, too? glob_t g; int err = glob("/dev/dri/renderD*", 0, nullptr, &g); if (err != 0) { fprintf(stderr, "Couldn't list render nodes (%s) when trying to autodetect a replacement.\n", strerror(errno)); } else { for (size_t i = 0; i < g.gl_pathc; ++i) { string path = g.gl_pathv[i]; va_dpy = try_open_va_mjpeg(path); if (va_dpy != nullptr) { fprintf(stderr, "Autodetected %s as a suitable replacement; using it.\n", path.c_str()); globfree(&g); if (need_env_reset) { unsetenv("LIBVA_MESSAGING_LEVEL"); } return path; } } } fprintf(stderr, "No suitable VA-API JPEG decoders were found in /dev/dri; giving up.\n"); fprintf(stderr, "Note that if you are using an Intel CPU with an external GPU,\n"); fprintf(stderr, "you may need to enable the integrated Intel GPU in your BIOS\n"); fprintf(stderr, "to expose Quick Sync.\n"); return "none"; } void init_jpeg_vaapi() { string dpy = get_usable_va_display(); if (dpy == "none") { return; } va_dpy = try_open_va_mjpeg(dpy); if (va_dpy == nullptr) { return; } fprintf(stderr, "VA-API JPEG decoding initialized.\n"); vaapi_jpeg_decoding_usable = true; } class VABufferDestroyer { public: VABufferDestroyer(VADisplay dpy, VABufferID buf) : dpy(dpy), buf(buf) {} ~VABufferDestroyer() { VAStatus va_status = vaDestroyBuffer(dpy, buf); CHECK_VASTATUS(va_status, "vaDestroyBuffer"); } private: VADisplay dpy; VABufferID buf; }; shared_ptr decode_jpeg_vaapi(const string &jpeg) { jpeg_decompress_struct dinfo; JPEGWrapErrorManager error_mgr(&dinfo); if (!error_mgr.run([&dinfo] { jpeg_create_decompress(&dinfo); })) { return nullptr; } JPEGDestroyer destroy_dinfo(&dinfo); jpeg_save_markers(&dinfo, JPEG_APP0 + 1, 0xFFFF); jpeg_mem_src(&dinfo, reinterpret_cast(jpeg.data()), jpeg.size()); if (!error_mgr.run([&dinfo] { jpeg_read_header(&dinfo, true); })) { return nullptr; } if (dinfo.num_components != 3) { fprintf(stderr, "Not a color JPEG. (%d components, Y=%dx%d, Cb=%dx%d, Cr=%dx%d)\n", dinfo.num_components, dinfo.comp_info[0].h_samp_factor, dinfo.comp_info[0].v_samp_factor, dinfo.comp_info[1].h_samp_factor, dinfo.comp_info[1].v_samp_factor, dinfo.comp_info[2].h_samp_factor, dinfo.comp_info[2].v_samp_factor); return nullptr; } const bool is_422 = dinfo.comp_info[0].h_samp_factor == 2 && dinfo.comp_info[1].h_samp_factor == 1 && dinfo.comp_info[1].v_samp_factor == dinfo.comp_info[0].v_samp_factor && dinfo.comp_info[2].h_samp_factor == 1 && dinfo.comp_info[2].v_samp_factor == dinfo.comp_info[0].v_samp_factor; const bool is_420 = dinfo.comp_info[0].h_samp_factor == 2 && dinfo.comp_info[0].v_samp_factor == 2 && dinfo.comp_info[1].h_samp_factor == 1 && dinfo.comp_info[1].v_samp_factor == 1 && dinfo.comp_info[2].h_samp_factor == 1 && dinfo.comp_info[2].v_samp_factor == 1; if (!is_422 && !is_420) { fprintf(stderr, "Not 4:2:2 or 4:2:0. (Y=%dx%d, Cb=%dx%d, Cr=%dx%d)\n", dinfo.comp_info[0].h_samp_factor, dinfo.comp_info[0].v_samp_factor, dinfo.comp_info[1].h_samp_factor, dinfo.comp_info[1].v_samp_factor, dinfo.comp_info[2].h_samp_factor, dinfo.comp_info[2].v_samp_factor); return nullptr; } // Picture parameters. VAPictureParameterBufferJPEGBaseline pic_param; memset(&pic_param, 0, sizeof(pic_param)); pic_param.picture_width = dinfo.image_width; pic_param.picture_height = dinfo.image_height; for (int component_idx = 0; component_idx < dinfo.num_components; ++component_idx) { const jpeg_component_info *comp = &dinfo.comp_info[component_idx]; pic_param.components[component_idx].component_id = comp->component_id; pic_param.components[component_idx].h_sampling_factor = comp->h_samp_factor; pic_param.components[component_idx].v_sampling_factor = comp->v_samp_factor; pic_param.components[component_idx].quantiser_table_selector = comp->quant_tbl_no; } pic_param.num_components = dinfo.num_components; pic_param.color_space = 0; // YUV. pic_param.rotation = VA_ROTATION_NONE; VAResourcePool::VAResources resources = va_pool->get_va_resources(dinfo.image_width, dinfo.image_height, is_422 ? VA_FOURCC_UYVY : VA_FOURCC_NV12); ReleaseVAResources release(va_pool.get(), resources); VABufferID pic_param_buffer; VAStatus va_status = vaCreateBuffer(va_dpy->va_dpy, resources.context, VAPictureParameterBufferType, sizeof(pic_param), 1, &pic_param, &pic_param_buffer); CHECK_VASTATUS_RET(va_status, "vaCreateBuffer"); VABufferDestroyer destroy_pic_param(va_dpy->va_dpy, pic_param_buffer); // Quantization matrices. VAIQMatrixBufferJPEGBaseline iq; memset(&iq, 0, sizeof(iq)); for (int quant_tbl_idx = 0; quant_tbl_idx < min(4, NUM_QUANT_TBLS); ++quant_tbl_idx) { const JQUANT_TBL *qtbl = dinfo.quant_tbl_ptrs[quant_tbl_idx]; if (qtbl == nullptr) { iq.load_quantiser_table[quant_tbl_idx] = 0; } else { iq.load_quantiser_table[quant_tbl_idx] = 1; for (int i = 0; i < 64; ++i) { if (qtbl->quantval[i] > 255) { fprintf(stderr, "Baseline JPEG only!\n"); return nullptr; } iq.quantiser_table[quant_tbl_idx][i] = qtbl->quantval[jpeg_natural_order[i]]; } } } VABufferID iq_buffer; va_status = vaCreateBuffer(va_dpy->va_dpy, resources.context, VAIQMatrixBufferType, sizeof(iq), 1, &iq, &iq_buffer); CHECK_VASTATUS_RET(va_status, "vaCreateBuffer"); VABufferDestroyer destroy_iq(va_dpy->va_dpy, iq_buffer); // Huffman tables (arithmetic is not supported). VAHuffmanTableBufferJPEGBaseline huff; memset(&huff, 0, sizeof(huff)); for (int huff_tbl_idx = 0; huff_tbl_idx < min(2, NUM_HUFF_TBLS); ++huff_tbl_idx) { const JHUFF_TBL *ac_hufftbl = dinfo.ac_huff_tbl_ptrs[huff_tbl_idx]; const JHUFF_TBL *dc_hufftbl = dinfo.dc_huff_tbl_ptrs[huff_tbl_idx]; if (ac_hufftbl == nullptr) { assert(dc_hufftbl == nullptr); huff.load_huffman_table[huff_tbl_idx] = 0; } else { assert(dc_hufftbl != nullptr); huff.load_huffman_table[huff_tbl_idx] = 1; for (int i = 0; i < 16; ++i) { huff.huffman_table[huff_tbl_idx].num_dc_codes[i] = dc_hufftbl->bits[i + 1]; } for (int i = 0; i < 12; ++i) { huff.huffman_table[huff_tbl_idx].dc_values[i] = dc_hufftbl->huffval[i]; } for (int i = 0; i < 16; ++i) { huff.huffman_table[huff_tbl_idx].num_ac_codes[i] = ac_hufftbl->bits[i + 1]; } for (int i = 0; i < 162; ++i) { huff.huffman_table[huff_tbl_idx].ac_values[i] = ac_hufftbl->huffval[i]; } } } VABufferID huff_buffer; va_status = vaCreateBuffer(va_dpy->va_dpy, resources.context, VAHuffmanTableBufferType, sizeof(huff), 1, &huff, &huff_buffer); CHECK_VASTATUS_RET(va_status, "vaCreateBuffer"); VABufferDestroyer destroy_huff(va_dpy->va_dpy, huff_buffer); // Slice parameters (metadata about the slice). VASliceParameterBufferJPEGBaseline parms; memset(&parms, 0, sizeof(parms)); parms.slice_data_size = dinfo.src->bytes_in_buffer; parms.slice_data_offset = 0; parms.slice_data_flag = VA_SLICE_DATA_FLAG_ALL; parms.slice_horizontal_position = 0; parms.slice_vertical_position = 0; for (int component_idx = 0; component_idx < dinfo.num_components; ++component_idx) { const jpeg_component_info *comp = &dinfo.comp_info[component_idx]; parms.components[component_idx].component_selector = comp->component_id; parms.components[component_idx].dc_table_selector = comp->dc_tbl_no; parms.components[component_idx].ac_table_selector = comp->ac_tbl_no; if (parms.components[component_idx].dc_table_selector > 1 || parms.components[component_idx].ac_table_selector > 1) { fprintf(stderr, "Uses too many Huffman tables\n"); return nullptr; } } parms.num_components = dinfo.num_components; parms.restart_interval = dinfo.restart_interval; int horiz_mcus = (dinfo.image_width + (DCTSIZE * 2) - 1) / (DCTSIZE * 2); int vert_mcus = (dinfo.image_height + DCTSIZE - 1) / DCTSIZE; parms.num_mcus = horiz_mcus * vert_mcus; VABufferID slice_param_buffer; va_status = vaCreateBuffer(va_dpy->va_dpy, resources.context, VASliceParameterBufferType, sizeof(parms), 1, &parms, &slice_param_buffer); CHECK_VASTATUS_RET(va_status, "vaCreateBuffer"); VABufferDestroyer destroy_slice_param(va_dpy->va_dpy, slice_param_buffer); // The actual data. VA-API will destuff and all for us. VABufferID data_buffer; va_status = vaCreateBuffer(va_dpy->va_dpy, resources.context, VASliceDataBufferType, dinfo.src->bytes_in_buffer, 1, const_cast(dinfo.src->next_input_byte), &data_buffer); CHECK_VASTATUS_RET(va_status, "vaCreateBuffer"); VABufferDestroyer destroy_data(va_dpy->va_dpy, data_buffer); va_status = vaBeginPicture(va_dpy->va_dpy, resources.context, resources.surface); CHECK_VASTATUS_RET(va_status, "vaBeginPicture"); va_status = vaRenderPicture(va_dpy->va_dpy, resources.context, &pic_param_buffer, 1); CHECK_VASTATUS_RET(va_status, "vaRenderPicture(pic_param)"); va_status = vaRenderPicture(va_dpy->va_dpy, resources.context, &iq_buffer, 1); CHECK_VASTATUS_RET(va_status, "vaRenderPicture(iq)"); va_status = vaRenderPicture(va_dpy->va_dpy, resources.context, &huff_buffer, 1); CHECK_VASTATUS_RET(va_status, "vaRenderPicture(huff)"); va_status = vaRenderPicture(va_dpy->va_dpy, resources.context, &slice_param_buffer, 1); CHECK_VASTATUS_RET(va_status, "vaRenderPicture(slice_param)"); va_status = vaRenderPicture(va_dpy->va_dpy, resources.context, &data_buffer, 1); CHECK_VASTATUS_RET(va_status, "vaRenderPicture(data)"); va_status = vaEndPicture(va_dpy->va_dpy, resources.context); CHECK_VASTATUS_RET(va_status, "vaEndPicture"); // vaDeriveImage() works, but the resulting image seems to live in // uncached memory, which makes copying data out from it very, very slow. // Thanks to FFmpeg for the observation that you can vaGetImage() the // surface onto your own image (although then, it can't be planar, which // is unfortunate for us). #if 0 VAImage image; va_status = vaDeriveImage(va_dpy->va_dpy, surf, &image); CHECK_VASTATUS_RET(va_status, "vaDeriveImage"); #else va_status = vaSyncSurface(va_dpy->va_dpy, resources.surface); CHECK_VASTATUS_RET(va_status, "vaSyncSurface"); va_status = vaGetImage(va_dpy->va_dpy, resources.surface, 0, 0, dinfo.image_width, dinfo.image_height, resources.image.image_id); CHECK_VASTATUS_RET(va_status, "vaGetImage"); #endif void *mapped; va_status = vaMapBuffer(va_dpy->va_dpy, resources.image.buf, &mapped); CHECK_VASTATUS_RET(va_status, "vaMapBuffer"); shared_ptr frame(new Frame); #if 0 // 4:2:2 planar (for vaDeriveImage). frame->y.reset(new uint8_t[dinfo.image_width * dinfo.image_height]); frame->cb.reset(new uint8_t[(dinfo.image_width / 2) * dinfo.image_height]); frame->cr.reset(new uint8_t[(dinfo.image_width / 2) * dinfo.image_height]); for (int component_idx = 0; component_idx < dinfo.num_components; ++component_idx) { uint8_t *dptr; size_t width; if (component_idx == 0) { dptr = frame->y.get(); width = dinfo.image_width; } else if (component_idx == 1) { dptr = frame->cb.get(); width = dinfo.image_width / 2; } else if (component_idx == 2) { dptr = frame->cr.get(); width = dinfo.image_width / 2; } else { assert(false); } const uint8_t *sptr = (const uint8_t *)mapped + image.offsets[component_idx]; size_t spitch = image.pitches[component_idx]; for (size_t y = 0; y < dinfo.image_height; ++y) { memcpy(dptr + y * width, sptr + y * spitch, width); } } #else // Convert Y'CbCr to separate Y' and CbCr. frame->is_semiplanar = true; PBO pbo = global_pbo_pool->alloc_pbo(); size_t cbcr_offset = dinfo.image_width * dinfo.image_height; uint8_t *y_pix = pbo.ptr; uint8_t *cbcr_pix = pbo.ptr + cbcr_offset; unsigned cbcr_width = dinfo.image_width / 2; unsigned cbcr_height; if (is_422) { const uint8_t *src = (const uint8_t *)mapped + resources.image.offsets[0]; if (resources.image.pitches[0] == dinfo.image_width * 2) { memcpy_interleaved(cbcr_pix, y_pix, src, dinfo.image_width * dinfo.image_height * 2); } else { for (unsigned y = 0; y < dinfo.image_height; ++y) { memcpy_interleaved(cbcr_pix + y * dinfo.image_width, y_pix + y * dinfo.image_width, src + y * resources.image.pitches[0], dinfo.image_width * 2); } } cbcr_height = dinfo.image_height; } else { assert(is_420); const uint8_t *src_y = (const uint8_t *)mapped + resources.image.offsets[0]; const uint8_t *src_cbcr = (const uint8_t *)mapped + resources.image.offsets[1]; memcpy_with_pitch(y_pix, src_y, dinfo.image_width, resources.image.pitches[0], dinfo.image_height); memcpy_with_pitch(cbcr_pix, src_cbcr, dinfo.image_width, resources.image.pitches[1], dinfo.image_height / 2); cbcr_height = dinfo.image_height / 2; } glBindBuffer(GL_PIXEL_UNPACK_BUFFER, pbo.pbo); frame->y = create_texture_2d(dinfo.image_width, dinfo.image_height, GL_R8, GL_RED, GL_UNSIGNED_BYTE, BUFFER_OFFSET(0)); frame->cbcr = create_texture_2d(cbcr_width, cbcr_height, GL_RG8, GL_RG, GL_UNSIGNED_BYTE, BUFFER_OFFSET(cbcr_offset)); glFlushMappedNamedBufferRange(pbo.pbo, 0, dinfo.image_width * dinfo.image_height + cbcr_width * cbcr_height * 2); glBindBuffer(GL_PIXEL_UNPACK_BUFFER, 0); glMemoryBarrier(GL_PIXEL_BUFFER_BARRIER_BIT); pbo.upload_done = RefCountedGLsync(GL_SYNC_GPU_COMMANDS_COMPLETE, /*flags=*/0); frame->uploaded_ui_thread = pbo.upload_done; frame->uploaded_interpolation = pbo.upload_done; global_pbo_pool->release_pbo(move(pbo)); #endif frame->width = dinfo.image_width; frame->height = dinfo.image_height; frame->chroma_subsampling_x = 2; frame->chroma_subsampling_y = is_420 ? 2 : 1; if (dinfo.marker_list != nullptr && dinfo.marker_list->marker == JPEG_APP0 + 1 && dinfo.marker_list->data_length >= 4 && memcmp(dinfo.marker_list->data, "Exif", 4) == 0) { frame->exif_data.assign(reinterpret_cast(dinfo.marker_list->data), dinfo.marker_list->data_length); } va_status = vaUnmapBuffer(va_dpy->va_dpy, resources.image.buf); CHECK_VASTATUS_RET(va_status, "vaUnmapBuffer"); return frame; } nageru-2.3.0/futatabi/vaapi_jpeg_decoder.h000066400000000000000000000005621450736322200205460ustar00rootroot00000000000000#ifndef _VAAPI_JPEG_DECODER_H #define _VAAPI_JPEG_DECODER_H 1 #include #include #include #include struct Frame; std::string get_usable_va_display(); void init_jpeg_vaapi(); std::shared_ptr decode_jpeg_vaapi(const std::string &jpeg); extern bool vaapi_jpeg_decoding_usable; #endif // !defined(_VAAPI_JPEG_DECODER_H) nageru-2.3.0/futatabi/variational_refinement.txt000066400000000000000000000611731450736322200220760ustar00rootroot00000000000000Variational refinement -- an introduction and derivation The variational refinement is probably the most difficult part of the algorithm to understand, in part because the description in most papers are very heavy on notation and rather light on exposition. I've tried to give a somewhat friendlier introduction to this specific algorithm below. The general idea is fairly simple; we try to optimize the flow field as a whole, by minimizing some mathematical notion of badness expressed as an energy function. The one used in the dense inverse search paper [Kroeger16; se references below] has this form: E(U) = int( σ Ψ(E_I) + γ Ψ(E_G) + α Ψ(E_S) ) dx where Ψ(a²) = sqrt(a² + ε²) for some small constant ε = 0.001, and σ, γ, α are empirically set weighting constants. (We'll get to what the different enery terms are in a minute.) The integral is, for all practical purposes, just a sum over all the pixels in the flow. In general, such formulas are nonconvex and highly nonlinear, so we cannot hope to find a global minimum -- but if we start from the flow generated by the motion search, we can at least hope to make it somehow better by walking towards a local minimum. (In fact, there are many methods for optical flow that work _only_ by such minimization, so the word “refinement” is maybe not doing the method justice. One could just as well say that the motion search is a way of finding a reasonable starting point for the optimization.) The dense inverse search paper [Kroeger16] sets up the energy terms as described by some motion tensors and normalizations, then says simply that it is optimized by “θ_vo fixed point iterations and θ_vi iterations of Successive Over Relaxation (SOR) for the linear system”. It's not immediately obvious what this means, but it gives a reference to [Brox04]. However, that paper describes a numerical approximation scheme that is _far_ more complicated than what the DIS code actually does. Rather, one must look at the other main reference they are giving, which is [Weinzaepfel13], describing a system called DeepFlow. DIS borrows most of the exposition and code for its variational refinement from DeepFlow, just removing some terms and fixing up a few issues here and there. (There are some slight differences in the paper, like the use of ∂z instead of ∂t, but that looks mostly like an error to me.) Unfortunately, that paper in turn refers to [Brox11], which appears no more useful in clearing up the notation to me. However, digging down in the references, finally one finds [Zimmer11], which is where the tensor notation appears to come from. This allows us to look at the first term in the energy, E_I, which comes from the intensity constant assumption. The basic idea is optical flow nearly by definition should preserve intensity after the warp: I_0(x + u) = I_1(x) where I_0 is the first picture, I_1 is the second, x is any 2D coordinate and u is the flow at x (which we are optimizing over). In general, we'll be optimizing over the entire field of u (potentially hundreds of thousands of values), but we'll be looking mostly at individual points, so we'll skip the coordinates when we can (e.g. we write u instead of or u(x, y)). u is of course the 2D flow, although often, we'll write its components separately as u and v instead of as a vector u. Before we go further, we need to add some more notation: * I_x is the partial derivative of I with respect to x (at some point), and similarly for I_y. These do not depend on u, so they can be precalculated before the optimization. * I_xx is the double partial derivative of I, and similar for I_yy and I_xy (the latter is the same as I_yx). * I_t is the temporal derivative of I, ie. in practice just I_t(x) = I_1(x) - I_0(x). Returning now to our original assertion: I_0(x + u) = I_1(x) Classically in optical flow, one assumes that the flow is smooth and linear around the point x, which allows one to approximate this equation by I_x u + I_y v + I_t = 0 This is usually simply called “the optical flow constraint”, and gives rise to a very natural part of the energy: E_I = I_x u + I_y v + I_t Remember that we send E_I through the function Ψ(a²) = sqrt(a² + ε²), so clearly Ψ(E_I) will be minimized if indeed E_I is zero. At this point, many papers start talking about Euler-Lagrange multivariate equations, which is a fairly daunting concept (at least the Wikipedia page is suitable for scaring small children). However, for the first two terms, we don't need its general form, and it reduces to something much simpler; just differentiate the energy by u and equate the result to zero (finding some minimum; it can't be a maximum, since *wave hands intensely*). Then differentiate the energy by v and set that to zero, too; now you have two equations in two unknowns (or, since we're optimizing over a field, maybe 500k equations in 500k unknowns -- although the equation set will be very sparse), which is hopefully solvable using linear methods. We'll look at what this gives for E_I in a moment, then try to apply the same notions to E_G and E_S later. First we modify E_I a bit by adding some normalization: E_I = β_0 (I_x u + I_y v + I_t) where β_0 = 1/(abs(∇I)² + 0.01). Note that β_0 depends on I only, so for the purposes of optimizing u, it's a constant and can be precomputed across I. (β_0 will, of course, depend on x, but so do all the other terms in the equation.) Now we give it to Maple, differentiating first by u and then by v: > M := (u,v) -> B_0 * (I_x * u + I_y * v + I_t); M := (u, v) -> B_0 (I_x u + I_y v + I_t) > diff(sqrt(M(u,v)^2 + e), u); 2 B_0 (I_x u + I_y v + I_t) I_x ------------------------------------ 2 2 1/2 (B_0 (I_x u + I_y v + I_t) + e) > diff(sqrt(M(u,v)^2 + e), v); 2 B_0 (I_x u + I_y v + I_t) I_y ------------------------------------ 2 2 1/2 (B_0 (I_x u + I_y v + I_t) + e) So these are the two expressions to be set to zero (for each point). We'll notice immediately that this isn't very linear in u and v, so here's where the “fixed point iterations” come in; we simply assume that our previous values for u and v are approximately good enough for the denominator, and optimize them in the numerator only. Then we get new values that are hopefully a bit closer, which we can then use for the denominator, and so on. (This is seemingly an old technique; [Brox05] cites [Ciarlet78]. It is justifiable in the sense that the only thing really held constant is the derivative of the penalizer.) In other words, if we define the constant k1 = β_0² / sqrt(β_0² (I_x u' + I_y v' + I_t)² + ε²) (where u' and v' are the guesses for u and v from the previous iteration) we have the much more manageable k1 I_x² u + k1 I_x I_y v = - k1 I_t I_x k1 I_x I_y u + k1 I_y² v = - k1 I_t I_y ie., two linear equations in u and v. Now, you will notice two immediate problems by this equation set: * The factor k1 is completely useless, since it's just multiplied in everywhere. * The set of equations is colinear (the determinant of the matrix is zero), and thus there is an infinite number of possible solutions—this is known as the so-called “aperture problem”. It shouldn't be surprising, though, as we cannot expect that starting with a single constraint should allow us to solve for two unknowns. However, both problems will go away as soon as we start adding more terms, so let's look at the gradient constancy term E_G next. It is fairly similar to the brightness constancy term, except it uses the (spatial) gradient instead of intensity: ∇I_0(x + u) = ∇I_1(x) or equivalently (by definition): (∂I/∂x)_0(x + u) = (∂I/∂x)_1(x) (∂I/∂y)_0(x + u) = (∂I/∂y)_1(x) The idea is that this is more robust to changes in lighting. It doesn't replace the intensity term, but augments it; the weighting constants σ and γ control their relative importance. Also note that this actually gives us two independent equations, unlike the brightness constancy term. However, it is not obvious at all how to discretize this. In particular, most papers, including [Brox04], appear to want _not_ to make any linear assumptions of the flow in this case, and end up with tons of terms. (The DIS and DeepFlow papers do, again, use some tensor notation that I do not understand, but I'm not convinced it actually contains any of the discretization.) Yet more paper searching eventually turns up [Fahad07], which simply states that the discretized versions of these equations are: I_xx u + I_xy v + I_xt = 0 I_yx u + I_yy v + I_yt = 0. which seems to match well what the DIS code uses. Note that even though this is an equation set equal to zero, we can't just solve for them; we need to make (penalized, normalized) energy terms and add them to the other terms. This gives E_G = β_x (I_xx u + I_xy v + I_xt) + β_y (I_yx u + I_yy v + I_yt) with normalization terms β_x = 1 / (abs(∇(I_x))² + 0.01) (∇(I_x) is the gradient of ∂I/∂x) β_y = 1 / (abs(∇(I_y))² + 0.01) (The DIS paper writes ∇I_dx and ∇I_dy instead of ∇I_x and ∇I_y, but I believe that's a typo; the DeepFlow paper says ∇I_x and ∇I_y.) The papers both write that Ψ(E_G) is used, which would mean that the penalized term is E_G = sqrt((β_x (I_xx u + I_xy v + I_xt) + β_y (I_yx u + I_yy v + I_yt))² + ε²) but that isn't what the code actually does. Instead, it seems that the two terms are squared independently: E_G = sqrt((β_x (I_xx u + I_xy v + I_xt))² + (β_y (I_yx u + I_yy v + I_yt))² + ε²) Both are solvable just fine, and it probably does not matter all that much which we use in practice (although [Zimmer11] suggests that if we are using multichannel images, we should penalize the three channels separately), but we follow what the code actually does here. We can differentiate them and equate them to zero as before: > M_x := (u,v) -> B_x * (I_xx * u + I_xy * v + I_xt); M_x := (u, v) -> B_x (I_xx u + I_xy v + I_xt) > M_y := (u,v) -> B_y * (I_xy * u + I_yy * v + I_yt); M_y := (u, v) -> B_y (I_xy u + I_yy v + I_yt) > diff(sqrt(M_x(u,v)^2 + M_y(u,v)^2 + e), u); 2 2 2 (I_xx u + I_xy v + I_xt) B_x I_xx + 2 B_y (I_xy u + I_yy v + I_yt) I_xy --------------------------------------------------------------------------- 2 2 2 2 1/2 2 ((I_xx u + I_xy v + I_xt) B_x + B_y (I_xy u + I_yy v + I_yt) + e) > diff(sqrt(M_x(u,v)^2 + M_y(u,v)^2 + e), v); 2 2 2 (I_xx u + I_xy v + I_xt) B_x I_xy + 2 B_y (I_xy u + I_yy v + I_yt) I_yy --------------------------------------------------------------------------- 2 2 2 2 1/2 2 ((I_xx u + I_xy v + I_xt) B_x + B_y (I_xy u + I_yy v + I_yt) + e) Using the same fixed-point scheme where we hold the terms in the denominator constant and equal to last iteration's values, we get a new common constant k2 = 1 / sqrt(β_x² (I_xx u' + I_xy v' + I_xt)² + β_y² (I_xy u' + I_yy v' + I_yt)²) and for brevity k_x = k2 β_x² k_y = k2 β_y² and thus, collecting terms for u and v, we get the two equations: (k_x I_xx² + k_y I_xy²) u + (k_x I_xx I_xy + k_y I_xy I_yy) v = - k_x I_xx I_xt - k_y I_xy I_yt (k_x I_xx I_xy + k_y I_xy I_yy) u + (k_x I_xy² + k_y I_yy²) v = - k_x I_xy I_xt - k_y I_yy I_yt which is linear in u and v, not colinear (unless we are extremely unlucky), and can be easily solved. Of course, for optimizing the weighted sum σ Ψ(E_I) + γ Ψ(E_G), we just add the two equation sets pairwise with appropriate weights. There's a small discrepancy here: The equations suggest that we should be be squaring the normalization terms β_0², β_x², β_y²; however, the code does not appear to do so. It's possible that they were intended to be added outside of the penalization, e.g. Ψ(a²) = sqrt(β a² + ε²), but given that these come from [Zimmer11], which mentions nothing of the sort, I'll just have to assume that this is an implementation mishap. The final smoothness term the one that binds the flow field together as a whole so that we don't have WxH completely independent equations (with its positive and negative sides, of course). It is the simplest in terms of notation, but it requires the full power of the Euler-Lagrange equations to minimize, so we'll need to figure that part out. E_S = abs(∇u)² + abs(∇v)² or E_S = (u_x² + u_y²) + (v_x² + v_y²) The penalized form used in the DeepFlow notation, contrary to what you'd expect from the paper, is: E_S = sqrt(u_x² + u_y² + v_x² + v_y² + ε²) How would one go about to minimize such an expression by u? (We'll deal with v later.) It's perhaps no big surprise that the expression involves double derivatives, but the full form involves the Euler-Lagrange equations. They allow us to minimize expressions that contain x, y, u(x, y) _and_ the partial derivatives u_x(x, y) and u_y(x, y), although the answer becomes a differential equation. The Wikipedia page is, unfortunately, not very beginner-friendly, but the general idea is: Differentiate the expression by u_x (yes, differentiating by a partial derivative!), negate it, and then differentiate the result by x. Then do the same thing by u_y and y, add the two results together and equate to zero. Mathematically (https://en.wikipedia.org/wiki/Euler%E2%80%93Lagrange_equation#Several_functions_of_several_variables_with_single_derivative): ∂E/∂u - ∂/∂x (∂E/∂u_x) - ∂/∂y (∂E/∂u_y) = 0 The first term disappears, since we don't have a non-differentiated u(x, y) in E_S. (Previously, the two _other_ terms would disappear, because we didn't have u_x or u_y in E_I or E_G.) This means we get - ∂/∂x (u_x / sqrt(u_x² + u_y² + v_x² + v_y² + ε²)) - ∂/∂y (u_y / sqrt(u_x² + u_y² + v_x² + v_y² + ε²)) = 0 (We don't remove the minus signs since this is supposed to be added to all the other terms.) This is what's called an _anisotropic diffusion_ (or Perona–Malik diffusion) equation, and is extensively described in literature. It has the effect of smoothing the flow more in some places than others; in particular, it does not smooth as strongly near edges, so it is edge-preserving. (It's a bit odd to call it anisotropic, since it does smooth equally in all directions; [Brox05] calls it vector-valued diffusion.) We'd love to our usual trick of keeping the nonlinear terms in the denominator constant, but alas, we can't do that yet, since it's under the differentiation operator; this factor has to be discretized together with u before we can treat it as a constant. So instead, we'll define it as a function (called the _diffusivity_ at the given point): g(x, y) = 1 / sqrt(u_x² + u_y² + v_x² + v_y² + ε²) = 0 which gives us - ∂/∂x ( g(x, y) u_x ) - ∂/∂y ( g(x, y) u_y ) = 0 We'll also have a similar equation for minimizing v, of course: - ∂/∂x ( g(x, y) v_x ) - ∂/∂y ( g(x, y) v_y ) = 0 There's no normalization term β here, unlike the other terms; DeepFlow2 adds one, but we're not including it here. At this point, we make a tweak. This seemingly goes back to at least [Brox04], which also makes the same tweak to all the other terms (which we don't, but see below). We split u (and v) into something based on the original value plus a differential du (and dv), and then solve for du (or dv) instead. (In math-speak, we are moving to an implicit method, which is often more numerically stable.) In other words, u(x, y) = u0(x, y) + du(x, y) where u0(x, y) is the initial guess for the flow. (It's not the value from previous iteration, for reasons that will be clear later, it's the first one. [Brox04] differs here, but it does a number of things differently in the numerics anyway.) This gives us: - ∂/∂x ( g(x, y) (u0 + du)_x ) - ∂/∂y ( g(x, y) (u0 + du)_y ) = 0 or - ∂/∂x ( g(x, y) du_x ) - ∂/∂y ( g(x, y) du_y ) = ∂/∂x ( g(x, y) u0_x ) + ∂/∂y ( g(x, y) u0_y ) where the right-hand side is effectively a constant for these purposes (although it still needs to be calculated anew for each iteration, since g(x, y) changes). Of course, now we have a different problem; all the other terms are formulated in terms of u and v, not du and dv. DeepFlow solves this by not searching for the flow between I_0 and I_1, but between I_0 and a pre-warped I_1. In other words, before any of the derivatives involving I_t are calculated, we calculate an I_w with bilinear interpolation: I_w(x, y) = I_1(x + u0(x, y), y + v0(x, y)) and then redefine I_t (occasionally called I_z) as I_t(x, y) = I_w(x, y) - I_0(x, y) Note that the plus sign effectively means inverting the flow, so if the u0 and v0 were already correctly estimated, perfectly smooth and linear everywhere, I_w = I_0. (All spatial derivatives are calculated on the mean between I_0 and I_w; the paper doesn't mention this.) After this, all the equations for E_I and E_G earlier will still hold, they will just be calculating du and dv instead. Note that this means we have three values for the flow; there's u0 for the initial guess, du for the current guess of delta from u0 (which makes u0 + du the current guess of the flow), and du' for the previous guess of delta from u0. (The initial values for du' and dv' will be zero.) Now back to our equations, as we look at practical implementation: - ∂/∂x ( g(x, y) du_x ) - ∂/∂y ( g(x, y) du_y ) = ∂/∂x ( g(x, y) u0_x ) + ∂/∂y ( g(x, y) u0_y ) - ∂/∂x ( g(x, y) dv_x ) - ∂/∂y ( g(x, y) dv_y ) = ∂/∂x ( g(x, y) v0_x ) + ∂/∂y ( g(x, y) v0_y ) We can discretize the left-hand and right-hand side identically (they differ only in signs and in variable), so let's look only at - ∂/∂x ( g(x, y) du_x ) - ∂/∂y ( g(x, y) du_y ) [Brox05] equation (2.14) (which refers to a 1998 book, although I couldn't immediately find the equation in question in that book) discretizes this as - 1/2 (g(x+1, y) + g(x, y)) (du(x+1, y) - du(x, y)) + 1/2 (g(x-1, y) + g(x, y)) (du(x, y) - du(x-1, y)) - 1/2 (g(x, y+1) + g(x, y)) (du(x, y+1) - du(x, y)) + 1/2 (g(x, y-1) + g(x, y)) (du(x, y) - du(x, y-1)) It also mentions that it would be better to sample g at the half-way points, e.g. g(x+0.5, y), but that begs the question exactly how we'd do that, and DeepFlow doesn't seem to care, so we stick with their version. Now we can finally let g use the values of the flow (note that this is the actual flow u and v, not du and dv!) from the previous iteration, as before: g(x, y) = 1 / sqrt(u'_x² + u'_y² + v'_x² + v'_y² + ε²) The single derivatives in g(x) are approximated by standard central differences (see https://en.wikipedia.org/wiki/Finite_difference_coefficient), e.g. u_x(x, y) = 1/2 (u(x + 1, y) - u(x - 1, y)) although the derivatives of I are using the fancier I_x(x, y) = 1/12 (-I(x - 2, y) + 8 I(x - 1, y) - 8 I(x - 1, y) + I(x - 2, y)) I assume this is because I_x derivatives are calculated only once, so we can afford more accurate derivatives (or possibly simply because of influence from earlier papers). Let's now define a smoothness constant between the neighbors (x,y) and (x1,y1): s(x1, y1) = 1/2 (g(x, y) + g(x1, y1)) Collecting all the du(x, y) terms of the discretized equation above, ignoring the right-hand side, which is just a constant for us anyway: - s(x+1, y) (du(x+1, y) - du(x, y)) + s(x-1, y) (du(x, y) - du(x-1, y)) - s(x, y+1) (du(x, y+1) - du(x, y)) + s(x, y-1) (du(x, y) - du(x, y-1)) = C - s(x+1, y) du(x+1, y) + s(x+1, y) du(x, y) + s(x-1, y) du(x, y) - s(x-1, y) du(x-1, y) - s(x, y+1) du(x, y+1) + s(x, y+1) du(x, y) + s(x, y-1) du(x, y) - s(x, y-1) du(x, y-1) = C (s(x+1, y) + s(x-1, y) + s(x, y+1) + s(x, y-1)) du(x, y) = s(x+1, y) du(x+1, y) + s(x-1, y) du(x-1, y) + s(x, y+1) du(x, y+1) + s(x, y-1) du(x, y-1) + C It is interesting to note that if s = 1 uniformly, which would be the case without our penalizer Ψ(a²), we would have the familiar discrete Laplacian, where du(x, y) would seek to simply become the average of its four immediate neighbors. Now our equation system is finally complete and linear, and the rest is fairly pedestrian. The last term connects all the unknowns together, but we still solve them mostly as 2x2 matrices. The most basic iterative method is Jacobi, where we solve du(x, y) and dv(x,y) using the previous iteration's value for all other du/dv values. (That this converges at all it beyond this text to prove, but it does. Not that we bother iterating until it converges; a few iterations is good enough.) Gauss-Seidel iterations improve on this in that (surprisingly!) using this iteration's computed du/dv values if they're ready; this improves convergence, but is hard to parallelize. Successive over-relaxation (SOR) improves further on this, in that it assumes that the solution moves towards the right value, so why not just go a bit further? That is, if Gauss-Seidel would tell you to increase the flow by 1.0 pixel to the right, perhaps go 1.5 pixels to the right instead (this value is called ω). Again, the convergence proof is beyond the scope here, but SOR converges for any ω between 1 and 2 (1 gives plain Gauss-Seidel, and over 2, we risk overshooting and never converging). Optimal ω depends on the equation system; DIS uses ω = 1.6, which presumably was measured, while we do ω = 1.8 (seems to be marginally better after some light testing). Efficient GPU implementation of SOR is not trivial; like noted before, Gauss-Seidel is inherently serial, which is a poor match for the GPU. Worse, doing SOR with Jacobi as base instead of Gauss-Seidel makes for an algorithm which simply does not converge. We solve this by using a method called red-black SOR (not to be confused with red-black binary trees). Conceptually, it assigns every unknown a color, with every other being red or black (similar to a checkerboard). Since red values now only depend on black values and vice versa, one can do all red values in parallel, then all black values, and so on. (This is equivalent to reordering the equation set; different such orderings can have different convergence speeds.) Our GPU SOR implementation is not overly efficient, so essentially one such half-iteration of red-black SOR costs the same as one full iteration of Jacobi but convergence is so much faster that it's worth it. Generally speaking, Gauss-Seidel converges twice as fast as Jacobi (ie., if Jacobi converges in N iterations, Gauss-Seidel does so in N/2), but SOR converges _geometrically_ faster, ie., in O(√N) iterations. Do note that the DeepFlow code does not fully use SOR or even Gauss-Seidel; it solves every 2x2 block (ie., single du/dv pair) using Cramer's rule, and then pushes that vector 60% further, SOR-style. This would be clearly more accurate if we didn't have SOR in the mix (since du and dv would converge immediately relative to each other, bar Cramer's numerical issues), but I'm not sure whether it's better given SOR. (DIS changes this to a more traditional SOR formulation, which we also use. It doesn't seem to be much different in practical testing; perhaps minutely worse, but I haven't done a deep analysis here.) And that's it. References: [Brox04]: Brox, Bruhn, Papenberg, Weickert: “High Accuracy Optical Flow Estimation Based on a Theory for Warping”, in Proceedings of the European Conference on Computer Vision (ECCV), 2004 [Brox05]: Brox: “From Pixels to Regions: Partial Differential Equations in Image Analysis”, PhD thesis, 2005 [Brox11]: Brox, Malik: “Large Displacement Optical Flow: Descriptor Matching in Variational Motion Estimation”, IEEE Transactions on Pattern Analysis and Machine Intelligence, 2011 [Ciarlet78]: Ciarlet: “The Finite Element Method for Elliptic Problems”, 1978 [Fahad07]: Fahad, Morris: “Multiple Combined Constraints for Optical Flow Estimation”, in Proceedings of the 3rd International Conference on Advances in Visual Computing (ISVC), 2007 [Kroeger16]: Kroeger, Timofte, Dai, van Gool: “Fast Optical Flow using Dense Inverse Search”, in Proceedings of the European Conference on Computer Vision (ECCV), 2016 [Weinzaepfel13]: Weinzaepfel, Revaud, Harchaoui, Schmid: “DeepFlow: Large displacement optical flow with deep matching”, in IEEE International Conference on Computer Vision (ICCV), 2013 [Zimmer11]: Zimmer, Bruhn, Weickert: “Optic Flow in Harmony”, International Journal of Computer Vision, 2011 nageru-2.3.0/futatabi/video_stream.cpp000066400000000000000000001037531450736322200177760ustar00rootroot00000000000000#include "video_stream.h" extern "C" { #include #include #include } #include "chroma_subsampler.h" #include "exif_parser.h" #include "flags.h" #include "flow.h" #include "jpeg_frame_view.h" #include "movit/util.h" #include "pbo_pool.h" #include "player.h" #include "shared/context.h" #include "shared/ffmpeg_raii.h" #include "shared/httpd.h" #include "shared/metrics.h" #include "shared/shared_defs.h" #include "shared/mux.h" #include "util.h" #include "ycbcr_converter.h" #include #include #include using namespace movit; using namespace std; using namespace std::chrono; namespace { once_flag video_metrics_inited; Summary metric_jpeg_encode_time_seconds; Summary metric_fade_latency_seconds; Summary metric_interpolation_latency_seconds; Summary metric_fade_fence_wait_time_seconds; Summary metric_interpolation_fence_wait_time_seconds; void wait_for_upload(shared_ptr &frame) { if (frame->uploaded_interpolation != nullptr) { glWaitSync(frame->uploaded_interpolation.get(), /*flags=*/0, GL_TIMEOUT_IGNORED); frame->uploaded_interpolation.reset(); } } } // namespace extern HTTPD *global_httpd; struct VectorDestinationManager { jpeg_destination_mgr pub; string dest; VectorDestinationManager() { pub.init_destination = init_destination_thunk; pub.empty_output_buffer = empty_output_buffer_thunk; pub.term_destination = term_destination_thunk; } static void init_destination_thunk(j_compress_ptr ptr) { ((VectorDestinationManager *)(ptr->dest))->init_destination(); } inline void init_destination() { make_room(0); } static boolean empty_output_buffer_thunk(j_compress_ptr ptr) { return ((VectorDestinationManager *)(ptr->dest))->empty_output_buffer(); } inline bool empty_output_buffer() { make_room(dest.size()); // Should ignore pub.free_in_buffer! return true; } inline void make_room(size_t bytes_used) { dest.resize(bytes_used + 4096); dest.resize(dest.capacity()); pub.next_output_byte = (uint8_t *)dest.data() + bytes_used; pub.free_in_buffer = dest.size() - bytes_used; } static void term_destination_thunk(j_compress_ptr ptr) { ((VectorDestinationManager *)(ptr->dest))->term_destination(); } inline void term_destination() { dest.resize(dest.size() - pub.free_in_buffer); } }; static_assert(std::is_standard_layout::value, ""); string encode_jpeg(const uint8_t *y_data, const uint8_t *cb_data, const uint8_t *cr_data, unsigned width, unsigned height, const string exif_data) { steady_clock::time_point start = steady_clock::now(); VectorDestinationManager dest; jpeg_compress_struct cinfo; jpeg_error_mgr jerr; cinfo.err = jpeg_std_error(&jerr); jpeg_create_compress(&cinfo); cinfo.dest = (jpeg_destination_mgr *)&dest; cinfo.input_components = 3; cinfo.in_color_space = JCS_RGB; jpeg_set_defaults(&cinfo); constexpr int quality = 90; jpeg_set_quality(&cinfo, quality, /*force_baseline=*/false); cinfo.image_width = width; cinfo.image_height = height; cinfo.raw_data_in = true; jpeg_set_colorspace(&cinfo, JCS_YCbCr); cinfo.comp_info[0].h_samp_factor = 2; cinfo.comp_info[0].v_samp_factor = 1; cinfo.comp_info[1].h_samp_factor = 1; cinfo.comp_info[1].v_samp_factor = 1; cinfo.comp_info[2].h_samp_factor = 1; cinfo.comp_info[2].v_samp_factor = 1; cinfo.CCIR601_sampling = true; // Seems to be mostly ignored by libjpeg, though. jpeg_start_compress(&cinfo, true); // This comment marker is private to FFmpeg. It signals limited Y'CbCr range // (and nothing else). jpeg_write_marker(&cinfo, JPEG_COM, (const JOCTET *)"CS=ITU601", strlen("CS=ITU601")); if (!exif_data.empty()) { jpeg_write_marker(&cinfo, JPEG_APP0 + 1, (const JOCTET *)exif_data.data(), exif_data.size()); } JSAMPROW yptr[8], cbptr[8], crptr[8]; JSAMPARRAY data[3] = { yptr, cbptr, crptr }; for (unsigned y = 0; y < height; y += 8) { for (unsigned yy = 0; yy < 8; ++yy) { yptr[yy] = const_cast(&y_data[(y + yy) * width]); cbptr[yy] = const_cast(&cb_data[(y + yy) * width / 2]); crptr[yy] = const_cast(&cr_data[(y + yy) * width / 2]); } jpeg_write_raw_data(&cinfo, data, /*num_lines=*/8); } jpeg_finish_compress(&cinfo); jpeg_destroy_compress(&cinfo); steady_clock::time_point stop = steady_clock::now(); metric_jpeg_encode_time_seconds.count_event(duration(stop - start).count()); return move(dest.dest); } string encode_jpeg_from_pbo(void *contents, unsigned width, unsigned height, const string exif_data) { unsigned chroma_width = width / 2; const uint8_t *y = (const uint8_t *)contents; const uint8_t *cb = (const uint8_t *)contents + width * height; const uint8_t *cr = (const uint8_t *)contents + width * height + chroma_width * height; return encode_jpeg(y, cb, cr, width, height, move(exif_data)); } VideoStream::VideoStream(AVFormatContext *file_avctx) : avctx(file_avctx), output_fast_forward(file_avctx != nullptr) { call_once(video_metrics_inited, [] { vector quantiles{ 0.01, 0.1, 0.25, 0.5, 0.75, 0.9, 0.99 }; metric_jpeg_encode_time_seconds.init(quantiles, 60.0); global_metrics.add("jpeg_encode_time_seconds", &metric_jpeg_encode_time_seconds); metric_fade_fence_wait_time_seconds.init(quantiles, 60.0); global_metrics.add("fade_fence_wait_time_seconds", &metric_fade_fence_wait_time_seconds); metric_interpolation_fence_wait_time_seconds.init(quantiles, 60.0); global_metrics.add("interpolation_fence_wait_time_seconds", &metric_interpolation_fence_wait_time_seconds); metric_fade_latency_seconds.init(quantiles, 60.0); global_metrics.add("fade_latency_seconds", &metric_fade_latency_seconds); metric_interpolation_latency_seconds.init(quantiles, 60.0); global_metrics.add("interpolation_latency_seconds", &metric_interpolation_latency_seconds); }); ycbcr_converter.reset(new YCbCrConverter(YCbCrConverter::OUTPUT_TO_DUAL_YCBCR, /*resource_pool=*/nullptr)); ycbcr_semiplanar_converter.reset(new YCbCrConverter(YCbCrConverter::OUTPUT_TO_SEMIPLANAR, /*resource_pool=*/nullptr)); GLuint input_tex[num_interpolate_slots], gray_tex[num_interpolate_slots]; GLuint fade_y_output_tex[num_interpolate_slots], fade_cbcr_output_tex[num_interpolate_slots]; GLuint cb_tex[num_interpolate_slots], cr_tex[num_interpolate_slots]; glCreateTextures(GL_TEXTURE_2D_ARRAY, num_interpolate_slots, input_tex); glCreateTextures(GL_TEXTURE_2D_ARRAY, num_interpolate_slots, gray_tex); glCreateTextures(GL_TEXTURE_2D, num_interpolate_slots, fade_y_output_tex); glCreateTextures(GL_TEXTURE_2D, num_interpolate_slots, fade_cbcr_output_tex); glCreateTextures(GL_TEXTURE_2D, num_interpolate_slots, cb_tex); glCreateTextures(GL_TEXTURE_2D, num_interpolate_slots, cr_tex); check_error(); size_t width = global_flags.width, height = global_flags.height; int levels = find_num_levels(width, height); for (size_t i = 0; i < num_interpolate_slots; ++i) { glTextureStorage3D(input_tex[i], levels, GL_RGBA8, width, height, 2); check_error(); glTextureStorage3D(gray_tex[i], levels, GL_R8, width, height, 2); check_error(); glTextureStorage2D(fade_y_output_tex[i], 1, GL_R8, width, height); check_error(); glTextureStorage2D(fade_cbcr_output_tex[i], 1, GL_RG8, width, height); check_error(); glTextureStorage2D(cb_tex[i], 1, GL_R8, width / 2, height); check_error(); glTextureStorage2D(cr_tex[i], 1, GL_R8, width / 2, height); check_error(); unique_ptr resource(new InterpolatedFrameResources); resource->owner = this; resource->input_tex = input_tex[i]; resource->gray_tex = gray_tex[i]; resource->fade_y_output_tex = fade_y_output_tex[i]; resource->fade_cbcr_output_tex = fade_cbcr_output_tex[i]; resource->cb_tex = cb_tex[i]; resource->cr_tex = cr_tex[i]; glCreateFramebuffers(2, resource->input_fbos); check_error(); glCreateFramebuffers(1, &resource->fade_fbo); check_error(); glNamedFramebufferTextureLayer(resource->input_fbos[0], GL_COLOR_ATTACHMENT0, input_tex[i], 0, 0); check_error(); glNamedFramebufferTextureLayer(resource->input_fbos[0], GL_COLOR_ATTACHMENT1, gray_tex[i], 0, 0); check_error(); glNamedFramebufferTextureLayer(resource->input_fbos[1], GL_COLOR_ATTACHMENT0, input_tex[i], 0, 1); check_error(); glNamedFramebufferTextureLayer(resource->input_fbos[1], GL_COLOR_ATTACHMENT1, gray_tex[i], 0, 1); check_error(); glNamedFramebufferTexture(resource->fade_fbo, GL_COLOR_ATTACHMENT0, fade_y_output_tex[i], 0); check_error(); glNamedFramebufferTexture(resource->fade_fbo, GL_COLOR_ATTACHMENT1, fade_cbcr_output_tex[i], 0); check_error(); GLuint bufs[] = { GL_COLOR_ATTACHMENT0, GL_COLOR_ATTACHMENT1 }; glNamedFramebufferDrawBuffers(resource->input_fbos[0], 2, bufs); check_error(); glNamedFramebufferDrawBuffers(resource->input_fbos[1], 2, bufs); check_error(); glNamedFramebufferDrawBuffers(resource->fade_fbo, 2, bufs); check_error(); glCreateBuffers(1, &resource->pbo); check_error(); glNamedBufferStorage(resource->pbo, width * height * 4, nullptr, GL_MAP_READ_BIT | GL_MAP_PERSISTENT_BIT); check_error(); resource->pbo_contents = glMapNamedBufferRange(resource->pbo, 0, width * height * 4, GL_MAP_READ_BIT | GL_MAP_PERSISTENT_BIT); interpolate_resources.push_back(move(resource)); } check_error(); OperatingPoint op; if (global_flags.interpolation_quality == 0 || global_flags.interpolation_quality == 1) { op = operating_point1; } else if (global_flags.interpolation_quality == 2) { op = operating_point2; } else if (global_flags.interpolation_quality == 3) { op = operating_point3; } else if (global_flags.interpolation_quality == 4) { op = operating_point4; } else { // Quality 0 will be changed to 1 in flags.cpp. assert(false); } compute_flow.reset(new DISComputeFlow(width, height, op)); interpolate.reset(new Interpolate(op, /*split_ycbcr_output=*/true)); interpolate_no_split.reset(new Interpolate(op, /*split_ycbcr_output=*/false)); chroma_subsampler.reset(new ChromaSubsampler); check_error(); // The “last frame” is initially black. unique_ptr y(new uint8_t[global_flags.width * global_flags.height]); unique_ptr cb_or_cr(new uint8_t[(global_flags.width / 2) * global_flags.height]); memset(y.get(), 16, global_flags.width * global_flags.height); memset(cb_or_cr.get(), 128, (global_flags.width / 2) * global_flags.height); last_frame = encode_jpeg(y.get(), cb_or_cr.get(), cb_or_cr.get(), global_flags.width, global_flags.height, /*exif_data=*/""); if (file_avctx != nullptr) { with_subtitles = Mux::WITHOUT_SUBTITLES; } else { with_subtitles = Mux::WITH_SUBTITLES; } } VideoStream::~VideoStream() { if (last_flow_tex != 0) { compute_flow->release_texture(last_flow_tex); } for (const unique_ptr &resource : interpolate_resources) { glUnmapNamedBuffer(resource->pbo); check_error(); glDeleteBuffers(1, &resource->pbo); check_error(); glDeleteFramebuffers(2, resource->input_fbos); check_error(); glDeleteFramebuffers(1, &resource->fade_fbo); check_error(); glDeleteTextures(1, &resource->input_tex); check_error(); glDeleteTextures(1, &resource->gray_tex); check_error(); glDeleteTextures(1, &resource->fade_y_output_tex); check_error(); glDeleteTextures(1, &resource->fade_cbcr_output_tex); check_error(); glDeleteTextures(1, &resource->cb_tex); check_error(); glDeleteTextures(1, &resource->cr_tex); check_error(); } assert(interpolate_resources.size() == num_interpolate_slots); } void VideoStream::start() { if (avctx == nullptr) { avctx = avformat_alloc_context(); // We use Matroska, because it's pretty much the only mux where FFmpeg // allows writing chroma location to override JFIF's default center placement. // (Note that at the time of writing, however, FFmpeg does not correctly // _read_ this information!) avctx->oformat = av_guess_format("matroska", nullptr, nullptr); uint8_t *buf = (uint8_t *)av_malloc(MUX_BUFFER_SIZE); avctx->pb = avio_alloc_context(buf, MUX_BUFFER_SIZE, 1, this, nullptr, nullptr, nullptr); avctx->pb->write_data_type = &VideoStream::write_packet2_thunk; avctx->pb->ignore_boundary_point = 1; avctx->flags = AVFMT_FLAG_CUSTOM_IO; } AVCodecParameters *audio_codecpar = avcodec_parameters_alloc(); audio_codecpar->codec_type = AVMEDIA_TYPE_AUDIO; audio_codecpar->codec_id = AV_CODEC_ID_PCM_S32LE; audio_codecpar->ch_layout.order = AV_CHANNEL_ORDER_NATIVE; audio_codecpar->ch_layout.nb_channels = 2; audio_codecpar->ch_layout.u.mask = AV_CH_LAYOUT_STEREO; audio_codecpar->sample_rate = OUTPUT_FREQUENCY; size_t width = global_flags.width, height = global_flags.height; // Doesn't matter for MJPEG. mux.reset(new Mux(avctx, width, height, Mux::CODEC_MJPEG, /*video_extradata=*/"", audio_codecpar, AVCOL_SPC_BT709, COARSE_TIMEBASE, /*write_callback=*/nullptr, Mux::WRITE_FOREGROUND, {}, with_subtitles)); avcodec_parameters_free(&audio_codecpar); encode_thread = thread(&VideoStream::encode_thread_func, this); } void VideoStream::stop() { should_quit = true; queue_changed.notify_all(); clear_queue(); encode_thread.join(); } void VideoStream::clear_queue() { deque q; { lock_guard lock(queue_lock); q = move(frame_queue); } // These are not RAII-ed, unfortunately, so we'll need to clean them ourselves. // Note that release_texture() is thread-safe. for (const QueuedFrame &qf : q) { if (qf.type == QueuedFrame::INTERPOLATED || qf.type == QueuedFrame::FADED_INTERPOLATED) { if (qf.flow_tex != 0) { compute_flow->release_texture(qf.flow_tex); } } if (qf.type == QueuedFrame::INTERPOLATED) { interpolate->release_texture(qf.output_tex); interpolate->release_texture(qf.cbcr_tex); } } // Destroy q outside the mutex, as that would be a double-lock. } void VideoStream::schedule_original_frame(steady_clock::time_point local_pts, int64_t output_pts, function &&display_func, QueueSpotHolder &&queue_spot_holder, FrameOnDisk frame, const string &subtitle, bool include_audio) { fprintf(stderr, "output_pts=%" PRId64 " original input_pts=%" PRId64 "\n", output_pts, frame.pts); QueuedFrame qf; qf.local_pts = local_pts; qf.type = QueuedFrame::ORIGINAL; qf.output_pts = output_pts; qf.display_func = move(display_func); qf.queue_spot_holder = move(queue_spot_holder); qf.subtitle = subtitle; FrameReader::Frame read_frame = frame_reader.read_frame(frame, /*read_video=*/true, include_audio); qf.encoded_jpeg.reset(new string(move(read_frame.video))); qf.audio = move(read_frame.audio); lock_guard lock(queue_lock); frame_queue.push_back(move(qf)); queue_changed.notify_all(); } void VideoStream::schedule_faded_frame(steady_clock::time_point local_pts, int64_t output_pts, function &&display_func, QueueSpotHolder &&queue_spot_holder, FrameOnDisk frame1_spec, FrameOnDisk frame2_spec, float fade_alpha, const string &subtitle) { fprintf(stderr, "output_pts=%" PRId64 " faded input_pts=%" PRId64 ",%" PRId64 " fade_alpha=%.2f\n", output_pts, frame1_spec.pts, frame2_spec.pts, fade_alpha); // Get the temporary OpenGL resources we need for doing the fade. // (We share these with interpolated frames, which is slightly // overkill, but there's no need to waste resources on keeping // separate pools around.) BorrowedInterpolatedFrameResources resources; { lock_guard lock(queue_lock); if (interpolate_resources.empty()) { fprintf(stderr, "WARNING: Too many interpolated frames already in transit; dropping one.\n"); return; } resources = BorrowedInterpolatedFrameResources(interpolate_resources.front().release()); interpolate_resources.pop_front(); } bool did_decode; shared_ptr frame1 = decode_jpeg_with_cache(frame1_spec, DECODE_IF_NOT_IN_CACHE, &frame_reader, &did_decode); shared_ptr frame2 = decode_jpeg_with_cache(frame2_spec, DECODE_IF_NOT_IN_CACHE, &frame_reader, &did_decode); wait_for_upload(frame1); wait_for_upload(frame2); ycbcr_semiplanar_converter->prepare_chain_for_fade(frame1, frame2, fade_alpha)->render_to_fbo(resources->fade_fbo, global_flags.width, global_flags.height); QueuedFrame qf; qf.local_pts = local_pts; qf.type = QueuedFrame::FADED; qf.output_pts = output_pts; qf.frame1 = frame1_spec; qf.display_func = move(display_func); qf.queue_spot_holder = move(queue_spot_holder); qf.subtitle = subtitle; qf.secondary_frame = frame2_spec; // Subsample and split Cb/Cr. chroma_subsampler->subsample_chroma(resources->fade_cbcr_output_tex, global_flags.width, global_flags.height, resources->cb_tex, resources->cr_tex); // Read it down (asynchronously) to the CPU. glPixelStorei(GL_PACK_ROW_LENGTH, 0); glBindBuffer(GL_PIXEL_PACK_BUFFER, resources->pbo); check_error(); glGetTextureImage(resources->fade_y_output_tex, 0, GL_RED, GL_UNSIGNED_BYTE, global_flags.width * global_flags.height * 4, BUFFER_OFFSET(0)); check_error(); glGetTextureImage(resources->cb_tex, 0, GL_RED, GL_UNSIGNED_BYTE, global_flags.width * global_flags.height * 3, BUFFER_OFFSET(global_flags.width * global_flags.height)); check_error(); glGetTextureImage(resources->cr_tex, 0, GL_RED, GL_UNSIGNED_BYTE, global_flags.width * global_flags.height * 3 - (global_flags.width / 2) * global_flags.height, BUFFER_OFFSET(global_flags.width * global_flags.height + (global_flags.width / 2) * global_flags.height)); check_error(); glBindBuffer(GL_PIXEL_PACK_BUFFER, 0); // Set a fence we can wait for to make sure the CPU sees the read. glMemoryBarrier(GL_CLIENT_MAPPED_BUFFER_BARRIER_BIT); check_error(); qf.fence_created = steady_clock::now(); qf.fence = RefCountedGLsync(GL_SYNC_GPU_COMMANDS_COMPLETE, /*flags=*/0); check_error(); qf.resources = move(resources); qf.local_pts = local_pts; lock_guard lock(queue_lock); frame_queue.push_back(move(qf)); queue_changed.notify_all(); } void VideoStream::schedule_interpolated_frame(steady_clock::time_point local_pts, int64_t output_pts, function)> &&display_func, QueueSpotHolder &&queue_spot_holder, FrameOnDisk frame1, FrameOnDisk frame2, float alpha, FrameOnDisk secondary_frame, float fade_alpha, const string &subtitle, bool play_audio) { if (secondary_frame.pts != -1) { fprintf(stderr, "output_pts=%" PRId64 " interpolated input_pts1=%" PRId64 " input_pts2=%" PRId64 " alpha=%.3f secondary_pts=%" PRId64 " fade_alpha=%.2f\n", output_pts, frame1.pts, frame2.pts, alpha, secondary_frame.pts, fade_alpha); } else { fprintf(stderr, "output_pts=%" PRId64 " interpolated input_pts1=%" PRId64 " input_pts2=%" PRId64 " alpha=%.3f\n", output_pts, frame1.pts, frame2.pts, alpha); } // Get the temporary OpenGL resources we need for doing the interpolation. BorrowedInterpolatedFrameResources resources; { lock_guard lock(queue_lock); if (interpolate_resources.empty()) { fprintf(stderr, "WARNING: Too many interpolated frames already in transit; dropping one.\n"); return; } resources = BorrowedInterpolatedFrameResources(interpolate_resources.front().release()); interpolate_resources.pop_front(); } QueuedFrame qf; qf.type = (secondary_frame.pts == -1) ? QueuedFrame::INTERPOLATED : QueuedFrame::FADED_INTERPOLATED; qf.output_pts = output_pts; qf.display_decoded_func = move(display_func); qf.queue_spot_holder = move(queue_spot_holder); qf.local_pts = local_pts; qf.subtitle = subtitle; if (play_audio) { qf.audio = frame_reader.read_frame(frame1, /*read_video=*/false, /*read_audio=*/true).audio; } check_error(); // Convert frame0 and frame1 to OpenGL textures. for (size_t frame_no = 0; frame_no < 2; ++frame_no) { FrameOnDisk frame_spec = frame_no == 1 ? frame2 : frame1; bool did_decode; shared_ptr frame = decode_jpeg_with_cache(frame_spec, DECODE_IF_NOT_IN_CACHE, &frame_reader, &did_decode); wait_for_upload(frame); ycbcr_converter->prepare_chain_for_conversion(frame)->render_to_fbo(resources->input_fbos[frame_no], global_flags.width, global_flags.height); if (frame_no == 1) { qf.exif_data = frame->exif_data; // Use the white point from the last frame. } } glGenerateTextureMipmap(resources->input_tex); check_error(); glGenerateTextureMipmap(resources->gray_tex); check_error(); GLuint flow_tex; if (last_flow_tex != 0 && frame1 == last_frame1 && frame2 == last_frame2) { // Reuse the flow from previous computation. This frequently happens // if we slow down by more than 2x, so that there are multiple interpolated // frames between each original. flow_tex = last_flow_tex; qf.flow_tex = 0; } else { // Cache miss, so release last_flow_tex. qf.flow_tex = last_flow_tex; // Compute the flow. flow_tex = compute_flow->exec(resources->gray_tex, DISComputeFlow::FORWARD_AND_BACKWARD, DISComputeFlow::DO_NOT_RESIZE_FLOW); check_error(); // Store the flow texture for possible reuse next frame. last_flow_tex = flow_tex; last_frame1 = frame1; last_frame2 = frame2; } if (secondary_frame.pts != -1) { // Fade. First kick off the interpolation. tie(qf.output_tex, ignore) = interpolate_no_split->exec(resources->input_tex, resources->gray_tex, flow_tex, global_flags.width, global_flags.height, alpha); check_error(); // Now decode the image we are fading against. bool did_decode; shared_ptr frame2 = decode_jpeg_with_cache(secondary_frame, DECODE_IF_NOT_IN_CACHE, &frame_reader, &did_decode); wait_for_upload(frame2); // Then fade against it, putting it into the fade Y' and CbCr textures. RGBTriplet neutral_color = get_neutral_color(qf.exif_data); ycbcr_semiplanar_converter->prepare_chain_for_fade_from_texture(qf.output_tex, neutral_color, global_flags.width, global_flags.height, frame2, fade_alpha)->render_to_fbo(resources->fade_fbo, global_flags.width, global_flags.height); // Subsample and split Cb/Cr. chroma_subsampler->subsample_chroma(resources->fade_cbcr_output_tex, global_flags.width, global_flags.height, resources->cb_tex, resources->cr_tex); interpolate_no_split->release_texture(qf.output_tex); // We already applied the white balance, so don't have the client redo it. qf.exif_data.clear(); } else { tie(qf.output_tex, qf.cbcr_tex) = interpolate->exec(resources->input_tex, resources->gray_tex, flow_tex, global_flags.width, global_flags.height, alpha); check_error(); // Subsample and split Cb/Cr. chroma_subsampler->subsample_chroma(qf.cbcr_tex, global_flags.width, global_flags.height, resources->cb_tex, resources->cr_tex); } // We could have released qf.flow_tex here, but to make sure we don't cause a stall // when trying to reuse it for the next frame, we can just as well hold on to it // and release it only when the readback is done. // // TODO: This is maybe less relevant now that qf.flow_tex contains the texture we used // _last_ frame, not this one. // Read it down (asynchronously) to the CPU. glPixelStorei(GL_PACK_ROW_LENGTH, 0); glBindBuffer(GL_PIXEL_PACK_BUFFER, resources->pbo); check_error(); if (secondary_frame.pts != -1) { glGetTextureImage(resources->fade_y_output_tex, 0, GL_RED, GL_UNSIGNED_BYTE, global_flags.width * global_flags.height * 4, BUFFER_OFFSET(0)); } else { glGetTextureImage(qf.output_tex, 0, GL_RED, GL_UNSIGNED_BYTE, global_flags.width * global_flags.height * 4, BUFFER_OFFSET(0)); } check_error(); glGetTextureImage(resources->cb_tex, 0, GL_RED, GL_UNSIGNED_BYTE, global_flags.width * global_flags.height * 3, BUFFER_OFFSET(global_flags.width * global_flags.height)); check_error(); glGetTextureImage(resources->cr_tex, 0, GL_RED, GL_UNSIGNED_BYTE, global_flags.width * global_flags.height * 3 - (global_flags.width / 2) * global_flags.height, BUFFER_OFFSET(global_flags.width * global_flags.height + (global_flags.width / 2) * global_flags.height)); check_error(); glBindBuffer(GL_PIXEL_PACK_BUFFER, 0); // Set a fence we can wait for to make sure the CPU sees the read. glMemoryBarrier(GL_CLIENT_MAPPED_BUFFER_BARRIER_BIT); check_error(); qf.fence_created = steady_clock::now(); qf.fence = RefCountedGLsync(GL_SYNC_GPU_COMMANDS_COMPLETE, /*flags=*/0); check_error(); qf.resources = move(resources); lock_guard lock(queue_lock); frame_queue.push_back(move(qf)); queue_changed.notify_all(); } void VideoStream::schedule_refresh_frame(steady_clock::time_point local_pts, int64_t output_pts, function &&display_func, QueueSpotHolder &&queue_spot_holder, const string &subtitle) { QueuedFrame qf; qf.type = QueuedFrame::REFRESH; qf.output_pts = output_pts; qf.display_func = move(display_func); qf.queue_spot_holder = move(queue_spot_holder); qf.subtitle = subtitle; lock_guard lock(queue_lock); frame_queue.push_back(move(qf)); queue_changed.notify_all(); } void VideoStream::schedule_silence(steady_clock::time_point local_pts, int64_t output_pts, int64_t length_pts, QueueSpotHolder &&queue_spot_holder) { QueuedFrame qf; qf.type = QueuedFrame::SILENCE; qf.output_pts = output_pts; qf.queue_spot_holder = move(queue_spot_holder); qf.silence_length_pts = length_pts; lock_guard lock(queue_lock); frame_queue.push_back(move(qf)); queue_changed.notify_all(); } namespace { RefCountedTexture clone_r8_texture(GLuint src_tex, unsigned width, unsigned height) { GLuint tex; glCreateTextures(GL_TEXTURE_2D, 1, &tex); check_error(); glTextureStorage2D(tex, 1, GL_R8, width, height); check_error(); glCopyImageSubData(src_tex, GL_TEXTURE_2D, 0, 0, 0, 0, tex, GL_TEXTURE_2D, 0, 0, 0, 0, width, height, 1); check_error(); glTextureParameteri(tex, GL_TEXTURE_MIN_FILTER, GL_LINEAR); check_error(); glTextureParameteri(tex, GL_TEXTURE_MAG_FILTER, GL_LINEAR); check_error(); glTextureParameteri(tex, GL_TEXTURE_WRAP_S, GL_CLAMP_TO_EDGE); check_error(); glTextureParameteri(tex, GL_TEXTURE_WRAP_T, GL_CLAMP_TO_EDGE); check_error(); return RefCountedTexture(new GLuint(tex), TextureDeleter()); } } // namespace void VideoStream::encode_thread_func() { pthread_setname_np(pthread_self(), "VideoStream"); QSurface *surface = create_surface(); QOpenGLContext *context = create_context(surface); bool ok = make_current(context, surface); if (!ok) { fprintf(stderr, "Video stream couldn't get an OpenGL context\n"); abort(); } init_pbo_pool(); while (!should_quit) { QueuedFrame qf; { unique_lock lock(queue_lock); // Wait until we have a frame to play. queue_changed.wait(lock, [this] { return !frame_queue.empty() || should_quit; }); if (should_quit) { break; } steady_clock::time_point frame_start = frame_queue.front().local_pts; // Now sleep until the frame is supposed to start (the usual case), // _or_ clear_queue() happened. bool aborted; if (output_fast_forward) { aborted = frame_queue.empty() || frame_queue.front().local_pts != frame_start; } else { aborted = queue_changed.wait_until(lock, frame_start, [this, frame_start] { return frame_queue.empty() || frame_queue.front().local_pts != frame_start; }); } if (aborted) { // clear_queue() happened, so don't play this frame after all. continue; } qf = move(frame_queue.front()); frame_queue.pop_front(); } // Hack: We mux the subtitle packet one time unit before the actual frame, // so that Nageru is sure to get it first. if (!qf.subtitle.empty() && with_subtitles == Mux::WITH_SUBTITLES) { AVPacketWithDeleter pkt = av_packet_alloc_unique(); pkt->stream_index = mux->get_subtitle_stream_idx(); assert(pkt->stream_index != -1); pkt->data = (uint8_t *)qf.subtitle.data(); pkt->size = qf.subtitle.size(); pkt->flags = 0; pkt->duration = lrint(TIMEBASE / global_flags.output_framerate); // Doesn't really matter for Nageru. mux->add_packet(*pkt, qf.output_pts - 1, qf.output_pts - 1); } if (qf.type == QueuedFrame::ORIGINAL) { // Send the JPEG frame on, unchanged. string jpeg = move(*qf.encoded_jpeg); AVPacketWithDeleter pkt = av_packet_alloc_unique(); pkt->stream_index = 0; pkt->data = (uint8_t *)jpeg.data(); pkt->size = jpeg.size(); pkt->flags = AV_PKT_FLAG_KEY; mux->add_packet(*pkt, qf.output_pts, qf.output_pts); last_frame = move(jpeg); add_audio_or_silence(qf); } else if (qf.type == QueuedFrame::FADED) { steady_clock::time_point start = steady_clock::now(); glClientWaitSync(qf.fence.get(), /*flags=*/0, GL_TIMEOUT_IGNORED); steady_clock::time_point stop = steady_clock::now(); metric_fade_fence_wait_time_seconds.count_event(duration(stop - start).count()); metric_fade_latency_seconds.count_event(duration(stop - qf.fence_created).count()); // Now JPEG encode it, and send it on to the stream. string jpeg = encode_jpeg_from_pbo(qf.resources->pbo_contents, global_flags.width, global_flags.height, /*exif_data=*/""); AVPacketWithDeleter pkt = av_packet_alloc_unique(); pkt->stream_index = 0; pkt->data = (uint8_t *)jpeg.data(); pkt->size = jpeg.size(); pkt->flags = AV_PKT_FLAG_KEY; mux->add_packet(*pkt, qf.output_pts, qf.output_pts); last_frame = move(jpeg); add_audio_or_silence(qf); } else if (qf.type == QueuedFrame::INTERPOLATED || qf.type == QueuedFrame::FADED_INTERPOLATED) { steady_clock::time_point start = steady_clock::now(); glClientWaitSync(qf.fence.get(), /*flags=*/0, GL_TIMEOUT_IGNORED); steady_clock::time_point stop = steady_clock::now(); metric_interpolation_fence_wait_time_seconds.count_event(duration(stop - start).count()); metric_interpolation_latency_seconds.count_event(duration(stop - qf.fence_created).count()); // Send it on to display. if (qf.display_decoded_func != nullptr) { shared_ptr frame(new Frame); if (qf.type == QueuedFrame::FADED_INTERPOLATED) { frame->y = clone_r8_texture(qf.resources->fade_y_output_tex, global_flags.width, global_flags.height); } else { frame->y = clone_r8_texture(qf.output_tex, global_flags.width, global_flags.height); } frame->cb = clone_r8_texture(qf.resources->cb_tex, global_flags.width / 2, global_flags.height); frame->cr = clone_r8_texture(qf.resources->cr_tex, global_flags.width / 2, global_flags.height); frame->width = global_flags.width; frame->height = global_flags.height; frame->chroma_subsampling_x = 2; frame->chroma_subsampling_y = 1; frame->uploaded_ui_thread = RefCountedGLsync(GL_SYNC_GPU_COMMANDS_COMPLETE, /*flags=*/0); qf.display_decoded_func(move(frame)); } // Now JPEG encode it, and send it on to the stream. string jpeg = encode_jpeg_from_pbo(qf.resources->pbo_contents, global_flags.width, global_flags.height, move(qf.exif_data)); if (qf.flow_tex != 0) { compute_flow->release_texture(qf.flow_tex); } if (qf.type != QueuedFrame::FADED_INTERPOLATED) { interpolate->release_texture(qf.output_tex); interpolate->release_texture(qf.cbcr_tex); } AVPacketWithDeleter pkt = av_packet_alloc_unique(); pkt->stream_index = 0; pkt->data = (uint8_t *)jpeg.data(); pkt->size = jpeg.size(); pkt->flags = AV_PKT_FLAG_KEY; mux->add_packet(*pkt, qf.output_pts, qf.output_pts); last_frame = move(jpeg); add_audio_or_silence(qf); } else if (qf.type == QueuedFrame::REFRESH) { AVPacketWithDeleter pkt = av_packet_alloc_unique(); pkt->stream_index = 0; pkt->data = (uint8_t *)last_frame.data(); pkt->size = last_frame.size(); pkt->flags = AV_PKT_FLAG_KEY; mux->add_packet(*pkt, qf.output_pts, qf.output_pts); add_audio_or_silence(qf); // Definitely silence. } else if (qf.type == QueuedFrame::SILENCE) { add_silence(qf.output_pts, qf.silence_length_pts); } else { assert(false); } if (qf.display_func != nullptr) { qf.display_func(); } } } int VideoStream::write_packet2_thunk(void *opaque, uint8_t *buf, int buf_size, AVIODataMarkerType type, int64_t time) { VideoStream *video_stream = (VideoStream *)opaque; return video_stream->write_packet2(buf, buf_size, type, time); } int VideoStream::write_packet2(uint8_t *buf, int buf_size, AVIODataMarkerType type, int64_t time) { if (type == AVIO_DATA_MARKER_SYNC_POINT || type == AVIO_DATA_MARKER_BOUNDARY_POINT) { seen_sync_markers = true; } else if (type == AVIO_DATA_MARKER_UNKNOWN && !seen_sync_markers) { // We don't know if this is a keyframe or not (the muxer could // avoid marking it), so we just have to make the best of it. type = AVIO_DATA_MARKER_SYNC_POINT; } HTTPD::StreamID stream_id{ HTTPD::MAIN_STREAM, 0 }; if (type == AVIO_DATA_MARKER_HEADER) { stream_mux_header.append((char *)buf, buf_size); global_httpd->set_header(stream_id, stream_mux_header); } else { global_httpd->add_data(stream_id, (char *)buf, buf_size, type == AVIO_DATA_MARKER_SYNC_POINT, time, AVRational{ AV_TIME_BASE, 1 }); } return buf_size; } void VideoStream::add_silence(int64_t pts, int64_t length_pts) { // At 59.94, this will never quite add up (even discounting refresh frames, // which have unpredictable length), but hopefully, the player in the other // end should be able to stretch silence easily enough. long num_samples = lrint(length_pts * double(OUTPUT_FREQUENCY) / double(TIMEBASE)) * 2; uint8_t *zero = (uint8_t *)calloc(num_samples, sizeof(int32_t)); AVPacketWithDeleter pkt = av_packet_alloc_unique(); pkt->stream_index = 1; pkt->data = zero; pkt->size = num_samples * sizeof(int32_t); pkt->flags = AV_PKT_FLAG_KEY; mux->add_packet(*pkt, pts, pts); free(zero); } void VideoStream::add_audio_or_silence(const QueuedFrame &qf) { if (qf.audio.empty()) { int64_t frame_length = lrint(double(TIMEBASE) / global_flags.output_framerate); add_silence(qf.output_pts, frame_length); } else { AVPacketWithDeleter pkt = av_packet_alloc_unique(); pkt->stream_index = 1; pkt->data = (uint8_t *)qf.audio.data(); pkt->size = qf.audio.size(); pkt->flags = AV_PKT_FLAG_KEY; mux->add_packet(*pkt, qf.output_pts, qf.output_pts); } } nageru-2.3.0/futatabi/video_stream.h000066400000000000000000000154371450736322200174440ustar00rootroot00000000000000#ifndef _VIDEO_STREAM_H #define _VIDEO_STREAM_H 1 #include #include extern "C" { #include #include } #include "frame_on_disk.h" #include "jpeg_frame_view.h" #include "queue_spot_holder.h" #include "shared/mux.h" #include "shared/ref_counted_gl_sync.h" #include #include #include #include #include #include #include #include #include #include #include class ChromaSubsampler; class DISComputeFlow; class Interpolate; class QSurface; class QSurfaceFormat; class YCbCrConverter; class VideoStream { public: VideoStream(AVFormatContext *file_avctx); // nullptr if output to stream. ~VideoStream(); void start(); void stop(); void clear_queue(); // “display_func” is called after the frame has been calculated (if needed) // and has gone out to the stream. void schedule_original_frame(std::chrono::steady_clock::time_point, int64_t output_pts, std::function &&display_func, QueueSpotHolder &&queue_spot_holder, FrameOnDisk frame, const std::string &subtitle, bool include_audio); void schedule_faded_frame(std::chrono::steady_clock::time_point, int64_t output_pts, std::function &&display_func, QueueSpotHolder &&queue_spot_holder, FrameOnDisk frame1, FrameOnDisk frame2, float fade_alpha, const std::string &subtitle); // Always no audio. void schedule_interpolated_frame(std::chrono::steady_clock::time_point, int64_t output_pts, std::function)> &&display_func, QueueSpotHolder &&queue_spot_holder, FrameOnDisk frame1, FrameOnDisk frame2, float alpha, FrameOnDisk secondary_frame, // Empty = no secondary (fade) frame. float fade_alpha, const std::string &subtitle, bool include_audio); void schedule_refresh_frame(std::chrono::steady_clock::time_point, int64_t output_pts, std::function &&display_func, QueueSpotHolder &&queue_spot_holder, const std::string &subtitle); // Always no audio. void schedule_silence(std::chrono::steady_clock::time_point, int64_t output_pts, int64_t length_pts, QueueSpotHolder &&queue_spot_holder); private: struct QueuedFrame; FrameReader frame_reader; void encode_thread_func(); std::thread encode_thread; std::atomic should_quit{ false }; static int write_packet2_thunk(void *opaque, uint8_t *buf, int buf_size, AVIODataMarkerType type, int64_t time); int write_packet2(uint8_t *buf, int buf_size, AVIODataMarkerType type, int64_t time); void add_silence(int64_t pts, int64_t length_pts); void add_audio_or_silence(const QueuedFrame &qf); // Allocated at the very start; if we're empty, we start dropping frames // (so that we don't build up an infinite interpolation backlog). struct InterpolatedFrameResources { VideoStream *owner; // Used only for IFRReleaser, below. GLuint input_tex; // Layered (contains both input frames), Y'CbCr. GLuint gray_tex; // Same, but Y only. GLuint input_fbos[2]; // For rendering to the two layers of input_tex. // Destination textures and FBO if there is a fade. GLuint fade_y_output_tex, fade_cbcr_output_tex; GLuint fade_fbo; GLuint cb_tex, cr_tex; // Subsampled, final output. GLuint pbo; // For reading the data back. void *pbo_contents; // Persistently mapped. }; std::mutex queue_lock; std::deque> interpolate_resources; // Under . static constexpr size_t num_interpolate_slots = 15; // Should be larger than Player::max_queued_frames, or we risk mass-dropping frames. struct IFRReleaser { void operator()(InterpolatedFrameResources *ifr) const { if (ifr != nullptr) { std::lock_guard lock(ifr->owner->queue_lock); ifr->owner->interpolate_resources.emplace_back(ifr); } } }; using BorrowedInterpolatedFrameResources = std::unique_ptr; struct QueuedFrame { std::chrono::steady_clock::time_point local_pts; int64_t output_pts; enum Type { ORIGINAL, FADED, INTERPOLATED, FADED_INTERPOLATED, REFRESH, SILENCE } type; // For original frames only. Made move-only so we know explicitly // we don't copy these ~200 kB files around inadvertedly. std::unique_ptr encoded_jpeg; // For everything except original frames and silence. FrameOnDisk frame1; // For fades only (including fades against interpolated frames). FrameOnDisk secondary_frame; // For interpolated frames only. FrameOnDisk frame2; float alpha; BorrowedInterpolatedFrameResources resources; RefCountedGLsync fence; // Set when the interpolated image is read back to the CPU. std::chrono::steady_clock::time_point fence_created; GLuint flow_tex, output_tex, cbcr_tex; // Released in the receiving thread; not really used for anything else. flow_tex will typically even be from a previous frame. FrameOnDisk id; std::function display_func; // Called when the image is done decoding. std::function)> display_decoded_func; // Same, except for INTERPOLATED and FADED_INTERPOLATED. std::string subtitle; // Blank for none. std::string exif_data; // Blank for none. // Audio, in stereo interleaved 32-bit PCM. If empty and not of type SILENCE, one frame's worth of silence samples // is synthesized. std::string audio; // For silence frames only. int64_t silence_length_pts; QueueSpotHolder queue_spot_holder; }; std::deque frame_queue; // Under . std::condition_variable queue_changed; AVFormatContext *avctx; std::unique_ptr mux; // To HTTP, or to file. std::string stream_mux_header; // Only used in HTTP. bool seen_sync_markers = false; bool output_fast_forward; std::unique_ptr ycbcr_converter; std::unique_ptr ycbcr_semiplanar_converter; // Frame interpolation. std::unique_ptr compute_flow; std::unique_ptr interpolate, interpolate_no_split; std::unique_ptr chroma_subsampler; // Cached flow computation from previous frame, if any. GLuint last_flow_tex = 0; FrameOnDisk last_frame1, last_frame2; std::string last_frame; Mux::WithSubtitles with_subtitles; // true for streaming, false for export to file. }; #endif // !defined(_VIDEO_STREAM_H) nageru-2.3.0/futatabi/vis.cpp000066400000000000000000000013031450736322200161020ustar00rootroot00000000000000// Visualize a .flo file. #include "util.h" #include #include #include using namespace std; int main(int argc, char **argv) { if (argc != 3) { fprintf(stderr, "Usage: ./vis input.flo out.ppm\n"); abort(); } Flow flow = read_flow(argv[1]); FILE *fp = fopen(argv[2], "wb"); fprintf(fp, "P6\n%d %d\n255\n", flow.width, flow.height); for (unsigned y = 0; y < unsigned(flow.height); ++y) { for (unsigned x = 0; x < unsigned(flow.width); ++x) { float du = flow.flow[y * flow.width + x].du; float dv = flow.flow[y * flow.width + x].dv; uint8_t r, g, b; flow2rgb(du, dv, &r, &g, &b); putc(r, fp); putc(g, fp); putc(b, fp); } } fclose(fp); } nageru-2.3.0/futatabi/vs.vert000066400000000000000000000007501450736322200161340ustar00rootroot00000000000000#version 450 core #extension GL_ARB_shader_viewport_layer_array : require layout(location=0) in vec2 position; out vec3 tc; void main() { // The result of glOrtho(0.0, 1.0, 0.0, 1.0, 0.0, 1.0) is: // // 2.000 0.000 0.000 -1.000 // 0.000 2.000 0.000 -1.000 // 0.000 0.000 -2.000 -1.000 // 0.000 0.000 0.000 1.000 gl_Position = vec4(2.0 * position.x - 1.0, 2.0 * position.y - 1.0, -1.0, 1.0); tc.xy = position; tc.z = gl_InstanceID; gl_Layer = gl_InstanceID; } nageru-2.3.0/futatabi/ycbcr_converter.cpp000066400000000000000000000233441450736322200205030ustar00rootroot00000000000000#include "ycbcr_converter.h" #include "exif_parser.h" #include "flags.h" #include "jpeg_frame.h" #include #include #include #include using namespace movit; using namespace std; namespace { void setup_outputs(YCbCrConverter::OutputMode output_mode, const ImageFormat &output_format, const YCbCrFormat &ycbcr_output_format, EffectChain *chain) { if (output_mode == YCbCrConverter::OUTPUT_TO_RGBA) { chain->add_output(output_format, OUTPUT_ALPHA_FORMAT_POSTMULTIPLIED); chain->set_output_origin(OUTPUT_ORIGIN_BOTTOM_LEFT); } else if (output_mode == YCbCrConverter::OUTPUT_TO_SEMIPLANAR) { chain->add_ycbcr_output(output_format, OUTPUT_ALPHA_FORMAT_POSTMULTIPLIED, ycbcr_output_format, YCBCR_OUTPUT_SPLIT_Y_AND_CBCR); chain->set_output_origin(OUTPUT_ORIGIN_TOP_LEFT); } else { assert(output_mode == YCbCrConverter::OUTPUT_TO_DUAL_YCBCR); // One full Y'CbCr texture (for interpolation), one that's just Y (throwing away the // Cb and Cr channels). The second copy is sort of redundant, but it's the easiest way // of getting the gray data into a layered texture. chain->add_ycbcr_output(output_format, OUTPUT_ALPHA_FORMAT_POSTMULTIPLIED, ycbcr_output_format); chain->add_ycbcr_output(output_format, OUTPUT_ALPHA_FORMAT_POSTMULTIPLIED, ycbcr_output_format); chain->set_output_origin(OUTPUT_ORIGIN_TOP_LEFT); } } } // namespace YCbCrConverter::YCbCrConverter(YCbCrConverter::OutputMode output_mode, ResourcePool *resource_pool) { ImageFormat inout_format; inout_format.color_space = COLORSPACE_sRGB; inout_format.gamma_curve = GAMMA_sRGB; ycbcr_format.luma_coefficients = YCBCR_REC_709; ycbcr_format.num_levels = 256; ycbcr_format.chroma_subsampling_x = 2; ycbcr_format.chroma_subsampling_y = 1; ycbcr_format.cb_x_position = 0.0f; // H.264 -- _not_ JPEG, even though our input is MJPEG-encoded ycbcr_format.cb_y_position = 0.5f; // Irrelevant. ycbcr_format.cr_x_position = 0.0f; ycbcr_format.cr_y_position = 0.5f; // This is a hack. Even though we're sending MJPEG around, which is // full-range, it's mostly transporting signals from limited-range // sources with no conversion, so we ought to have had false here. // However, in the off chance that we're actually getting real MJPEG, // we don't want to crush its blacks (or whites) by clamping. All of // our processing is fades or other linear operations, so if we're in // limited-range input, we'll stay in limited-range output. (Fading // between limited-range and full-range sources will be broken, // of course.) There will be some slight confusion in the parts of the // algorithms dealing with RGB, but they're small and we'll manage. ycbcr_format.full_range = false; YCbCrFormat ycbcr_output_format = ycbcr_format; ycbcr_output_format.chroma_subsampling_x = 1; // Planar Y'CbCr decoding chain. planar_chain.reset(new EffectChain(global_flags.width, global_flags.height, resource_pool)); ycbcr_planar_input = (YCbCrInput *)planar_chain->add_input(new YCbCrInput(inout_format, ycbcr_format, global_flags.width, global_flags.height, YCBCR_INPUT_PLANAR)); setup_outputs(output_mode, inout_format, ycbcr_output_format, planar_chain.get()); planar_chain->set_dither_bits(8); planar_chain->finalize(); // Semiplanar Y'CbCr decoding chain (for images coming from VA-API). semiplanar_chain.reset(new EffectChain(global_flags.width, global_flags.height, resource_pool)); ycbcr_semiplanar_input = (YCbCrInput *)semiplanar_chain->add_input(new YCbCrInput(inout_format, ycbcr_format, global_flags.width, global_flags.height, YCBCR_INPUT_SPLIT_Y_AND_CBCR)); setup_outputs(output_mode, inout_format, ycbcr_output_format, semiplanar_chain.get()); semiplanar_chain->set_dither_bits(8); semiplanar_chain->finalize(); // Fade chains. These include white balance adjustments. for (bool first_input_is_semiplanar : { false, true }) { for (bool second_input_is_semiplanar : { false, true }) { FadeChain &fade_chain = fade_chains[first_input_is_semiplanar][second_input_is_semiplanar]; fade_chain.chain.reset(new EffectChain(global_flags.width, global_flags.height, resource_pool)); fade_chain.input[0] = (YCbCrInput *)fade_chain.chain->add_input( new YCbCrInput(inout_format, ycbcr_format, global_flags.width, global_flags.height, first_input_is_semiplanar ? YCBCR_INPUT_SPLIT_Y_AND_CBCR : YCBCR_INPUT_PLANAR)); fade_chain.input[1] = (YCbCrInput *)fade_chain.chain->add_input( new YCbCrInput(inout_format, ycbcr_format, global_flags.width, global_flags.height, second_input_is_semiplanar ? YCBCR_INPUT_SPLIT_Y_AND_CBCR : YCBCR_INPUT_PLANAR)); fade_chain.wb_effect[0] = (WhiteBalanceEffect *)fade_chain.chain->add_effect( new WhiteBalanceEffect, fade_chain.input[0]); fade_chain.wb_effect[1] = (WhiteBalanceEffect *)fade_chain.chain->add_effect( new WhiteBalanceEffect, fade_chain.input[1]); fade_chain.mix_effect = (MixEffect *)fade_chain.chain->add_effect( new MixEffect, fade_chain.wb_effect[0], fade_chain.wb_effect[1]); setup_outputs(output_mode, inout_format, ycbcr_output_format, fade_chain.chain.get()); fade_chain.chain->set_dither_bits(8); fade_chain.chain->finalize(); } } // Fade from interleaved chain (ie., first input is interleaved, since it comes // directly from the GPU anyway). for (bool second_input_is_semiplanar : { false, true }) { FadeChain &fade_chain = interleaved_fade_chains[second_input_is_semiplanar]; fade_chain.chain.reset(new EffectChain(global_flags.width, global_flags.height, resource_pool)); ycbcr_format.chroma_subsampling_x = 1; fade_chain.input[0] = (YCbCrInput *)fade_chain.chain->add_input( new YCbCrInput(inout_format, ycbcr_format, global_flags.width, global_flags.height, YCBCR_INPUT_INTERLEAVED)); ycbcr_format.chroma_subsampling_x = 2; fade_chain.input[1] = (YCbCrInput *)fade_chain.chain->add_input( new YCbCrInput(inout_format, ycbcr_format, global_flags.width, global_flags.height, second_input_is_semiplanar ? YCBCR_INPUT_SPLIT_Y_AND_CBCR : YCBCR_INPUT_PLANAR)); fade_chain.wb_effect[0] = (WhiteBalanceEffect *)fade_chain.chain->add_effect( new WhiteBalanceEffect, fade_chain.input[0]); fade_chain.wb_effect[1] = (WhiteBalanceEffect *)fade_chain.chain->add_effect( new WhiteBalanceEffect, fade_chain.input[1]); fade_chain.mix_effect = (MixEffect *)fade_chain.chain->add_effect( new MixEffect, fade_chain.wb_effect[0], fade_chain.wb_effect[1]); setup_outputs(output_mode, inout_format, ycbcr_output_format, fade_chain.chain.get()); fade_chain.chain->set_dither_bits(8); fade_chain.chain->finalize(); } } EffectChain *YCbCrConverter::prepare_chain_for_conversion(shared_ptr frame) { if (frame->is_semiplanar) { setup_input_for_frame(frame, ycbcr_format, ycbcr_semiplanar_input); return semiplanar_chain.get(); } else { setup_input_for_frame(frame, ycbcr_format, ycbcr_planar_input); return planar_chain.get(); } } EffectChain *YCbCrConverter::prepare_chain_for_fade(shared_ptr frame, shared_ptr secondary_frame, float fade_alpha) { const FadeChain &fade_chain = fade_chains[frame->is_semiplanar][secondary_frame->is_semiplanar]; setup_input_for_frame(frame, ycbcr_format, fade_chain.input[0]); setup_input_for_frame(secondary_frame, ycbcr_format, fade_chain.input[1]); bool ok = fade_chain.mix_effect->set_float("strength_first", 1.0f - fade_alpha); ok |= fade_chain.mix_effect->set_float("strength_second", fade_alpha); RGBTriplet neutral_color0 = get_neutral_color(frame->exif_data); RGBTriplet neutral_color1 = get_neutral_color(secondary_frame->exif_data); ok |= fade_chain.wb_effect[0]->set_vec3("neutral_color", (float *)&neutral_color0); ok |= fade_chain.wb_effect[1]->set_vec3("neutral_color", (float *)&neutral_color1); assert(ok); return fade_chain.chain.get(); } EffectChain *YCbCrConverter::prepare_chain_for_fade_from_texture(GLuint tex, RGBTriplet tex_neutral_color, unsigned width, unsigned height, std::shared_ptr secondary_frame, float fade_alpha) { const FadeChain &fade_chain = interleaved_fade_chains[secondary_frame->is_semiplanar]; { YCbCrFormat format_copy = ycbcr_format; format_copy.chroma_subsampling_x = 1; format_copy.chroma_subsampling_y = 1; fade_chain.input[0]->change_ycbcr_format(format_copy); fade_chain.input[0]->set_width(width); // Doesn't really matter. fade_chain.input[0]->set_height(height); fade_chain.input[0]->set_texture_num(0, tex); glTextureParameteri(tex, GL_TEXTURE_MIN_FILTER, GL_LINEAR); glTextureParameteri(tex, GL_TEXTURE_MAG_FILTER, GL_LINEAR); glTextureParameteri(tex, GL_TEXTURE_WRAP_S, GL_CLAMP_TO_BORDER); glTextureParameteri(tex, GL_TEXTURE_WRAP_T, GL_CLAMP_TO_BORDER); } setup_input_for_frame(secondary_frame, ycbcr_format, fade_chain.input[1]); bool ok = fade_chain.mix_effect->set_float("strength_first", 1.0f - fade_alpha); ok |= fade_chain.mix_effect->set_float("strength_second", fade_alpha); RGBTriplet neutral_color1 = get_neutral_color(secondary_frame->exif_data); ok |= fade_chain.wb_effect[0]->set_vec3("neutral_color", (float *)&tex_neutral_color); ok |= fade_chain.wb_effect[1]->set_vec3("neutral_color", (float *)&neutral_color1); assert(ok); return fade_chain.chain.get(); } void setup_input_for_frame(shared_ptr frame, const YCbCrFormat &ycbcr_format, YCbCrInput *input) { YCbCrFormat format_copy = ycbcr_format; format_copy.chroma_subsampling_x = frame->chroma_subsampling_x; format_copy.chroma_subsampling_y = frame->chroma_subsampling_y; input->change_ycbcr_format(format_copy); input->set_width(frame->width); input->set_height(frame->height); input->set_texture_num(0, *frame->y); if (frame->is_semiplanar) { input->set_texture_num(1, *frame->cbcr); } else { input->set_texture_num(1, *frame->cb); input->set_texture_num(2, *frame->cr); } } nageru-2.3.0/futatabi/ycbcr_converter.h000066400000000000000000000042041450736322200201420ustar00rootroot00000000000000#ifndef _YCBCR_CONVERTER_H #define _YCBCR_CONVERTER_H 1 #include #include #include #include namespace movit { class EffectChain; class MixEffect; class ResourcePool; class WhiteBalanceEffect; struct YCbCrFormat; } // namespace movit struct Frame; class YCbCrConverter { public: enum OutputMode { OUTPUT_TO_RGBA, // One texture (bottom-left origin): RGBA OUTPUT_TO_SEMIPLANAR, // Two textures (top-left origin): Y, CbCr OUTPUT_TO_DUAL_YCBCR // Two textures (top-left origin): Y'CbCr, Y'CbCr }; YCbCrConverter(OutputMode output_mode, movit::ResourcePool *resource_pool); // Returns the appropriate chain for rendering. Fades apply white balance, // straight-up conversion does not. movit::EffectChain *prepare_chain_for_conversion(std::shared_ptr frame); movit::EffectChain *prepare_chain_for_fade(std::shared_ptr frame, std::shared_ptr secondary_frame, float fade_alpha); // must be interleaved Y'CbCr. movit::EffectChain *prepare_chain_for_fade_from_texture(GLuint tex, movit::RGBTriplet neutral_color, unsigned width, unsigned height, std::shared_ptr secondary_frame, float fade_alpha); private: movit::YCbCrFormat ycbcr_format; // Effectively only converts from 4:2:2 (or 4:2:0, or whatever) to 4:4:4. // TODO: Have a separate version with ResampleEffect, for scaling? std::unique_ptr planar_chain, semiplanar_chain; movit::YCbCrInput *ycbcr_planar_input, *ycbcr_semiplanar_input; // These do fades, parametrized on whether the two inputs are planar // or semiplanar. struct FadeChain { std::unique_ptr chain; movit::YCbCrInput *input[2]; movit::WhiteBalanceEffect *wb_effect[2]; movit::MixEffect *mix_effect; }; FadeChain fade_chains[2][2]; // These do fades, where the first input is interleaved and the second is // either planar or semiplanar. FadeChain interleaved_fade_chains[2]; }; // TODO: make private void setup_input_for_frame(std::shared_ptr frame, const movit::YCbCrFormat &ycbcr_format, movit::YCbCrInput *input); #endif // !defined(_YCBCR_CONVERTER_H) nageru-2.3.0/meson.build000066400000000000000000000375441450736322200151600ustar00rootroot00000000000000project('nageru', 'cpp', default_options: ['buildtype=debugoptimized'], version: '2.3.0') cxx = meson.get_compiler('cpp') qt5 = import('qt5') protoc = find_program('protoc') embedded_bmusb = get_option('embedded_bmusb') alsadep = dependency('alsa') bmusbdep = dependency('bmusb', required: not embedded_bmusb) dldep = cxx.find_library('dl') eigendep = dependency('eigen3') epoxydep = dependency('epoxy') libavcodecdep = dependency('libavcodec') libavformatdep = dependency('libavformat') libswresampledep = dependency('libswresample') libavutildep = dependency('libavutil') libdrmdep = dependency('libdrm') libjpegdep = dependency('libjpeg') libswscaledep = dependency('libswscale') libusbdep = dependency('libusb-1.0') luajitdep = dependency('luajit') movitdep = dependency('movit') protobufdep = dependency('protobuf') qt5deps = dependency('qt5', modules: ['Core', 'Gui', 'Widgets', 'OpenGLExtensions', 'OpenGL', 'Network']) sdl2_imagedep = dependency('SDL2_image', required: false) sdl2dep = dependency('sdl2', required: false) srtdep = dependency('srt', required: false) svtav1dep = dependency('SvtAv1Enc', required: false, version: '>=1.5.0') sqlite3dep = dependency('sqlite3') threaddep = dependency('threads') vadrmdep = dependency('libva-drm') vax11dep = dependency('libva-x11') x11dep = dependency('x11') x264dep = dependency('x264') zitaresamplerdep = cxx.find_library('zita-resampler') # Use lld if we can; it links a lot faster than ld.bfd or gold. code = '''#include int main() { printf("Hello, world!\n"); return 0; } ''' if cxx.links(code, args: '-fuse-ld=lld', name: 'check for LLD') add_project_link_arguments('-fuse-ld=lld', language: 'cpp') endif # Add the right MOVIT_SHADER_DIR definition. movit_shader_dir = movitdep.get_pkgconfig_variable('shaderdir') add_project_arguments('-DMOVIT_SHADER_DIR="' + movit_shader_dir + '"', language: 'cpp') # Make the Nageru version available as a #define. add_project_arguments('-DNAGERU_VERSION="' + meson.project_version() + '"', language: 'cpp') # Make the prefix (e.g. /usr/local) available as a #define. add_project_arguments('-DPREFIX="' + get_option('prefix') + '"', language: 'cpp') # This needs to be done before declaring any build targets. if get_option('cef_dir') != '' add_project_arguments('-DHAVE_CEF=1', language: 'cpp') endif if srtdep.found() # NOTE: Seemingly there's no way to figure out if we have OpenSSL libsrt # or gnutls libsrt, so we cannot check license compatibility here. add_project_arguments('-DHAVE_SRT=1', language: 'cpp') endif if svtav1dep.found() add_project_arguments('-DHAVE_AV1=1', language: 'cpp') endif top_include = include_directories('.') subdir('shared') # Nageru. (Not a subdir() because we don't want the output in nageru/nageru.) nageru_srcs = [] nageru_deps = [shareddep, qt5deps, libjpegdep, movitdep, protobufdep, vax11dep, vadrmdep, x11dep, libavformatdep, libswresampledep, libavcodecdep, libavutildep, libswscaledep, libusbdep, luajitdep, dldep, x264dep, svtav1dep, alsadep, zitaresamplerdep, threaddep, eigendep, srtdep, libdrmdep] nageru_include_dirs = [include_directories('nageru')] nageru_link_with = [] nageru_build_rpath = '' nageru_install_rpath = '' kaeru_link_with = [] kaeru_extra_deps = [] # CEF. exe_dir = join_paths(get_option('prefix'), 'lib/nageru') cef_dir = get_option('cef_dir') cef_build_type = get_option('cef_build_type') have_cef = (cef_dir != '') if have_cef # This is done in the top-level file; just kept here for reference. # add_project_arguments('-DHAVE_CEF=1', language: 'cpp') system_cef = (cef_build_type == 'system') if system_cef cef_lib_dir = cef_dir cef_resource_dir = cef_dir else cef_lib_dir = join_paths(cef_dir, cef_build_type) cef_resource_dir = join_paths(cef_dir, 'Resources') nageru_include_dirs += include_directories(cef_dir) nageru_include_dirs += include_directories(join_paths(cef_dir, 'include')) nageru_build_rpath = cef_lib_dir nageru_install_rpath = '$ORIGIN/' endif # CEF wrapper library; not built as part of the CEF binary distribution, # but should be if CEF is installed as a system library. if system_cef cefdlldep = cxx.find_library('cef_dll_wrapper') nageru_deps += cefdlldep else cmake = find_program('cmake') cef_compile_script = find_program('nageru/scripts/compile_cef_dll_wrapper.sh') cef_dll_target = custom_target('libcef_dll_wrapper', input: join_paths(cef_dir, 'libcef_dll/CMakeLists.txt'), output: ['libcef_dll_wrapper.a', 'cef-stamp'], command: [cef_compile_script, '@BUILD_DIR@', cef_dir, cmake, '@OUTPUT@']) # Putting the .a in sources seemingly hits a bug where the .a files get sorted # in the wrong order. This is a workaround; see # https://github.com/mesonbuild/meson/issues/3613#issuecomment-408276296 . cefdlldep = declare_dependency(sources: cef_dll_target[1], link_args: cef_dll_target.full_path()) nageru_deps += cefdlldep endif cef_libs = ['libEGL.so', 'libGLESv2.so', 'snapshot_blob.bin', 'v8_context_snapshot.bin'] cef_resources = ['resources.pak', 'chrome_100_percent.pak', 'chrome_200_percent.pak'] if not get_option('cef_no_icudtl') cef_resources += ['icudtl.dat'] endif if cef_build_type != 'system' cef_libs += ['libcef.so', 'libEGL.so', 'libGLESv2.so', 'libvk_swiftshader.so', 'libvulkan.so.1', 'vk_swiftshader_icd.json'] endif # Symlink the files into the build directory, so that running nageru without ninja install works. run_command('mkdir', '-p', join_paths(meson.current_build_dir(), 'locales/'), check: true) foreach file : cef_libs run_command('ln', '-sf', join_paths(cef_lib_dir, file), meson.current_build_dir(), check: true) install_data(join_paths(cef_lib_dir, file), install_dir: exe_dir) endforeach foreach file : cef_resources run_command('ln', '-sf', join_paths(cef_resource_dir, file), meson.current_build_dir(), check: true) install_data(join_paths(cef_resource_dir, file), install_dir: exe_dir) endforeach run_command('ln', '-sf', join_paths(cef_resource_dir, 'locales/en-US.pak'), join_paths(meson.current_build_dir(), 'locales/'), check: true) install_data(join_paths(cef_resource_dir, 'locales/en-US.pak'), install_dir: join_paths(exe_dir, 'locales')) # NOTE: We link against libcef.so in the local directory, _not_ in the CEF directory, # since upstream CEF searches for icudtl.dat in whatever path dladdr() says libcef.so # comes from, and the upstream CEF tarballs have libcef.so and icudtl.dat in different # directories. Thus, get both from the local symlinks we just created. cefdep = cxx.find_library('cef', dirs: meson.current_build_dir()) nageru_deps += cefdep endif # bmusb. if embedded_bmusb bmusb_dir = include_directories('nageru/bmusb') nageru_include_dirs += bmusb_dir bmusb = static_library('bmusb', 'nageru/bmusb/bmusb.cpp', 'nageru/bmusb/fake_capture.cpp', dependencies: [libusbdep], include_directories: [bmusb_dir]) nageru_link_with += bmusb kaeru_link_with += bmusb else nageru_deps += bmusbdep kaeru_extra_deps += bmusbdep endif # Protobuf compilation. gen = generator(protoc, \ output : ['@BASENAME@.pb.cc', '@BASENAME@.pb.h'], arguments : ['--proto_path=@CURRENT_SOURCE_DIR@/nageru', '--cpp_out=@BUILD_DIR@', '-I@CURRENT_SOURCE_DIR@/shared', '@INPUT@']) proto_generated = gen.process(['nageru/state.proto', 'nageru/json.proto', 'nageru/nageru_midi_mapping.proto']) protobuf_lib = static_library('nageru_protobufs', proto_generated, dependencies: nageru_deps, include_directories: nageru_include_dirs) protobuf_hdrs = declare_dependency(sources: proto_generated) nageru_link_with += protobuf_lib # Preprocess Qt as needed. qt_files = qt5.preprocess( moc_headers: ['nageru/analyzer.h', 'nageru/clickable_label.h', 'nageru/compression_reduction_meter.h', 'nageru/correlation_meter.h', 'nageru/ellipsis_label.h', 'nageru/glwidget.h', 'nageru/input_mapping_dialog.h', 'nageru/lrameter.h', 'nageru/mainwindow.h', 'nageru/midi_mapping_dialog.h', 'nageru/nonlinear_fader.h', 'nageru/vumeter.h', 'nageru/rgb_histogram.h'], ui_files: ['nageru/analyzer.ui', 'nageru/audio_expanded_view.ui', 'nageru/audio_miniview.ui', 'nageru/display.ui', 'nageru/input_mapping.ui', 'nageru/mainwindow.ui', 'nageru/midi_mapping.ui'], dependencies: qt5deps) # Qt objects. nageru_srcs += ['nageru/glwidget.cpp', 'nageru/mainwindow.cpp', 'nageru/vumeter.cpp', 'nageru/lrameter.cpp', 'nageru/compression_reduction_meter.cpp', 'nageru/correlation_meter.cpp', 'nageru/analyzer.cpp', 'nageru/input_mapping_dialog.cpp', 'nageru/midi_mapping_dialog.cpp', 'nageru/nonlinear_fader.cpp', 'nageru/context_menus.cpp', 'nageru/vu_common.cpp', 'nageru/piecewise_interpolator.cpp', 'nageru/midi_mapper.cpp', 'nageru/rgb_histogram.cpp'] # Auxiliary objects used for nearly everything. aux_srcs = ['nageru/flags.cpp'] aux = static_library('aux', aux_srcs, dependencies: nageru_deps, include_directories: nageru_include_dirs) nageru_link_with += aux # Audio objects. audio_mixer_srcs = ['nageru/audio_mixer.cpp', 'nageru/alsa_input.cpp', 'nageru/alsa_pool.cpp', 'nageru/ebu_r128_proc.cc', 'nageru/stereocompressor.cpp', 'nageru/resampling_queue.cpp', 'nageru/flags.cpp', 'nageru/correlation_measurer.cpp', 'nageru/filter.cpp', 'nageru/input_mapping.cpp'] audio = static_library('audio', audio_mixer_srcs, dependencies: [nageru_deps, protobuf_hdrs], include_directories: nageru_include_dirs) nageru_link_with += audio # Mixer objects. nageru_srcs += ['nageru/chroma_subsampler.cpp', 'nageru/v210_converter.cpp', 'nageru/mixer.cpp', 'nageru/pbo_frame_allocator.cpp', 'nageru/theme.cpp', 'nageru/scene.cpp', 'nageru/image_input.cpp', 'nageru/alsa_output.cpp', 'nageru/timecode_renderer.cpp', 'nageru/tweaked_inputs.cpp', 'nageru/mjpeg_encoder.cpp', 'nageru/srt_metrics.cpp'] # Streaming and encoding objects (largely the set that is shared between Nageru and Kaeru). stream_srcs = ['nageru/quicksync_encoder.cpp', 'nageru/video_encoder.cpp', 'nageru/x264_encoder.cpp', 'nageru/x264_dynamic.cpp', 'nageru/x264_speed_control.cpp', 'nageru/audio_encoder.cpp', 'nageru/ffmpeg_util.cpp', 'nageru/ffmpeg_capture.cpp', 'nageru/print_latency.cpp', 'nageru/basic_stats.cpp', 'nageru/ref_counted_frame.cpp', 'nageru/v4l_output.cpp'] if svtav1dep.found() stream_srcs += 'nageru/av1_encoder.cpp' endif stream = static_library('stream', stream_srcs, dependencies: nageru_deps, include_directories: nageru_include_dirs) nageru_link_with += stream # DeckLink. decklink_dir = include_directories('nageru/decklink', is_system: true) decklink_lib = static_library('decklink', 'nageru/decklink/DeckLinkAPIDispatch.cpp', include_directories: decklink_dir, cpp_args: '-w') nageru_link_with += decklink_lib nageru_srcs += ['nageru/decklink_capture.cpp', 'nageru/decklink_util.cpp', 'nageru/decklink_output.cpp'] nageru_include_dirs += decklink_dir # CEF input. if have_cef nageru_srcs += ['nageru/nageru_cef_app.cpp', 'nageru/cef_capture.cpp'] endif nageru_srcs += qt_files nageru_srcs += proto_generated # Shaders needed at runtime. shaders = ['nageru/cbcr_subsample.vert', 'nageru/cbcr_subsample.frag', 'nageru/uyvy_subsample.vert', 'nageru/uyvy_subsample.frag', 'nageru/v210_subsample.comp', 'nageru/timecode.vert', 'nageru/timecode.frag', 'nageru/timecode_10bit.frag'] foreach shader : shaders run_command('ln', '-sf', join_paths(meson.current_source_dir(), shader), meson.current_build_dir(), check: true) endforeach nageru_shader_srcs = bin2h_gen.process(shaders) nageru_srcs += nageru_shader_srcs # Everything except main.cpp. (We do this because if you specify a .cpp file in # both Nageru and Kaeru, it gets compiled twice. In the older Makefiles, Kaeru # depended on a smaller set of objects.) core = static_library('core', nageru_srcs, dependencies: nageru_deps, include_directories: nageru_include_dirs) nageru_link_with += core # Nageru executable; it goes into /usr/lib/nageru since CEF files go there, too # (we can't put them straight into /usr/bin). executable('nageru', 'nageru/main.cpp', dependencies: nageru_deps, include_directories: nageru_include_dirs, link_with: nageru_link_with, build_rpath: nageru_build_rpath, install_rpath: nageru_install_rpath, install: true, install_dir: exe_dir ) meson.add_install_script('nageru/scripts/setup_nageru_symlink.sh') # Kaeru executable. executable('kaeru', 'nageru/kaeru.cpp', dependencies: [nageru_deps, kaeru_extra_deps], include_directories: nageru_include_dirs, link_with: [stream, aux, kaeru_link_with], install: true) # Audio mixer microbenchmark. executable('benchmark_audio_mixer', 'nageru/benchmark_audio_mixer.cpp', dependencies: nageru_deps, include_directories: nageru_include_dirs, link_with: [audio, aux]) # These are needed for a default run. data_files = ['nageru/theme.lua', 'nageru/simple.lua', 'nageru/bg.jpeg', 'nageru/akai_midimix.midimapping', 'futatabi/behringer_cmd_pl1.midimapping'] install_data(data_files, install_dir: join_paths(get_option('prefix'), 'share/nageru')) foreach file : data_files run_command('ln', '-sf', join_paths(meson.current_source_dir(), file), meson.current_build_dir(), check: true) endforeach # Futatabi. (Not a subdir() because we don't want the output in nageru/nageru.) # Protobuf compilation. gen = generator(protoc, \ output : ['@BASENAME@.pb.cc', '@BASENAME@.pb.h'], arguments : ['--proto_path=@CURRENT_SOURCE_DIR@/futatabi', '--cpp_out=@BUILD_DIR@', '-I@CURRENT_SOURCE_DIR@/shared', '@INPUT@']) proto_generated = gen.process('futatabi/state.proto', 'futatabi/frame.proto', 'futatabi/futatabi_midi_mapping.proto') # Preprocess Qt as needed. moc_files = qt5.preprocess( moc_headers: ['futatabi/mainwindow.h', 'futatabi/jpeg_frame_view.h', 'futatabi/clip_list.h', 'futatabi/midi_mapping_dialog.h'], ui_files: ['futatabi/mainwindow.ui', 'futatabi/midi_mapping.ui'], qresources: ['futatabi/mainwindow.qrc'], dependencies: qt5deps) # Flow objects. futatabi_srcs = ['futatabi/flow.cpp', 'futatabi/gpu_timers.cpp'] # All the other files. futatabi_srcs += ['futatabi/main.cpp', 'futatabi/player.cpp', 'futatabi/video_stream.cpp', 'futatabi/chroma_subsampler.cpp'] futatabi_srcs += ['futatabi/vaapi_jpeg_decoder.cpp', 'futatabi/db.cpp', 'futatabi/ycbcr_converter.cpp', 'futatabi/flags.cpp'] futatabi_srcs += ['futatabi/mainwindow.cpp', 'futatabi/jpeg_frame_view.cpp', 'futatabi/clip_list.cpp', 'futatabi/frame_on_disk.cpp'] futatabi_srcs += ['futatabi/export.cpp', 'futatabi/midi_mapper.cpp', 'futatabi/midi_mapping_dialog.cpp'] futatabi_srcs += ['futatabi/exif_parser.cpp', 'futatabi/pbo_pool.cpp'] futatabi_srcs += moc_files futatabi_srcs += proto_generated # Shaders needed at runtime. shaders = ['futatabi/chroma_subsample.vert', 'futatabi/densify.vert', 'futatabi/equations.vert', 'futatabi/hole_fill.vert', 'futatabi/motion_search.vert', 'futatabi/sor.vert', 'futatabi/splat.vert', 'futatabi/vs.vert'] shaders += ['futatabi/add_base_flow.frag', 'futatabi/blend.frag', 'futatabi/chroma_subsample.frag', 'futatabi/densify.frag', 'futatabi/derivatives.frag', 'futatabi/diffusivity.frag', 'futatabi/equations.frag', 'futatabi/gray.frag', 'futatabi/hole_blend.frag', 'futatabi/hole_fill.frag', 'futatabi/motion_search.frag', 'futatabi/prewarp.frag', 'futatabi/resize_flow.frag', 'futatabi/sobel.frag', 'futatabi/sor.frag', 'futatabi/splat.frag'] foreach shader : shaders run_command('ln', '-sf', join_paths(meson.current_source_dir(), shader), meson.current_build_dir(), check: true) endforeach futatabi_shader_srcs = bin2h_gen.process(shaders) futatabi_srcs += futatabi_shader_srcs executable('futatabi', futatabi_srcs, dependencies: [shareddep, qt5deps, libjpegdep, movitdep, libmicrohttpddep, protobufdep, sqlite3dep, vax11dep, vadrmdep, x11dep, threaddep, libavformatdep, libavcodecdep, libavutildep, libswscaledep, eigendep], link_with: shared, include_directories: [include_directories('futatabi')], install: true) # Test binaries for the optical flow code. if sdl2dep.found() and sdl2_imagedep.found() executable('flow', 'futatabi/flow_main.cpp', 'futatabi/flow.cpp', 'futatabi/gpu_timers.cpp', futatabi_shader_srcs, dependencies: [shareddep, epoxydep, sdl2dep, sdl2_imagedep]) endif executable('eval', 'futatabi/eval.cpp', 'futatabi/util.cpp') executable('vis', 'futatabi/vis.cpp', 'futatabi/util.cpp') nageru-2.3.0/meson_options.txt000066400000000000000000000012051450736322200164340ustar00rootroot00000000000000option('embedded_bmusb', type: 'boolean', value: false, description: 'Use bmusb from the bmusb/ git submodule instead of from the system') # Set this to build with CEF. # E.g.: meson configure -Dcef_dir=/home/sesse/cef_binary_3.3282.1734.g8f26fe0_linux64 option('cef_dir', type: 'string', description: 'If not empty, build against CEF in this directory') option('cef_build_type', type: 'string', value: 'Release', description: 'CEF version to build against (Release or Debug, or “system” for a system-installed)') option('cef_no_icudtl', type: 'boolean', value: false, description: 'Set to true if the CEF installation has no icudtl.dat.') nageru-2.3.0/nageru/000077500000000000000000000000001450736322200142625ustar00rootroot00000000000000nageru-2.3.0/nageru/Nageru-Grafana.json000066400000000000000000001173761450736322200177520ustar00rootroot00000000000000{ "__inputs": [ { "name": "DS_EXAMPLE", "label": "Data source", "description": "", "type": "datasource", "pluginId": "prometheus", "pluginName": "Prometheus" } ], "__requires": [ { "type": "grafana", "id": "grafana", "name": "Grafana", "version": "5.1.0" }, { "type": "panel", "id": "graph", "name": "Graph", "version": "5.0.0" }, { "type": "panel", "id": "heatmap", "name": "Heatmap", "version": "5.0.0" }, { "type": "datasource", "id": "prometheus", "name": "Prometheus", "version": "5.0.0" }, { "type": "panel", "id": "singlestat", "name": "Singlestat", "version": "5.0.0" } ], "annotations": { "list": [ { "builtIn": 1, "datasource": "-- Grafana --", "enable": true, "hide": true, "iconColor": "rgba(0, 211, 255, 1)", "name": "Annotations & Alerts", "type": "dashboard" } ] }, "editable": true, "gnetId": null, "graphTooltip": 0, "id": null, "iteration": 1524926525808, "links": [], "panels": [ { "collapsed": false, "gridPos": { "h": 1, "w": 24, "x": 0, "y": 0 }, "id": 63, "panels": [], "repeat": "instance", "title": "$instance", "type": "row" }, { "cacheTimeout": null, "colorBackground": false, "colorValue": false, "colors": [ "rgba(245, 54, 54, 0.9)", "rgba(237, 129, 40, 0.89)", "rgba(50, 172, 45, 0.97)" ], "datasource": "${DS_EXAMPLE}", "format": "s", "gauge": { "maxValue": 100, "minValue": 0, "show": false, "thresholdLabels": false, "thresholdMarkers": true }, "gridPos": { "h": 4, "w": 4, "x": 0, "y": 1 }, "id": 37, "interval": null, "links": [], "mappingType": 1, "mappingTypes": [ { "name": "value to text", "value": 1 }, { "name": "range to text", "value": 2 } ], "maxDataPoints": 100, "nullPointMode": "connected", "nullText": null, "postfix": "", "postfixFontSize": "50%", "prefix": "", "prefixFontSize": "50%", "rangeMaps": [ { "from": "null", "text": "N/A", "to": "null" } ], "repeat": null, "sparkline": { "fillColor": "rgba(31, 118, 189, 0.18)", "full": false, "lineColor": "rgb(31, 120, 193)", "show": false }, "tableColumn": "", "targets": [ { "expr": "time() - nageru_start_time_seconds{instance=~\"$instance\"}", "format": "time_series", "hide": false, "intervalFactor": 2, "legendFormat": "", "refId": "A", "step": 240 } ], "thresholds": "", "title": "Nageru uptime", "type": "singlestat", "valueFontSize": "80%", "valueMaps": [ { "op": "=", "text": "N/A", "value": "null" } ], "valueName": "current" }, { "cacheTimeout": null, "colorBackground": false, "colorValue": false, "colors": [ "rgba(245, 54, 54, 0.9)", "rgba(237, 129, 40, 0.89)", "rgba(50, 172, 45, 0.97)" ], "datasource": "${DS_EXAMPLE}", "format": "dtdurations", "gauge": { "maxValue": 100, "minValue": 0, "show": false, "thresholdLabels": false, "thresholdMarkers": true }, "gridPos": { "h": 4, "w": 4, "x": 4, "y": 1 }, "id": 6, "interval": null, "links": [], "mappingType": 1, "mappingTypes": [ { "name": "value to text", "value": 1 }, { "name": "range to text", "value": 2 } ], "maxDataPoints": 100, "nullPointMode": "connected", "nullText": null, "postfix": "", "postfixFontSize": "50%", "prefix": "", "prefixFontSize": "50%", "rangeMaps": [ { "from": "null", "text": "N/A", "to": "null" } ], "repeat": null, "sparkline": { "fillColor": "rgba(31, 118, 189, 0.18)", "full": false, "lineColor": "rgb(31, 120, 193)", "show": false }, "tableColumn": "instance", "targets": [ { "expr": "nageru_disk_free_bytes / ignoring(destination) deriv(nageru_mux_written_bytes{destination=\"files_total\",instance=~\"$instance\"}[10m])", "format": "time_series", "interval": "", "intervalFactor": 2, "legendFormat": "", "refId": "A", "step": 240 } ], "thresholds": "", "title": "Disk space remaining", "type": "singlestat", "valueFontSize": "80%", "valueMaps": [ { "op": "=", "text": "N/A", "value": "null" } ], "valueName": "current" }, { "cacheTimeout": null, "colorBackground": false, "colorValue": false, "colors": [ "rgba(245, 54, 54, 0.9)", "rgba(237, 129, 40, 0.89)", "rgba(50, 172, 45, 0.97)" ], "datasource": "${DS_EXAMPLE}", "format": "none", "gauge": { "maxValue": 100, "minValue": 0, "show": false, "thresholdLabels": false, "thresholdMarkers": true }, "gridPos": { "h": 4, "w": 4, "x": 8, "y": 1 }, "id": 11, "interval": null, "links": [], "mappingType": 1, "mappingTypes": [ { "name": "value to text", "value": 1 }, { "name": "range to text", "value": 2 } ], "maxDataPoints": 100, "nullPointMode": "connected", "nullText": null, "postfix": "", "postfixFontSize": "50%", "prefix": "", "prefixFontSize": "50%", "rangeMaps": [ { "from": "null", "text": "N/A", "to": "null" } ], "sparkline": { "fillColor": "rgba(31, 118, 189, 0.18)", "full": false, "lineColor": "rgb(31, 120, 193)", "show": true }, "tableColumn": "", "targets": [ { "expr": "nageru_num_connected_clients{instance=~\"$instance\"}", "format": "time_series", "intervalFactor": 2, "legendFormat": "", "refId": "A", "step": 240 } ], "thresholds": "", "title": "Connected clients", "type": "singlestat", "valueFontSize": "80%", "valueMaps": [ { "op": "=", "text": "N/A", "value": "null" } ], "valueName": "current" }, { "cacheTimeout": null, "colorBackground": false, "colorValue": false, "colors": [ "rgba(245, 54, 54, 0.9)", "rgba(237, 129, 40, 0.89)", "rgba(50, 172, 45, 0.97)" ], "datasource": "${DS_EXAMPLE}", "format": "none", "gauge": { "maxValue": 100, "minValue": 0, "show": false, "thresholdLabels": false, "thresholdMarkers": true }, "gridPos": { "h": 4, "w": 4, "x": 12, "y": 1 }, "id": 46, "interval": null, "links": [], "mappingType": 1, "mappingTypes": [ { "name": "value to text", "value": 1 }, { "name": "range to text", "value": 2 } ], "maxDataPoints": 100, "nullPointMode": "connected", "nullText": null, "postfix": "", "postfixFontSize": "50%", "prefix": "", "prefixFontSize": "50%", "rangeMaps": [ { "from": "null", "text": "N/A", "to": "null" } ], "sparkline": { "fillColor": "rgba(31, 118, 189, 0.18)", "full": false, "lineColor": "rgb(31, 120, 193)", "show": true }, "tableColumn": "", "targets": [ { "expr": "sum(nageru_input_has_signal_bool{cardtype=\"ffmpeg\",instance=~\"$instance\"})", "format": "time_series", "intervalFactor": 2, "legendFormat": "", "metric": "", "refId": "A", "step": 240 } ], "thresholds": "", "title": "Connected FFmpeg inputs", "type": "singlestat", "valueFontSize": "80%", "valueMaps": [ { "op": "=", "text": "N/A", "value": "null" } ], "valueName": "current" }, { "cacheTimeout": null, "colorBackground": false, "colorValue": false, "colors": [ "rgba(245, 54, 54, 0.9)", "rgba(237, 129, 40, 0.89)", "rgba(50, 172, 45, 0.97)" ], "datasource": "${DS_EXAMPLE}", "decimals": 1, "format": "none", "gauge": { "maxValue": 100, "minValue": 0, "show": false, "thresholdLabels": false, "thresholdMarkers": true }, "gridPos": { "h": 4, "w": 4, "x": 16, "y": 1 }, "id": 7, "interval": null, "links": [], "mappingType": 1, "mappingTypes": [ { "name": "value to text", "value": 1 }, { "name": "range to text", "value": 2 } ], "maxDataPoints": 100, "nullPointMode": "connected", "nullText": null, "postfix": " LU", "postfixFontSize": "50%", "prefix": "", "prefixFontSize": "50%", "rangeMaps": [ { "from": "null", "text": "N/A", "to": "null" } ], "sparkline": { "fillColor": "rgba(31, 118, 189, 0.18)", "full": false, "lineColor": "rgb(31, 120, 193)", "show": true }, "tableColumn": "", "targets": [ { "expr": "nageru_audio_loudness_integrated_lufs{instance=~\"$instance\"} + 23", "format": "time_series", "intervalFactor": 2, "legendFormat": "", "refId": "A", "step": 240 } ], "thresholds": "", "title": "Overall audio level", "type": "singlestat", "valueFontSize": "80%", "valueMaps": [ { "op": "=", "text": "N/A", "value": "null" } ], "valueName": "current" }, { "aliasColors": {}, "bars": false, "dashLength": 10, "dashes": false, "datasource": "${DS_EXAMPLE}", "fill": 0, "gridPos": { "h": 4, "w": 4, "x": 20, "y": 1 }, "id": 18, "legend": { "avg": false, "current": false, "max": false, "min": false, "show": false, "total": false, "values": false }, "lines": true, "linewidth": 1, "links": [], "nullPointMode": "null", "percentage": false, "pointradius": 5, "points": false, "renderer": "flot", "seriesOverrides": [], "spaceLength": 10, "stack": false, "steppedLine": false, "targets": [ { "expr": "nageru_audio_correlation{instance=~\"$instance\"}", "format": "time_series", "intervalFactor": 2, "legendFormat": "", "refId": "A", "step": 60 } ], "thresholds": [], "timeFrom": null, "timeShift": null, "title": "Audio correlation", "tooltip": { "shared": true, "sort": 0, "value_type": "individual" }, "type": "graph", "xaxis": { "buckets": null, "mode": "time", "name": null, "show": true, "values": [] }, "yaxes": [ { "format": "short", "label": "", "logBase": 1, "max": "1", "min": "-1", "show": true }, { "format": "short", "label": null, "logBase": 1, "max": null, "min": null, "show": true } ], "yaxis": { "align": false, "alignLevel": null } }, { "collapsed": false, "gridPos": { "h": 1, "w": 24, "x": 0, "y": 5 }, "id": 64, "panels": [], "repeat": null, "title": "Dashboard Row", "type": "row" }, { "aliasColors": {}, "bars": false, "dashLength": 10, "dashes": false, "datasource": "${DS_EXAMPLE}", "fill": 1, "gridPos": { "h": 7, "w": 12, "x": 0, "y": 6 }, "id": 1, "legend": { "avg": false, "current": false, "max": false, "min": false, "show": true, "total": false, "values": false }, "lines": true, "linewidth": 1, "links": [], "nullPointMode": "null", "percentage": false, "pointradius": 5, "points": false, "renderer": "flot", "seriesOverrides": [], "spaceLength": 10, "stack": true, "steppedLine": false, "targets": [ { "expr": "rate(nageru_decklink_output_completed_frames{status!=\"completed\",instance=~\"$instance\"}[1m])", "format": "time_series", "interval": "", "intervalFactor": 2, "legendFormat": "Output frames {{status}}", "refId": "A", "step": 20 }, { "expr": "sum(rate(nageru_input_dropped_frames_error{instance=~\"$instance\"}[1m])) without (cardtype)", "format": "time_series", "interval": "", "intervalFactor": 2, "legendFormat": "Error frames card {{card}}", "refId": "B", "step": 20 }, { "expr": "rate(nageru_quick_sync_stalled_frames{instance=~\"$instance\"}[1m])", "format": "time_series", "interval": "", "intervalFactor": 2, "legendFormat": "Quick Sync stalled frames", "refId": "C", "step": 20 }, { "expr": "rate(nageru_x264_dropped_frames{instance=~\"$instance\"}[1m])", "format": "time_series", "interval": "", "intervalFactor": 2, "legendFormat": "x264 dropped frames", "refId": "D", "step": 20 }, { "expr": "rate(nageru_x264_speedcontrol_idle_frames{instance=~\"$instance\"}[1m])", "format": "time_series", "interval": "", "intervalFactor": 2, "legendFormat": "x264 speedcontrol idle frames", "refId": "E", "step": 20 }, { "expr": "rate(nageru_x264_speedcontrol_late_frames{instance=~\"$instance\"}[1m])", "format": "time_series", "interval": "", "intervalFactor": 2, "legendFormat": "x264 speedcontrol late frames", "refId": "F", "step": 20 }, { "expr": "rate(nageru_memory_gpu_evictions{instance=~\"$instance\"}[1m])", "format": "time_series", "interval": "", "intervalFactor": 1, "legendFormat": "GPU memory evictions", "refId": "G" } ], "thresholds": [], "timeFrom": null, "timeShift": null, "title": "Potential performance problems", "tooltip": { "shared": true, "sort": 0, "value_type": "individual" }, "type": "graph", "xaxis": { "buckets": null, "mode": "time", "name": null, "show": true, "values": [] }, "yaxes": [ { "format": "short", "label": null, "logBase": 1, "max": null, "min": null, "show": true }, { "format": "short", "label": null, "logBase": 1, "max": null, "min": null, "show": true } ], "yaxis": { "align": false, "alignLevel": null } }, { "aliasColors": {}, "bars": false, "dashLength": 10, "dashes": false, "datasource": "${DS_EXAMPLE}", "fill": 1, "gridPos": { "h": 7, "w": 12, "x": 12, "y": 6 }, "id": 27, "legend": { "avg": false, "current": false, "max": false, "min": false, "show": true, "total": false, "values": false }, "lines": true, "linewidth": 1, "links": [], "nullPointMode": "null", "percentage": false, "pointradius": 5, "points": false, "renderer": "flot", "seriesOverrides": [], "spaceLength": 10, "stack": true, "steppedLine": false, "targets": [ { "expr": "sum(rate(nageru_input_queue_duped_frames{instance=~\"$instance\"}[1m])) without (cardtype)", "format": "time_series", "interval": "", "intervalFactor": 2, "legendFormat": "Duplicated frames (queue starvation) card {{card}}", "metric": "", "refId": "A", "step": 20 }, { "expr": "sum(rate(nageru_input_dropped_frames_jitter{instance=~\"$instance\"}[1m])) without (cardtype)", "format": "time_series", "interval": "", "intervalFactor": 2, "legendFormat": "Dropped frames card {{card}}", "refId": "B", "step": 20 } ], "thresholds": [], "timeFrom": null, "timeShift": null, "title": "Queue events", "tooltip": { "shared": true, "sort": 0, "value_type": "individual" }, "type": "graph", "xaxis": { "buckets": null, "mode": "time", "name": null, "show": true, "values": [] }, "yaxes": [ { "format": "short", "label": null, "logBase": 1, "max": null, "min": null, "show": true }, { "format": "short", "label": null, "logBase": 1, "max": null, "min": null, "show": true } ], "yaxis": { "align": false, "alignLevel": null } }, { "collapsed": false, "gridPos": { "h": 1, "w": 24, "x": 0, "y": 13 }, "id": 65, "panels": [], "repeat": null, "title": "Dashboard Row", "type": "row" }, { "aliasColors": {}, "bars": false, "dashLength": 10, "dashes": false, "datasource": "${DS_EXAMPLE}", "fill": 1, "gridPos": { "h": 7, "w": 12, "x": 0, "y": 14 }, "id": 12, "legend": { "avg": false, "current": false, "max": false, "min": false, "show": true, "total": false, "values": false }, "lines": true, "linewidth": 1, "links": [], "nullPointMode": "null", "percentage": false, "pointradius": 5, "points": false, "renderer": "flot", "seriesOverrides": [], "spaceLength": 10, "stack": true, "steppedLine": false, "targets": [ { "expr": "8 * rate(nageru_mux_stream_bytes{destination=\"http\",instance=~\"$instance\"}[1m])", "format": "time_series", "interval": "", "intervalFactor": 2, "legendFormat": "{{stream}}", "refId": "A", "step": 20 } ], "thresholds": [], "timeFrom": null, "timeShift": null, "title": "Stream bitrates", "tooltip": { "shared": true, "sort": 0, "value_type": "individual" }, "type": "graph", "xaxis": { "buckets": null, "mode": "time", "name": null, "show": true, "values": [] }, "yaxes": [ { "format": "bps", "label": null, "logBase": 1, "max": null, "min": "0", "show": true }, { "format": "short", "label": null, "logBase": 1, "max": null, "min": null, "show": true } ], "yaxis": { "align": false, "alignLevel": null } }, { "aliasColors": {}, "bars": false, "dashLength": 10, "dashes": false, "datasource": "${DS_EXAMPLE}", "fill": 1, "gridPos": { "h": 7, "w": 12, "x": 12, "y": 14 }, "id": 13, "legend": { "avg": false, "current": false, "max": false, "min": false, "show": true, "total": false, "values": false }, "lines": true, "linewidth": 1, "links": [], "nullPointMode": "null", "percentage": false, "pointradius": 5, "points": false, "renderer": "flot", "seriesOverrides": [], "spaceLength": 10, "stack": true, "steppedLine": false, "targets": [ { "expr": "8 * rate(nageru_mux_stream_bytes{destination=\"current_file\",instance=~\"$instance\"}[1m])", "format": "time_series", "interval": "", "intervalFactor": 2, "legendFormat": "{{stream}}", "refId": "A", "step": 20 } ], "thresholds": [], "timeFrom": null, "timeShift": null, "title": "Disk bitrates", "tooltip": { "shared": true, "sort": 0, "value_type": "individual" }, "type": "graph", "xaxis": { "buckets": null, "mode": "time", "name": null, "show": true, "values": [] }, "yaxes": [ { "format": "bps", "label": null, "logBase": 1, "max": null, "min": "0", "show": true }, { "format": "short", "label": null, "logBase": 1, "max": null, "min": null, "show": true } ], "yaxis": { "align": false, "alignLevel": null } }, { "collapsed": false, "gridPos": { "h": 1, "w": 24, "x": 0, "y": 21 }, "id": 66, "panels": [], "repeat": null, "title": "Dashboard Row", "type": "row" }, { "aliasColors": {}, "bars": false, "dashLength": 10, "dashes": false, "datasource": "${DS_EXAMPLE}", "fill": 1, "gridPos": { "h": 7, "w": 8, "x": 0, "y": 22 }, "id": 19, "legend": { "avg": false, "current": false, "max": false, "min": false, "show": true, "total": false, "values": false }, "lines": true, "linewidth": 1, "links": [], "nullPointMode": "null", "percentage": false, "pointradius": 5, "points": false, "renderer": "flot", "seriesOverrides": [ { "alias": "90-percentile", "fillBelowTo": "10-percentile", "lines": false }, { "alias": "10-percentile", "lines": false }, { "alias": "Average", "fill": 0 } ], "spaceLength": 10, "stack": false, "steppedLine": false, "targets": [ { "expr": "histogram_quantile(0.9, rate(nageru_x264_crf_bucket{instance=~\"$instance\"}[1m]))", "format": "time_series", "intervalFactor": 2, "legendFormat": "90-percentile", "refId": "B", "step": 30 }, { "expr": "histogram_quantile(0.1, rate(nageru_x264_crf_bucket{instance=~\"$instance\"}[1m]))", "format": "time_series", "interval": "", "intervalFactor": 2, "legendFormat": "10-percentile", "refId": "A", "step": 30 }, { "expr": "rate(nageru_x264_crf_sum{instance=~\"$instance\"}[1m]) / rate(nageru_x264_crf_count{instance=~\"$instance\"}[1m])", "format": "time_series", "interval": "", "intervalFactor": 2, "legendFormat": "Average", "refId": "C", "step": 30 } ], "thresholds": [], "timeFrom": null, "timeShift": null, "title": "x264 average CRF (lower is better)", "tooltip": { "shared": true, "sort": 0, "value_type": "individual" }, "type": "graph", "xaxis": { "buckets": null, "mode": "time", "name": null, "show": true, "values": [] }, "yaxes": [ { "format": "short", "label": null, "logBase": 1, "max": null, "min": null, "show": true }, { "format": "short", "label": null, "logBase": 1, "max": null, "min": null, "show": true } ], "yaxis": { "align": false, "alignLevel": null } }, { "cards": { "cardPadding": 0, "cardRound": null }, "color": { "cardColor": "#b4ff00", "colorScale": "sqrt", "colorScheme": "interpolateOranges", "exponent": 0.5, "mode": "spectrum" }, "dataFormat": "tsbuckets", "datasource": "${DS_EXAMPLE}", "gridPos": { "h": 7, "w": 24, "x": 0, "y": 29 }, "heatmap": {}, "highlightCards": true, "id": 55, "legend": { "show": false }, "links": [], "repeat": "instance", "repeatDirection": "h", "targets": [ { "expr": "rate(nageru_x264_speedcontrol_preset_used_frames_bucket{instance=~\"$instance\"}[1m])", "format": "heatmap", "interval": "", "intervalFactor": 4, "legendFormat": "{{le}}", "refId": "A", "step": 30 } ], "title": "x264 speed control chosen preset", "tooltip": { "show": true, "showHistogram": false }, "type": "heatmap", "xAxis": { "show": true }, "xBucketNumber": null, "xBucketSize": "", "yAxis": { "decimals": null, "format": "none", "logBase": 1, "max": "26", "min": "0", "show": true, "splitFactor": null }, "yBucketBound": "auto", "yBucketNumber": null, "yBucketSize": 1 }, { "aliasColors": {}, "bars": false, "dashLength": 10, "dashes": false, "datasource": "${DS_EXAMPLE}", "fill": 1, "gridPos": { "h": 7, "w": 8, "x": 16, "y": 36 }, "id": 62, "legend": { "avg": false, "current": false, "max": false, "min": false, "show": true, "total": false, "values": false }, "lines": true, "linewidth": 1, "links": [], "nullPointMode": "null", "percentage": false, "pointradius": 5, "points": false, "renderer": "flot", "seriesOverrides": [], "spaceLength": 10, "stack": false, "steppedLine": false, "targets": [ { "expr": "nageru_x264_speedcontrol_buffer_available_seconds{instance=~\"$instance\"} / nageru_x264_speedcontrol_buffer_size_seconds{instance=~\"$instance\"}", "format": "time_series", "interval": "", "intervalFactor": 2, "legendFormat": "x264 speed control buffer available", "refId": "A", "step": 30 } ], "thresholds": [], "timeFrom": null, "timeShift": null, "title": "x264 buffer space available", "tooltip": { "shared": true, "sort": 0, "value_type": "individual" }, "type": "graph", "xaxis": { "buckets": null, "mode": "time", "name": null, "show": true, "values": [] }, "yaxes": [ { "format": "percentunit", "label": "", "logBase": 1, "max": null, "min": null, "show": true }, { "format": "short", "label": null, "logBase": 1, "max": null, "min": null, "show": true } ], "yaxis": { "align": false, "alignLevel": null } }, { "collapsed": false, "gridPos": { "h": 1, "w": 24, "x": 0, "y": 43 }, "id": 67, "panels": [], "repeat": null, "title": "Dashboard Row", "type": "row" }, { "aliasColors": {}, "bars": false, "dashLength": 10, "dashes": false, "datasource": "${DS_EXAMPLE}", "fill": 0, "gridPos": { "h": 7, "w": 12, "x": 0, "y": 44 }, "id": 2, "legend": { "alignAsTable": false, "avg": false, "current": false, "max": false, "min": false, "rightSide": false, "show": false, "sideWidth": null, "total": false, "values": false }, "lines": true, "linewidth": 1, "links": [], "nullPointMode": "null", "percentage": false, "pointradius": 5, "points": false, "renderer": "flot", "repeat": "card", "seriesOverrides": [ { "alias": "90-percentile", "fillBelowTo": "10-percentile", "lines": false }, { "alias": "10-percentile", "lines": false } ], "spaceLength": 10, "stack": false, "steppedLine": false, "targets": [ { "expr": "nageru_latency_seconds{measuring_point=\"decklink_output\",frame_type=\"total\",quantile=\"0.9\",frame_age=\"0\",card=\"$card\",instance=~\"$instance\"}", "format": "time_series", "hide": false, "interval": "", "intervalFactor": 2, "legendFormat": "90-percentile", "metric": "", "refId": "A", "step": 30 }, { "expr": "nageru_latency_seconds{measuring_point=\"decklink_output\",frame_type=\"total\",quantile=\"0.1\",frame_age=\"0\",card=\"$card\",instance=~\"$instance\"}", "format": "time_series", "interval": "", "intervalFactor": 2, "legendFormat": "10-percentile", "refId": "B", "step": 30 }, { "expr": "sum(\n rate(nageru_latency_seconds_sum{measuring_point=\"decklink_output\",frame_age=\"0\",card=\"$card\",instance=~\"$instance\"}[1m])\n) without (frame_type) / sum(\n rate(nageru_latency_seconds_count{measuring_point=\"decklink_output\",frame_age=\"0\",card=\"$card\",instance=~\"$instance\"}[1m])\n) without (frame_type)", "format": "time_series", "interval": "", "intervalFactor": 2, "legendFormat": "Average", "refId": "C", "step": 30 } ], "thresholds": [], "timeFrom": null, "timeShift": null, "title": "HDMI/SDI latency, card $card", "tooltip": { "shared": true, "sort": 0, "value_type": "individual" }, "type": "graph", "xaxis": { "buckets": null, "mode": "time", "name": null, "show": true, "values": [] }, "yaxes": [ { "format": "dtdurations", "label": null, "logBase": 1, "max": null, "min": null, "show": true }, { "format": "short", "label": null, "logBase": 1, "max": null, "min": null, "show": true } ], "yaxis": { "align": false, "alignLevel": null } }, { "aliasColors": {}, "bars": false, "dashLength": 10, "dashes": false, "datasource": "${DS_EXAMPLE}", "fill": 0, "gridPos": { "h": 7, "w": 12, "x": 0, "y": 51 }, "id": 20, "legend": { "alignAsTable": false, "avg": false, "current": false, "max": false, "min": false, "rightSide": false, "show": false, "sideWidth": null, "total": false, "values": false }, "lines": true, "linewidth": 1, "links": [], "nullPointMode": "null", "percentage": false, "pointradius": 5, "points": false, "renderer": "flot", "repeat": "card", "seriesOverrides": [ { "alias": "90-percentile", "fillBelowTo": "10-percentile", "lines": false }, { "alias": "10-percentile", "lines": false } ], "spaceLength": 10, "stack": false, "steppedLine": false, "targets": [ { "expr": "nageru_latency_seconds{measuring_point=\"mixer\",frame_type=\"total\",quantile=\"0.9\",frame_age=\"0\",card=\"$card\",instance=~\"$instance\"}", "format": "time_series", "hide": false, "interval": "", "intervalFactor": 2, "legendFormat": "90-percentile", "metric": "", "refId": "A", "step": 30 }, { "expr": "nageru_latency_seconds{measuring_point=\"mixer\",frame_type=\"total\",quantile=\"0.1\",frame_age=\"0\",card=\"$card\",instance=~\"$instance\"}", "format": "time_series", "interval": "", "intervalFactor": 2, "legendFormat": "10-percentile", "refId": "B", "step": 30 }, { "expr": "sum(\n rate(nageru_latency_seconds_sum{measuring_point=\"mixer\",frame_age=\"0\",card=\"$card\",instance=~\"$instance\"}[1m])\n) without (frame_type) / sum(\n rate(nageru_latency_seconds_count{measuring_point=\"mixer\",frame_age=\"0\",card=\"$card\",instance=~\"$instance\"}[1m])\n) without (frame_type)", "format": "time_series", "interval": "", "intervalFactor": 2, "legendFormat": "Average", "refId": "C", "step": 30 } ], "thresholds": [], "timeFrom": null, "timeShift": null, "title": "Mixer latency, card $card", "tooltip": { "shared": true, "sort": 0, "value_type": "individual" }, "type": "graph", "xaxis": { "buckets": null, "mode": "time", "name": null, "show": true, "values": [] }, "yaxes": [ { "format": "dtdurations", "label": "", "logBase": 1, "max": null, "min": null, "show": true }, { "format": "short", "label": null, "logBase": 1, "max": null, "min": null, "show": true } ], "yaxis": { "align": false, "alignLevel": null } }, { "aliasColors": {}, "bars": false, "dashLength": 10, "dashes": false, "datasource": "${DS_EXAMPLE}", "fill": 1, "gridPos": { "h": 7, "w": 8, "x": 0, "y": 58 }, "id": 14, "legend": { "avg": false, "current": false, "max": false, "min": false, "show": true, "total": false, "values": false }, "lines": true, "linewidth": 1, "links": [], "nullPointMode": "null", "percentage": false, "pointradius": 5, "points": false, "renderer": "flot", "seriesOverrides": [], "spaceLength": 10, "stack": false, "steppedLine": false, "targets": [ { "expr": "nageru_memory_used_bytes{instance=~\"$instance\"}", "format": "time_series", "interval": "", "intervalFactor": 2, "legendFormat": "Used", "refId": "A", "step": 30 }, { "expr": "nageru_memory_locked_limit_bytes{instance=~\"$instance\"}", "format": "time_series", "interval": "", "intervalFactor": 2, "legendFormat": "Max locked", "refId": "B", "step": 30 }, { "expr": "nageru_memory_gpu_used_bytes{instance=~\"$instance\"} ", "format": "time_series", "intervalFactor": 1, "legendFormat": "GPU used", "refId": "C" }, { "expr": "nageru_memory_gpu_total_bytes{instance=~\"$instance\"} ", "format": "time_series", "interval": "", "intervalFactor": 1, "legendFormat": "GPU max", "refId": "D" } ], "thresholds": [], "timeFrom": null, "timeShift": null, "title": "Memory usage", "tooltip": { "shared": true, "sort": 0, "value_type": "individual" }, "type": "graph", "xaxis": { "buckets": null, "mode": "time", "name": null, "show": true, "values": [] }, "yaxes": [ { "format": "bytes", "label": "", "logBase": 1, "max": null, "min": "0", "show": true }, { "format": "short", "label": null, "logBase": 1, "max": null, "min": null, "show": true } ], "yaxis": { "align": false, "alignLevel": null } } ], "refresh": "30s", "schemaVersion": 16, "style": "dark", "tags": [], "templating": { "list": [ { "allValue": null, "current": {}, "datasource": "${DS_EXAMPLE}", "hide": 0, "includeAll": true, "label": null, "multi": false, "name": "instance", "options": [], "query": "nageru_latency_seconds{measuring_point=\"mixer\"}", "refresh": 1, "regex": "/.*instance=\"([^\"]+)\".*/", "sort": 1, "tagValuesQuery": "", "tags": [], "tagsQuery": "", "type": "query", "useTags": false }, { "allValue": null, "current": {}, "datasource": "${DS_EXAMPLE}", "hide": 0, "includeAll": true, "label": null, "multi": false, "name": "card", "options": [], "query": "nageru_latency_seconds{measuring_point=\"mixer\"}", "refresh": 1, "regex": "/.*card=\"(\\d+)\".*/", "sort": 3, "tagValuesQuery": "", "tags": [], "tagsQuery": "", "type": "query", "useTags": false } ] }, "time": { "from": "now-3h", "to": "now" }, "timepicker": { "refresh_intervals": [ "5s", "10s", "30s", "1m", "5m", "15m", "30m", "1h", "2h", "1d" ], "time_options": [ "5m", "15m", "1h", "6h", "12h", "24h", "2d", "7d", "30d" ] }, "timezone": "browser", "title": "Nageru", "uid": "UML0ZDMmz", "version": 7 } nageru-2.3.0/nageru/akai_midimix.midimapping000066400000000000000000000135101450736322200211270ustar00rootroot00000000000000# Example mapping for the Akai MIDImix. This one is written by hand, # and serves as a simple example of the basic features. The MIDImix # doesn't have a ton of controls, so not everything is mapped up, # and some "wrong" mappings need to be done; in particular, we've set up # two controller banks and switch between them with the BANK LEFT and # BANK RIGHT buttons (which are normally meant to switch between channels # 1–8 and 9–16, as I understand it). # # The mappings for the 270° pots on each bus are: # # Bank 1: Treble, mid, bass # Bank 2: Gain, compressor threshold, (globals) # # The “(globals)” here are only for use on the two rightmost buses: # The third pot on bus 7 controls the lo-cut cutoff, and the pot on # bus 8 controls the limiter threshold. # # The mute button controls muting (obviously) for that bus, and the solo # button (accessible by holding the global solo button and pressing the # mute button for the bus) is abused for toggling auto gain staging. # # The REC ARM button for each bus is abused to be a “has peaked” meter; # pressing it will reset the measurement. # # Finally, the faders work pretty much as you'd expect; each bus' fader # is connected to the volume for that bus, and the master fader is # connected to the global makeup gain. num_controller_banks: 2 treble_bank: 0 mid_bank: 0 bass_bank: 0 gain_bank: 1 compressor_threshold_bank: 1 locut_bank: 1 limiter_threshold_bank: 1 # Bus 1. We also store the master controller here. bus_mapping { treble { controller_number: 16 } mid { controller_number: 17 } bass { controller_number: 18 } gain { controller_number: 16 } compressor_threshold { controller_number: 17 } fader { controller_number: 19 } toggle_mute { note_number: 1 } toggle_auto_gain_staging { note_number: 2 } clear_peak { note_number: 3 } # Master. makeup_gain { controller_number: 62 } select_bank_1 { note_number: 25 # Bank left. } select_bank_2 { note_number: 26 # Bank right. } # Lights. is_muted { note_number: 1 } auto_gain_staging_is_on { note_number: 2 } has_peaked { note_number: 3 } # Global lights. bank_1_is_selected { note_number: 25 } bank_2_is_selected { note_number: 26 } } # Bus 2. bus_mapping { treble { controller_number: 20 } mid { controller_number: 21 } bass { controller_number: 22 } gain { controller_number: 20 } compressor_threshold { controller_number: 21 } fader { controller_number: 23 } toggle_mute { note_number: 4 } toggle_auto_gain_staging { note_number: 5 } clear_peak { note_number: 6 } # Lights. is_muted { note_number: 4 } auto_gain_staging_is_on { note_number: 5 } has_peaked { note_number: 6 } } # Bus 3. bus_mapping { treble { controller_number: 24 } mid { controller_number: 25 } bass { controller_number: 26 } gain { controller_number: 24 } compressor_threshold { controller_number: 25 } fader { controller_number: 27 } toggle_mute { note_number: 7 } toggle_auto_gain_staging { note_number: 8 } clear_peak { note_number: 9 } # Lights. is_muted { note_number: 7 } auto_gain_staging_is_on { note_number: 8 } has_peaked { note_number: 9 } } # Bus 4. bus_mapping { treble { controller_number: 28 } mid { controller_number: 29 } bass { controller_number: 30 } gain { controller_number: 28 } compressor_threshold { controller_number: 29 } fader { controller_number: 31 } toggle_mute { note_number: 10 } toggle_auto_gain_staging { note_number: 11 } clear_peak { note_number: 12 } # Lights. is_muted { note_number: 10 } auto_gain_staging_is_on { note_number: 11 } has_peaked { note_number: 12 } } # Bus 5. Note the discontinuity in the controller numbers, # but not in the note numbers. bus_mapping { treble { controller_number: 46 } mid { controller_number: 47 } bass { controller_number: 48 } gain { controller_number: 46 } compressor_threshold { controller_number: 47 } fader { controller_number: 49 } toggle_mute { note_number: 13 } toggle_auto_gain_staging { note_number: 14 } clear_peak { note_number: 15 } # Lights. is_muted { note_number: 13 } auto_gain_staging_is_on { note_number: 14 } has_peaked { note_number: 15 } } # Bus 6. bus_mapping { treble { controller_number: 50 } mid { controller_number: 51 } bass { controller_number: 52 } gain { controller_number: 50 } compressor_threshold { controller_number: 51 } fader { controller_number: 53 } toggle_mute { note_number: 16 } toggle_auto_gain_staging { note_number: 17 } clear_peak { note_number: 18 } # Lights. is_muted { note_number: 16 } auto_gain_staging_is_on { note_number: 17 } has_peaked { note_number: 18 } } # Bus 7. bus_mapping { treble { controller_number: 54 } mid { controller_number: 55 } bass { controller_number: 56 } gain { controller_number: 54 } compressor_threshold { controller_number: 55 } fader { controller_number: 57 } toggle_mute { note_number: 19 } toggle_auto_gain_staging { note_number: 20 } clear_peak { note_number: 21 } # Lights. is_muted { note_number: 19 } auto_gain_staging_is_on { note_number: 20 } has_peaked { note_number: 21 } # Global controllers. locut { controller_number: 56 } } # Bus 8. bus_mapping { treble { controller_number: 58 } mid { controller_number: 59 } bass { controller_number: 60 } gain { controller_number: 58 } compressor_threshold { controller_number: 59 } fader { controller_number: 61 } toggle_mute { note_number: 22 } toggle_auto_gain_staging { note_number: 23 } clear_peak { note_number: 24 } # Lights. is_muted { note_number: 22 } auto_gain_staging_is_on { note_number: 23 } has_peaked { note_number: 24 } # Global controllers. limiter_threshold { controller_number: 60 } } nageru-2.3.0/nageru/alsa_input.cpp000066400000000000000000000247641450736322200171420ustar00rootroot00000000000000#include "alsa_input.h" #include #include #include #include #include #include #include "alsa_pool.h" #include "bmusb/bmusb.h" #include "shared/timebase.h" using namespace std; using namespace std::chrono; using namespace std::placeholders; #define RETURN_ON_ERROR(msg, expr) do { \ int err = (expr); \ if (err < 0) { \ fprintf(stderr, "[%s] " msg ": %s\n", device.c_str(), snd_strerror(err)); \ if (err == -ENODEV) return CaptureEndReason::DEVICE_GONE; \ return CaptureEndReason::OTHER_ERROR; \ } \ } while (false) #define RETURN_FALSE_ON_ERROR(msg, expr) do { \ int err = (expr); \ if (err < 0) { \ fprintf(stderr, "[%s] " msg ": %s\n", device.c_str(), snd_strerror(err)); \ return false; \ } \ } while (false) #define WARN_ON_ERROR(msg, expr) do { \ int err = (expr); \ if (err < 0) { \ fprintf(stderr, "[%s] " msg ": %s\n", device.c_str(), snd_strerror(err)); \ } \ } while (false) ALSAInput::ALSAInput(const char *device, unsigned sample_rate, unsigned num_channels, audio_callback_t audio_callback, ALSAPool *parent_pool, unsigned internal_dev_index) : device(device), sample_rate(sample_rate), num_channels(num_channels), audio_callback(audio_callback), parent_pool(parent_pool), internal_dev_index(internal_dev_index) { } bool ALSAInput::open_device() { RETURN_FALSE_ON_ERROR("snd_pcm_open()", snd_pcm_open(&pcm_handle, device.c_str(), SND_PCM_STREAM_CAPTURE, 0)); // Set format. snd_pcm_hw_params_t *hw_params; snd_pcm_hw_params_alloca(&hw_params); if (!set_base_params(device.c_str(), pcm_handle, hw_params, &sample_rate)) { return false; } RETURN_FALSE_ON_ERROR("snd_pcm_hw_params_set_channels()", snd_pcm_hw_params_set_channels(pcm_handle, hw_params, num_channels)); // Fragment size of 64 samples (about 1 ms at 48 kHz; a frame at 60 // fps/48 kHz is 800 samples.) We ask for 64 such periods in our buffer // (~85 ms buffer); more than that, and our jitter is probably so high // that the resampling queue can't keep up anyway. // The entire thing with periods and such is a bit mysterious to me; // seemingly I can get 96 frames at a time with no problems even if // the period size is 64 frames. And if I set num_periods to e.g. 1, // I can't have a big buffer. num_periods = 16; int dir = 0; RETURN_FALSE_ON_ERROR("snd_pcm_hw_params_set_periods_near()", snd_pcm_hw_params_set_periods_near(pcm_handle, hw_params, &num_periods, &dir)); period_size = 64; dir = 0; RETURN_FALSE_ON_ERROR("snd_pcm_hw_params_set_period_size_near()", snd_pcm_hw_params_set_period_size_near(pcm_handle, hw_params, &period_size, &dir)); buffer_frames = 64 * 64; RETURN_FALSE_ON_ERROR("snd_pcm_hw_params_set_buffer_size_near()", snd_pcm_hw_params_set_buffer_size_near(pcm_handle, hw_params, &buffer_frames)); RETURN_FALSE_ON_ERROR("snd_pcm_hw_params()", snd_pcm_hw_params(pcm_handle, hw_params)); //snd_pcm_hw_params_free(hw_params); // Figure out which format the card actually chose. RETURN_FALSE_ON_ERROR("snd_pcm_hw_params_current()", snd_pcm_hw_params_current(pcm_handle, hw_params)); snd_pcm_format_t chosen_format; RETURN_FALSE_ON_ERROR("snd_pcm_hw_params_get_format()", snd_pcm_hw_params_get_format(hw_params, &chosen_format)); audio_format.num_channels = num_channels; audio_format.bits_per_sample = 0; switch (chosen_format) { case SND_PCM_FORMAT_S16_LE: audio_format.bits_per_sample = 16; break; case SND_PCM_FORMAT_S24_LE: audio_format.bits_per_sample = 24; break; case SND_PCM_FORMAT_S32_LE: audio_format.bits_per_sample = 32; break; default: assert(false); } audio_format.sample_rate = sample_rate; //printf("num_periods=%u period_size=%u buffer_frames=%u sample_rate=%u bits_per_sample=%d\n", // num_periods, unsigned(period_size), unsigned(buffer_frames), sample_rate, audio_format.bits_per_sample); buffer.reset(new uint8_t[buffer_frames * num_channels * audio_format.bits_per_sample / 8]); snd_pcm_sw_params_t *sw_params; snd_pcm_sw_params_alloca(&sw_params); RETURN_FALSE_ON_ERROR("snd_pcm_sw_params_current()", snd_pcm_sw_params_current(pcm_handle, sw_params)); RETURN_FALSE_ON_ERROR("snd_pcm_sw_params_set_start_threshold", snd_pcm_sw_params_set_start_threshold(pcm_handle, sw_params, num_periods * period_size / 2)); RETURN_FALSE_ON_ERROR("snd_pcm_sw_params_set_tstamp_mode", snd_pcm_sw_params_set_tstamp_mode(pcm_handle, sw_params, SND_PCM_TSTAMP_ENABLE)); RETURN_FALSE_ON_ERROR("snd_pcm_sw_params_set_tstamp_type", snd_pcm_sw_params_set_tstamp_type(pcm_handle, sw_params, SND_PCM_TSTAMP_TYPE_MONOTONIC)); RETURN_FALSE_ON_ERROR("snd_pcm_sw_params()", snd_pcm_sw_params(pcm_handle, sw_params)); RETURN_FALSE_ON_ERROR("snd_pcm_nonblock()", snd_pcm_nonblock(pcm_handle, 1)); RETURN_FALSE_ON_ERROR("snd_pcm_prepare()", snd_pcm_prepare(pcm_handle)); return true; } bool ALSAInput::set_base_params(const char *device_name, snd_pcm_t *pcm_handle, snd_pcm_hw_params_t *hw_params, unsigned *sample_rate) { int err; err = snd_pcm_hw_params_any(pcm_handle, hw_params); if (err < 0) { fprintf(stderr, "[%s] snd_pcm_hw_params_any(): %s\n", device_name, snd_strerror(err)); return false; } err = snd_pcm_hw_params_set_access(pcm_handle, hw_params, SND_PCM_ACCESS_RW_INTERLEAVED); if (err < 0) { fprintf(stderr, "[%s] snd_pcm_hw_params_set_access(): %s\n", device_name, snd_strerror(err)); return false; } snd_pcm_format_mask_t *format_mask; snd_pcm_format_mask_alloca(&format_mask); snd_pcm_format_mask_set(format_mask, SND_PCM_FORMAT_S16_LE); snd_pcm_format_mask_set(format_mask, SND_PCM_FORMAT_S24_LE); snd_pcm_format_mask_set(format_mask, SND_PCM_FORMAT_S32_LE); err = snd_pcm_hw_params_set_format_mask(pcm_handle, hw_params, format_mask); if (err < 0) { fprintf(stderr, "[%s] snd_pcm_hw_params_set_format_mask(): %s\n", device_name, snd_strerror(err)); return false; } err = snd_pcm_hw_params_set_rate_near(pcm_handle, hw_params, sample_rate, 0); if (err < 0) { fprintf(stderr, "[%s] snd_pcm_hw_params_set_rate_near(): %s\n", device_name, snd_strerror(err)); return false; } return true; } ALSAInput::~ALSAInput() { if (pcm_handle) { WARN_ON_ERROR("snd_pcm_close()", snd_pcm_close(pcm_handle)); } } void ALSAInput::start_capture_thread() { assert(!device.empty()); should_quit.unquit(); capture_thread = thread(&ALSAInput::capture_thread_func, this); } void ALSAInput::stop_capture_thread() { should_quit.quit(); capture_thread.join(); } void ALSAInput::capture_thread_func() { if (!done_init) { char thread_name[16]; snprintf(thread_name, sizeof(thread_name), "ALSA_C_%d", internal_dev_index); pthread_setname_np(pthread_self(), thread_name); done_init = true; } parent_pool->set_card_state(internal_dev_index, ALSAPool::Device::State::STARTING); // If the device hasn't been opened already, we need to do so // before we can capture. while (!should_quit.should_quit() && pcm_handle == nullptr) { if (!open_device()) { fprintf(stderr, "[%s] Waiting one second and trying again...\n", device.c_str()); should_quit.sleep_for(seconds(1)); } } if (should_quit.should_quit()) { // Don't call free_card(); that would be a deadlock. if (pcm_handle) { WARN_ON_ERROR("snd_pcm_close()", snd_pcm_close(pcm_handle)); } pcm_handle = nullptr; return; } // Do the actual capture. (Termination condition within loop.) for ( ;; ) { switch (do_capture()) { case CaptureEndReason::REQUESTED_QUIT: // Don't call free_card(); that would be a deadlock. WARN_ON_ERROR("snd_pcm_close()", snd_pcm_close(pcm_handle)); pcm_handle = nullptr; return; case CaptureEndReason::DEVICE_GONE: parent_pool->free_card(internal_dev_index); WARN_ON_ERROR("snd_pcm_close()", snd_pcm_close(pcm_handle)); pcm_handle = nullptr; return; case CaptureEndReason::OTHER_ERROR: parent_pool->set_card_state(internal_dev_index, ALSAPool::Device::State::STARTING); fprintf(stderr, "[%s] Sleeping one second and restarting capture...\n", device.c_str()); should_quit.sleep_for(seconds(1)); break; } } } ALSAInput::CaptureEndReason ALSAInput::do_capture() { parent_pool->set_card_state(internal_dev_index, ALSAPool::Device::State::STARTING); RETURN_ON_ERROR("snd_pcm_start()", snd_pcm_start(pcm_handle)); parent_pool->set_card_state(internal_dev_index, ALSAPool::Device::State::RUNNING); snd_pcm_status_t *status; snd_pcm_status_alloca(&status); while (!should_quit.should_quit()) { int ret = snd_pcm_wait(pcm_handle, /*timeout=*/100); if (ret == 0) continue; // Timeout. if (ret == -EPIPE) { fprintf(stderr, "[%s] ALSA overrun\n", device.c_str()); snd_pcm_prepare(pcm_handle); snd_pcm_start(pcm_handle); continue; } RETURN_ON_ERROR("snd_pcm_wait()", ret); ret = snd_pcm_status(pcm_handle, status); RETURN_ON_ERROR("snd_pcm_status()", ret); snd_pcm_sframes_t avail = snd_pcm_status_get_avail(status); snd_htimestamp_t alsa_ts; snd_pcm_status_get_htstamp(status, &alsa_ts); snd_pcm_sframes_t frames = snd_pcm_readi(pcm_handle, buffer.get(), avail); if (frames == -EPIPE) { fprintf(stderr, "[%s] ALSA overrun\n", device.c_str()); snd_pcm_prepare(pcm_handle); snd_pcm_start(pcm_handle); continue; } if (frames == 0) { fprintf(stderr, "snd_pcm_readi() returned 0\n"); break; } RETURN_ON_ERROR("snd_pcm_readi()", frames); // NOTE: This assumes steady_clock::time_point is the same as clock_gettime(CLOCK_MONOTONIC). const steady_clock::time_point ts = steady_clock::time_point(seconds(alsa_ts.tv_sec) + nanoseconds(alsa_ts.tv_nsec)); bool success; do { if (should_quit.should_quit()) return CaptureEndReason::REQUESTED_QUIT; success = audio_callback(buffer.get(), frames, audio_format, ts); } while (!success); } return CaptureEndReason::REQUESTED_QUIT; } nageru-2.3.0/nageru/alsa_input.h000066400000000000000000000045111450736322200165730ustar00rootroot00000000000000#ifndef _ALSA_INPUT_H #define _ALSA_INPUT_H 1 // ALSA sound input, running in a separate thread and sending audio back // in callbacks. // // Note: “frame” here generally refers to the ALSA definition of frame, // which is a set of samples, exactly one for each channel. #include #include #include #include #include #include #include #include #include #include "bmusb/bmusb.h" #include "quittable_sleeper.h" class ALSAPool; class ALSAInput { public: typedef std::function audio_callback_t; ALSAInput(const char *device, unsigned sample_rate, unsigned num_channels, audio_callback_t audio_callback, ALSAPool *parent_pool, unsigned internal_dev_index); ~ALSAInput(); // If not called before start_capture_thread(), the capture thread // will call it until it succeeds. bool open_device(); // Not valid before the device has been successfully opened. // NOTE: Might very well be different from the sample rate given to the // constructor, since the card might not support the one you wanted. unsigned get_sample_rate() const { return sample_rate; } void start_capture_thread(); void stop_capture_thread(); // Set access, sample rate and format parameters on the given ALSA PCM handle. // Returns the computed parameter set and the chosen sample rate. Note that // sample_rate is an in/out parameter; you send in the desired rate, // and ALSA picks one as close to that as possible. static bool set_base_params(const char *device_name, snd_pcm_t *pcm_handle, snd_pcm_hw_params_t *hw_params, unsigned *sample_rate); private: bool done_init = false; void capture_thread_func(); enum class CaptureEndReason { REQUESTED_QUIT, DEVICE_GONE, OTHER_ERROR }; CaptureEndReason do_capture(); std::string device; unsigned sample_rate, num_channels, num_periods; snd_pcm_uframes_t period_size; snd_pcm_uframes_t buffer_frames; bmusb::AudioFormat audio_format; audio_callback_t audio_callback; snd_pcm_t *pcm_handle = nullptr; std::thread capture_thread; QuittableSleeper should_quit; std::unique_ptr buffer; ALSAPool *parent_pool; unsigned internal_dev_index; }; #endif // !defined(_ALSA_INPUT_H) nageru-2.3.0/nageru/alsa_output.cpp000066400000000000000000000067641450736322200173430ustar00rootroot00000000000000#include "alsa_output.h" #include #include #include #include #include using namespace std; namespace { void die_on_error(const char *func_name, int err) { if (err < 0) { fprintf(stderr, "%s: %s\n", func_name, snd_strerror(err)); abort(); } } } // namespace ALSAOutput::ALSAOutput(int sample_rate, int num_channels) : sample_rate(sample_rate), num_channels(num_channels) { die_on_error("snd_pcm_open()", snd_pcm_open(&pcm_handle, "default", SND_PCM_STREAM_PLAYBACK, 0)); // Set format. snd_pcm_hw_params_t *hw_params; snd_pcm_hw_params_alloca(&hw_params); die_on_error("snd_pcm_hw_params_any()", snd_pcm_hw_params_any(pcm_handle, hw_params)); die_on_error("snd_pcm_hw_params_set_access()", snd_pcm_hw_params_set_access(pcm_handle, hw_params, SND_PCM_ACCESS_RW_INTERLEAVED)); die_on_error("snd_pcm_hw_params_set_format()", snd_pcm_hw_params_set_format(pcm_handle, hw_params, SND_PCM_FORMAT_FLOAT_LE)); die_on_error("snd_pcm_hw_params_set_rate()", snd_pcm_hw_params_set_rate(pcm_handle, hw_params, sample_rate, 0)); die_on_error("snd_pcm_hw_params_set_channels", snd_pcm_hw_params_set_channels(pcm_handle, hw_params, num_channels)); // Fragment size of 2048 samples. (A frame at 60 fps/48 kHz is 800 samples.) // We ask for 4 such periods (~170 ms buffer). unsigned int num_periods = 4; int dir = 0; die_on_error("snd_pcm_hw_params_set_periods_near()", snd_pcm_hw_params_set_periods_near(pcm_handle, hw_params, &num_periods, &dir)); period_size = 2048; dir = 0; die_on_error("snd_pcm_hw_params_set_period_size_near()", snd_pcm_hw_params_set_period_size_near(pcm_handle, hw_params, &period_size, &dir)); die_on_error("snd_pcm_hw_params()", snd_pcm_hw_params(pcm_handle, hw_params)); //snd_pcm_hw_params_free(hw_params); snd_pcm_sw_params_t *sw_params; snd_pcm_sw_params_alloca(&sw_params); die_on_error("snd_pcm_sw_params_current()", snd_pcm_sw_params_current(pcm_handle, sw_params)); die_on_error("snd_pcm_sw_params_set_start_threshold", snd_pcm_sw_params_set_start_threshold(pcm_handle, sw_params, num_periods * period_size / 2)); die_on_error("snd_pcm_sw_params()", snd_pcm_sw_params(pcm_handle, sw_params)); die_on_error("snd_pcm_nonblock", snd_pcm_nonblock(pcm_handle, 1)); die_on_error("snd_pcm_prepare()", snd_pcm_prepare(pcm_handle)); } void ALSAOutput::write(const vector &samples) { buffer.insert(buffer.end(), samples.begin(), samples.end()); try_again: int periods_to_write = buffer.size() / (period_size * num_channels); if (periods_to_write == 0) { return; } int ret = snd_pcm_writei(pcm_handle, buffer.data(), periods_to_write * period_size); if (ret == -EPIPE) { fprintf(stderr, "warning: snd_pcm_writei() reported underrun\n"); snd_pcm_recover(pcm_handle, ret, 1); goto try_again; } else if (ret == -EAGAIN) { ret = 0; } else if (ret < 0) { fprintf(stderr, "error: snd_pcm_writei() returned '%s'\n", snd_strerror(ret)); abort(); } else if (ret > 0) { buffer.erase(buffer.begin(), buffer.begin() + ret * num_channels); } if (buffer.size() >= period_size * num_channels) { // Still more to write. if (ret == 0) { if (buffer.size() >= period_size * num_channels * 8) { // OK, almost 100 ms. Giving up. fprintf(stderr, "warning: ALSA overrun, dropping some audio (%d ms)\n", int(buffer.size() * 1000 / (num_channels * sample_rate))); buffer.clear(); } } else if (ret > 0) { // Not a completely failure (effectively a short write), // possibly due to a signal. goto try_again; } } } nageru-2.3.0/nageru/alsa_output.h000066400000000000000000000012711450736322200167740ustar00rootroot00000000000000#ifndef _ALSA_OUTPUT_H #define _ALSA_OUTPUT_H 1 // Extremely minimalistic ALSA output. Will not resample to fit // sound card clock, will not care much about over- or underflows // (so it will not block), will not care about A/V sync. // // This means that if you run it for long enough, clocks will // probably drift out of sync enough to make a little pop. #include #include class ALSAOutput { public: ALSAOutput(int sample_rate, int num_channels); void write(const std::vector &samples); private: snd_pcm_t *pcm_handle; std::vector buffer; snd_pcm_uframes_t period_size; int sample_rate, num_channels; }; #endif // !defined(_ALSA_OUTPUT_H) nageru-2.3.0/nageru/alsa_pool.cpp000066400000000000000000000367141450736322200167520ustar00rootroot00000000000000#include "alsa_pool.h" #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include "alsa_input.h" #include "audio_mixer.h" #include "defs.h" #include "input_mapping.h" #include "state.pb.h" using namespace std; using namespace std::placeholders; ALSAPool::ALSAPool() { should_quit_fd = eventfd(/*initval=*/0, /*flags=*/0); assert(should_quit_fd != -1); } ALSAPool::~ALSAPool() { for (Device &device : devices) { if (device.input != nullptr) { device.input->stop_capture_thread(); } } should_quit = true; const uint64_t one = 1; if (write(should_quit_fd, &one, sizeof(one)) != sizeof(one)) { perror("write(should_quit_fd)"); abort(); } inotify_thread.join(); while (retry_threads_running > 0) { this_thread::sleep_for(std::chrono::milliseconds(100)); } } std::vector ALSAPool::get_devices() { lock_guard lock(mu); for (Device &device : devices) { device.held = true; } return devices; } void ALSAPool::hold_device(unsigned index) { lock_guard lock(mu); assert(index < devices.size()); devices[index].held = true; } void ALSAPool::release_device(unsigned index) { lock_guard lock(mu); if (index < devices.size()) { devices[index].held = false; } } void ALSAPool::enumerate_devices() { // Enumerate all cards. for (int card_index = -1; snd_card_next(&card_index) == 0 && card_index >= 0; ) { char address[256]; snprintf(address, sizeof(address), "hw:%d", card_index); snd_ctl_t *ctl; int err = snd_ctl_open(&ctl, address, 0); if (err < 0) { printf("%s: %s\n", address, snd_strerror(err)); continue; } unique_ptr ctl_closer(ctl, snd_ctl_close); // Enumerate all devices on this card. for (int dev_index = -1; snd_ctl_pcm_next_device(ctl, &dev_index) == 0 && dev_index >= 0; ) { probe_device_with_retry(card_index, dev_index); } } } void ALSAPool::probe_device_with_retry(unsigned card_index, unsigned dev_index) { char address[256]; snprintf(address, sizeof(address), "hw:%d,%d", card_index, dev_index); lock_guard lock(add_device_mutex); if (add_device_tries_left.count(address)) { // Some thread is already busy retrying this, // so just reset its count. add_device_tries_left[address] = num_retries; return; } // Try (while still holding the lock) to add the device synchronously. ProbeResult result = probe_device_once(card_index, dev_index); if (result == ProbeResult::SUCCESS) { return; } else if (result == ProbeResult::FAILURE) { return; } assert(result == ProbeResult::DEFER); // Add failed for whatever reason (probably just that the device // isn't up yet. Set up a count so that nobody else starts a thread, // then start it ourselves. fprintf(stderr, "Trying %s again in one second...\n", address); add_device_tries_left[address] = num_retries; ++retry_threads_running; thread(&ALSAPool::probe_device_retry_thread_func, this, card_index, dev_index).detach(); } void ALSAPool::probe_device_retry_thread_func(unsigned card_index, unsigned dev_index) { char address[256]; snprintf(address, sizeof(address), "hw:%d,%d", card_index, dev_index); char thread_name[16]; snprintf(thread_name, sizeof(thread_name), "Reprobe_hw:%d,%d", card_index, dev_index); pthread_setname_np(pthread_self(), thread_name); for ( ;; ) { // Termination condition within the loop. sleep(1); // See if there are any retries left. lock_guard lock(add_device_mutex); if (should_quit || !add_device_tries_left.count(address) || add_device_tries_left[address] == 0) { add_device_tries_left.erase(address); fprintf(stderr, "Giving up probe of %s.\n", address); break; } // Seemingly there were. Give it a try (we still hold the mutex). ProbeResult result = probe_device_once(card_index, dev_index); if (result == ProbeResult::SUCCESS) { add_device_tries_left.erase(address); fprintf(stderr, "Probe of %s succeeded.\n", address); break; } else if (result == ProbeResult::FAILURE || --add_device_tries_left[address] == 0) { add_device_tries_left.erase(address); fprintf(stderr, "Giving up probe of %s.\n", address); break; } // Failed again. assert(result == ProbeResult::DEFER); fprintf(stderr, "Trying %s again in one second (%d tries left)...\n", address, add_device_tries_left[address]); } --retry_threads_running; } ALSAPool::ProbeResult ALSAPool::probe_device_once(unsigned card_index, unsigned dev_index) { char address[256]; snprintf(address, sizeof(address), "hw:%d", card_index); snd_ctl_t *ctl; int err = snd_ctl_open(&ctl, address, 0); if (err < 0) { printf("%s: %s\n", address, snd_strerror(err)); return ALSAPool::ProbeResult::DEFER; } unique_ptr ctl_closer(ctl, snd_ctl_close); snprintf(address, sizeof(address), "hw:%d,%d", card_index, dev_index); snd_pcm_info_t *pcm_info; snd_pcm_info_alloca(&pcm_info); snd_pcm_info_set_device(pcm_info, dev_index); snd_pcm_info_set_subdevice(pcm_info, 0); snd_pcm_info_set_stream(pcm_info, SND_PCM_STREAM_CAPTURE); err = snd_ctl_pcm_info(ctl, pcm_info); if (err == -ENOENT) { // Not a capture card. return ALSAPool::ProbeResult::FAILURE; } if (err < 0) { // Not available for capture. printf("%s: Not available for capture.\n", address); return ALSAPool::ProbeResult::DEFER; } unsigned num_channels = 0; // Find all channel maps for this device, and pick out the one // with the most channels. snd_pcm_chmap_query_t **cmaps = snd_pcm_query_chmaps_from_hw(card_index, dev_index, 0, SND_PCM_STREAM_CAPTURE); if (cmaps != nullptr) { for (snd_pcm_chmap_query_t **ptr = cmaps; *ptr; ++ptr) { num_channels = max(num_channels, (*ptr)->map.channels); } snd_pcm_free_chmaps(cmaps); } if (num_channels == 0) { // Device had no channel maps. We need to open it to query. // TODO: Do this asynchronously. snd_pcm_t *pcm_handle; int err = snd_pcm_open(&pcm_handle, address, SND_PCM_STREAM_CAPTURE, 0); if (err < 0) { printf("%s: %s\n", address, snd_strerror(err)); return ALSAPool::ProbeResult::DEFER; } snd_pcm_hw_params_t *hw_params; snd_pcm_hw_params_alloca(&hw_params); unsigned sample_rate; if (!ALSAInput::set_base_params(address, pcm_handle, hw_params, &sample_rate)) { snd_pcm_close(pcm_handle); return ALSAPool::ProbeResult::DEFER; } err = snd_pcm_hw_params_get_channels_max(hw_params, &num_channels); if (err < 0) { fprintf(stderr, "[%s] snd_pcm_hw_params_get_channels_max(): %s\n", address, snd_strerror(err)); snd_pcm_close(pcm_handle); return ALSAPool::ProbeResult::DEFER; } snd_pcm_close(pcm_handle); } if (num_channels == 0) { printf("%s: No channel maps with channels\n", address); return ALSAPool::ProbeResult::FAILURE; } snd_ctl_card_info_t *card_info; snd_ctl_card_info_alloca(&card_info); snd_ctl_card_info(ctl, card_info); string name = snd_ctl_card_info_get_name(card_info); string info = snd_pcm_info_get_name(pcm_info); unsigned internal_dev_index; string display_name; { lock_guard lock(mu); internal_dev_index = find_free_device_index(name, info, num_channels, address); devices[internal_dev_index].address = address; devices[internal_dev_index].name = name; devices[internal_dev_index].info = info; devices[internal_dev_index].num_channels = num_channels; // Note: Purposefully does not overwrite held. display_name = devices[internal_dev_index].display_name(); } reset_device(internal_dev_index); // Restarts it if it is held (ie., we just replaced a dead card). DeviceSpec spec{InputSourceType::ALSA_INPUT, internal_dev_index}; global_audio_mixer->set_device_parameters(spec, display_name, CardType::LIVE_CARD, /*num_channels=*/0, /*active=*/true); // Type and channels are ignored. global_audio_mixer->trigger_state_changed_callback(); return ALSAPool::ProbeResult::SUCCESS; } void ALSAPool::unplug_device(unsigned card_index, unsigned dev_index) { char address[256]; snprintf(address, sizeof(address), "hw:%d,%d", card_index, dev_index); for (unsigned i = 0; i < devices.size(); ++i) { if (devices[i].state != Device::State::EMPTY && devices[i].state != Device::State::DEAD && devices[i].address == address) { free_card(i); } } } void ALSAPool::init() { inotify_thread = thread(&ALSAPool::inotify_thread_func, this); enumerate_devices(); } void ALSAPool::inotify_thread_func() { pthread_setname_np(pthread_self(), "ALSA_Hotplug"); int inotify_fd = inotify_init(); if (inotify_fd == -1) { perror("inotify_init()"); fprintf(stderr, "No hotplug of ALSA devices available.\n"); return; } int watch_fd = inotify_add_watch(inotify_fd, "/dev/snd", IN_MOVE | IN_CREATE | IN_DELETE); if (watch_fd == -1) { perror("inotify_add_watch()"); fprintf(stderr, "No hotplug of ALSA devices available.\n"); close(inotify_fd); return; } int size = sizeof(inotify_event) + NAME_MAX + 1; unique_ptr buf(new char[size]); while (!should_quit) { pollfd fds[2]; fds[0].fd = inotify_fd; fds[0].events = POLLIN; fds[0].revents = 0; fds[1].fd = should_quit_fd; fds[1].events = POLLIN; fds[1].revents = 0; int ret = poll(fds, 2, -1); if (ret == -1) { if (errno == EINTR) { continue; } else { perror("poll(inotify_fd)"); return; } } if (ret == 0) { continue; } if (fds[1].revents) break; // should_quit_fd asserted. ret = read(inotify_fd, buf.get(), size); if (ret == -1) { if (errno == EINTR) { continue; } else { perror("read(inotify_fd)"); close(watch_fd); close(inotify_fd); return; } } if (ret < int(sizeof(inotify_event))) { fprintf(stderr, "inotify read unexpectedly returned %d, giving up hotplug of ALSA devices.\n", int(ret)); close(watch_fd); close(inotify_fd); return; } for (int i = 0; i < ret; ) { const inotify_event *event = reinterpret_cast(&buf[i]); i += sizeof(inotify_event) + event->len; if (event->mask & IN_Q_OVERFLOW) { fprintf(stderr, "WARNING: inotify overflowed, may lose ALSA hotplug events.\n"); continue; } unsigned card, device; char type; if (sscanf(event->name, "pcmC%uD%u%c", &card, &device, &type) == 3 && type == 'c') { if (event->mask & (IN_MOVED_FROM | IN_DELETE)) { printf("Deleted capture device: Card %u, device %u\n", card, device); unplug_device(card, device); } if (event->mask & (IN_MOVED_TO | IN_CREATE)) { printf("Adding capture device: Card %u, device %u\n", card, device); probe_device_with_retry(card, device); } } } } close(watch_fd); close(inotify_fd); close(should_quit_fd); } void ALSAPool::reset_device(unsigned index) { lock_guard lock(mu); Device *device = &devices[index]; if (device->state == Device::State::DEAD) { // Not running, and should not be started. return; } if (inputs[index] != nullptr) { inputs[index]->stop_capture_thread(); } if (!device->held) { inputs[index].reset(); } else { // TODO: Put on a background thread instead of locking? auto callback = bind(&AudioMixer::add_audio, global_audio_mixer, DeviceSpec{InputSourceType::ALSA_INPUT, index}, _1, _2, _3, _4); inputs[index].reset(new ALSAInput(device->address.c_str(), OUTPUT_FREQUENCY, device->num_channels, callback, this, index)); inputs[index]->start_capture_thread(); } device->input = inputs[index].get(); } unsigned ALSAPool::get_capture_frequency(unsigned index) { lock_guard lock(mu); assert(devices[index].held); if (devices[index].input) return devices[index].input->get_sample_rate(); else return OUTPUT_FREQUENCY; } ALSAPool::Device::State ALSAPool::get_card_state(unsigned index) { lock_guard lock(mu); assert(devices[index].held); return devices[index].state; } void ALSAPool::set_card_state(unsigned index, ALSAPool::Device::State state) { { lock_guard lock(mu); devices[index].state = state; } DeviceSpec spec{InputSourceType::ALSA_INPUT, index}; bool silence = (state != ALSAPool::Device::State::RUNNING); while (!global_audio_mixer->silence_card(spec, silence)) ; global_audio_mixer->trigger_state_changed_callback(); } unsigned ALSAPool::find_free_device_index(const string &name, const string &info, unsigned num_channels, const string &address) { // First try to find an exact match on a dead card. for (unsigned i = 0; i < devices.size(); ++i) { if (devices[i].state == Device::State::DEAD && devices[i].address == address && devices[i].name == name && devices[i].info == info && devices[i].num_channels == num_channels) { devices[i].state = Device::State::READY; return i; } } // Then try to find a match on everything but the address // (probably that devices were plugged back in a different order). // If we have two cards that are equal, this might get them mixed up, // but we don't have anything better. for (unsigned i = 0; i < devices.size(); ++i) { if (devices[i].state == Device::State::DEAD && devices[i].name == name && devices[i].info == info && devices[i].num_channels == num_channels) { devices[i].state = Device::State::READY; return i; } } // OK, so we didn't find a match; see if there are any empty slots. for (unsigned i = 0; i < devices.size(); ++i) { if (devices[i].state == Device::State::EMPTY) { devices[i].state = Device::State::READY; devices[i].held = false; return i; } } // Failing that, we just insert the new device at the end. Device new_dev; new_dev.state = Device::State::READY; new_dev.held = false; devices.push_back(new_dev); inputs.emplace_back(nullptr); return devices.size() - 1; } unsigned ALSAPool::create_dead_card(const string &name, const string &info, unsigned num_channels) { lock_guard lock(mu); // See if there are any empty slots. If not, insert one at the end. vector::iterator free_device = find_if(devices.begin(), devices.end(), [](const Device &device) { return device.state == Device::State::EMPTY; }); if (free_device == devices.end()) { devices.push_back(Device()); inputs.emplace_back(nullptr); free_device = devices.end() - 1; } free_device->state = Device::State::DEAD; free_device->name = name; free_device->info = info; free_device->num_channels = num_channels; free_device->held = true; return distance(devices.begin(), free_device); } void ALSAPool::serialize_device(unsigned index, DeviceSpecProto *serialized) { lock_guard lock(mu); assert(index < devices.size()); assert(devices[index].held); serialized->set_type(DeviceSpecProto::ALSA_INPUT); serialized->set_index(index); serialized->set_display_name(devices[index].display_name()); serialized->set_alsa_name(devices[index].name); serialized->set_alsa_info(devices[index].info); serialized->set_num_channels(devices[index].num_channels); serialized->set_address(devices[index].address); } void ALSAPool::free_card(unsigned index) { DeviceSpec spec{InputSourceType::ALSA_INPUT, index}; while (!global_audio_mixer->silence_card(spec, true)) ; { lock_guard lock(mu); if (devices[index].held) { devices[index].state = Device::State::DEAD; } else { devices[index].state = Device::State::EMPTY; inputs[index].reset(); } while (!devices.empty() && devices.back().state == Device::State::EMPTY) { devices.pop_back(); inputs.pop_back(); } } global_audio_mixer->trigger_state_changed_callback(); } nageru-2.3.0/nageru/alsa_pool.h000066400000000000000000000126761450736322200164200ustar00rootroot00000000000000#ifndef _ALSA_POOL_H #define _ALSA_POOL_H 1 #include #include #include #include #include #include #include class ALSAInput; class DeviceSpecProto; // The class dealing with the collective of all ALSA cards in the system. // In particular, it deals with enumeration of cards, and hotplug of new ones. class ALSAPool { public: ALSAPool(); ~ALSAPool(); struct Device { enum class State { // There is no card here. (There probably used to be one, // but it got removed.) We don't insert a card before // we've actually probed it, ie., we know whether it // can be captured from at all, and what its name is. EMPTY, // This card is ready for capture, as far as we know. // (It could still be used by someone else; we don't know // until we try to open it.) READY, // We are trying to start capture from this card, but we are not // streaming yet. Note that this could in theory go on forever, // if the card is in use by some other process; in the UI, // we will show this state as “(busy)”. STARTING, // The card is capturing and sending data. If there's a fatal error, // it could go back to STARTING, or it could go to DEAD // (depending on the error). RUNNING, // The card is gone (e.g., unplugged). However, since there's // still a bus using it, we can't just remove the entry. // If the card comes back (ie., a new card is plugged in, // and we believe it has the same configuration), it could be // installed in place of this card, and then presumably be put // back into STARTING or RUNNING. DEAD } state = State::EMPTY; std::string address; // E.g. “hw:0,0”. std::string name, info; unsigned num_channels; ALSAInput *input = nullptr; // nullptr iff EMPTY or DEAD. // Whether the AudioMixer is interested in this card or not. // “Interested” could mean either of two things: Either it is part of // a bus mapping, or it is in the process of enumerating devices // (to show to the user). A card that is _not_ held can disappear // at any given time as a result of an error or hotplug event; // a card that is held will go to the DEAD state instead. bool held = false; std::string display_name() const { return name + " (" + info + ")"; } }; void init(); // Get the list of all current devices. Note that this will implicitly mark // all of the returned devices as held, since the input mapping UI needs // some kind of stability when the user is to choose. Thus, when you are done // with the list and have set a new mapping, you must go through all the devices // you don't want and release them using release_device(). std::vector get_devices(); void hold_device(unsigned index); void release_device(unsigned index); // Note: index is allowed to go out of bounds. // If device is held, start or restart capture. If device is not held, // stop capture if it isn't already. void reset_device(unsigned index); // Note: The card must be held. Returns OUTPUT_FREQUENCY if the card is in EMPTY or DEAD. unsigned get_capture_frequency(unsigned index); // Note: The card must be held. Device::State get_card_state(unsigned index); // Only for ALSAInput. void set_card_state(unsigned index, Device::State state); // Just a short form for taking and then moving the card to // EMPTY or DEAD state. Only for ALSAInput and for internal use. void free_card(unsigned index); // Create a new card, mark it immediately as DEAD and hold it. // Returns the new index. unsigned create_dead_card(const std::string &name, const std::string &info, unsigned num_channels); // Make a protobuf representation of the given card, so that it can be // matched against at a later stage. For AudioMixer only. // The given card must be held. void serialize_device(unsigned index, DeviceSpecProto *serialized); private: mutable std::mutex mu; std::vector devices; // Under mu. std::vector> inputs; // Under mu, corresponds 1:1 to devices. // Keyed on device address (e.g. “hw:0,0”). If there's an entry here, // it means we already have a thread doing retries, so we shouldn't // start a new one. std::unordered_map add_device_tries_left; // Under add_device_mutex. std::mutex add_device_mutex; static constexpr int num_retries = 10; void inotify_thread_func(); void enumerate_devices(); // Try to add an input at the given card/device. If it succeeds, return // synchronously. If not, fire off a background thread to try up to // times. void probe_device_with_retry(unsigned card_index, unsigned dev_index); void probe_device_retry_thread_func(unsigned card_index, unsigned dev_index); enum class ProbeResult { SUCCESS, DEFER, FAILURE }; ProbeResult probe_device_once(unsigned card_index, unsigned dev_index); void unplug_device(unsigned card_index, unsigned dev_index); // Must be called with held. Will allocate a new entry if needed. // The returned entry will be set to READY state. unsigned find_free_device_index(const std::string &name, const std::string &info, unsigned num_channels, const std::string &address); std::atomic should_quit{false}; int should_quit_fd; std::thread inotify_thread; std::atomic retry_threads_running{0}; friend class ALSAInput; }; #endif // !defined(_ALSA_POOL_H) nageru-2.3.0/nageru/analyzer.cpp000066400000000000000000000247731450736322200166300ustar00rootroot00000000000000#include "analyzer.h" #include #include #include #include #include #include #include #include "shared/context.h" #include "flags.h" #include "mixer.h" #include "ui_analyzer.h" using namespace std; Analyzer::Analyzer() : ui(new Ui::Analyzer), grabbed_image(global_flags.width, global_flags.height, QImage::Format_ARGB32_Premultiplied) { ui->setupUi(this); surface = create_surface(QSurfaceFormat::defaultFormat()); context = create_context(surface); if (!make_current(context, surface)) { printf("oops\n"); abort(); } grab_timer.setSingleShot(true); connect(&grab_timer, &QTimer::timeout, bind(&Analyzer::grab_clicked, this)); ui->input_box->addItem("Live", Mixer::OUTPUT_LIVE); ui->input_box->addItem("Preview", Mixer::OUTPUT_PREVIEW); unsigned num_channels = global_mixer->get_num_channels(); for (unsigned channel_idx = 0; channel_idx < num_channels; ++channel_idx) { Mixer::Output channel = static_cast(Mixer::OUTPUT_INPUT0 + channel_idx); string name = global_mixer->get_channel_name(channel); ui->input_box->addItem(QString::fromStdString(name), channel); } ui->grab_frequency_box->addItem("Never", 0); ui->grab_frequency_box->addItem("100 ms", 100); ui->grab_frequency_box->addItem("1 sec", 1000); ui->grab_frequency_box->addItem("10 sec", 10000); ui->grab_frequency_box->setCurrentIndex(2); connect(ui->grab_btn, &QPushButton::clicked, bind(&Analyzer::grab_clicked, this)); connect(ui->input_box, static_cast(&QComboBox::currentIndexChanged), bind(&Analyzer::signal_changed, this)); signal_changed(); ui->grabbed_frame_label->installEventFilter(this); glGenBuffers(1, &pbo); glBindBuffer(GL_PIXEL_PACK_BUFFER_ARB, pbo); glBufferData(GL_PIXEL_PACK_BUFFER_ARB, global_flags.width * global_flags.height * 4, nullptr, GL_STREAM_READ); } Analyzer::~Analyzer() { delete_context(context); delete surface; } void Analyzer::update_channel_name(Mixer::Output output, const string &name) { if (output >= Mixer::OUTPUT_INPUT0) { int index = (output - Mixer::OUTPUT_INPUT0) + 2; ui->input_box->setItemText(index, QString::fromStdString(name)); } } void Analyzer::mixer_shutting_down() { ui->display->shutdown(); if (!make_current(context, surface)) { printf("oops\n"); abort(); } glDeleteBuffers(1, &pbo); check_error(); if (resource_pool != nullptr) { resource_pool->clean_context(); } } void Analyzer::grab_clicked() { Mixer::Output channel = static_cast(ui->input_box->currentData().value()); if (!make_current(context, surface)) { printf("oops\n"); abort(); } Mixer::DisplayFrame frame; if (!global_mixer->get_display_frame(channel, &frame)) { // Not ready yet. return; } // Set up an FBO to render into. if (resource_pool == nullptr) { resource_pool = frame.chain->get_resource_pool(); } else { assert(resource_pool == frame.chain->get_resource_pool()); } GLuint fbo_tex = resource_pool->create_2d_texture(GL_RGBA8, global_flags.width, global_flags.height); check_error(); GLuint fbo = resource_pool->create_fbo(fbo_tex); check_error(); glWaitSync(frame.ready_fence.get(), /*flags=*/0, GL_TIMEOUT_IGNORED); check_error(); frame.setup_chain(); check_error(); glDisable(GL_FRAMEBUFFER_SRGB); check_error(); frame.chain->render_to_fbo(fbo, global_flags.width, global_flags.height); check_error(); // Read back to memory. glBindFramebuffer(GL_FRAMEBUFFER, fbo); check_error(); glBindBuffer(GL_PIXEL_PACK_BUFFER, pbo); check_error(); glReadPixels(0, 0, global_flags.width, global_flags.height, GL_BGRA, GL_UNSIGNED_INT_8_8_8_8_REV, BUFFER_OFFSET(0)); check_error(); unsigned char *buf = (unsigned char *)glMapBuffer(GL_PIXEL_PACK_BUFFER, GL_READ_ONLY); check_error(); size_t pitch = global_flags.width * 4; for (int y = 0; y < global_flags.height; ++y) { memcpy(grabbed_image.scanLine(global_flags.height - y - 1), buf + y * pitch, pitch); } { char buf[256]; snprintf(buf, sizeof(buf), "Grabbed frame (%dx%d)", global_flags.width, global_flags.height); ui->grabbed_frame_sublabel->setText(buf); } QPixmap pixmap; pixmap.convertFromImage(grabbed_image); ui->grabbed_frame_label->setPixmap(pixmap); int r_hist[256] = {0}, g_hist[256] = {0}, b_hist[256] = {0}; const unsigned char *ptr = buf; for (int i = 0; i < global_flags.height * global_flags.width; ++i) { uint8_t b = *ptr++; uint8_t g = *ptr++; uint8_t r = *ptr++; ++ptr; ++r_hist[r]; ++g_hist[g]; ++b_hist[b]; } glUnmapBuffer(GL_PIXEL_PACK_BUFFER); check_error(); glBindBuffer(GL_PIXEL_PACK_BUFFER, 0); check_error(); glBindFramebuffer(GL_FRAMEBUFFER, 0); check_error(); vector r_vec(256), g_vec(256), b_vec(256); for (unsigned i = 0; i < 256; ++i) { r_vec[i] = log(r_hist[i] + 1.0); g_vec[i] = log(g_hist[i] + 1.0); b_vec[i] = log(b_hist[i] + 1.0); } ui->histogram->set_histograms(std::move(r_vec), std::move(g_vec), std::move(b_vec)); resource_pool->release_2d_texture(fbo_tex); check_error(); resource_pool->release_fbo(fbo); check_error(); if (last_x >= 0 && last_y >= 0) { grab_pixel(last_x, last_y); } if (isVisible()) { grab_timer.stop(); // Set up the next autograb if configured. int delay = ui->grab_frequency_box->currentData().toInt(nullptr); if (delay > 0) { grab_timer.start(delay); } } } void Analyzer::signal_changed() { Mixer::Output channel = static_cast(ui->input_box->currentData().value()); ui->display->set_output(channel); grab_clicked(); } bool Analyzer::eventFilter(QObject *watched, QEvent *event) { if (event->type() == QEvent::MouseMove && watched->isWidgetType()) { const QMouseEvent *mouse_event = (QMouseEvent *)event; last_x = mouse_event->x(); last_y = mouse_event->y(); grab_pixel(mouse_event->x(), mouse_event->y()); } if (event->type() == QEvent::Leave && watched->isWidgetType()) { last_x = last_y = -1; ui->coord_label->setText("Selected coordinate (x,y): (none)"); ui->red_label->setText(u8"—"); ui->green_label->setText(u8"—"); ui->blue_label->setText(u8"—"); ui->hex_label->setText(u8"#—"); } return false; } void Analyzer::grab_pixel(int x, int y) { QPixmap pixmap = ui->grabbed_frame_label->pixmap(Qt::ReturnByValue); x = lrint(x * double(pixmap.width()) / ui->grabbed_frame_label->width()); y = lrint(y * double(pixmap.height()) / ui->grabbed_frame_label->height()); x = std::min(x, pixmap.width() - 1); y = std::min(y, pixmap.height() - 1); char buf[256]; snprintf(buf, sizeof(buf), "Selected coordinate (x,y): (%d,%d)", x, y); ui->coord_label->setText(buf); QRgb pixel = grabbed_image.pixel(x, y); ui->red_label->setText(QString::fromStdString(to_string(qRed(pixel)))); ui->green_label->setText(QString::fromStdString(to_string(qGreen(pixel)))); ui->blue_label->setText(QString::fromStdString(to_string(qBlue(pixel)))); snprintf(buf, sizeof(buf), "#%02x%02x%02x", qRed(pixel), qGreen(pixel), qBlue(pixel)); ui->hex_label->setText(buf); } void Analyzer::resizeEvent(QResizeEvent* event) { QMainWindow::resizeEvent(event); // Ask for a relayout, but only after the event loop is done doing relayout // on everything else. QMetaObject::invokeMethod(this, "relayout", Qt::QueuedConnection); } void Analyzer::showEvent(QShowEvent *event) { grab_clicked(); } void Analyzer::relayout() { double aspect = double(global_flags.width) / global_flags.height; // Left pane (2/5 of the width). { int width = ui->left_pane->geometry().width(); int height = ui->left_pane->geometry().height(); // Figure out how much space everything that's non-responsive needs. int remaining_height = height - ui->left_pane->spacing() * (ui->left_pane->count() - 1); remaining_height -= ui->input_box->geometry().height(); ui->left_pane->setStretch(2, ui->grab_btn->geometry().height()); remaining_height -= ui->grab_btn->geometry().height(); ui->left_pane->setStretch(3, ui->grab_btn->geometry().height()); remaining_height -= ui->histogram_label->geometry().height(); ui->left_pane->setStretch(5, ui->histogram_label->geometry().height()); // The histogram's minimumHeight returns 0, so let's set a reasonable minimum for it. int min_histogram_height = 50; remaining_height -= min_histogram_height; // Allocate so that the display is 16:9, if possible. unsigned wanted_display_height = width / aspect; unsigned display_height; unsigned margin = 0; if (remaining_height >= int(wanted_display_height)) { display_height = wanted_display_height; } else { display_height = remaining_height; int display_width = lrint(display_height * aspect); margin = (width - display_width) / 2; } ui->left_pane->setStretch(1, display_height); ui->display_left_spacer->changeSize(margin, 1); ui->display_right_spacer->changeSize(margin, 1); remaining_height -= display_height; // Figure out if we can do the histogram at 16:9. remaining_height += min_histogram_height; unsigned histogram_height; if (remaining_height >= int(wanted_display_height)) { histogram_height = wanted_display_height; } else { histogram_height = remaining_height; } remaining_height -= histogram_height; ui->left_pane->setStretch(4, histogram_height); ui->left_pane->setStretch(0, remaining_height / 2); ui->left_pane->setStretch(6, remaining_height / 2); } // Right pane (remaining 3/5 of the width). { int width = ui->right_pane->geometry().width(); int height = ui->right_pane->geometry().height(); // Figure out how much space everything that's non-responsive needs. int remaining_height = height - ui->right_pane->spacing() * (ui->right_pane->count() - 1); remaining_height -= ui->grabbed_frame_sublabel->geometry().height(); remaining_height -= ui->coord_label->geometry().height(); remaining_height -= ui->color_hbox->geometry().height(); // Allocate so that the display is 16:9, if possible. unsigned wanted_display_height = width / aspect; unsigned display_height; unsigned margin = 0; if (remaining_height >= int(wanted_display_height)) { display_height = wanted_display_height; } else { display_height = remaining_height; int display_width = lrint(display_height * aspect); margin = (width - display_width) / 2; } ui->right_pane->setStretch(1, display_height); ui->grabbed_frame_left_spacer->changeSize(margin, 1); ui->grabbed_frame_right_spacer->changeSize(margin, 1); remaining_height -= display_height; if (remaining_height < 0) remaining_height = 0; ui->right_pane->setStretch(0, remaining_height / 2); ui->right_pane->setStretch(5, remaining_height / 2); } } nageru-2.3.0/nageru/analyzer.h000066400000000000000000000020321450736322200162550ustar00rootroot00000000000000#ifndef _ANALYZER_H #define _ANALYZER_H 1 #include #include #include #include #include #include #include "mixer.h" class QObject; class QOpenGLContext; class QSurface; namespace Ui { class Analyzer; } // namespace Ui namespace movit { class ResourcePool; } // namespace movit class Analyzer : public QMainWindow { Q_OBJECT public: Analyzer(); ~Analyzer(); void update_channel_name(Mixer::Output output, const std::string &name); void mixer_shutting_down(); public slots: void relayout(); private: void grab_clicked(); void signal_changed(); void grab_pixel(int x, int y); bool eventFilter(QObject *watched, QEvent *event) override; void resizeEvent(QResizeEvent *event) override; void showEvent(QShowEvent *event) override; Ui::Analyzer *ui; QSurface *surface; QOpenGLContext *context; GLuint pbo; movit::ResourcePool *resource_pool = nullptr; QImage grabbed_image; QTimer grab_timer; int last_x = -1, last_y = -1; }; #endif // !defined(_ANALYZER_H) nageru-2.3.0/nageru/analyzer.ui000066400000000000000000000247011450736322200164520ustar00rootroot00000000000000 Analyzer 0 0 845 472 Analyzer Qt::Vertical 20 5 0 Qt::Horizontal 5 20 true false background: rgb(233, 185, 110) Qt::Horizontal 5 20 Grab every: Grab false background: rgb(173, 127, 168) 0 0 RGB histogram Qt::AlignCenter Qt::Vertical 20 5 Qt::Vertical 20 5 0 Qt::Horizontal 5 20 1 1 CrossCursor true false background: color(0,0,0) true Qt::Horizontal 5 20 Grabbed frame Qt::AlignCenter Selected coordinate (x,y): (none) Qt::AlignCenter Color (8-bit sRGB): Qt::AlignCenter Green: Hex: Blue: #— Red: Qt::Vertical 20 5 GLWidget QWidget
glwidget.h
RGBHistogram QWidget
rgb_histogram.h
1
nageru-2.3.0/nageru/audio_encoder.cpp000066400000000000000000000132671450736322200175770ustar00rootroot00000000000000#include "audio_encoder.h" extern "C" { #include #include #include #include #include #include #include #include #include #include } #include #include #include #include #include #include #include #include "defs.h" #include "shared/mux.h" #include "shared/timebase.h" using namespace std; AudioEncoder::AudioEncoder(const string &codec_name, int bit_rate, const AVOutputFormat *oformat) { const AVCodec *codec = avcodec_find_encoder_by_name(codec_name.c_str()); if (codec == nullptr) { fprintf(stderr, "ERROR: Could not find codec '%s'\n", codec_name.c_str()); abort(); } ctx = avcodec_alloc_context3(codec); ctx->bit_rate = bit_rate; ctx->sample_rate = OUTPUT_FREQUENCY; ctx->sample_fmt = codec->sample_fmts[0]; ctx->ch_layout.order = AV_CHANNEL_ORDER_NATIVE; ctx->ch_layout.nb_channels = 2; ctx->ch_layout.u.mask = AV_CH_LAYOUT_STEREO; ctx->time_base = AVRational{1, TIMEBASE}; if (oformat->flags & AVFMT_GLOBALHEADER) { ctx->flags |= AV_CODEC_FLAG_GLOBAL_HEADER; } if (avcodec_open2(ctx, codec, NULL) < 0) { fprintf(stderr, "Could not open codec '%s'\n", codec_name.c_str()); abort(); } resampler = nullptr; int ok = swr_alloc_set_opts2(&resampler, /*out_ch_layout=*/&ctx->ch_layout, /*out_sample_fmt=*/ctx->sample_fmt, /*out_sample_rate=*/OUTPUT_FREQUENCY, /*in_ch_layout=*/&ctx->ch_layout, /*in_sample_fmt=*/AV_SAMPLE_FMT_FLT, /*in_sample_rate=*/OUTPUT_FREQUENCY, /*log_offset=*/0, /*log_ctx=*/nullptr); if (ok != 0) { fprintf(stderr, "Allocating resampler failed.\n"); abort(); } if (swr_init(resampler) < 0) { fprintf(stderr, "Could not open resample context.\n"); abort(); } audio_frame = av_frame_alloc(); } AudioEncoder::~AudioEncoder() { av_frame_free(&audio_frame); swr_free(&resampler); avcodec_free_context(&ctx); } void AudioEncoder::encode_audio(const vector &audio, int64_t audio_pts) { if (ctx->frame_size == 0) { // No queueing needed. assert(audio_queue.empty()); assert(audio.size() % 2 == 0); encode_audio_one_frame(&audio[0], audio.size() / 2, audio_pts); return; } int64_t sample_offset = audio_queue.size(); audio_queue.insert(audio_queue.end(), audio.begin(), audio.end()); size_t sample_num; for (sample_num = 0; sample_num + ctx->frame_size * 2 <= audio_queue.size(); sample_num += ctx->frame_size * 2) { int64_t adjusted_audio_pts = audio_pts + (int64_t(sample_num) - sample_offset) * TIMEBASE / (OUTPUT_FREQUENCY * 2); encode_audio_one_frame(&audio_queue[sample_num], ctx->frame_size, adjusted_audio_pts); } audio_queue.erase(audio_queue.begin(), audio_queue.begin() + sample_num); last_pts = audio_pts + audio.size() * TIMEBASE / (OUTPUT_FREQUENCY * 2); } void AudioEncoder::encode_audio_one_frame(const float *audio, size_t num_samples, int64_t audio_pts) { audio_frame->pts = audio_pts; audio_frame->nb_samples = num_samples; audio_frame->ch_layout.order = AV_CHANNEL_ORDER_NATIVE; audio_frame->ch_layout.nb_channels = 2; audio_frame->ch_layout.u.mask = AV_CH_LAYOUT_STEREO; audio_frame->format = ctx->sample_fmt; audio_frame->sample_rate = OUTPUT_FREQUENCY; if (av_samples_alloc(audio_frame->data, nullptr, 2, num_samples, ctx->sample_fmt, 0) < 0) { fprintf(stderr, "Could not allocate %zu samples.\n", num_samples); abort(); } if (swr_convert(resampler, audio_frame->data, num_samples, reinterpret_cast(&audio), num_samples) < 0) { fprintf(stderr, "Audio conversion failed.\n"); abort(); } int err = avcodec_send_frame(ctx, audio_frame); if (err < 0) { fprintf(stderr, "avcodec_send_frame() failed with error %d\n", err); abort(); } for ( ;; ) { // Termination condition within loop. AVPacketWithDeleter pkt = av_packet_alloc_unique(); pkt->data = nullptr; pkt->size = 0; int err = avcodec_receive_packet(ctx, pkt.get()); if (err == 0) { pkt->stream_index = 1; pkt->flags = 0; for (Mux *mux : muxes) { mux->add_packet(*pkt, pkt->pts, pkt->dts); } } else if (err == AVERROR(EAGAIN)) { break; } else { fprintf(stderr, "avcodec_receive_frame() failed with error %d\n", err); abort(); } } av_freep(&audio_frame->data[0]); av_frame_unref(audio_frame); } void AudioEncoder::encode_last_audio() { if (!audio_queue.empty()) { // Last frame can be whatever size we want. assert(audio_queue.size() % 2 == 0); encode_audio_one_frame(&audio_queue[0], audio_queue.size() / 2, last_pts); audio_queue.clear(); } if (ctx->codec->capabilities & AV_CODEC_CAP_DELAY) { // Collect any delayed frames. for ( ;; ) { AVPacketWithDeleter pkt = av_packet_alloc_unique(); pkt->data = nullptr; pkt->size = 0; int err = avcodec_receive_packet(ctx, pkt.get()); if (err == 0) { pkt->stream_index = 1; pkt->flags = 0; for (Mux *mux : muxes) { mux->add_packet(*pkt, pkt->pts, pkt->dts); } } else if (err == AVERROR_EOF) { break; } else { fprintf(stderr, "avcodec_receive_frame() failed with error %d\n", err); abort(); } } } } AVCodecParametersWithDeleter AudioEncoder::get_codec_parameters() { AVCodecParameters *codecpar = avcodec_parameters_alloc(); avcodec_parameters_from_context(codecpar, ctx); return AVCodecParametersWithDeleter(codecpar); } nageru-2.3.0/nageru/audio_encoder.h000066400000000000000000000023051450736322200172330ustar00rootroot00000000000000// A class to encode audio (using ffmpeg) and send it to a Mux. #ifndef _AUDIO_ENCODER_H #define _AUDIO_ENCODER_H 1 #include #include #include #include #include extern "C" { #include #include #include #include } #include "shared/ffmpeg_raii.h" class Mux; class AudioEncoder { public: AudioEncoder(const std::string &codec_name, int bit_rate, const AVOutputFormat *oformat); ~AudioEncoder(); void add_mux(Mux *mux) { // Does not take ownership. assert(mux != nullptr); muxes.push_back(mux); } void encode_audio(const std::vector &audio, int64_t audio_pts); void encode_last_audio(); const AVCodec *get_codec() const { return ctx->codec; } AVCodecParametersWithDeleter get_codec_parameters(); private: void encode_audio_one_frame(const float *audio, size_t num_samples, int64_t audio_pts); std::vector audio_queue; int64_t last_pts = 0; // The first pts after all audio we've encoded. AVCodecContext *ctx; SwrContext *resampler; AVFrame *audio_frame = nullptr; std::vector muxes; }; #endif // !defined(_AUDIO_ENCODER_H) nageru-2.3.0/nageru/audio_expanded_view.ui000066400000000000000000000403031450736322200206240ustar00rootroot00000000000000 AudioExpandedView 0 0 312 484 AudioExpandedView DejaVu Sans 75 true true Bus name Qt::AlignCenter Qt::Vertical 20 40 31 31 -100 100 100 50.000000000000000 true Stereo: 100% Qt::Horizontal 8 Lo-cut 31 31 -150 150 60.000000000000000 true Treble: +0.0 dB 31 31 -150 150 60.000000000000000 true Mid: +0.0 dB 31 31 -150 150 60.000000000000000 true Bass: +0.0 dB Qt::Horizontal 8 Auto gain staging true 31 31 -300 300 60.000000000000000 true Gain: +0.0 dB Qt::Horizontal Qt::Horizontal 40 20 Compressor true Qt::Horizontal 40 20 Threshold Qt::AlignCenter 64 64 -400 0 -260 30.000000000000000 true -10.0 dB Qt::AlignCenter 0 Reduction Qt::AlignCenter 16777215 16777215 Qt::Vertical 20 40 20 16777215 60 0 -40.0 Qt::AlignCenter 0 0 0 0 40 22 8 QPushButton:checked { background: rgba(255,0,0,80); } Mute true 1000 10 100 Qt::Vertical 60 0 +0.0 dB Qt::AlignCenter VUMeter QWidget
vumeter.h
1
ClickableLabel QLabel
clickable_label.h
NonLinearFader QSlider
nonlinear_fader.h
EllipsisLabel QLabel
ellipsis_label.h
CompressionReductionMeter QWidget
compression_reduction_meter.h
1
nageru-2.3.0/nageru/audio_miniview.ui000066400000000000000000000266021450736322200176370ustar00rootroot00000000000000 AudioMiniView 0 0 139 300 0 0 139 0 139 16777215 Form 0 0 0 0 0 1 true QFrame::Panel QFrame::Plain 0 6 0 0 0 0 0 6 1 0 0 0 Channel description Qt::AlignCenter 0 0 4 0 0 0 1 16 0 1 0 0 0 255 255 255 5 239 111 255 255 255 5 239 111 5 239 111 5 239 111 true 30 0 -0.0 Qt::AlignCenter 4 0 0 1000 10 100 Qt::Vertical QSlider::NoTicks 30 0 0 30 0 0 +0.0 dB Qt::AlignCenter Qt::Vertical VUMeter QWidget
vumeter.h
1
EllipsisLabel QLabel
ellipsis_label.h
NonLinearFader QSlider
nonlinear_fader.h
ClickableLabel QLabel
clickable_label.h
nageru-2.3.0/nageru/audio_mixer.cpp000066400000000000000000001345471450736322200173110ustar00rootroot00000000000000#include "audio_mixer.h" #include #include #include #include #ifdef __SSE2__ #include #endif #include #include #include #include #include #include #include #include #include #include #include "decibel.h" #include "flags.h" #include "shared/metrics.h" #include "state.pb.h" #include "shared/timebase.h" using namespace bmusb; using namespace std; using namespace std::chrono; using namespace std::placeholders; namespace { // TODO: If these prove to be a bottleneck, they can be SSSE3-optimized // (usually including multiple channels at a time). void convert_fixed16_to_fp32(float *dst, size_t out_channel, size_t out_num_channels, const uint8_t *src, size_t in_channel, size_t in_num_channels, size_t num_samples) { assert(in_channel < in_num_channels); assert(out_channel < out_num_channels); src += in_channel * 2; dst += out_channel; for (size_t i = 0; i < num_samples; ++i) { int16_t s = le16toh(*(int16_t *)src); *dst = s * (1.0f / 32768.0f); src += 2 * in_num_channels; dst += out_num_channels; } } void convert_fixed16_to_fixed32(int32_t *dst, size_t out_channel, size_t out_num_channels, const uint8_t *src, size_t in_channel, size_t in_num_channels, size_t num_samples) { assert(in_channel < in_num_channels); assert(out_channel < out_num_channels); src += in_channel * 2; dst += out_channel; for (size_t i = 0; i < num_samples; ++i) { uint32_t s = uint32_t(uint16_t(le16toh(*(int16_t *)src))) << 16; // Keep the sign bit in place, repeat the other 15 bits as far as they go. *dst = s | ((s & 0x7fffffff) >> 15) | ((s & 0x7fffffff) >> 30); src += 2 * in_num_channels; dst += out_num_channels; } } void convert_fixed24_to_fp32(float *dst, size_t out_channel, size_t out_num_channels, const uint8_t *src, size_t in_channel, size_t in_num_channels, size_t num_samples) { assert(in_channel < in_num_channels); assert(out_channel < out_num_channels); src += in_channel * 3; dst += out_channel; for (size_t i = 0; i < num_samples; ++i) { uint32_t s1 = src[0]; uint32_t s2 = src[1]; uint32_t s3 = src[2]; uint32_t s = (s1 << 8) | (s2 << 16) | (s3 << 24); // Note: The bottom eight bits are zero; s3 includes the sign bit. *dst = int(s) * (1.0f / (256.0f * 8388608.0f)); // 256 for signed down-shift by 8, then 2^23 for the actual conversion. src += 3 * in_num_channels; dst += out_num_channels; } } void convert_fixed24_to_fixed32(int32_t *dst, size_t out_channel, size_t out_num_channels, const uint8_t *src, size_t in_channel, size_t in_num_channels, size_t num_samples) { assert(in_channel < in_num_channels); assert(out_channel < out_num_channels); src += in_channel * 3; dst += out_channel; for (size_t i = 0; i < num_samples; ++i) { uint32_t s1 = src[0]; uint32_t s2 = src[1]; uint32_t s3 = src[2]; uint32_t s = (s1 << 8) | (s2 << 16) | (s3 << 24); // Keep the sign bit in place, repeat the other 23 bits as far as they go. *dst = s | ((s & 0x7fffffff) >> 23); src += 3 * in_num_channels; dst += out_num_channels; } } void convert_fixed32_to_fp32(float *dst, size_t out_channel, size_t out_num_channels, const uint8_t *src, size_t in_channel, size_t in_num_channels, size_t num_samples) { assert(in_channel < in_num_channels); assert(out_channel < out_num_channels); src += in_channel * 4; dst += out_channel; for (size_t i = 0; i < num_samples; ++i) { int32_t s = le32toh(*(int32_t *)src); *dst = s * (1.0f / 2147483648.0f); src += 4 * in_num_channels; dst += out_num_channels; } } // Basically just a reinterleave. void convert_fixed32_to_fixed32(int32_t *dst, size_t out_channel, size_t out_num_channels, const uint8_t *src, size_t in_channel, size_t in_num_channels, size_t num_samples) { assert(in_channel < in_num_channels); assert(out_channel < out_num_channels); src += in_channel * 4; dst += out_channel; for (size_t i = 0; i < num_samples; ++i) { int32_t s = le32toh(*(int32_t *)src); *dst = s; src += 4 * in_num_channels; dst += out_num_channels; } } float find_peak_plain(const float *samples, size_t num_samples) __attribute__((unused)); float find_peak_plain(const float *samples, size_t num_samples) { float m = fabs(samples[0]); for (size_t i = 1; i < num_samples; ++i) { m = max(m, fabs(samples[i])); } return m; } #ifdef __SSE__ static inline float horizontal_max(__m128 m) { __m128 tmp = _mm_shuffle_ps(m, m, _MM_SHUFFLE(1, 0, 3, 2)); m = _mm_max_ps(m, tmp); tmp = _mm_shuffle_ps(m, m, _MM_SHUFFLE(2, 3, 0, 1)); m = _mm_max_ps(m, tmp); return _mm_cvtss_f32(m); } float find_peak(const float *samples, size_t num_samples) { const __m128 abs_mask = _mm_castsi128_ps(_mm_set1_epi32(0x7fffffffu)); __m128 m = _mm_setzero_ps(); for (size_t i = 0; i < (num_samples & ~3); i += 4) { __m128 x = _mm_loadu_ps(samples + i); x = _mm_and_ps(x, abs_mask); m = _mm_max_ps(m, x); } float result = horizontal_max(m); for (size_t i = (num_samples & ~3); i < num_samples; ++i) { result = max(result, fabs(samples[i])); } #if 0 // Self-test. We should be bit-exact the same. float reference_result = find_peak_plain(samples, num_samples); if (result != reference_result) { fprintf(stderr, "Error: Peak is %f [%f %f %f %f]; should be %f.\n", result, _mm_cvtss_f32(_mm_shuffle_ps(m, m, _MM_SHUFFLE(0, 0, 0, 0))), _mm_cvtss_f32(_mm_shuffle_ps(m, m, _MM_SHUFFLE(1, 1, 1, 1))), _mm_cvtss_f32(_mm_shuffle_ps(m, m, _MM_SHUFFLE(2, 2, 2, 2))), _mm_cvtss_f32(_mm_shuffle_ps(m, m, _MM_SHUFFLE(3, 3, 3, 3))), reference_result); abort(); } #endif return result; } #else float find_peak(const float *samples, size_t num_samples) { return find_peak_plain(samples, num_samples); } #endif void deinterleave_samples(const vector &in, vector *out_l, vector *out_r) { size_t num_samples = in.size() / 2; out_l->resize(num_samples); out_r->resize(num_samples); const float *inptr = in.data(); float *lptr = &(*out_l)[0]; float *rptr = &(*out_r)[0]; for (size_t i = 0; i < num_samples; ++i) { *lptr++ = *inptr++; *rptr++ = *inptr++; } } } // namespace AudioMixer::AudioMixer() : limiter(OUTPUT_FREQUENCY), correlation(OUTPUT_FREQUENCY) { for (unsigned bus_index = 0; bus_index < MAX_BUSES; ++bus_index) { locut[bus_index].init(FILTER_HPF, 2); eq[bus_index][EQ_BAND_BASS].init(FILTER_LOW_SHELF, 1); // Note: EQ_BAND_MID isn't used (see comments in apply_eq()). eq[bus_index][EQ_BAND_TREBLE].init(FILTER_HIGH_SHELF, 1); compressor[bus_index].reset(new StereoCompressor(OUTPUT_FREQUENCY)); level_compressor[bus_index].reset(new StereoCompressor(OUTPUT_FREQUENCY)); set_bus_settings(bus_index, get_default_bus_settings()); } set_limiter_enabled(global_flags.limiter_enabled); set_final_makeup_gain_auto(global_flags.final_makeup_gain_auto); r128.init(2, OUTPUT_FREQUENCY); r128.integr_start(); // hlen=16 is pretty low quality, but we use quite a bit of CPU otherwise, // and there's a limit to how important the peak meter is. peak_resampler.setup(OUTPUT_FREQUENCY, OUTPUT_FREQUENCY * 4, /*num_channels=*/2, /*hlen=*/16, /*frel=*/1.0); global_audio_mixer = this; alsa_pool.init(); if (!global_flags.input_mapping_filename.empty()) { // Must happen after ALSAPool is initialized, as it needs to know the card list. current_mapping_mode = MappingMode::MULTICHANNEL; InputMapping new_input_mapping; if (!load_input_mapping_from_file(get_devices(), global_flags.input_mapping_filename, &new_input_mapping)) { fprintf(stderr, "Failed to load input mapping from '%s', exiting.\n", global_flags.input_mapping_filename.c_str()); abort(); } set_input_mapping(new_input_mapping); } else { set_simple_input(/*card_index=*/0); if (global_flags.multichannel_mapping_mode) { current_mapping_mode = MappingMode::MULTICHANNEL; } } global_metrics.add("audio_loudness_short_lufs", &metric_audio_loudness_short_lufs, Metrics::TYPE_GAUGE); global_metrics.add("audio_loudness_integrated_lufs", &metric_audio_loudness_integrated_lufs, Metrics::TYPE_GAUGE); global_metrics.add("audio_loudness_range_low_lufs", &metric_audio_loudness_range_low_lufs, Metrics::TYPE_GAUGE); global_metrics.add("audio_loudness_range_high_lufs", &metric_audio_loudness_range_high_lufs, Metrics::TYPE_GAUGE); global_metrics.add("audio_peak_dbfs", &metric_audio_peak_dbfs, Metrics::TYPE_GAUGE); global_metrics.add("audio_final_makeup_gain_db", &metric_audio_final_makeup_gain_db, Metrics::TYPE_GAUGE); global_metrics.add("audio_correlation", &metric_audio_correlation, Metrics::TYPE_GAUGE); } void AudioMixer::reset_resampler(DeviceSpec device_spec) { lock_guard lock(audio_mutex); reset_resampler_mutex_held(device_spec); } void AudioMixer::reset_resampler_mutex_held(DeviceSpec device_spec) { AudioDevice *device = find_audio_device(device_spec); if (device->interesting_channels.empty()) { device->resampling_queue.reset(); } else { device->resampling_queue.reset(new ResamplingQueue( spec_to_string(device_spec), device->capture_frequency, OUTPUT_FREQUENCY, device->interesting_channels.size(), global_flags.audio_queue_length_ms * 0.001)); } } bool AudioMixer::add_audio(DeviceSpec device_spec, const uint8_t *data, unsigned num_samples, AudioFormat audio_format, steady_clock::time_point frame_time) { AudioDevice *device = find_audio_device(device_spec); unique_lock lock(audio_mutex, defer_lock); if (!lock.try_lock_for(chrono::milliseconds(10))) { return false; } if (device->resampling_queue == nullptr) { // No buses use this device; throw it away. return true; } unsigned num_channels = device->interesting_channels.size(); if (num_channels == 0) { // No buses use this device; throw it away. (Normally, we should not // be here, but probably, we are in the process of changing a mapping, // and the queue just isn't gone yet. In any case, returning is harmless.) return true; } // Convert the audio to fp32. unique_ptr audio(new float[num_samples * num_channels]); unsigned channel_index = 0; for (auto channel_it = device->interesting_channels.cbegin(); channel_it != device->interesting_channels.end(); ++channel_it, ++channel_index) { switch (audio_format.bits_per_sample) { case 0: assert(num_samples == 0); break; case 16: convert_fixed16_to_fp32(audio.get(), channel_index, num_channels, data, *channel_it, audio_format.num_channels, num_samples); break; case 24: convert_fixed24_to_fp32(audio.get(), channel_index, num_channels, data, *channel_it, audio_format.num_channels, num_samples); break; case 32: convert_fixed32_to_fp32(audio.get(), channel_index, num_channels, data, *channel_it, audio_format.num_channels, num_samples); break; default: fprintf(stderr, "Cannot handle audio with %u bits per sample\n", audio_format.bits_per_sample); assert(false); } } // If we changed frequency since last frame, we'll need to reset the resampler. if (audio_format.sample_rate != device->capture_frequency) { device->capture_frequency = audio_format.sample_rate; reset_resampler_mutex_held(device_spec); } // Now add it. device->resampling_queue->add_input_samples(frame_time, audio.get(), num_samples, ResamplingQueue::ADJUST_RATE); return true; } vector convert_audio_to_fixed32(const uint8_t *data, unsigned num_samples, bmusb::AudioFormat audio_format, unsigned num_channels) { vector audio; if (num_channels > audio_format.num_channels) { audio.resize(num_samples * num_channels, 0); } else { audio.resize(num_samples * num_channels); } for (unsigned channel_index = 0; channel_index < num_channels && channel_index < audio_format.num_channels; ++channel_index) { switch (audio_format.bits_per_sample) { case 0: assert(num_samples == 0); break; case 16: convert_fixed16_to_fixed32(&audio[0], channel_index, num_channels, data, channel_index, audio_format.num_channels, num_samples); break; case 24: convert_fixed24_to_fixed32(&audio[0], channel_index, num_channels, data, channel_index, audio_format.num_channels, num_samples); break; case 32: convert_fixed32_to_fixed32(&audio[0], channel_index, num_channels, data, channel_index, audio_format.num_channels, num_samples); break; default: fprintf(stderr, "Cannot handle audio with %u bits per sample\n", audio_format.bits_per_sample); assert(false); } } return audio; } bool AudioMixer::add_silence(DeviceSpec device_spec, unsigned samples_per_frame, unsigned num_frames) { AudioDevice *device = find_audio_device(device_spec); unique_lock lock(audio_mutex, defer_lock); if (!lock.try_lock_for(chrono::milliseconds(10))) { return false; } if (device->resampling_queue == nullptr) { // No buses use this device; throw it away. return true; } unsigned num_channels = device->interesting_channels.size(); assert(num_channels > 0); vector silence(samples_per_frame * num_channels, 0.0f); for (unsigned i = 0; i < num_frames; ++i) { device->resampling_queue->add_input_samples(steady_clock::now(), silence.data(), samples_per_frame, ResamplingQueue::DO_NOT_ADJUST_RATE); } return true; } bool AudioMixer::silence_card(DeviceSpec device_spec, bool silence) { AudioDevice *device = find_audio_device(device_spec); unique_lock lock(audio_mutex, defer_lock); if (!lock.try_lock_for(chrono::milliseconds(10))) { return false; } if (device->silenced && !silence) { reset_resampler_mutex_held(device_spec); } device->silenced = silence; return true; } AudioMixer::BusSettings AudioMixer::get_default_bus_settings() { BusSettings settings; settings.fader_volume_db = 0.0f; settings.muted = false; settings.locut_enabled = global_flags.locut_enabled; settings.stereo_width = 1.0f; for (unsigned band_index = 0; band_index < NUM_EQ_BANDS; ++band_index) { settings.eq_level_db[band_index] = 0.0f; } settings.gain_staging_db = global_flags.initial_gain_staging_db; settings.level_compressor_enabled = global_flags.gain_staging_auto; settings.compressor_threshold_dbfs = ref_level_dbfs - 12.0f; // -12 dB. settings.compressor_enabled = global_flags.compressor_enabled; return settings; } AudioMixer::BusSettings AudioMixer::get_bus_settings(unsigned bus_index) const { lock_guard lock(audio_mutex); BusSettings settings; settings.fader_volume_db = fader_volume_db[bus_index]; settings.muted = mute[bus_index]; settings.locut_enabled = locut_enabled[bus_index]; settings.stereo_width = stereo_width[bus_index]; for (unsigned band_index = 0; band_index < NUM_EQ_BANDS; ++band_index) { settings.eq_level_db[band_index] = eq_level_db[bus_index][band_index]; } settings.gain_staging_db = gain_staging_db[bus_index]; settings.level_compressor_enabled = level_compressor_enabled[bus_index]; settings.compressor_threshold_dbfs = compressor_threshold_dbfs[bus_index]; settings.compressor_enabled = compressor_enabled[bus_index]; return settings; } void AudioMixer::set_bus_settings(unsigned bus_index, const AudioMixer::BusSettings &settings) { lock_guard lock(audio_mutex); fader_volume_db[bus_index] = settings.fader_volume_db; mute[bus_index] = settings.muted; locut_enabled[bus_index] = settings.locut_enabled; stereo_width[bus_index] = settings.stereo_width; for (unsigned band_index = 0; band_index < NUM_EQ_BANDS; ++band_index) { eq_level_db[bus_index][band_index] = settings.eq_level_db[band_index]; } gain_staging_db[bus_index] = settings.gain_staging_db; last_gain_staging_db[bus_index] = gain_staging_db[bus_index]; level_compressor_enabled[bus_index] = settings.level_compressor_enabled; compressor_threshold_dbfs[bus_index] = settings.compressor_threshold_dbfs; compressor_enabled[bus_index] = settings.compressor_enabled; } AudioMixer::AudioDevice *AudioMixer::find_audio_device(DeviceSpec device) { switch (device.type) { case InputSourceType::CAPTURE_CARD: return &video_cards[device.index]; case InputSourceType::ALSA_INPUT: return &alsa_inputs[device.index]; case InputSourceType::SILENCE: default: assert(false); } return nullptr; } // Get a pointer to the given channel from the given device. // The channel must be picked out earlier and resampled. void AudioMixer::find_sample_src_from_device(const map> &samples_card, DeviceSpec device_spec, int source_channel, const float **srcptr, unsigned *stride) { static float zero = 0.0f; if (source_channel == -1 || device_spec.type == InputSourceType::SILENCE) { *srcptr = &zero; *stride = 0; return; } AudioDevice *device = find_audio_device(device_spec); assert(device->interesting_channels.count(source_channel) != 0); unsigned channel_index = 0; for (int channel : device->interesting_channels) { if (channel == source_channel) break; ++channel_index; } assert(channel_index < device->interesting_channels.size()); const auto it = samples_card.find(device_spec); assert(it != samples_card.end()); *srcptr = &(it->second)[channel_index]; *stride = device->interesting_channels.size(); } // TODO: Can be SSSE3-optimized if need be. void AudioMixer::fill_audio_bus(const map> &samples_card, const InputMapping::Bus &bus, unsigned num_samples, float stereo_width, float *output) { if (bus.device.type == InputSourceType::SILENCE) { memset(output, 0, num_samples * 2 * sizeof(*output)); } else { assert(bus.device.type == InputSourceType::CAPTURE_CARD || bus.device.type == InputSourceType::ALSA_INPUT); const float *lsrc, *rsrc; unsigned lstride, rstride; float *dptr = output; find_sample_src_from_device(samples_card, bus.device, bus.source_channel[0], &lsrc, &lstride); find_sample_src_from_device(samples_card, bus.device, bus.source_channel[1], &rsrc, &rstride); // Apply stereo width settings. Set stereo width w to a 0..1 range instead of // -1..1, since it makes for much easier calculations (so 0.5 = completely mono). // Then, what we want is // // L' = wL + (1-w)R = R + w(L-R) // R' = wR + (1-w)L = L + w(R-L) // // This can be further simplified calculation-wise by defining the weighted // difference signal D = w(R-L), so that: // // L' = R - D // R' = L + D float w = 0.5f * stereo_width + 0.5f; if (bus.source_channel[0] == bus.source_channel[1]) { // Mono anyway, so no need to bother. w = 1.0f; } else if (fabs(w) < 1e-3) { // Perfect inverse. swap(lsrc, rsrc); swap(lstride, rstride); w = 1.0f; } if (fabs(w - 1.0f) < 1e-3) { // No calculations needed for stereo_width = 1. for (unsigned i = 0; i < num_samples; ++i) { *dptr++ = *lsrc; *dptr++ = *rsrc; lsrc += lstride; rsrc += rstride; } } else { // General case. for (unsigned i = 0; i < num_samples; ++i) { float left = *lsrc, right = *rsrc; float diff = w * (right - left); *dptr++ = right - diff; *dptr++ = left + diff; lsrc += lstride; rsrc += rstride; } } } } vector AudioMixer::get_active_devices() const { vector ret; for (unsigned card_index = 0; card_index < MAX_VIDEO_CARDS; ++card_index) { const DeviceSpec device_spec{InputSourceType::CAPTURE_CARD, card_index}; if (!find_audio_device(device_spec)->interesting_channels.empty()) { ret.push_back(device_spec); } } for (unsigned card_index = 0; card_index < MAX_ALSA_CARDS; ++card_index) { const DeviceSpec device_spec{InputSourceType::ALSA_INPUT, card_index}; if (!find_audio_device(device_spec)->interesting_channels.empty()) { ret.push_back(device_spec); } } return ret; } namespace { void apply_gain(float db, float last_db, vector *samples) { if (fabs(db - last_db) < 1e-3) { // Constant over this frame. const float gain = from_db(db); for (size_t i = 0; i < samples->size(); ++i) { (*samples)[i] *= gain; } } else { // We need to do a fade. unsigned num_samples = samples->size() / 2; float gain = from_db(last_db); const float gain_inc = pow(from_db(db - last_db), 1.0 / num_samples); for (size_t i = 0; i < num_samples; ++i) { (*samples)[i * 2 + 0] *= gain; (*samples)[i * 2 + 1] *= gain; gain *= gain_inc; } } } } // namespace vector AudioMixer::get_output(steady_clock::time_point ts, unsigned num_samples, ResamplingQueue::RateAdjustmentPolicy rate_adjustment_policy) { map> samples_card; vector samples_bus; lock_guard lock(audio_mutex); // Pick out all the interesting channels from all the cards. for (const DeviceSpec &device_spec : get_active_devices()) { AudioDevice *device = find_audio_device(device_spec); samples_card[device_spec].resize(num_samples * device->interesting_channels.size()); if (device->silenced) { memset(&samples_card[device_spec][0], 0, samples_card[device_spec].size() * sizeof(float)); } else { device->resampling_queue->get_output_samples( ts, &samples_card[device_spec][0], num_samples, rate_adjustment_policy); } } vector samples_out, left, right; samples_out.resize(num_samples * 2); samples_bus.resize(num_samples * 2); for (unsigned bus_index = 0; bus_index < input_mapping.buses.size(); ++bus_index) { fill_audio_bus(samples_card, input_mapping.buses[bus_index], num_samples, stereo_width[bus_index], &samples_bus[0]); apply_eq(bus_index, &samples_bus); { lock_guard lock(compressor_mutex); // Apply a level compressor to get the general level right. // Basically, if it's over about -40 dBFS, we squeeze it down to that level // (or more precisely, near it, since we don't use infinite ratio), // then apply a makeup gain to get it to -14 dBFS. -14 dBFS is, of course, // entirely arbitrary, but from practical tests with speech, it seems to // put ut around -23 LUFS, so it's a reasonable starting point for later use. if (level_compressor_enabled[bus_index]) { float threshold = 0.01f; // -40 dBFS. float ratio = 20.0f; float attack_time = 0.5f; float release_time = 20.0f; float makeup_gain = from_db(ref_level_dbfs - (-40.0f)); // +26 dB. level_compressor[bus_index]->process(samples_bus.data(), samples_bus.size() / 2, threshold, ratio, attack_time, release_time, makeup_gain); gain_staging_db[bus_index] = to_db(level_compressor[bus_index]->get_attenuation() * makeup_gain); } else { // Just apply the gain we already had. float db = gain_staging_db[bus_index]; float last_db = last_gain_staging_db[bus_index]; apply_gain(db, last_db, &samples_bus); } last_gain_staging_db[bus_index] = gain_staging_db[bus_index]; #if 0 printf("level=%f (%+5.2f dBFS) attenuation=%f (%+5.2f dB) end_result=%+5.2f dB\n", level_compressor.get_level(), to_db(level_compressor.get_level()), level_compressor.get_attenuation(), to_db(level_compressor.get_attenuation()), to_db(level_compressor.get_level() * level_compressor.get_attenuation() * makeup_gain)); #endif // The real compressor. if (compressor_enabled[bus_index]) { float threshold = from_db(compressor_threshold_dbfs[bus_index]); float ratio = 20.0f; float attack_time = 0.005f; float release_time = 0.040f; float makeup_gain = 2.0f; // +6 dB. compressor[bus_index]->process(samples_bus.data(), samples_bus.size() / 2, threshold, ratio, attack_time, release_time, makeup_gain); // compressor_att = compressor.get_attenuation(); } } add_bus_to_master(bus_index, samples_bus, &samples_out); deinterleave_samples(samples_bus, &left, &right); measure_bus_levels(bus_index, left, right); } { lock_guard lock(compressor_mutex); // Finally a limiter at -4 dB (so, -10 dBFS) to take out the worst peaks only. // Note that since ratio is not infinite, we could go slightly higher than this. if (limiter_enabled) { float threshold = from_db(limiter_threshold_dbfs); float ratio = 30.0f; float attack_time = 0.0f; // Instant. float release_time = 0.020f; float makeup_gain = 1.0f; // 0 dB. limiter.process(samples_out.data(), samples_out.size() / 2, threshold, ratio, attack_time, release_time, makeup_gain); // limiter_att = limiter.get_attenuation(); } // printf("limiter=%+5.1f compressor=%+5.1f\n", to_db(limiter_att), to_db(compressor_att)); } // At this point, we are most likely close to +0 LU (at least if the // faders sum to 0 dB and the compressors are on), but all of our // measurements have been on raw sample values, not R128 values. // So we have a final makeup gain to get us to +0 LU; the gain // adjustments required should be relatively small, and also, the // offset shouldn't change much (only if the type of audio changes // significantly). Thus, we shoot for updating this value basically // “whenever we process buffers”, since the R128 calculation isn't exactly // something we get out per-sample. // // Note that there's a feedback loop here, so we choose a very slow filter // (half-time of 30 seconds). double target_loudness_factor, alpha; double loudness_lu = r128.loudness_M() - ref_level_lufs; target_loudness_factor = final_makeup_gain * from_db(-loudness_lu); // If we're outside +/- 5 LU (after correction), we don't count it as // a normal signal (probably silence) and don't change the // correction factor; just apply what we already have. if (fabs(loudness_lu) >= 5.0 || !final_makeup_gain_auto) { alpha = 0.0; } else { // Formula adapted from // https://en.wikipedia.org/wiki/Low-pass_filter#Simple_infinite_impulse_response_filter. const double half_time_s = 30.0; const double fc_mul_2pi_delta_t = 1.0 / (half_time_s * OUTPUT_FREQUENCY); alpha = fc_mul_2pi_delta_t / (fc_mul_2pi_delta_t + 1.0); } { lock_guard lock(compressor_mutex); double m = final_makeup_gain; for (size_t i = 0; i < samples_out.size(); i += 2) { samples_out[i + 0] *= m; samples_out[i + 1] *= m; m += (target_loudness_factor - m) * alpha; } final_makeup_gain = m; } update_meters(samples_out); return samples_out; } namespace { void apply_filter_fade(StereoFilter *filter, float *data, unsigned num_samples, float cutoff_hz, float db, float last_db) { // A granularity of 32 samples is an okay tradeoff between speed and // smoothness; recalculating the filters is pretty expensive, so it's // good that we don't do this all the time. static constexpr unsigned filter_granularity_samples = 32; const float cutoff_linear = cutoff_hz * 2.0 * M_PI / OUTPUT_FREQUENCY; if (fabs(db - last_db) < 1e-3) { // Constant over this frame. if (fabs(db) > 0.01f) { filter->render(data, num_samples, cutoff_linear, 0.5f, db / 40.0f); } } else { // We need to do a fade. (Rounding up avoids division by zero.) unsigned num_blocks = (num_samples + filter_granularity_samples - 1) / filter_granularity_samples; const float inc_db_norm = (db - last_db) / 40.0f / num_blocks; float db_norm = db / 40.0f; for (size_t i = 0; i < num_samples; i += filter_granularity_samples) { size_t samples_this_block = std::min(num_samples - i, filter_granularity_samples); filter->render(data + i * 2, samples_this_block, cutoff_linear, 0.5f, db_norm); db_norm += inc_db_norm; } } } } // namespace void AudioMixer::apply_eq(unsigned bus_index, vector *samples_bus) { constexpr float bass_freq_hz = 200.0f; constexpr float treble_freq_hz = 4700.0f; // Cut away everything under 120 Hz (or whatever the cutoff is); // we don't need it for voice, and it will reduce headroom // and confuse the compressor. (In particular, any hums at 50 or 60 Hz // should be dampened.) if (locut_enabled[bus_index]) { locut[bus_index].render(samples_bus->data(), samples_bus->size() / 2, locut_cutoff_hz * 2.0 * M_PI / OUTPUT_FREQUENCY, 0.5f); } // Apply the rest of the EQ. Since we only have a simple three-band EQ, // we can implement it with two shelf filters. We use a simple gain to // set the mid-level filter, and then offset the low and high bands // from that if we need to. (We could perhaps have folded the gain into // the next part, but it's so cheap that the trouble isn't worth it.) // // If any part of the EQ has changed appreciably since last frame, // we fade smoothly during the course of this frame. const float bass_db = eq_level_db[bus_index][EQ_BAND_BASS]; const float mid_db = eq_level_db[bus_index][EQ_BAND_MID]; const float treble_db = eq_level_db[bus_index][EQ_BAND_TREBLE]; const float last_bass_db = last_eq_level_db[bus_index][EQ_BAND_BASS]; const float last_mid_db = last_eq_level_db[bus_index][EQ_BAND_MID]; const float last_treble_db = last_eq_level_db[bus_index][EQ_BAND_TREBLE]; assert(samples_bus->size() % 2 == 0); const unsigned num_samples = samples_bus->size() / 2; apply_gain(mid_db, last_mid_db, samples_bus); apply_filter_fade(&eq[bus_index][EQ_BAND_BASS], samples_bus->data(), num_samples, bass_freq_hz, bass_db - mid_db, last_bass_db - last_mid_db); apply_filter_fade(&eq[bus_index][EQ_BAND_TREBLE], samples_bus->data(), num_samples, treble_freq_hz, treble_db - mid_db, last_treble_db - last_mid_db); last_eq_level_db[bus_index][EQ_BAND_BASS] = bass_db; last_eq_level_db[bus_index][EQ_BAND_MID] = mid_db; last_eq_level_db[bus_index][EQ_BAND_TREBLE] = treble_db; } void AudioMixer::add_bus_to_master(unsigned bus_index, const vector &samples_bus, vector *samples_out) { assert(samples_bus.size() == samples_out->size()); assert(samples_bus.size() % 2 == 0); unsigned num_samples = samples_bus.size() / 2; const float new_volume_db = mute[bus_index] ? -90.0f : fader_volume_db[bus_index].load(); if (fabs(new_volume_db - last_fader_volume_db[bus_index]) > 1e-3) { // The volume has changed; do a fade over the course of this frame. // (We might have some numerical issues here, but it seems to sound OK.) // For the purpose of fading here, the silence floor is set to -90 dB // (the fader only goes to -84). float old_volume = from_db(max(last_fader_volume_db[bus_index], -90.0f)); float volume = from_db(max(new_volume_db, -90.0f)); float volume_inc = pow(volume / old_volume, 1.0 / num_samples); volume = old_volume; if (bus_index == 0) { for (unsigned i = 0; i < num_samples; ++i) { (*samples_out)[i * 2 + 0] = samples_bus[i * 2 + 0] * volume; (*samples_out)[i * 2 + 1] = samples_bus[i * 2 + 1] * volume; volume *= volume_inc; } } else { for (unsigned i = 0; i < num_samples; ++i) { (*samples_out)[i * 2 + 0] += samples_bus[i * 2 + 0] * volume; (*samples_out)[i * 2 + 1] += samples_bus[i * 2 + 1] * volume; volume *= volume_inc; } } } else if (new_volume_db > -90.0f) { float volume = from_db(new_volume_db); if (bus_index == 0) { for (unsigned i = 0; i < num_samples; ++i) { (*samples_out)[i * 2 + 0] = samples_bus[i * 2 + 0] * volume; (*samples_out)[i * 2 + 1] = samples_bus[i * 2 + 1] * volume; } } else { for (unsigned i = 0; i < num_samples; ++i) { (*samples_out)[i * 2 + 0] += samples_bus[i * 2 + 0] * volume; (*samples_out)[i * 2 + 1] += samples_bus[i * 2 + 1] * volume; } } } last_fader_volume_db[bus_index] = new_volume_db; } void AudioMixer::measure_bus_levels(unsigned bus_index, const vector &left, const vector &right) { assert(left.size() == right.size()); const float volume = mute[bus_index] ? 0.0f : from_db(fader_volume_db[bus_index]); const float peak_levels[2] = { find_peak(left.data(), left.size()) * volume, find_peak(right.data(), right.size()) * volume }; for (unsigned channel = 0; channel < 2; ++channel) { // Compute the current value, including hold and falloff. // The constants are borrowed from zita-mu1 by Fons Adriaensen. static constexpr float hold_sec = 0.5f; static constexpr float falloff_db_sec = 15.0f; // dB/sec falloff after hold. float current_peak; PeakHistory &history = peak_history[bus_index][channel]; history.historic_peak = max(history.historic_peak, peak_levels[channel]); if (history.age_seconds < hold_sec) { current_peak = history.last_peak; } else { current_peak = history.last_peak * from_db(-falloff_db_sec * (history.age_seconds - hold_sec)); } // See if we have a new peak to replace the old (possibly falling) one. if (peak_levels[channel] > current_peak) { history.last_peak = peak_levels[channel]; history.age_seconds = 0.0f; // Not 100% correct, but more than good enough given our frame sizes. current_peak = peak_levels[channel]; } else { history.age_seconds += float(left.size()) / OUTPUT_FREQUENCY; } history.current_level = peak_levels[channel]; history.current_peak = current_peak; } } void AudioMixer::update_meters(const vector &samples) { // Upsample 4x to find interpolated peak. peak_resampler.inp_data = const_cast(samples.data()); peak_resampler.inp_count = samples.size() / 2; vector interpolated_samples; interpolated_samples.resize(samples.size()); { lock_guard lock(audio_measure_mutex); while (peak_resampler.inp_count > 0) { // About four iterations. peak_resampler.out_data = &interpolated_samples[0]; peak_resampler.out_count = interpolated_samples.size() / 2; peak_resampler.process(); size_t out_stereo_samples = interpolated_samples.size() / 2 - peak_resampler.out_count; peak = max(peak, find_peak(interpolated_samples.data(), out_stereo_samples * 2)); peak_resampler.out_data = nullptr; } } // Find R128 levels and L/R correlation. vector left, right; deinterleave_samples(samples, &left, &right); float *ptrs[] = { left.data(), right.data() }; { lock_guard lock(audio_measure_mutex); r128.process(left.size(), ptrs); correlation.process_samples(samples); } send_audio_level_callback(); } void AudioMixer::reset_meters() { lock_guard lock(audio_measure_mutex); peak_resampler.reset(); peak = 0.0f; r128.reset(); r128.integr_start(); correlation.reset(); } void AudioMixer::send_audio_level_callback() { if (audio_level_callback == nullptr) { return; } lock_guard lock(audio_measure_mutex); double loudness_s = r128.loudness_S(); double loudness_i = r128.integrated(); double loudness_range_low = r128.range_min(); double loudness_range_high = r128.range_max(); metric_audio_loudness_short_lufs = loudness_s; metric_audio_loudness_integrated_lufs = loudness_i; metric_audio_loudness_range_low_lufs = loudness_range_low; metric_audio_loudness_range_high_lufs = loudness_range_high; metric_audio_peak_dbfs = to_db(peak); metric_audio_final_makeup_gain_db = to_db(final_makeup_gain); metric_audio_correlation = correlation.get_correlation(); vector bus_levels; bus_levels.resize(input_mapping.buses.size()); { lock_guard lock(compressor_mutex); for (unsigned bus_index = 0; bus_index < bus_levels.size(); ++bus_index) { BusLevel &levels = bus_levels[bus_index]; BusMetrics &metrics = bus_metrics[bus_index]; levels.current_level_dbfs[0] = metrics.current_level_dbfs[0] = to_db(peak_history[bus_index][0].current_level); levels.current_level_dbfs[1] = metrics.current_level_dbfs[1] = to_db(peak_history[bus_index][1].current_level); levels.peak_level_dbfs[0] = metrics.peak_level_dbfs[0] = to_db(peak_history[bus_index][0].current_peak); levels.peak_level_dbfs[1] = metrics.peak_level_dbfs[1] = to_db(peak_history[bus_index][1].current_peak); levels.historic_peak_dbfs = metrics.historic_peak_dbfs = to_db( max(peak_history[bus_index][0].historic_peak, peak_history[bus_index][1].historic_peak)); levels.gain_staging_db = metrics.gain_staging_db = gain_staging_db[bus_index]; if (compressor_enabled[bus_index]) { levels.compressor_attenuation_db = metrics.compressor_attenuation_db = -to_db(compressor[bus_index]->get_attenuation()); } else { levels.compressor_attenuation_db = 0.0; metrics.compressor_attenuation_db = 0.0 / 0.0; } } } audio_level_callback(loudness_s, to_db(peak), bus_levels, loudness_i, loudness_range_low, loudness_range_high, to_db(final_makeup_gain), correlation.get_correlation()); } map AudioMixer::get_devices() { lock_guard lock(audio_mutex); map devices; for (unsigned card_index = 0; card_index < MAX_VIDEO_CARDS; ++card_index) { const DeviceSpec spec{ InputSourceType::CAPTURE_CARD, card_index }; const AudioDevice *device = &video_cards[card_index]; DeviceInfo info; info.display_name = device->display_name; info.num_channels = device->num_channels; devices.insert(make_pair(spec, info)); } vector available_alsa_devices = alsa_pool.get_devices(); for (unsigned card_index = 0; card_index < available_alsa_devices.size(); ++card_index) { const DeviceSpec spec{ InputSourceType::ALSA_INPUT, card_index }; const ALSAPool::Device &device = available_alsa_devices[card_index]; DeviceInfo info; info.display_name = device.display_name(); info.num_channels = device.num_channels; info.alsa_name = device.name; info.alsa_info = device.info; info.alsa_address = device.address; devices.insert(make_pair(spec, info)); } return devices; } void AudioMixer::set_device_parameters(DeviceSpec device_spec, const std::string &display_name, CardType card_type, unsigned num_channels, bool active) { AudioDevice *device = find_audio_device(device_spec); lock_guard lock(audio_mutex); if (active || device->display_name.empty()) { device->display_name = display_name; } device->card_type = card_type; device->active = active; } bool AudioMixer::get_active(DeviceSpec device_spec) { AudioDevice *device = find_audio_device(device_spec); lock_guard lock(audio_mutex); return device->active; } void AudioMixer::serialize_device(DeviceSpec device_spec, DeviceSpecProto *device_spec_proto) { lock_guard lock(audio_mutex); switch (device_spec.type) { case InputSourceType::SILENCE: device_spec_proto->set_type(DeviceSpecProto::SILENCE); break; case InputSourceType::CAPTURE_CARD: device_spec_proto->set_type(DeviceSpecProto::CAPTURE_CARD); device_spec_proto->set_index(device_spec.index); device_spec_proto->set_display_name(video_cards[device_spec.index].display_name); break; case InputSourceType::ALSA_INPUT: alsa_pool.serialize_device(device_spec.index, device_spec_proto); break; } } void AudioMixer::set_simple_input(unsigned card_index) { assert(card_index < MAX_VIDEO_CARDS); InputMapping new_input_mapping; InputMapping::Bus input; input.name = "Main"; input.device = DeviceSpec{InputSourceType::CAPTURE_CARD, card_index}; input.source_channel[0] = 0; input.source_channel[1] = 1; new_input_mapping.buses.push_back(input); lock_guard lock(audio_mutex); current_mapping_mode = MappingMode::SIMPLE; set_input_mapping_lock_held(new_input_mapping); fader_volume_db[0] = 0.0f; } unsigned AudioMixer::get_simple_input() const { lock_guard lock(audio_mutex); if (input_mapping.buses.size() == 1 && input_mapping.buses[0].device.type == InputSourceType::CAPTURE_CARD && input_mapping.buses[0].source_channel[0] == 0 && input_mapping.buses[0].source_channel[1] == 1) { return input_mapping.buses[0].device.index; } else { return numeric_limits::max(); } } void AudioMixer::set_input_mapping(const InputMapping &new_input_mapping) { lock_guard lock(audio_mutex); set_input_mapping_lock_held(new_input_mapping); current_mapping_mode = MappingMode::MULTICHANNEL; } AudioMixer::MappingMode AudioMixer::get_mapping_mode() const { lock_guard lock(audio_mutex); return current_mapping_mode; } void AudioMixer::set_input_mapping_lock_held(const InputMapping &new_input_mapping) { map> interesting_channels; for (const InputMapping::Bus &bus : new_input_mapping.buses) { if (bus.device.type == InputSourceType::CAPTURE_CARD || bus.device.type == InputSourceType::ALSA_INPUT) { for (unsigned channel = 0; channel < 2; ++channel) { if (bus.source_channel[channel] != -1) { interesting_channels[bus.device].insert(bus.source_channel[channel]); } } } else { assert(bus.device.type == InputSourceType::SILENCE); } } // Kill all the old metrics, and set up new ones. for (unsigned bus_index = 0; bus_index < input_mapping.buses.size(); ++bus_index) { BusMetrics &metrics = bus_metrics[bus_index]; vector> labels_left = metrics.labels; labels_left.emplace_back("channel", "left"); vector> labels_right = metrics.labels; labels_right.emplace_back("channel", "right"); global_metrics.remove("bus_current_level_dbfs", labels_left); global_metrics.remove("bus_current_level_dbfs", labels_right); global_metrics.remove("bus_peak_level_dbfs", labels_left); global_metrics.remove("bus_peak_level_dbfs", labels_right); global_metrics.remove("bus_historic_peak_dbfs", metrics.labels); global_metrics.remove("bus_gain_staging_db", metrics.labels); global_metrics.remove("bus_compressor_attenuation_db", metrics.labels); } bus_metrics.reset(new BusMetrics[new_input_mapping.buses.size()]); for (unsigned bus_index = 0; bus_index < new_input_mapping.buses.size(); ++bus_index) { const InputMapping::Bus &bus = new_input_mapping.buses[bus_index]; BusMetrics &metrics = bus_metrics[bus_index]; char bus_index_str[16], source_index_str[16], source_channels_str[64]; snprintf(bus_index_str, sizeof(bus_index_str), "%u", bus_index); snprintf(source_index_str, sizeof(source_index_str), "%u", bus.device.index); snprintf(source_channels_str, sizeof(source_channels_str), "%d:%d", bus.source_channel[0], bus.source_channel[1]); vector> labels; metrics.labels.emplace_back("index", bus_index_str); metrics.labels.emplace_back("name", bus.name); if (bus.device.type == InputSourceType::SILENCE) { metrics.labels.emplace_back("source_type", "silence"); } else if (bus.device.type == InputSourceType::CAPTURE_CARD) { AudioDevice *device = find_audio_device(bus.device); if (device->card_type == CardType::FFMPEG_INPUT) { metrics.labels.emplace_back("source_type", "ffmpeg_video_input"); } else { metrics.labels.emplace_back("source_type", "capture_card"); } } else if (bus.device.type == InputSourceType::ALSA_INPUT) { metrics.labels.emplace_back("source_type", "alsa_input"); } else { assert(false); } metrics.labels.emplace_back("source_index", source_index_str); metrics.labels.emplace_back("source_channels", source_channels_str); vector> labels_left = metrics.labels; labels_left.emplace_back("channel", "left"); vector> labels_right = metrics.labels; labels_right.emplace_back("channel", "right"); global_metrics.add("bus_current_level_dbfs", labels_left, &metrics.current_level_dbfs[0], Metrics::TYPE_GAUGE); global_metrics.add("bus_current_level_dbfs", labels_right, &metrics.current_level_dbfs[1], Metrics::TYPE_GAUGE); global_metrics.add("bus_peak_level_dbfs", labels_left, &metrics.peak_level_dbfs[0], Metrics::TYPE_GAUGE); global_metrics.add("bus_peak_level_dbfs", labels_right, &metrics.peak_level_dbfs[1], Metrics::TYPE_GAUGE); global_metrics.add("bus_historic_peak_dbfs", metrics.labels, &metrics.historic_peak_dbfs, Metrics::TYPE_GAUGE); global_metrics.add("bus_gain_staging_db", metrics.labels, &metrics.gain_staging_db, Metrics::TYPE_GAUGE); global_metrics.add("bus_compressor_attenuation_db", metrics.labels, &metrics.compressor_attenuation_db, Metrics::TYPE_GAUGE); } // Reset resamplers for all cards that don't have the exact same state as before. for (unsigned card_index = 0; card_index < MAX_VIDEO_CARDS; ++card_index) { const DeviceSpec device_spec{InputSourceType::CAPTURE_CARD, card_index}; AudioDevice *device = find_audio_device(device_spec); if (device->interesting_channels != interesting_channels[device_spec]) { device->interesting_channels = interesting_channels[device_spec]; reset_resampler_mutex_held(device_spec); } } for (unsigned card_index = 0; card_index < MAX_ALSA_CARDS; ++card_index) { const DeviceSpec device_spec{InputSourceType::ALSA_INPUT, card_index}; AudioDevice *device = find_audio_device(device_spec); if (interesting_channels[device_spec].empty()) { alsa_pool.release_device(card_index); } else { alsa_pool.hold_device(card_index); } if (device->interesting_channels != interesting_channels[device_spec]) { device->interesting_channels = interesting_channels[device_spec]; alsa_pool.reset_device(device_spec.index); reset_resampler_mutex_held(device_spec); } } input_mapping = new_input_mapping; } InputMapping AudioMixer::get_input_mapping() const { lock_guard lock(audio_mutex); return input_mapping; } unsigned AudioMixer::num_buses() const { lock_guard lock(audio_mutex); return input_mapping.buses.size(); } void AudioMixer::reset_peak(unsigned bus_index) { lock_guard lock(audio_mutex); for (unsigned channel = 0; channel < 2; ++channel) { PeakHistory &history = peak_history[bus_index][channel]; history.current_level = 0.0f; history.historic_peak = 0.0f; history.current_peak = 0.0f; history.last_peak = 0.0f; history.age_seconds = 0.0f; } } bool AudioMixer::is_mono(unsigned bus_index) { lock_guard lock(audio_mutex); const InputMapping::Bus &bus = input_mapping.buses[bus_index]; if (bus.device.type == InputSourceType::SILENCE) { return true; } else { assert(bus.device.type == InputSourceType::CAPTURE_CARD || bus.device.type == InputSourceType::ALSA_INPUT); return bus.source_channel[0] == bus.source_channel[1]; } } // This is perhaps not the most user-friendly output, but it's at least better // than the raw index. It would be nice to have it identical to // Mixer::description_for_card for capture cards, though. string AudioMixer::spec_to_string(DeviceSpec device_spec) const { char buf[256]; switch (device_spec.type) { case InputSourceType::SILENCE: return ""; case InputSourceType::CAPTURE_CARD: { const AudioDevice *device = find_audio_device(device_spec); if (device->card_type == CardType::FFMPEG_INPUT) { snprintf(buf, sizeof(buf), "Virtual capture card %u (%s)", device_spec.index, device->display_name.c_str()); } else { snprintf(buf, sizeof(buf), "Capture card %u (%s)", device_spec.index, device->display_name.c_str()); } return buf; } case InputSourceType::ALSA_INPUT: snprintf(buf, sizeof(buf), "ALSA input %u", device_spec.index); return buf; default: assert(false); } } AudioMixer *global_audio_mixer = nullptr; nageru-2.3.0/nageru/audio_mixer.h000066400000000000000000000362451450736322200167520ustar00rootroot00000000000000#ifndef _AUDIO_MIXER_H #define _AUDIO_MIXER_H 1 // The audio mixer, dealing with extracting the right signals from // each capture card, resampling signals so that they are in sync, // processing them with effects (if desired), and then mixing them // all together into one final audio signal. // // All operations on AudioMixer (except destruction) are thread-safe. #include #include #include #include #include #include #include #include #include #include #include #include #include "alsa_pool.h" #include "card_type.h" #include "correlation_measurer.h" #include "decibel.h" #include "defs.h" #include "ebu_r128_proc.h" #include "filter.h" #include "input_mapping.h" #include "resampling_queue.h" #include "stereocompressor.h" class DeviceSpecProto; namespace bmusb { struct AudioFormat; } // namespace bmusb // Convert the given audio from {16,24,32}-bit M-channel to 32-bit N-channel PCM. // Assumes little-endian and chunky, signed PCM throughout. std::vector convert_audio_to_fixed32(const uint8_t *data, unsigned num_samples, bmusb::AudioFormat audio_format, unsigned num_destination_channels); enum EQBand { EQ_BAND_BASS = 0, EQ_BAND_MID, EQ_BAND_TREBLE, NUM_EQ_BANDS }; class AudioMixer { public: AudioMixer(); void reset_resampler(DeviceSpec device_spec); void reset_meters(); // Add audio (or silence) to the given device's queue. Can return false if // the lock wasn't successfully taken; if so, you should simply try again. // (This is to avoid a deadlock where a card hangs on the mutex in add_audio() // while we are trying to shut it down from another thread that also holds // the mutex.) bool add_audio(DeviceSpec device_spec, const uint8_t *data, unsigned num_samples, bmusb::AudioFormat audio_format, std::chrono::steady_clock::time_point frame_time); bool add_silence(DeviceSpec device_spec, unsigned samples_per_frame, unsigned num_frames); // If a given device is offline for whatever reason and cannot deliver audio // (by means of add_audio() or add_silence()), you can call put it in silence mode, // where it will be taken to only output silence. Note that when taking it _out_ // of silence mode, the resampler will be reset, so that old audio will not // affect it. Same true/false behavior as add_audio(). bool silence_card(DeviceSpec device_spec, bool silence); std::vector get_output(std::chrono::steady_clock::time_point ts, unsigned num_samples, ResamplingQueue::RateAdjustmentPolicy rate_adjustment_policy); float get_fader_volume(unsigned bus_index) const { return fader_volume_db[bus_index]; } void set_fader_volume(unsigned bus_index, float level_db) { fader_volume_db[bus_index] = level_db; } bool get_mute(unsigned bus_index) const { return mute[bus_index]; } void set_mute(unsigned bus_index, bool muted) { mute[bus_index] = muted; } // Note: This operation holds all ALSA devices (see ALSAPool::get_devices()). // You will need to call set_input_mapping() to get the hold state correctly, // or every card will be held forever. std::map get_devices(); // See comments on ALSAPool::get_card_state(). ALSAPool::Device::State get_alsa_card_state(unsigned index) { return alsa_pool.get_card_state(index); } // See comments on ALSAPool::create_dead_card(). DeviceSpec create_dead_card(const std::string &name, const std::string &info, unsigned num_channels) { unsigned dead_card_index = alsa_pool.create_dead_card(name, info, num_channels); return DeviceSpec{InputSourceType::ALSA_INPUT, dead_card_index}; } // NOTE: The display name is not overridden if active == false. void set_device_parameters(DeviceSpec device_spec, const std::string &display_name, CardType card_type, unsigned num_channels, bool active); bool get_active(DeviceSpec device_spec); // Note: The card should be held (currently this isn't enforced, though). void serialize_device(DeviceSpec device_spec, DeviceSpecProto *device_spec_proto); enum class MappingMode { // A single bus, only from a video card (no ALSA devices), // only channel 1 and 2, locked to +0 dB. Note that this is // only an UI abstraction around exactly the same audio code // as MULTICHANNEL; it's just less flexible. SIMPLE, // Full, arbitrary mappings. MULTICHANNEL }; // Automatically sets mapping mode to MappingMode::SIMPLE. void set_simple_input(unsigned card_index); // If mapping mode is not representable as a MappingMode::SIMPLE type // mapping, returns numeric_limits::max(). unsigned get_simple_input() const; // Implicitly sets mapping mode to MappingMode::MULTICHANNEL. void set_input_mapping(const InputMapping &input_mapping); MappingMode get_mapping_mode() const; InputMapping get_input_mapping() const; unsigned num_buses() const; void set_locut_cutoff(float cutoff_hz) { locut_cutoff_hz = cutoff_hz; } float get_locut_cutoff() const { return locut_cutoff_hz; } void set_locut_enabled(unsigned bus, bool enabled) { locut_enabled[bus] = enabled; } bool get_locut_enabled(unsigned bus) { return locut_enabled[bus]; } bool is_mono(unsigned bus_index); void set_stereo_width(unsigned bus_index, float width) { stereo_width[bus_index] = width; } float get_stereo_width(unsigned bus_index) { return stereo_width[bus_index]; } void set_eq(unsigned bus_index, EQBand band, float db_gain) { assert(band >= 0 && band < NUM_EQ_BANDS); eq_level_db[bus_index][band] = db_gain; } float get_eq(unsigned bus_index, EQBand band) const { assert(band >= 0 && band < NUM_EQ_BANDS); return eq_level_db[bus_index][band]; } float get_limiter_threshold_dbfs() const { return limiter_threshold_dbfs; } float get_compressor_threshold_dbfs(unsigned bus_index) const { return compressor_threshold_dbfs[bus_index]; } void set_limiter_threshold_dbfs(float threshold_dbfs) { limiter_threshold_dbfs = threshold_dbfs; } void set_compressor_threshold_dbfs(unsigned bus_index, float threshold_dbfs) { compressor_threshold_dbfs[bus_index] = threshold_dbfs; } void set_limiter_enabled(bool enabled) { limiter_enabled = enabled; } bool get_limiter_enabled() const { return limiter_enabled; } void set_compressor_enabled(unsigned bus_index, bool enabled) { compressor_enabled[bus_index] = enabled; } bool get_compressor_enabled(unsigned bus_index) const { return compressor_enabled[bus_index]; } void set_gain_staging_db(unsigned bus_index, float gain_db) { std::lock_guard lock(compressor_mutex); level_compressor_enabled[bus_index] = false; gain_staging_db[bus_index] = gain_db; } float get_gain_staging_db(unsigned bus_index) const { std::lock_guard lock(compressor_mutex); return gain_staging_db[bus_index]; } void set_gain_staging_auto(unsigned bus_index, bool enabled) { std::lock_guard lock(compressor_mutex); level_compressor_enabled[bus_index] = enabled; } bool get_gain_staging_auto(unsigned bus_index) const { std::lock_guard lock(compressor_mutex); return level_compressor_enabled[bus_index]; } void set_final_makeup_gain_db(float gain_db) { std::lock_guard lock(compressor_mutex); final_makeup_gain_auto = false; final_makeup_gain = from_db(gain_db); } float get_final_makeup_gain_db() { std::lock_guard lock(compressor_mutex); return to_db(final_makeup_gain); } void set_final_makeup_gain_auto(bool enabled) { std::lock_guard lock(compressor_mutex); final_makeup_gain_auto = enabled; } bool get_final_makeup_gain_auto() const { std::lock_guard lock(compressor_mutex); return final_makeup_gain_auto; } void reset_peak(unsigned bus_index); struct BusLevel { float current_level_dbfs[2]; // Digital peak of last frame, left and right. float peak_level_dbfs[2]; // Digital peak with hold, left and right. float historic_peak_dbfs; float gain_staging_db; float compressor_attenuation_db; // A positive number; 0.0 for no attenuation. }; typedef std::function bus_levels, float global_level_lufs, float range_low_lufs, float range_high_lufs, float final_makeup_gain_db, float correlation)> audio_level_callback_t; void set_audio_level_callback(audio_level_callback_t callback) { audio_level_callback = callback; } typedef std::function state_changed_callback_t; void set_state_changed_callback(state_changed_callback_t callback) { state_changed_callback = callback; } state_changed_callback_t get_state_changed_callback() const { return state_changed_callback; } void trigger_state_changed_callback() { if (state_changed_callback != nullptr) { state_changed_callback(); } } // A combination of all settings for a bus. Useful if you want to get // or store them as a whole without bothering to call all of the get_* // or set_* functions for that bus. struct BusSettings { float fader_volume_db; bool muted; bool locut_enabled; float stereo_width; float eq_level_db[NUM_EQ_BANDS]; float gain_staging_db; bool level_compressor_enabled; float compressor_threshold_dbfs; bool compressor_enabled; }; static BusSettings get_default_bus_settings(); BusSettings get_bus_settings(unsigned bus_index) const; void set_bus_settings(unsigned bus_index, const BusSettings &settings); private: struct AudioDevice { std::unique_ptr resampling_queue; std::string display_name; unsigned capture_frequency = OUTPUT_FREQUENCY; // Which channels we consider interesting (ie., are part of some input_mapping). std::set interesting_channels; bool silenced = false; CardType card_type; unsigned num_channels = 2; // Ignored for ALSA cards, which check the device directly. bool active = false; // Only really relevant for capture cards (not ALSA cards). }; const AudioDevice *find_audio_device(DeviceSpec device_spec) const { return const_cast(this)->find_audio_device(device_spec); } AudioDevice *find_audio_device(DeviceSpec device_spec); void find_sample_src_from_device(const std::map> &samples_card, DeviceSpec device_spec, int source_channel, const float **srcptr, unsigned *stride); void fill_audio_bus(const std::map> &samples_card, const InputMapping::Bus &bus, unsigned num_samples, float stereo_width, float *output); void reset_resampler_mutex_held(DeviceSpec device_spec); void apply_eq(unsigned bus_index, std::vector *samples_bus); void update_meters(const std::vector &samples); void add_bus_to_master(unsigned bus_index, const std::vector &samples_bus, std::vector *samples_out); void measure_bus_levels(unsigned bus_index, const std::vector &left, const std::vector &right); void send_audio_level_callback(); std::vector get_active_devices() const; void set_input_mapping_lock_held(const InputMapping &input_mapping); std::string spec_to_string(DeviceSpec device_spec) const; mutable std::timed_mutex audio_mutex; ALSAPool alsa_pool; AudioDevice video_cards[MAX_VIDEO_CARDS]; // Under audio_mutex. AudioDevice alsa_inputs[MAX_ALSA_CARDS]; // Under audio_mutex. std::atomic locut_cutoff_hz{120}; StereoFilter locut[MAX_BUSES]; // Default cutoff 120 Hz, 24 dB/oct. std::atomic locut_enabled[MAX_BUSES]; StereoFilter eq[MAX_BUSES][NUM_EQ_BANDS]; // The one for EQBand::MID isn't actually used (see comments in apply_eq()). // First compressor; takes us up to about -12 dBFS. mutable std::mutex compressor_mutex; std::unique_ptr level_compressor[MAX_BUSES]; // Under compressor_mutex. Used to set/override gain_staging_db if . float gain_staging_db[MAX_BUSES]; // Under compressor_mutex. float last_gain_staging_db[MAX_BUSES]; // Under compressor_mutex. bool level_compressor_enabled[MAX_BUSES]; // Under compressor_mutex. static constexpr float ref_level_dbfs = -14.0f; // Chosen so that we end up around 0 LU in practice. static constexpr float ref_level_lufs = -23.0f; // 0 LU, more or less by definition. StereoCompressor limiter; std::atomic limiter_threshold_dbfs{ref_level_dbfs + 4.0f}; // 4 dB. std::atomic limiter_enabled{true}; std::unique_ptr compressor[MAX_BUSES]; std::atomic compressor_threshold_dbfs[MAX_BUSES]; std::atomic compressor_enabled[MAX_BUSES]; // Note: The values here are not in dB. struct PeakHistory { float current_level = 0.0f; // Peak of the last frame. float historic_peak = 0.0f; // Highest peak since last reset; no falloff. float current_peak = 0.0f; // Current peak of the peak meter. float last_peak = 0.0f; float age_seconds = 0.0f; // Time since "last_peak" was set. }; PeakHistory peak_history[MAX_BUSES][2]; // Separate for each channel. Under audio_mutex. double final_makeup_gain = 1.0; // Under compressor_mutex. Read/write by the user. Note: Not in dB, we want the numeric precision so that we can change it slowly. bool final_makeup_gain_auto = true; // Under compressor_mutex. MappingMode current_mapping_mode; // Under audio_mutex. InputMapping input_mapping; // Under audio_mutex. std::atomic fader_volume_db[MAX_BUSES] {{ 0.0f }}; std::atomic mute[MAX_BUSES] {{ false }}; float last_fader_volume_db[MAX_BUSES] { 0.0f }; // Under audio_mutex. std::atomic stereo_width[MAX_BUSES] {{ 0.0f }}; // Default 1.0f (is set in constructor). std::atomic eq_level_db[MAX_BUSES][NUM_EQ_BANDS] {{{ 0.0f }}}; float last_eq_level_db[MAX_BUSES][NUM_EQ_BANDS] {{ 0.0f }}; audio_level_callback_t audio_level_callback = nullptr; state_changed_callback_t state_changed_callback = nullptr; mutable std::mutex audio_measure_mutex; Ebu_r128_proc r128; // Under audio_measure_mutex. CorrelationMeasurer correlation; // Under audio_measure_mutex. Resampler peak_resampler; // Under audio_measure_mutex. std::atomic peak{0.0f}; // Metrics. std::atomic metric_audio_loudness_short_lufs{0.0 / 0.0}; std::atomic metric_audio_loudness_integrated_lufs{0.0 / 0.0}; std::atomic metric_audio_loudness_range_low_lufs{0.0 / 0.0}; std::atomic metric_audio_loudness_range_high_lufs{0.0 / 0.0}; std::atomic metric_audio_peak_dbfs{0.0 / 0.0}; std::atomic metric_audio_final_makeup_gain_db{0.0}; std::atomic metric_audio_correlation{0.0}; // These are all gauges corresponding to the elements of BusLevel. // In a sense, they'd probably do better as histograms, but that's an // awful lot of time series when you have many buses. struct BusMetrics { std::vector> labels; std::atomic current_level_dbfs[2]{{0.0/0.0},{0.0/0.0}}; std::atomic peak_level_dbfs[2]{{0.0/0.0},{0.0/0.0}}; std::atomic historic_peak_dbfs{0.0/0.0}; std::atomic gain_staging_db{0.0/0.0}; std::atomic compressor_attenuation_db{0.0/0.0}; }; std::unique_ptr bus_metrics; // One for each bus in . }; extern AudioMixer *global_audio_mixer; #endif // !defined(_AUDIO_MIXER_H) nageru-2.3.0/nageru/av1_encoder.cpp000066400000000000000000000301671450736322200171630ustar00rootroot00000000000000#include "av1_encoder.h" #include #include #include #include #include #include #include #include #include #include #include #include #include "defs.h" #include "flags.h" #include "shared/metrics.h" #include "shared/mux.h" #include "print_latency.h" #include "shared/timebase.h" #include "shared/memcpy_interleaved.h" extern "C" { #include #include } using namespace movit; using namespace std; using namespace std::chrono; using namespace std::placeholders; namespace { // AV1Encoder can be restarted if --record-av1-video is set, so make these // metrics global. atomic metric_av1_queued_frames{0}; atomic metric_av1_max_queued_frames{AV1_QUEUE_LENGTH}; atomic metric_av1_dropped_frames{0}; atomic metric_av1_output_frames_i{0}; atomic metric_av1_output_frames_p{0}; Histogram metric_av1_qp; LatencyHistogram av1_latency_histogram; once_flag av1_metrics_inited; } // namespace AV1Encoder::AV1Encoder(const AVOutputFormat *oformat) : wants_global_headers(oformat->flags & AVFMT_GLOBALHEADER) { call_once(av1_metrics_inited, []{ global_metrics.add("av1_queued_frames", {}, &metric_av1_queued_frames, Metrics::TYPE_GAUGE); global_metrics.add("av1_max_queued_frames", {}, &metric_av1_max_queued_frames, Metrics::TYPE_GAUGE); global_metrics.add("av1_dropped_frames", {}, &metric_av1_dropped_frames); global_metrics.add("av1_output_frames", {{ "type", "i" }}, &metric_av1_output_frames_i); global_metrics.add("av1_output_frames", {{ "type", "p" }}, &metric_av1_output_frames_p); metric_av1_qp.init_uniform(50); global_metrics.add("av1_qp", {}, &metric_av1_qp); av1_latency_histogram.init("av1"); }); const size_t bytes_per_pixel = global_flags.bit_depth > 8 ? 2 : 1; frame_pool.reset(new uint8_t[global_flags.width * global_flags.height * 2 * bytes_per_pixel * AV1_QUEUE_LENGTH]); for (unsigned i = 0; i < AV1_QUEUE_LENGTH; ++i) { free_frames.push(frame_pool.get() + i * (global_flags.width * global_flags.height * 2 * bytes_per_pixel)); } encoder_thread = thread(&AV1Encoder::encoder_thread_func, this); } AV1Encoder::~AV1Encoder() { should_quit = true; queued_frames_nonempty.notify_all(); encoder_thread.join(); } void AV1Encoder::add_frame(int64_t pts, int64_t duration, YCbCrLumaCoefficients ycbcr_coefficients, const uint8_t *data, const ReceivedTimestamps &received_ts) { assert(!should_quit); QueuedFrame qf; qf.pts = pts; qf.duration = duration; qf.ycbcr_coefficients = ycbcr_coefficients; qf.received_ts = received_ts; { lock_guard lock(mu); if (free_frames.empty()) { fprintf(stderr, "WARNING: AV1 queue full, dropping frame with pts %" PRId64 "\n", pts); ++metric_av1_dropped_frames; return; } qf.data = free_frames.front(); free_frames.pop(); } // Since we're copying anyway, we can unpack from NV12 to fully planar on the fly. // SVT-AV1 makes its own copy, though, and it would have been nice to avoid the // double-copy (and also perhaps let the GPU do the 10-bit compression SVT-AV1 // wants, instead of doing it on the CPU). const size_t bytes_per_pixel = global_flags.bit_depth > 8 ? 2 : 1; size_t frame_size = global_flags.width * global_flags.height * bytes_per_pixel; assert(global_flags.width % 2 == 0); assert(global_flags.height % 2 == 0); uint8_t *y = qf.data; uint8_t *cb = y + frame_size; uint8_t *cr = cb + frame_size / 4; memcpy(y, data, frame_size); if (global_flags.bit_depth == 8) { memcpy_interleaved(cb, cr, data + frame_size, frame_size / 2); } else { const uint16_t *src = reinterpret_cast(data + frame_size); uint16_t *cb16 = reinterpret_cast(cb); uint16_t *cr16 = reinterpret_cast(cr); memcpy_interleaved_word(cb16, cr16, src, frame_size / 4); } { lock_guard lock(mu); queued_frames.push(qf); queued_frames_nonempty.notify_all(); metric_av1_queued_frames = queued_frames.size(); } } void AV1Encoder::init_av1() { EbSvtAv1EncConfiguration config; // svt_av1_enc_init_handle() is defined to fill config with the defaults; // yet, seemingly, not everything is written, and some of it can cause // Valgrind warnings and/or crashes. It should never hurt to put it // into a known state beforehand, and it seems to fix the crashes, // so we do that. memset(&config, 0, sizeof(config)); EbErrorType ret = svt_av1_enc_init_handle(&encoder, nullptr, &config); if (ret != EB_ErrorNone) { fprintf(stderr, "Error initializing SVT-AV1 handle (error %08x)\n", ret); exit(EXIT_FAILURE); } // NOTE: We don't set CBR, as it requires low-delay mode, which is // generally problematic wrt. quality and performance. config.enc_mode = global_flags.av1_preset; config.intra_period_length = 63; // Approx. one second, conforms to the (n % 8) - 1 == 0 rule. config.source_width = global_flags.width; config.source_height = global_flags.height; config.frame_rate_numerator = global_flags.av1_fps_num; config.frame_rate_denominator = global_flags.av1_fps_den; config.encoder_bit_depth = global_flags.bit_depth; config.rate_control_mode = 1; // VBR. config.target_bit_rate = global_flags.av1_bitrate * 1000; // NOTE: These should be in sync with the ones in quicksync_encoder.cpp (sps_rbsp()). config.color_primaries = EB_CICP_CP_BT_709; config.transfer_characteristics = EB_CICP_TC_SRGB; if (global_flags.ycbcr_rec709_coefficients) { config.matrix_coefficients = EB_CICP_MC_BT_709; } else { config.matrix_coefficients = EB_CICP_MC_BT_601; } config.color_range = EB_CR_STUDIO_RANGE; config.chroma_sample_position = EB_CSP_VERTICAL; const vector &extra_param = global_flags.av1_extra_param; for (const string &str : extra_param) { const size_t pos = str.find(','); if (pos == string::npos) { if (svt_av1_enc_parse_parameter(&config, str.c_str(), nullptr) != EB_ErrorNone) { fprintf(stderr, "ERROR: SVT-AV1 rejected parameter '%s' with no value\n", str.c_str()); exit(EXIT_FAILURE); } } else { const string key = str.substr(0, pos); const string value = str.substr(pos + 1); if (svt_av1_enc_parse_parameter(&config, key.c_str(), value.c_str()) != EB_ErrorNone) { fprintf(stderr, "ERROR: SVT-AV1 rejected parameter '%s' set to '%s'\n", key.c_str(), value.c_str()); exit(EXIT_FAILURE); } } } ret = svt_av1_enc_set_parameter(encoder, &config); if (ret != EB_ErrorNone) { fprintf(stderr, "Error configuring SVT-AV1 (error %08x)\n", ret); exit(EXIT_FAILURE); } ret = svt_av1_enc_init(encoder); if (ret != EB_ErrorNone) { fprintf(stderr, "Error initializing SVT-AV1 (error %08x)\n", ret); exit(EXIT_FAILURE); } if (wants_global_headers) { EbBufferHeaderType *header = NULL; ret = svt_av1_enc_stream_header(encoder, &header); if (ret != EB_ErrorNone) { fprintf(stderr, "Error building SVT-AV1 header (error %08x)\n", ret); exit(EXIT_FAILURE); } global_headers = string(reinterpret_cast(header->p_buffer), header->n_filled_len); svt_av1_enc_stream_header_release(header); // Don't care about errors. } } void AV1Encoder::encoder_thread_func() { if (nice(5) == -1) { perror("nice()"); // No exit; it's not fatal. } pthread_setname_np(pthread_self(), "AV1_encode"); init_av1(); av1_init_done = true; bool frames_left; do { QueuedFrame qf; // Wait for a queued frame, then dequeue it. { unique_lock lock(mu); queued_frames_nonempty.wait(lock, [this]() { return !queued_frames.empty() || should_quit; }); if (!queued_frames.empty()) { qf = queued_frames.front(); queued_frames.pop(); } else { qf.pts = -1; qf.duration = -1; qf.data = nullptr; } metric_av1_queued_frames = queued_frames.size(); frames_left = !queued_frames.empty(); } encode_frame(qf); { lock_guard lock(mu); free_frames.push(qf.data); } // We should quit only if the should_quit flag is set _and_ we have nothing // in our queue. } while (!should_quit || frames_left); // Signal end of stream. EbBufferHeaderType hdr; hdr.n_alloc_len = 0; hdr.n_filled_len = 0; hdr.n_tick_count = 0; hdr.p_app_private = nullptr; hdr.pic_type = EB_AV1_INVALID_PICTURE; hdr.p_buffer = nullptr; hdr.metadata = nullptr; hdr.flags = EB_BUFFERFLAG_EOS; svt_av1_enc_send_picture(encoder, &hdr); bool seen_eof = false; do { EbBufferHeaderType *buf; EbErrorType ret = svt_av1_enc_get_packet(encoder, &buf, /*pic_send_done=*/true); if (ret == EB_NoErrorEmptyQueue) { assert(false); } seen_eof = (buf->flags & EB_BUFFERFLAG_EOS); process_packet(buf); } while (!seen_eof); svt_av1_enc_deinit(encoder); svt_av1_enc_deinit_handle(encoder); } void AV1Encoder::encode_frame(AV1Encoder::QueuedFrame qf) { if (qf.data) { const size_t bytes_per_pixel = global_flags.bit_depth > 8 ? 2 : 1; EbSvtIOFormat pic; pic.luma = qf.data; pic.cb = pic.luma + global_flags.width * global_flags.height * bytes_per_pixel; pic.cr = pic.cb + (global_flags.width * global_flags.height / 4) * bytes_per_pixel; pic.y_stride = global_flags.width; // In pixels, so no bytes_per_pixel. pic.cb_stride = global_flags.width / 2; // Likewise. pic.cr_stride = global_flags.width / 2; // Likewise. pic.width = global_flags.width; pic.height = global_flags.height; pic.org_x = 0; pic.org_y = 0; pic.color_fmt = EB_YUV420; pic.bit_depth = global_flags.bit_depth > 8 ? EB_TEN_BIT : EB_EIGHT_BIT; EbBufferHeaderType hdr; hdr.p_buffer = reinterpret_cast(&pic); hdr.n_alloc_len = (global_flags.width * global_flags.height * 3 / 2) * bytes_per_pixel; hdr.n_filled_len = hdr.n_alloc_len; hdr.n_tick_count = 0; hdr.p_app_private = nullptr; hdr.pic_type = EB_AV1_INVALID_PICTURE; // Actually means auto, according to FFmpeg. hdr.metadata = nullptr; hdr.flags = 0; hdr.pts = av_rescale_q(qf.pts, AVRational{ 1, TIMEBASE }, AVRational{ global_flags.av1_fps_den, global_flags.av1_fps_num }); if (hdr.pts <= last_pts) { fprintf(stderr, "WARNING: Receiving frames faster than given --av1-fps value (%d/%d); dropping frame.\n", global_flags.av1_fps_num, global_flags.av1_fps_den); } else { svt_av1_enc_send_picture(encoder, &hdr); frames_being_encoded[hdr.pts] = qf.received_ts; last_pts = hdr.pts; } } for ( ;; ) { EbBufferHeaderType *buf; EbErrorType ret = svt_av1_enc_get_packet(encoder, &buf, /*pic_send_done=*/false); if (ret == EB_NoErrorEmptyQueue) { return; } process_packet(buf); } } void AV1Encoder::process_packet(EbBufferHeaderType *buf) { if (buf->n_filled_len == 0) { // TODO: Can this ever happen? svt_av1_enc_release_out_buffer(&buf); return; } switch (buf->pic_type) { case EB_AV1_KEY_PICTURE: case EB_AV1_INTRA_ONLY_PICTURE: ++metric_av1_output_frames_i; break; case EB_AV1_INTER_PICTURE: // We don't really know whether it's P or B. ++metric_av1_output_frames_p; break; default: break; } metric_av1_qp.count_event(buf->qp); if (frames_being_encoded.count(buf->pts)) { ReceivedTimestamps received_ts = frames_being_encoded[buf->pts]; frames_being_encoded.erase(buf->pts); static int frameno = 0; print_latency("Current AV1 latency (video inputs → network mux):", received_ts, /*b_frame=*/false, &frameno, &av1_latency_histogram); } else { assert(false); } AVPacket pkt; memset(&pkt, 0, sizeof(pkt)); pkt.buf = nullptr; pkt.data = buf->p_buffer; pkt.size = buf->n_filled_len; pkt.stream_index = 0; if (buf->pic_type == EB_AV1_KEY_PICTURE) { pkt.flags = AV_PKT_FLAG_KEY; } else if (buf->pic_type == EB_AV1_NON_REF_PICTURE) { // I have no idea if this does anything in practice, // but the libavcodec plugin does it. pkt.flags = AV_PKT_FLAG_DISPOSABLE; } else { pkt.flags = 0; } pkt.pts = av_rescale_q(buf->pts, AVRational{ global_flags.av1_fps_den, global_flags.av1_fps_num }, AVRational{ 1, TIMEBASE }); pkt.dts = av_rescale_q(buf->dts, AVRational{ global_flags.av1_fps_den, global_flags.av1_fps_num }, AVRational{ 1, TIMEBASE }); for (Mux *mux : muxes) { mux->add_packet(pkt, pkt.pts, pkt.dts); } svt_av1_enc_release_out_buffer(&buf); } nageru-2.3.0/nageru/av1_encoder.h000066400000000000000000000072441450736322200166300ustar00rootroot00000000000000// An AV1 encoder using the SVT-AV1 encoder library. (libaom does not seem // to be suitable for real-time streaming as of 2022, as it is not using // threads particularly efficiently.) AV1 is a newer format than H.264, // obviously both for better and for worse: Higher coding efficiency // (with sufficient amount of cores, SVT-AV1 is even better than x264 // at higher frame rates), but generally smaller ecosystem, no speed // control, less sophisticated rate control, etc.. // // We don't support storing AV1 to disk currently, only to HTTP. // We also don't support hardware AV1 encoding, as hardware supporting it // is very rare currently. // // Since SVT-AV1 does not support VFR, you need to declare the frame rate // up-front, using the --av1-framerate flag. If the given frame rate is // too high (ie., you are producing frames too slowly), rate control will get // confused and use too little bitrate. If it is too low, Nageru will need to // drop frames before input to the encoder. #ifndef _AV1_ENCODER_H #define _AV1_ENCODER_H 1 #include #include #include #include #include #include #include #include #include #include #include extern "C" { #include } #include #include "defs.h" #include "shared/metrics.h" #include "print_latency.h" #include "video_codec_interface.h" class Mux; struct EbBufferHeaderType; struct EbComponentType; class AV1Encoder : public VideoCodecInterface { public: AV1Encoder(const AVOutputFormat *oformat); // Does not take ownership. // Called after the last frame. Will block; once this returns, // the last data is flushed. ~AV1Encoder() override; // Must be called before first frame. Does not take ownership. void add_mux(Mux *mux) override { muxes.push_back(mux); } // is taken to be raw NV12 data of WIDTHxHEIGHT resolution. // Does not block. void add_frame(int64_t pts, int64_t duration, movit::YCbCrLumaCoefficients ycbcr_coefficients, const uint8_t *data, const ReceivedTimestamps &received_ts) override; std::string get_global_headers() const override { while (!av1_init_done) { sched_yield(); } return global_headers; } private: struct QueuedFrame { int64_t pts, duration; movit::YCbCrLumaCoefficients ycbcr_coefficients; uint8_t *data; ReceivedTimestamps received_ts; }; void encoder_thread_func(); void init_av1(); void encode_frame(QueuedFrame qf); void process_packet(EbBufferHeaderType *buf); // Takes ownership. // One big memory chunk of all 50 (or whatever) frames, allocated in // the constructor. All data functions just use pointers into this // pool. std::unique_ptr frame_pool; std::vector muxes; const bool wants_global_headers; std::string global_headers; std::thread encoder_thread; std::atomic av1_init_done{false}; std::atomic should_quit{false}; EbComponentType *encoder; int64_t last_pts = -1; // Protects everything below it. std::mutex mu; // Frames that are not being encoded or waiting to be encoded, // so that add_frame() can use new ones. // TODO: Do we actually need this queue, or is SVT-AV1's queue // non-blocking so that we can drop it? std::queue free_frames; // Frames that are waiting to be encoded (ie., add_frame() has been // called, but they are not picked up for encoding yet). std::queue queued_frames; // Whenever the state of changes. std::condition_variable queued_frames_nonempty; // Key is the pts of the frame. std::unordered_map frames_being_encoded; }; #endif // !defined(_AV1_ENCODER_H) nageru-2.3.0/nageru/basic_stats.cpp000066400000000000000000000117641450736322200172760ustar00rootroot00000000000000#include "basic_stats.h" #include "shared/metrics.h" #include #include #include // Epoxy seems to be missing these. Taken from the NVX_gpu_memory_info spec. #ifndef GPU_MEMORY_INFO_DEDICATED_VIDMEM_NVX #define GPU_MEMORY_INFO_DEDICATED_VIDMEM_NVX 0x9047 #endif #ifndef GPU_MEMORY_INFO_TOTAL_AVAILABLE_MEMORY_NVX #define GPU_MEMORY_INFO_TOTAL_AVAILABLE_MEMORY_NVX 0x9048 #endif #ifndef GPU_MEMORY_INFO_CURRENT_AVAILABLE_VIDMEM_NVX #define GPU_MEMORY_INFO_CURRENT_AVAILABLE_VIDMEM_NVX 0x9049 #endif #ifndef GPU_MEMORY_INFO_EVICTION_COUNT_NVX #define GPU_MEMORY_INFO_EVICTION_COUNT_NVX 0x904A #endif #ifndef GPU_MEMORY_INFO_EVICTED_MEMORY_NVX #define GPU_MEMORY_INFO_EVICTED_MEMORY_NVX 0x904B #endif using namespace std; using namespace std::chrono; bool uses_mlock = false; BasicStats::BasicStats(bool verbose, bool use_opengl) : verbose(verbose) { start = steady_clock::now(); metric_start_time_seconds = get_timestamp_for_metrics(); global_metrics.add("frames_output_total", &metric_frames_output_total); global_metrics.add("frames_output_dropped", &metric_frames_output_dropped); global_metrics.add("start_time_seconds", &metric_start_time_seconds, Metrics::TYPE_GAUGE); global_metrics.add("memory_used_bytes", &metrics_memory_used_bytes); global_metrics.add("memory_locked_limit_bytes", &metrics_memory_locked_limit_bytes); // TODO: It would be nice to compile this out entirely for Kaeru, // to avoid pulling in the symbols from libGL/Epoxy. if (use_opengl) { gpu_memory_stats.reset(new GPUMemoryStats(verbose)); } } void BasicStats::update(int frame_num, int stats_dropped_frames) { steady_clock::time_point now = steady_clock::now(); double elapsed = duration(now - start).count(); metric_frames_output_total = frame_num; metric_frames_output_dropped = stats_dropped_frames; if (frame_num % 100 != 0) { return; } if (verbose) { printf("%d frames (%d dropped) in %.3f seconds = %.1f fps (%.1f ms/frame)", frame_num, stats_dropped_frames, elapsed, frame_num / elapsed, 1e3 * elapsed / frame_num); } // Check our memory usage, to see if we are close to our mlockall() // limit (if at all set). rusage used; if (getrusage(RUSAGE_SELF, &used) == -1) { perror("getrusage(RUSAGE_SELF)"); assert(false); } metrics_memory_used_bytes = used.ru_maxrss * 1024; if (uses_mlock) { rlimit limit; if (getrlimit(RLIMIT_MEMLOCK, &limit) == -1) { perror("getrlimit(RLIMIT_MEMLOCK)"); assert(false); } metrics_memory_locked_limit_bytes = limit.rlim_cur; if (verbose) { if (limit.rlim_cur == 0) { printf(", using %ld MB memory (locked)", long(used.ru_maxrss / 1024)); } else { printf(", using %ld / %ld MB lockable memory (%.1f%%)", long(used.ru_maxrss / 1024), long(limit.rlim_cur / 1048576), float(100.0 * (used.ru_maxrss * 1024.0) / limit.rlim_cur)); } } } else { metrics_memory_locked_limit_bytes = 0.0 / 0.0; if (verbose) { printf(", using %ld MB memory (not locked)", long(used.ru_maxrss / 1024)); } } if (gpu_memory_stats != nullptr) { gpu_memory_stats->update(); } if (verbose) { printf("\n"); } } GPUMemoryStats::GPUMemoryStats(bool verbose) : verbose(verbose) { // GL_NV_query_memory is exposed but supposedly only works on // Quadro/Titan cards, so we use GL_NVX_gpu_memory_info even though it's // formally marked as experimental. // Intel/Mesa doesn't seem to have anything comparable (at least nothing // that gets the amount of _available_ memory). supported = epoxy_has_gl_extension("GL_NVX_gpu_memory_info"); if (supported) { global_metrics.add("memory_gpu_total_bytes", &metric_memory_gpu_total_bytes, Metrics::TYPE_GAUGE); global_metrics.add("memory_gpu_dedicated_bytes", &metric_memory_gpu_dedicated_bytes, Metrics::TYPE_GAUGE); global_metrics.add("memory_gpu_used_bytes", &metric_memory_gpu_used_bytes, Metrics::TYPE_GAUGE); global_metrics.add("memory_gpu_evicted_bytes", &metric_memory_gpu_evicted_bytes, Metrics::TYPE_GAUGE); global_metrics.add("memory_gpu_evictions", &metric_memory_gpu_evictions); } } void GPUMemoryStats::update() { if (!supported) { return; } GLint total, dedicated, available, evicted, evictions; glGetIntegerv(GPU_MEMORY_INFO_TOTAL_AVAILABLE_MEMORY_NVX, &total); glGetIntegerv(GPU_MEMORY_INFO_DEDICATED_VIDMEM_NVX, &dedicated); glGetIntegerv(GPU_MEMORY_INFO_CURRENT_AVAILABLE_VIDMEM_NVX, &available); glGetIntegerv(GPU_MEMORY_INFO_EVICTED_MEMORY_NVX, &evicted); glGetIntegerv(GPU_MEMORY_INFO_EVICTION_COUNT_NVX, &evictions); if (glGetError() == 0) { metric_memory_gpu_total_bytes = int64_t(total) * 1024; metric_memory_gpu_dedicated_bytes = int64_t(dedicated) * 1024; metric_memory_gpu_used_bytes = int64_t(total - available) * 1024; metric_memory_gpu_evicted_bytes = int64_t(evicted) * 1024; metric_memory_gpu_evictions = evictions; if (verbose) { printf(", using %d / %d MB GPU memory (%.1f%%)", (total - available) / 1024, total / 1024, float(100.0 * (total - available) / total)); } } } nageru-2.3.0/nageru/basic_stats.h000066400000000000000000000025371450736322200167410ustar00rootroot00000000000000#ifndef _BASIC_STATS_H #define _BASIC_STATS_H // Holds some metrics for basic statistics about uptime, memory usage and such. #include #include #include #include extern bool uses_mlock; class GPUMemoryStats; class BasicStats { public: BasicStats(bool verbose, bool use_opengl); void update(int frame_num, int stats_dropped_frames); private: std::chrono::steady_clock::time_point start; bool verbose; std::unique_ptr gpu_memory_stats; // Metrics. std::atomic metric_frames_output_total{0}; std::atomic metric_frames_output_dropped{0}; std::atomic metric_start_time_seconds{0.0 / 0.0}; std::atomic metrics_memory_used_bytes{0}; std::atomic metrics_memory_locked_limit_bytes{0.0 / 0.0}; }; // Holds some metrics for GPU memory usage. Currently only exposed for NVIDIA cards // (no-op on all other platforms). class GPUMemoryStats { public: GPUMemoryStats(bool verbose); void update(); private: bool verbose, supported; // Metrics. std::atomic metric_memory_gpu_total_bytes{0}; std::atomic metric_memory_gpu_dedicated_bytes{0}; std::atomic metric_memory_gpu_used_bytes{0}; std::atomic metric_memory_gpu_evicted_bytes{0}; std::atomic metric_memory_gpu_evictions{0}; }; #endif // !defined(_BASIC_STATS_H) nageru-2.3.0/nageru/benchmark_audio_mixer.cpp000066400000000000000000000115321450736322200213070ustar00rootroot00000000000000// Rather simplistic benchmark of AudioMixer. Sets up a simple mapping // with the default settings, feeds some white noise to the inputs and // runs a while. Useful for e.g. profiling. #include #include #include #include #include #include #include #include #include #include "audio_mixer.h" #include "decibel.h" #include "defs.h" #include "input_mapping.h" #include "resampling_queue.h" #include "shared/timebase.h" #define NUM_BENCHMARK_CARDS 4 #define NUM_WARMUP_FRAMES 100 #define NUM_BENCHMARK_FRAMES 1000 #define NUM_TEST_FRAMES 10 #define NUM_CHANNELS 8 #define NUM_SAMPLES 1024 using namespace std; using namespace std::chrono; // 16-bit samples, white noise at full volume. uint8_t samples16[(NUM_SAMPLES * NUM_CHANNELS + 1024) * sizeof(uint16_t)]; // 24-bit samples, white noise at low volume (-48 dB). uint8_t samples24[(NUM_SAMPLES * NUM_CHANNELS + 1024) * 3]; static uint32_t seed = 1234; // We use our own instead of rand() to get deterministic behavior. // Quality doesn't really matter much. uint32_t lcgrand() { seed = seed * 1103515245u + 12345u; return seed; } void reset_lcgrand() { seed = 1234; } void callback(float level_lufs, float peak_db, std::vector bus_levels, float global_level_lufs, float range_low_lufs, float range_high_lufs, float final_makeup_gain_db, float correlation) { // Empty. } vector process_frame(unsigned frame_num, AudioMixer *mixer) { duration> frame_duration(frame_num); steady_clock::time_point ts = steady_clock::time_point(duration_cast(frame_duration)); // Feed the inputs. for (unsigned card_index = 0; card_index < NUM_BENCHMARK_CARDS; ++card_index) { bmusb::AudioFormat audio_format; audio_format.bits_per_sample = card_index == 3 ? 24 : 16; audio_format.num_channels = NUM_CHANNELS; unsigned num_samples = NUM_SAMPLES + (lcgrand() % 9) - 5; bool ok = mixer->add_audio(DeviceSpec{InputSourceType::CAPTURE_CARD, card_index}, card_index == 3 ? samples24 : samples16, num_samples, audio_format, ts); assert(ok); } return mixer->get_output(ts, NUM_SAMPLES, ResamplingQueue::ADJUST_RATE); } void init_mapping(AudioMixer *mixer) { InputMapping mapping; InputMapping::Bus bus1; bus1.device = DeviceSpec{InputSourceType::CAPTURE_CARD, 0}; bus1.source_channel[0] = 0; bus1.source_channel[1] = 1; mapping.buses.push_back(bus1); InputMapping::Bus bus2; bus2.device = DeviceSpec{InputSourceType::CAPTURE_CARD, 3}; bus2.source_channel[0] = 6; bus2.source_channel[1] = 4; mapping.buses.push_back(bus2); mixer->set_input_mapping(mapping); } void do_test(const char *filename) { AudioMixer mixer; mixer.set_audio_level_callback(callback); init_mapping(&mixer); reset_lcgrand(); vector output; for (unsigned i = 0; i < NUM_TEST_FRAMES; ++i) { vector frame_output = process_frame(i, &mixer); output.insert(output.end(), frame_output.begin(), frame_output.end()); } FILE *fp = fopen(filename, "rb"); if (fp == nullptr) { fprintf(stderr, "%s not found, writing new reference.\n", filename); fp = fopen(filename, "wb"); fwrite(&output[0], output.size() * sizeof(float), 1, fp); fclose(fp); return; } vector ref; ref.resize(output.size()); fread(&ref[0], output.size() * sizeof(float), 1, fp); fclose(fp); float max_err = 0.0f, sum_sq_err = 0.0f; for (unsigned i = 0; i < output.size(); ++i) { float err = output[i] - ref[i]; max_err = max(max_err, fabs(err)); sum_sq_err += err * err; } printf("Largest error: %.6f (%+.1f dB)\n", max_err, to_db(max_err)); printf("RMS error: %+.1f dB\n", to_db(sqrt(sum_sq_err) / output.size())); } void do_benchmark() { AudioMixer mixer; mixer.set_audio_level_callback(callback); init_mapping(&mixer); size_t out_samples = 0; reset_lcgrand(); steady_clock::time_point start, end; for (unsigned i = 0; i < NUM_WARMUP_FRAMES + NUM_BENCHMARK_FRAMES; ++i) { if (i == NUM_WARMUP_FRAMES) { start = steady_clock::now(); } vector output = process_frame(i, &mixer); if (i >= NUM_WARMUP_FRAMES) { out_samples += output.size(); } } end = steady_clock::now(); double elapsed = duration(end - start).count(); double simulated = double(out_samples) / (OUTPUT_FREQUENCY * 2); printf("%zu samples produced in %.1f ms (%.1f%% CPU, %.1fx realtime).\n", out_samples, elapsed * 1e3, 100.0 * elapsed / simulated, simulated / elapsed); } int main(int argc, char **argv) { for (unsigned i = 0; i < NUM_SAMPLES * NUM_CHANNELS + 1024; ++i) { samples16[i * 2] = lcgrand() & 0xff; samples16[i * 2 + 1] = lcgrand() & 0xff; samples24[i * 3] = lcgrand() & 0xff; samples24[i * 3 + 1] = lcgrand() & 0xff; samples24[i * 3 + 2] = 0; } if (argc == 2) { do_test(argv[1]); } do_benchmark(); } nageru-2.3.0/nageru/bg.jpeg000066400000000000000000003443401450736322200155310ustar00rootroot00000000000000JFIFC       C " H !1AQ"aq2B#R3b$Cr4SDcsT/!1A"Q2BaRq#3 ?|C*&K~N럙tm_]]_U\)4.]m€se`EIim (kzR-7YLU|H oIC6Ma;۴ꥮ+vE2z.\ l;xU9FI,WlScZlqQ[! qt6 j{ٰAb+#AT>p/Ķo'KZ:*Z918Tl2DwTI=9rjH4'$Cr.pTJrBjA7U6DHQ#WGB((Q'Ks#%CZtgEN/; ={dCq'@E/cs4Ut#헹v*HmQ&0MDɖfHY(p[(t fëj!e&v"apB?S}WdX.瀗ͯB0$'g\es=F3=emz,u2iI^P:& C IV2d-l#LHZe13{v^#5#S*%_kl#GloTKz-.^čFmuφU:dč*~\:gDG6]s2LTh$HAh_?ZhIl!}N0P=K!dT r$r!VR#$w$Ac򴨚g{-\HU.<@t]  }XJЕvOU_S.fW't~T!.~i[BNa \ T|J?J52_ELf ѷ2K!,/2Ka$uLX[09n)*OfEOU0>jF ] 5Nc 7طr|j k?%W54595p;49}[~J6iJ#ύ+rWZ1م#tƦSlm3o:!GS7:CEԾke{_4.tW&q= >L1wGf1 Ak^(mPԝYox"*@kt!5*>l:UHپQAEO[_/åjcaq-ӼC$|UDyI/gDhCx0y[Co*OA@yCnQU:'<2&櫔 "" 7UuT:?~s `?tMCrI$zQLbWIn< #)nV#[7] kzg|8/ AEËʢPXtޛQXo t?'m.amM0s-g}Oةoܺ&P.;)|-/3Ue?esuFOnz =w *JbiN57DGC!٧+=E' i: mD7H)lR;ltsn1a@KJ`9hi)j8R `-# #535#FZ:x 5 b!Kqpk٨d8V,klnxW ) tDG TlU!lIle+G*ַ(,tV|Dс KqDΆPǃt$)A3[`1eϔ-gI/ǁn E9ɲ[Wlx>SJm(I}gOd8XǵHX}-!4v ce؞L(,9B;e[?M0Ro%A"}K9&)Tmʩ# U=lH EOPzcn oLg Y=k!0,lok֘&kRLNn2j42:OAnAŸ {B)ݴ+8Wt_͐vm5=*dc¥w=6UHۭr!$dr9R#E lI3dʲ-.-uNE#'pZU.64*u9EBq͊› _mY41"ᔜܥD$'C`<9BgQ)hh@蟴 ǥ7i d%F.@:9+9L`U.hJvP"Sk8葃-]S%pʬLnGu\seS,{nSK_3B7]#qPLD~ߦ8NC6=J㥓aDO9^F9R9L~hmʛh5Q Qr V2DqȽyDB-ՠHG%Ll@=+3'=+ E)bR,dɦ[U!>f*<&}Rhɒ;$YklRIfmeԧ=^ꃗRh 'SZv|m7)eG 2TN!?ѳTQ]}V6]JrwL@=MGUDE٣ıF\肓]فAEF NR)3o$>VG vtT-E2bit/D29AtHSfsbD:+[bBݰfJQ"@{&3" BIȦŵZLH[/^!6\-bvԀm6+tS lq1#6C`0Ve{m1#6TE _U25#KI^/uc 9蘑d K(%XUdGŗ](oP|ET@8_(o% ) v!E#aeoC}Lk${jhI3w+VrJ?2d^a>pz5 B2 6knZ,lJ>p.L-ID3A?mQ Z \ݧrm : oVa`,Hْ>+I-=M/eIB]kc4XYDߣUy@{#UilQ?͒}DJ81JF{[+oG3{Q;eWFbB&ܧ&tR~E*f$:T^2SeDr$|=0[d98^[c{/hex')`y藵"7.5*k+ 4L%dC+$iG#jal<׷wJ$c{g]7;VҩY^_G{^ \pfeS^oFܭЊd7|7rFUd'NB z2Df:Oa- -up i[ꯖ"IPcz[)ɀe 7<)l":Vmvx*@6T@GmREQa6Sk/|]rc?n,|G)<3<'UX8:ksLO$ 4$z&/ˏWYOfu(y7r-l4q~SB]$.,;,l4.mLQazZ3-?3ZE;uF4[5eqGZ j@r%$_5W |h DګGk~85cͨTFYE;GYA$sϢ02~-?e6}a{B^& o.Io꫌?f֯pErfh>I|V副Y%_ݐ*''At49(މOBSDGE#ɬt&:n#LBtllt@rltDNF! tpC qfthS6Sۛ+YӁX"kyL@;lٲ`tSXt&}S1OEh,:ālt 3 Mh=U@l` p 'mMH͕rK+C{Yp1 6Ch+V41IVw-SR;eYpPS[=\b LHݠCQQ+@P7%y35#oSQ賓]qj765dr{IA#WE^ Y&Vn~}U2s=4[DNQ}ntXZ[M;Tۧ7LHo ߥ^IRlS3&܂QE27/'ьCD}mK64{&lcE[rHZyH#;G2fS'=QQґubo"B=Ot&1WE: 4LR2$'ܫ6hVn>I}4CU:m>6n=,,*o4 锐GOͯFg[Q4@Җ73/dclL Y%G6,=޸\|`m ےtTWYD~)zs4 0hz`us,}fl6ǰ\Ooe19oQ.#ϮjWck@TGӚa#AWuF+Wmjj>,aa9|s@^ [kQ.}E0`}j,. ZG5֖KQ+P9JGQPO)[IfYWM<ϖG3ʛJyKn,#H\ef`.o#vU*AX;eL16d͕ A\X:`EISll e|4S6 NDʚ쮤kyE@1W`&]Qi 't6"(<斊Ǎc\y4x6_KBaqtb&<^Tqb 6—O֊?Z7q6tc>kh`h0!#bh|-Q-+VNX \}ۃ:-Elf([ȝ`[ZtbXj)mܤΊFL7X[aV MMIl l| }~ r_ԬvʤI|]{yWh˃` 3yh;Ӫau0V"xxu.͚ m,6e+J&!룳;!*W&6 JEKMHVEA=me=rU}p:6]gtj uT$fEUW_ Mj+0>wm U'45ߩc~^m.S^E=c^NLT|` t3Kp lM3: ]nW)lCNcҵI$t2l TdtX? Qwg;mj*Z vj슾uɁK_4y[j1 R "gO3/F^O pI Z~mT/w FG~fRuS#$jd"{,n ~wZ{jm62/Eџ,OC*H6T]dq~KhnB5_HqQWQÖKQSVxkY)fǍUʍmtHu}23\lNX5UG1}_u1rRgP o&]fy!U3+g/ysrnWݚ{GD6SV$naceC/:Lu NqFU yJ|) Pyʱ`25#x@fyJN!hXItG{T=͠`mtt{MR+e#kB:38MG{STD6[u{(`~="&eͿW6 X`0)ʇꊇE$B1TV7[&)@(fbXUZ7AK$ccf1\3 cZ:uB[+۰FGH7JTzU$.TL̈4tz5T3FHchoZԣR3K/%H8۰TMZts7H{4"%. r0CԪs)'4]9Qk3G_L!3Tx!(f~)BO\X}j?+Ûfܮ#[i4iCj{v?BU]N&HG Uz%UNEҹ#chEX-7[[:CVj$$|' A_Ca}jbvq3&zx|DFPכ$E~w}~9WF#qp?)[9?;Rݶ_3;$ҾGwqWeNGPZJtW)JoRyſRA=W E7L6NjH6.l'npٓ=jaV͕6g];V>m=T<*buxi&tK!h4 j09azplt. p Ix"y6`2?[Oj…N+bt,Ki%n v-%)sydt :vGC,K.VD Z|\tzX})4K`38q`E(*Y9qS̤Z`cq 0*DbD]#lI*%VvHE={of\GAe7 0AU>h>0;B⻣WCll+`'&.1]@Hʍ:.Ypɇ8 RZǻHz`+bѼ<,vmdxEg$` ,RRi,8 ,S}B x "C^Njr"ι3M%XsKA [: Hf9Wy?ł4}B:;԰9f5hMǧ|VͺAd;^G ;j\Sp;¹ ρζWi!>L{Kv󄚢FjLNv ;{> 4MtdHKhÛ~m4| ~[ n 7 \{mх&S6mpɜ:[dph쌎<]Y̥./ g0Hk[ʪqE :j9g 5/Z~Uԁ>.dlcR#ZCͰ(ڊ#7G ֒GhP%u:A>tXऔ n5*s,q&wwOG\ TkE^_=.(i{ORxG8]rًSm;I yܤ>* HU죑܄5a~Y9u_%_: VI= il?N8 θL s3:4ac{a14]e$ɩlԁ͸i!#,P.R&nЎi >Dll 4wL.>LTc&Vvl)XGLL{Rݏ<9~.#(9;!6UTs(tQ~LALZ;۹%Ll .( lLc`Ҭ jFr.HWajG#il d;TI^H\$ ;F0I*Eo@4])p{.=ێq&;$@_nR TԎHiXn3uez)7{JbFlD.ы] t!5H|2x S Oatz{3')#=$GqN 廿 7 hM6gH%l(@MH^- URhENz) 1%5# N^U%>Z$ꋋN;K#Lyκ*=wp& hִubv +LyyV#Xִq`Qh'(>Wm{.i3AMZ3V B&$i44R[#%,uLl,th='Q7+?4lpp[0,7Fss=Yo#d4m.Zۏ#/$4B펙 f ;@cTrP6tw(vKu7MuƱ7Tt lUtp]Eꕎ:}vi~suU=VWyf;fz=Zm+u$"ol{[3Z;[M+Æͼj2!x9:W|.5-&mi-&?J[Ƌ }O-M! : Ep``z/+STLQ\o F)y|$TDu; F&_Q0= Zly*mx "`˻{wLԬ}ݤTد4SCKgË](nsw_6lUT7/y+lwu;/]`"āGz4 g^9]ZgE.ܮes4c'OUD!4%I EDNi ɍ,TuAyS')^Pf2|*$!Mcp0\~)!q'*򱊪iGRp,ADv-MIgaTk@{ABe b3F?xEQZo<`Pм#hM3sնHyj:ͽSK1HZaD[Yq>ѱ^FkRFާF:1p[=Ĉnn|Ul2c".Jm^s˅jg%-!%nF(:+{|K­ i(Ц:6RkL rn]9̤YgB_f\!r)sd$yb^U\{5gkD mr9:fbȻWY>wi5q+:@*NгZd2sw\3trѤK?oTշda|GD፨l7рw Y3ٳ^Fß茆['kKUe-d.C!૎[Яfį4UH&uL#Ӕܧ[" ^ !P̚֊8 '|Ѱࠜ6;(eD:>aW6AlXx1ݬR& {- 0vS]py+F_*.S4 INgwuqˍ@RO' rTG;) ٺjGISnΊTJ/ksx6* U.MH#H{$k DǧO!Se@^xh3EiJcx`Dԅ|QiS<hBFY5!O?I-Ϫ>47{Y0+@ ]ι=tO#e gx~Pu)u6 ~ROr}(7WCEUQN#9#s˖8>jC}:->"=u(;%Dq6 BwTH?)f!=f@m"1i +MtW͛SLqOn>$5QV@Rik聟Qq~)eXIi.wmI@1!@UjT4k3?dD=vW8;\Put83-nYP gc9>OBU?cz~ඍo_sק'W=qqw.&UNP7,KR8*$,\5Ikwwme[\ʹ)t>b_ҎxS;6u+^n=0KOcbe?fn2G嬿&N^ZG3UHM;r7&LqrCהLL+DS5il[F״>/b4; C-?ӹb{^BYwrʊ:{"swQRYZP8cv}k|)pP:UW{~nS0+k4u:xT7WvzcjO >$%Ɔ4(~ZojM}}Xuwfuj gntwʹLEnHպdx ZJ:Xr}6`KK2PMs&a#<<_Wǿ bcv\kOʹY >>4eClQQ:gDnG[o.ib-τ.fM=J0R\Qe&t \b&; `!hD jh23YFH<76/t|Zg1-T>i5j&rR9n ]z[NkLѐ-o3gTYZxS=pJ[Sm& ExEcpqad WΏpKj B&UL6j8Z^6 $G &3{ۅLl7o 1k/Sa5m'el#K@7!pBݸnjci[kGD+p]%P2 G>^.ʬ0,g;J7EFxbqu{)wMHDu+6w蘅HVttIT %B~ */?#bB: "1.}S`s`4q(Kض5Ls5Dm5!mlMn ưW|#j`!:dU.ۢflDCUNFȎz9K `:nv\>e5/jlr&#u\oUBk:lsOP\NMЏsUMX]p{MLhZ|@PIS|vgę쉟`Tpݴg ~l/,P^㵭sSP]ޥ}?DרG'J g첷SKhly_esT7~%%~/CNkmpijx DS:KһA&QΈ; D͊ tn7n!V!jՉ_ 'Y@r GKꪒ>DoU=ρW8 q' sE{j$V=#ƪ~dIjOWXmq`ϺCۀGKv? v/ .YO>=,/  hEٌpe o`Qxs=,P^&yq{|ERS{@V2ZsT/qJcO.v˱ii vG,OFoQ[Q߅=Ytc`RS[ECJ{]K l2- @Ùu n&[% V6ِvȁgD-RXm Yv)*/4CiQBAFZQ b`P 6CnVm+tן1hhB4ۭ@kEO*Alدn] Bˡ O[se@ AWvYf!+C<ݿU׃2t  -{ :-^;H+]E3KE?ir:5`9f'6H;S[ cm*{pEE2Xf}mCQu,,$g)6PgrTEr3w#b\a7T#q+X,kk#$7x(VDH\QЊaDCe ~#G+ϧl5+iw &S\|tOK#XZؚh;H;̰ͰYEQ[q3uO<ʱ~KB -X_I0dkNל,$N<lG<].CL)YA*0#l {@6U-]^ww3Z4cړEdYh9wT]*DO_@ͭ4`:UT_|mƑ܈пKNLfx#'&'c+L\)ӂ㝂-]+*cppt=GUFGԬGusLN>^oK'tueGR;  ;Ry7+隖'c#wM~S2*~1{`4۹]v1Nih Jj:}0mu8Mh͕fq1tf/~W>3[R)[RǖuA ۷_ HuUc0dbF NiDL?TLq|ˑ6,U`ftlΉ1l@Fɋ4~3- ƎJ)[STn5 G)%,8yJ8'U- EVN#_@qfu}94Jˏٔ;YC %1 -/Ǣ%T,px9“̉C>C{""7U7q쯉3@]!/ms@>208Z+9xfKs},q>Bl8GӼ5#7 &u\\ A$a1C36 YLw6P] #d_{ׅ,(rh^CSlo',|GF.hNcȐ:Y!\8wtlto?%å@Gæ[ U{`$&)EGLYE6 nAR` BGOW0,kut}tT?)L4dL:eeAF@SR5C֩4tknA_-'MHroA7Xh,fj%L$ tYk!:Pk,}]%q\7+Q6ϙ1 kȉZ̵wY.:~R9u78ٗ'T]U/$ךi6:ȃ}tO/4W.L%5i 3o4EO9YC _,w'cvzQϠUy>6-ǩXkj7sԪwɺ/b~cVW`>i$Kk1Ieulq%C'J d)}[ReՌ>j?#܇X雾f:`Ux(! A[mR|8j$lM\y_dWeW?Io,;] >paS[=K$:GwqC>L\]/yckzaRoAIRTH}lbJ-V,yG|[cTo@@6-gw 7\ߊZ6(;-{]1x~6]ܛ0/$ɝy͢1L?`=ZM n*x6O~V2>;;'Q6&0д(Ǘi!]]jFnA dBklK.}h⥧w`Ia[eRK3DqW"#^$7s^y%nPwe^?$peEP_=Q@0_BaNܥS,_S"ʘ"~8.2TрQmeq%>ʶ\:Q( leLIsvcR. gٽm8䫚Mб.d@K#ԁ[F ѷQ cFU͍6 ԃZRrЍ.Ecq@jk(d EGSD7EKA$Xc@U!mMi_QwdJ[;g O+]kiu^LPi -׶;&eMG&Y=ldDtraYM6LP,SŪ`u 'ɖ־V7Q15?ᄵL$0Ӈpe`g( ]69\ )]Dq|6ɭXʍ@Bϲ:^bBWDkI+77CP,f(K;/G/72ٚ$v9YY }Tt{$kz S9`n0Oޙ%=3U~# KkGwR3ZC%2X<ϑ''~Ɨa-0Iu:L70p[kQ*'3Ѝ7V2g0h#o"ckp|U#M1kI62 -#% ћy#H_ZYP`YKi c=@Q6=`ɬŕ,fz]f5733+vaimA@VQ58zp+x!/ct~cU~L~?W@M7zc&$DgI_UJ\8aYjVI>yк'X0RӸpu!s\0BTay8R\z3ύ{De0ǀR0R;wdd3:--{)uj(=8PTΐ}4.pЇ-L*FEPI7\*Ɩ;':kUGq h M3f~Jɣ?UŁm;pB=mϲz5"F=/emk oZ2GHMD6"FuhϺtޚ(éVt+~OVϟ@S8H_f+c@kN}[pomR|:|r &;FMsC脖4rjË/S@1y pq.rRh &c4Z4e7MH_w>kڕw%2T8(hU:&#w%U<{/<lIJXSFk xP5zp;[2VBu]ufrTM)qe1E;@3GUUGIQ|pDS8zE{Qs̒V(W9$*038ngHI\6 ԣKuQѓr7#rJSWchv0CY䥤' =2UR (c^)w8\I9Ckf뽊# \fWd:OGzd @S}k6/sMʦa.{6¾-<"GRI6 r=ɺgU;kqLA:YHzyScK NJ.ce) ]1 UZ-njLvoad|0OUxz@FFr8% -D7[' Vx ְRJDÜ1r׽v8KQSw CJX$wtLlwU{ W2 :]-%q7( dGuDFt[#k~se4QqcG65-s#n V2T2$L}l$Pg*5In+C]TŅ}=Frʝi! $5(k'$ `<γ1EG$-Jڗ{')v \q_/, PPuu*JH]hqފVq"LDU+޹\uU!*mPǜR?D``ހl 7d>v O t-6W2_!b}1ҸhbiR4(xZocHIbe?ާ bJq$[T)31WnoE^?rcƓFdi^Ugan\}sl$ $?F X&qA+_#DBF_;i o|?3dϷSק\5-=f®~fqu_lknetH}+ai7|FM7.7UGR54B(<ד|mS6`ʌwڱdd %͍ [r)kYw.m5ʽb^؊r"kD\ b{fhAV2;v}?Õ쬤D1 khY+]{U fݯ ,,ѯ!i~4O`m {׏0}U煏 RـpR||"O/~PH]c2ǜ :A aZ{eyp63TxODzgACmBЦ\mlܘ-ֳ G]so;$J"^ci7acbecA# @k%Rf\JlamWvEJ[CwFtu9Nig'=^ ,0RJuN*+Ð -P46sD[U[ʙ3HK.+O_| |?;heќ4/&R- @RP6Ng5zCGrCD@2:K 5:q٫ )(mܦ pPm <"UDbĐ3CۆOlF2AUH.Gp4gL T|$U02gB==X5lj(V@cM`ŢU8h<>e/CGKd oiaL{aPyLPr2hUdh=Ja颱MǨ4Z9jST$w/CIN?F9#+U-P_QMH]3!ĵ~Aͨ>`>K*6tdO143`~3뻁M@ɨ);ѩɓ F_@˩< Iij;JlV5%kI˝!@L 1J*5Z{'$C&!ӅK=u->fs^+&E8 Y*ܸWhp%}NQR+' ́}K(]o@|oPJJ.C`F F¥'Xz!1/_clO4:Bq{ 6m=EUۢ,e1"J[GO, E>(ţ`RY98TL'ިK*\[Xz/mM;I!ˊ fN4 _^LY/\֛tULeu)〰$l݂puiņz~0T]()CŒ1#a*8cƨ 2*gde$sWEJ9#(ةShFEO [FSG`|t4d)D8ܥ;2_Xgca쪒ۛ;lbZ 1ԁWE.K5VmJy}V6cRZ7}II3aqO1٧oRi[1>4 v#Kʢp$uĥ6CAh9꩝ۤ#p2<-Fq62W Y\ 6B;,U pnT`p=Pʐ $ZGe7*@ߪ(B_[il0e1M0AV6p0ᄟdS4~5DtgŘơwض:f=Qi}[GUKl!.*ߋc?QI56\-ZyǢ8z}Ukmq1l]XӾLGi-@h')>-uMS8hf*Q'wհ 1|جF+K_ |"U6fA[; l-Ϧ+1꩜3"A}[<򥎨BD9w*zGXWXiߴz 8|C+ʊkmaoTb.)LJ\$a#.4$ɒmK~ܡjh#N/|'_3pBb}RZ2Ӽ4\rj&Xȩ> 0AZ5PFw4 zeed~ Dђd,`o--_V)ZZ]u)E4F3g# [ N]ʱRXL)FxC[qetTŎQ!~=$*;6 DxDJbqusHʡ.ϲ&]4 :x,'DփOu<ťS[[ex3O>)N@ZE2鵬)>5خT08errNрҘeb2kTHŜܤa+ΨrxcHid#čx{A;!h\NK t^q~ʰEB!u(ijZ|3 PS '\}Wd>Ft+=Y%U5lqr]Jm;)%N<˜5ʐajC74_Q` ^CRCkyrՎbU9FJK_TrKq*}W G yR`{Q諞MVUzDdV}2CZJ1gaog@K_5Mv>1$Y%Ksݯ~%HS=h$R鏠Q+sԣ[FSE}'BO1 iMm ]-ָi$>@豷o5"k<mT&=הƟDey-\6E 6/M{&$dvM){vVZE5 4ӌgX{&lmV#)wTJ:X}:,5 {g~.>r@`JR:He˴~Q L`#{Vm+Mn.]rNrE, '7SN9,)/[HV7BK{ *S*zg,] n)SѾ׵Zj;X)G2)ol&ю!9`H.?=Ylc4##tq9vCq 8ZEGmuoƎ<0}\tgӪ!,R5ikeMZ]IPTIR=(d[(g;HMGUZMe֚J'%Rgq^"fKnGtGJ~߲*=:Gd6[E`6I3.}Ϻ~>w ^rŶ7uS@u#R x mX]Fl[A%x &Yi>Eo)|TЦ̈́ڨ>>o_bȄ=I|Sφ0* }*G Ԥ0N{7+1=Ԩ_p j*g+ ZP|nqO'Ԣѥ285D@> \熵3Umr@:,l>ކ4ZysS_kUP'湭#h)c,vA!yn jKk+camtاbGl=]24ͽ ]={."<DTgv\kZ8YDÄl<*i6E2HcF eEYWMR:evqBMlw -7엒$-sɔ)u\d]ιD8؋XX5-W꠱w[:[3OL,VE_,Ƶsl68w E}= ^D{#B%1i7Ѐ }dёFƀl{G9zd\ X\sGlb]עĄWdIS'x\,}כo) |0TAo*@`*#8(`ۣ(9@UF4UWU5>HDH * 7%ÛeT+hm&1o%ic^`b7sET M0ܘWMN_ h=OȸFDT y#'-ĺ- kmŮȯi3Q.dEGA!2v̉JB,XaQQ\R٫v~ ]B/D. 96\m{yܳjprv4V%y_f~ #ze)Ze[tgI9'~RRUq1pIJN,uLy|-O1> M(&5h>!wY*(oi62/5!9\&g46S,Iq(i?҈˃e5Iby[v()uOH6_I%vB܎( $5s MH1-W]!%>y$8ЮhaɰMHR]:򻁓SkpD&$ to=~ʇIsʬRZ@7uZZ #H=s7QzZQywk3J6g4] '(J+uF~;Ps$Ͳ)w#j:qV$Jvmp@E^W6V VQÅ&@0Q); BI_6m,?ŸFeLR. ipdtc+A:-1 mdќѢeRC<Ͱ촔F.-47;S-&zF!R|'"Bϔ0>6ܢDpE8\tCU#́ *I'/MFn*9FH蹁.p ҋr X\U[U:K( Ic:EP/[ׄx^^@|ײlɧv,DrnxRtRؔH^qBo1qH6!s&T7 ?d}.KTcܩ)aԺwOK&L7dwo!$d|PaϪ& 7;!TlT.zn{#bf*QԥDEd1d qPQ20l=-Jr]I7Ytv(wotlǐk`Zq~гS/}>'4<D`|Ty6tڍT/ !@tg(I;Mɺs(Z15*_T .;HZ˭%rBKm+ i[f5RC#XlG BJ@d T;GJɿ*?Z5vtwpUwE؏U z;}WD\G~$lk@P}[G%2W!eԛ|t:}p*+M~5E[2plɨF\:q~ܤ~.w6O[fmaKPWp&;5duο7*b6~/m f^-0rs%X*rdauE%C \I.vSY쎇Dz؅{NYi~Lh-|m)Qp_piQD*NEMVVU [d1 Ŭ7S5BV62m6rV{t4*K"y ]FxXZG~Q#Alt,msJ֩2zkYH*`h,HYj27kn ȸ˒DI\|kV.HD4Z㑌*_&ǝۂ[ujꮎN%QP/ !ayG ?4DIkT]cCث6i<Z4EDyyC62y%O"6(ZqKEl "6=YUrQrSxoETK<3ZY Vn!{x;?AYcf#VCOcnz/e;a췕:pp ͦ$,$dGjܵwkE˖)Dn.S`aQ@R4nX8L hkqx*|VNZ48 + N?6rcB}`Y\ƴ+GQ#cS `Noю T+8ߢkG}Q-1ʉ)+d!2 hm9LU-**NI!<8ִ"~0x# }f;6 ZH i{ypqtPh͎)yz-8KZ:7oڗbqw~G=nƃwVx. =V?QkZTh*ݿRpmmd[[Ve:)<"j["y(JM$ROqMC`Y)_ UDwԭ%hq˽PGzt4~&؊(X\6=],tĒCGrɪ4 ).NsTQܠm/60di6NY\J D3xXLqMfUXi4q5H_m̈́-e<&z#q[$}e5"N -w&O ,%HE6n$*Yv.S'}ٶ;N7L)x{h$jjQyzHW\F}2=|)%ԩqG}76Ȓ + `aOpP'ԣ &$ȗbvODŧr4 2<#bɵ&)Y۸P鶰dV'HǑkqMa)IT:F0p>eE5F3`m2e#.5VqP\Ħ$, |ʧռ[.uDwkq7' *̞!DEAGs%*&oU$)P2rd$FR^A*R&#t[<.SR8-{wzٓtZ\;.oFOO3GwN:bs2*FynQэ$tw FC@M 4zQ7\Y= ^;k]-p߁a2{fr)XؘL(hyϢ-1`S՞b zF8𩒱p*7{(>c$b|^!ikN&y4j1F0nkmY*uJg֜UuphUkmϟqC%T;܄Ĥvu(T|B{H8S)%\-{*%u Gt8: !1QEޡck7@PKh/~l C粸84uU#MDN&p FNZΔeF%lb\`]a>MHx2PJ%M( [)sI)\}cIy$'Tc#c +$kF@OWE,sT@s/gLsSj nR gq*f?!4'CLJ'6FBnT ᑒtM9`>ր6<̴:ELt ichjJy,E0F@MYG} Ky_ضQц5\KrM'U6݊t.m+G*{}&ReKC){iAdO6 M3xLa°Ł) !y՘>y.T\"h:S4'T +tئP5jc/}$ycxr28TjZttp9E5s ~ J'Q75$c^7Dϊnx苏lۨPdK$vpn#< }^Waw(,ux51,w_ꬔ8qAG<| 6XSiABOI*68% ">+;@Y0tFM_nrZVnOv]L;yW\[*ȽϞk LS RĬp-,oS^^\>xy8U%1w9&BHV]b؉Ԯh]윾, ܏e 𽊛Lނ舩l6v?dDT@8CpOZoo2<#㤲1jXKkemWL>gtMGxué%xA~̃ 8]X^H~A6"Qdzp#D_!-a>623Fѫ>R)[(nßD]%=-=u֋6z*c01(6iᛈ<9㔶j q|Vf=i! =~76]!u$6u] o.H_CScrd _0 wU^0lTn{ P6!~P_#"kUUph)yI C?MFw{5d[<%+9Nփ33d=eC'ȿ"td5W5̒uHJ6ۃw_YL`(tS-`܅g7FD`ܶY&X6đ;[[YX DSz0#|ײ! }}kK$ϝۭ|Ǿp^;Dz Nߒ p윤?#KKUu6Y۱O)X)$:`떷 }z[9a5R8 LB%t2/briZ{N䆥 JC&তUPM\QAdvXJ'f<ݎFzI3pp)b*0 tͰopJc.GP[P%d-~{o J*̠mij+i]7$\{GgOvOu``(ߵ'舏J{so@HאSO+cC=Ldb[d <"҉> 1:[O @&̈dt:P}ӸX\ ͂j3bȴX#"pXiT` 3 TcPuȽFH#_Uˁm-$J`]RdF}S8`eWb @֏3FCLAc-Qt/\w8L#eӄz8AF6ŒYM%gEA 6;A=ʽUGK|{WE)r*%ԣ,_G ;&}o@Sg}$kj@@G+-6\vwi&Su >VUZعˏ_&4ٛ\;MRl (iBAo!U녚KdW~!J}W +5 ߈m$ 95N~˽F!UnyC 1lA6^ZE] GekGd3dhܭBal w9\PUtcz |r2CXkbg'Jzk%tt{@ d$Z}D]AC+]9=R8Sj]&6>% 7 3.R/Z qMhɃ!k}ymH:f6tKX o 2x%2F0}  槕Dz{@B%vdՔcjRe-lV>W2ӄɴ]Z~ Ŷ.m1&HFz5ML@F|+|E΅f)<5w;^}XCT,\&6[~g}Ocn2t5"V{UVM6{ YL=Ǯ&KfqrȪa/PU'$\&Q$k‰bjt4q[@B—E g'ٵA+ n88S]NbgX[}~X 92BË^ ïe vGUe;Ŷ[*#OLL:6=j!8.FMϐ&} k<"%?eDl8ZZz cs]\=Q8Yl=wxڊGn}U>[T}J{i]v-kkr4nNdf.Rw ?NEnVp*iopi[)w hŭGFo.%yju{x/)muSp}!4Rs]Y։ѮUYrdJ-%k59ww#py֠x7S{H̢VXfWݰ{Cy_lmɤu吸!-͇ʈ(M))"`܎gbt Kl;stn~}סn~8dgN1(4$h" Qp~I rz*c*ǖq=Ǻ9"{i j8gz?">Ik͕[{Vvw9[JFۂneyk i?e("ds-j8 ~c1 "&c Z z".?ŧŠ;&Lzit쵖\L-m(DQ?0jbV}O?(cg"]¦Jb0=7nLo@=_4l ^%G)|P縜Q/(|QI7?Q.\)8U[ U(Fj5"Ny%@fK" I2TI\Q.$vOU(l]yFx $F+ º:g8ᩉ)#mm\4y@@v:W.*!%5M827Ӓbc{)HhYr&|vs8VJvw(-44Z&l r}1ܧ4}:.Nj]EBH5EoUBBz[xDhV|M.+r#LrCIO%|Q܃t^bev.RdMoKSvyGsUSn旗C>bARl]3IUЬ"DK=8]`LU G*|{UUw\2sCR-U%tuT:kQ-Ny IQ/cN:NiX&v;=:?2I\s8 G_Sdrg*(jCF,m5@a#.\leA$T5Ǝk*cה{?]0ZkB=_UR1\\Np(F]}VZ nv dmiLEs)mmuۡ킈9*_ W^.}TMrml߆|ܡyϲܗ"l[aʢJn,2y#%j *]r_*9@ٺ4X T^S&zNW &E-qqͬvy*%OM6VC&cTB w 뇶AS'd`wK]umq(\ 7v!WMyZxʗ:]bjl4AwM969X]&п99 YE> GzzfE{ ;!.۱ %uc=913$m`#[- drb00\p,S&}B!PEM{*R8; EF\FEʣz&b=|V<] l3ʦZKlSz(:a]ʬ5Zy=.Sj+$psMNdh nIDqxyR>_$-j(Z<i螣'쌵- L&b1rnTY wG2+\靀{"fYDŽz.? A^O)Ș/pUcTxv gukZMgf<;oﲠHQI/q% Ҍt둥XoQ@eմ?6dsM&-hAdlkߕeT sM>s! >S)ZXD6"66<\)Vm1O AIWol7&S- 3eoAUK)$`%oٌǕ!=R #)aY=Cv$ Pc;8[; au5wWSZ^ުJjjfk5nZH ڋJ%{I?W8@[d4׻fK[_&C$Tz*( K!m9̀fTֺwu l_ .t t-dIPqo2zЦLHz(ykv6]3ex0u V D@Z +e\)@{@M2L cuy@ꉧy>^ct0fEUTm7+aȓ{vUh]`HەoV0ÐVIФq$28+UJͅ1e}U8 CkIS5spS128gŢ1Ac]27{Z%S1$`p*Q4U0SrH 4AI<0Ӧ3^>6m ᐒz8HP@lgv):UqY]krc*Ԡj*ͺowuAj 6Y2y(:j/@ϩ؜#5Ỿ +3>!s H3yU |{tĕS\F3M>ddmůrnY.$e[U:Q#q |-3P\7YV:L4M 8 Bf+r3wۺFBFF$nBZ+HyV8Ec\<;F[,RY /գΩzb1 };M<=D2E#/lwI0-prX ev C1TUK3P8 = )QpIa9'~ճN^@!ݐw~DV9N Z"9/{& 6#\ٯNR 0nNGD}=Cdnt#$ GSɩ ւdnFw dM=,re\ mkY:gA7TmlAr_B0uMU3'*Zf~MfN@_Hs[pR.1so蘐#Z(rWLZB9͒6P놶uTNXM*k|ɐ] `A%!lnK㵣NH[4%qO)kE|L)+ˈ%MRdxϲFu'j٥9q UUpF=Seh,쌤$RU:&Ȫ N"U9  -=/ScO~:ƞ٣.<RQs]α YSSF=_ A \21²w84\ё̸kcDkgZa:0{LYo|-,"F J3GGOLH\YUrWRǡJ YKM/˹ܕòwT]I\\{/Jv۪q#]ܫq![;}=i>ž[3nLYGF]g9Kc3+{7Ld0E'Ee }ww#ač׀%6c)vH)6=0= *2sgkp&S-Sq訒=s#.:Cijk*~A.%f^ R>Ϥl5Xbdv[7+YUT_N@?A~ٍ$ʒbfU3\EJ^]$=6i-rr2ۆSctoDҿmِ+@Si$fu=ƱS !M(:Ԩu!nVĖ7˕~Xp @T:).u^*Tڵ" t62.\0zA.UFK .Htx~Oyϰ5"HzA E[O+t:QaqPˍ7]MA AVa4u5YsZ \}VIk)2 c)'O426kmcIyaAB[ѕ`to!ƤSHm6{_!rPZ=-OŚ8mn}X+%;d/;#~?a.ë'e54^gv1zu7y sg*nK>o.j|gWoy:14rS]UU2So#*&i.6 7@sJ]R\&XZ CpiyRccUUUJ*Eq{tǢeYx/MlUψ֋R矺 ePtR^-I<Ъd/uY } 땢".)m/eߘLu+v [nU2'tgE tD6]p6z68Kι?u1TْU)J뛃2wwB8Q?)v3hSpd! ѷ>,rK8iF3^IQUtweIk P=5|E0C+6ċsvWrBSR6zmatQ\`.C ;MtI;(14m/hpxLGQ2_>636ga\,loUisN盥2S'ZCSLy^Np1]\iPFZZZ_> S'i>}K&JZo M=K}#$7[G5*OV;+7_HAݴGYǐZbWi.Ŏi7+\f,eJmS=.h#GX} stTtw5\3k{|Z\ ̮{ɁuBhh6dw>ZL276轺̈y)EGOn:pm<}S;X+IW `3#u oz*d\LK@.>U^G rU] FQ&O6-aɻ`ާ֪ ,yRUٵԼY7h:7%fQW1w;rnVrZ=nN; y)G00ˍw6cn7alfŲ=el` %uL@f=9^*悫܅cGa\_;!4lAފִ.q,MDZ9r g HO_J|9U:bI*ry[D.rm~Wp9+tck npD.nG[\="E%U(chOSh<16cfv+Sf@'(Z M%᱁SM0 Jq&F-QX7\78 }J&fcS`L= `.lgwmSB8V;ZtMl4Rk-*z\Ao*q8od -D#4\앾MS#v3֦Hl;W)Y ?¥n;-rWGD~g\<칮tZQUW#y$q?ꈕ S$ "BԜ%mw-L%fe->6 3sJ[nDe0mm,VTX{u}UCZԫ֟5q)k=RP/q;{V 1nǥ:oc{%  ]͕S:;~2ۅ0+=.+ .^+6v〼z!_UQAh)ئʃz.@ flUQHgÅh!T ؊EW2Ba@mXI G67:'m18W2Z9精:RH;mپ/_!Et 2t– k @-µ Nj)!tj(Soi(Bol ##zx4Q)|*_ &PhT#H~}<XZ˱O.HD3O?dG)&/ƞ%( 9ƌu)ubz,ǗP6@M=\ڞPuJz|`[D<[]xoă/h5}LmWdKo'oS]rI>;Po~UNY`Ax& }TH]XCïzN0wrrKqTHv.d}_1uDS.pɒ6kcLK!#0--sy }dDySMP^R9|r5ɷVvrsd[<$%iQ8ٲk uDwDa*s|<5? TtqҸ#RvD1V f{xwd,ձ20s Cp2)5o)Kk{\ vz;HtxF£R!Qe47keXfr`%rUɟT/+- o$D~O^JGS8%/w c2 m2[%\6h%9vOaTd{I+PP\5v誊2⍊3dԌoG\q.=9E 5G#oO!=~ˍ.hU |A'lC>-A̤WQ$O IRm[cD;wq=Pmߎzsx#2 0>Cfeko`.&ۮК1bs܄(m eM4XS[ JMe)_m>CmdʞQQ Ɍ>OY f)6J.X# SVA(k>r쏅Ǿ6$ƥx]pk2 *GXz "IB# JĒKT.1r'3t.yH\EѤ^{+H98WҖ;6ELF/$'BHԶЊZ&۠D_$7tk);|;)UQ4,Ɲr|pU#x6Fiy9 |,53ڦvD!g%2G"3d(߅,fy)EtAq@vY-WPy~醥UrHA^wJJe"097RѭW :+zf6؝X"dH bК`M]sͧqC)VÕca$_j- +Y =EP+i S-t`YU68jߟ-ePzVSle0l= #ȾN g ͦRS;D[*{=-1:l]^mܢbffTS *)g:h&eޡROcܫbqUTN"k cA5Xslrj.;IurJdz^mLdnK'_\n՚6zdϰ)kdzZyrs>#OŮEX|A/Tt%li-nrգs qZu  U"[~_";ZY.IjT1rcS'Q4E`\˚%UMK&1c`7]_J'syңe_#ܕk^0PqpW52XJQJ$nޡQPcȇ(np"L)74X]t洃BNK/#'!LAe8spUDO 㭡$p4 4Tœ@8U-xխɴ | i* )hxvܮQ _NN]Nd?r8M3P2-Ӫh@RC(kncE2 e&U\تg| $Pʧm'I*A ͍Q':a1Ɍ('`T>,z$p0l:iK)D6KjCg(qeCLSn vݥ5 ,QZIXou|58LHͮULa.hI+ \_Y \36Pm O6)|VӇxHjtnF:z$ybZ ]U I[V#H| w<'(G8=L5CɶV& /d@(]֍E 3@8?FLqKB#~VUBNIWFmנBVk=z%${"I3i>TG@aߪZkw\unZ7tG v(Ɋܿi|ڊx*AYz)q%&:F#p s⶞ B{r;~-yQ?2莨c+^I5(ݧog)Nɥ'!7KM{T $ụqv:5QBLOU9xsӭlh"yfk|O[QpxK*,-'(9#{uHvcs],ǹ(gU=Pc/p 5+6TE[-S|ο<*3-~rU9T:G8Un{쬍9(!"Miq&scdd@SE슍}ʥky*_ &E>B X HQ3UyP57BrׅDE o)ˮUr[euYpB7a$LOkE=JKceGX FqBRuʥӼ l`lV2;ULtDsq%T\ (ZƱ64Jiv'X Za$V"Eo'QtrH^l[OU݄l@tIҾL~剼"}dҰ=9?dgFSҶ/@(ZuAسW L6`މ|;X!++͍0,(mOw* $:l_3,NUeg~{e\?$x6hG)}L!,V sAGun֛U+a_%*a`WGk`rBX#cY'J.]fr]Dt7#)CY>hX!fX L{+~Fl'C"4 >`.=,7ұ0v^-SϪum8?۩SV$7v۾6s0sfC *Mp$2t]['8jG23:P]skZ*nS$;-5zg,~q߲a Ft"qR;;{ea肟['$^yD+]sZئ'1bU̐焹-uU픑`2" T9:8pɮC*3\X(7I_\\Z)p.*~N [u1#/Yk>AU@2Ht9p-#_׺eLtX$@Ѥi "gHDEkrNӊJj|0OweBiM?$T1fpa퉁vVQm;G}bY&8҆G[K@_7X8>5t4Q键-qXZ+y?fz-UNx`{z~&SDwCJu:gyZG^uLP߳5GmC`E|(̲:H+ ;p蝰B'?q菑9FR<\wUUCf0dPg{2T0b;> -,g{VnhBKWeuiIS?z_Kg/8Gf/{+*Z֎|Ū*dWͬAĶq2 X h+4p񯆮T_tHр,yNe[dk esձ<\ρ[r|ɳ [&P{ B`r> ] .n]t鸎t80d3i5kSؚ9>t$TgϲkT&պ,FKJjE/iQTvnY:bk|Vܶ'?Ij5ڇ>:|vXV8CWFKaf$ǭ=d%P}fr|k^#Bt$;p ،)-RqG=bcL[NEk#K GI06*T/n=y[غfNY,\ҫ]dAǢ~&Twwઢ<͕TBYUU'sM3*|Õ X6O'? <>9~707n}2(!@u.>X5þA2MdM>&3hj.Z;Pb8/=_ \|BQ=,EV]zx)'o6^`AUPiQ<[Uў9(û\hoUGquӏ_%TK8NXђ B8{(F^$qx{'I=Q% mNtGSʼnJ L-!ױN+C7;U>2ܫc3syutִ]OV-^*r8*ǜ!2iL .zt]Iz*b#sKs8L N^<\ܩP杦U.n*\[BOOQ\P;(fg%o"vbw8GJ>#ẁ+df{C}lUEo)փ%9W)p~0FI6Nt6*cqm=<#cI1"rOElqX}(>3ʿETi/ OM$6Xy*(!!"CB`qhoMV.|SL:8%1:̺K wQ4[.ёԥr{8*'˩z X pᖛ]5LlpkچIN2 GvM>3[m!ùYmOuOs$VܐOUSRg'=EVf0SãFŵd/V<)rQ4>`nU\F|I6w)2vKPg5(XGedP=V7-'t4X('3u~qMsWvԦeN_%Wr.SQtXln<!QC;v^",;BTE.)HâxCpW~%HL[Ôt<Ў/)ЈCg};͚rzUP>9k#~ ;8N`FF7LMOAQ1M5ј,?h(h)v<441n[_茎S-FK" [bzW6!7{*!ډ yZ>/{G'cH6+[oTUo]Ԃ }JH,nr{Ǫu7\͇Yq Hs~p96HJ3po Rv/Z8URw dcu٥ nP/ԶkUa -KYB>6 vpTA%9 KX3)'+VmH8{.̲6>a?*y6:zi0G=IGI3OF4| ]EI zE-n#Oܸ {?TAV4Jw?h|7UDxM#We$ %7q:#(i([pMXNK|ȪE U1#)憆4Yk0{)$%%8IM=CzNj 8sDz\M* aS+flM!W=`,nXgKɡ@<%ִb|7r_S\TN3Pz::sT ^I+ t}r; *u@nnպDAhbK)qn'?}^D͛o[??L_ER$(%\Gs#\]84 n{'U7Tyc^?(Վ<ܻվp\Սɿ'_(Y;uD{K[n\P7Hf0rS67qLLU-ԭ769gZ/w:?:pSK>mY;/fIIj5کR6mj@Ƃ7R:5#FXϪy%˟] [ֳ|5p] \Pe0W#_8߽ӭ3Y7 {Ny"S"ȥƩhm-{'hR3 ^ܬF{8<=U1I+ M.cmf+ k/L,SZ[Q0dLèɧ/߅ncGWF"tUTr|HGqۂ9Q2S8Ea|MIPm{xo/./隵8a篺ZȈV ]#U' Àدi~F!x?(//,ufUTsҧr?76x?u]Ui-m{m>Я#a488y~~Q CQ ?3SpQ n9_ൺ`oiK$\"kCzƩ.W:^7\8,~"iki7t^ǯߺʫ+{ܟ5}6<6q}M"GU#l=SM3Bf5ցf*TvbN3~exqĵ5=(Ӏ,pExu$G~46L[.RoqmđC(`@}-cZySo^L.,e@N (l_;t w%c݁׺ rc znWnP۝u0 d)w;词U32\m@DZ, j:ذ2(@Վp6XV UL-5 "ip V}ٍ'$XK"rIsU/hPϪ PT=&NU_)t)H*³b넋_ ^Wp2ODR*{'헩̯ +I`p" "v8etk}ԩ,. JEG|=J "7i\L՗$S_Tl],۩{?&T~ž #7CuXm+x2=}MSa|"Doh C sTF39503sGeN*Ll Jt5 )bqغVOQ9eYjdľNs~SLy*'0l4&H5=P0gcٜKR`=S\ vPuĹĺG_+}Vcp£QoHKvDĈ,{N\rOR)vu^U1? -|tԫ.xCLzYQ2AFY96B(=Byo)#%6S8GVM:_[k=6~]6ḷeC+A_odj1̕rPj n7]K5RW'?R ]Lͩ4w}b6lѢR7$96,_ˏjHDxlu8՞%cn> 핔;=;C~yn#<\TTK! {')Ήs]TZOu!.&J T<ªb˗[Kd^ ]pgpSgFE$~TIEGK}&:-~؝7Ov |u,a׷pȴ2vId a.tE [荢Xd|lZ5ȷ"p/)zQ?.:0Z8[8`CDrfjhch%ĔXл;cYY}K0GcH`-sMQaCa^JhbS@|o !+1vмsF5٩3 =|6V-.ӹ'V4^Hۑlpjh{~#B\6Y'|V/GqW=!VghE@]꘴ܠ <6 )YI{w}U 1.}ڏxaq{,h"-ccлz@Lv<_ʼnA԰9elsTd MRԲ$3fDΪ-rOkfyK] #< q][߲6Y<[N$z-U\NHWTu!FF Hp ,핂7|ʥ詍ŮJ:H˺!^L8_쩒2lLp;,ޞ^)^SQx*$-#NP|FǵfEǿmt,]S q'<ɳ(wȹtRqڋ,nө*9 {ܑ9N7]뭘 K5,狡jCMN (7( YvhLTϩwɲJ!ms 4.G:wOfY+;Bn- -@gVmy%!%yB)SKNeowg#.&M1 |3T= X|LեpcvVo>7sSĀ鎉9/hBQ㕤Lxw8N-<'mpZ}IJBåKq\wK$,7ஔTz`Sָ=wP^?S0:sW4rj[<7CX_̈oٕG7i?EόSqBx~^2ƛd<>)o]Ƭy1?in[i񴸋O,9B \Ӗv!j|9Tid3n,_B-;,uJyo?g<(]- 6׷/ Ve=3y\U}_Ondf9p%-lUY1WzzTG:|M7h3S3"Jiabb',wxHEsO$R0U`ђr[ZAF*TpI\ٷq*eΰ[1?J1|T_ ub|=O Ȳq#}=݀n8FLDU>X0<Y?E 1GU_\t~-9-@eN/}E 6pX4%@ IwNj]#$4 ٨>Z%e{rY7;Ӏ Z "a膞\JI6T 2\Aōwx\fc m:+0u\G"gM+Gn,;icy͹T zh\eL7ѽJqQ4:d_{=B}tсKJ `9>}65k:4?Gtc%} xr @ֵMM#22J~4cm&;La`C7pi瑕;AzO5yX=WS.t%UknsTIe@ŇӖs:Y,vM]4Yg5G KZ13NOcP wE*Bza7cO MFg%5z0L7{uLK\jD\0J*&&@ ..7mr8 R!b<!),Sdrz)G"z\*zwwyqpgo~zח ll[dTI8 ˿ ^z s\F_ЊVOT͒ݍ=HmKGUZ]DE$Ѱ&mL36G7BsִL>P H:\!Α-c\iCm`=VCM<1 WB վ>hT&Y -!Uo-?h^~pd$[j,E6`Rm;NHN)9 i7{l/U__Zr8]l[T+-ʓnf[* ~Wz$7H ÔʆH߆t诡T  jtXێZz\:7ufC/~T.S[~q&ުtrCu pn>p{V5{#fipT3u%J v#(m N/o곴.aoT 7[,8 BfȽF;vqI`u0m7 @aA[%+nm*>4ѭZ76KM,6 %4Sͽ;~K)hVῦyjvFO sdpN?``Q^b;qLntipUnKc%\ooTPrT䥦~֝ilH[GQшkZB`v朎I sK͍>d<\=be聡Gm.i7&P7ͣ1# og8f,l+Cש5=Sէ#S{-=J}O|;3ئGfpm[^?&-i9Q#{D5p-CE+!izde[F.bwi/z=y'ײ:$zvO)vZ 㦷';D4aβe V1Oĩm̑yo3^ǫ-q Bg;.rOqjZ r_<+X Na Y3$}Ň+%",>}5d{&QQQlS1)O+ k*6Q3mrJWQ3[ XO`bcTT>mPw7j%l3q7s*+Ff9FK^=JwT{*{-KD(v9nJzBպhDA1\)s cr=hu|qqQSf~t۠BނH(\3m<&Yw*㑀,P(b|6PCXrE=.RqU"4 >W@#71,]5.iz%Pvo6g3Fi3u z-LPș4#剿UQ X#c v6|7{g8J+5j,ꖹ;ŁB}c詬"ݞ% #xhfd%yrq90S]Bc"sy;Ry^{rTI(ʪe.Ddpr`bTܛECyqNH$Hzy8vG%Azy fץ(gH]|9N$zR׏}ΤLe"ǏE60_Q'/pU9n}ꯎ ss H^2nD_n/ nz=|O卭e;thU2 byVmvl[eEiVR9]M[ vç,تeArTRMh#wi`lN\*@S!GSl[z#{~ҽsvl›e`l2d79Ϣ* 6#c5x@!H}>r6@=JőS8ZГYDw})`f$ڟJ+4W6 NjklMdMoD` 'Es!Y\vj<5@ɂ)ΕPDNh|ܩI#Z-d_1,:CozqhW*61!zQkʶM@Pͧo.V폎}R9]'݌3yuc͐na7xLH9 ů}J&FIrj=9!FJ"j;aփr=ҺJVz^[ g;'jDW;YLIvRkn$&/iu1ap'o麛~8p*F6b6ԣR96,zơB۷,Mt>i1 ʧ%fZB_Q+nITU7tCfk9GYuøGRjk}Ry*;p6tk}(9WM>W;!권F B[.V{3`Ca6RdwXTWRj/:ї4mPIPFaܟT=s&hQZSW$9U,8!.msnv;S@A-sm#Pnh GFlT$kN Y"U)]㹶_$V7o(=t[5a 2=cI>ɕ.#]DF:HM%]ŗcҦd[qQmEB|اo-M)hL.ig쨌Z:=U"-P?ue;"I[,q^}ިj%W]땡dTmT3Z1dN}W&E %ោ hCA%M;n$vZ/_1 ?QÅ ҹw'ڕuj:l'ICuq͓/No>gm*tzZTmvG갾&OMhkˈm> K>rmtUjTɁ^=c7| CԴҾ):_-p0Gul h_j|;j9vCH4X;4:h54%U1N 8r4qԅ~Q#n1-v>ʳ8A_[$]W%HD@\X$Za0}H%~\!e^Zee6Et YfH+ eU$$yq!iCƌd:Y>+ٸ-񡒈Lh* 7q'&G~  6 K&\ {!о*Y$(ǟ$}4`S;5p[ viݐnCo%r|O%BTվEsC#kEˏ`nW|E -Se]/}{.Sw]B xIUcs(l7-}Kk{II:LfVk#hfZ:I<_Q+ћm_-uKZ3$<c uQ\G"1>z\o?q쭞x) %졠ӳKfӑu[ ziO|c,RY(@6TM-^.cgWgꊶz;+=COuLe!]n{e.ئ콳VXYMQdH\-˶)Fʰ守Sg#v/o6Dܮ\bfONA-,*.XbR}OfB\Sm&6$i]t.<~SM&dOk0tS)Y 9dtt!5vNۮ!1.Uc$ *.!~.ldr6 䫙OqY X] |육}Qʙ~ ;ChY+KOi21tE!Q%i { )v QO_}yvOԄ *][MVY741rΌ:ZU0#F>5PslmW<$`8qdEl;OČ]>:u+diKߕmliw%8Z)-5AI?E)7TDdYCZ^/cW[GDVӂɣ37 *y{[ONDc۹&_M2F/"#`cPKLHNM"\n.,ԼCKLKZ+9W D#7%5#ϼˤk'iE#@IA7`;m; s%s7D@6B[ĵhA.&2i&Gψ>҄=-BIMkb܎d`? +=\]sԴv6 5E "p1CJ¥:v@.x#SjWI<8贺f0Kx5;(iQT etCtڻrB.շ7]%UGe\5 cb?,R2dw#O"_lCUV1^LCd? 3S$8d{M=T,_4uħ#= Rjk@Z;B@sJ_Hwā 2>_hu8 i|EAR*.>ڿwSq-6)hS\ռ+/e9WG/SgۃZ <;hZ)g:Ҽyi>Le`+&6oZg$XtS`Ŭjox0Xo-pֿP:o `$a }U1C֘k``hV5Ƴx5m(k~$'[n>K" TnYZn09T]rm{Y`iu\qiy[)3tL6-9s~a-elۢ=[FSmlhw(A"T=MH`9YG*CnY-GRUu6܀stكC$Z|PRlO33Ij? ϳnS-lU-Q͏AgLltwç/r /5ʟբɥw|۶RjYXFؠ?ONdc톧]{O^߫y?T[''h;Ji2>|_+DpբaN9"h!9vbm-mHm3C ŢI/"_-%6Fִef.#$pUK56 MW`e_ݬ7=H*f%FY$&5[ *rqOUP)KGz@e.yrݗq/Xww !Sih[;+IVf$ؗAFw{%J]|fsI.*MUjAx]"Lk{iokB-tOTm6O8KHj@Hra8S.R[LbA԰C]9Y{B 8^\m^_(lGE͞@pr9YM,Op9.nːz)uSe{WV+c6cK`SH54Уm~P&?ŒRxzGӻæ1YeEmҫ;]КE #Ԅ<6زa /)z`L[舎6F fELW\CMG1Sl.9?K```gOP$]^ȇeX B˩#Dz5f{,k8[an7TNvI7UMu]\ =w^ġ \abV{7طm򣿲ۭ>']n\2cPdq?`]L^Ds{>W>!'hS?|jCN &^i"OTb?7}" ͤ T#vOwQW/" ]_QL_b\BZ7FSO]MJ%NX9-\]ůK)cT%Sa-{iGyJJHdD7fCin$59Jp?Má쏒n9TT^eZgi˅qg\)-GO's~l's[#r;,npE-8F rTP: &L8&\:lGn=h hhYR@ ͊G5!SĢ$ +d&B6EغC }u t$llvЩ7 xּLAyc .MS[lܔY$GhUoG9<ܔh# \9 mM=>}3T1YFym+#?i)lNȽ*/ 6䅱CCv/RVgxꁞFr Rk&Fp9I-eދ9SPXO@V2Wjf/)eF심\B;QV]/wSWɵ+(I"I*A)s NUqŒ#JEGPG&Ÿ2ӄukq*ߕ)Ȫ#o~Uό ч5)M=F ~OU|Q珪- '얩 Zj'Iqe>Р!xc #0T-*l z,ޟ?ksVE#A]4U⩮4vJ72@@v[ԧݥXT3sJh׏5эͺUSFI7mګMty"<%54c$ 'FAui_G \[ QOP>_ nWLFNܦT^2n;Ux+!>tvCYLJ֑evxjm; EKYK@4%)I* qq ] @nQxXуqFTZX%!?ᕮj*M_F])?Ry. S-s#cӢv'nڙSj :VtMQ*KWNA#إRo_E5x4Uc,'(-+Pq_M4'50K,19ԟP;;I7ϼ#Qsږu흃svRZYnSGu(o+} Pmiʉ;TFӓk.LQh?'Ůk64 hii&ۇ_eomͷVPvJp7Յ#TO+]lv.'GWLzpC'$Jf? iꚧ&XcVShpNy򘼏#'I/پ=!_8SR~l.>c?{ߌu=ԴZםm0SIU,tҼܹ}$:.aolozV3tb61<tښ/hbOÞ<Ql#lQ@p{Sk0n9O~8W_g7'׼Ikڄ|P  \u9 a #6eLZ@\Z!$(isd2@ވɽh>&uEk1B7@Y.itǐ(І6[ӂ# 9ov;OMe}-0!{fQKsR'[^yP%کHEsucipҸi45!ltqΏI/,mI6  o6Y~ąҶ6٭\1ޖCLi85B 0]IjE-vȺ&W&92eZ^sr'Dloe3cQu›#*A4}Q:S HMVu"!TK1aaAYI*B(4`ldZ}1=8EKn)UPhZ8htTo-Cb6IvIy6 5BCc.D6Y 'm3!*!ʛ#2`%b2q›b<+KZ\UIY /ORf.cbZE//SyAKTpVк3mEttҐM!ǜ%gANU7x^b˷[$Cas⁎ O!p;!̠YCqQ:S(BF\U[Wp y%^6W XFr5Iś{qMu:e5#Fc-WgVOkwn16r"qUa^W8zgʨ:/8Q:6VGÅ]5q؞9#iRe9' "R)]S#)es߲tKeG["Z=m}D 1Us}=VBX3)pʇyn 15=6ÁLjZ!sʲJ6F{kh\J9i,'Vc%kc{ ΋9Y']Fo{)k# -z]>jb\"wInʦBr0xI*ʛ1~12,n8>ԩi\{ԼLݴs &v^ԛ(No+.G dwl?5}PN?h<]1"I"Ղ09t uh v>k_/'({ pVa`:' kx"-a*\ax >4če'6JnHM6@LBh\:"g1uY=JHdKGU AAU6Y6y6 -l 'z=D?Q#y-qd*[@(w^Y TsGC+!k 7m4aꊃL; $B-t =ػ T-6ӦvKkck?6cpd]=Ttz|lqO#&=!h6mLkG? XQ_?DLr*%&; E8o&SMVG%ORuTZnkz(FHB]otGo; vk( TTmCC=N GԚYy.lVPsa'[m zu 7N~.>kW@EQ5}g_!6 <(t*:]ɷG6 I/ 6U姧o HFUO貳{tU;IIn=߫l-%O_DT>R;+R:&fIfەjLM~ʰV:k S6LtԽ{^ leTz|1'iZj.=) [2qlAII5?'9Pk碹~ц_h%vQa^X}V(?UE~/6X\R+ \#PjpH.i|~S۞ PJMݔʛ$u)(?N. ];agi/ ոm,6=gi[TrUNtf w\L* |,.f-('d{uuƂI/,:lԄhУ_*J0vG,v=OIqOgnd?ZpL үwU_8UQx{L|`~P_QsPu92>ϒGеE+^[}5c:s?P!߶'m.< 54*x.`bx瞤QMT u`U *(4=ec[}ShCVg oeAᙛ#jc-<-~k ?<7\<7,ϋ|gR) ]Ҹ?%PJR0>_Ӵ1}{?4rV^>ltIqAO-:;턟w/Ks(37\X?h 4b{5)x-dQ! MliGͼgjye&$TzǺqO횇" @0}WkItT,ҽ@˸ߥ1QuULYMࠎ`tʩ,S!`hM!<`%a+[)9Q;J y%W2 %$۞I(z{3i \EJO@9>eͲiO@R(,Ӈ.Ξ[(.8;V(nťƟO>i%OC~QK4ͧo ~O-d*0 Xz""݂GLnQLEL7*DO Sk}Q usb.d zɪ(l^p T )ض Jc|ޥ>6@Hhb j!*ݟ29[VGQ^r~WT߸U%NTKsr"eCs_Oİx? -tpm_(]ve~Tl(1I *pJ5'hxx: m@ Z {m` yB-"b|:7 htdNi41 o# `\.OtRʍOĵQ8D_NynHW0S'=c{Dɸgx\doTr gFnф➡,puuDq3^koS%2|3MJ9Lo^?)bʫmk+[ GTK_c~b(eQ4; 寖[l=rIBo2YU8FGpw}$ɒ.^]=|?d70 VzflKZvJW(n\U  5msG)?:P_z\ YP.A`jZO=5hdmv iUdq͊$W2KqnMAxq!3xf;( .?5a,ni C/,ujS7Y@ʺ L/h䂶?*+ nzHX4pjo3 C2 :1q2F׎k)7^ ne )ÝYǴ B8<.j$mp R?)G!C,-Ob6#.>V}%&GdTt'̖ȦSS&}i ʚ+as轷&MS}@1}@56?*n2T,vvh jH1=yitacfcEYüolތx6mh`Qyw>5MOG0vC/θ=Cv1ϲ&?]5l9 tZ]3\ْOULrCC 6/;#"z:6o38{e:P*+{x._cӦ0~:%`"eLiz &*I[i'f߂8$!?]GB\fk&7/ ui/C-Yec]^*ُuLuv_ 8N%ѝ~Js2`=̜mob,Sqod(&f4me*ʱΆLlDK`SQd-6aʪ9-eI/!r.82n6M R'!MKw|ςË_$ ]"a23P|n4rr|m8.VN_T5! d %Ό}%cSZ!`$uDH%<; cnfpޗY`cwB=nHȾmʙOF]&=@!Px^/8kq󐴄U4b uNa-C7‘;tgui#T+}#F_wvZ#OG畁͛DH-0S74Dy.}:7;-9<:fS':uWi:l61Ju oi4JPK oƶI=v^TΞW!o֛rT>z5nSBd4t&%g2-aw?L`^qH+uSR'`y:U-d2% S<2nQH[ 54NScBUOyGjBIZ,ju+C!h.w"ȖT$e 18nۧ=,-~t?\:Z|1~]HR2g|;Lc)7M^Ъ}HD0(X9&hmf-7x%JuQ ^ZꪗvW!54 (qvS:}=|L`c>˞Mt1!u>]bY`е1 5싎D@R*%ۡW.)h6lCnk;)tAp0>?tC!/ɮdK 0dvW6"y mUŪW0=U\ g.RhԬKbS[aʄ0/J\nrUy?DrcY+|4z fs~PVeq%"S V ./\2z[Ef &[_DZA&^Dʇsvey<rs`rW es|I#]$'n*E䪈͚8LHKqԚkSkX tčd;x)s# z)ߢW2,PuV5l6 ڍ"Y<5'>LsfFOtf:,> I=ShMPE50Q4UqLj%&EMb;W:kpTLDHqtƀQOv:)da#`bߩTL9MiuT4OBۀ^n1<@O~ͭ=?'J8=@AmőSlNa#Hi*[@!D4yWC=ksB6e"PSK CN$&9ev^}J&l6MWo$))Bm +2,m(|hٓUt,̧4R5[tSɜ|>=\Xn -CZ ZWG{dwBQ%Dѹ>U2cq@:W{,ak& $_'|W)t(68 lTHxBMՏe9jC)2# DrodĊ"KLvM+lsaoUJ)^s/odmaTm Cr:8WKYp7G1NIM(x WQMcr3SFe [+K=bg} .mtƦ܂# õP}K,7xi|MhPE8PqnNOA8*EqLFHNt76..QDY-\-hi3llݺdLkN6Yfes s-V*X"OGnD*yh=RJ A㡷 iюF@UQ-K'ބ }Wv@ qiS \ޣAy.q<*nq߅zHtP'$˟T,my2ga.L[uK.'`'|u1c\W+=˭l5 A6RS3Ll\{2-r)d)rn[C!|U'O2|:O(Sxnܬu31j$Ӛ,/E@΍Q>W\#)翙/EN_dKjܵ[UuGD.vY]OLCfvNMO3EV IsvB;i)o \e>DI/'ꋎ}*-v;$s?Er_24]Pf%а=V1Y3qФ{TVo>sI;Y,@7u=Km4Mw_)sOϕ}"now辣?$f[ݹJ46с4}vLm _!ݡ,ՏFmޗLӋ.@!%"g={&2a͞6|wcfFHVAէMMECE =R{5.Ycys ~ 2\{e#+ˍ]y;B{ҟoh1IR웁O{fH=Vz}6wf|Wm:##,ϔ{;v7eVu|Z|71?Q3!*qQ5ùLӣa`7D?bt!7۪o!gNRىmJnJQnIG5z\ljiCmU%$S7`<;|:CM,E.18RLj$ v_0cFlGNk}EKH姢v;uɑ٥ә83D3%oDҎT~2@.HUzTMd)0ߢH諩_+nn-tAyLF,US'.&y-Ff pa7@!ij1^4rS`V:} jS=#=:&f+Ӈѡlyeu),trj5 ?4X)qFh>?SͧLci\xK }\P39z >bǴ3íjY\`b}AwR듓eA)H $gYq{{oLHb9A 9IZ &$6X5\K;vZ:*opVvH TI%|ȺdBmqw\"byPj)RO;e%5T ۡNc͈h)_t/ULl[`4/\"P7BoЁBy~?PFܿ$tGcͣ:Gll;&oyCѤwߪ2 MuHF3["gM^L߈ùdڃZ4uPx)ɯgUI{$m- +`fKClv%fX!]+-SQwxϗv`z4Hi=UG0d]QW@I9FU;v0CPhkPnz/G1Ч;نyLIO9ar锔y>5h1mt{wĎ6 -hPW5%Wc)+-ˮ}N׳ڝR/LVN 'Ԁ$MT4Q@/88G C5h O)+q9AKKJf:0,~锓4hMuS!qfOcުQWzA<"ˉljVl^+?9>!S64n-?3s(CK.YPDWJ>}nBX GkZvpKj|7R`whӝP^Qo)[{qO 5FRBv>4|MyC;BSL#ZS _BgX|?b?n eWUSD,qhB;Ql;A,i?iZ ko|Qoicg=育䷠̝~q$ EM&N>]w)DLl&!1cOF[_lݡFIFӷ; $MA-οva<7q]l~ێ%]ro"BKne.6@766 ǰ!czhGN3M)(4 WyMLw?rEfK^ ȈHs.07^ 8cxiu}0]'#ӲSEI$M]8dnE5ҿ^ }V=,ߎ|^!s718o6diiZ~*+*%3z6W@7C88ĒI$I^mm\?THg(:N /Q$ AW?sz ^O0ҒG{.\.@SQi9x9M) 62$MtB};k,. t~1R+ `q X757D2:}ҝYMl#zZ5B[ {@TI4@ /] <D dУh64gϐnwDd=P5D8VM48i̎{))/;}Ϝ˨XY)kott|֠8ւPU.Ǫ{/Ql#uJSPR)02PսT?@ uMpi rԅhǚm,L&C'7R\-`߅cIUsԫqW>6Lv]ATpVœb [fܮI$纲8" 6od`{lDLtÁu=Ѱ#tj-"b.>F!x)4/ܪ}[Shsg9Gw&M,2y4tUA*gL[&$lb~)<8t>o(Lْ&[1UеO50۹!ɜqD5WNTN=v>p.<4D3{@#,̺## \XvShr^ .nph *ndh=)gficrs$|xhj+s.)%oe02pMKJ0mCO'5:^NKce "ʘ4]jH0F@`lFzZ{C%:̯hM 4 %n4ԖOTjܸA})J1tpÛ~Rh;5LbqkZ-ZAOTC^*ˣ5t3wP5ujay43|[CKe֖e"*6ꮝZktC=Dd=P2McbU&) EͅlUMґ>8 Ck_ v= jQְ2WYupJcO3!85"rѥl--mt6E<`vʖ>n*(ik$W y5}Mb?ʖ@'p 浠M@K '#rGĥ0+v(;'bAvS$`Yc-=~e1 ЭB^x%;4\D4|F{Z"hi %mԣ+@jѭnߢa/bJETXNU]Q4˙D&xTO$41sL9S}uIÝ)[ CGGRkXhÁcK4dbo[QHw %:~ˢC KzIM;>&mީΒ\SԳu: dO9-=}ZZHbid!cpz_Lk;~seFZO5J(ivg$tMׯ(ޘEEX-A]S\6:%ZA ?q2ܲ05%:[<jIvʩ9Ilq%|Nvtp|-%&ցf1bu@4Fmhj"`/`cƗ8cS< &=Tpm*a.T:O+0?jeI}"9&,~ة.>GE͔2Y ښ%WG9i&[ 4߭pZXBwG ČS_ԔYεHZƋpTڋpBe-kUW?X9BE-u;ZPi@G'Nn~۞ri 5H)5H.quiԚO.'qfaz' @>#hdw@ЈBSP ȡ1q/ - $U,gG:NDMYwɒ=NF?U? hѭOrS|/;oԫRk5:+2M)'`; TUd_+K\ 9R+H}K*;sB5-GEC # vHFK+M" fp/ H Giq&`xMeA+ӆ6a(hj*:~ ͻ H*`/ꌎd:| pd Ue:Ee hhh^ ŀd"oƒW H$F_ , }xe<ZB:Zm2}VME?߀4zLP-&qR RϾؾLdMc0hEGOe Ե{| t4Bo,0ňZ T9\te['uW.|~I*I*̄T 2jDUYuDPs9)XdmPi(I'}PORB"H:_-5%k8 hl/C鲴yԶni@1m|/-}}UzVd<,Qā%9-TٛuzHGRIM!c=%u×TEuP,MuNz-m{"骭pmXt{C%p!['vZ"8{,;10]I`SUI"-#j5n񞽓7Ss-jhVN5h&8ϋ|uE+o|ϊgߢn>8H?Yg]S&yw6$\[L>T70EqfT"AWo/w+ Oc T$ u&BF̿>yZ.S~1Pr׺$m !wźgɍGcCH*Zfšy`RQ;o':R; {& ti\i-^H#_'.M\ IN{z-,2qqBr^Ż )\M mz>M-M6$9ԣ[RB>@:cϣ/KO6vٽmMSg?Ɏ6R&̩X{*;4z+ncgfAM{pMOF=r وkF{GUvY3<-S?EJP꿯jmk7Qj糏'Lx?䖴 MWDw9O!tRlё_Wb O ?)/ -Ǟ(;tCl~k]촱Qvt( Sq,,>l Y2.@, gn<:9ۻIt QzֵHuD!w=[i?@{+_,:_ xRT/ch˭{ߩF] ,mV䔹\X ֔I esm{ "pr%ǰU9_z~N W4]M$ͯf] eɕ.krSieAY4T`2SdR7ZaOY@55.xq-%٠{# D6+[Fv= HVmʴ7襲6) e;YO@.l=6裒rn~&t!ҍtrBE$O@?rCN h(6O#!lSCCNo nd\t8RUw Q,kNJV"G%A$¶2&rIK+ua$~>RwINgku^|tcg$%uZrUjG>kEv<%1*`lUXŕW:?6Zc6; \+M2M&.4 6,LEEhF['M8nTEk 0E3Ua6;T9D2"Xp5z+l]̄WO##.!9ЊX'Li4y_bd֛Nķ{W"uGN:(ӧ#6pj}3;q00<7JSG)68EcZ;h}!rkIb諈Tc #YH i7Liomhb[dS[eT`eQ%A{Z=1S0E3 zEaRns-Ԝ5zl /<_/i̬8\ v.ֿsR9k*Ő٫[u#}_UuFYPm10>_4.>Et߀&&j wY"斚^Y=JYW47l-G=a%n{(Yx0; e|8^q_y^ ! rK}fP9^x"KtCl*J, uAI9qU9ČLP^!pW$yGJn2y蚐i$VC|"{{[:B4ZkV/m O@3(4}ɒ#PJ OqƸk)`MbMHiνkg.)vXzKrS7L6*mRl.${ MH,]MʔqCԇ}r6Rxӯ "3mi`m>88ꙺ?5z#^ <]z&QTTw\Gyh0=-zl3Rc+5Mem2Frxox&ʇ@L2z'bw약9zEnC\JI{~PSձ!2;od EC8eJi$oXr=ZQ3(y Xw(6T 9 ITniZiz"9v=VX.6=SJds،hB썊Ӎ 6 }tJs d)*z }U0^T%Kt)cNO9g&Y*qVj|$s&.caM)Ee@p6(9 b~W> ͕F-V.}J$y8`MCɧ l}Pd7{_sH`{ 2d=9}SUH>($4rFA@sQ.Ap>/PKmd%sx$v)%M nTM sK-:PQTˤ3ilݼR.o(R| E?uTOGE% &Br%۷ї 2*P߁NљcJ Fld`g"Fq+pq፮]~YnyD2 DS)KBH1K[f %e3::M $ pulbDPy>RJ\.s.@Ҝ쐴Z +v sjtC+@_$+ƐĆpȦj_ꔆ,UD(j3SָFEwn9 DT>Aa!5߂eǀbzj*ZĞ :]dR|ybvrQJ*jZM+gEѕ H9 h\²V3a)n~_J,%舩y 4<gwЅJE![44J'T(Ywu첵Uڌ44ps'Q[MNp4j|K+<J6FORL d_Z#y_1?#RH!e*oO}u}ePE#N\G_F.x:_(~=LbPsSX;x kڄR%9q8h֎,g[^j$dI̒ hcmﵣRݶD:*epe)Z]+pyTÞ܌{ FVT<œJ |" +ͦL0˔TTނH_V{m L!<@pR4 6QPA`0V@R|Ȩ0NE" 1 V׭XfAJe$ ˼* W7H(-[htE M):]$|; vۻ#)= X qS4tEO襬jEEN{"n-rQ==#7M miBLhw9 Mxز#vI7}8Uɝ?I%pkzlfW& MnH#~RjNWc^rl䚯S7#u@[R9aY&jkddBTWk}O||kf4SmTsb짞E2qʰZ.U@+cX=D^,8V\eEQ޹e&?[d?зzrDMѡMM!1 uY7 TۭOFk~M)c=@ֲ1h=)o^\;S8` E~!ު)ٍ& t2a.&p:Cf}.c)';bʸU\`IM)hN)4xsܦ1ցlFo1%qS1fKB6U)RIdD|K9-!t l7zW}-(s%ۥyu7Sb |([GO YЕZ&6/iY3F1%8Ã:\3v2G׍@Q !rU:_MF$ֿ{sPTjM Q aJ:ئ)%ɣd2NxM;$n[p pl՜%ѮQLSKڮv`ZzzK.=[}U펥÷w 5~A~L3[!-C۷nu pfY*^Y#=SCQt76:I^mƛBy[Nyg]D|))p%jcpT*%65GӶySFFݬ h*'N)eEc[2.JRһtOn7ϳV6pUjsu^V}XkQy_UR_(mE;d':جhq;ئD5j W\vA0p7Fb.ش:3nߙT1|Gk&m~:3"Pͽ"pۢ> ^< hےUuC34&_(eelqp{sۢQ1g׺o[d5OE|W]+O|?+`=(i-1Q5(:y=ހŒ͆,p)%[U2Mܵ-Q/-]\@vu~UI H+U~R.unipL 9Uvs#ch`QX-p`ԋ~MHMccm_gC#ǁdDpzGÀN T"ݒꎊmCOZMgjrr;m6Q0yKGy51 !B![I'XpKN# ":]':pxsN἞/=iz)c뇖IpSݝ' si4:I$qsw9ǒI`W5dC*gv$y?;GqZE|Ko ӕ [ET= #AI FHYnl2U_YNn6:@@D2H:FaSld tL4edt4D#` :$Ն$4{Gȩj&8l>[sY6:l"AnEOd!"@y]ԩ\uX Ǣѓ \dD4&䩆3HIP`U=#*vVc"jA-kFm4_W/_ϵGaq"JsŽQqS J[[a 5EAF5&ԺH)މ g:).#c<0 wD7!'oepPcsN ѱ>PO>JR tC} t'`' -}GE 2e$l>^Ϧk!LY= %5! q.tLX n=o^]GOLqЅI ]V)[DM :Ih}z dJw#}ORKYR Tg0n8ucnqtԄ:$,7.DP\ZE27Ѝ-5HgO<)c]`^ QI XTޞ==E5Z7FRzD~;EK*eh^d.i.EXr/e is.BQ5F{z{e+ 6.-m:T?dx7E=Pr]Q\7(}NJW+q$:Zq'fU`>0} I):4aЃ6w(TBҋ`]YNi߾'tt+~mdഎ Qᕊ5Hk x]'ɉWF)CcF6Z+ hOnlm S;4XdH `[e\\b?OVgk8nWZ=w8Y[\۲נgWFO*^ݸNAT6=dzAJgIPi]ۻ\4{r/Hvw {Q .Bw.n<"JOf^Q ep1;DƜ0 @`UC<6D@?5aV@ MS(G H돁\Kk}JI>4. n!0$%T.}K-(g6L 0Y ~Tj5-? {W|[J:rtqp)N~`2z!y(E)< t 盎O 3nrj50cat*hRqsJ&TUO h˞sSMo{@2鬁m̆Xf/6Gr5- [K~E=,Frրke7EA0R[waT>8̕S6&&zXGM_}/f[-QYQznM?4 }*:I*ǯ __!Q yV{ UɚeMe=K V=I?xIUkHtT9+ԹY( <[&u:~RB3_j΃%U8>`6jλUs!ʛ"/5-!:"nwccccll KBK+̑{WJOE664|v5GNNMѰӸ؆ite"ripř<|Y>nɗBZ%ƦKgI``kE$qm^F "h hoVS1rHt(u} { auT+ k't|q681Vf?w@4Tp0 5C#6VF4#]̮dV!{nZ|ߢnԌu16dꃩ#1 URѴtYBZ⊤|=AQ˜k #C}$t㍨Coڻ,<A[Uv=J= Tc„nh Z퉻rTJ^yt/7IryP3mp;PΔ&&SR7 u$nEU8$-B2~1 $:SepPMb[;$ܨ|_8UJ}s|ƩE?sW~rS@\^e eO &쩢 ]NJvz&3e? uPu=EҌغJ}%Wg77DU 7J%? k""e63w$N ;mRT[N#BR<pQYG!:Q;|&u㠽g\7( w  dCc.GR"?# fe5 [VUb D\s]%j]ăS.|VFJG|H߷)|qMPsnfiMHD`8>jtxmg+ ƛMNC&qsF7Gt{ gOX۴={dkY'\lpz5-`R &?W %M9z#gc!@>[Ԅ^ߡW i$c B6*=+cF t %]pUL hh+R,7c;-Q~CM5cDw뢨m= Wͳ!*ng1s,j>2εFG[sOaVR/z/ @yR +[Ճ&>a u#qcٴn!_H<&$DeiI-ap!ѫ#ꖘCnl`~SF#{ASdhi'2d/aSeXy6 $j)I{e5` 0_۔%ХkG`m(|(1'7s=8he1 Ď)CF('obx3X C-nÈlXd|$`z3+ r:1QLpile"nq`9`h;iUIYJBT9DdF  അ.״-pG57 }@;:IPB.8&}hU8#c477%X"qOE5 63)eguCoch!m Sͷ]Z6/=CU{~QmS3h HA\l=M3 GrU!$Zέ/ÄpI*֏VjnJۓBci_ $G&Z8 7C,}YstTITOSR0VԢ#M!ϠGCsG R~R+e5SӵWCnB7ѺELӴ6MvZc<^*ORu9,ndv69?@1޺ {&O7"H.QhWrGHְwq8f|IG 2r=f4oy+,c]IH/%uzԏY'<d.d5:GA8RH1m]i-'̛( T/ɓ:td ~0[>Ҏ 'yzvW%v/=e2kl$ ҁ+!sY\)PlݕR.8/~ͶПpes[iő$2}S9]|?Tm.<$ShPB{h0ӷlM `Myi\Kh<|K[܃G~JbԶ*xe | 61IЋ}_EKmw{㫓D҉egkì#u;I*U_ Rn~2QHy+c}??\EtW袧d 2q#w_飷v8 <T^uLǐ \wL-zjr%rPM@GE w>ik zPsfG Eet^iB#ܡ[d~vI|=e-#2)xBLowSY/ ;=b**H<|G6gf~ JZl,|qqM j>>+]xIERPD+BVެiL_$s{9ǹ'f<5CxV3m=x!z;O! 9*gkA%Bod>Q$\6O.TymbFc{_*+&ȶI2e8E UC@-GqM w@I *wsp^:!7D((UU}zawrJ~aD镕XZi~+=CY&&?CUv+Qxr,۞{#[)/;)X,ӫpdvtELu+266Ja>RuI dt4K8RǕA$/ROVjq>cTHy_G8 'HboJj5*Ի9[t5HҫR̔Uj]7/SCC+]5`ࠧ$ ~%՗\3>{u6CtC!hˑ!G#EnVT'(6 :0*Ʋ mscR) LF?yaEenBl{ap7P| YjB!]$-EIZC>\LRQ\I*p2u GQ2~3{"@X^ֵ<&4|1{Z.JJFO`t|i.%,^C>sf[\"訡6DP4t˯~nQq>D!L!(Kr8qsui;[ `R2I|y&xth'ףYQYMN[L| #Iz3ٖ:mCyv\T=+͒ &{; fܐB4lJd(* '-.aC ltQv&er<#$ Mn.S%?X™i۰O+-R܁`] %5#6FͶmu0G*mJ;e r22.Ue(3pxvt(o'n= lZ&b­Ԏ>Zd-x] E+V6'?Wf=BӜ.6kIMev{tD& 1Nvؾ .)E6(!X]sʨ3ɩ,t†Op467:PEU:aۅMHi;xT=xE$mK*es꜐rᩃRi!7q&&!cNO zaT)6Ht\s ݊씻ʁIH>CQT@sjBmN2;|%Roc<$T-ٺ-2mORx{lm5i j.qwOK]:ze/t)eVgR7zj>stTw%ZKZK'dWl0$2v]=Pm*˷#=Ü YFJи6qmy !_3Qԕ3S8:)n|SDpM}P}n=۾noE 7Ni =-vmK㺢k\ʖO*I[^7 Z+x:e8|wR#7s숊i-pE(lkQ#1h0p+YGDz8d@q.[=x\{p2PW Lp#huѷw_;Su(_qEDRʽ&)YK3PbagUsYّ`t)4Lp#umTMAc\db̟3tsHQ0xr <ѷaJ*|9S%Z9~%I]|Tf;"cn\ Q| 3L|ܭ,Zf0m(fv!y\xv!Js@UقюHl/ݲĐe*u ꆻ;Q.C\[쿺!dG5 RFbUl!ga ԥgR d}ZHFE0)I[?-7QZekk8~c6tq(%:D\NpGTE+wHJM}^&;s Ap{kWURFnvɺA7bĤ4VJ%.l}:W y@ \F/ 7Ghgkyq{̦nlO`-ݐ{ yx$~ݍKHJz*K'(_l҉>k6Z2;&gtiN2w44ѵs?L}TnHQY)il:4pBwŪ;A8kk^,м=7HVǪ{4n;p,=xpю6ߍ|/6>>#N⺏UF`cSDeL-mWǜ|_g61b~ꙪCUs{* e.\ {|.lwu|t+o{+/ [b ucbSkZ=1-hQ.񒇰 /U[[ZUB-Uc f'g.C,QHKKCWZE O G]!yxOd*`B'FM28,Lb ( ܅#LpCchk,/ u* @pkPhh9'[]QHռM4K4pfku*1FTӸ&6,n\HI2|TPr3I$K*u_̕WjQbFM 6z }Cl0OWd!I \lnqJX𘖆TȮd]D{Y\غ-H"d}8숞l4Y\ 6U{a }_(hw{k#^z{>LQ$ֽCI@pkbg)OO9%[\AP\N~ʗ~K=j>.>ʲV_JzGq=t=-|4S-7Dpht_IT.z6-֏`KQ7GFZ3Ӹ $\oe,e`̼&rEmDG# TSӋjI\R ax SU9lchK%{K\^DsS*I %PUtܒ./pTK1(O"쨓o~W so.灋]A tUHTQ.Axn ,z4yztNHtnD5ިVM$=+Zakq?오BHnvZ9 p?sMPiyoeh+Z{l=] na-Se[Gתtv[oEͤosz؉(픆>F{ߥeK)yʱ1SP=t>dĝ>dƖIZ@J::ZxCIη #V-rˠ;G-V2kNI"b"G#|!Ap],cl5*\:jPsͺe \쬛E<<ձ Ň(GHuna] %dYPlQݻ鲃Req'𬍎&r(ҷB=Υq>QdNw}m 6$tpIO(tWΜTMvַת ]tOSKL S!Yܒnrk_ }R6]5>v;m7Xk߾ʗ "Mh%9 GqPfIRu+<> N:ÃF/Kٟ(>!q;>'WE[ d95:#,|mbpϖkX"'T\+[ <-t'4=Cd2j}[nh`֛ X˹d`i_fTDIQmdlw+iI#&hnt"2~B>+ϳVKFAq򛲂8 Z<3aUvoZZ-D<B";oRn7O.# =\l$C0'Lnw |6q?ʘSxb%H~=.g UٰBO\ 4z%kyIW]f7bײՙ_:^ʤL8m6GJ[!9?evRhy7]'4ݦN曓V,Dov,L::GȘi#cȿ~QHMd|ϪUicTo/etLt0$g]Ws3:9Se)J D=[v͕%O} =.<( jy#?i7C߂AL})6Alj4y Nt 1oM-ffVHN[t3oZt*kG.NV؈IkȜGi)%I\5cbF4bXOCq ?w1cLSi^'쭏KyҜe_3ZX4yJ+q6߄/d3#7;]ttq9=QuJ1cqʍ''h]L/]5y> Hi'/2Ԕ٩(l6O)]y?R2p=MҶ\imiR뢢=3æ8{#b@w9?E][u.stm?y }n^NhiG׿zH˝4twyoh:yst c'['ftꚙ$7{CKRb:lH$7t7srNJZ!$9$sV)z㒆|v^]l%5Amʛb%^qv"ޗ*c.|+ HN9ScM^k@\pD{9T_ب:[ ExYme=SB:Ӽ0}I'J{5-!@G{a>Ӽ2\ZꁼnGA Zc&QaRߑH]EG@ CH?-&8}mTTfȆDk:i3HRA$\ aYP;<~*s %ek:t`$6fƻc?e뵒nKW=jH~:A6I'ΔT%% l׹ܗMYrqhdƣPzobwAe>cCTMUꄒθoCkߗ6DO&i!nI%ZȽ,:+V: "6>3V|=] H}6/kU{cc1+c LGa;c^P~)K8\c%of IUoqpq|/a7B8h! -FyB1< ݛ =UnwU.8 ̒s13Nj>f[ Z#d25Uss_+KVDP5"BicnRi`@[glSh=m<6b66]SYѴ+wP;v'ۢB$S;%:,٩l.q%ǕK:3֣WqGftZܺS!=TCTmVgEoUTIP '^ur;aE 谗ʃeQ V.`;E7cT:Lc򡸻DeIqfx7nM%DzR0Qݧz.珙:Ql+ŷRSekm]tnbJiP7S(@'wӄ=DUlu]OzVHꃅ[Lʯ윤n/6#eo{G|z4gGNRzތ&"[e2;fJ]B,*zC=,.DG("7lCC 83u}q -4d{Ph?V 5'ð-D[̟@:utDԁRE)Rp*tXmO 9N"b^FSiƻeIbkOkt|u;HP{5W6n+|jf_V<dSoÍnh#a=rM (@j:c}fNnU ͩӲ6( z%PvGCCtITy$PΩw!ߔ;TWwZ c&㺜U퐂ǩ^ '44ёۇtW2V2p~jS5Hv,׉}6\ck#e:|Ҏ\|'e+@v*[{^?lDX7SdNqa 7,ѐ.*ӜlNPmL!m9 >FCIvB0Kn[z+-ls(\PkuBcr[ p}k)>ʗ%&Ƨ p5+3X ^AETWBKq#ԙ.C,?U1nDd!fTSvXGH;݈(ow\y(t-2PKGԅl53kZyo.)Ox|=C?FB7?TdMi=Pmjog}5ow?C dߋ3|? s3eGˉ?@GD?$,kdh<14lfy%TűP 6po*%yP44Z] [ x{U;PoqG^4H~>[ ^bIa7Tjҷt[G'aiá)wGy[䯞/~-ǩx;kʗGGO= 4H`hkX'0QlEQշh*{,ѪD|439ꕶ\dC]vzjVnd%|Q 1:\d$TqF⭠Kf㕓w>H5ro)-Vxuv/ UĒw$:qT87r[=qutbH42 r]=a͝ J<$t H2ZÕ7T8&]dw=S5|ΰd]8mȺ!zYs H[usc=F\2bzdp1ӓEGJ,TS db' f^Q':% =K[Brm'lt.CI8NI&'&̔LSѸBI)<S ߪjѸCQ{d7yVac=؞ i Z rH[-Soh Ji#=kidmk[=9ZXY4CmLM,%RFi-`2wB[XzYW_ ݺKtVlcj^,v5=:8n4I)r1x{= ^:]DtOUqobgn7/\\\.핫vwqQܫ.(9녠:-2z-́\|}.@od.'=%rξJbFh^e 9`=SR4q=,n -l6GCm&3d G.?E&ݗE߇GodI'6ʘ15#$PIV+rlmcb'`족c zlRI(b1 ,5B)$Z~t2Δ'{Z6z*!>!zL0F1UW NHOuϯtD:|uO~P.մP&z|UC&'}BȽ*%>]Dllygto(Lp2lg-d mT:o>;:JП;}2rp¹mM<3[Ot^*ҥhn+`;3Br Hc쪂O5\ik)ꍮGBj@zZuC9G㑔7#jCƊROn]hMizJ`- I j&EDm&8|\ְ6(@n>\BI4}SeXUiI{15^*_LAl윥, { md4d DT9ej2b:QZ7p`J`?/Z_ }@U 8;oE3Okyh\+eq?u/N2Q54y[]lt&F%bBy*O7LH͌r|4y"P $. DĴc{$ke>%fLBvTx [U//7X3Zhg|lٶ8ݯ(uYsXXg7GA˾tSy1VVX<}צ YCctΗAo'ja$Ez#`kPf&vF,4L[N.Kqx`n W}\3(Yk_b~g/rK^ݗY9W| !~F 9ܮϨ|xdf$蛣c]P֭-gZq:4F8U +ul$ԷEN?/!*PWQ,q|.' UMX !Uf[^"H-9dQy<}Ny&DKdΙ\ .Û-Ѻ-xP|!9snq8GQhu:P4'z29 cKƋA K۪`4|qЧxACN>%=k0d\T  J)7D&@<$: D#ֲ8Z_#֎* 5(-wsj^!bK'_fN )O'9uItU.$o15+5:w甖S9%UZJuobUчAhiS )]F^NRjˉ'$-I&d=J9ʼ#Jr$t&D{zY6蹱2rQÜza-iEp1tLTpRm`b 3DP=לuKuư* pp8 ;aԀ)twUPrOdفϜIuK(y%#r&M~e['`"cO@4|Ίl 7O*z$ŲնÐM̉ 0 ^lTYTdGkfᶲۣ>Hg=Cmf'76,y@'4}`1IoTRƹM){_A5-".Z LRMW-n.}KPeUXfevj"Yfq%*J|J8 BbaBGtkR{ʗLJ7VmN-HQ kuD9{e{B`.2(DMLR pZۜS͑襶&f7Rs{̞-]5#9ӅݗR 'V,*l6VD1ʹpt;؁s" |Fsk02qؾ浇::8a˼ׅkIyu>e!fz,2e<MM{u}S gET\Ð5!tExV3{f`nؘj@] R@SJji͵DzSnĒE0$bqb|kNEsV.ThߔWaV7}%1Vc?\. f~ܯ%b]=c>F=i׏W \? چL}R+tl{'41$vŊrbkf~w9e6YS)\7Mis45؃M '}UDf\&j$Mz1f3kN:4tMI sS+iČ{y}P%O7ku|Ts3-M;o /A>p*fuLodih/T̋%vASZ< K.AV\6sM1:bWU^څ7qPXq4o RRz9(TK)4td{'`koӴC㵿jH?E/7lHlEGY\_w{d"?CG7og2j.!DzCG45:C${ÑdT w9bNc=OPIZ;6uX)MdV&Nj]g'1#}Py+.D? a/{^vTFbqLYlm'"'>WC-}$8,/|9td?ZojlMQgP GA`ϏKe?kM =4wpDKS2<7Q38ܠ?Xٴ0=]o|ƺJSYQώ(o_xUһKq-_Ĩ}, h˞>=霯=hHx.raE׸O:gi'VtיfnJj}zRE%6pHe;][UH~ )iYN5׷a`dӼ8K8sX:_4Qӹ/VŚLs1T@ϴ`.%.%t}.ߢoo7&xf"5|RO8U:AU QI[u(!P[{3[-]QsfǥTMmkx1}n8qe9htF1&)!$$7 8=%hh# 7\TdPcuiENE쭎/@!!iDCc $9%UЂ.$`pzd$z4`.I[RQj~#k}8 ;Y:X{xvEYrQU_Εj<)u:.\TjW[=q$2ԗuUF- AW:G|]7NJkEӔEQ snU"EHbEQB⋊-d=&8Ok% "X"">-Ċ#d\46(CEޯKtEqSaphQt4Ӂ1"%ܔ@\S\*.L2Q\M~|$?ULuTQ>dd*%U[*\; LH|)%'$~V2-F@

h#p>ts^0i#$i~cCi-` lv`cؓM#4>Z=0,̦hEI%% WLiSYS4 R[$ xd5䐋}ljcW3.}V;UHkY[;{rx&y=xTr|VWMsSJ\MԌ$7(ttdʖ݁AIʚpN} -)Ґmz&E,?ʞ~w3y=Ud߲\*p)#R RanMa ߇|YXX$qXeʐ꧷](͐buwCqtԎ# D]ʹ:Q V6?DCbxϲl6؍WGqGCB-d8ʢq }C@ }T* ̡L:\ZU -mSp .WHX(_ԅtQ}4mhLH _ ܡcM! $ϐ@de6P씓9l7H[{F~W w&i}INvt8mmhtx|ҝϨdm,DF:J!w\3Gm j/z2]NH:MWn.7](Zj7lV䞫W$:UEq<ey\aH6P"/@IU,0}$ēܫ0iIH#`q7Uk)mԎv 31"6# ˿ ~RlIP##`TMY 7`M)J5P&p?Ēw,N./|}EXvI$4 &kaUb*.(L5>Ţ8tχdQ=Vh'GUDZ5 _SXWERu#Մ:eMe߾U[Gv6_sk~}^U%9T>\W5pUvoYuz耵jȼo%q1fB믴~~G{}vitM©/SZkMt2NGpLY}oC$vk5y^ZoNA'7 oSzo|RY%-\QX+.7UQbo?V//Ϯo*!~lc\;)~,?O 4ϭ2D>]i 5ik^ؚ9tE@j^'UYpe>ԏXEsFŽ UqYHHO%X [G,|xmn=q=Ȧ ǻ)a,b&k+_ ?3<[ ᬬphN?+-WN6\r%pϰ*la;F/oxK^gސ|SG{P;o&ww |i1+(4T1g|yPhlOlc+e |s-&Q·h*<|vުOg?]ju U#Tn1=KnQ/a/G*s+g9l.I?ÊTD}:mjqGGmܣcH$i>"uMC#fG㚱GѴv>R> ~ N{0ѵ\\Ǟl]Ojw6[N?QSZ%}TOPu!3kCCL1RsE]Ŗ.FJ、|N?* ɺ_YrT|)$C־WY%?|#Y^XX+#r"xdLq..ll/LƈJic,K.}ԗ.~ލvFֆDi#"5ɽ8  ˝b+&Ŕ`S8顦fHh Z-Kc!`ISY o_,BzI2R]S; 7S],>ccV-ÀarJ$)$rc8%%*Aފ1ӀX~0 !65ҜF܄ɣ$/{ho)>;wr?jϦa~jzX 2oT["ikvY sұ|__һ{& Y]=TYd.=+pxtz^?nageru-2.3.0/nageru/bmusb/000077500000000000000000000000001450736322200153725ustar00rootroot00000000000000nageru-2.3.0/nageru/card_type.h000066400000000000000000000002371450736322200164070ustar00rootroot00000000000000#ifndef _CARD_TYPE_H #define _CARD_TYPE_H 1 enum class CardType { LIVE_CARD, FAKE_CAPTURE, FFMPEG_INPUT, CEF_INPUT, }; #endif // !defined(_CARD_TYPE_H) nageru-2.3.0/nageru/cbcr_subsample.frag000066400000000000000000000003131450736322200201040ustar00rootroot00000000000000#version 130 in vec2 tc0, tc1; uniform sampler2D cbcr_tex; out vec4 FragColor, FragColor2; void main() { FragColor = 0.5 * (texture(cbcr_tex, tc0) + texture(cbcr_tex, tc1)); FragColor2 = FragColor; } nageru-2.3.0/nageru/cbcr_subsample.vert000066400000000000000000000010361450736322200201500ustar00rootroot00000000000000#version 130 in vec2 position; in vec2 texcoord; out vec2 tc0, tc1; uniform vec2 foo_chroma_offset_0; uniform vec2 foo_chroma_offset_1; void main() { // The result of glOrtho(0.0, 1.0, 0.0, 1.0, 0.0, 1.0) is: // // 2.000 0.000 0.000 -1.000 // 0.000 2.000 0.000 -1.000 // 0.000 0.000 -2.000 -1.000 // 0.000 0.000 0.000 1.000 gl_Position = vec4(2.0 * position.x - 1.0, 2.0 * position.y - 1.0, -1.0, 1.0); vec2 flipped_tc = texcoord; tc0 = flipped_tc + foo_chroma_offset_0; tc1 = flipped_tc + foo_chroma_offset_1; }; nageru-2.3.0/nageru/cef_capture.cpp000066400000000000000000000153671450736322200172620ustar00rootroot00000000000000#include #include #include #include #include #include #include "cef_capture.h" #include "nageru_cef_app.h" #undef CHECK #include #include #include #include "bmusb/bmusb.h" using namespace std; using namespace std::chrono; using namespace bmusb; extern CefRefPtr cef_app; CEFCapture::CEFCapture(const string &url, unsigned width, unsigned height) : cef_client(new NageruCEFClient(this)), width(width), height(height), start_url(url) { char buf[256]; snprintf(buf, sizeof(buf), "CEF card %d", card_index + 1); description = buf; } CEFCapture::~CEFCapture() { if (has_dequeue_callbacks) { dequeue_cleanup_callback(); } } void CEFCapture::post_to_cef_ui_thread(std::function &&func, int64_t delay_ms) { lock_guard lock(browser_mutex); if (browser != nullptr) { if (delay_ms <= 0) { CefPostTask(TID_UI, new CEFTaskAdapter(std::move(func))); } else { CefPostDelayedTask(TID_UI, new CEFTaskAdapter(std::move(func)), delay_ms); } } else { deferred_tasks.push_back(std::move(func)); } } void CEFCapture::set_url(const string &url) { post_to_cef_ui_thread([this, url] { loaded = false; browser->GetMainFrame()->LoadURL(url); }); } void CEFCapture::reload() { post_to_cef_ui_thread([this] { loaded = false; browser->Reload(); }); } void CEFCapture::set_max_fps(int max_fps) { post_to_cef_ui_thread([this, max_fps] { browser->GetHost()->SetWindowlessFrameRate(max_fps); this->max_fps = max_fps; }); } void CEFCapture::execute_javascript_async(const string &js) { post_to_cef_ui_thread([this, js] { if (loaded) { CefString script_url(""); int start_line = 1; browser->GetMainFrame()->ExecuteJavaScript(js, script_url, start_line); } else { deferred_javascript.push_back(js); } }); } void CEFCapture::resize(unsigned width, unsigned height) { lock_guard lock(resolution_mutex); this->width = width; this->height = height; } void CEFCapture::request_new_frame(bool ignore_if_locked) { unique_lock outer_lock(browser_mutex, defer_lock); if (ignore_if_locked && !outer_lock.try_lock()) { // If the caller is holding card_mutex, we need to abort here // if we can't get browser_mutex, since otherwise, the UI thread // might hold browser_mutex (blocking post_to_cef_ui_thread()) // and be waiting for card_mutex. return; } // By adding a delay, we make sure we don't get a new frame // delivered immediately (we probably already are on the UI thread), // where we couldn't really deal with it. post_to_cef_ui_thread([this] { lock_guard lock(browser_mutex); if (browser != nullptr) { // Could happen if we are shutting down. browser->GetHost()->Invalidate(PET_VIEW); } }, 16); } void CEFCapture::OnPaint(const void *buffer, int width, int height) { steady_clock::time_point timestamp = steady_clock::now(); VideoFormat video_format; video_format.width = width; video_format.height = height; video_format.stride = width * 4; video_format.frame_rate_nom = max_fps; video_format.frame_rate_den = 1; video_format.has_signal = true; video_format.is_connected = true; FrameAllocator::Frame video_frame = video_frame_allocator->alloc_frame(); if (video_frame.data == nullptr) { // We lost a frame, so we need to invalidate the entire thing. // (CEF only sends OnPaint when there are actual changes, // so we need to do this explicitly, or we could be stuck on an // old frame forever if the image doesn't change.) request_new_frame(/*ignore_if_locked=*/false); ++timecode; } else { assert(video_frame.size >= unsigned(width * height * 4)); assert(!video_frame.interleaved); memcpy(video_frame.data, buffer, width * height * 4); video_frame.len = video_format.stride * height; video_frame.received_timestamp = timestamp; frame_callback(timecode++, video_frame, 0, video_format, FrameAllocator::Frame(), 0, AudioFormat()); } } void CEFCapture::OnLoadEnd() { post_to_cef_ui_thread([this] { loaded = true; for (const string &js : deferred_javascript) { CefString script_url(""); int start_line = 1; browser->GetMainFrame()->ExecuteJavaScript(js, script_url, start_line); } deferred_javascript.clear(); }); } void CEFCapture::configure_card() { if (video_frame_allocator == nullptr) { owned_video_frame_allocator.reset(new MallocFrameAllocator(FRAME_SIZE, NUM_QUEUED_VIDEO_FRAMES)); set_video_frame_allocator(owned_video_frame_allocator.get()); } } void CEFCapture::start_bm_capture() { cef_app->initialize_cef(); CefPostTask(TID_UI, new CEFTaskAdapter([this]{ lock_guard lock(browser_mutex); CefBrowserSettings browser_settings; browser_settings.webgl = cef_state_t::STATE_ENABLED; browser_settings.windowless_frame_rate = max_fps; CefWindowInfo window_info; window_info.SetAsWindowless(0); browser = CefBrowserHost::CreateBrowserSync(window_info, cef_client, start_url, browser_settings, nullptr, nullptr); for (function &task : deferred_tasks) { task(); } deferred_tasks.clear(); })); } void CEFCapture::stop_dequeue_thread() { { lock_guard lock(browser_mutex); cef_app->close_browser(browser); browser = nullptr; // Or unref_cef() will be sad. } cef_app->unref_cef(); } std::map CEFCapture::get_available_video_modes() const { VideoMode mode; char buf[256]; snprintf(buf, sizeof(buf), "%ux%u", width, height); mode.name = buf; mode.autodetect = false; mode.width = width; mode.height = height; mode.frame_rate_num = max_fps; mode.frame_rate_den = 1; mode.interlaced = false; return {{ 0, mode }}; } std::map CEFCapture::get_available_video_inputs() const { return {{ 0, "HTML video input" }}; } std::map CEFCapture::get_available_audio_inputs() const { return {{ 0, "Fake HTML audio input (silence)" }}; } void CEFCapture::set_video_mode(uint32_t video_mode_id) { assert(video_mode_id == 0); } void CEFCapture::set_video_input(uint32_t video_input_id) { assert(video_input_id == 0); } void CEFCapture::set_audio_input(uint32_t audio_input_id) { assert(audio_input_id == 0); } void NageruCEFClient::OnPaint(CefRefPtr browser, PaintElementType type, const RectList &dirtyRects, const void *buffer, int width, int height) { parent->OnPaint(buffer, width, height); } void NageruCEFClient::GetViewRect(CefRefPtr browser, CefRect &rect) { parent->GetViewRect(rect); } void CEFCapture::GetViewRect(CefRect &rect) { lock_guard lock(resolution_mutex); rect = CefRect(0, 0, width, height); } void NageruCEFClient::OnLoadEnd(CefRefPtr browser, CefRefPtr frame, int httpStatusCode) { parent->OnLoadEnd(); } nageru-2.3.0/nageru/cef_capture.h000066400000000000000000000133141450736322200167150ustar00rootroot00000000000000#ifndef _CEF_CAPTURE_H #define _CEF_CAPTURE_H 1 // CEFCapture represents a single CEF virtual capture card (usually, there would only // be one globally), similar to FFmpegCapture. It owns a CefBrowser, which calls // OnPaint() back every time it has a frame. Note that it runs asynchronously; // there's no way to get frame-perfect sync. #include #include #include #include #include #include #include #include #include #include #include #undef CHECK #include #include #include #include class CefBrowser; class CefRect; class CEFCapture; // A helper class for CEFCapture to proxy information to CEF, without becoming // CEF-refcounted itself. class NageruCEFClient : public CefClient, public CefRenderHandler, public CefLoadHandler { public: NageruCEFClient(CEFCapture *parent) : parent(parent) {} CefRefPtr GetRenderHandler() override { return this; } CefRefPtr GetLoadHandler() override { return this; } // CefRenderHandler. void OnPaint(CefRefPtr browser, PaintElementType type, const RectList &dirtyRects, const void *buffer, int width, int height) override; void GetViewRect(CefRefPtr browser, CefRect &rect) override; // CefLoadHandler. void OnLoadEnd(CefRefPtr browser, CefRefPtr frame, int httpStatusCode) override; private: CEFCapture *parent; IMPLEMENT_REFCOUNTING(NageruCEFClient); }; class CEFCapture : public bmusb::CaptureInterface { public: CEFCapture(const std::string &url, unsigned width, unsigned height); ~CEFCapture(); void set_card_index(int card_index) { this->card_index = card_index; } int get_card_index() const { return card_index; } void set_url(const std::string &url); void reload(); void set_max_fps(int max_fps); void execute_javascript_async(const std::string &js); void resize(unsigned width, unsigned height); void request_new_frame(bool ignore_if_locked); // Callbacks from NageruCEFClient. void OnPaint(const void *buffer, int width, int height); void GetViewRect(CefRect &rect); void OnLoadEnd(); // CaptureInterface. void set_video_frame_allocator(bmusb::FrameAllocator *allocator) override { video_frame_allocator = allocator; if (owned_video_frame_allocator.get() != allocator) { owned_video_frame_allocator.reset(); } } bmusb::FrameAllocator *get_video_frame_allocator() override { return video_frame_allocator; } // Does not take ownership. void set_audio_frame_allocator(bmusb::FrameAllocator *allocator) override { } bmusb::FrameAllocator *get_audio_frame_allocator() override { return nullptr; } void set_frame_callback(bmusb::frame_callback_t callback) override { frame_callback = callback; } void set_dequeue_thread_callbacks(std::function init, std::function cleanup) override { dequeue_init_callback = init; dequeue_cleanup_callback = cleanup; has_dequeue_callbacks = true; } std::string get_description() const override { return description; } void configure_card() override; void start_bm_capture() override; void stop_dequeue_thread() override; bool get_disconnected() const override { return false; } std::set get_available_pixel_formats() const override { return std::set{ bmusb::PixelFormat_8BitBGRA }; } void set_pixel_format(bmusb::PixelFormat pixel_format) override { assert(pixel_format == bmusb::PixelFormat_8BitBGRA); } bmusb::PixelFormat get_current_pixel_format() const override { return bmusb::PixelFormat_8BitBGRA; } std::map get_available_video_modes() const override; void set_video_mode(uint32_t video_mode_id) override; uint32_t get_current_video_mode() const override { return 0; } std::map get_available_video_inputs() const override; void set_video_input(uint32_t video_input_id) override; uint32_t get_current_video_input() const override { return 0; } std::map get_available_audio_inputs() const override; void set_audio_input(uint32_t audio_input_id) override; uint32_t get_current_audio_input() const override { return 0; } private: void post_to_cef_ui_thread(std::function &&func, int64_t delay_ms = 0); CefRefPtr cef_client; // Needs to be different from browser_mutex below, since GetViewRect // can be called unpredictably from when we are already holding // . std::mutex resolution_mutex; unsigned width, height; // Under . int card_index = -1; bool has_dequeue_callbacks = false; std::function dequeue_init_callback = nullptr; std::function dequeue_cleanup_callback = nullptr; bmusb::FrameAllocator *video_frame_allocator = nullptr; std::unique_ptr owned_video_frame_allocator; bmusb::frame_callback_t frame_callback = nullptr; std::string description, start_url; std::atomic max_fps{60}; // Needs to be recursive because the lambda in OnPaint could cause // OnPaint itself to be called. std::recursive_mutex browser_mutex; CefRefPtr browser; // Under . // Tasks waiting for to get ready. Under . std::vector> deferred_tasks; // Whether the last set_url() (includes the implicit one in the constructor) // has loaded yet. Accessed from the CEF thread only. bool loaded = false; // JavaScript waiting for the first page (well, any page) to have loaded. // Accessed from the CEF thread only. std::vector deferred_javascript; int timecode = 0; }; #endif // !defined(_CEF_CAPTURE_H) nageru-2.3.0/nageru/chroma_subsampler.cpp000066400000000000000000000265211450736322200205020ustar00rootroot00000000000000#include "chroma_subsampler.h" #include "v210_converter.h" #include #include #include #include #include "embedded_files.h" #include "shared/read_file.h" using namespace movit; using namespace std; ChromaSubsampler::ChromaSubsampler(ResourcePool *resource_pool) : resource_pool(resource_pool) { vector frag_shader_outputs; // Set up stuff for NV12 conversion. // // Note: Due to the horizontally co-sited chroma/luma samples in H.264 // (chrome position is left for horizontal and center for vertical), // we need to be a bit careful in our subsampling. A diagram will make // this clearer, showing some luma and chroma samples: // // a b c d // +---+---+---+---+ // | | | | | // | Y | Y | Y | Y | // | | | | | // +---+---+---+---+ // // +-------+-------+ // | | | // | C | C | // | | | // +-------+-------+ // // Clearly, the rightmost chroma sample here needs to be equivalent to // b/4 + c/2 + d/4. (We could also implement more sophisticated filters, // of course, but as long as the upsampling is not going to be equally // sophisticated, it's probably not worth it.) If we sample once with // no mipmapping, we get just c, ie., no actual filtering in the // horizontal direction. (For the vertical direction, we can just // sample in the middle to get the right filtering.) One could imagine // we could use mipmapping (assuming we can create mipmaps cheaply), // but then, what we'd get is this: // // (a+b)/2 (c+d)/2 // +-------+-------+ // | | | // | Y | Y | // | | | // +-------+-------+ // // +-------+-------+ // | | | // | C | C | // | | | // +-------+-------+ // // which ends up sampling equally from a and b, which clearly isn't right. Instead, // we need to do two (non-mipmapped) chroma samples, both hitting exactly in-between // source pixels. // // Sampling in-between b and c gives us the sample (b+c)/2, and similarly for c and d. // Taking the average of these gives of (b+c)/4 + (c+d)/4 = b/4 + c/2 + d/4, which is // exactly what we want. // // See also http://www.poynton.com/PDFs/Merging_RGB_and_422.pdf, pages 6–7. // Cb/Cr shader. string cbcr_vert_shader = read_file("cbcr_subsample.vert", _binary_cbcr_subsample_vert_data, _binary_cbcr_subsample_vert_size); string cbcr_frag_shader = read_file("cbcr_subsample.frag", _binary_cbcr_subsample_frag_data, _binary_cbcr_subsample_frag_size); cbcr_program_num = resource_pool->compile_glsl_program(cbcr_vert_shader, cbcr_frag_shader, frag_shader_outputs); check_error(); cbcr_chroma_offset_0_location = get_uniform_location(cbcr_program_num, "foo", "chroma_offset_0"); check_error(); cbcr_chroma_offset_1_location = get_uniform_location(cbcr_program_num, "foo", "chroma_offset_1"); check_error(); cbcr_texture_sampler_uniform = glGetUniformLocation(cbcr_program_num, "cbcr_tex"); check_error(); cbcr_position_attribute_index = glGetAttribLocation(cbcr_program_num, "position"); check_error(); cbcr_texcoord_attribute_index = glGetAttribLocation(cbcr_program_num, "texcoord"); check_error(); // Same, for UYVY conversion. string uyvy_vert_shader = read_file("uyvy_subsample.vert", _binary_uyvy_subsample_vert_data, _binary_uyvy_subsample_vert_size); string uyvy_frag_shader = read_file("uyvy_subsample.frag", _binary_uyvy_subsample_frag_data, _binary_uyvy_subsample_frag_size); uyvy_program_num = resource_pool->compile_glsl_program(uyvy_vert_shader, uyvy_frag_shader, frag_shader_outputs); check_error(); uyvy_luma_offset_0_location = get_uniform_location(uyvy_program_num, "foo", "luma_offset_0"); check_error(); uyvy_luma_offset_1_location = get_uniform_location(uyvy_program_num, "foo", "luma_offset_1"); check_error(); uyvy_chroma_offset_0_location = get_uniform_location(uyvy_program_num, "foo", "chroma_offset_0"); check_error(); uyvy_chroma_offset_1_location = get_uniform_location(uyvy_program_num, "foo", "chroma_offset_1"); check_error(); uyvy_y_texture_sampler_uniform = glGetUniformLocation(uyvy_program_num, "y_tex"); check_error(); uyvy_cbcr_texture_sampler_uniform = glGetUniformLocation(uyvy_program_num, "cbcr_tex"); check_error(); uyvy_position_attribute_index = glGetAttribLocation(uyvy_program_num, "position"); check_error(); uyvy_texcoord_attribute_index = glGetAttribLocation(uyvy_program_num, "texcoord"); check_error(); // Shared between the two. float vertices[] = { 0.0f, 2.0f, 0.0f, 0.0f, 2.0f, 0.0f }; vbo = generate_vbo(2, GL_FLOAT, sizeof(vertices), vertices); check_error(); // v210 compute shader. if (v210Converter::has_hardware_support()) { string v210_shader_src = read_file("v210_subsample.comp", _binary_v210_subsample_comp_data, _binary_v210_subsample_comp_size); GLuint shader_num = movit::compile_shader(v210_shader_src, GL_COMPUTE_SHADER); check_error(); v210_program_num = glCreateProgram(); check_error(); glAttachShader(v210_program_num, shader_num); check_error(); glLinkProgram(v210_program_num); check_error(); GLint success; glGetProgramiv(v210_program_num, GL_LINK_STATUS, &success); check_error(); if (success == GL_FALSE) { GLchar error_log[1024] = {0}; glGetProgramInfoLog(v210_program_num, 1024, nullptr, error_log); fprintf(stderr, "Error linking program: %s\n", error_log); abort(); } v210_in_y_pos = glGetUniformLocation(v210_program_num, "in_y"); check_error(); v210_in_cbcr_pos = glGetUniformLocation(v210_program_num, "in_cbcr"); check_error(); v210_outbuf_pos = glGetUniformLocation(v210_program_num, "outbuf"); check_error(); v210_inv_width_pos = glGetUniformLocation(v210_program_num, "inv_width"); check_error(); v210_inv_height_pos = glGetUniformLocation(v210_program_num, "inv_height"); check_error(); } else { v210_program_num = 0; } } ChromaSubsampler::~ChromaSubsampler() { resource_pool->release_glsl_program(cbcr_program_num); check_error(); resource_pool->release_glsl_program(uyvy_program_num); check_error(); glDeleteBuffers(1, &vbo); check_error(); if (v210_program_num != 0) { glDeleteProgram(v210_program_num); check_error(); } } void ChromaSubsampler::subsample_chroma(GLuint cbcr_tex, unsigned width, unsigned height, GLuint dst_tex, GLuint dst2_tex) { GLuint vao = resource_pool->create_vec2_vao({ cbcr_position_attribute_index, cbcr_texcoord_attribute_index }, vbo); glBindVertexArray(vao); check_error(); // Extract Cb/Cr. GLuint fbo; if (dst2_tex <= 0) { fbo = resource_pool->create_fbo(dst_tex); } else { fbo = resource_pool->create_fbo(dst_tex, dst2_tex); } glBindFramebuffer(GL_FRAMEBUFFER, fbo); glViewport(0, 0, width/2, height/2); check_error(); glUseProgram(cbcr_program_num); check_error(); glActiveTexture(GL_TEXTURE0); check_error(); glBindTexture(GL_TEXTURE_2D, cbcr_tex); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_MIN_FILTER, GL_LINEAR); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_S, GL_CLAMP_TO_EDGE); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_T, GL_CLAMP_TO_EDGE); check_error(); glUniform2f(cbcr_chroma_offset_0_location, -1.0f / width, 0.0f); check_error(); glUniform2f(cbcr_chroma_offset_1_location, -0.0f / width, 0.0f); check_error(); glUniform1i(cbcr_texture_sampler_uniform, 0); glDrawArrays(GL_TRIANGLES, 0, 3); check_error(); glUseProgram(0); check_error(); glBindFramebuffer(GL_FRAMEBUFFER, 0); check_error(); glBindVertexArray(0); check_error(); resource_pool->release_fbo(fbo); resource_pool->release_vec2_vao(vao); } void ChromaSubsampler::create_uyvy(GLuint y_tex, GLuint cbcr_tex, unsigned width, unsigned height, GLuint dst_tex) { GLuint vao = resource_pool->create_vec2_vao({ cbcr_position_attribute_index, cbcr_texcoord_attribute_index }, vbo); glBindVertexArray(vao); check_error(); glBindVertexArray(vao); check_error(); GLuint fbo = resource_pool->create_fbo(dst_tex); glBindFramebuffer(GL_FRAMEBUFFER, fbo); glViewport(0, 0, width/2, height); check_error(); glUseProgram(uyvy_program_num); check_error(); glUniform1i(uyvy_y_texture_sampler_uniform, 0); check_error(); glUniform1i(uyvy_cbcr_texture_sampler_uniform, 1); check_error(); glActiveTexture(GL_TEXTURE0); check_error(); glBindTexture(GL_TEXTURE_2D, y_tex); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_MIN_FILTER, GL_LINEAR); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_S, GL_CLAMP_TO_EDGE); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_T, GL_CLAMP_TO_EDGE); check_error(); glActiveTexture(GL_TEXTURE1); check_error(); glBindTexture(GL_TEXTURE_2D, cbcr_tex); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_MIN_FILTER, GL_LINEAR); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_S, GL_CLAMP_TO_EDGE); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_T, GL_CLAMP_TO_EDGE); check_error(); glUniform2f(uyvy_luma_offset_0_location, -0.5f / width, 0.0f); check_error(); glUniform2f(uyvy_luma_offset_1_location, 0.5f / width, 0.0f); check_error(); glUniform2f(uyvy_chroma_offset_0_location, -1.0f / width, 0.0f); check_error(); glUniform2f(uyvy_chroma_offset_1_location, -0.0f / width, 0.0f); check_error(); glBindBuffer(GL_ARRAY_BUFFER, vbo); check_error(); glDrawArrays(GL_TRIANGLES, 0, 3); check_error(); glActiveTexture(GL_TEXTURE0); check_error(); glUseProgram(0); check_error(); glBindFramebuffer(GL_FRAMEBUFFER, 0); check_error(); glBindVertexArray(0); check_error(); resource_pool->release_fbo(fbo); resource_pool->release_vec2_vao(vao); } void ChromaSubsampler::create_v210(GLuint y_tex, GLuint cbcr_tex, unsigned width, unsigned height, GLuint dst_tex) { assert(v210_program_num != 0); glUseProgram(v210_program_num); check_error(); glUniform1i(v210_in_y_pos, 0); check_error(); glUniform1i(v210_in_cbcr_pos, 1); check_error(); glUniform1i(v210_outbuf_pos, 2); check_error(); glUniform1f(v210_inv_width_pos, 1.0 / width); check_error(); glUniform1f(v210_inv_height_pos, 1.0 / height); check_error(); glActiveTexture(GL_TEXTURE0); check_error(); glBindTexture(GL_TEXTURE_2D, y_tex); // We don't actually need to bind it, but we need to set the state. check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_MIN_FILTER, GL_LINEAR); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_S, GL_CLAMP_TO_EDGE); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_T, GL_CLAMP_TO_EDGE); check_error(); glBindImageTexture(0, y_tex, 0, GL_FALSE, 0, GL_READ_ONLY, GL_R16); // This is the real bind. check_error(); glActiveTexture(GL_TEXTURE1); check_error(); glBindTexture(GL_TEXTURE_2D, cbcr_tex); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_MIN_FILTER, GL_LINEAR); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_S, GL_CLAMP_TO_EDGE); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_T, GL_CLAMP_TO_EDGE); check_error(); glBindImageTexture(2, dst_tex, 0, GL_FALSE, 0, GL_WRITE_ONLY, GL_RGB10_A2); check_error(); // Actually run the shader. We use workgroups of size 2x16 threadst , and each thread // processes 6x1 input pixels, so round up to number of 12x16 pixel blocks. glDispatchCompute((width + 11) / 12, (height + 15) / 16, 1); glBindTexture(GL_TEXTURE_2D, 0); check_error(); glActiveTexture(GL_TEXTURE0); check_error(); glUseProgram(0); check_error(); } nageru-2.3.0/nageru/chroma_subsampler.h000066400000000000000000000047011450736322200201430ustar00rootroot00000000000000#ifndef _CHROMA_SUBSAMPLER_H #define _CHROMA_SUBSAMPLER_H 1 #include namespace movit { class ResourcePool; } // namespace movit class ChromaSubsampler { public: ChromaSubsampler(movit::ResourcePool *resource_pool); ~ChromaSubsampler(); // Subsamples chroma (packed Cb and Cr) 2x2 to yield chroma suitable for // NV12 (semiplanar 4:2:0). Chroma positioning is left/center (H.264 convention). // width and height are the dimensions (in pixels) of the input texture. // // You can get two equal copies if you'd like; just set dst2_tex to a texture // number and it will receive an exact copy of what goes into dst_tex. void subsample_chroma(GLuint cbcr_tex, unsigned width, unsigned height, GLuint dst_tex, GLuint dst2_tex = 0); // Subsamples and interleaves luma and chroma to give 4:2:2 packed Y'CbCr (UYVY). // Chroma positioning is left (H.264 convention). // width and height are the dimensions (in pixels) of the input textures. void create_uyvy(GLuint y_tex, GLuint cbcr_tex, unsigned width, unsigned height, GLuint dst_tex); // Subsamples and interleaves luma and chroma to give 10-bit 4:2:2 // packed Y'CbCr (v210); see v210converter.h for more information on // the format. Luma and chroma are assumed to be 10-bit data packed // into 16-bit textures. Chroma positioning is left (H.264 convention). // width and height are the dimensions (in pixels) of the input textures; // Requires compute shaders; check v210Converter::has_hardware_support(). void create_v210(GLuint y_tex, GLuint cbcr_tex, unsigned width, unsigned height, GLuint dst_tex); private: movit::ResourcePool *resource_pool; GLuint vbo; // Holds position and texcoord data. GLuint cbcr_program_num; // Owned by . GLuint cbcr_texture_sampler_uniform; GLint cbcr_position_attribute_index, cbcr_texcoord_attribute_index; GLuint cbcr_chroma_offset_0_location, cbcr_chroma_offset_1_location; GLuint uyvy_program_num; // Owned by . GLuint uyvy_y_texture_sampler_uniform, uyvy_cbcr_texture_sampler_uniform; GLint uyvy_position_attribute_index, uyvy_texcoord_attribute_index; GLuint uyvy_luma_offset_0_location, uyvy_luma_offset_1_location; GLuint uyvy_chroma_offset_0_location, uyvy_chroma_offset_1_location; GLuint v210_program_num; // Compute shader, so owned by ourselves. Can be 0. GLuint v210_in_y_pos, v210_in_cbcr_pos, v210_outbuf_pos; GLuint v210_inv_width_pos, v210_inv_height_pos; }; #endif // !defined(_CHROMA_SUBSAMPLER_H) nageru-2.3.0/nageru/clickable_label.h000066400000000000000000000006731450736322200175110ustar00rootroot00000000000000#ifndef _CLICKABLE_LABEL_H #define _CLICKABLE_LABEL_H 1 // Just like a normal QLabel, except that it can also emit a clicked signal. #include class QMouseEvent; class ClickableLabel : public QLabel { Q_OBJECT public: ClickableLabel(QWidget *parent) : QLabel(parent) {} signals: void clicked(); protected: void mousePressEvent(QMouseEvent *event) override { emit clicked(); } }; #endif // !defined(_CLICKABLE_LABEL_H) nageru-2.3.0/nageru/compression_reduction_meter.cpp000066400000000000000000000053371450736322200226070ustar00rootroot00000000000000#include "compression_reduction_meter.h" #include #include #include "piecewise_interpolator.h" #include "vu_common.h" class QPaintEvent; class QResizeEvent; using namespace std; namespace { vector control_points = { { 60.0f, 6.0f }, { 30.0f, 5.0f }, { 18.0f, 4.0f }, { 12.0f, 3.0f }, { 6.0f, 2.0f }, { 3.0f, 1.0f }, { 0.0f, 0.0f } }; PiecewiseInterpolator interpolator(control_points); } // namespace CompressionReductionMeter::CompressionReductionMeter(QWidget *parent) : QWidget(parent) { } void CompressionReductionMeter::resizeEvent(QResizeEvent *event) { recalculate_pixmaps(); } void CompressionReductionMeter::paintEvent(QPaintEvent *event) { QPainter painter(this); float level_db; { lock_guard lock(level_mutex); level_db = this->level_db; } int on_pos = lrint(db_to_pos(level_db)); QRect on_rect(0, 0, width(), on_pos); QRect off_rect(0, on_pos, width(), height()); painter.drawPixmap(on_rect, on_pixmap, on_rect); painter.drawPixmap(off_rect, off_pixmap, off_rect); } void CompressionReductionMeter::recalculate_pixmaps() { constexpr int y_offset = text_box_height / 2; constexpr int text_margin = 5; float margin = 0.5 * (width() - meter_width); on_pixmap = QPixmap(width(), height()); QPainter on_painter(&on_pixmap); on_painter.fillRect(0, 0, width(), height(), parentWidget()->palette().window()); draw_vu_meter(on_painter, width(), meter_height(), margin, 2.0, true, min_level, max_level, /*flip=*/true, y_offset); draw_scale(&on_painter, 0.5 * width() + 0.5 * meter_width + text_margin); off_pixmap = QPixmap(width(), height()); QPainter off_painter(&off_pixmap); off_painter.fillRect(0, 0, width(), height(), parentWidget()->palette().window()); draw_vu_meter(off_painter, width(), meter_height(), margin, 2.0, false, min_level, max_level, /*flip=*/true, y_offset); draw_scale(&off_painter, 0.5 * width() + 0.5 * meter_width + text_margin); } void CompressionReductionMeter::draw_scale(QPainter *painter, int x_pos) { QFont font; font.setPointSize(8); painter->setPen(Qt::black); painter->setFont(font); for (size_t i = 0; i < control_points.size(); ++i) { char buf[256]; snprintf(buf, 256, "%.0f", control_points[i].db_value); double y = db_to_pos(control_points[i].db_value); painter->drawText(QRect(x_pos, y - text_box_height / 2, text_box_width, text_box_height), Qt::AlignCenter | Qt::AlignVCenter, buf); } } double CompressionReductionMeter::db_to_pos(double level_db) const { float value = interpolator.db_to_fraction(level_db); return height() - lufs_to_pos(value, meter_height(), min_level, max_level) - text_box_height / 2; } int CompressionReductionMeter::meter_height() const { return height() - text_box_height; } nageru-2.3.0/nageru/compression_reduction_meter.h000066400000000000000000000025401450736322200222450ustar00rootroot00000000000000#ifndef COMPRESSION_REDUCTION_METER_H #define COMPRESSION_REDUCTION_METER_H // A meter that goes downwards instead of upwards, and has a non-linear scale. #include #include #include #include #include #include "piecewise_interpolator.h" class QObject; class QPaintEvent; class QResizeEvent; class CompressionReductionMeter : public QWidget { Q_OBJECT public: CompressionReductionMeter(QWidget *parent); void set_reduction_db(float level_db) { std::lock_guard lock(level_mutex); this->level_db = level_db; QMetaObject::invokeMethod(this, "update", Qt::AutoConnection); } private: void resizeEvent(QResizeEvent *event) override; void paintEvent(QPaintEvent *event) override; void recalculate_pixmaps(); void draw_scale(QPainter *painter, int x_pos); double db_to_pos(double db) const; int meter_height() const; std::mutex level_mutex; float level_db = 0.0f; static constexpr float min_level = 0.0f; // Must match control_points (in the .cpp file). static constexpr float max_level = 6.0f; // Same. static constexpr int meter_width = 20; // Size of the text box. The meter will be shrunk to make room for the text box // (half the height) on both sides. static constexpr int text_box_width = 15; static constexpr int text_box_height = 10; QPixmap on_pixmap, off_pixmap; }; #endif nageru-2.3.0/nageru/context.h000066400000000000000000000010351450736322200161160ustar00rootroot00000000000000 // Needs to be in its own file because Qt and libepoxy seemingly don't coexist well // within the same file. class QSurface; class QOpenGLContext; class QSurfaceFormat; class QGLWidget; extern bool using_egl; extern QGLWidget *global_share_widget; QSurface *create_surface(const QSurfaceFormat &format); QSurface *create_surface_with_same_format(const QSurface *surface); QOpenGLContext *create_context(const QSurface *surface); bool make_current(QOpenGLContext *context, QSurface *surface); void delete_context(QOpenGLContext *context); nageru-2.3.0/nageru/context_menus.cpp000066400000000000000000000037651450736322200176740ustar00rootroot00000000000000#include #include #include #include #include "mixer.h" using namespace std; void fill_hdmi_sdi_output_device_menu(QMenu *menu) { menu->clear(); QActionGroup *card_group = new QActionGroup(menu); int current_card = global_mixer->get_output_card_index(); QAction *none_action = new QAction("None", card_group); none_action->setCheckable(true); if (current_card == -1) { none_action->setChecked(true); } QObject::connect(none_action, &QAction::triggered, []{ global_mixer->set_output_card(-1); }); menu->addAction(none_action); for (unsigned card_index = 0; card_index < MAX_VIDEO_CARDS; ++card_index) { if (!global_mixer->card_can_be_used_as_output(card_index)) { continue; } QString description(QString::fromStdString(global_mixer->get_output_card_description(card_index))); QAction *action = new QAction(description, card_group); action->setCheckable(true); if (current_card == int(card_index)) { action->setChecked(true); } QObject::connect(action, &QAction::triggered, [card_index]{ global_mixer->set_output_card(card_index); }); menu->addAction(action); } } void fill_hdmi_sdi_output_resolution_menu(QMenu *menu) { menu->clear(); int current_card = global_mixer->get_output_card_index(); if (current_card == -1) { menu->setEnabled(false); return; } menu->setEnabled(true); QActionGroup *resolution_group = new QActionGroup(menu); uint32_t current_mode = global_mixer->get_output_video_mode(); map video_modes = global_mixer->get_available_output_video_modes(); for (const auto &mode : video_modes) { QString description(QString::fromStdString(mode.second.name)); QAction *action = new QAction(description, resolution_group); action->setCheckable(true); if (current_mode == mode.first) { action->setChecked(true); } const uint32_t mode_id = mode.first; QObject::connect(action, &QAction::triggered, [mode_id]{ global_mixer->set_output_video_mode(mode_id); }); menu->addAction(action); } } nageru-2.3.0/nageru/context_menus.h000066400000000000000000000012451450736322200173300ustar00rootroot00000000000000#ifndef _CONTEXT_MENUS_H #define _CONTEXT_MENUS_H 1 // Some context menus for controlling various I/O selections, // based on data from Mixer. class QMenu; // Populate a submenu for selecting output card, with an action for each card. // Will call into the mixer on trigger. void fill_hdmi_sdi_output_device_menu(QMenu *menu); // Populate a submenu for choosing the output resolution. Since this is // card-dependent, the entire menu is disabled if we haven't chosen a card // (but it's still there so that the user will know it exists). // Will call into the mixer on trigger. void fill_hdmi_sdi_output_resolution_menu(QMenu *menu); #endif // !defined(_CONTEXT_MENUS_H) nageru-2.3.0/nageru/correlation_measurer.cpp000066400000000000000000000043111450736322200212110ustar00rootroot00000000000000// Adapted from Adriaensen's project Zita-mu1 (as of January 2016). // Original copyright follows: // // Copyright (C) 2008-2015 Fons Adriaensen // // This program is free software; you can redistribute it and/or modify // it under the terms of the GNU General Public License as published by // the Free Software Foundation; either version 3 of the License, or // (at your option) any later version. // // This program is distributed in the hope that it will be useful, // but WITHOUT ANY WARRANTY; without even the implied warranty of // MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the // GNU General Public License for more details. // // You should have received a copy of the GNU General Public License // along with this program. If not, see . #include "correlation_measurer.h" #include #include #include using namespace std; CorrelationMeasurer::CorrelationMeasurer(unsigned sample_rate, float lowpass_cutoff_hz, float falloff_seconds) : w1(2.0 * M_PI * lowpass_cutoff_hz / sample_rate), w2(1.0 / (falloff_seconds * sample_rate)) { } void CorrelationMeasurer::reset() { zl = zr = zll = zlr = zrr = 0.0f; } void CorrelationMeasurer::process_samples(const std::vector &samples) { assert(samples.size() % 2 == 0); // The compiler isn't always happy about modifying members, // since it doesn't always know they can't alias on . // Help it out a bit. float l = zl, r = zr, ll = zll, lr = zlr, rr = zrr; const float w1c = w1, w2c = w2; for (size_t i = 0; i < samples.size(); i += 2) { // The 1e-15f epsilon is to avoid denormals. // TODO: Just set the SSE flush-to-zero flags instead. l += w1c * (samples[i + 0] - l) + 1e-15f; r += w1c * (samples[i + 1] - r) + 1e-15f; lr += w2c * (l * r - lr); ll += w2c * (l * l - ll); rr += w2c * (r * r - rr); } zl = l; zr = r; zll = ll; zlr = lr; zrr = rr; } float CorrelationMeasurer::get_correlation() const { // The 1e-12f epsilon is to avoid division by zero. // zll and zrr are both always non-negative, so we do not risk negative values. return zlr / sqrt(zll * zrr + 1e-12f); } nageru-2.3.0/nageru/correlation_measurer.h000066400000000000000000000042271450736322200206640ustar00rootroot00000000000000#ifndef _CORRELATION_MEASURER_H #define _CORRELATION_MEASURER_H 1 // Measurement of left/right stereo correlation. +1 is pure mono // (okay but not ideal), 0 is no correlation (usually bad, unless // it is due to silence), strongly negative values means inverted // phase (bad). Typical values for e.g. music would be somewhere // around +0.7, although you can expect it to vary a bit. // // This is, of course, based on the regular Pearson correlation, // where µ_L and µ_R is taken to be 0 (ie., no DC offset). It is // filtered through a simple IIR filter so that older values are // weighed less than newer, depending on . // // // Adapted from Adriaensen's project Zita-mu1 (as of January 2016). // Original copyright follows: // // Copyright (C) 2008-2015 Fons Adriaensen // // This program is free software; you can redistribute it and/or modify // it under the terms of the GNU General Public License as published by // the Free Software Foundation; either version 3 of the License, or // (at your option) any later version. // // This program is distributed in the hope that it will be useful, // but WITHOUT ANY WARRANTY; without even the implied warranty of // MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the // GNU General Public License for more details. // // You should have received a copy of the GNU General Public License // along with this program. If not, see . #include class CorrelationMeasurer { public: CorrelationMeasurer(unsigned sample_rate, float lowpass_cutoff_hz = 1000.0f, float falloff_seconds = 0.150f); void process_samples(const std::vector &samples); // Taken to be stereo, interleaved. void reset(); float get_correlation() const; private: float w1, w2; // Filtered values of left and right channel, respectively. float zl = 0.0f, zr = 0.0f; // Filtered values of l², r² and lr (where l and r are the filtered // versions, given by zl and zr). Together, they make up what we need // to calculate the correlation. float zll = 0.0f, zlr = 0.0f, zrr = 0.0f; }; #endif // !defined(_CORRELATION_MEASURER_H) nageru-2.3.0/nageru/correlation_meter.cpp000066400000000000000000000032231450736322200205030ustar00rootroot00000000000000#include "correlation_meter.h" #include #include #include #include #include #include class QPaintEvent; class QResizeEvent; using namespace std; CorrelationMeter::CorrelationMeter(QWidget *parent) : QWidget(parent) { } void CorrelationMeter::resizeEvent(QResizeEvent *event) { on_pixmap = QPixmap(width(), height()); QPainter on_painter(&on_pixmap); QLinearGradient on(0, 0, width(), 0); on.setColorAt(0.0f, QColor(255, 0, 0)); on.setColorAt(0.5f, QColor(255, 255, 0)); on.setColorAt(0.8f, QColor(0, 255, 0)); on.setColorAt(0.95f, QColor(255, 255, 0)); on_painter.fillRect(0, 0, width(), height(), Qt::black); on_painter.fillRect(1, 1, width() - 2, height() - 2, on); off_pixmap = QPixmap(width(), height()); QPainter off_painter(&off_pixmap); QLinearGradient off(0, 0, width(), 0); off.setColorAt(0.0f, QColor(127, 0, 0)); off.setColorAt(0.5f, QColor(127, 127, 0)); off.setColorAt(0.8f, QColor(0, 127, 0)); off.setColorAt(0.95f, QColor(127, 127, 0)); off_painter.fillRect(0, 0, width(), height(), Qt::black); off_painter.fillRect(1, 1, width() - 2, height() - 2, off); } void CorrelationMeter::paintEvent(QPaintEvent *event) { QPainter painter(this); float correlation; { lock_guard lock(correlation_mutex); correlation = this->correlation; } // Just in case. correlation = std::min(std::max(correlation, -1.0f), 1.0f); int pos = 3 + lrintf(0.5f * (correlation + 1.0f) * (width() - 6)); QRect off_rect(0, 0, width(), height()); QRect on_rect(pos - 2, 0, 5, height()); painter.drawPixmap(off_rect, off_pixmap, off_rect); painter.drawPixmap(on_rect, on_pixmap, on_rect); } nageru-2.3.0/nageru/correlation_meter.h000066400000000000000000000012701450736322200201500ustar00rootroot00000000000000#ifndef CORRELATION_METER_H #define CORRELATION_METER_H #include #include #include #include class QObject; class QPaintEvent; class QResizeEvent; class CorrelationMeter : public QWidget { Q_OBJECT public: CorrelationMeter(QWidget *parent); void set_correlation(float correlation) { std::lock_guard lock(correlation_mutex); this->correlation = correlation; QMetaObject::invokeMethod(this, "update", Qt::AutoConnection); } private: void resizeEvent(QResizeEvent *event) override; void paintEvent(QPaintEvent *event) override; std::mutex correlation_mutex; float correlation = 0.0f; QPixmap on_pixmap, off_pixmap; }; #endif nageru-2.3.0/nageru/decibel.h000066400000000000000000000004331450736322200160220ustar00rootroot00000000000000#ifndef _DECIBEL_H #define _DECIBEL_H 1 // Utility routines for working with decibels. #include static inline double from_db(double db) { return pow(10.0, db / 20.0); } static inline double to_db(double val) { return 20.0 * log10(val); } #endif // !defined(_DECIBEL_H) nageru-2.3.0/nageru/decklink/000077500000000000000000000000001450736322200160465ustar00rootroot00000000000000nageru-2.3.0/nageru/decklink/DeckLinkAPI.h000066400000000000000000002034731450736322200202460ustar00rootroot00000000000000/* -LICENSE-START- ** Copyright (c) 2018 Blackmagic Design ** ** Permission is hereby granted, free of charge, to any person or organization ** obtaining a copy of the software and accompanying documentation covered by ** this license (the "Software") to use, reproduce, display, distribute, ** execute, and transmit the Software, and to prepare derivative works of the ** Software, and to permit third-parties to whom the Software is furnished to ** do so, all subject to the following: ** ** The copyright notices in the Software and this entire statement, including ** the above license grant, this restriction and the following disclaimer, ** must be included in all copies of the Software, in whole or in part, and ** all derivative works of the Software, unless such copies or derivative ** works are solely in the form of machine-executable object code generated by ** a source language processor. ** ** THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR ** IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, ** FITNESS FOR A PARTICULAR PURPOSE, TITLE AND NON-INFRINGEMENT. IN NO EVENT ** SHALL THE COPYRIGHT HOLDERS OR ANYONE DISTRIBUTING THE SOFTWARE BE LIABLE ** FOR ANY DAMAGES OR OTHER LIABILITY, WHETHER IN CONTRACT, TORT OR OTHERWISE, ** ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER ** DEALINGS IN THE SOFTWARE. ** -LICENSE-END- */ #ifndef BMD_DECKLINKAPI_H #define BMD_DECKLINKAPI_H #ifndef BMD_CONST #if defined(_MSC_VER) #define BMD_CONST __declspec(selectany) static const #else #define BMD_CONST static const #endif #endif #ifndef BMD_PUBLIC #define BMD_PUBLIC #endif /* DeckLink API */ #include #include "LinuxCOM.h" #include "DeckLinkAPITypes.h" #include "DeckLinkAPIModes.h" #include "DeckLinkAPIDiscovery.h" #include "DeckLinkAPIConfiguration.h" #include "DeckLinkAPIDeckControl.h" #define BLACKMAGIC_DECKLINK_API_MAGIC 1 // Type Declarations // Interface ID Declarations BMD_CONST REFIID IID_IDeckLinkVideoOutputCallback = /* 20AA5225-1958-47CB-820B-80A8D521A6EE */ {0x20,0xAA,0x52,0x25,0x19,0x58,0x47,0xCB,0x82,0x0B,0x80,0xA8,0xD5,0x21,0xA6,0xEE}; BMD_CONST REFIID IID_IDeckLinkInputCallback = /* DD04E5EC-7415-42AB-AE4A-E80C4DFC044A */ {0xDD,0x04,0xE5,0xEC,0x74,0x15,0x42,0xAB,0xAE,0x4A,0xE8,0x0C,0x4D,0xFC,0x04,0x4A}; BMD_CONST REFIID IID_IDeckLinkEncoderInputCallback = /* ACF13E61-F4A0-4974-A6A7-59AFF6268B31 */ {0xAC,0xF1,0x3E,0x61,0xF4,0xA0,0x49,0x74,0xA6,0xA7,0x59,0xAF,0xF6,0x26,0x8B,0x31}; BMD_CONST REFIID IID_IDeckLinkMemoryAllocator = /* B36EB6E7-9D29-4AA8-92EF-843B87A289E8 */ {0xB3,0x6E,0xB6,0xE7,0x9D,0x29,0x4A,0xA8,0x92,0xEF,0x84,0x3B,0x87,0xA2,0x89,0xE8}; BMD_CONST REFIID IID_IDeckLinkAudioOutputCallback = /* 403C681B-7F46-4A12-B993-2BB127084EE6 */ {0x40,0x3C,0x68,0x1B,0x7F,0x46,0x4A,0x12,0xB9,0x93,0x2B,0xB1,0x27,0x08,0x4E,0xE6}; BMD_CONST REFIID IID_IDeckLinkIterator = /* 50FB36CD-3063-4B73-BDBB-958087F2D8BA */ {0x50,0xFB,0x36,0xCD,0x30,0x63,0x4B,0x73,0xBD,0xBB,0x95,0x80,0x87,0xF2,0xD8,0xBA}; BMD_CONST REFIID IID_IDeckLinkAPIInformation = /* 7BEA3C68-730D-4322-AF34-8A7152B532A4 */ {0x7B,0xEA,0x3C,0x68,0x73,0x0D,0x43,0x22,0xAF,0x34,0x8A,0x71,0x52,0xB5,0x32,0xA4}; BMD_CONST REFIID IID_IDeckLinkOutput = /* CC5C8A6E-3F2F-4B3A-87EA-FD78AF300564 */ {0xCC,0x5C,0x8A,0x6E,0x3F,0x2F,0x4B,0x3A,0x87,0xEA,0xFD,0x78,0xAF,0x30,0x05,0x64}; BMD_CONST REFIID IID_IDeckLinkInput = /* AF22762B-DFAC-4846-AA79-FA8883560995 */ {0xAF,0x22,0x76,0x2B,0xDF,0xAC,0x48,0x46,0xAA,0x79,0xFA,0x88,0x83,0x56,0x09,0x95}; BMD_CONST REFIID IID_IDeckLinkHDMIInputEDID = /* ABBBACBC-45BC-4665-9D92-ACE6E5A97902 */ {0xAB,0xBB,0xAC,0xBC,0x45,0xBC,0x46,0x65,0x9D,0x92,0xAC,0xE6,0xE5,0xA9,0x79,0x02}; BMD_CONST REFIID IID_IDeckLinkEncoderInput = /* 270587DA-6B7D-42E7-A1F0-6D853F581185 */ {0x27,0x05,0x87,0xDA,0x6B,0x7D,0x42,0xE7,0xA1,0xF0,0x6D,0x85,0x3F,0x58,0x11,0x85}; BMD_CONST REFIID IID_IDeckLinkVideoFrame = /* 3F716FE0-F023-4111-BE5D-EF4414C05B17 */ {0x3F,0x71,0x6F,0xE0,0xF0,0x23,0x41,0x11,0xBE,0x5D,0xEF,0x44,0x14,0xC0,0x5B,0x17}; BMD_CONST REFIID IID_IDeckLinkMutableVideoFrame = /* 69E2639F-40DA-4E19-B6F2-20ACE815C390 */ {0x69,0xE2,0x63,0x9F,0x40,0xDA,0x4E,0x19,0xB6,0xF2,0x20,0xAC,0xE8,0x15,0xC3,0x90}; BMD_CONST REFIID IID_IDeckLinkVideoFrame3DExtensions = /* DA0F7E4A-EDC7-48A8-9CDD-2DB51C729CD7 */ {0xDA,0x0F,0x7E,0x4A,0xED,0xC7,0x48,0xA8,0x9C,0xDD,0x2D,0xB5,0x1C,0x72,0x9C,0xD7}; BMD_CONST REFIID IID_IDeckLinkVideoFrameMetadataExtensions = /* D5973DC9-6432-46D0-8F0B-2496F8A1238F */ {0xD5,0x97,0x3D,0xC9,0x64,0x32,0x46,0xD0,0x8F,0x0B,0x24,0x96,0xF8,0xA1,0x23,0x8F}; BMD_CONST REFIID IID_IDeckLinkVideoInputFrame = /* 05CFE374-537C-4094-9A57-680525118F44 */ {0x05,0xCF,0xE3,0x74,0x53,0x7C,0x40,0x94,0x9A,0x57,0x68,0x05,0x25,0x11,0x8F,0x44}; BMD_CONST REFIID IID_IDeckLinkAncillaryPacket = /* CC5BBF7E-029C-4D3B-9158-6000EF5E3670 */ {0xCC,0x5B,0xBF,0x7E,0x02,0x9C,0x4D,0x3B,0x91,0x58,0x60,0x00,0xEF,0x5E,0x36,0x70}; BMD_CONST REFIID IID_IDeckLinkAncillaryPacketIterator = /* 3FC8994B-88FB-4C17-968F-9AAB69D964A7 */ {0x3F,0xC8,0x99,0x4B,0x88,0xFB,0x4C,0x17,0x96,0x8F,0x9A,0xAB,0x69,0xD9,0x64,0xA7}; BMD_CONST REFIID IID_IDeckLinkVideoFrameAncillaryPackets = /* 6C186C0F-459E-41D8-AEE2-4812D81AEE68 */ {0x6C,0x18,0x6C,0x0F,0x45,0x9E,0x41,0xD8,0xAE,0xE2,0x48,0x12,0xD8,0x1A,0xEE,0x68}; BMD_CONST REFIID IID_IDeckLinkVideoFrameAncillary = /* 732E723C-D1A4-4E29-9E8E-4A88797A0004 */ {0x73,0x2E,0x72,0x3C,0xD1,0xA4,0x4E,0x29,0x9E,0x8E,0x4A,0x88,0x79,0x7A,0x00,0x04}; BMD_CONST REFIID IID_IDeckLinkEncoderPacket = /* B693F36C-316E-4AF1-B6C2-F389A4BCA620 */ {0xB6,0x93,0xF3,0x6C,0x31,0x6E,0x4A,0xF1,0xB6,0xC2,0xF3,0x89,0xA4,0xBC,0xA6,0x20}; BMD_CONST REFIID IID_IDeckLinkEncoderVideoPacket = /* 4E7FD944-E8C7-4EAC-B8C0-7B77F80F5AE0 */ {0x4E,0x7F,0xD9,0x44,0xE8,0xC7,0x4E,0xAC,0xB8,0xC0,0x7B,0x77,0xF8,0x0F,0x5A,0xE0}; BMD_CONST REFIID IID_IDeckLinkEncoderAudioPacket = /* 49E8EDC8-693B-4E14-8EF6-12C658F5A07A */ {0x49,0xE8,0xED,0xC8,0x69,0x3B,0x4E,0x14,0x8E,0xF6,0x12,0xC6,0x58,0xF5,0xA0,0x7A}; BMD_CONST REFIID IID_IDeckLinkH265NALPacket = /* 639C8E0B-68D5-4BDE-A6D4-95F3AEAFF2E7 */ {0x63,0x9C,0x8E,0x0B,0x68,0xD5,0x4B,0xDE,0xA6,0xD4,0x95,0xF3,0xAE,0xAF,0xF2,0xE7}; BMD_CONST REFIID IID_IDeckLinkAudioInputPacket = /* E43D5870-2894-11DE-8C30-0800200C9A66 */ {0xE4,0x3D,0x58,0x70,0x28,0x94,0x11,0xDE,0x8C,0x30,0x08,0x00,0x20,0x0C,0x9A,0x66}; BMD_CONST REFIID IID_IDeckLinkScreenPreviewCallback = /* B1D3F49A-85FE-4C5D-95C8-0B5D5DCCD438 */ {0xB1,0xD3,0xF4,0x9A,0x85,0xFE,0x4C,0x5D,0x95,0xC8,0x0B,0x5D,0x5D,0xCC,0xD4,0x38}; BMD_CONST REFIID IID_IDeckLinkGLScreenPreviewHelper = /* 504E2209-CAC7-4C1A-9FB4-C5BB6274D22F */ {0x50,0x4E,0x22,0x09,0xCA,0xC7,0x4C,0x1A,0x9F,0xB4,0xC5,0xBB,0x62,0x74,0xD2,0x2F}; BMD_CONST REFIID IID_IDeckLinkNotificationCallback = /* B002A1EC-070D-4288-8289-BD5D36E5FF0D */ {0xB0,0x02,0xA1,0xEC,0x07,0x0D,0x42,0x88,0x82,0x89,0xBD,0x5D,0x36,0xE5,0xFF,0x0D}; BMD_CONST REFIID IID_IDeckLinkNotification = /* 0A1FB207-E215-441B-9B19-6FA1575946C5 */ {0x0A,0x1F,0xB2,0x07,0xE2,0x15,0x44,0x1B,0x9B,0x19,0x6F,0xA1,0x57,0x59,0x46,0xC5}; BMD_CONST REFIID IID_IDeckLinkAttributes = /* ABC11843-D966-44CB-96E2-A1CB5D3135C4 */ {0xAB,0xC1,0x18,0x43,0xD9,0x66,0x44,0xCB,0x96,0xE2,0xA1,0xCB,0x5D,0x31,0x35,0xC4}; BMD_CONST REFIID IID_IDeckLinkStatus = /* 5F558200-4028-49BC-BEAC-DB3FA4A96E46 */ {0x5F,0x55,0x82,0x00,0x40,0x28,0x49,0xBC,0xBE,0xAC,0xDB,0x3F,0xA4,0xA9,0x6E,0x46}; BMD_CONST REFIID IID_IDeckLinkKeyer = /* 89AFCAF5-65F8-421E-98F7-96FE5F5BFBA3 */ {0x89,0xAF,0xCA,0xF5,0x65,0xF8,0x42,0x1E,0x98,0xF7,0x96,0xFE,0x5F,0x5B,0xFB,0xA3}; BMD_CONST REFIID IID_IDeckLinkVideoConversion = /* 3BBCB8A2-DA2C-42D9-B5D8-88083644E99A */ {0x3B,0xBC,0xB8,0xA2,0xDA,0x2C,0x42,0xD9,0xB5,0xD8,0x88,0x08,0x36,0x44,0xE9,0x9A}; BMD_CONST REFIID IID_IDeckLinkDeviceNotificationCallback = /* 4997053B-0ADF-4CC8-AC70-7A50C4BE728F */ {0x49,0x97,0x05,0x3B,0x0A,0xDF,0x4C,0xC8,0xAC,0x70,0x7A,0x50,0xC4,0xBE,0x72,0x8F}; BMD_CONST REFIID IID_IDeckLinkDiscovery = /* CDBF631C-BC76-45FA-B44D-C55059BC6101 */ {0xCD,0xBF,0x63,0x1C,0xBC,0x76,0x45,0xFA,0xB4,0x4D,0xC5,0x50,0x59,0xBC,0x61,0x01}; /* Enum BMDVideoOutputFlags - Flags to control the output of ancillary data along with video. */ typedef uint32_t BMDVideoOutputFlags; enum _BMDVideoOutputFlags { bmdVideoOutputFlagDefault = 0, bmdVideoOutputVANC = 1 << 0, bmdVideoOutputVITC = 1 << 1, bmdVideoOutputRP188 = 1 << 2, bmdVideoOutputDualStream3D = 1 << 4 }; /* Enum BMDPacketType - Type of packet */ typedef uint32_t BMDPacketType; enum _BMDPacketType { bmdPacketTypeStreamInterruptedMarker = /* 'sint' */ 0x73696E74, // A packet of this type marks the time when a video stream was interrupted, for example by a disconnected cable bmdPacketTypeStreamData = /* 'sdat' */ 0x73646174 // Regular stream data }; /* Enum BMDFrameFlags - Frame flags */ typedef uint32_t BMDFrameFlags; enum _BMDFrameFlags { bmdFrameFlagDefault = 0, bmdFrameFlagFlipVertical = 1 << 0, bmdFrameContainsHDRMetadata = 1 << 1, bmdFrameContainsCintelMetadata = 1 << 2, /* Flags that are applicable only to instances of IDeckLinkVideoInputFrame */ bmdFrameCapturedAsPsF = 1 << 30, bmdFrameHasNoInputSource = 1 << 31 }; /* Enum BMDVideoInputFlags - Flags applicable to video input */ typedef uint32_t BMDVideoInputFlags; enum _BMDVideoInputFlags { bmdVideoInputFlagDefault = 0, bmdVideoInputEnableFormatDetection = 1 << 0, bmdVideoInputDualStream3D = 1 << 1 }; /* Enum BMDVideoInputFormatChangedEvents - Bitmask passed to the VideoInputFormatChanged notification to identify the properties of the input signal that have changed */ typedef uint32_t BMDVideoInputFormatChangedEvents; enum _BMDVideoInputFormatChangedEvents { bmdVideoInputDisplayModeChanged = 1 << 0, bmdVideoInputFieldDominanceChanged = 1 << 1, bmdVideoInputColorspaceChanged = 1 << 2 }; /* Enum BMDDetectedVideoInputFormatFlags - Flags passed to the VideoInputFormatChanged notification to describe the detected video input signal */ typedef uint32_t BMDDetectedVideoInputFormatFlags; enum _BMDDetectedVideoInputFormatFlags { bmdDetectedVideoInputYCbCr422 = 1 << 0, bmdDetectedVideoInputRGB444 = 1 << 1, bmdDetectedVideoInputDualStream3D = 1 << 2 }; /* Enum BMDDeckLinkCapturePassthroughMode - Enumerates whether the video output is electrically connected to the video input or if the clean switching mode is enabled */ typedef uint32_t BMDDeckLinkCapturePassthroughMode; enum _BMDDeckLinkCapturePassthroughMode { bmdDeckLinkCapturePassthroughModeDisabled = /* 'pdis' */ 0x70646973, bmdDeckLinkCapturePassthroughModeDirect = /* 'pdir' */ 0x70646972, bmdDeckLinkCapturePassthroughModeCleanSwitch = /* 'pcln' */ 0x70636C6E }; /* Enum BMDOutputFrameCompletionResult - Frame Completion Callback */ typedef uint32_t BMDOutputFrameCompletionResult; enum _BMDOutputFrameCompletionResult { bmdOutputFrameCompleted, bmdOutputFrameDisplayedLate, bmdOutputFrameDropped, bmdOutputFrameFlushed }; /* Enum BMDReferenceStatus - GenLock input status */ typedef uint32_t BMDReferenceStatus; enum _BMDReferenceStatus { bmdReferenceNotSupportedByHardware = 1 << 0, bmdReferenceLocked = 1 << 1 }; /* Enum BMDAudioFormat - Audio Format */ typedef uint32_t BMDAudioFormat; enum _BMDAudioFormat { bmdAudioFormatPCM = /* 'lpcm' */ 0x6C70636D // Linear signed PCM samples }; /* Enum BMDAudioSampleRate - Audio sample rates supported for output/input */ typedef uint32_t BMDAudioSampleRate; enum _BMDAudioSampleRate { bmdAudioSampleRate48kHz = 48000 }; /* Enum BMDAudioSampleType - Audio sample sizes supported for output/input */ typedef uint32_t BMDAudioSampleType; enum _BMDAudioSampleType { bmdAudioSampleType16bitInteger = 16, bmdAudioSampleType32bitInteger = 32 }; /* Enum BMDAudioOutputStreamType - Audio output stream type */ typedef uint32_t BMDAudioOutputStreamType; enum _BMDAudioOutputStreamType { bmdAudioOutputStreamContinuous, bmdAudioOutputStreamContinuousDontResample, bmdAudioOutputStreamTimestamped }; /* Enum BMDDisplayModeSupport - Output mode supported flags */ typedef uint32_t BMDDisplayModeSupport; enum _BMDDisplayModeSupport { bmdDisplayModeNotSupported = 0, bmdDisplayModeSupported, bmdDisplayModeSupportedWithConversion }; /* Enum BMDAncillaryPacketFormat - Ancillary packet format */ typedef uint32_t BMDAncillaryPacketFormat; enum _BMDAncillaryPacketFormat { bmdAncillaryPacketFormatUInt8 = /* 'ui08' */ 0x75693038, bmdAncillaryPacketFormatUInt16 = /* 'ui16' */ 0x75693136, bmdAncillaryPacketFormatYCbCr10 = /* 'v210' */ 0x76323130 }; /* Enum BMDTimecodeFormat - Timecode formats for frame metadata */ typedef uint32_t BMDTimecodeFormat; enum _BMDTimecodeFormat { bmdTimecodeRP188VITC1 = /* 'rpv1' */ 0x72707631, // RP188 timecode where DBB1 equals VITC1 (line 9) bmdTimecodeRP188VITC2 = /* 'rp12' */ 0x72703132, // RP188 timecode where DBB1 equals VITC2 (line 9 for progressive or line 571 for interlaced/PsF) bmdTimecodeRP188LTC = /* 'rplt' */ 0x72706C74, // RP188 timecode where DBB1 equals LTC (line 10) bmdTimecodeRP188Any = /* 'rp18' */ 0x72703138, // For capture: return the first valid timecode in {VITC1, LTC ,VITC2} - For playback: set the timecode as VITC1 bmdTimecodeVITC = /* 'vitc' */ 0x76697463, bmdTimecodeVITCField2 = /* 'vit2' */ 0x76697432, bmdTimecodeSerial = /* 'seri' */ 0x73657269 }; /* Enum BMDAnalogVideoFlags - Analog video display flags */ typedef uint32_t BMDAnalogVideoFlags; enum _BMDAnalogVideoFlags { bmdAnalogVideoFlagCompositeSetup75 = 1 << 0, bmdAnalogVideoFlagComponentBetacamLevels = 1 << 1 }; /* Enum BMDAudioOutputAnalogAESSwitch - Audio output Analog/AESEBU switch */ typedef uint32_t BMDAudioOutputAnalogAESSwitch; enum _BMDAudioOutputAnalogAESSwitch { bmdAudioOutputSwitchAESEBU = /* 'aes ' */ 0x61657320, bmdAudioOutputSwitchAnalog = /* 'anlg' */ 0x616E6C67 }; /* Enum BMDVideoOutputConversionMode - Video/audio conversion mode */ typedef uint32_t BMDVideoOutputConversionMode; enum _BMDVideoOutputConversionMode { bmdNoVideoOutputConversion = /* 'none' */ 0x6E6F6E65, bmdVideoOutputLetterboxDownconversion = /* 'ltbx' */ 0x6C746278, bmdVideoOutputAnamorphicDownconversion = /* 'amph' */ 0x616D7068, bmdVideoOutputHD720toHD1080Conversion = /* '720c' */ 0x37323063, bmdVideoOutputHardwareLetterboxDownconversion = /* 'HWlb' */ 0x48576C62, bmdVideoOutputHardwareAnamorphicDownconversion = /* 'HWam' */ 0x4857616D, bmdVideoOutputHardwareCenterCutDownconversion = /* 'HWcc' */ 0x48576363, bmdVideoOutputHardware720p1080pCrossconversion = /* 'xcap' */ 0x78636170, bmdVideoOutputHardwareAnamorphic720pUpconversion = /* 'ua7p' */ 0x75613770, bmdVideoOutputHardwareAnamorphic1080iUpconversion = /* 'ua1i' */ 0x75613169, bmdVideoOutputHardwareAnamorphic149To720pUpconversion = /* 'u47p' */ 0x75343770, bmdVideoOutputHardwareAnamorphic149To1080iUpconversion = /* 'u41i' */ 0x75343169, bmdVideoOutputHardwarePillarbox720pUpconversion = /* 'up7p' */ 0x75703770, bmdVideoOutputHardwarePillarbox1080iUpconversion = /* 'up1i' */ 0x75703169 }; /* Enum BMDVideoInputConversionMode - Video input conversion mode */ typedef uint32_t BMDVideoInputConversionMode; enum _BMDVideoInputConversionMode { bmdNoVideoInputConversion = /* 'none' */ 0x6E6F6E65, bmdVideoInputLetterboxDownconversionFromHD1080 = /* '10lb' */ 0x31306C62, bmdVideoInputAnamorphicDownconversionFromHD1080 = /* '10am' */ 0x3130616D, bmdVideoInputLetterboxDownconversionFromHD720 = /* '72lb' */ 0x37326C62, bmdVideoInputAnamorphicDownconversionFromHD720 = /* '72am' */ 0x3732616D, bmdVideoInputLetterboxUpconversion = /* 'lbup' */ 0x6C627570, bmdVideoInputAnamorphicUpconversion = /* 'amup' */ 0x616D7570 }; /* Enum BMDVideo3DPackingFormat - Video 3D packing format */ typedef uint32_t BMDVideo3DPackingFormat; enum _BMDVideo3DPackingFormat { bmdVideo3DPackingSidebySideHalf = /* 'sbsh' */ 0x73627368, bmdVideo3DPackingLinebyLine = /* 'lbyl' */ 0x6C62796C, bmdVideo3DPackingTopAndBottom = /* 'tabo' */ 0x7461626F, bmdVideo3DPackingFramePacking = /* 'frpk' */ 0x6672706B, bmdVideo3DPackingLeftOnly = /* 'left' */ 0x6C656674, bmdVideo3DPackingRightOnly = /* 'righ' */ 0x72696768 }; /* Enum BMDIdleVideoOutputOperation - Video output operation when not playing video */ typedef uint32_t BMDIdleVideoOutputOperation; enum _BMDIdleVideoOutputOperation { bmdIdleVideoOutputBlack = /* 'blac' */ 0x626C6163, bmdIdleVideoOutputLastFrame = /* 'lafa' */ 0x6C616661 }; /* Enum BMDVideoEncoderFrameCodingMode - Video frame coding mode */ typedef uint32_t BMDVideoEncoderFrameCodingMode; enum _BMDVideoEncoderFrameCodingMode { bmdVideoEncoderFrameCodingModeInter = /* 'inte' */ 0x696E7465, bmdVideoEncoderFrameCodingModeIntra = /* 'intr' */ 0x696E7472 }; /* Enum BMDDNxHRLevel - DNxHR Levels */ typedef uint32_t BMDDNxHRLevel; enum _BMDDNxHRLevel { bmdDNxHRLevelSQ = /* 'dnsq' */ 0x646E7371, bmdDNxHRLevelLB = /* 'dnlb' */ 0x646E6C62, bmdDNxHRLevelHQ = /* 'dnhq' */ 0x646E6871, bmdDNxHRLevelHQX = /* 'dhqx' */ 0x64687178, bmdDNxHRLevel444 = /* 'd444' */ 0x64343434 }; /* Enum BMDLinkConfiguration - Video link configuration */ typedef uint32_t BMDLinkConfiguration; enum _BMDLinkConfiguration { bmdLinkConfigurationSingleLink = /* 'lcsl' */ 0x6C63736C, bmdLinkConfigurationDualLink = /* 'lcdl' */ 0x6C63646C, bmdLinkConfigurationQuadLink = /* 'lcql' */ 0x6C63716C }; /* Enum BMDDeviceInterface - Device interface type */ typedef uint32_t BMDDeviceInterface; enum _BMDDeviceInterface { bmdDeviceInterfacePCI = /* 'pci ' */ 0x70636920, bmdDeviceInterfaceUSB = /* 'usb ' */ 0x75736220, bmdDeviceInterfaceThunderbolt = /* 'thun' */ 0x7468756E }; /* Enum BMDColorspace - Colorspace */ typedef uint32_t BMDColorspace; enum _BMDColorspace { bmdColorspaceRec601 = /* 'r601' */ 0x72363031, bmdColorspaceRec709 = /* 'r709' */ 0x72373039, bmdColorspaceRec2020 = /* '2020' */ 0x32303230 }; /* Enum BMDDynamicRange - SDR or HDR */ typedef uint32_t BMDDynamicRange; enum _BMDDynamicRange { bmdDynamicRangeSDR = 0, bmdDynamicRangeHDRStaticPQ = 1 << 29, // SMPTE ST 2084 bmdDynamicRangeHDRStaticHLG = 1 << 30 // ITU-R BT.2100-0 }; /* Enum BMDDeckLinkHDMIInputEDIDID - DeckLink HDMI Input EDID ID */ typedef uint32_t BMDDeckLinkHDMIInputEDIDID; enum _BMDDeckLinkHDMIInputEDIDID { bmdDeckLinkHDMIInputEDIDDynamicRange = /* 'HIDy' */ 0x48494479 // Parameter is of type BMDDynamicRange. Default is (bmdDynamicRangeSDR|bmdDynamicRangeHDRStaticPQ) }; /* Enum BMDDeckLinkFrameMetadataID - DeckLink Frame Metadata ID */ typedef uint32_t BMDDeckLinkFrameMetadataID; enum _BMDDeckLinkFrameMetadataID { bmdDeckLinkFrameMetadataColorspace = /* 'cspc' */ 0x63737063, // Colorspace of video frame (see BMDColorspace) bmdDeckLinkFrameMetadataHDRElectroOpticalTransferFunc = /* 'eotf' */ 0x656F7466, // EOTF in range 0-7 as per CEA 861.3 bmdDeckLinkFrameMetadataCintelFilmType = /* 'cfty' */ 0x63667479, // Current film type bmdDeckLinkFrameMetadataCintelFilmGauge = /* 'cfga' */ 0x63666761, // Current film gauge bmdDeckLinkFrameMetadataCintelOffsetDetectedHorizontal = /* 'odfh' */ 0x6F646668, // Horizontal offset (pixels) detected in image bmdDeckLinkFrameMetadataCintelOffsetDetectedVertical = /* 'odfv' */ 0x6F646676, // Vertical offset (pixels) detected in image bmdDeckLinkFrameMetadataCintelKeykodeLow = /* 'ckkl' */ 0x636B6B6C, // Raw keykode value - low 64 bits bmdDeckLinkFrameMetadataCintelKeykodeHigh = /* 'ckkh' */ 0x636B6B68, // Raw keykode value - high 64 bits bmdDeckLinkFrameMetadataCintelTile1Size = /* 'ct1s' */ 0x63743173, // Size in bytes of compressed raw tile 1 bmdDeckLinkFrameMetadataCintelTile2Size = /* 'ct2s' */ 0x63743273, // Size in bytes of compressed raw tile 2 bmdDeckLinkFrameMetadataCintelTile3Size = /* 'ct3s' */ 0x63743373, // Size in bytes of compressed raw tile 3 bmdDeckLinkFrameMetadataCintelTile4Size = /* 'ct4s' */ 0x63743473, // Size in bytes of compressed raw tile 4 bmdDeckLinkFrameMetadataCintelImageWidth = /* 'IWPx' */ 0x49575078, // Width in pixels of image bmdDeckLinkFrameMetadataCintelImageHeight = /* 'IHPx' */ 0x49485078, // Height in pixels of image bmdDeckLinkFrameMetadataCintelLinearMaskingRedInRed = /* 'mrir' */ 0x6D726972, // Red in red linear masking parameter bmdDeckLinkFrameMetadataCintelLinearMaskingGreenInRed = /* 'mgir' */ 0x6D676972, // Green in red linear masking parameter bmdDeckLinkFrameMetadataCintelLinearMaskingBlueInRed = /* 'mbir' */ 0x6D626972, // Blue in red linear masking parameter bmdDeckLinkFrameMetadataCintelLinearMaskingRedInGreen = /* 'mrig' */ 0x6D726967, // Red in green linear masking parameter bmdDeckLinkFrameMetadataCintelLinearMaskingGreenInGreen = /* 'mgig' */ 0x6D676967, // Green in green linear masking parameter bmdDeckLinkFrameMetadataCintelLinearMaskingBlueInGreen = /* 'mbig' */ 0x6D626967, // Blue in green linear masking parameter bmdDeckLinkFrameMetadataCintelLinearMaskingRedInBlue = /* 'mrib' */ 0x6D726962, // Red in blue linear masking parameter bmdDeckLinkFrameMetadataCintelLinearMaskingGreenInBlue = /* 'mgib' */ 0x6D676962, // Green in blue linear masking parameter bmdDeckLinkFrameMetadataCintelLinearMaskingBlueInBlue = /* 'mbib' */ 0x6D626962, // Blue in blue linear masking parameter bmdDeckLinkFrameMetadataCintelLogMaskingRedInRed = /* 'mlrr' */ 0x6D6C7272, // Red in red log masking parameter bmdDeckLinkFrameMetadataCintelLogMaskingGreenInRed = /* 'mlgr' */ 0x6D6C6772, // Green in red log masking parameter bmdDeckLinkFrameMetadataCintelLogMaskingBlueInRed = /* 'mlbr' */ 0x6D6C6272, // Blue in red log masking parameter bmdDeckLinkFrameMetadataCintelLogMaskingRedInGreen = /* 'mlrg' */ 0x6D6C7267, // Red in green log masking parameter bmdDeckLinkFrameMetadataCintelLogMaskingGreenInGreen = /* 'mlgg' */ 0x6D6C6767, // Green in green log masking parameter bmdDeckLinkFrameMetadataCintelLogMaskingBlueInGreen = /* 'mlbg' */ 0x6D6C6267, // Blue in green log masking parameter bmdDeckLinkFrameMetadataCintelLogMaskingRedInBlue = /* 'mlrb' */ 0x6D6C7262, // Red in blue log masking parameter bmdDeckLinkFrameMetadataCintelLogMaskingGreenInBlue = /* 'mlgb' */ 0x6D6C6762, // Green in blue log masking parameter bmdDeckLinkFrameMetadataCintelLogMaskingBlueInBlue = /* 'mlbb' */ 0x6D6C6262, // Blue in blue log masking parameter bmdDeckLinkFrameMetadataCintelFilmFrameRate = /* 'cffr' */ 0x63666672, // Film frame rate bmdDeckLinkFrameMetadataHDRDisplayPrimariesRedX = /* 'hdrx' */ 0x68647278, // Red display primaries in range 0.0 - 1.0 bmdDeckLinkFrameMetadataHDRDisplayPrimariesRedY = /* 'hdry' */ 0x68647279, // Red display primaries in range 0.0 - 1.0 bmdDeckLinkFrameMetadataHDRDisplayPrimariesGreenX = /* 'hdgx' */ 0x68646778, // Green display primaries in range 0.0 - 1.0 bmdDeckLinkFrameMetadataHDRDisplayPrimariesGreenY = /* 'hdgy' */ 0x68646779, // Green display primaries in range 0.0 - 1.0 bmdDeckLinkFrameMetadataHDRDisplayPrimariesBlueX = /* 'hdbx' */ 0x68646278, // Blue display primaries in range 0.0 - 1.0 bmdDeckLinkFrameMetadataHDRDisplayPrimariesBlueY = /* 'hdby' */ 0x68646279, // Blue display primaries in range 0.0 - 1.0 bmdDeckLinkFrameMetadataHDRWhitePointX = /* 'hdwx' */ 0x68647778, // White point in range 0.0 - 1.0 bmdDeckLinkFrameMetadataHDRWhitePointY = /* 'hdwy' */ 0x68647779, // White point in range 0.0 - 1.0 bmdDeckLinkFrameMetadataHDRMaxDisplayMasteringLuminance = /* 'hdml' */ 0x68646D6C, // Max display mastering luminance in range 1 cd/m2 - 65535 cd/m2 bmdDeckLinkFrameMetadataHDRMinDisplayMasteringLuminance = /* 'hmil' */ 0x686D696C, // Min display mastering luminance in range 0.0001 cd/m2 - 6.5535 cd/m2 bmdDeckLinkFrameMetadataHDRMaximumContentLightLevel = /* 'mcll' */ 0x6D636C6C, // Maximum Content Light Level in range 1 cd/m2 - 65535 cd/m2 bmdDeckLinkFrameMetadataHDRMaximumFrameAverageLightLevel = /* 'fall' */ 0x66616C6C, // Maximum Frame Average Light Level in range 1 cd/m2 - 65535 cd/m2 bmdDeckLinkFrameMetadataCintelOffsetToApplyHorizontal = /* 'otah' */ 0x6F746168, // Horizontal offset (pixels) to be applied to image bmdDeckLinkFrameMetadataCintelOffsetToApplyVertical = /* 'otav' */ 0x6F746176, // Vertical offset (pixels) to be applied to image bmdDeckLinkFrameMetadataCintelGainRed = /* 'LfRd' */ 0x4C665264, // Red gain parameter to apply after log bmdDeckLinkFrameMetadataCintelGainGreen = /* 'LfGr' */ 0x4C664772, // Green gain parameter to apply after log bmdDeckLinkFrameMetadataCintelGainBlue = /* 'LfBl' */ 0x4C66426C, // Blue gain parameter to apply after log bmdDeckLinkFrameMetadataCintelLiftRed = /* 'GnRd' */ 0x476E5264, // Red lift parameter to apply after log and gain bmdDeckLinkFrameMetadataCintelLiftGreen = /* 'GnGr' */ 0x476E4772, // Green lift parameter to apply after log and gain bmdDeckLinkFrameMetadataCintelLiftBlue = /* 'GnBl' */ 0x476E426C // Blue lift parameter to apply after log and gain }; /* Enum BMDDuplexMode - Duplex for configurable ports */ typedef uint32_t BMDDuplexMode; enum _BMDDuplexMode { bmdDuplexModeFull = /* 'fdup' */ 0x66647570, bmdDuplexModeHalf = /* 'hdup' */ 0x68647570 }; /* Enum BMDDeckLinkAttributeID - DeckLink Attribute ID */ typedef uint32_t BMDDeckLinkAttributeID; enum _BMDDeckLinkAttributeID { /* Flags */ BMDDeckLinkSupportsInternalKeying = /* 'keyi' */ 0x6B657969, BMDDeckLinkSupportsExternalKeying = /* 'keye' */ 0x6B657965, BMDDeckLinkSupportsHDKeying = /* 'keyh' */ 0x6B657968, BMDDeckLinkSupportsInputFormatDetection = /* 'infd' */ 0x696E6664, BMDDeckLinkHasReferenceInput = /* 'hrin' */ 0x6872696E, BMDDeckLinkHasSerialPort = /* 'hspt' */ 0x68737074, BMDDeckLinkHasAnalogVideoOutputGain = /* 'avog' */ 0x61766F67, BMDDeckLinkCanOnlyAdjustOverallVideoOutputGain = /* 'ovog' */ 0x6F766F67, BMDDeckLinkHasVideoInputAntiAliasingFilter = /* 'aafl' */ 0x6161666C, BMDDeckLinkHasBypass = /* 'byps' */ 0x62797073, BMDDeckLinkSupportsClockTimingAdjustment = /* 'ctad' */ 0x63746164, BMDDeckLinkSupportsFullDuplex = /* 'fdup' */ 0x66647570, BMDDeckLinkSupportsFullFrameReferenceInputTimingOffset = /* 'frin' */ 0x6672696E, BMDDeckLinkSupportsSMPTELevelAOutput = /* 'lvla' */ 0x6C766C61, BMDDeckLinkSupportsDualLinkSDI = /* 'sdls' */ 0x73646C73, BMDDeckLinkSupportsQuadLinkSDI = /* 'sqls' */ 0x73716C73, BMDDeckLinkSupportsIdleOutput = /* 'idou' */ 0x69646F75, BMDDeckLinkHasLTCTimecodeInput = /* 'hltc' */ 0x686C7463, BMDDeckLinkSupportsDuplexModeConfiguration = /* 'dupx' */ 0x64757078, BMDDeckLinkSupportsHDRMetadata = /* 'hdrm' */ 0x6864726D, BMDDeckLinkSupportsColorspaceMetadata = /* 'cmet' */ 0x636D6574, /* Integers */ BMDDeckLinkMaximumAudioChannels = /* 'mach' */ 0x6D616368, BMDDeckLinkMaximumAnalogAudioInputChannels = /* 'iach' */ 0x69616368, BMDDeckLinkMaximumAnalogAudioOutputChannels = /* 'aach' */ 0x61616368, BMDDeckLinkNumberOfSubDevices = /* 'nsbd' */ 0x6E736264, BMDDeckLinkSubDeviceIndex = /* 'subi' */ 0x73756269, BMDDeckLinkPersistentID = /* 'peid' */ 0x70656964, BMDDeckLinkDeviceGroupID = /* 'dgid' */ 0x64676964, BMDDeckLinkTopologicalID = /* 'toid' */ 0x746F6964, BMDDeckLinkVideoOutputConnections = /* 'vocn' */ 0x766F636E, // Returns a BMDVideoConnection bit field BMDDeckLinkVideoInputConnections = /* 'vicn' */ 0x7669636E, // Returns a BMDVideoConnection bit field BMDDeckLinkAudioOutputConnections = /* 'aocn' */ 0x616F636E, // Returns a BMDAudioConnection bit field BMDDeckLinkAudioInputConnections = /* 'aicn' */ 0x6169636E, // Returns a BMDAudioConnection bit field BMDDeckLinkVideoIOSupport = /* 'vios' */ 0x76696F73, // Returns a BMDVideoIOSupport bit field BMDDeckLinkDeckControlConnections = /* 'dccn' */ 0x6463636E, // Returns a BMDDeckControlConnection bit field BMDDeckLinkDeviceInterface = /* 'dbus' */ 0x64627573, // Returns a BMDDeviceInterface BMDDeckLinkAudioInputRCAChannelCount = /* 'airc' */ 0x61697263, BMDDeckLinkAudioInputXLRChannelCount = /* 'aixc' */ 0x61697863, BMDDeckLinkAudioOutputRCAChannelCount = /* 'aorc' */ 0x616F7263, BMDDeckLinkAudioOutputXLRChannelCount = /* 'aoxc' */ 0x616F7863, BMDDeckLinkPairedDevicePersistentID = /* 'ppid' */ 0x70706964, /* Floats */ BMDDeckLinkVideoInputGainMinimum = /* 'vigm' */ 0x7669676D, BMDDeckLinkVideoInputGainMaximum = /* 'vigx' */ 0x76696778, BMDDeckLinkVideoOutputGainMinimum = /* 'vogm' */ 0x766F676D, BMDDeckLinkVideoOutputGainMaximum = /* 'vogx' */ 0x766F6778, BMDDeckLinkMicrophoneInputGainMinimum = /* 'migm' */ 0x6D69676D, BMDDeckLinkMicrophoneInputGainMaximum = /* 'migx' */ 0x6D696778, /* Strings */ BMDDeckLinkSerialPortDeviceName = /* 'slpn' */ 0x736C706E, BMDDeckLinkVendorName = /* 'vndr' */ 0x766E6472, BMDDeckLinkDisplayName = /* 'dspn' */ 0x6473706E, BMDDeckLinkModelName = /* 'mdln' */ 0x6D646C6E, BMDDeckLinkDeviceHandle = /* 'devh' */ 0x64657668 }; /* Enum BMDDeckLinkAPIInformationID - DeckLinkAPI information ID */ typedef uint32_t BMDDeckLinkAPIInformationID; enum _BMDDeckLinkAPIInformationID { BMDDeckLinkAPIVersion = /* 'vers' */ 0x76657273 }; /* Enum BMDDeckLinkStatusID - DeckLink Status ID */ typedef uint32_t BMDDeckLinkStatusID; enum _BMDDeckLinkStatusID { /* Integers */ bmdDeckLinkStatusDetectedVideoInputMode = /* 'dvim' */ 0x6476696D, bmdDeckLinkStatusDetectedVideoInputFlags = /* 'dvif' */ 0x64766966, bmdDeckLinkStatusCurrentVideoInputMode = /* 'cvim' */ 0x6376696D, bmdDeckLinkStatusCurrentVideoInputPixelFormat = /* 'cvip' */ 0x63766970, bmdDeckLinkStatusCurrentVideoInputFlags = /* 'cvif' */ 0x63766966, bmdDeckLinkStatusCurrentVideoOutputMode = /* 'cvom' */ 0x63766F6D, bmdDeckLinkStatusCurrentVideoOutputFlags = /* 'cvof' */ 0x63766F66, bmdDeckLinkStatusPCIExpressLinkWidth = /* 'pwid' */ 0x70776964, bmdDeckLinkStatusPCIExpressLinkSpeed = /* 'plnk' */ 0x706C6E6B, bmdDeckLinkStatusLastVideoOutputPixelFormat = /* 'opix' */ 0x6F706978, bmdDeckLinkStatusReferenceSignalMode = /* 'refm' */ 0x7265666D, bmdDeckLinkStatusReferenceSignalFlags = /* 'reff' */ 0x72656666, bmdDeckLinkStatusDuplexMode = /* 'dupx' */ 0x64757078, bmdDeckLinkStatusBusy = /* 'busy' */ 0x62757379, bmdDeckLinkStatusInterchangeablePanelType = /* 'icpt' */ 0x69637074, bmdDeckLinkStatusDeviceTemperature = /* 'dtmp' */ 0x64746D70, /* Flags */ bmdDeckLinkStatusVideoInputSignalLocked = /* 'visl' */ 0x7669736C, bmdDeckLinkStatusReferenceSignalLocked = /* 'refl' */ 0x7265666C, bmdDeckLinkStatusReceivedEDID = /* 'edid' */ 0x65646964 }; /* Enum BMDDeckLinkVideoStatusFlags - */ typedef uint32_t BMDDeckLinkVideoStatusFlags; enum _BMDDeckLinkVideoStatusFlags { bmdDeckLinkVideoStatusPsF = 1 << 0, bmdDeckLinkVideoStatusDualStream3D = 1 << 1 }; /* Enum BMDDuplexStatus - Duplex status of the device */ typedef uint32_t BMDDuplexStatus; enum _BMDDuplexStatus { bmdDuplexStatusFullDuplex = /* 'fdup' */ 0x66647570, bmdDuplexStatusHalfDuplex = /* 'hdup' */ 0x68647570, bmdDuplexStatusSimplex = /* 'splx' */ 0x73706C78, bmdDuplexStatusInactive = /* 'inac' */ 0x696E6163 }; /* Enum BMDPanelType - The type of interchangeable panel */ typedef uint32_t BMDPanelType; enum _BMDPanelType { bmdPanelNotDetected = /* 'npnl' */ 0x6E706E6C, bmdPanelTeranexMiniSmartPanel = /* 'tmsm' */ 0x746D736D }; /* Enum BMDDeviceBusyState - Current device busy state */ typedef uint32_t BMDDeviceBusyState; enum _BMDDeviceBusyState { bmdDeviceCaptureBusy = 1 << 0, bmdDevicePlaybackBusy = 1 << 1, bmdDeviceSerialPortBusy = 1 << 2 }; /* Enum BMDVideoIOSupport - Device video input/output support */ typedef uint32_t BMDVideoIOSupport; enum _BMDVideoIOSupport { bmdDeviceSupportsCapture = 1 << 0, bmdDeviceSupportsPlayback = 1 << 1 }; /* Enum BMD3DPreviewFormat - Linked Frame preview format */ typedef uint32_t BMD3DPreviewFormat; enum _BMD3DPreviewFormat { bmd3DPreviewFormatDefault = /* 'defa' */ 0x64656661, bmd3DPreviewFormatLeftOnly = /* 'left' */ 0x6C656674, bmd3DPreviewFormatRightOnly = /* 'righ' */ 0x72696768, bmd3DPreviewFormatSideBySide = /* 'side' */ 0x73696465, bmd3DPreviewFormatTopBottom = /* 'topb' */ 0x746F7062 }; /* Enum BMDNotifications - Events that can be subscribed through IDeckLinkNotification */ typedef uint32_t BMDNotifications; enum _BMDNotifications { bmdPreferencesChanged = /* 'pref' */ 0x70726566, bmdStatusChanged = /* 'stat' */ 0x73746174 }; #if defined(__cplusplus) // Forward Declarations class IDeckLinkVideoOutputCallback; class IDeckLinkInputCallback; class IDeckLinkEncoderInputCallback; class IDeckLinkMemoryAllocator; class IDeckLinkAudioOutputCallback; class IDeckLinkIterator; class IDeckLinkAPIInformation; class IDeckLinkOutput; class IDeckLinkInput; class IDeckLinkHDMIInputEDID; class IDeckLinkEncoderInput; class IDeckLinkVideoFrame; class IDeckLinkMutableVideoFrame; class IDeckLinkVideoFrame3DExtensions; class IDeckLinkVideoFrameMetadataExtensions; class IDeckLinkVideoInputFrame; class IDeckLinkAncillaryPacket; class IDeckLinkAncillaryPacketIterator; class IDeckLinkVideoFrameAncillaryPackets; class IDeckLinkVideoFrameAncillary; class IDeckLinkEncoderPacket; class IDeckLinkEncoderVideoPacket; class IDeckLinkEncoderAudioPacket; class IDeckLinkH265NALPacket; class IDeckLinkAudioInputPacket; class IDeckLinkScreenPreviewCallback; class IDeckLinkGLScreenPreviewHelper; class IDeckLinkNotificationCallback; class IDeckLinkNotification; class IDeckLinkAttributes; class IDeckLinkStatus; class IDeckLinkKeyer; class IDeckLinkVideoConversion; class IDeckLinkDeviceNotificationCallback; class IDeckLinkDiscovery; /* Interface IDeckLinkVideoOutputCallback - Frame completion callback. */ class BMD_PUBLIC IDeckLinkVideoOutputCallback : public IUnknown { public: virtual HRESULT ScheduledFrameCompleted (/* in */ IDeckLinkVideoFrame *completedFrame, /* in */ BMDOutputFrameCompletionResult result) = 0; virtual HRESULT ScheduledPlaybackHasStopped (void) = 0; protected: virtual ~IDeckLinkVideoOutputCallback () {} // call Release method to drop reference count }; /* Interface IDeckLinkInputCallback - Frame arrival callback. */ class BMD_PUBLIC IDeckLinkInputCallback : public IUnknown { public: virtual HRESULT VideoInputFormatChanged (/* in */ BMDVideoInputFormatChangedEvents notificationEvents, /* in */ IDeckLinkDisplayMode *newDisplayMode, /* in */ BMDDetectedVideoInputFormatFlags detectedSignalFlags) = 0; virtual HRESULT VideoInputFrameArrived (/* in */ IDeckLinkVideoInputFrame* videoFrame, /* in */ IDeckLinkAudioInputPacket* audioPacket) = 0; protected: virtual ~IDeckLinkInputCallback () {} // call Release method to drop reference count }; /* Interface IDeckLinkEncoderInputCallback - Frame arrival callback. */ class BMD_PUBLIC IDeckLinkEncoderInputCallback : public IUnknown { public: virtual HRESULT VideoInputSignalChanged (/* in */ BMDVideoInputFormatChangedEvents notificationEvents, /* in */ IDeckLinkDisplayMode *newDisplayMode, /* in */ BMDDetectedVideoInputFormatFlags detectedSignalFlags) = 0; virtual HRESULT VideoPacketArrived (/* in */ IDeckLinkEncoderVideoPacket* videoPacket) = 0; virtual HRESULT AudioPacketArrived (/* in */ IDeckLinkEncoderAudioPacket* audioPacket) = 0; protected: virtual ~IDeckLinkEncoderInputCallback () {} // call Release method to drop reference count }; /* Interface IDeckLinkMemoryAllocator - Memory allocator for video frames. */ class BMD_PUBLIC IDeckLinkMemoryAllocator : public IUnknown { public: virtual HRESULT AllocateBuffer (/* in */ uint32_t bufferSize, /* out */ void **allocatedBuffer) = 0; virtual HRESULT ReleaseBuffer (/* in */ void *buffer) = 0; virtual HRESULT Commit (void) = 0; virtual HRESULT Decommit (void) = 0; }; /* Interface IDeckLinkAudioOutputCallback - Optional callback to allow audio samples to be pulled as required. */ class BMD_PUBLIC IDeckLinkAudioOutputCallback : public IUnknown { public: virtual HRESULT RenderAudioSamples (/* in */ bool preroll) = 0; }; /* Interface IDeckLinkIterator - enumerates installed DeckLink hardware */ class BMD_PUBLIC IDeckLinkIterator : public IUnknown { public: virtual HRESULT Next (/* out */ IDeckLink **deckLinkInstance) = 0; }; /* Interface IDeckLinkAPIInformation - DeckLinkAPI attribute interface */ class BMD_PUBLIC IDeckLinkAPIInformation : public IUnknown { public: virtual HRESULT GetFlag (/* in */ BMDDeckLinkAPIInformationID cfgID, /* out */ bool *value) = 0; virtual HRESULT GetInt (/* in */ BMDDeckLinkAPIInformationID cfgID, /* out */ int64_t *value) = 0; virtual HRESULT GetFloat (/* in */ BMDDeckLinkAPIInformationID cfgID, /* out */ double *value) = 0; virtual HRESULT GetString (/* in */ BMDDeckLinkAPIInformationID cfgID, /* out */ const char **value) = 0; protected: virtual ~IDeckLinkAPIInformation () {} // call Release method to drop reference count }; /* Interface IDeckLinkOutput - Created by QueryInterface from IDeckLink. */ class BMD_PUBLIC IDeckLinkOutput : public IUnknown { public: virtual HRESULT DoesSupportVideoMode (/* in */ BMDDisplayMode displayMode, /* in */ BMDPixelFormat pixelFormat, /* in */ BMDVideoOutputFlags flags, /* out */ BMDDisplayModeSupport *result, /* out */ IDeckLinkDisplayMode **resultDisplayMode) = 0; virtual HRESULT GetDisplayModeIterator (/* out */ IDeckLinkDisplayModeIterator **iterator) = 0; virtual HRESULT SetScreenPreviewCallback (/* in */ IDeckLinkScreenPreviewCallback *previewCallback) = 0; /* Video Output */ virtual HRESULT EnableVideoOutput (/* in */ BMDDisplayMode displayMode, /* in */ BMDVideoOutputFlags flags) = 0; virtual HRESULT DisableVideoOutput (void) = 0; virtual HRESULT SetVideoOutputFrameMemoryAllocator (/* in */ IDeckLinkMemoryAllocator *theAllocator) = 0; virtual HRESULT CreateVideoFrame (/* in */ int32_t width, /* in */ int32_t height, /* in */ int32_t rowBytes, /* in */ BMDPixelFormat pixelFormat, /* in */ BMDFrameFlags flags, /* out */ IDeckLinkMutableVideoFrame **outFrame) = 0; virtual HRESULT CreateAncillaryData (/* in */ BMDPixelFormat pixelFormat, /* out */ IDeckLinkVideoFrameAncillary **outBuffer) = 0; // Use of IDeckLinkVideoFrameAncillaryPackets is preferred virtual HRESULT DisplayVideoFrameSync (/* in */ IDeckLinkVideoFrame *theFrame) = 0; virtual HRESULT ScheduleVideoFrame (/* in */ IDeckLinkVideoFrame *theFrame, /* in */ BMDTimeValue displayTime, /* in */ BMDTimeValue displayDuration, /* in */ BMDTimeScale timeScale) = 0; virtual HRESULT SetScheduledFrameCompletionCallback (/* in */ IDeckLinkVideoOutputCallback *theCallback) = 0; virtual HRESULT GetBufferedVideoFrameCount (/* out */ uint32_t *bufferedFrameCount) = 0; /* Audio Output */ virtual HRESULT EnableAudioOutput (/* in */ BMDAudioSampleRate sampleRate, /* in */ BMDAudioSampleType sampleType, /* in */ uint32_t channelCount, /* in */ BMDAudioOutputStreamType streamType) = 0; virtual HRESULT DisableAudioOutput (void) = 0; virtual HRESULT WriteAudioSamplesSync (/* in */ void *buffer, /* in */ uint32_t sampleFrameCount, /* out */ uint32_t *sampleFramesWritten) = 0; virtual HRESULT BeginAudioPreroll (void) = 0; virtual HRESULT EndAudioPreroll (void) = 0; virtual HRESULT ScheduleAudioSamples (/* in */ void *buffer, /* in */ uint32_t sampleFrameCount, /* in */ BMDTimeValue streamTime, /* in */ BMDTimeScale timeScale, /* out */ uint32_t *sampleFramesWritten) = 0; virtual HRESULT GetBufferedAudioSampleFrameCount (/* out */ uint32_t *bufferedSampleFrameCount) = 0; virtual HRESULT FlushBufferedAudioSamples (void) = 0; virtual HRESULT SetAudioCallback (/* in */ IDeckLinkAudioOutputCallback *theCallback) = 0; /* Output Control */ virtual HRESULT StartScheduledPlayback (/* in */ BMDTimeValue playbackStartTime, /* in */ BMDTimeScale timeScale, /* in */ double playbackSpeed) = 0; virtual HRESULT StopScheduledPlayback (/* in */ BMDTimeValue stopPlaybackAtTime, /* out */ BMDTimeValue *actualStopTime, /* in */ BMDTimeScale timeScale) = 0; virtual HRESULT IsScheduledPlaybackRunning (/* out */ bool *active) = 0; virtual HRESULT GetScheduledStreamTime (/* in */ BMDTimeScale desiredTimeScale, /* out */ BMDTimeValue *streamTime, /* out */ double *playbackSpeed) = 0; virtual HRESULT GetReferenceStatus (/* out */ BMDReferenceStatus *referenceStatus) = 0; /* Hardware Timing */ virtual HRESULT GetHardwareReferenceClock (/* in */ BMDTimeScale desiredTimeScale, /* out */ BMDTimeValue *hardwareTime, /* out */ BMDTimeValue *timeInFrame, /* out */ BMDTimeValue *ticksPerFrame) = 0; virtual HRESULT GetFrameCompletionReferenceTimestamp (/* in */ IDeckLinkVideoFrame *theFrame, /* in */ BMDTimeScale desiredTimeScale, /* out */ BMDTimeValue *frameCompletionTimestamp) = 0; protected: virtual ~IDeckLinkOutput () {} // call Release method to drop reference count }; /* Interface IDeckLinkInput - Created by QueryInterface from IDeckLink. */ class BMD_PUBLIC IDeckLinkInput : public IUnknown { public: virtual HRESULT DoesSupportVideoMode (/* in */ BMDDisplayMode displayMode, /* in */ BMDPixelFormat pixelFormat, /* in */ BMDVideoInputFlags flags, /* out */ BMDDisplayModeSupport *result, /* out */ IDeckLinkDisplayMode **resultDisplayMode) = 0; virtual HRESULT GetDisplayModeIterator (/* out */ IDeckLinkDisplayModeIterator **iterator) = 0; virtual HRESULT SetScreenPreviewCallback (/* in */ IDeckLinkScreenPreviewCallback *previewCallback) = 0; /* Video Input */ virtual HRESULT EnableVideoInput (/* in */ BMDDisplayMode displayMode, /* in */ BMDPixelFormat pixelFormat, /* in */ BMDVideoInputFlags flags) = 0; virtual HRESULT DisableVideoInput (void) = 0; virtual HRESULT GetAvailableVideoFrameCount (/* out */ uint32_t *availableFrameCount) = 0; virtual HRESULT SetVideoInputFrameMemoryAllocator (/* in */ IDeckLinkMemoryAllocator *theAllocator) = 0; /* Audio Input */ virtual HRESULT EnableAudioInput (/* in */ BMDAudioSampleRate sampleRate, /* in */ BMDAudioSampleType sampleType, /* in */ uint32_t channelCount) = 0; virtual HRESULT DisableAudioInput (void) = 0; virtual HRESULT GetAvailableAudioSampleFrameCount (/* out */ uint32_t *availableSampleFrameCount) = 0; /* Input Control */ virtual HRESULT StartStreams (void) = 0; virtual HRESULT StopStreams (void) = 0; virtual HRESULT PauseStreams (void) = 0; virtual HRESULT FlushStreams (void) = 0; virtual HRESULT SetCallback (/* in */ IDeckLinkInputCallback *theCallback) = 0; /* Hardware Timing */ virtual HRESULT GetHardwareReferenceClock (/* in */ BMDTimeScale desiredTimeScale, /* out */ BMDTimeValue *hardwareTime, /* out */ BMDTimeValue *timeInFrame, /* out */ BMDTimeValue *ticksPerFrame) = 0; protected: virtual ~IDeckLinkInput () {} // call Release method to drop reference count }; /* Interface IDeckLinkHDMIInputEDID - Created by QueryInterface from IDeckLink. Releasing all references will restore EDID to default */ class BMD_PUBLIC IDeckLinkHDMIInputEDID : public IUnknown { public: virtual HRESULT SetInt (/* in */ BMDDeckLinkHDMIInputEDIDID cfgID, /* in */ int64_t value) = 0; virtual HRESULT GetInt (/* in */ BMDDeckLinkHDMIInputEDIDID cfgID, /* out */ int64_t *value) = 0; virtual HRESULT WriteToEDID (void) = 0; protected: virtual ~IDeckLinkHDMIInputEDID () {} // call Release method to drop reference count }; /* Interface IDeckLinkEncoderInput - Created by QueryInterface from IDeckLink. */ class BMD_PUBLIC IDeckLinkEncoderInput : public IUnknown { public: virtual HRESULT DoesSupportVideoMode (/* in */ BMDDisplayMode displayMode, /* in */ BMDPixelFormat pixelFormat, /* in */ BMDVideoInputFlags flags, /* out */ BMDDisplayModeSupport *result, /* out */ IDeckLinkDisplayMode **resultDisplayMode) = 0; virtual HRESULT GetDisplayModeIterator (/* out */ IDeckLinkDisplayModeIterator **iterator) = 0; /* Video Input */ virtual HRESULT EnableVideoInput (/* in */ BMDDisplayMode displayMode, /* in */ BMDPixelFormat pixelFormat, /* in */ BMDVideoInputFlags flags) = 0; virtual HRESULT DisableVideoInput (void) = 0; virtual HRESULT GetAvailablePacketsCount (/* out */ uint32_t *availablePacketsCount) = 0; virtual HRESULT SetMemoryAllocator (/* in */ IDeckLinkMemoryAllocator *theAllocator) = 0; /* Audio Input */ virtual HRESULT EnableAudioInput (/* in */ BMDAudioFormat audioFormat, /* in */ BMDAudioSampleRate sampleRate, /* in */ BMDAudioSampleType sampleType, /* in */ uint32_t channelCount) = 0; virtual HRESULT DisableAudioInput (void) = 0; virtual HRESULT GetAvailableAudioSampleFrameCount (/* out */ uint32_t *availableSampleFrameCount) = 0; /* Input Control */ virtual HRESULT StartStreams (void) = 0; virtual HRESULT StopStreams (void) = 0; virtual HRESULT PauseStreams (void) = 0; virtual HRESULT FlushStreams (void) = 0; virtual HRESULT SetCallback (/* in */ IDeckLinkEncoderInputCallback *theCallback) = 0; /* Hardware Timing */ virtual HRESULT GetHardwareReferenceClock (/* in */ BMDTimeScale desiredTimeScale, /* out */ BMDTimeValue *hardwareTime, /* out */ BMDTimeValue *timeInFrame, /* out */ BMDTimeValue *ticksPerFrame) = 0; protected: virtual ~IDeckLinkEncoderInput () {} // call Release method to drop reference count }; /* Interface IDeckLinkVideoFrame - Interface to encapsulate a video frame; can be caller-implemented. */ class BMD_PUBLIC IDeckLinkVideoFrame : public IUnknown { public: virtual long GetWidth (void) = 0; virtual long GetHeight (void) = 0; virtual long GetRowBytes (void) = 0; virtual BMDPixelFormat GetPixelFormat (void) = 0; virtual BMDFrameFlags GetFlags (void) = 0; virtual HRESULT GetBytes (/* out */ void **buffer) = 0; virtual HRESULT GetTimecode (/* in */ BMDTimecodeFormat format, /* out */ IDeckLinkTimecode **timecode) = 0; virtual HRESULT GetAncillaryData (/* out */ IDeckLinkVideoFrameAncillary **ancillary) = 0; // Use of IDeckLinkVideoFrameAncillaryPackets is preferred protected: virtual ~IDeckLinkVideoFrame () {} // call Release method to drop reference count }; /* Interface IDeckLinkMutableVideoFrame - Created by IDeckLinkOutput::CreateVideoFrame. */ class BMD_PUBLIC IDeckLinkMutableVideoFrame : public IDeckLinkVideoFrame { public: virtual HRESULT SetFlags (/* in */ BMDFrameFlags newFlags) = 0; virtual HRESULT SetTimecode (/* in */ BMDTimecodeFormat format, /* in */ IDeckLinkTimecode *timecode) = 0; virtual HRESULT SetTimecodeFromComponents (/* in */ BMDTimecodeFormat format, /* in */ uint8_t hours, /* in */ uint8_t minutes, /* in */ uint8_t seconds, /* in */ uint8_t frames, /* in */ BMDTimecodeFlags flags) = 0; virtual HRESULT SetAncillaryData (/* in */ IDeckLinkVideoFrameAncillary *ancillary) = 0; virtual HRESULT SetTimecodeUserBits (/* in */ BMDTimecodeFormat format, /* in */ BMDTimecodeUserBits userBits) = 0; protected: virtual ~IDeckLinkMutableVideoFrame () {} // call Release method to drop reference count }; /* Interface IDeckLinkVideoFrame3DExtensions - Optional interface implemented on IDeckLinkVideoFrame to support 3D frames */ class BMD_PUBLIC IDeckLinkVideoFrame3DExtensions : public IUnknown { public: virtual BMDVideo3DPackingFormat Get3DPackingFormat (void) = 0; virtual HRESULT GetFrameForRightEye (/* out */ IDeckLinkVideoFrame* *rightEyeFrame) = 0; protected: virtual ~IDeckLinkVideoFrame3DExtensions () {} // call Release method to drop reference count }; /* Interface IDeckLinkVideoFrameMetadataExtensions - Optional interface implemented on IDeckLinkVideoFrame to support frame metadata such as HDMI HDR information */ class BMD_PUBLIC IDeckLinkVideoFrameMetadataExtensions : public IUnknown { public: virtual HRESULT GetInt (/* in */ BMDDeckLinkFrameMetadataID metadataID, /* out */ int64_t *value) = 0; virtual HRESULT GetFloat (/* in */ BMDDeckLinkFrameMetadataID metadataID, /* out */ double *value) = 0; virtual HRESULT GetFlag (/* in */ BMDDeckLinkFrameMetadataID metadataID, /* out */ bool* value) = 0; virtual HRESULT GetString (/* in */ BMDDeckLinkFrameMetadataID metadataID, /* out */ const char **value) = 0; protected: virtual ~IDeckLinkVideoFrameMetadataExtensions () {} // call Release method to drop reference count }; /* Interface IDeckLinkVideoInputFrame - Provided by the IDeckLinkVideoInput frame arrival callback. */ class BMD_PUBLIC IDeckLinkVideoInputFrame : public IDeckLinkVideoFrame { public: virtual HRESULT GetStreamTime (/* out */ BMDTimeValue *frameTime, /* out */ BMDTimeValue *frameDuration, /* in */ BMDTimeScale timeScale) = 0; virtual HRESULT GetHardwareReferenceTimestamp (/* in */ BMDTimeScale timeScale, /* out */ BMDTimeValue *frameTime, /* out */ BMDTimeValue *frameDuration) = 0; protected: virtual ~IDeckLinkVideoInputFrame () {} // call Release method to drop reference count }; /* Interface IDeckLinkAncillaryPacket - On output, user needs to implement this interface */ class BMD_PUBLIC IDeckLinkAncillaryPacket : public IUnknown { public: virtual HRESULT GetBytes (/* in */ BMDAncillaryPacketFormat format /* For output, only one format need be offered */, /* out */ const void **data /* Optional */, /* out */ uint32_t *size /* Optional */) = 0; virtual uint8_t GetDID (void) = 0; virtual uint8_t GetSDID (void) = 0; virtual uint32_t GetLineNumber (void) = 0; // On output, zero is auto virtual uint8_t GetDataStreamIndex (void) = 0; // Usually zero. Can only be 1 if non-SD and the first data stream is completely full protected: virtual ~IDeckLinkAncillaryPacket () {} // call Release method to drop reference count }; /* Interface IDeckLinkAncillaryPacketIterator - Enumerates ancillary packets */ class BMD_PUBLIC IDeckLinkAncillaryPacketIterator : public IUnknown { public: virtual HRESULT Next (/* out */ IDeckLinkAncillaryPacket **packet) = 0; protected: virtual ~IDeckLinkAncillaryPacketIterator () {} // call Release method to drop reference count }; /* Interface IDeckLinkVideoFrameAncillaryPackets - Obtained through QueryInterface() on an IDeckLinkVideoFrame object. */ class BMD_PUBLIC IDeckLinkVideoFrameAncillaryPackets : public IUnknown { public: virtual HRESULT GetPacketIterator (/* out */ IDeckLinkAncillaryPacketIterator **iterator) = 0; virtual HRESULT GetFirstPacketByID (/* in */ uint8_t DID, /* in */ uint8_t SDID, /* out */ IDeckLinkAncillaryPacket **packet) = 0; virtual HRESULT AttachPacket (/* in */ IDeckLinkAncillaryPacket *packet) = 0; // Implement IDeckLinkAncillaryPacket to output your own virtual HRESULT DetachPacket (/* in */ IDeckLinkAncillaryPacket *packet) = 0; virtual HRESULT DetachAllPackets (void) = 0; protected: virtual ~IDeckLinkVideoFrameAncillaryPackets () {} // call Release method to drop reference count }; /* Interface IDeckLinkVideoFrameAncillary - Use of IDeckLinkVideoFrameAncillaryPackets is preferred. Obtained through QueryInterface() on an IDeckLinkVideoFrame object. */ class BMD_PUBLIC IDeckLinkVideoFrameAncillary : public IUnknown { public: virtual HRESULT GetBufferForVerticalBlankingLine (/* in */ uint32_t lineNumber, /* out */ void **buffer) = 0; // Pixels/rowbytes is same as display mode, except for above HD where it's 1920 pixels for UHD modes and 2048 pixels for DCI modes virtual BMDPixelFormat GetPixelFormat (void) = 0; virtual BMDDisplayMode GetDisplayMode (void) = 0; protected: virtual ~IDeckLinkVideoFrameAncillary () {} // call Release method to drop reference count }; /* Interface IDeckLinkEncoderPacket - Interface to encapsulate an encoded packet. */ class BMD_PUBLIC IDeckLinkEncoderPacket : public IUnknown { public: virtual HRESULT GetBytes (/* out */ void **buffer) = 0; virtual long GetSize (void) = 0; virtual HRESULT GetStreamTime (/* out */ BMDTimeValue *frameTime, /* in */ BMDTimeScale timeScale) = 0; virtual BMDPacketType GetPacketType (void) = 0; protected: virtual ~IDeckLinkEncoderPacket () {} // call Release method to drop reference count }; /* Interface IDeckLinkEncoderVideoPacket - Provided by the IDeckLinkEncoderInput video packet arrival callback. */ class BMD_PUBLIC IDeckLinkEncoderVideoPacket : public IDeckLinkEncoderPacket { public: virtual BMDPixelFormat GetPixelFormat (void) = 0; virtual HRESULT GetHardwareReferenceTimestamp (/* in */ BMDTimeScale timeScale, /* out */ BMDTimeValue *frameTime, /* out */ BMDTimeValue *frameDuration) = 0; virtual HRESULT GetTimecode (/* in */ BMDTimecodeFormat format, /* out */ IDeckLinkTimecode **timecode) = 0; protected: virtual ~IDeckLinkEncoderVideoPacket () {} // call Release method to drop reference count }; /* Interface IDeckLinkEncoderAudioPacket - Provided by the IDeckLinkEncoderInput audio packet arrival callback. */ class BMD_PUBLIC IDeckLinkEncoderAudioPacket : public IDeckLinkEncoderPacket { public: virtual BMDAudioFormat GetAudioFormat (void) = 0; protected: virtual ~IDeckLinkEncoderAudioPacket () {} // call Release method to drop reference count }; /* Interface IDeckLinkH265NALPacket - Obtained through QueryInterface() on an IDeckLinkEncoderVideoPacket object */ class BMD_PUBLIC IDeckLinkH265NALPacket : public IDeckLinkEncoderVideoPacket { public: virtual HRESULT GetUnitType (/* out */ uint8_t *unitType) = 0; virtual HRESULT GetBytesNoPrefix (/* out */ void **buffer) = 0; virtual long GetSizeNoPrefix (void) = 0; protected: virtual ~IDeckLinkH265NALPacket () {} // call Release method to drop reference count }; /* Interface IDeckLinkAudioInputPacket - Provided by the IDeckLinkInput callback. */ class BMD_PUBLIC IDeckLinkAudioInputPacket : public IUnknown { public: virtual long GetSampleFrameCount (void) = 0; virtual HRESULT GetBytes (/* out */ void **buffer) = 0; virtual HRESULT GetPacketTime (/* out */ BMDTimeValue *packetTime, /* in */ BMDTimeScale timeScale) = 0; protected: virtual ~IDeckLinkAudioInputPacket () {} // call Release method to drop reference count }; /* Interface IDeckLinkScreenPreviewCallback - Screen preview callback */ class BMD_PUBLIC IDeckLinkScreenPreviewCallback : public IUnknown { public: virtual HRESULT DrawFrame (/* in */ IDeckLinkVideoFrame *theFrame) = 0; protected: virtual ~IDeckLinkScreenPreviewCallback () {} // call Release method to drop reference count }; /* Interface IDeckLinkGLScreenPreviewHelper - Created with CoCreateInstance(). */ class BMD_PUBLIC IDeckLinkGLScreenPreviewHelper : public IUnknown { public: /* Methods must be called with OpenGL context set */ virtual HRESULT InitializeGL (void) = 0; virtual HRESULT PaintGL (void) = 0; virtual HRESULT SetFrame (/* in */ IDeckLinkVideoFrame *theFrame) = 0; virtual HRESULT Set3DPreviewFormat (/* in */ BMD3DPreviewFormat previewFormat) = 0; protected: virtual ~IDeckLinkGLScreenPreviewHelper () {} // call Release method to drop reference count }; /* Interface IDeckLinkNotificationCallback - DeckLink Notification Callback Interface */ class BMD_PUBLIC IDeckLinkNotificationCallback : public IUnknown { public: virtual HRESULT Notify (/* in */ BMDNotifications topic, /* in */ uint64_t param1, /* in */ uint64_t param2) = 0; }; /* Interface IDeckLinkNotification - DeckLink Notification interface */ class BMD_PUBLIC IDeckLinkNotification : public IUnknown { public: virtual HRESULT Subscribe (/* in */ BMDNotifications topic, /* in */ IDeckLinkNotificationCallback *theCallback) = 0; virtual HRESULT Unsubscribe (/* in */ BMDNotifications topic, /* in */ IDeckLinkNotificationCallback *theCallback) = 0; }; /* Interface IDeckLinkAttributes - DeckLink Attribute interface */ class BMD_PUBLIC IDeckLinkAttributes : public IUnknown { public: virtual HRESULT GetFlag (/* in */ BMDDeckLinkAttributeID cfgID, /* out */ bool *value) = 0; virtual HRESULT GetInt (/* in */ BMDDeckLinkAttributeID cfgID, /* out */ int64_t *value) = 0; virtual HRESULT GetFloat (/* in */ BMDDeckLinkAttributeID cfgID, /* out */ double *value) = 0; virtual HRESULT GetString (/* in */ BMDDeckLinkAttributeID cfgID, /* out */ const char **value) = 0; protected: virtual ~IDeckLinkAttributes () {} // call Release method to drop reference count }; /* Interface IDeckLinkStatus - DeckLink Status interface */ class BMD_PUBLIC IDeckLinkStatus : public IUnknown { public: virtual HRESULT GetFlag (/* in */ BMDDeckLinkStatusID statusID, /* out */ bool *value) = 0; virtual HRESULT GetInt (/* in */ BMDDeckLinkStatusID statusID, /* out */ int64_t *value) = 0; virtual HRESULT GetFloat (/* in */ BMDDeckLinkStatusID statusID, /* out */ double *value) = 0; virtual HRESULT GetString (/* in */ BMDDeckLinkStatusID statusID, /* out */ const char **value) = 0; virtual HRESULT GetBytes (/* in */ BMDDeckLinkStatusID statusID, /* out */ void *buffer, /* in, out */ uint32_t *bufferSize) = 0; protected: virtual ~IDeckLinkStatus () {} // call Release method to drop reference count }; /* Interface IDeckLinkKeyer - DeckLink Keyer interface */ class BMD_PUBLIC IDeckLinkKeyer : public IUnknown { public: virtual HRESULT Enable (/* in */ bool isExternal) = 0; virtual HRESULT SetLevel (/* in */ uint8_t level) = 0; virtual HRESULT RampUp (/* in */ uint32_t numberOfFrames) = 0; virtual HRESULT RampDown (/* in */ uint32_t numberOfFrames) = 0; virtual HRESULT Disable (void) = 0; protected: virtual ~IDeckLinkKeyer () {} // call Release method to drop reference count }; /* Interface IDeckLinkVideoConversion - Created with CoCreateInstance(). */ class BMD_PUBLIC IDeckLinkVideoConversion : public IUnknown { public: virtual HRESULT ConvertFrame (/* in */ IDeckLinkVideoFrame* srcFrame, /* in */ IDeckLinkVideoFrame* dstFrame) = 0; protected: virtual ~IDeckLinkVideoConversion () {} // call Release method to drop reference count }; /* Interface IDeckLinkDeviceNotificationCallback - DeckLink device arrival/removal notification callbacks */ class BMD_PUBLIC IDeckLinkDeviceNotificationCallback : public IUnknown { public: virtual HRESULT DeckLinkDeviceArrived (/* in */ IDeckLink* deckLinkDevice) = 0; virtual HRESULT DeckLinkDeviceRemoved (/* in */ IDeckLink* deckLinkDevice) = 0; protected: virtual ~IDeckLinkDeviceNotificationCallback () {} // call Release method to drop reference count }; /* Interface IDeckLinkDiscovery - DeckLink device discovery */ class BMD_PUBLIC IDeckLinkDiscovery : public IUnknown { public: virtual HRESULT InstallDeviceNotifications (/* in */ IDeckLinkDeviceNotificationCallback* deviceNotificationCallback) = 0; virtual HRESULT UninstallDeviceNotifications (void) = 0; protected: virtual ~IDeckLinkDiscovery () {} // call Release method to drop reference count }; /* Functions */ extern "C" { IDeckLinkIterator* BMD_PUBLIC CreateDeckLinkIteratorInstance (void); IDeckLinkDiscovery* BMD_PUBLIC CreateDeckLinkDiscoveryInstance (void); IDeckLinkAPIInformation* BMD_PUBLIC CreateDeckLinkAPIInformationInstance (void); IDeckLinkGLScreenPreviewHelper* BMD_PUBLIC CreateOpenGLScreenPreviewHelper (void); IDeckLinkVideoConversion* BMD_PUBLIC CreateVideoConversionInstance (void); IDeckLinkVideoFrameAncillaryPackets* BMD_PUBLIC CreateVideoFrameAncillaryPacketsInstance (void); // For use when creating a custom IDeckLinkVideoFrame without wrapping IDeckLinkOutput::CreateVideoFrame } #endif // defined(__cplusplus) #endif /* defined(BMD_DECKLINKAPI_H) */ nageru-2.3.0/nageru/decklink/DeckLinkAPIConfiguration.h000066400000000000000000000324421450736322200227720ustar00rootroot00000000000000/* -LICENSE-START- ** Copyright (c) 2018 Blackmagic Design ** ** Permission is hereby granted, free of charge, to any person or organization ** obtaining a copy of the software and accompanying documentation covered by ** this license (the "Software") to use, reproduce, display, distribute, ** execute, and transmit the Software, and to prepare derivative works of the ** Software, and to permit third-parties to whom the Software is furnished to ** do so, all subject to the following: ** ** The copyright notices in the Software and this entire statement, including ** the above license grant, this restriction and the following disclaimer, ** must be included in all copies of the Software, in whole or in part, and ** all derivative works of the Software, unless such copies or derivative ** works are solely in the form of machine-executable object code generated by ** a source language processor. ** ** THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR ** IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, ** FITNESS FOR A PARTICULAR PURPOSE, TITLE AND NON-INFRINGEMENT. IN NO EVENT ** SHALL THE COPYRIGHT HOLDERS OR ANYONE DISTRIBUTING THE SOFTWARE BE LIABLE ** FOR ANY DAMAGES OR OTHER LIABILITY, WHETHER IN CONTRACT, TORT OR OTHERWISE, ** ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER ** DEALINGS IN THE SOFTWARE. ** -LICENSE-END- */ #ifndef BMD_DECKLINKAPICONFIGURATION_H #define BMD_DECKLINKAPICONFIGURATION_H #ifndef BMD_CONST #if defined(_MSC_VER) #define BMD_CONST __declspec(selectany) static const #else #define BMD_CONST static const #endif #endif #ifndef BMD_PUBLIC #define BMD_PUBLIC #endif // Type Declarations // Interface ID Declarations BMD_CONST REFIID IID_IDeckLinkConfiguration = /* EF90380B-4AE5-4346-9077-E288E149F129 */ {0xEF,0x90,0x38,0x0B,0x4A,0xE5,0x43,0x46,0x90,0x77,0xE2,0x88,0xE1,0x49,0xF1,0x29}; BMD_CONST REFIID IID_IDeckLinkEncoderConfiguration = /* 138050E5-C60A-4552-BF3F-0F358049327E */ {0x13,0x80,0x50,0xE5,0xC6,0x0A,0x45,0x52,0xBF,0x3F,0x0F,0x35,0x80,0x49,0x32,0x7E}; /* Enum BMDDeckLinkConfigurationID - DeckLink Configuration ID */ typedef uint32_t BMDDeckLinkConfigurationID; enum _BMDDeckLinkConfigurationID { /* Serial port Flags */ bmdDeckLinkConfigSwapSerialRxTx = /* 'ssrt' */ 0x73737274, /* Video Input/Output Integers */ bmdDeckLinkConfigHDMI3DPackingFormat = /* '3dpf' */ 0x33647066, bmdDeckLinkConfigBypass = /* 'byps' */ 0x62797073, bmdDeckLinkConfigClockTimingAdjustment = /* 'ctad' */ 0x63746164, bmdDeckLinkConfigDuplexMode = /* 'dupx' */ 0x64757078, /* Audio Input/Output Flags */ bmdDeckLinkConfigAnalogAudioConsumerLevels = /* 'aacl' */ 0x6161636C, /* Video output flags */ bmdDeckLinkConfigFieldFlickerRemoval = /* 'fdfr' */ 0x66646672, bmdDeckLinkConfigHD1080p24ToHD1080i5994Conversion = /* 'to59' */ 0x746F3539, bmdDeckLinkConfig444SDIVideoOutput = /* '444o' */ 0x3434346F, bmdDeckLinkConfigBlackVideoOutputDuringCapture = /* 'bvoc' */ 0x62766F63, bmdDeckLinkConfigLowLatencyVideoOutput = /* 'llvo' */ 0x6C6C766F, bmdDeckLinkConfigDownConversionOnAllAnalogOutput = /* 'caao' */ 0x6361616F, bmdDeckLinkConfigSMPTELevelAOutput = /* 'smta' */ 0x736D7461, bmdDeckLinkConfigRec2020Output = /* 'rec2' */ 0x72656332, // Ensure output is Rec.2020 colorspace bmdDeckLinkConfigQuadLinkSDIVideoOutputSquareDivisionSplit = /* 'SDQS' */ 0x53445153, /* Video Output Flags */ bmdDeckLinkConfigOutput1080pAsPsF = /* 'pfpr' */ 0x70667072, /* Video Output Integers */ bmdDeckLinkConfigVideoOutputConnection = /* 'vocn' */ 0x766F636E, bmdDeckLinkConfigVideoOutputConversionMode = /* 'vocm' */ 0x766F636D, bmdDeckLinkConfigAnalogVideoOutputFlags = /* 'avof' */ 0x61766F66, bmdDeckLinkConfigReferenceInputTimingOffset = /* 'glot' */ 0x676C6F74, bmdDeckLinkConfigVideoOutputIdleOperation = /* 'voio' */ 0x766F696F, bmdDeckLinkConfigDefaultVideoOutputMode = /* 'dvom' */ 0x64766F6D, bmdDeckLinkConfigDefaultVideoOutputModeFlags = /* 'dvof' */ 0x64766F66, bmdDeckLinkConfigSDIOutputLinkConfiguration = /* 'solc' */ 0x736F6C63, /* Video Output Floats */ bmdDeckLinkConfigVideoOutputComponentLumaGain = /* 'oclg' */ 0x6F636C67, bmdDeckLinkConfigVideoOutputComponentChromaBlueGain = /* 'occb' */ 0x6F636362, bmdDeckLinkConfigVideoOutputComponentChromaRedGain = /* 'occr' */ 0x6F636372, bmdDeckLinkConfigVideoOutputCompositeLumaGain = /* 'oilg' */ 0x6F696C67, bmdDeckLinkConfigVideoOutputCompositeChromaGain = /* 'oicg' */ 0x6F696367, bmdDeckLinkConfigVideoOutputSVideoLumaGain = /* 'oslg' */ 0x6F736C67, bmdDeckLinkConfigVideoOutputSVideoChromaGain = /* 'oscg' */ 0x6F736367, /* Video Input Flags */ bmdDeckLinkConfigVideoInputScanning = /* 'visc' */ 0x76697363, // Applicable to H264 Pro Recorder only bmdDeckLinkConfigUseDedicatedLTCInput = /* 'dltc' */ 0x646C7463, // Use timecode from LTC input instead of SDI stream bmdDeckLinkConfigSDIInput3DPayloadOverride = /* '3dds' */ 0x33646473, /* Video Input Flags */ bmdDeckLinkConfigCapture1080pAsPsF = /* 'cfpr' */ 0x63667072, /* Video Input Integers */ bmdDeckLinkConfigVideoInputConnection = /* 'vicn' */ 0x7669636E, bmdDeckLinkConfigAnalogVideoInputFlags = /* 'avif' */ 0x61766966, bmdDeckLinkConfigVideoInputConversionMode = /* 'vicm' */ 0x7669636D, bmdDeckLinkConfig32PulldownSequenceInitialTimecodeFrame = /* 'pdif' */ 0x70646966, bmdDeckLinkConfigVANCSourceLine1Mapping = /* 'vsl1' */ 0x76736C31, bmdDeckLinkConfigVANCSourceLine2Mapping = /* 'vsl2' */ 0x76736C32, bmdDeckLinkConfigVANCSourceLine3Mapping = /* 'vsl3' */ 0x76736C33, bmdDeckLinkConfigCapturePassThroughMode = /* 'cptm' */ 0x6370746D, /* Video Input Floats */ bmdDeckLinkConfigVideoInputComponentLumaGain = /* 'iclg' */ 0x69636C67, bmdDeckLinkConfigVideoInputComponentChromaBlueGain = /* 'iccb' */ 0x69636362, bmdDeckLinkConfigVideoInputComponentChromaRedGain = /* 'iccr' */ 0x69636372, bmdDeckLinkConfigVideoInputCompositeLumaGain = /* 'iilg' */ 0x69696C67, bmdDeckLinkConfigVideoInputCompositeChromaGain = /* 'iicg' */ 0x69696367, bmdDeckLinkConfigVideoInputSVideoLumaGain = /* 'islg' */ 0x69736C67, bmdDeckLinkConfigVideoInputSVideoChromaGain = /* 'iscg' */ 0x69736367, /* Audio Input Flags */ bmdDeckLinkConfigMicrophonePhantomPower = /* 'mphp' */ 0x6D706870, /* Audio Input Integers */ bmdDeckLinkConfigAudioInputConnection = /* 'aicn' */ 0x6169636E, /* Audio Input Floats */ bmdDeckLinkConfigAnalogAudioInputScaleChannel1 = /* 'ais1' */ 0x61697331, bmdDeckLinkConfigAnalogAudioInputScaleChannel2 = /* 'ais2' */ 0x61697332, bmdDeckLinkConfigAnalogAudioInputScaleChannel3 = /* 'ais3' */ 0x61697333, bmdDeckLinkConfigAnalogAudioInputScaleChannel4 = /* 'ais4' */ 0x61697334, bmdDeckLinkConfigDigitalAudioInputScale = /* 'dais' */ 0x64616973, bmdDeckLinkConfigMicrophoneInputGain = /* 'micg' */ 0x6D696367, /* Audio Output Integers */ bmdDeckLinkConfigAudioOutputAESAnalogSwitch = /* 'aoaa' */ 0x616F6161, /* Audio Output Floats */ bmdDeckLinkConfigAnalogAudioOutputScaleChannel1 = /* 'aos1' */ 0x616F7331, bmdDeckLinkConfigAnalogAudioOutputScaleChannel2 = /* 'aos2' */ 0x616F7332, bmdDeckLinkConfigAnalogAudioOutputScaleChannel3 = /* 'aos3' */ 0x616F7333, bmdDeckLinkConfigAnalogAudioOutputScaleChannel4 = /* 'aos4' */ 0x616F7334, bmdDeckLinkConfigDigitalAudioOutputScale = /* 'daos' */ 0x64616F73, bmdDeckLinkConfigHeadphoneVolume = /* 'hvol' */ 0x68766F6C, /* Device Information Strings */ bmdDeckLinkConfigDeviceInformationLabel = /* 'dila' */ 0x64696C61, bmdDeckLinkConfigDeviceInformationSerialNumber = /* 'disn' */ 0x6469736E, bmdDeckLinkConfigDeviceInformationCompany = /* 'dico' */ 0x6469636F, bmdDeckLinkConfigDeviceInformationPhone = /* 'diph' */ 0x64697068, bmdDeckLinkConfigDeviceInformationEmail = /* 'diem' */ 0x6469656D, bmdDeckLinkConfigDeviceInformationDate = /* 'dida' */ 0x64696461, /* Deck Control Integers */ bmdDeckLinkConfigDeckControlConnection = /* 'dcco' */ 0x6463636F }; /* Enum BMDDeckLinkEncoderConfigurationID - DeckLink Encoder Configuration ID */ typedef uint32_t BMDDeckLinkEncoderConfigurationID; enum _BMDDeckLinkEncoderConfigurationID { /* Video Encoder Integers */ bmdDeckLinkEncoderConfigPreferredBitDepth = /* 'epbr' */ 0x65706272, bmdDeckLinkEncoderConfigFrameCodingMode = /* 'efcm' */ 0x6566636D, /* HEVC/H.265 Encoder Integers */ bmdDeckLinkEncoderConfigH265TargetBitrate = /* 'htbr' */ 0x68746272, /* DNxHR/DNxHD Compression ID */ bmdDeckLinkEncoderConfigDNxHRCompressionID = /* 'dcid' */ 0x64636964, /* DNxHR/DNxHD Level */ bmdDeckLinkEncoderConfigDNxHRLevel = /* 'dlev' */ 0x646C6576, /* Encoded Sample Decriptions */ bmdDeckLinkEncoderConfigMPEG4SampleDescription = /* 'stsE' */ 0x73747345, // Full MPEG4 sample description (aka SampleEntry of an 'stsd' atom-box). Useful for MediaFoundation, QuickTime, MKV and more bmdDeckLinkEncoderConfigMPEG4CodecSpecificDesc = /* 'esds' */ 0x65736473 // Sample description extensions only (atom stream, each with size and fourCC header). Useful for AVFoundation, VideoToolbox, MKV and more }; // Forward Declarations class IDeckLinkConfiguration; class IDeckLinkEncoderConfiguration; /* Interface IDeckLinkConfiguration - DeckLink Configuration interface */ class BMD_PUBLIC IDeckLinkConfiguration : public IUnknown { public: virtual HRESULT SetFlag (/* in */ BMDDeckLinkConfigurationID cfgID, /* in */ bool value) = 0; virtual HRESULT GetFlag (/* in */ BMDDeckLinkConfigurationID cfgID, /* out */ bool *value) = 0; virtual HRESULT SetInt (/* in */ BMDDeckLinkConfigurationID cfgID, /* in */ int64_t value) = 0; virtual HRESULT GetInt (/* in */ BMDDeckLinkConfigurationID cfgID, /* out */ int64_t *value) = 0; virtual HRESULT SetFloat (/* in */ BMDDeckLinkConfigurationID cfgID, /* in */ double value) = 0; virtual HRESULT GetFloat (/* in */ BMDDeckLinkConfigurationID cfgID, /* out */ double *value) = 0; virtual HRESULT SetString (/* in */ BMDDeckLinkConfigurationID cfgID, /* in */ const char *value) = 0; virtual HRESULT GetString (/* in */ BMDDeckLinkConfigurationID cfgID, /* out */ const char **value) = 0; virtual HRESULT WriteConfigurationToPreferences (void) = 0; protected: virtual ~IDeckLinkConfiguration () {} // call Release method to drop reference count }; /* Interface IDeckLinkEncoderConfiguration - DeckLink Encoder Configuration interface. Obtained from IDeckLinkEncoderInput */ class BMD_PUBLIC IDeckLinkEncoderConfiguration : public IUnknown { public: virtual HRESULT SetFlag (/* in */ BMDDeckLinkEncoderConfigurationID cfgID, /* in */ bool value) = 0; virtual HRESULT GetFlag (/* in */ BMDDeckLinkEncoderConfigurationID cfgID, /* out */ bool *value) = 0; virtual HRESULT SetInt (/* in */ BMDDeckLinkEncoderConfigurationID cfgID, /* in */ int64_t value) = 0; virtual HRESULT GetInt (/* in */ BMDDeckLinkEncoderConfigurationID cfgID, /* out */ int64_t *value) = 0; virtual HRESULT SetFloat (/* in */ BMDDeckLinkEncoderConfigurationID cfgID, /* in */ double value) = 0; virtual HRESULT GetFloat (/* in */ BMDDeckLinkEncoderConfigurationID cfgID, /* out */ double *value) = 0; virtual HRESULT SetString (/* in */ BMDDeckLinkEncoderConfigurationID cfgID, /* in */ const char *value) = 0; virtual HRESULT GetString (/* in */ BMDDeckLinkEncoderConfigurationID cfgID, /* out */ const char **value) = 0; virtual HRESULT GetBytes (/* in */ BMDDeckLinkEncoderConfigurationID cfgID, /* out */ void *buffer /* optional */, /* in, out */ uint32_t *bufferSize) = 0; protected: virtual ~IDeckLinkEncoderConfiguration () {} // call Release method to drop reference count }; /* Functions */ extern "C" { } #endif /* defined(BMD_DECKLINKAPICONFIGURATION_H) */ nageru-2.3.0/nageru/decklink/DeckLinkAPIDeckControl.h000066400000000000000000000310011450736322200223600ustar00rootroot00000000000000/* -LICENSE-START- ** Copyright (c) 2018 Blackmagic Design ** ** Permission is hereby granted, free of charge, to any person or organization ** obtaining a copy of the software and accompanying documentation covered by ** this license (the "Software") to use, reproduce, display, distribute, ** execute, and transmit the Software, and to prepare derivative works of the ** Software, and to permit third-parties to whom the Software is furnished to ** do so, all subject to the following: ** ** The copyright notices in the Software and this entire statement, including ** the above license grant, this restriction and the following disclaimer, ** must be included in all copies of the Software, in whole or in part, and ** all derivative works of the Software, unless such copies or derivative ** works are solely in the form of machine-executable object code generated by ** a source language processor. ** ** THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR ** IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, ** FITNESS FOR A PARTICULAR PURPOSE, TITLE AND NON-INFRINGEMENT. IN NO EVENT ** SHALL THE COPYRIGHT HOLDERS OR ANYONE DISTRIBUTING THE SOFTWARE BE LIABLE ** FOR ANY DAMAGES OR OTHER LIABILITY, WHETHER IN CONTRACT, TORT OR OTHERWISE, ** ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER ** DEALINGS IN THE SOFTWARE. ** -LICENSE-END- */ #ifndef BMD_DECKLINKAPIDECKCONTROL_H #define BMD_DECKLINKAPIDECKCONTROL_H #ifndef BMD_CONST #if defined(_MSC_VER) #define BMD_CONST __declspec(selectany) static const #else #define BMD_CONST static const #endif #endif #ifndef BMD_PUBLIC #define BMD_PUBLIC #endif // Type Declarations // Interface ID Declarations BMD_CONST REFIID IID_IDeckLinkDeckControlStatusCallback = /* 53436FFB-B434-4906-BADC-AE3060FFE8EF */ {0x53,0x43,0x6F,0xFB,0xB4,0x34,0x49,0x06,0xBA,0xDC,0xAE,0x30,0x60,0xFF,0xE8,0xEF}; BMD_CONST REFIID IID_IDeckLinkDeckControl = /* 8E1C3ACE-19C7-4E00-8B92-D80431D958BE */ {0x8E,0x1C,0x3A,0xCE,0x19,0xC7,0x4E,0x00,0x8B,0x92,0xD8,0x04,0x31,0xD9,0x58,0xBE}; /* Enum BMDDeckControlMode - DeckControl mode */ typedef uint32_t BMDDeckControlMode; enum _BMDDeckControlMode { bmdDeckControlNotOpened = /* 'ntop' */ 0x6E746F70, bmdDeckControlVTRControlMode = /* 'vtrc' */ 0x76747263, bmdDeckControlExportMode = /* 'expm' */ 0x6578706D, bmdDeckControlCaptureMode = /* 'capm' */ 0x6361706D }; /* Enum BMDDeckControlEvent - DeckControl event */ typedef uint32_t BMDDeckControlEvent; enum _BMDDeckControlEvent { bmdDeckControlAbortedEvent = /* 'abte' */ 0x61627465, // This event is triggered when a capture or edit-to-tape operation is aborted. /* Export-To-Tape events */ bmdDeckControlPrepareForExportEvent = /* 'pfee' */ 0x70666565, // This event is triggered a few frames before reaching the in-point. IDeckLinkInput::StartScheduledPlayback() should be called at this point. bmdDeckControlExportCompleteEvent = /* 'exce' */ 0x65786365, // This event is triggered a few frames after reaching the out-point. At this point, it is safe to stop playback. /* Capture events */ bmdDeckControlPrepareForCaptureEvent = /* 'pfce' */ 0x70666365, // This event is triggered a few frames before reaching the in-point. The serial timecode attached to IDeckLinkVideoInputFrames is now valid. bmdDeckControlCaptureCompleteEvent = /* 'ccev' */ 0x63636576 // This event is triggered a few frames after reaching the out-point. }; /* Enum BMDDeckControlVTRControlState - VTR Control state */ typedef uint32_t BMDDeckControlVTRControlState; enum _BMDDeckControlVTRControlState { bmdDeckControlNotInVTRControlMode = /* 'nvcm' */ 0x6E76636D, bmdDeckControlVTRControlPlaying = /* 'vtrp' */ 0x76747270, bmdDeckControlVTRControlRecording = /* 'vtrr' */ 0x76747272, bmdDeckControlVTRControlStill = /* 'vtra' */ 0x76747261, bmdDeckControlVTRControlShuttleForward = /* 'vtsf' */ 0x76747366, bmdDeckControlVTRControlShuttleReverse = /* 'vtsr' */ 0x76747372, bmdDeckControlVTRControlJogForward = /* 'vtjf' */ 0x76746A66, bmdDeckControlVTRControlJogReverse = /* 'vtjr' */ 0x76746A72, bmdDeckControlVTRControlStopped = /* 'vtro' */ 0x7674726F }; /* Enum BMDDeckControlStatusFlags - Deck Control status flags */ typedef uint32_t BMDDeckControlStatusFlags; enum _BMDDeckControlStatusFlags { bmdDeckControlStatusDeckConnected = 1 << 0, bmdDeckControlStatusRemoteMode = 1 << 1, bmdDeckControlStatusRecordInhibited = 1 << 2, bmdDeckControlStatusCassetteOut = 1 << 3 }; /* Enum BMDDeckControlExportModeOpsFlags - Export mode flags */ typedef uint32_t BMDDeckControlExportModeOpsFlags; enum _BMDDeckControlExportModeOpsFlags { bmdDeckControlExportModeInsertVideo = 1 << 0, bmdDeckControlExportModeInsertAudio1 = 1 << 1, bmdDeckControlExportModeInsertAudio2 = 1 << 2, bmdDeckControlExportModeInsertAudio3 = 1 << 3, bmdDeckControlExportModeInsertAudio4 = 1 << 4, bmdDeckControlExportModeInsertAudio5 = 1 << 5, bmdDeckControlExportModeInsertAudio6 = 1 << 6, bmdDeckControlExportModeInsertAudio7 = 1 << 7, bmdDeckControlExportModeInsertAudio8 = 1 << 8, bmdDeckControlExportModeInsertAudio9 = 1 << 9, bmdDeckControlExportModeInsertAudio10 = 1 << 10, bmdDeckControlExportModeInsertAudio11 = 1 << 11, bmdDeckControlExportModeInsertAudio12 = 1 << 12, bmdDeckControlExportModeInsertTimeCode = 1 << 13, bmdDeckControlExportModeInsertAssemble = 1 << 14, bmdDeckControlExportModeInsertPreview = 1 << 15, bmdDeckControlUseManualExport = 1 << 16 }; /* Enum BMDDeckControlError - Deck Control error */ typedef uint32_t BMDDeckControlError; enum _BMDDeckControlError { bmdDeckControlNoError = /* 'noer' */ 0x6E6F6572, bmdDeckControlModeError = /* 'moer' */ 0x6D6F6572, bmdDeckControlMissedInPointError = /* 'mier' */ 0x6D696572, bmdDeckControlDeckTimeoutError = /* 'dter' */ 0x64746572, bmdDeckControlCommandFailedError = /* 'cfer' */ 0x63666572, bmdDeckControlDeviceAlreadyOpenedError = /* 'dalo' */ 0x64616C6F, bmdDeckControlFailedToOpenDeviceError = /* 'fder' */ 0x66646572, bmdDeckControlInLocalModeError = /* 'lmer' */ 0x6C6D6572, bmdDeckControlEndOfTapeError = /* 'eter' */ 0x65746572, bmdDeckControlUserAbortError = /* 'uaer' */ 0x75616572, bmdDeckControlNoTapeInDeckError = /* 'nter' */ 0x6E746572, bmdDeckControlNoVideoFromCardError = /* 'nvfc' */ 0x6E766663, bmdDeckControlNoCommunicationError = /* 'ncom' */ 0x6E636F6D, bmdDeckControlBufferTooSmallError = /* 'btsm' */ 0x6274736D, bmdDeckControlBadChecksumError = /* 'chks' */ 0x63686B73, bmdDeckControlUnknownError = /* 'uner' */ 0x756E6572 }; // Forward Declarations class IDeckLinkDeckControlStatusCallback; class IDeckLinkDeckControl; /* Interface IDeckLinkDeckControlStatusCallback - Deck control state change callback. */ class BMD_PUBLIC IDeckLinkDeckControlStatusCallback : public IUnknown { public: virtual HRESULT TimecodeUpdate (/* in */ BMDTimecodeBCD currentTimecode) = 0; virtual HRESULT VTRControlStateChanged (/* in */ BMDDeckControlVTRControlState newState, /* in */ BMDDeckControlError error) = 0; virtual HRESULT DeckControlEventReceived (/* in */ BMDDeckControlEvent event, /* in */ BMDDeckControlError error) = 0; virtual HRESULT DeckControlStatusChanged (/* in */ BMDDeckControlStatusFlags flags, /* in */ uint32_t mask) = 0; protected: virtual ~IDeckLinkDeckControlStatusCallback () {} // call Release method to drop reference count }; /* Interface IDeckLinkDeckControl - Deck Control main interface */ class BMD_PUBLIC IDeckLinkDeckControl : public IUnknown { public: virtual HRESULT Open (/* in */ BMDTimeScale timeScale, /* in */ BMDTimeValue timeValue, /* in */ bool timecodeIsDropFrame, /* out */ BMDDeckControlError *error) = 0; virtual HRESULT Close (/* in */ bool standbyOn) = 0; virtual HRESULT GetCurrentState (/* out */ BMDDeckControlMode *mode, /* out */ BMDDeckControlVTRControlState *vtrControlState, /* out */ BMDDeckControlStatusFlags *flags) = 0; virtual HRESULT SetStandby (/* in */ bool standbyOn) = 0; virtual HRESULT SendCommand (/* in */ uint8_t *inBuffer, /* in */ uint32_t inBufferSize, /* out */ uint8_t *outBuffer, /* out */ uint32_t *outDataSize, /* in */ uint32_t outBufferSize, /* out */ BMDDeckControlError *error) = 0; virtual HRESULT Play (/* out */ BMDDeckControlError *error) = 0; virtual HRESULT Stop (/* out */ BMDDeckControlError *error) = 0; virtual HRESULT TogglePlayStop (/* out */ BMDDeckControlError *error) = 0; virtual HRESULT Eject (/* out */ BMDDeckControlError *error) = 0; virtual HRESULT GoToTimecode (/* in */ BMDTimecodeBCD timecode, /* out */ BMDDeckControlError *error) = 0; virtual HRESULT FastForward (/* in */ bool viewTape, /* out */ BMDDeckControlError *error) = 0; virtual HRESULT Rewind (/* in */ bool viewTape, /* out */ BMDDeckControlError *error) = 0; virtual HRESULT StepForward (/* out */ BMDDeckControlError *error) = 0; virtual HRESULT StepBack (/* out */ BMDDeckControlError *error) = 0; virtual HRESULT Jog (/* in */ double rate, /* out */ BMDDeckControlError *error) = 0; virtual HRESULT Shuttle (/* in */ double rate, /* out */ BMDDeckControlError *error) = 0; virtual HRESULT GetTimecodeString (/* out */ const char **currentTimeCode, /* out */ BMDDeckControlError *error) = 0; virtual HRESULT GetTimecode (/* out */ IDeckLinkTimecode **currentTimecode, /* out */ BMDDeckControlError *error) = 0; virtual HRESULT GetTimecodeBCD (/* out */ BMDTimecodeBCD *currentTimecode, /* out */ BMDDeckControlError *error) = 0; virtual HRESULT SetPreroll (/* in */ uint32_t prerollSeconds) = 0; virtual HRESULT GetPreroll (/* out */ uint32_t *prerollSeconds) = 0; virtual HRESULT SetExportOffset (/* in */ int32_t exportOffsetFields) = 0; virtual HRESULT GetExportOffset (/* out */ int32_t *exportOffsetFields) = 0; virtual HRESULT GetManualExportOffset (/* out */ int32_t *deckManualExportOffsetFields) = 0; virtual HRESULT SetCaptureOffset (/* in */ int32_t captureOffsetFields) = 0; virtual HRESULT GetCaptureOffset (/* out */ int32_t *captureOffsetFields) = 0; virtual HRESULT StartExport (/* in */ BMDTimecodeBCD inTimecode, /* in */ BMDTimecodeBCD outTimecode, /* in */ BMDDeckControlExportModeOpsFlags exportModeOps, /* out */ BMDDeckControlError *error) = 0; virtual HRESULT StartCapture (/* in */ bool useVITC, /* in */ BMDTimecodeBCD inTimecode, /* in */ BMDTimecodeBCD outTimecode, /* out */ BMDDeckControlError *error) = 0; virtual HRESULT GetDeviceID (/* out */ uint16_t *deviceId, /* out */ BMDDeckControlError *error) = 0; virtual HRESULT Abort (void) = 0; virtual HRESULT CrashRecordStart (/* out */ BMDDeckControlError *error) = 0; virtual HRESULT CrashRecordStop (/* out */ BMDDeckControlError *error) = 0; virtual HRESULT SetCallback (/* in */ IDeckLinkDeckControlStatusCallback *callback) = 0; protected: virtual ~IDeckLinkDeckControl () {} // call Release method to drop reference count }; /* Functions */ extern "C" { } #endif /* defined(BMD_DECKLINKAPIDECKCONTROL_H) */ nageru-2.3.0/nageru/decklink/DeckLinkAPIDiscovery.h000066400000000000000000000046211450736322200221300ustar00rootroot00000000000000/* -LICENSE-START- ** Copyright (c) 2018 Blackmagic Design ** ** Permission is hereby granted, free of charge, to any person or organization ** obtaining a copy of the software and accompanying documentation covered by ** this license (the "Software") to use, reproduce, display, distribute, ** execute, and transmit the Software, and to prepare derivative works of the ** Software, and to permit third-parties to whom the Software is furnished to ** do so, all subject to the following: ** ** The copyright notices in the Software and this entire statement, including ** the above license grant, this restriction and the following disclaimer, ** must be included in all copies of the Software, in whole or in part, and ** all derivative works of the Software, unless such copies or derivative ** works are solely in the form of machine-executable object code generated by ** a source language processor. ** ** THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR ** IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, ** FITNESS FOR A PARTICULAR PURPOSE, TITLE AND NON-INFRINGEMENT. IN NO EVENT ** SHALL THE COPYRIGHT HOLDERS OR ANYONE DISTRIBUTING THE SOFTWARE BE LIABLE ** FOR ANY DAMAGES OR OTHER LIABILITY, WHETHER IN CONTRACT, TORT OR OTHERWISE, ** ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER ** DEALINGS IN THE SOFTWARE. ** -LICENSE-END- */ #ifndef BMD_DECKLINKAPIDISCOVERY_H #define BMD_DECKLINKAPIDISCOVERY_H #ifndef BMD_CONST #if defined(_MSC_VER) #define BMD_CONST __declspec(selectany) static const #else #define BMD_CONST static const #endif #endif #ifndef BMD_PUBLIC #define BMD_PUBLIC #endif // Type Declarations // Interface ID Declarations BMD_CONST REFIID IID_IDeckLink = /* C418FBDD-0587-48ED-8FE5-640F0A14AF91 */ {0xC4,0x18,0xFB,0xDD,0x05,0x87,0x48,0xED,0x8F,0xE5,0x64,0x0F,0x0A,0x14,0xAF,0x91}; // Forward Declarations class IDeckLink; /* Interface IDeckLink - represents a DeckLink device */ class BMD_PUBLIC IDeckLink : public IUnknown { public: virtual HRESULT GetModelName (/* out */ const char **modelName) = 0; virtual HRESULT GetDisplayName (/* out */ const char **displayName) = 0; protected: virtual ~IDeckLink () {} // call Release method to drop reference count }; /* Functions */ extern "C" { } #endif /* defined(BMD_DECKLINKAPIDISCOVERY_H) */ nageru-2.3.0/nageru/decklink/DeckLinkAPIDispatch.cpp000077500000000000000000000121731450736322200222570ustar00rootroot00000000000000/* -LICENSE-START- ** Copyright (c) 2009 Blackmagic Design ** ** Permission is hereby granted, free of charge, to any person or organization ** obtaining a copy of the software and accompanying documentation covered by ** this license (the "Software") to use, reproduce, display, distribute, ** execute, and transmit the Software, and to prepare derivative works of the ** Software, and to permit third-parties to whom the Software is furnished to ** do so, all subject to the following: ** ** The copyright notices in the Software and this entire statement, including ** the above license grant, this restriction and the following disclaimer, ** must be included in all copies of the Software, in whole or in part, and ** all derivative works of the Software, unless such copies or derivative ** works are solely in the form of machine-executable object code generated by ** a source language processor. ** ** THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR ** IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, ** FITNESS FOR A PARTICULAR PURPOSE, TITLE AND NON-INFRINGEMENT. IN NO EVENT ** SHALL THE COPYRIGHT HOLDERS OR ANYONE DISTRIBUTING THE SOFTWARE BE LIABLE ** FOR ANY DAMAGES OR OTHER LIABILITY, WHETHER IN CONTRACT, TORT OR OTHERWISE, ** ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER ** DEALINGS IN THE SOFTWARE. ** -LICENSE-END- **/ #include #include #include #include "DeckLinkAPI.h" #define kDeckLinkAPI_Name "libDeckLinkAPI.so" #define KDeckLinkPreviewAPI_Name "libDeckLinkPreviewAPI.so" typedef IDeckLinkIterator* (*CreateIteratorFunc)(void); typedef IDeckLinkAPIInformation* (*CreateAPIInformationFunc)(void); typedef IDeckLinkGLScreenPreviewHelper* (*CreateOpenGLScreenPreviewHelperFunc)(void); typedef IDeckLinkVideoConversion* (*CreateVideoConversionInstanceFunc)(void); typedef IDeckLinkDiscovery* (*CreateDeckLinkDiscoveryInstanceFunc)(void); static pthread_once_t gDeckLinkOnceControl = PTHREAD_ONCE_INIT; static pthread_once_t gPreviewOnceControl = PTHREAD_ONCE_INIT; static bool gLoadedDeckLinkAPI = false; static CreateIteratorFunc gCreateIteratorFunc = NULL; static CreateAPIInformationFunc gCreateAPIInformationFunc = NULL; static CreateOpenGLScreenPreviewHelperFunc gCreateOpenGLPreviewFunc = NULL; static CreateVideoConversionInstanceFunc gCreateVideoConversionFunc = NULL; static CreateDeckLinkDiscoveryInstanceFunc gCreateDeckLinkDiscoveryFunc = NULL; void InitDeckLinkAPI (void) { void *libraryHandle; libraryHandle = dlopen(kDeckLinkAPI_Name, RTLD_NOW|RTLD_GLOBAL); if (!libraryHandle) { fprintf(stderr, "%s\n", dlerror()); return; } gLoadedDeckLinkAPI = true; gCreateIteratorFunc = (CreateIteratorFunc)dlsym(libraryHandle, "CreateDeckLinkIteratorInstance_0002"); if (!gCreateIteratorFunc) fprintf(stderr, "%s\n", dlerror()); gCreateAPIInformationFunc = (CreateAPIInformationFunc)dlsym(libraryHandle, "CreateDeckLinkAPIInformationInstance_0001"); if (!gCreateAPIInformationFunc) fprintf(stderr, "%s\n", dlerror()); gCreateVideoConversionFunc = (CreateVideoConversionInstanceFunc)dlsym(libraryHandle, "CreateVideoConversionInstance_0001"); if (!gCreateVideoConversionFunc) fprintf(stderr, "%s\n", dlerror()); gCreateDeckLinkDiscoveryFunc = (CreateDeckLinkDiscoveryInstanceFunc)dlsym(libraryHandle, "CreateDeckLinkDiscoveryInstance_0001"); if (!gCreateDeckLinkDiscoveryFunc) fprintf(stderr, "%s\n", dlerror()); } void InitDeckLinkPreviewAPI (void) { void *libraryHandle; libraryHandle = dlopen(KDeckLinkPreviewAPI_Name, RTLD_NOW|RTLD_GLOBAL); if (!libraryHandle) { fprintf(stderr, "%s\n", dlerror()); return; } gCreateOpenGLPreviewFunc = (CreateOpenGLScreenPreviewHelperFunc)dlsym(libraryHandle, "CreateOpenGLScreenPreviewHelper_0001"); if (!gCreateOpenGLPreviewFunc) fprintf(stderr, "%s\n", dlerror()); } bool IsDeckLinkAPIPresent (void) { // If the DeckLink API dynamic library was successfully loaded, return this knowledge to the caller return gLoadedDeckLinkAPI; } IDeckLinkIterator* CreateDeckLinkIteratorInstance (void) { pthread_once(&gDeckLinkOnceControl, InitDeckLinkAPI); if (gCreateIteratorFunc == NULL) return NULL; return gCreateIteratorFunc(); } IDeckLinkAPIInformation* CreateDeckLinkAPIInformationInstance (void) { pthread_once(&gDeckLinkOnceControl, InitDeckLinkAPI); if (gCreateAPIInformationFunc == NULL) return NULL; return gCreateAPIInformationFunc(); } IDeckLinkGLScreenPreviewHelper* CreateOpenGLScreenPreviewHelper (void) { pthread_once(&gDeckLinkOnceControl, InitDeckLinkAPI); pthread_once(&gPreviewOnceControl, InitDeckLinkPreviewAPI); if (gCreateOpenGLPreviewFunc == NULL) return NULL; return gCreateOpenGLPreviewFunc(); } IDeckLinkVideoConversion* CreateVideoConversionInstance (void) { pthread_once(&gDeckLinkOnceControl, InitDeckLinkAPI); if (gCreateVideoConversionFunc == NULL) return NULL; return gCreateVideoConversionFunc(); } IDeckLinkDiscovery* CreateDeckLinkDiscoveryInstance (void) { pthread_once(&gDeckLinkOnceControl, InitDeckLinkAPI); if (gCreateDeckLinkDiscoveryFunc == NULL) return NULL; return gCreateDeckLinkDiscoveryFunc(); } nageru-2.3.0/nageru/decklink/DeckLinkAPIModes.h000066400000000000000000000310661450736322200212330ustar00rootroot00000000000000/* -LICENSE-START- ** Copyright (c) 2018 Blackmagic Design ** ** Permission is hereby granted, free of charge, to any person or organization ** obtaining a copy of the software and accompanying documentation covered by ** this license (the "Software") to use, reproduce, display, distribute, ** execute, and transmit the Software, and to prepare derivative works of the ** Software, and to permit third-parties to whom the Software is furnished to ** do so, all subject to the following: ** ** The copyright notices in the Software and this entire statement, including ** the above license grant, this restriction and the following disclaimer, ** must be included in all copies of the Software, in whole or in part, and ** all derivative works of the Software, unless such copies or derivative ** works are solely in the form of machine-executable object code generated by ** a source language processor. ** ** THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR ** IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, ** FITNESS FOR A PARTICULAR PURPOSE, TITLE AND NON-INFRINGEMENT. IN NO EVENT ** SHALL THE COPYRIGHT HOLDERS OR ANYONE DISTRIBUTING THE SOFTWARE BE LIABLE ** FOR ANY DAMAGES OR OTHER LIABILITY, WHETHER IN CONTRACT, TORT OR OTHERWISE, ** ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER ** DEALINGS IN THE SOFTWARE. ** -LICENSE-END- */ #ifndef BMD_DECKLINKAPIMODES_H #define BMD_DECKLINKAPIMODES_H #ifndef BMD_CONST #if defined(_MSC_VER) #define BMD_CONST __declspec(selectany) static const #else #define BMD_CONST static const #endif #endif #ifndef BMD_PUBLIC #define BMD_PUBLIC #endif // Type Declarations // Interface ID Declarations BMD_CONST REFIID IID_IDeckLinkDisplayModeIterator = /* 9C88499F-F601-4021-B80B-032E4EB41C35 */ {0x9C,0x88,0x49,0x9F,0xF6,0x01,0x40,0x21,0xB8,0x0B,0x03,0x2E,0x4E,0xB4,0x1C,0x35}; BMD_CONST REFIID IID_IDeckLinkDisplayMode = /* 3EB2C1AB-0A3D-4523-A3AD-F40D7FB14E78 */ {0x3E,0xB2,0xC1,0xAB,0x0A,0x3D,0x45,0x23,0xA3,0xAD,0xF4,0x0D,0x7F,0xB1,0x4E,0x78}; /* Enum BMDDisplayMode - Video display modes */ typedef uint32_t BMDDisplayMode; enum _BMDDisplayMode { /* SD Modes */ bmdModeNTSC = /* 'ntsc' */ 0x6E747363, bmdModeNTSC2398 = /* 'nt23' */ 0x6E743233, // 3:2 pulldown bmdModePAL = /* 'pal ' */ 0x70616C20, bmdModeNTSCp = /* 'ntsp' */ 0x6E747370, bmdModePALp = /* 'palp' */ 0x70616C70, /* HD 1080 Modes */ bmdModeHD1080p2398 = /* '23ps' */ 0x32337073, bmdModeHD1080p24 = /* '24ps' */ 0x32347073, bmdModeHD1080p25 = /* 'Hp25' */ 0x48703235, bmdModeHD1080p2997 = /* 'Hp29' */ 0x48703239, bmdModeHD1080p30 = /* 'Hp30' */ 0x48703330, bmdModeHD1080p50 = /* 'Hp50' */ 0x48703530, bmdModeHD1080p5994 = /* 'Hp59' */ 0x48703539, bmdModeHD1080p6000 = /* 'Hp60' */ 0x48703630, // N.B. This _really_ is 60.00 Hz. bmdModeHD1080i50 = /* 'Hi50' */ 0x48693530, bmdModeHD1080i5994 = /* 'Hi59' */ 0x48693539, bmdModeHD1080i6000 = /* 'Hi60' */ 0x48693630, // N.B. This _really_ is 60.00 Hz. /* HD 720 Modes */ bmdModeHD720p50 = /* 'hp50' */ 0x68703530, bmdModeHD720p5994 = /* 'hp59' */ 0x68703539, bmdModeHD720p60 = /* 'hp60' */ 0x68703630, /* 2K Modes */ bmdMode2k2398 = /* '2k23' */ 0x326B3233, bmdMode2k24 = /* '2k24' */ 0x326B3234, bmdMode2k25 = /* '2k25' */ 0x326B3235, /* 2K DCI Modes */ bmdMode2kDCI2398 = /* '2d23' */ 0x32643233, bmdMode2kDCI24 = /* '2d24' */ 0x32643234, bmdMode2kDCI25 = /* '2d25' */ 0x32643235, bmdMode2kDCI2997 = /* '2d29' */ 0x32643239, bmdMode2kDCI30 = /* '2d30' */ 0x32643330, bmdMode2kDCI50 = /* '2d50' */ 0x32643530, bmdMode2kDCI5994 = /* '2d59' */ 0x32643539, bmdMode2kDCI60 = /* '2d60' */ 0x32643630, /* 4K UHD Modes */ bmdMode4K2160p2398 = /* '4k23' */ 0x346B3233, bmdMode4K2160p24 = /* '4k24' */ 0x346B3234, bmdMode4K2160p25 = /* '4k25' */ 0x346B3235, bmdMode4K2160p2997 = /* '4k29' */ 0x346B3239, bmdMode4K2160p30 = /* '4k30' */ 0x346B3330, bmdMode4K2160p50 = /* '4k50' */ 0x346B3530, bmdMode4K2160p5994 = /* '4k59' */ 0x346B3539, bmdMode4K2160p60 = /* '4k60' */ 0x346B3630, /* 4K DCI Modes */ bmdMode4kDCI2398 = /* '4d23' */ 0x34643233, bmdMode4kDCI24 = /* '4d24' */ 0x34643234, bmdMode4kDCI25 = /* '4d25' */ 0x34643235, bmdMode4kDCI2997 = /* '4d29' */ 0x34643239, bmdMode4kDCI30 = /* '4d30' */ 0x34643330, bmdMode4kDCI50 = /* '4d50' */ 0x34643530, bmdMode4kDCI5994 = /* '4d59' */ 0x34643539, bmdMode4kDCI60 = /* '4d60' */ 0x34643630, /* 8K UHD Modes */ bmdMode8K4320p2398 = /* '8k23' */ 0x386B3233, bmdMode8K4320p24 = /* '8k24' */ 0x386B3234, bmdMode8K4320p25 = /* '8k25' */ 0x386B3235, bmdMode8K4320p2997 = /* '8k29' */ 0x386B3239, bmdMode8K4320p30 = /* '8k30' */ 0x386B3330, bmdMode8K4320p50 = /* '8k50' */ 0x386B3530, bmdMode8K4320p5994 = /* '8k59' */ 0x386B3539, bmdMode8K4320p60 = /* '8k60' */ 0x386B3630, /* 8K DCI Modes */ bmdMode8kDCI2398 = /* '8d23' */ 0x38643233, bmdMode8kDCI24 = /* '8d24' */ 0x38643234, bmdMode8kDCI25 = /* '8d25' */ 0x38643235, bmdMode8kDCI2997 = /* '8d29' */ 0x38643239, bmdMode8kDCI30 = /* '8d30' */ 0x38643330, bmdMode8kDCI50 = /* '8d50' */ 0x38643530, bmdMode8kDCI5994 = /* '8d59' */ 0x38643539, bmdMode8kDCI60 = /* '8d60' */ 0x38643630, /* RAW Modes for Cintel (input only) */ bmdModeCintelRAW = /* 'rwci' */ 0x72776369, // Frame size up to 4096x3072, variable frame rate bmdModeCintelCompressedRAW = /* 'rwcc' */ 0x72776363, // Frame size up to 4096x3072, variable frame rate /* Special Modes */ bmdModeUnknown = /* 'iunk' */ 0x69756E6B }; /* Enum BMDFieldDominance - Video field dominance */ typedef uint32_t BMDFieldDominance; enum _BMDFieldDominance { bmdUnknownFieldDominance = 0, bmdLowerFieldFirst = /* 'lowr' */ 0x6C6F7772, bmdUpperFieldFirst = /* 'uppr' */ 0x75707072, bmdProgressiveFrame = /* 'prog' */ 0x70726F67, bmdProgressiveSegmentedFrame = /* 'psf ' */ 0x70736620 }; /* Enum BMDPixelFormat - Video pixel formats supported for output/input */ typedef uint32_t BMDPixelFormat; enum _BMDPixelFormat { bmdFormat8BitYUV = /* '2vuy' */ 0x32767579, bmdFormat10BitYUV = /* 'v210' */ 0x76323130, bmdFormat8BitARGB = 32, bmdFormat8BitBGRA = /* 'BGRA' */ 0x42475241, bmdFormat10BitRGB = /* 'r210' */ 0x72323130, // Big-endian RGB 10-bit per component with SMPTE video levels (64-960). Packed as 2:10:10:10 bmdFormat12BitRGB = /* 'R12B' */ 0x52313242, // Big-endian RGB 12-bit per component with full range (0-4095). Packed as 12-bit per component bmdFormat12BitRGBLE = /* 'R12L' */ 0x5231324C, // Little-endian RGB 12-bit per component with full range (0-4095). Packed as 12-bit per component bmdFormat10BitRGBXLE = /* 'R10l' */ 0x5231306C, // Little-endian 10-bit RGB with SMPTE video levels (64-940) bmdFormat10BitRGBX = /* 'R10b' */ 0x52313062, // Big-endian 10-bit RGB with SMPTE video levels (64-940) bmdFormatH265 = /* 'hev1' */ 0x68657631, // High Efficiency Video Coding (HEVC/h.265) /* AVID DNxHR */ bmdFormatDNxHR = /* 'AVdh' */ 0x41566468, /* Cintel formats */ bmdFormat12BitRAWGRBG = /* 'r12p' */ 0x72313270, // 12-bit RAW data for bayer pattern GRBG bmdFormat12BitRAWJPEG = /* 'r16p' */ 0x72313670 // 12-bit RAW data arranged in tiles and JPEG compressed }; /* Enum BMDDisplayModeFlags - Flags to describe the characteristics of an IDeckLinkDisplayMode. */ typedef uint32_t BMDDisplayModeFlags; enum _BMDDisplayModeFlags { bmdDisplayModeSupports3D = 1 << 0, bmdDisplayModeColorspaceRec601 = 1 << 1, bmdDisplayModeColorspaceRec709 = 1 << 2, bmdDisplayModeColorspaceRec2020 = 1 << 3 }; // Forward Declarations class IDeckLinkDisplayModeIterator; class IDeckLinkDisplayMode; /* Interface IDeckLinkDisplayModeIterator - enumerates over supported input/output display modes. */ class BMD_PUBLIC IDeckLinkDisplayModeIterator : public IUnknown { public: virtual HRESULT Next (/* out */ IDeckLinkDisplayMode **deckLinkDisplayMode) = 0; protected: virtual ~IDeckLinkDisplayModeIterator () {} // call Release method to drop reference count }; /* Interface IDeckLinkDisplayMode - represents a display mode */ class BMD_PUBLIC IDeckLinkDisplayMode : public IUnknown { public: virtual HRESULT GetName (/* out */ const char **name) = 0; virtual BMDDisplayMode GetDisplayMode (void) = 0; virtual long GetWidth (void) = 0; virtual long GetHeight (void) = 0; virtual HRESULT GetFrameRate (/* out */ BMDTimeValue *frameDuration, /* out */ BMDTimeScale *timeScale) = 0; virtual BMDFieldDominance GetFieldDominance (void) = 0; virtual BMDDisplayModeFlags GetFlags (void) = 0; protected: virtual ~IDeckLinkDisplayMode () {} // call Release method to drop reference count }; /* Functions */ extern "C" { } #endif /* defined(BMD_DECKLINKAPIMODES_H) */ nageru-2.3.0/nageru/decklink/DeckLinkAPITypes.h000066400000000000000000000112621450736322200212640ustar00rootroot00000000000000/* -LICENSE-START- ** Copyright (c) 2018 Blackmagic Design ** ** Permission is hereby granted, free of charge, to any person or organization ** obtaining a copy of the software and accompanying documentation covered by ** this license (the "Software") to use, reproduce, display, distribute, ** execute, and transmit the Software, and to prepare derivative works of the ** Software, and to permit third-parties to whom the Software is furnished to ** do so, all subject to the following: ** ** The copyright notices in the Software and this entire statement, including ** the above license grant, this restriction and the following disclaimer, ** must be included in all copies of the Software, in whole or in part, and ** all derivative works of the Software, unless such copies or derivative ** works are solely in the form of machine-executable object code generated by ** a source language processor. ** ** THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR ** IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, ** FITNESS FOR A PARTICULAR PURPOSE, TITLE AND NON-INFRINGEMENT. IN NO EVENT ** SHALL THE COPYRIGHT HOLDERS OR ANYONE DISTRIBUTING THE SOFTWARE BE LIABLE ** FOR ANY DAMAGES OR OTHER LIABILITY, WHETHER IN CONTRACT, TORT OR OTHERWISE, ** ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER ** DEALINGS IN THE SOFTWARE. ** -LICENSE-END- */ #ifndef BMD_DECKLINKAPITYPES_H #define BMD_DECKLINKAPITYPES_H #ifndef BMD_CONST #if defined(_MSC_VER) #define BMD_CONST __declspec(selectany) static const #else #define BMD_CONST static const #endif #endif #ifndef BMD_PUBLIC #define BMD_PUBLIC #endif // Type Declarations typedef int64_t BMDTimeValue; typedef int64_t BMDTimeScale; typedef uint32_t BMDTimecodeBCD; typedef uint32_t BMDTimecodeUserBits; // Interface ID Declarations BMD_CONST REFIID IID_IDeckLinkTimecode = /* BC6CFBD3-8317-4325-AC1C-1216391E9340 */ {0xBC,0x6C,0xFB,0xD3,0x83,0x17,0x43,0x25,0xAC,0x1C,0x12,0x16,0x39,0x1E,0x93,0x40}; /* Enum BMDTimecodeFlags - Timecode flags */ typedef uint32_t BMDTimecodeFlags; enum _BMDTimecodeFlags { bmdTimecodeFlagDefault = 0, bmdTimecodeIsDropFrame = 1 << 0, bmdTimecodeFieldMark = 1 << 1, bmdTimecodeColorFrame = 1 << 2 }; /* Enum BMDVideoConnection - Video connection types */ typedef uint32_t BMDVideoConnection; enum _BMDVideoConnection { bmdVideoConnectionSDI = 1 << 0, bmdVideoConnectionHDMI = 1 << 1, bmdVideoConnectionOpticalSDI = 1 << 2, bmdVideoConnectionComponent = 1 << 3, bmdVideoConnectionComposite = 1 << 4, bmdVideoConnectionSVideo = 1 << 5 }; /* Enum BMDAudioConnection - Audio connection types */ typedef uint32_t BMDAudioConnection; enum _BMDAudioConnection { bmdAudioConnectionEmbedded = 1 << 0, bmdAudioConnectionAESEBU = 1 << 1, bmdAudioConnectionAnalog = 1 << 2, bmdAudioConnectionAnalogXLR = 1 << 3, bmdAudioConnectionAnalogRCA = 1 << 4, bmdAudioConnectionMicrophone = 1 << 5, bmdAudioConnectionHeadphones = 1 << 6 }; /* Enum BMDDeckControlConnection - Deck control connections */ typedef uint32_t BMDDeckControlConnection; enum _BMDDeckControlConnection { bmdDeckControlConnectionRS422Remote1 = 1 << 0, bmdDeckControlConnectionRS422Remote2 = 1 << 1 }; // Forward Declarations class IDeckLinkTimecode; /* Interface IDeckLinkTimecode - Used for video frame timecode representation. */ class BMD_PUBLIC IDeckLinkTimecode : public IUnknown { public: virtual BMDTimecodeBCD GetBCD (void) = 0; virtual HRESULT GetComponents (/* out */ uint8_t *hours, /* out */ uint8_t *minutes, /* out */ uint8_t *seconds, /* out */ uint8_t *frames) = 0; virtual HRESULT GetString (/* out */ const char **timecode) = 0; virtual BMDTimecodeFlags GetFlags (void) = 0; virtual HRESULT GetTimecodeUserBits (/* out */ BMDTimecodeUserBits *userBits) = 0; protected: virtual ~IDeckLinkTimecode () {} // call Release method to drop reference count }; /* Functions */ extern "C" { } #endif /* defined(BMD_DECKLINKAPITYPES_H) */ nageru-2.3.0/nageru/decklink/LinuxCOM.h000066400000000000000000000066331450736322200176650ustar00rootroot00000000000000/* -LICENSE-START- ** Copyright (c) 2009 Blackmagic Design ** ** Permission is hereby granted, free of charge, to any person or organization ** obtaining a copy of the software and accompanying documentation covered by ** this license (the "Software") to use, reproduce, display, distribute, ** execute, and transmit the Software, and to prepare derivative works of the ** Software, and to permit third-parties to whom the Software is furnished to ** do so, all subject to the following: ** ** The copyright notices in the Software and this entire statement, including ** the above license grant, this restriction and the following disclaimer, ** must be included in all copies of the Software, in whole or in part, and ** all derivative works of the Software, unless such copies or derivative ** works are solely in the form of machine-executable object code generated by ** a source language processor. ** ** THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR ** IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, ** FITNESS FOR A PARTICULAR PURPOSE, TITLE AND NON-INFRINGEMENT. IN NO EVENT ** SHALL THE COPYRIGHT HOLDERS OR ANYONE DISTRIBUTING THE SOFTWARE BE LIABLE ** FOR ANY DAMAGES OR OTHER LIABILITY, WHETHER IN CONTRACT, TORT OR OTHERWISE, ** ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER ** DEALINGS IN THE SOFTWARE. ** -LICENSE-END- */ #ifndef __LINUX_COM_H_ #define __LINUX_COM_H_ struct REFIID { unsigned char byte0; unsigned char byte1; unsigned char byte2; unsigned char byte3; unsigned char byte4; unsigned char byte5; unsigned char byte6; unsigned char byte7; unsigned char byte8; unsigned char byte9; unsigned char byte10; unsigned char byte11; unsigned char byte12; unsigned char byte13; unsigned char byte14; unsigned char byte15; }; typedef REFIID CFUUIDBytes; #define CFUUIDGetUUIDBytes(x) x typedef int HRESULT; typedef unsigned long ULONG; typedef void *LPVOID; #define SUCCEEDED(Status) ((HRESULT)(Status) >= 0) #define FAILED(Status) ((HRESULT)(Status)<0) #define IS_ERROR(Status) ((unsigned long)(Status) >> 31 == SEVERITY_ERROR) #define HRESULT_CODE(hr) ((hr) & 0xFFFF) #define HRESULT_FACILITY(hr) (((hr) >> 16) & 0x1fff) #define HRESULT_SEVERITY(hr) (((hr) >> 31) & 0x1) #define SEVERITY_SUCCESS 0 #define SEVERITY_ERROR 1 #define MAKE_HRESULT(sev,fac,code) ((HRESULT) (((unsigned long)(sev)<<31) | ((unsigned long)(fac)<<16) | ((unsigned long)(code))) ) #define S_OK ((HRESULT)0x00000000L) #define S_FALSE ((HRESULT)0x00000001L) #define E_UNEXPECTED ((HRESULT)0x8000FFFFL) #define E_NOTIMPL ((HRESULT)0x80000001L) #define E_OUTOFMEMORY ((HRESULT)0x80000002L) #define E_INVALIDARG ((HRESULT)0x80000003L) #define E_NOINTERFACE ((HRESULT)0x80000004L) #define E_POINTER ((HRESULT)0x80000005L) #define E_HANDLE ((HRESULT)0x80000006L) #define E_ABORT ((HRESULT)0x80000007L) #define E_FAIL ((HRESULT)0x80000008L) #define E_ACCESSDENIED ((HRESULT)0x80000009L) #define STDMETHODCALLTYPE #define IID_IUnknown (REFIID){0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xC0,0x00,0x00,0x00,0x00,0x00,0x00,0x46} #define IUnknownUUID IID_IUnknown #ifndef BMD_PUBLIC #define BMD_PUBLIC #endif #ifdef __cplusplus class BMD_PUBLIC IUnknown { public: virtual HRESULT STDMETHODCALLTYPE QueryInterface(REFIID iid, LPVOID *ppv) = 0; virtual ULONG STDMETHODCALLTYPE AddRef(void) = 0; virtual ULONG STDMETHODCALLTYPE Release(void) = 0; }; #endif #endif nageru-2.3.0/nageru/decklink_capture.cpp000066400000000000000000000314711450736322200203030ustar00rootroot00000000000000#include "decklink_capture.h" #include #include #include #include #include #ifdef __SSE2__ #include #endif #include #include #include #include #include #include #include #include #include #include "bmusb/bmusb.h" #include "decklink_util.h" #include "flags.h" #include "shared/memcpy_interleaved.h" #include "v210_converter.h" using namespace std; using namespace std::chrono; using namespace std::placeholders; using namespace bmusb; namespace { BMDPixelFormat pixel_format_to_bmd(PixelFormat pixel_format) { switch (pixel_format) { case PixelFormat_8BitYCbCr: return bmdFormat8BitYUV; case PixelFormat_10BitYCbCr: return bmdFormat10BitYUV; default: assert(false); } } } // namespace DeckLinkCapture::DeckLinkCapture(IDeckLink *card, int card_index) : card_index(card_index), card(card) { { const char *model_name; char buf[256]; if (card->GetModelName(&model_name) == S_OK) { snprintf(buf, sizeof(buf), "PCI card %d: %s", card_index, model_name); } else { snprintf(buf, sizeof(buf), "PCI card %d: Unknown DeckLink card", card_index); } description = buf; } if (card->QueryInterface(IID_IDeckLinkInput, (void**)&input) != S_OK) { fprintf(stderr, "Card %d has no inputs\n", card_index); abort(); } IDeckLinkAttributes *attr; if (card->QueryInterface(IID_IDeckLinkAttributes, (void**)&attr) != S_OK) { fprintf(stderr, "Card %d has no attributes\n", card_index); abort(); } // Get the list of available video inputs. int64_t video_input_mask; if (attr->GetInt(BMDDeckLinkVideoInputConnections, &video_input_mask) != S_OK) { fprintf(stderr, "Failed to enumerate video inputs for card %d\n", card_index); abort(); } const vector> video_input_types = { { bmdVideoConnectionSDI, "SDI" }, { bmdVideoConnectionHDMI, "HDMI" }, { bmdVideoConnectionOpticalSDI, "Optical SDI" }, { bmdVideoConnectionComponent, "Component" }, { bmdVideoConnectionComposite, "Composite" }, { bmdVideoConnectionSVideo, "S-Video" } }; for (const auto &video_input : video_input_types) { if (video_input_mask & video_input.first) { video_inputs.emplace(video_input.first, video_input.second); } } // And then the available audio inputs. int64_t audio_input_mask; if (attr->GetInt(BMDDeckLinkAudioInputConnections, &audio_input_mask) != S_OK) { fprintf(stderr, "Failed to enumerate audio inputs for card %d\n", card_index); abort(); } const vector> audio_input_types = { { bmdAudioConnectionEmbedded, "Embedded" }, { bmdAudioConnectionAESEBU, "AES/EBU" }, { bmdAudioConnectionAnalog, "Analog" }, { bmdAudioConnectionAnalogXLR, "Analog XLR" }, { bmdAudioConnectionAnalogRCA, "Analog RCA" }, { bmdAudioConnectionMicrophone, "Microphone" }, { bmdAudioConnectionHeadphones, "Headphones" } }; for (const auto &audio_input : audio_input_types) { if (audio_input_mask & audio_input.first) { audio_inputs.emplace(audio_input.first, audio_input.second); } } // Check if we the card supports input autodetection. if (attr->GetFlag(BMDDeckLinkSupportsInputFormatDetection, &supports_autodetect) != S_OK) { fprintf(stderr, "Warning: Failed to ask card %d whether it supports input format autodetection\n", card_index); supports_autodetect = false; } // If there's more than one subdevice on this card, label them. int64_t num_subdevices, subdevice_idx; if (attr->GetInt(BMDDeckLinkNumberOfSubDevices, &num_subdevices) == S_OK && num_subdevices > 1) { if (attr->GetInt(BMDDeckLinkSubDeviceIndex, &subdevice_idx) == S_OK) { char buf[256]; snprintf(buf, sizeof(buf), " (subdevice %d)", int(subdevice_idx)); description += buf; } } attr->Release(); /* Set up the video and audio sources. */ if (card->QueryInterface(IID_IDeckLinkConfiguration, (void**)&config) != S_OK) { fprintf(stderr, "Failed to get configuration interface for card %d\n", card_index); abort(); } BMDVideoConnection connection = pick_default_video_connection(card, BMDDeckLinkVideoInputConnections, card_index); set_video_input(connection); set_audio_input(bmdAudioConnectionEmbedded); IDeckLinkDisplayModeIterator *mode_it; if (input->GetDisplayModeIterator(&mode_it) != S_OK) { fprintf(stderr, "Failed to enumerate display modes for card %d\n", card_index); abort(); } video_modes = summarize_video_modes(mode_it, card_index); mode_it->Release(); set_video_mode_no_restart(bmdModeHD720p5994); input->SetCallback(this); } DeckLinkCapture::~DeckLinkCapture() { if (has_dequeue_callbacks) { dequeue_cleanup_callback(); } input->Release(); config->Release(); card->Release(); } HRESULT STDMETHODCALLTYPE DeckLinkCapture::QueryInterface(REFIID, LPVOID *) { return E_NOINTERFACE; } ULONG STDMETHODCALLTYPE DeckLinkCapture::AddRef(void) { return refcount.fetch_add(1) + 1; } ULONG STDMETHODCALLTYPE DeckLinkCapture::Release(void) { int new_ref = refcount.fetch_sub(1) - 1; if (new_ref == 0) delete this; return new_ref; } HRESULT STDMETHODCALLTYPE DeckLinkCapture::VideoInputFormatChanged( BMDVideoInputFormatChangedEvents, IDeckLinkDisplayMode* display_mode, BMDDetectedVideoInputFormatFlags format_flags) { if (format_flags & bmdDetectedVideoInputRGB444) { fprintf(stderr, "WARNING: Input detected as 4:4:4 RGB, but Nageru can't consume that yet.\n"); fprintf(stderr, "Doing hardware conversion to 4:2:2 Y'CbCr.\n"); } if (supports_autodetect && display_mode->GetDisplayMode() != current_video_mode) { set_video_mode(display_mode->GetDisplayMode()); } if (display_mode->GetFrameRate(&frame_duration, &time_scale) != S_OK) { fprintf(stderr, "Could not get new frame rate\n"); abort(); } field_dominance = display_mode->GetFieldDominance(); return S_OK; } HRESULT STDMETHODCALLTYPE DeckLinkCapture::VideoInputFrameArrived( IDeckLinkVideoInputFrame *video_frame, IDeckLinkAudioInputPacket *audio_frame) { if (!done_init) { char thread_name[16]; snprintf(thread_name, sizeof(thread_name), "DeckLink_C_%d", card_index); pthread_setname_np(pthread_self(), thread_name); sched_param param; memset(¶m, 0, sizeof(param)); param.sched_priority = 1; if (sched_setscheduler(0, SCHED_RR, ¶m) == -1) { printf("couldn't set realtime priority for DeckLink thread: %s\n", strerror(errno)); } if (has_dequeue_callbacks) { dequeue_init_callback(); } done_init = true; } steady_clock::time_point now = steady_clock::now(); FrameAllocator::Frame current_video_frame, current_audio_frame; VideoFormat video_format; AudioFormat audio_format; video_format.frame_rate_nom = time_scale; video_format.frame_rate_den = frame_duration; // TODO: Respect the TFF/BFF flag. video_format.interlaced = (field_dominance == bmdLowerFieldFirst || field_dominance == bmdUpperFieldFirst); video_format.second_field_start = 1; if (video_frame) { video_format.has_signal = !(video_frame->GetFlags() & bmdFrameHasNoInputSource); const int width = video_frame->GetWidth(); const int height = video_frame->GetHeight(); const int stride = video_frame->GetRowBytes(); const BMDPixelFormat format = video_frame->GetPixelFormat(); assert(format == pixel_format_to_bmd(current_pixel_format)); if (global_flags.bit_depth > 8) { assert(stride == int(v210Converter::get_v210_stride(width))); } else { assert(stride == width * 2); } current_video_frame = video_frame_allocator->create_frame(width, height, stride); if (current_video_frame.data != nullptr) { const uint8_t *src; video_frame->GetBytes((void **)&src); size_t num_bytes = stride * height; if (current_video_frame.interleaved) { uint8_t *data = current_video_frame.data; uint8_t *data2 = current_video_frame.data2; memcpy_interleaved(data, data2, src, num_bytes); } else { memcpy(current_video_frame.data, src, num_bytes); } if (current_video_frame.data_copy != nullptr) { memcpy(current_video_frame.data_copy, src, num_bytes); } current_video_frame.len += num_bytes; video_format.width = width; video_format.height = height; video_format.stride = stride; } } if (audio_frame) { int num_samples = audio_frame->GetSampleFrameCount(); current_audio_frame = audio_frame_allocator->alloc_frame(); if (current_audio_frame.data != nullptr) { const uint8_t *src; audio_frame->GetBytes((void **)&src); current_audio_frame.len = sizeof(int32_t) * 8 * num_samples; memcpy(current_audio_frame.data, src, current_audio_frame.len); audio_format.bits_per_sample = 32; audio_format.num_channels = 8; } } current_video_frame.received_timestamp = now; current_audio_frame.received_timestamp = now; if (current_video_frame.data != nullptr || current_audio_frame.data != nullptr) { // TODO: Put into a queue and put into a dequeue thread, if the // BlackMagic drivers don't already do that for us? frame_callback(timecode, current_video_frame, /*video_offset=*/0, video_format, current_audio_frame, /*audio_offset=*/0, audio_format); } timecode++; return S_OK; } void DeckLinkCapture::configure_card() { if (video_frame_allocator == nullptr) { owned_video_frame_allocator.reset(new MallocFrameAllocator(FRAME_SIZE, NUM_QUEUED_VIDEO_FRAMES)); set_video_frame_allocator(owned_video_frame_allocator.get()); } if (audio_frame_allocator == nullptr) { owned_audio_frame_allocator.reset(new MallocFrameAllocator(65536, NUM_QUEUED_AUDIO_FRAMES)); set_audio_frame_allocator(owned_audio_frame_allocator.get()); } } void DeckLinkCapture::start_bm_capture() { if (running) { return; } if (input->EnableVideoInput(current_video_mode, pixel_format_to_bmd(current_pixel_format), supports_autodetect ? bmdVideoInputEnableFormatDetection : 0) != S_OK) { fprintf(stderr, "Failed to set video mode 0x%04x for card %d\n", current_video_mode, card_index); abort(); } if (input->EnableAudioInput(48000, bmdAudioSampleType32bitInteger, 8) != S_OK) { fprintf(stderr, "Failed to enable audio input for card %d\n", card_index); abort(); } if (input->StartStreams() != S_OK) { fprintf(stderr, "StartStreams failed\n"); abort(); } running = true; } void DeckLinkCapture::stop_dequeue_thread() { if (!running) { return; } HRESULT result = input->StopStreams(); if (result != S_OK) { fprintf(stderr, "StopStreams failed with error 0x%x\n", result); abort(); } // We could call DisableVideoInput() and DisableAudioInput() here, // but they seem to be taking a really long time, and we only do this // during shutdown anyway (except when switching to output mode, // where DeckLinkOutput does the disabling), so StopStreams() will suffice. running = false; } void DeckLinkCapture::set_video_mode(uint32_t video_mode_id) { if (running) { if (input->PauseStreams() != S_OK) { fprintf(stderr, "PauseStreams failed\n"); abort(); } if (input->FlushStreams() != S_OK) { fprintf(stderr, "FlushStreams failed\n"); abort(); } } set_video_mode_no_restart(video_mode_id); if (running) { if (input->StartStreams() != S_OK) { fprintf(stderr, "StartStreams failed\n"); abort(); } } } void DeckLinkCapture::set_pixel_format(PixelFormat pixel_format) { current_pixel_format = pixel_format; set_video_mode(current_video_mode); } void DeckLinkCapture::set_video_mode_no_restart(uint32_t video_mode_id) { BMDDisplayModeSupport support; IDeckLinkDisplayMode *display_mode; if (input->DoesSupportVideoMode(video_mode_id, pixel_format_to_bmd(current_pixel_format), /*flags=*/0, &support, &display_mode)) { fprintf(stderr, "Failed to query display mode for card %d\n", card_index); abort(); } if (support == bmdDisplayModeNotSupported) { fprintf(stderr, "Card %d does not support display mode\n", card_index); abort(); } if (display_mode->GetFrameRate(&frame_duration, &time_scale) != S_OK) { fprintf(stderr, "Could not get frame rate for card %d\n", card_index); abort(); } field_dominance = display_mode->GetFieldDominance(); if (running) { if (input->EnableVideoInput(video_mode_id, pixel_format_to_bmd(current_pixel_format), supports_autodetect ? bmdVideoInputEnableFormatDetection : 0) != S_OK) { fprintf(stderr, "Failed to set video mode 0x%04x for card %d\n", video_mode_id, card_index); abort(); } } current_video_mode = video_mode_id; } void DeckLinkCapture::set_video_input(uint32_t video_input_id) { if (config->SetInt(bmdDeckLinkConfigVideoInputConnection, video_input_id) != S_OK) { fprintf(stderr, "Failed to set video input connection for card %d\n", card_index); abort(); } current_video_input = video_input_id; } void DeckLinkCapture::set_audio_input(uint32_t audio_input_id) { if (config->SetInt(bmdDeckLinkConfigAudioInputConnection, audio_input_id) != S_OK) { fprintf(stderr, "Failed to set audio input connection for card %d\n", card_index); abort(); } current_audio_input = audio_input_id; } nageru-2.3.0/nageru/decklink_capture.h000066400000000000000000000115131450736322200177430ustar00rootroot00000000000000#ifndef _DECKLINK_CAPTURE_H #define _DECKLINK_CAPTURE_H 1 #include #include #include #include #include #include #include #include #include "DeckLinkAPIModes.h" #include "DeckLinkAPITypes.h" #include "LinuxCOM.h" #include "bmusb/bmusb.h" class IDeckLink; class IDeckLinkConfiguration; // TODO: Adjust CaptureInterface to be a little less bmusb-centric. // There are too many member functions here that don't really do anything. class DeckLinkCapture : public bmusb::CaptureInterface, IDeckLinkInputCallback { public: DeckLinkCapture(IDeckLink *card, int card_index); // Takes ownership of . ~DeckLinkCapture(); IDeckLinkInput *get_input() const { return input; } // IDeckLinkInputCallback. HRESULT STDMETHODCALLTYPE QueryInterface(REFIID, LPVOID *) override; ULONG STDMETHODCALLTYPE AddRef() override; ULONG STDMETHODCALLTYPE Release() override; HRESULT STDMETHODCALLTYPE VideoInputFormatChanged( BMDVideoInputFormatChangedEvents, IDeckLinkDisplayMode*, BMDDetectedVideoInputFormatFlags) override; HRESULT STDMETHODCALLTYPE VideoInputFrameArrived( IDeckLinkVideoInputFrame *video_frame, IDeckLinkAudioInputPacket *audio_frame) override; // CaptureInterface. void set_video_frame_allocator(bmusb::FrameAllocator *allocator) override { video_frame_allocator = allocator; if (owned_video_frame_allocator.get() != allocator) { owned_video_frame_allocator.reset(); } } bmusb::FrameAllocator *get_video_frame_allocator() override { return video_frame_allocator; } // Does not take ownership. void set_audio_frame_allocator(bmusb::FrameAllocator *allocator) override { audio_frame_allocator = allocator; if (owned_audio_frame_allocator.get() != allocator) { owned_audio_frame_allocator.reset(); } } bmusb::FrameAllocator *get_audio_frame_allocator() override { return audio_frame_allocator; } void set_frame_callback(bmusb::frame_callback_t callback) override { frame_callback = callback; } void set_dequeue_thread_callbacks(std::function init, std::function cleanup) override { dequeue_init_callback = init; dequeue_cleanup_callback = cleanup; has_dequeue_callbacks = true; } std::string get_description() const override { return description; } void configure_card() override; void start_bm_capture() override; void stop_dequeue_thread() override; // TODO: Can the API communicate this to us somehow, for e.g. Thunderbolt cards? bool get_disconnected() const override { return false; } std::map get_available_video_modes() const override { return video_modes; } void set_video_mode(uint32_t video_mode_id) override; uint32_t get_current_video_mode() const override { return current_video_mode; } std::set get_available_pixel_formats() const override { return std::set{ bmusb::PixelFormat_8BitYCbCr, bmusb::PixelFormat_10BitYCbCr }; } void set_pixel_format(bmusb::PixelFormat pixel_format) override; bmusb::PixelFormat get_current_pixel_format() const override { return current_pixel_format; } std::map get_available_video_inputs() const override { return video_inputs; } void set_video_input(uint32_t video_input_id) override; uint32_t get_current_video_input() const override { return current_video_input; } std::map get_available_audio_inputs() const override { return audio_inputs; } void set_audio_input(uint32_t audio_input_id) override; uint32_t get_current_audio_input() const override { return current_audio_input; } private: void set_video_mode_no_restart(uint32_t video_mode_id); std::atomic refcount{1}; bool done_init = false; std::string description; uint16_t timecode = 0; int card_index; bool has_dequeue_callbacks = false; std::function dequeue_init_callback = nullptr; std::function dequeue_cleanup_callback = nullptr; bmusb::FrameAllocator *video_frame_allocator = nullptr; bmusb::FrameAllocator *audio_frame_allocator = nullptr; std::unique_ptr owned_video_frame_allocator; std::unique_ptr owned_audio_frame_allocator; bmusb::frame_callback_t frame_callback = nullptr; IDeckLinkConfiguration *config = nullptr; IDeckLink *card = nullptr; IDeckLinkInput *input = nullptr; BMDTimeValue frame_duration; BMDTimeScale time_scale; BMDFieldDominance field_dominance; bool running = false; bool supports_autodetect = false; std::map video_modes; BMDDisplayMode current_video_mode; bmusb::PixelFormat current_pixel_format = bmusb::PixelFormat_8BitYCbCr; std::map video_inputs; BMDVideoConnection current_video_input; std::map audio_inputs; BMDAudioConnection current_audio_input; }; #endif // !defined(_DECKLINK_CAPTURE_H) nageru-2.3.0/nageru/decklink_output.cpp000066400000000000000000000577161450736322200202120ustar00rootroot00000000000000#include #include #include // Must be above the Xlib includes. #include #include #include #include #include "chroma_subsampler.h" #include "decklink_output.h" #include "decklink_util.h" #include "flags.h" #include "shared/metrics.h" #include "print_latency.h" #include "shared/timebase.h" #include "v210_converter.h" using namespace movit; using namespace std; using namespace std::chrono; namespace { // This class can be deleted during regular use, so make all the metrics static. once_flag decklink_metrics_inited; LatencyHistogram latency_histogram; atomic metric_decklink_output_width_pixels{-1}; atomic metric_decklink_output_height_pixels{-1}; atomic metric_decklink_output_frame_rate_den{-1}; atomic metric_decklink_output_frame_rate_nom{-1}; atomic metric_decklink_output_inflight_frames{0}; atomic metric_decklink_output_color_mismatch_frames{0}; atomic metric_decklink_output_scheduled_frames_dropped{0}; atomic metric_decklink_output_scheduled_frames_late{0}; atomic metric_decklink_output_scheduled_frames_normal{0}; atomic metric_decklink_output_scheduled_frames_preroll{0}; atomic metric_decklink_output_completed_frames_completed{0}; atomic metric_decklink_output_completed_frames_dropped{0}; atomic metric_decklink_output_completed_frames_flushed{0}; atomic metric_decklink_output_completed_frames_late{0}; atomic metric_decklink_output_completed_frames_unknown{0}; atomic metric_decklink_output_scheduled_samples{0}; Summary metric_decklink_output_margin_seconds; } // namespace DeckLinkOutput::DeckLinkOutput(ResourcePool *resource_pool, QSurface *surface, unsigned width, unsigned height, unsigned card_index) : resource_pool(resource_pool), surface(surface), width(width), height(height), card_index(card_index) { chroma_subsampler.reset(new ChromaSubsampler(resource_pool)); call_once(decklink_metrics_inited, [](){ latency_histogram.init("decklink_output"); global_metrics.add("decklink_output_width_pixels", &metric_decklink_output_width_pixels, Metrics::TYPE_GAUGE); global_metrics.add("decklink_output_height_pixels", &metric_decklink_output_height_pixels, Metrics::TYPE_GAUGE); global_metrics.add("decklink_output_frame_rate_den", &metric_decklink_output_frame_rate_den, Metrics::TYPE_GAUGE); global_metrics.add("decklink_output_frame_rate_nom", &metric_decklink_output_frame_rate_nom, Metrics::TYPE_GAUGE); global_metrics.add("decklink_output_inflight_frames", &metric_decklink_output_inflight_frames, Metrics::TYPE_GAUGE); global_metrics.add("decklink_output_color_mismatch_frames", &metric_decklink_output_color_mismatch_frames); global_metrics.add("decklink_output_scheduled_frames", {{ "status", "dropped" }}, &metric_decklink_output_scheduled_frames_dropped); global_metrics.add("decklink_output_scheduled_frames", {{ "status", "late" }}, &metric_decklink_output_scheduled_frames_late); global_metrics.add("decklink_output_scheduled_frames", {{ "status", "normal" }}, &metric_decklink_output_scheduled_frames_normal); global_metrics.add("decklink_output_scheduled_frames", {{ "status", "preroll" }}, &metric_decklink_output_scheduled_frames_preroll); global_metrics.add("decklink_output_completed_frames", {{ "status", "completed" }}, &metric_decklink_output_completed_frames_completed); global_metrics.add("decklink_output_completed_frames", {{ "status", "dropped" }}, &metric_decklink_output_completed_frames_dropped); global_metrics.add("decklink_output_completed_frames", {{ "status", "flushed" }}, &metric_decklink_output_completed_frames_flushed); global_metrics.add("decklink_output_completed_frames", {{ "status", "late" }}, &metric_decklink_output_completed_frames_late); global_metrics.add("decklink_output_completed_frames", {{ "status", "unknown" }}, &metric_decklink_output_completed_frames_unknown); global_metrics.add("decklink_output_scheduled_samples", &metric_decklink_output_scheduled_samples); vector quantiles{0.01, 0.1, 0.25, 0.5, 0.75, 0.9, 0.99}; metric_decklink_output_margin_seconds.init(quantiles, 60.0); global_metrics.add("decklink_output_margin_seconds", &metric_decklink_output_margin_seconds); }); } DeckLinkOutput::~DeckLinkOutput() { if (output != nullptr) { output->Release(); } } bool DeckLinkOutput::set_device(IDeckLink *decklink, IDeckLinkInput *input_arg) { input = input_arg; if (decklink->QueryInterface(IID_IDeckLinkOutput, (void**)&output) != S_OK) { fprintf(stderr, "Warning: Card %u has no outputs\n", card_index); return false; } IDeckLinkDisplayModeIterator *mode_it; if (output->GetDisplayModeIterator(&mode_it) != S_OK) { fprintf(stderr, "Warning: Failed to enumerate output display modes for card %u\n", card_index); return false; } video_modes.clear(); for (const auto &it : summarize_video_modes(mode_it, card_index)) { if (it.second.width != width || it.second.height != height) { continue; } // We could support interlaced modes, but let's stay out of it for now, // since we don't have interlaced stream output. if (it.second.interlaced) { continue; } video_modes.insert(it); } mode_it->Release(); // HDMI or SDI generally mean “both HDMI and SDI at the same time” on DeckLink cards // that support both; pick_default_video_connection() will generally pick one of those // if they exist. (--prefer-hdmi-input would also affect the selection despite the name // of the option, but since either generally means both, it's inconsequential.) // We're not very likely to need analog outputs, so we don't need a way to change // beyond that. video_connection = pick_default_video_connection(decklink, BMDDeckLinkVideoOutputConnections, card_index); return true; } void DeckLinkOutput::start_output(uint32_t mode, int64_t base_pts, bool is_master_card_arg) { assert(output); assert(!playback_initiated); this->is_master_card = is_master_card_arg; if (video_modes.empty()) { fprintf(stderr, "ERROR: No matching output modes for %dx%d found\n", width, height); abort(); } should_quit.unquit(); playback_initiated = true; playback_started = false; this->base_pts = base_pts; IDeckLinkConfiguration *config = nullptr; if (output->QueryInterface(IID_IDeckLinkConfiguration, (void**)&config) != S_OK) { fprintf(stderr, "Failed to get configuration interface for output card\n"); abort(); } if (config->SetFlag(bmdDeckLinkConfigLowLatencyVideoOutput, true) != S_OK) { fprintf(stderr, "Failed to set low latency output\n"); abort(); } if (config->SetInt(bmdDeckLinkConfigVideoOutputConnection, video_connection) != S_OK) { fprintf(stderr, "Failed to set video output connection for card %u\n", card_index); abort(); } if (config->SetFlag(bmdDeckLinkConfigOutput1080pAsPsF, true) != S_OK) { fprintf(stderr, "Failed to set PsF flag for card\n"); abort(); } if (config->SetFlag(bmdDeckLinkConfigSMPTELevelAOutput, true) != S_OK) { // This affects at least some no-name SDI->HDMI converters. // Warn, but don't die. fprintf(stderr, "WARNING: Failed to enable SMTPE Level A; resolutions like 1080p60 might have issues.\n"); } BMDDisplayModeSupport support; IDeckLinkDisplayMode *display_mode; BMDPixelFormat pixel_format = global_flags.bit_depth > 8 ? bmdFormat10BitYUV : bmdFormat8BitYUV; if (output->DoesSupportVideoMode(mode, pixel_format, bmdVideoOutputFlagDefault, &support, &display_mode) != S_OK) { fprintf(stderr, "Couldn't ask for format support\n"); abort(); } if (support == bmdDisplayModeNotSupported) { fprintf(stderr, "Requested display mode not supported\n"); abort(); } current_mode_flags = display_mode->GetFlags(); BMDTimeValue time_value; BMDTimeScale time_scale; if (display_mode->GetFrameRate(&time_value, &time_scale) != S_OK) { fprintf(stderr, "Couldn't get frame rate\n"); abort(); } metric_decklink_output_width_pixels = width; metric_decklink_output_height_pixels = height; metric_decklink_output_frame_rate_nom = time_value; metric_decklink_output_frame_rate_den = time_scale; frame_duration = time_value * TIMEBASE / time_scale; display_mode->Release(); if (input != nullptr) { if (input->DisableVideoInput() != S_OK) { fprintf(stderr, "Warning: Failed to disable video input for card %d\n", card_index); } if (input->DisableAudioInput() != S_OK) { fprintf(stderr, "Warning: Failed to disable audio input for card %d\n", card_index); } } HRESULT result = output->EnableVideoOutput(mode, bmdVideoOutputFlagDefault); if (result != S_OK) { fprintf(stderr, "Couldn't enable output with error 0x%x\n", result); abort(); } if (output->SetScheduledFrameCompletionCallback(this) != S_OK) { fprintf(stderr, "Couldn't set callback\n"); abort(); } assert(OUTPUT_FREQUENCY == 48000); if (output->EnableAudioOutput(bmdAudioSampleRate48kHz, bmdAudioSampleType32bitInteger, 2, bmdAudioOutputStreamTimestamped) != S_OK) { fprintf(stderr, "Couldn't enable audio output\n"); abort(); } if (is_master_card) { if (output->BeginAudioPreroll() != S_OK) { fprintf(stderr, "Couldn't begin audio preroll\n"); abort(); } } else { playback_started = true; } present_thread = thread([this]{ QOpenGLContext *context = create_context(this->surface); eglBindAPI(EGL_OPENGL_API); if (!make_current(context, this->surface)) { printf("display=%p surface=%p context=%p curr=%p err=%d\n", eglGetCurrentDisplay(), this->surface, context, eglGetCurrentContext(), eglGetError()); abort(); } present_thread_func(); delete_context(context); }); } void DeckLinkOutput::end_output() { if (!playback_initiated) { return; } should_quit.quit(); frame_queues_changed.notify_all(); present_thread.join(); playback_initiated = false; if (is_master_card) { output->StopScheduledPlayback(0, nullptr, 0); } output->DisableVideoOutput(); output->DisableAudioOutput(); // Wait until all frames are accounted for, and free them. { unique_lock lock(frame_queue_mutex); while (!(frame_freelist.empty() && scheduled_frames.empty())) { frame_queues_changed.wait(lock, [this]{ return !frame_freelist.empty(); }); frame_freelist.pop(); } } } void DeckLinkOutput::send_frame(GLuint y_tex, GLuint cbcr_tex, YCbCrLumaCoefficients output_ycbcr_coefficients, const vector &input_frames, int64_t pts, int64_t duration) { assert(!should_quit.should_quit()); if ((current_mode_flags & bmdDisplayModeColorspaceRec601) && output_ycbcr_coefficients == YCBCR_REC_709) { if (!last_frame_had_mode_mismatch) { fprintf(stderr, "WARNING: Chosen output mode expects Rec. 601 Y'CbCr coefficients.\n"); fprintf(stderr, " Consider --output-ycbcr-coefficients=rec601 (or =auto).\n"); } last_frame_had_mode_mismatch = true; ++metric_decklink_output_color_mismatch_frames; } else if ((current_mode_flags & bmdDisplayModeColorspaceRec709) && output_ycbcr_coefficients == YCBCR_REC_601) { if (!last_frame_had_mode_mismatch) { fprintf(stderr, "WARNING: Chosen output mode expects Rec. 709 Y'CbCr coefficients.\n"); fprintf(stderr, " Consider --output-ycbcr-coefficients=rec709 (or =auto).\n"); } last_frame_had_mode_mismatch = true; ++metric_decklink_output_color_mismatch_frames; } else { last_frame_had_mode_mismatch = false; } unique_ptr frame = get_frame(); if (global_flags.bit_depth > 8) { chroma_subsampler->create_v210(y_tex, cbcr_tex, width, height, frame->uyvy_tex); } else { chroma_subsampler->create_uyvy(y_tex, cbcr_tex, width, height, frame->uyvy_tex); } // Download the UYVY texture to the PBO. glPixelStorei(GL_PACK_ROW_LENGTH, 0); check_error(); glBindBuffer(GL_PIXEL_PACK_BUFFER, frame->pbo); check_error(); if (global_flags.bit_depth > 8) { glBindTexture(GL_TEXTURE_2D, frame->uyvy_tex); check_error(); glGetTexImage(GL_TEXTURE_2D, 0, GL_RGBA, GL_UNSIGNED_INT_2_10_10_10_REV, BUFFER_OFFSET(0)); check_error(); } else { glBindTexture(GL_TEXTURE_2D, frame->uyvy_tex); check_error(); glGetTexImage(GL_TEXTURE_2D, 0, GL_BGRA, GL_UNSIGNED_INT_8_8_8_8_REV, BUFFER_OFFSET(0)); check_error(); } glBindTexture(GL_TEXTURE_2D, 0); check_error(); glBindBuffer(GL_PIXEL_PACK_BUFFER, 0); check_error(); glMemoryBarrier(GL_TEXTURE_UPDATE_BARRIER_BIT | GL_CLIENT_MAPPED_BUFFER_BARRIER_BIT); check_error(); frame->fence = RefCountedGLsync(GL_SYNC_GPU_COMMANDS_COMPLETE, /*flags=*/0); check_error(); glFlush(); // Make the DeckLink thread see the fence as soon as possible. check_error(); frame->input_frames = input_frames; frame->received_ts = find_received_timestamp(input_frames); frame->pts = pts; frame->duration = duration; { lock_guard lock(frame_queue_mutex); pending_video_frames.push(move(frame)); } frame_queues_changed.notify_all(); } void DeckLinkOutput::send_audio(int64_t pts, const std::vector &samples) { unique_ptr int_samples(new int32_t[samples.size()]); for (size_t i = 0; i < samples.size(); ++i) { int_samples[i] = lrintf(samples[i] * 2147483648.0f); } uint32_t frames_written; HRESULT result; if (is_master_card) { result = output->ScheduleAudioSamples(int_samples.get(), samples.size() / 2, pts, TIMEBASE, &frames_written); } else { result = output->WriteAudioSamplesSync(int_samples.get(), samples.size() / 2, &frames_written); } if (result != S_OK) { fprintf(stderr, "write audio to DeckLink (pts=%" PRId64 ") failed (result=0x%08x)\n", pts, result); } else { // Non-master card is not really synchronized on audio at all, so we don't warn on it. if (frames_written != samples.size() / 2 && is_master_card) { fprintf(stderr, "write audio to DeckLink returned short write (%u/%zu)\n", frames_written, samples.size() / 2); } } metric_decklink_output_scheduled_samples += samples.size() / 2; } void DeckLinkOutput::wait_for_frame(int64_t pts, int *dropped_frames, int64_t *frame_duration, bool *is_preroll, steady_clock::time_point *frame_timestamp) { assert(!should_quit.should_quit()); *dropped_frames = 0; *frame_duration = this->frame_duration; const BMDTimeValue buffer = lrint(*frame_duration * global_flags.output_buffer_frames); const BMDTimeValue max_overshoot = lrint(*frame_duration * global_flags.output_slop_frames); BMDTimeValue target_time = pts - buffer; // While prerolling, we send out frames as quickly as we can. if (target_time < base_pts) { *is_preroll = true; ++metric_decklink_output_scheduled_frames_preroll; return; } *is_preroll = !playback_started; if (!playback_started) { if (output->EndAudioPreroll() != S_OK) { fprintf(stderr, "Could not end audio preroll\n"); abort(); // TODO } if (output->StartScheduledPlayback(base_pts, TIMEBASE, 1.0) != S_OK) { fprintf(stderr, "Could not start playback\n"); abort(); // TODO } playback_started = true; } BMDTimeValue stream_frame_time; double playback_speed; output->GetScheduledStreamTime(TIMEBASE, &stream_frame_time, &playback_speed); *frame_timestamp = steady_clock::now() + nanoseconds((target_time - stream_frame_time) * 1000000000 / TIMEBASE); metric_decklink_output_margin_seconds.count_event( (target_time - stream_frame_time) / double(TIMEBASE)); // If we're ahead of time, wait for the frame to (approximately) start. if (stream_frame_time < target_time) { should_quit.sleep_until(*frame_timestamp); ++metric_decklink_output_scheduled_frames_normal; return; } // If we overshot the previous frame by just a little, // fire off one immediately. if (stream_frame_time < target_time + max_overshoot) { fprintf(stderr, "Warning: Frame was %ld ms late (but not skipping it due to --output-slop-frames).\n", lrint((stream_frame_time - target_time) * 1000.0 / TIMEBASE)); ++metric_decklink_output_scheduled_frames_late; return; } // Oops, we missed by more than one frame. Return immediately, // but drop so that we catch up. *dropped_frames = (stream_frame_time - target_time + *frame_duration - 1) / *frame_duration; const int64_t ns_per_frame = this->frame_duration * 1000000000 / TIMEBASE; *frame_timestamp += nanoseconds(*dropped_frames * ns_per_frame); fprintf(stderr, "Dropped %d output frames; skipping.\n", *dropped_frames); metric_decklink_output_scheduled_frames_dropped += *dropped_frames; ++metric_decklink_output_scheduled_frames_normal; } uint32_t DeckLinkOutput::pick_video_mode(uint32_t mode) const { if (video_modes.count(mode)) { return mode; } // Prioritize 59.94 > 60 > 29.97. If none of those are found, then pick the highest one. for (const pair &desired : vector>{ { 60000, 1001 }, { 60, 1 }, { 30000, 1001 } }) { for (const auto &it : video_modes) { if (it.second.frame_rate_num * desired.second == desired.first * it.second.frame_rate_den) { return it.first; } } } uint32_t best_mode = 0; double best_fps = 0.0; for (const auto &it : video_modes) { double fps = double(it.second.frame_rate_num) / it.second.frame_rate_den; if (fps > best_fps) { best_mode = it.first; best_fps = fps; } } return best_mode; } YCbCrLumaCoefficients DeckLinkOutput::preferred_ycbcr_coefficients() const { if (current_mode_flags & bmdDisplayModeColorspaceRec601) { return YCBCR_REC_601; } else { // Don't bother checking bmdDisplayModeColorspaceRec709; // if none is set, 709 is a good default anyway. return YCBCR_REC_709; } } HRESULT DeckLinkOutput::ScheduledFrameCompleted(/* in */ IDeckLinkVideoFrame *completedFrame, /* in */ BMDOutputFrameCompletionResult result) { Frame *frame = static_cast(completedFrame); switch (result) { case bmdOutputFrameCompleted: ++metric_decklink_output_completed_frames_completed; break; case bmdOutputFrameDisplayedLate: fprintf(stderr, "Output frame displayed late (pts=%" PRId64 ")\n", frame->pts); fprintf(stderr, "Consider increasing --output-buffer-frames if this persists.\n"); ++metric_decklink_output_completed_frames_late; break; case bmdOutputFrameDropped: fprintf(stderr, "Output frame was dropped (pts=%" PRId64 ")\n", frame->pts); fprintf(stderr, "Consider increasing --output-buffer-frames if this persists.\n"); ++metric_decklink_output_completed_frames_dropped; break; case bmdOutputFrameFlushed: fprintf(stderr, "Output frame was flushed (pts=%" PRId64 ")\n", frame->pts); ++metric_decklink_output_completed_frames_flushed; break; default: fprintf(stderr, "Output frame completed with unknown status %d\n", result); ++metric_decklink_output_completed_frames_unknown; break; } static int frameno = 0; print_latency("DeckLink output latency (frame received → output on HDMI):", frame->received_ts, false, &frameno, &latency_histogram); { lock_guard lock(frame_queue_mutex); frame_freelist.push(unique_ptr(frame)); assert(scheduled_frames.count(frame)); scheduled_frames.erase(frame); --metric_decklink_output_inflight_frames; } return S_OK; } HRESULT DeckLinkOutput::ScheduledPlaybackHasStopped() { printf("playback stopped!\n"); return S_OK; } unique_ptr DeckLinkOutput::get_frame() { lock_guard lock(frame_queue_mutex); if (!frame_freelist.empty()) { unique_ptr frame = move(frame_freelist.front()); frame_freelist.pop(); return frame; } unique_ptr frame(new Frame); size_t stride; if (global_flags.bit_depth > 8) { stride = v210Converter::get_v210_stride(width); GLint v210_width = stride / sizeof(uint32_t); frame->uyvy_tex = resource_pool->create_2d_texture(GL_RGB10_A2, v210_width, height); // We need valid texture state, or NVIDIA won't allow us to write to the texture. glBindTexture(GL_TEXTURE_2D, frame->uyvy_tex); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_MIN_FILTER, GL_LINEAR); check_error(); } else { stride = width * 2; frame->uyvy_tex = resource_pool->create_2d_texture(GL_RGBA8, width / 2, height); } glGenBuffers(1, &frame->pbo); check_error(); glBindBuffer(GL_PIXEL_PACK_BUFFER, frame->pbo); check_error(); glBufferStorage(GL_PIXEL_PACK_BUFFER, stride * height, nullptr, GL_MAP_READ_BIT | GL_MAP_PERSISTENT_BIT); check_error(); frame->uyvy_ptr = (uint8_t *)glMapBufferRange(GL_PIXEL_PACK_BUFFER, 0, stride * height, GL_MAP_READ_BIT | GL_MAP_PERSISTENT_BIT); check_error(); frame->uyvy_ptr_local.reset(new uint8_t[stride * height]); frame->resource_pool = resource_pool; return frame; } void DeckLinkOutput::present_thread_func() { pthread_setname_np(pthread_self(), "DeckLinkOutput"); for ( ;; ) { unique_ptr frame; { unique_lock lock(frame_queue_mutex); frame_queues_changed.wait(lock, [this]{ return should_quit.should_quit() || !pending_video_frames.empty(); }); if (should_quit.should_quit()) { return; } frame = move(pending_video_frames.front()); pending_video_frames.pop(); } for ( ;; ) { int err = glClientWaitSync(frame->fence.get(), /*flags=*/0, 0); if (err == GL_TIMEOUT_EXPIRED) { // NVIDIA likes to busy-wait; yield instead. this_thread::sleep_for(milliseconds(1)); } else { break; } } check_error(); frame->fence.reset(); if (global_flags.bit_depth > 8) { memcpy(frame->uyvy_ptr_local.get(), frame->uyvy_ptr, v210Converter::get_v210_stride(width) * height); } else { memcpy(frame->uyvy_ptr_local.get(), frame->uyvy_ptr, width * height * 2); } // Release any input frames we needed to render this frame. frame->input_frames.clear(); if (is_master_card) { BMDTimeValue pts = frame->pts; BMDTimeValue duration = frame->duration; HRESULT res = output->ScheduleVideoFrame(frame.get(), pts, duration, TIMEBASE); lock_guard lock(frame_queue_mutex); if (res == S_OK) { scheduled_frames.insert(frame.release()); // Owned by the driver now. ++metric_decklink_output_inflight_frames; } else { fprintf(stderr, "Could not schedule video frame! (error=0x%08x)\n", res); frame_freelist.push(move(frame)); } } else { HRESULT res = output->DisplayVideoFrameSync(frame.get()); if (res != S_OK) { fprintf(stderr, "Could not schedule video frame! (error=0x%08x)\n", res); } frame_freelist.push(move(frame)); } } } HRESULT STDMETHODCALLTYPE DeckLinkOutput::QueryInterface(REFIID, LPVOID *) { return E_NOINTERFACE; } ULONG STDMETHODCALLTYPE DeckLinkOutput::AddRef() { return refcount.fetch_add(1) + 1; } ULONG STDMETHODCALLTYPE DeckLinkOutput::Release() { int new_ref = refcount.fetch_sub(1) - 1; if (new_ref == 0) delete this; return new_ref; } DeckLinkOutput::Frame::~Frame() { glBindBuffer(GL_PIXEL_PACK_BUFFER, pbo); check_error(); glUnmapBuffer(GL_PIXEL_PACK_BUFFER); check_error(); glBindBuffer(GL_PIXEL_PACK_BUFFER, 0); check_error(); glDeleteBuffers(1, &pbo); check_error(); resource_pool->release_2d_texture(uyvy_tex); check_error(); } HRESULT STDMETHODCALLTYPE DeckLinkOutput::Frame::QueryInterface(REFIID, LPVOID *) { return E_NOINTERFACE; } ULONG STDMETHODCALLTYPE DeckLinkOutput::Frame::AddRef() { return refcount.fetch_add(1) + 1; } ULONG STDMETHODCALLTYPE DeckLinkOutput::Frame::Release() { int new_ref = refcount.fetch_sub(1) - 1; if (new_ref == 0) delete this; return new_ref; } long DeckLinkOutput::Frame::GetWidth() { return global_flags.width; } long DeckLinkOutput::Frame::GetHeight() { return global_flags.height; } long DeckLinkOutput::Frame::GetRowBytes() { if (global_flags.bit_depth > 8) { return v210Converter::get_v210_stride(global_flags.width); } else { return global_flags.width * 2; } } BMDPixelFormat DeckLinkOutput::Frame::GetPixelFormat() { if (global_flags.bit_depth > 8) { return bmdFormat10BitYUV; } else { return bmdFormat8BitYUV; } } BMDFrameFlags DeckLinkOutput::Frame::GetFlags() { return bmdFrameFlagDefault; } HRESULT DeckLinkOutput::Frame::GetBytes(/* out */ void **buffer) { *buffer = uyvy_ptr_local.get(); return S_OK; } HRESULT DeckLinkOutput::Frame::GetTimecode(/* in */ BMDTimecodeFormat format, /* out */ IDeckLinkTimecode **timecode) { fprintf(stderr, "STUB: GetTimecode()\n"); return E_NOTIMPL; } HRESULT DeckLinkOutput::Frame::GetAncillaryData(/* out */ IDeckLinkVideoFrameAncillary **ancillary) { fprintf(stderr, "STUB: GetAncillaryData()\n"); return E_NOTIMPL; } nageru-2.3.0/nageru/decklink_output.h000066400000000000000000000141361450736322200176440ustar00rootroot00000000000000#ifndef _DECKLINK_OUTPUT_H #define _DECKLINK_OUTPUT_H 1 #include #include #include #include #include #include #include #include #include #include #include #include #include #include "DeckLinkAPI.h" #include "DeckLinkAPITypes.h" #include "LinuxCOM.h" #include "shared/context.h" #include "print_latency.h" #include "quittable_sleeper.h" #include "ref_counted_frame.h" #include "shared/ref_counted_gl_sync.h" namespace movit { class ResourcePool; } // namespace movit class ChromaSubsampler; class IDeckLink; class IDeckLinkOutput; class QSurface; class DeckLinkOutput : public IDeckLinkVideoOutputCallback { public: DeckLinkOutput(movit::ResourcePool *resource_pool, QSurface *surface, unsigned width, unsigned height, unsigned card_index); ~DeckLinkOutput(); // The IDecklinkInput argument is to work around a bug // in the 11.7 and newer drivers against older SDKs, // where you get a freeze if querying an IDeckLinkInput interface // on an already-started card. bool set_device(IDeckLink *decklink, IDeckLinkInput *input_arg); void start_output(uint32_t mode, int64_t base_pts, bool is_master_card); // Mode comes from get_available_video_modes(). void end_output(); void send_frame(GLuint y_tex, GLuint cbcr_tex, movit::YCbCrLumaCoefficients ycbcr_coefficients, const std::vector &input_frames, int64_t pts, int64_t duration); void send_audio(int64_t pts, const std::vector &samples); // NOTE: The returned timestamp is undefined for preroll. // Otherwise, it is the timestamp of the output frame as it should have been, // even if we're overshooting. E.g. at 50 fps (0.02 spf), assuming the // last frame was at t=0.980: // // If we're at t=0.999, we wait until t=1.000 and return that. // If we're at t=1.001, we return t=1.000 immediately (small overshoot). // If we're at t=1.055, we drop two frames and return t=1.040 immediately. void wait_for_frame(int64_t pts, int *dropped_frames, int64_t *frame_duration, bool *is_preroll, std::chrono::steady_clock::time_point *frame_timestamp); // Analogous to CaptureInterface. Will only return modes that have the right width/height. std::map get_available_video_modes() const { return video_modes; } // If the given mode is supported, return it. If not, pick some “best” valid mode. uint32_t pick_video_mode(uint32_t mode) const; // Desired Y'CbCr coefficients for the current mode. Undefined before start_output(). movit::YCbCrLumaCoefficients preferred_ycbcr_coefficients() const; // IUnknown. HRESULT STDMETHODCALLTYPE QueryInterface(REFIID iid, LPVOID *ppv) override; ULONG STDMETHODCALLTYPE AddRef() override; ULONG STDMETHODCALLTYPE Release() override; // IDeckLinkVideoOutputCallback. HRESULT ScheduledFrameCompleted(/* in */ IDeckLinkVideoFrame *completedFrame, /* in */ BMDOutputFrameCompletionResult result) override; HRESULT ScheduledPlaybackHasStopped() override; private: struct Frame : public IDeckLinkVideoFrame { public: ~Frame(); // IUnknown. HRESULT STDMETHODCALLTYPE QueryInterface(REFIID iid, LPVOID *ppv) override; ULONG STDMETHODCALLTYPE AddRef() override; ULONG STDMETHODCALLTYPE Release() override; // IDeckLinkVideoFrame. long GetWidth() override; long GetHeight() override; long GetRowBytes() override; BMDPixelFormat GetPixelFormat() override; BMDFrameFlags GetFlags() override; HRESULT GetBytes(/* out */ void **buffer) override; HRESULT GetTimecode(/* in */ BMDTimecodeFormat format, /* out */ IDeckLinkTimecode **timecode) override; HRESULT GetAncillaryData(/* out */ IDeckLinkVideoFrameAncillary **ancillary) override; private: std::atomic refcount{1}; RefCountedGLsync fence; // Needs to be waited on before uyvy_ptr can be read from. std::vector input_frames; // Cannot be released before we are done rendering (ie., is asserted). ReceivedTimestamps received_ts; int64_t pts, duration; movit::ResourcePool *resource_pool; // These members are persistently allocated, and reused when the frame object is. GLuint uyvy_tex; // Owned by . Can also hold v210 data. GLuint pbo; uint8_t *uyvy_ptr; // Persistent mapping into the PBO. // Current Blackmagic drivers (January 2017) have a bug where sending a PBO // pointer to the driver causes a kernel oops. Thus, we do an extra copy into // this pointer before giving the data to the driver. (We don't do a get // directly into this pointer, because e.g. Intel/Mesa hits a slow path when // you do readback into something that's not a PBO.) When Blackmagic fixes // the bug, we should drop this. std::unique_ptr uyvy_ptr_local; friend class DeckLinkOutput; }; std::unique_ptr get_frame(); void create_uyvy(GLuint y_tex, GLuint cbcr_tex, GLuint dst_tex); void present_thread_func(); std::atomic refcount{1}; std::unique_ptr chroma_subsampler; std::map video_modes; std::thread present_thread; QuittableSleeper should_quit; std::mutex frame_queue_mutex; std::queue> pending_video_frames; // Under . std::queue> frame_freelist; // Under . std::unordered_set scheduled_frames; // Owned by the driver, so no unique_ptr. Under . std::condition_variable frame_queues_changed; bool playback_initiated = false, playback_started = false, is_master_card = false; int64_t base_pts, frame_duration; BMDDisplayModeFlags current_mode_flags = 0; bool last_frame_had_mode_mismatch = false; movit::ResourcePool *resource_pool; IDeckLinkInput *input = nullptr; IDeckLinkOutput *output = nullptr; BMDVideoConnection video_connection; QSurface *surface; unsigned width, height; unsigned card_index; GLuint uyvy_vbo; // Holds position and texcoord data. GLuint uyvy_program_num; // Owned by . GLuint uyvy_position_attribute_index, uyvy_texcoord_attribute_index; }; #endif // !defined(_DECKLINK_OUTPUT_H) nageru-2.3.0/nageru/decklink_util.cpp000066400000000000000000000063621450736322200176160ustar00rootroot00000000000000#include #include #include #include "decklink_util.h" #include "flags.h" using namespace bmusb; using namespace std; map summarize_video_modes(IDeckLinkDisplayModeIterator *mode_it, unsigned card_index) { map video_modes; for (IDeckLinkDisplayMode *mode_ptr; mode_it->Next(&mode_ptr) == S_OK; mode_ptr->Release()) { VideoMode mode; const char *mode_name; if (mode_ptr->GetName(&mode_name) != S_OK) { mode.name = "Unknown mode"; } else { mode.name = mode_name; free((char *)mode_name); } mode.autodetect = false; mode.width = mode_ptr->GetWidth(); mode.height = mode_ptr->GetHeight(); BMDTimeScale frame_rate_num; BMDTimeValue frame_rate_den; if (mode_ptr->GetFrameRate(&frame_rate_den, &frame_rate_num) != S_OK) { fprintf(stderr, "Could not get frame rate for mode '%s' on card %d\n", mode.name.c_str(), card_index); abort(); } mode.frame_rate_num = frame_rate_num; mode.frame_rate_den = frame_rate_den; // TODO: Respect the TFF/BFF flag. mode.interlaced = (mode_ptr->GetFieldDominance() == bmdLowerFieldFirst || mode_ptr->GetFieldDominance() == bmdUpperFieldFirst); uint32_t id = mode_ptr->GetDisplayMode(); video_modes.insert(make_pair(id, mode)); } return video_modes; } BMDVideoConnection pick_default_video_connection(IDeckLink *card, BMDDeckLinkAttributeID attribute_id, unsigned card_index) { assert(attribute_id == BMDDeckLinkVideoInputConnections || attribute_id == BMDDeckLinkVideoOutputConnections); IDeckLinkAttributes *attr; if (card->QueryInterface(IID_IDeckLinkAttributes, (void**)&attr) != S_OK) { fprintf(stderr, "Card %u has no attributes\n", card_index); abort(); } int64_t connection_mask; if (attr->GetInt(attribute_id, &connection_mask) != S_OK) { if (attribute_id == BMDDeckLinkVideoInputConnections) { fprintf(stderr, "Failed to enumerate video inputs for card %u\n", card_index); } else { fprintf(stderr, "Failed to enumerate video outputs for card %u\n", card_index); } abort(); } attr->Release(); if (connection_mask == 0) { if (attribute_id == BMDDeckLinkVideoInputConnections) { fprintf(stderr, "Card %u has no input connections\n", card_index); } else { fprintf(stderr, "Card %u has no output connections\n", card_index); } abort(); } if ((connection_mask & bmdVideoConnectionHDMI) && global_flags.default_hdmi_input) { return bmdVideoConnectionHDMI; } else if (connection_mask & bmdVideoConnectionSDI) { return bmdVideoConnectionSDI; } else if (connection_mask & bmdVideoConnectionHDMI) { return bmdVideoConnectionHDMI; } else { // Fallback: Return lowest-set bit, whatever that might be. return connection_mask & (-connection_mask); } } bool decklink_card_is_active(IDeckLink *card, unsigned card_index) { IDeckLinkStatus *status; if (card->QueryInterface(IID_IDeckLinkStatus, (void**)&status) != S_OK) { fprintf(stderr, "Card %u has no status interface\n", card_index); abort(); } int64_t duplex_mode; if (status->GetInt(bmdDeckLinkStatusDuplexMode, &duplex_mode) != S_OK) { fprintf(stderr, "Could not query duplex mode for card %u\n", card_index); abort(); } status->Release(); return (duplex_mode != bmdDuplexStatusInactive); } nageru-2.3.0/nageru/decklink_util.h000066400000000000000000000011221450736322200172500ustar00rootroot00000000000000#ifndef _DECKLINK_UTIL #define _DECKLINK_UTIL 1 #include #include #include "bmusb/bmusb.h" class IDeckLinkDisplayModeIterator; std::map summarize_video_modes(IDeckLinkDisplayModeIterator *mode_it, unsigned card_index); // Picks a video connection that the card supports. Priority list: HDMI, SDI, anything else. BMDVideoConnection pick_default_video_connection(IDeckLink *card, BMDDeckLinkAttributeID attribute_id, unsigned card_index); bool decklink_card_is_active(IDeckLink *card, unsigned card_index); #endif // !defined(_DECKLINK_UTIL) nageru-2.3.0/nageru/defs.h000066400000000000000000000025001450736322200153510ustar00rootroot00000000000000#ifndef _DEFS_H #define _DEFS_H #include #define TYPICAL_FPS 60 #define FAKE_FPS 25 // Must be an integer. // #define MAX_VIDEO_CARDS 16 // defined in shared_defs.h. #define MAX_ALSA_CARDS 16 #define MAX_BUSES 256 // Audio buses. #define FRAME_SIZE (8 << 20) // 8 MB. (FIXME: Not enough for a 2160p frame!) // For deinterlacing. See also comments on InputState. #define FRAME_HISTORY_LENGTH 5 #define AUDIO_OUTPUT_CODEC_NAME "pcm_s32le" #define DEFAULT_AUDIO_OUTPUT_BIT_RATE 0 #define DEFAULT_X264_OUTPUT_BIT_RATE 4500 // 5 Mbit after making room for some audio and TCP overhead. #define DEFAULT_AV1_OUTPUT_BIT_RATE 4500 // Same. #define LOCAL_DUMP_PREFIX "record-" #define LOCAL_DUMP_SUFFIX ".nut" #define DEFAULT_STREAM_MUX_NAME "nut" // Only for HTTP. Local dump guesses from LOCAL_DUMP_SUFFIX. #define DEFAULT_HTTPD_PORT 9095 #define DEFAULT_SRT_PORT 9710 #define DEFAULT_SRT_OUTPUT_LATENCY_MS 2000 #include "shared/shared_defs.h" // In number of frames. Comes in addition to any internal queues in x264 // (frame threading, lookahead, etc.). #define X264_QUEUE_LENGTH 50 #define AV1_QUEUE_LENGTH 50 #define X264_DEFAULT_PRESET "ultrafast" #define X264_DEFAULT_TUNE "film" #define DEFAULT_AV1_PRESET 12 #define DEFAULT_AV1_FPS_NUM 60000 #define DEFAULT_AV1_FPS_DEN 1001 #endif // !defined(_DEFS_H) nageru-2.3.0/nageru/display.ui000066400000000000000000000060251450736322200162710ustar00rootroot00000000000000 Display 0 0 606 433 Form 0 0 0 0 0 1 true QFrame::Box QFrame::Plain 0 3 3 3 3 0 0 1 0 0 24 TextLabel Qt::AlignCenter Set WB GLWidget QWidget

glwidget.h
nageru-2.3.0/nageru/ebu_r128_proc.cc000066400000000000000000000151761450736322200171550ustar00rootroot00000000000000// ------------------------------------------------------------------------ // // Copyright (C) 2010-2011 Fons Adriaensen // // This program is free software; you can redistribute it and/or modify // it under the terms of the GNU General Public License as published by // the Free Software Foundation; either version 2 of the License, or // (at your option) any later version. // // This program is distributed in the hope that it will be useful, // but WITHOUT ANY WARRANTY; without even the implied warranty of // MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the // GNU General Public License for more details. // // You should have received a copy of the GNU General Public License // along with this program; if not, write to the Free Software // Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. // // ------------------------------------------------------------------------ #include "ebu_r128_proc.h" #include #include float Ebu_r128_hist::_bin_power [100] = { 0.0f }; float Ebu_r128_proc::_chan_gain [5] = { 1.0f, 1.0f, 1.0f, 1.41f, 1.41f }; Ebu_r128_hist::Ebu_r128_hist (void) { _histc = new int [751]; initstat (); reset (); } Ebu_r128_hist::~Ebu_r128_hist (void) { delete[] _histc; } void Ebu_r128_hist::reset (void) { memset (_histc, 0, 751 * sizeof (float)); _count = 0; _error = 0; } void Ebu_r128_hist::initstat (void) { int i; if (_bin_power [0]) return; for (i = 0; i < 100; i++) { _bin_power [i] = powf (10.0f, i / 100.0f); } } void Ebu_r128_hist::addpoint (float v) { int k; k = (int) floorf (10 * v + 700.5f); if (k < 0) return; if (k > 750) { k = 750; _error++; } _histc [k]++; _count++; } float Ebu_r128_hist::integrate (int i) { int j, k, n; float s; j = i % 100; n = 0; s = 0; while (i <= 750) { k = _histc [i++]; n += k; s += k * _bin_power [j++]; if (j == 100) { j = 0; s /= 10.0f; } } return s / n; } void Ebu_r128_hist::calc_integ (float *vi, float *th) { int k; float s; if (_count < 50) { *vi = -200.0f; return; } s = integrate (0); // Original threshold was -8 dB below result of first integration // if (th) *th = 10 * log10f (s) - 8.0f; // k = (int)(floorf (100 * log10f (s) + 0.5f)) + 620; // Threshold redefined to -10 dB below result of first integration if (th) *th = 10 * log10f (s) - 10.0f; k = (int)(floorf (100 * log10f (s) + 0.5f)) + 600; if (k < 0) k = 0; s = integrate (k); *vi = 10 * log10f (s); } void Ebu_r128_hist::calc_range (float *v0, float *v1, float *th) { int i, j, k, n; float a, b, s; if (_count < 20) { *v0 = -200.0f; *v1 = -200.0f; return; } s = integrate (0); if (th) *th = 10 * log10f (s) - 20.0f; k = (int)(floorf (100 * log10f (s) + 0.5)) + 500; if (k < 0) k = 0; for (i = k, n = 0; i <= 750; i++) n += _histc [i]; a = 0.10f * n; b = 0.95f * n; for (i = k, s = 0; s < a; i++) s += _histc [i]; for (j = 750, s = n; s > b; j--) s -= _histc [j]; *v0 = (i - 701) / 10.0f; *v1 = (j - 699) / 10.0f; } Ebu_r128_proc::Ebu_r128_proc (void) { _fragm = 0; reset (); } Ebu_r128_proc::~Ebu_r128_proc (void) { } void Ebu_r128_proc::init (int nchan, float fsamp) { _nchan = nchan; _fsamp = fsamp; _fragm = (int) fsamp / 20; detect_init (_fsamp); reset (); } void Ebu_r128_proc::reset (void) { _integr = false; _frcnt = _fragm; _frpwr = 1e-30f; _wrind = 0; _div1 = 0; _div2 = 0; _loudness_M = -200.0f; _loudness_S = -200.0f; memset (_power, 0, 64 * sizeof (float)); integr_reset (); detect_reset (); } void Ebu_r128_proc::integr_reset (void) { _hist_M.reset (); _hist_S.reset (); _maxloudn_M = -200.0f; _maxloudn_S = -200.0f; _integrated = -200.0f; _integ_thr = -200.0f; _range_min = -200.0f; _range_max = -200.0f; _range_thr = -200.0f; _div1 = _div2 = 0; } void Ebu_r128_proc::process (int nfram, float *input []) { int i, k; for (i = 0; i < _nchan; i++) _ipp [i] = input [i]; while (nfram) { k = (_frcnt < nfram) ? _frcnt : nfram; _frpwr += detect_process (k); _frcnt -= k; if (_frcnt == 0) { _power [_wrind++] = _frpwr / _fragm; _frcnt = _fragm; _frpwr = 1e-30f; _wrind &= 63; _loudness_M = addfrags (8); _loudness_S = addfrags (60); if (_loudness_M > _maxloudn_M) _maxloudn_M = _loudness_M; if (_loudness_S > _maxloudn_S) _maxloudn_S = _loudness_S; if (_integr) { if (++_div1 == 2) { _hist_M.addpoint (_loudness_M); _div1 = 0; } if (++_div2 == 10) { _hist_S.addpoint (_loudness_S); _div2 = 0; _hist_M.calc_integ (&_integrated, &_integ_thr); _hist_S.calc_range (&_range_min, &_range_max, &_range_thr); } } } for (i = 0; i < _nchan; i++) _ipp [i] += k; nfram -= k; } } float Ebu_r128_proc::addfrags (int nfrag) { int i, k; float s; s = 0; k = (_wrind - nfrag) & 63; for (i = 0; i < nfrag; i++) s += _power [(i + k) & 63]; return -0.6976f + 10 * log10f (s / nfrag); } void Ebu_r128_proc::detect_init (float fsamp) { float a, b, c, d, r, u1, u2, w1, w2; r = 1 / tan (4712.3890f / fsamp); w1 = r / 1.12201f; w2 = r * 1.12201f; u1 = u2 = 1.4085f + 210.0f / fsamp; a = u1 * w1; b = w1 * w1; c = u2 * w2; d = w2 * w2; r = 1 + a + b; _a0 = (1 + c + d) / r; _a1 = (2 - 2 * d) / r; _a2 = (1 - c + d) / r; _b1 = (2 - 2 * b) / r; _b2 = (1 - a + b) / r; r = 48.0f / fsamp; a = 4.9886075f * r; b = 6.2298014f * r * r; r = 1 + a + b; a *= 2 / r; b *= 4 / r; _c3 = a + b; _c4 = b; r = 1.004995f / r; _a0 *= r; _a1 *= r; _a2 *= r; } void Ebu_r128_proc::detect_reset (void) { for (int i = 0; i < MAXCH; i++) _fst [i].reset (); } float Ebu_r128_proc::detect_process (int nfram) { int i, j; float si, sj; float x, y, z1, z2, z3, z4; float *p; Ebu_r128_fst *S; si = 0; for (i = 0, S = _fst; i < _nchan; i++, S++) { z1 = S->_z1; z2 = S->_z2; z3 = S->_z3; z4 = S->_z4; p = _ipp [i]; sj = 0; for (j = 0; j < nfram; j++) { x = p [j] - _b1 * z1 - _b2 * z2 + 1e-15f; y = _a0 * x + _a1 * z1 + _a2 * z2 - _c3 * z3 - _c4 * z4; z2 = z1; z1 = x; z4 += z3; z3 += y; sj += y * y; } if (_nchan == 1) si = 2 * sj; else si += _chan_gain [i] * sj; S->_z1 = z1; S->_z2 = z2; S->_z3 = z3; S->_z4 = z4; } return si; } nageru-2.3.0/nageru/ebu_r128_proc.h000066400000000000000000000101441450736322200170050ustar00rootroot00000000000000// ------------------------------------------------------------------------ // // Copyright (C) 2010-2011 Fons Adriaensen // // This program is free software; you can redistribute it and/or modify // it under the terms of the GNU General Public License as published by // the Free Software Foundation; either version 2 of the License, or // (at your option) any later version. // // This program is distributed in the hope that it will be useful, // but WITHOUT ANY WARRANTY; without even the implied warranty of // MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the // GNU General Public License for more details. // // You should have received a copy of the GNU General Public License // along with this program; if not, write to the Free Software // Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. // // ------------------------------------------------------------------------ #ifndef __EBU_R128_PROC_H #define __EBU_R128_PROC_H #define MAXCH 5 class Ebu_r128_fst { private: friend class Ebu_r128_proc; void reset (void) { _z1 = _z2 = _z3 = _z4 = 0; } float _z1, _z2, _z3, _z4; }; class Ebu_r128_hist { private: Ebu_r128_hist (void); ~Ebu_r128_hist (void); friend class Ebu_r128_proc; void reset (void); void initstat (void); void addpoint (float v); float integrate (int ind); void calc_integ (float *vi, float *th); void calc_range (float *v0, float *v1, float *th); int *_histc; int _count; int _error; static float _bin_power [100]; }; class Ebu_r128_proc { public: Ebu_r128_proc (void); ~Ebu_r128_proc (void); void init (int nchan, float fsamp); void reset (void); void process (int nfram, float *input []); void integr_reset (void); void integr_pause (void) { _integr = false; } void integr_start (void) { _integr = true; } float loudness_M (void) const { return _loudness_M; } float maxloudn_M (void) const { return _maxloudn_M; } float loudness_S (void) const { return _loudness_S; } float maxloudn_S (void) const { return _maxloudn_S; } float integrated (void) const { return _integrated; } float integ_thr (void) const { return _integ_thr; } float range_min (void) const { return _range_min; } float range_max (void) const { return _range_max; } float range_thr (void) const { return _range_thr; } const int *histogram_M (void) const { return _hist_M._histc; } const int *histogram_S (void) const { return _hist_S._histc; } int hist_M_count (void) const { return _hist_M._count; } int hist_S_count (void) const { return _hist_S._count; } private: float addfrags (int nfrag); void detect_init (float fsamp); void detect_reset (void); float detect_process (int nfram); bool _integr; // Integration on/off. int _nchan; // Number of channels, 2 or 5. float _fsamp; // Sample rate. int _fragm; // Fragmenst size, 1/20 second. int _frcnt; // Number of samples remaining in current fragment. float _frpwr; // Power accumulated for current fragment. float _power [64]; // Array of fragment powers. int _wrind; // Write index into _frpwr int _div1; // M period counter, 200 ms; int _div2; // S period counter, 1s; float _loudness_M; float _maxloudn_M; float _loudness_S; float _maxloudn_S; float _integrated; float _integ_thr; float _range_min; float _range_max; float _range_thr; // Filter coefficients and states. float _a0, _a1, _a2; float _b1, _b2; float _c3, _c4; float *_ipp [MAXCH]; Ebu_r128_fst _fst [MAXCH]; Ebu_r128_hist _hist_M; Ebu_r128_hist _hist_S; // Default channel gains. static float _chan_gain [5]; }; #endif nageru-2.3.0/nageru/ellipsis_label.h000066400000000000000000000011431450736322200174150ustar00rootroot00000000000000#ifndef _ELLIPSIS_LABEL_H #define _ELLIPSIS_LABEL_H 1 #include class EllipsisLabel : public QLabel { Q_OBJECT public: EllipsisLabel(QWidget *parent) : QLabel(parent) {} void setFullText(const QString &s) { full_text = s; updateEllipsisText(); } protected: void resizeEvent(QResizeEvent *event) override { QLabel::resizeEvent(event); updateEllipsisText(); } private: void updateEllipsisText() { QFontMetrics metrics(this->font()); this->setText(metrics.elidedText(full_text, Qt::ElideRight, this->width())); } QString full_text; }; #endif // !defined(_ELLIPSIS_LABEL_H) nageru-2.3.0/nageru/embedded_files.h000066400000000000000000000023671450736322200173560ustar00rootroot00000000000000#ifndef _EMBEDDED_FILES_H #define _EMBEDDED_FILES_H 1 // Files that are embedded into the binary as part of the build process. // They are used as a backup if the files are not available on disk // (which is typically the case if the program is installed, as opposed to // being run during development). #include extern const unsigned char *_binary_cbcr_subsample_vert_data; extern const size_t _binary_cbcr_subsample_vert_size; extern const unsigned char *_binary_cbcr_subsample_frag_data; extern const size_t _binary_cbcr_subsample_frag_size; extern const unsigned char *_binary_uyvy_subsample_vert_data; extern const size_t _binary_uyvy_subsample_vert_size; extern const unsigned char *_binary_uyvy_subsample_frag_data; extern const size_t _binary_uyvy_subsample_frag_size; extern const unsigned char *_binary_v210_subsample_comp_data; extern const size_t _binary_v210_subsample_comp_size; extern const unsigned char *_binary_timecode_vert_data; extern const size_t _binary_timecode_vert_size; extern const unsigned char *_binary_timecode_frag_data; extern const size_t _binary_timecode_frag_size; extern const unsigned char *_binary_timecode_10bit_frag_data; extern const size_t _binary_timecode_10bit_frag_size; #endif // !defined(_EMBEDDED_FILES_H) nageru-2.3.0/nageru/experiments/000077500000000000000000000000001450736322200166255ustar00rootroot00000000000000nageru-2.3.0/nageru/experiments/measure-x264.pl000066400000000000000000000077701450736322200213370ustar00rootroot00000000000000#! /usr/bin/perl # # A script to measure the quality and speed of the x264 presets used in speed control. # use strict; use warnings; use Time::HiRes; my $ssim_mode = 1; my $output_cpp = 1; my $flags = "--bitrate 4000 --frames 1000"; my $override_flags = "--weightp 1 --mbtree --rc-lookahead 20 --b-adapt 1 --bframes 3"; my $file = "elephants_dream_1080p24.y4m"; # https://media.xiph.org/video/derf/y4m/elephants_dream_1080p24.y4m if ($ssim_mode) { # This can be run on a faster machine if you want to. It just measures SSIM; # don't trust the timings, not even which modes are faster than others. # The mode where $output_cpp=0 is just meant as a quick way to test new presets # to see if they are good candidates. $flags .= " --threads 40 --ssim"; $override_flags .= " --tune ssim"; open my $fh, "<", "presets.txt" or die "presets.txt: $!"; my $preset_num = 0; for my $preset (<$fh>) { chomp $preset; my ($ssim, $elapsed) = measure_preset($file, $flags, $override_flags, $preset); if ($output_cpp) { output_cpp($file, $flags, $override_flags, $preset, $ssim, $preset_num++); } else { printf "%sdb %.3f %s\n", $ssim, $elapsed, $preset; } } close $fh; } else { # Actual benchmarking. my $repeat = 1; $flags .= " --threads 4"; open my $fh, "<", "presets.txt" or die "presets.txt: $!"; my $base = undef; for my $preset (<$fh>) { chomp $preset; my $sum_elapsed = 0.0; for my $i (1..$repeat) { my (undef, $elapsed) = measure_preset($file, $flags, $override_flags, $preset); $sum_elapsed += $elapsed; } my $avg = $sum_elapsed / $repeat; $base //= $avg; printf "%.3f %s\n", $avg / $base, $preset; } close $fh; } sub measure_preset { my ($file, $flags, $override_flags, $preset) = @_; my $now = [Time::HiRes::gettimeofday]; my $ssim; open my $x264, "-|", "/usr/bin/x264 $flags $preset $override_flags -o /dev/null $file 2>&1"; for my $line (<$x264>) { $line =~ /SSIM Mean.*\(\s*(\d+\.\d+)db\)/ and $ssim = $1; } close $x264; my $elapsed = Time::HiRes::tv_interval($now); return ($ssim, $elapsed); } sub output_cpp { my ($file, $flags, $override_flags, $preset, $ssim, $preset_num) = @_; unlink("tmp.h264"); system("/usr/bin/x264 $flags $preset $override_flags --frames 1 -o tmp.h264 $file >/dev/null 2>&1"); open my $fh, "<", "tmp.h264" or die "tmp.h264: $!"; my $raw; { local $/ = undef; $raw = <$fh>; } close $fh; $raw =~ /subme=(\d+)/ or die; my $subme = $1; $raw =~ /me=(\S+)/ or die; my $me = "X264_ME_" . uc($1); $raw =~ /ref=(\d+)/ or die; my $refs = $1; $raw =~ /mixed_ref=(\d+)/ or die; my $mix = $1; $raw =~ /trellis=(\d+)/ or die; my $trellis = $1; $raw =~ /analyse=0x[0-9a-f]+:(0x[0-9a-f]+)/ or die; my $partitions_hex = oct($1); my @partitions = (); push @partitions, 'I8' if ($partitions_hex & 0x0002); push @partitions, 'I4' if ($partitions_hex & 0x0001); push @partitions, 'P8' if ($partitions_hex & 0x0010); push @partitions, 'B8' if ($partitions_hex & 0x0100); push @partitions, 'P4' if ($partitions_hex & 0x0020); my $partitions = join('|', @partitions); $raw =~ /direct=(\d+)/ or die; my $direct = $1; $raw =~ /me_range=(\d+)/ or die; my $merange = $1; print "\n"; print "\t// Preset $preset_num: ${ssim}db, $preset\n"; print "\t{ .time= 0.000, .subme=$subme, .me=$me, .refs=$refs, .mix=$mix, .trellis=$trellis, .partitions=$partitions, .direct=$direct, .merange=$merange },\n"; #x264 - core 148 r2705 3f5ed56 - H.264/MPEG-4 AVC codec - Copyleft 2003-2016 - http://www.videolan.org/x264.html - options: cabac=1 ref=3 deblock=1:0:0 analyse=0x3:0x113 me=hex subme=7 psy=1 psy_rd=1.00:0.00 mixed_ref=1 me_range=16 chroma_me=1 trellis=1 8x8dct=1 cqm=0 deadzone=21,11 fast_pskip=1 chroma_qp_offset=-2 threads=34 lookahead_threads=5 sliced_threads=0 nr=0 decimate=1 interlaced=0 bluray_compat=0 constrained_intra=0 bframes=3 b_pyramid=2 b_adapt=1 b_bias=0 direct=1 weightb=1 open_gop=0 weightp=2 keyint=250 keyint_min=24 scenecut=40 intra_refresh=0 rc_lookahead=40 rc=crf mbtree=1 crf=23.0 qcomp=0.60 qpmin=0 qpmax=69 qpstep=4 ip_ratio=1.40 aq=1:1.00 } nageru-2.3.0/nageru/experiments/presets.txt000066400000000000000000000011721450736322200210540ustar00rootroot00000000000000--preset superfast --preset superfast --subme 2 --preset veryfast --preset veryfast --subme 3 --preset veryfast --subme 3 --ref 2 --preset veryfast --subme 4 --ref 2 --preset faster --preset faster --mixed-refs --preset faster --mixed-refs --subme 5 --preset fast --preset fast --subme 7 --preset medium --preset medium --subme 8 --preset medium --subme 8 --trellis 2 --preset medium --subme 8 --trellis 2 --direct auto --preset slow --preset slow --subme 9 --preset slow --subme 9 --me umh --preset slow --subme 9 --me umh --ref 6 --preset slow --subme 9 --me umh --ref 7 --preset slower --preset slower --subme 10 --preset veryslow nageru-2.3.0/nageru/experiments/queue_drop_policy.cpp000066400000000000000000000400301450736322200230550ustar00rootroot00000000000000/* * A program to simulate various queue-drop strategies, using real frame * arrival data as input. Contains various anchors, as well as parametrized * values of the real algorithms that have been used in Nageru over time. * * Expects a log of frame arrivals (in and out). This isn't included in the * git repository because it's quite large, but there's one available * in compressed form at * * https://storage.sesse.net/nageru-latency-log.txt.xz * * The data set in question contains a rather difficult case, with two 50 Hz * clocks slowly drifting from each other (at the rate of about a frame an hour). * This means they are very nearly in sync for a long time, where rare bursts * of jitter can make it hard for the algorithm to find the right level of * conservatism. * * This is not meant to be production-quality code. */ #include #include #include #include #include #include #include #include #include #include #include #include #include using namespace std; size_t max_drops = numeric_limits::max(); size_t max_underruns = numeric_limits::max(); double max_latency_ms = numeric_limits::max(); struct Event { enum { IN, OUT } direction; double t; }; class Queue { public: void add_frame(double t); void get_frame(double now); void drop_frame(); void eval(const string &name); size_t queue_len() const { return frames_in_queue.size(); } bool should_abort() const { return num_underruns > max_underruns || num_drops > max_drops; } private: deque frames_in_queue; size_t num_underruns = 0; size_t num_drops = 0; size_t frames_since_underrun = 0; size_t num_drops_on_first = 0; double latency_sum = 0.0; size_t latency_count = 0; }; void Queue::add_frame(double t) { frames_in_queue.push_back(t); } void Queue::get_frame(double now) { if (frames_in_queue.empty()) { ++num_underruns; frames_since_underrun = 0; return; } double t = frames_in_queue.front(); frames_in_queue.pop_front(); assert(now >= t); latency_sum += (now - t); ++latency_count; ++frames_since_underrun; } void Queue::drop_frame() { assert(!frames_in_queue.empty()); frames_in_queue.pop_front(); ++num_drops; if (frames_since_underrun <= 1) { ++num_drops_on_first; } } void Queue::eval(const string &name) { double latency_ms = 1e3 * latency_sum / latency_count; if (num_underruns > max_underruns) return; if (num_drops > max_drops) return; if (latency_ms > max_latency_ms) return; printf("%-50s: %2lu frames left in queue at end, %5lu underruns, %5lu drops (%5lu immediate), %6.2f ms avg latency\n", name.c_str(), frames_in_queue.size(), num_underruns, num_drops, num_drops_on_first, latency_ms); } // A strategy that never drops; low anchor for drops and underruns, high anchor for latency. void test_nodrop(const vector &events) { Queue q; for (const Event &event : events) { if (event.direction == Event::IN) { q.add_frame(event.t); } else { q.get_frame(event.t); } } q.eval("no-drop"); } // A strategy that accepts only one element in the queue; low anchor for latency. void test_limit_to_1(const vector &events) { Queue q; for (const Event &event : events) { if (event.direction == Event::IN) { q.add_frame(event.t); while (q.queue_len() > 1) q.drop_frame(); } else { q.get_frame(event.t); } } q.eval("limit-to-1"); } // A strategy that accepts one or two elements in the queue. void test_limit_to_2(const vector &events) { Queue q; for (const Event &event : events) { if (event.direction == Event::IN) { q.add_frame(event.t); while (q.queue_len() > 2) q.drop_frame(); } else { q.get_frame(event.t); } } q.eval("limit-to-2"); } // The algorithm used from Nageru 1.2.0 to 1.6.0; raise the ceiling by 1 every time // we underrun, drop it if the ceiling hasn't been needed for 1000 frames. void test_nageru_1_2_0(const vector &events) { Queue q; unsigned safe_queue_length = 1; unsigned frames_with_at_least_one = 0; bool been_at_safe_point_since_last_starvation = false; for (const Event &event : events) { if (event.direction == Event::IN) { q.add_frame(event.t); } else { unsigned queue_length = q.queue_len(); if (queue_length == 0) { // Starvation. if (been_at_safe_point_since_last_starvation /*&& safe_queue_length < unsigned(global_flags.max_input_queue_frames)*/) { ++safe_queue_length; } frames_with_at_least_one = 0; been_at_safe_point_since_last_starvation = false; q.get_frame(event.t); // mark it continue; } if (queue_length >= safe_queue_length) { been_at_safe_point_since_last_starvation = true; } if (++frames_with_at_least_one >= 1000 && safe_queue_length > 1) { --safe_queue_length; frames_with_at_least_one = 0; } while (q.queue_len() > safe_queue_length) { q.drop_frame(); } q.get_frame(event.t); } } q.eval("nageru-1.2.0"); } class Jitter { const double multiplier, alpha; double expected_timestamp = -1.0; double max_jitter_seconds = 0.0; public: Jitter(double multiplier, double alpha) : multiplier(multiplier), alpha(alpha) {} void update(double timestamp, double frame_duration, size_t dropped_frames) { if (expected_timestamp >= 0.0) { expected_timestamp += dropped_frames * frame_duration; double jitter_seconds = fabs(expected_timestamp - timestamp); max_jitter_seconds = max(multiplier * jitter_seconds, alpha * max_jitter_seconds); // About two seconds half-time. // Cap at 100 ms. max_jitter_seconds = min(max_jitter_seconds, 0.1); } expected_timestamp = timestamp + frame_duration; } double get_expected() const { return expected_timestamp; } double get_jitter() const { return max_jitter_seconds; } }; // Keep a running estimate of k times max jitter seen, decreasing by a factor alpha every frame. void test_jitter_filter(const vector &events, double multiplier, double alpha, double margin) { Queue q; Jitter input_jitter(multiplier, alpha); Jitter output_jitter(multiplier, alpha); for (const Event &event : events) { if (event.direction == Event::IN) { input_jitter.update(event.t, 0.020, 0); q.add_frame(event.t); } else { double now = event.t; output_jitter.update(event.t, 0.020, 0); q.get_frame(event.t); double seconds_until_next_frame = max(input_jitter.get_expected() - now + input_jitter.get_jitter(), 0.0); double master_frame_length_seconds = 0.020; seconds_until_next_frame += margin; // Hack. size_t safe_queue_length = max(floor((seconds_until_next_frame + output_jitter.get_jitter()) / master_frame_length_seconds), 0); while (q.queue_len() > safe_queue_length) { q.drop_frame(); } } if (q.should_abort()) return; } char name[256]; snprintf(name, sizeof(name), "jitter-filter[mul=%.1f,alpha=%.4f,margin=%.1f]", multiplier, alpha, 1e3 * margin); q.eval(name); } // Implements an unbalanced binary search tree that can also satisfy order queries // (e.g. “give me the 86th largest entry”). class HistoryJitter { const size_t history_length; const double multiplier, percentile; double expected_timestamp = 0.0; double max_jitter_seconds = 0.0; size_t num_updates = 0; deque history; struct TreeNode { double val; size_t children = 0; unique_ptr left, right; }; unique_ptr root; unique_ptr alloc_cache; // Holds the last freed value, for fast reallocation. TreeNode *alloc_node() { if (alloc_cache == nullptr) { return new TreeNode; } alloc_cache->children = 0; return alloc_cache.release(); } void insert(double val) { if (root == nullptr) { root.reset(alloc_node()); root->val = val; return; } else { insert(root.get(), val); } } void insert(TreeNode *node, double val) { ++node->children; if (val <= node->val) { // Goes into left. if (node->left == nullptr) { node->left.reset(alloc_node()); node->left->val = val; } else { insert(node->left.get(), val); } } else { // Goes into right. if (node->right == nullptr) { node->right.reset(alloc_node()); node->right->val = val; } else { insert(node->right.get(), val); } } } void remove(double val) { assert(root != nullptr); if (root->children == 0) { assert(root->val == val); alloc_cache = move(root); } else { remove(root.get(), val); } } void remove(TreeNode *node, double val) { //printf("Down into %p looking for %f [left=%p right=%p]\n", node, val, node->left.get(), node->right.get()); if (node->val == val) { remove(node); } else if (val < node->val) { assert(node->left != nullptr); --node->children; if (node->left->children == 0) { assert(node->left->val == val); alloc_cache = move(node->left); } else { remove(node->left.get(), val); } } else { assert(node->right != nullptr); --node->children; if (node->right->children == 0) { assert(node->right->val == val); alloc_cache = move(node->right); } else { remove(node->right.get(), val); } } } // Declares a node to be empty, so it should pull up the value of one of its children. // The node must be an interior node (ie., have at least one child). void remove(TreeNode *node) { //printf("Decided that %p must be removed\n", node); assert(node->children > 0); --node->children; bool remove_left; if (node->right == nullptr) { remove_left = true; } else if (node->left == nullptr) { remove_left = false; } else { remove_left = (node->left->children >= node->right->children); } if (remove_left) { if (node->left->children == 0) { node->val = node->left->val; alloc_cache = move(node->left); } else { // Move maximum value up to this node. node->val = elem_at(node->left.get(), node->left->children); remove(node->left.get(), node->val); } } else { if (node->right->children == 0) { node->val = node->right->val; alloc_cache = move(node->right); } else { // Move minimum value up to this node. node->val = elem_at(node->right.get(), 0); remove(node->right.get(), node->val); } } } double elem_at(size_t elem_idx) { return elem_at(root.get(), elem_idx); } double elem_at(TreeNode *node, size_t elem_idx) { //printf("Looking for %lu in node %p [%lu children]\n", elem_idx, node, node->children); assert(node != nullptr); assert(elem_idx <= node->children); if (node->left != nullptr) { if (elem_idx <= node->left->children) { return elem_at(node->left.get(), elem_idx); } else { elem_idx -= node->left->children + 1; } } if (elem_idx == 0) { return node->val; } return elem_at(node->right.get(), elem_idx - 1); } void print_tree(TreeNode *node, size_t indent, double min, double max) { if (node == nullptr) return; if (!(node->val >= min && node->val <= max)) { //printf("node %p is outside range [%f,%f]\n", node, min, max); assert(false); } for (size_t i = 0; i < indent * 2; ++i) putchar(' '); printf("%f [%p, %lu children]\n", node->val, node, node->children); print_tree(node->left.get(), indent + 1, min, node->val); print_tree(node->right.get(), indent + 1, node->val, max); } public: HistoryJitter(size_t history_length, double multiplier, double percentile) : history_length(history_length), multiplier(multiplier), percentile(percentile) {} void update(double timestamp, double frame_duration, size_t dropped_frames) { //if (++num_updates % 1000 == 0) { // printf("%d... [%lu in tree %p]\n", num_updates, root->children + 1, root.get()); //} if (expected_timestamp >= 0.0) { expected_timestamp += dropped_frames * frame_duration; double jitter_seconds = fabs(expected_timestamp - timestamp); history.push_back(jitter_seconds); insert(jitter_seconds); //printf("\nTree %p after insert of %f:\n", root.get(), jitter_seconds); //print_tree(root.get(), 0, -HUGE_VAL, HUGE_VAL); while (history.size() > history_length) { // printf("removing %f, because %p has %lu elements and history has %lu elements\n", history.front(), root.get(), root->children + 1, history.size()); remove(history.front()); history.pop_front(); } size_t elem_idx = lrint(percentile * (history.size() - 1)); // printf("Searching for element %lu in %p, which has %lu elements (history has %lu elements)\n", elem_idx, root.get(), root->children + 1, history.size()); // fflush(stdout); // // Cap at 100 ms. max_jitter_seconds = min(elem_at(elem_idx), 0.1); } expected_timestamp = timestamp + frame_duration; } double get_expected() const { return expected_timestamp; } double get_jitter() const { return max_jitter_seconds * multiplier; } }; void test_jitter_history(const vector &events, size_t history_length, double multiplier, double percentile, double margin) { Queue q; HistoryJitter input_jitter(history_length, multiplier, percentile); HistoryJitter output_jitter(history_length, multiplier, percentile); for (const Event &event : events) { if (event.direction == Event::IN) { input_jitter.update(event.t, 0.020, 0); q.add_frame(event.t); } else { double now = event.t; output_jitter.update(event.t, 0.020, 0); q.get_frame(event.t); double seconds_until_next_frame = max(input_jitter.get_expected() - now + input_jitter.get_jitter(), 0.0); double master_frame_length_seconds = 0.020; seconds_until_next_frame += margin; // Hack. size_t safe_queue_length = max(floor((seconds_until_next_frame + output_jitter.get_jitter()) / master_frame_length_seconds), 0); while (q.queue_len() > safe_queue_length) { q.drop_frame(); } } if (q.should_abort()) return; } char name[256]; snprintf(name, sizeof(name), "history[len=%lu,mul=%.1f,pct=%.4f,margin=%.1f]", history_length, multiplier, percentile, 1e3 * margin); q.eval(name); } int main(int argc, char **argv) { static const option long_options[] = { { "max-drops", required_argument, 0, 'd' }, { "max-underruns", required_argument, 0, 'u' }, { "max-latency-ms", required_argument, 0, 'l' }, { 0, 0, 0, 0 } }; for ( ;; ) { int option_index = 0; int c = getopt_long(argc, argv, "d:u:l:", long_options, &option_index); if (c == -1) { break; } switch (c) { case 'd': max_drops = atof(optarg); break; case 'u': max_underruns = atof(optarg); break; case 'l': max_latency_ms = atof(optarg); break; default: fprintf(stderr, "Usage: simul [--max-drops NUM] [--max-underruns NUM] [--max-latency-ms TIME]\n"); exit(1); } } vector events; const char *filename = (optind < argc) ? argv[optind] : "nageru-latency-log.txt"; FILE *fp = fopen(filename, "r"); if (fp == nullptr) { perror(filename); exit(1); } while (!feof(fp)) { char dir[256]; double t; if (fscanf(fp, "%s %lf", dir, &t) != 2) { break; } if (dir[0] == 'I') { events.push_back(Event{Event::IN, t}); } else if (dir[0] == 'O') { events.push_back(Event{Event::OUT, t}); } else { fprintf(stderr, "ERROR: Unreadable line\n"); exit(1); } } fclose(fp); sort(events.begin(), events.end(), [](const Event &a, const Event &b) { return a.t < b.t; }); test_nodrop(events); test_limit_to_1(events); test_limit_to_2(events); test_nageru_1_2_0(events); for (double multiplier : { 0.0, 0.5, 1.0, 2.0, 3.0, 5.0 }) { for (double alpha : { 0.5, 0.9, 0.99, 0.995, 0.999, 0.9999 }) { for (double margin_ms : { -1.0, 0.0, 1.0, 2.0, 5.0, 10.0, 20.0 }) { test_jitter_filter(events, multiplier, alpha, 1e-3 * margin_ms); } } } for (size_t history_samples : { 10, 100, 500, 1000, 5000, 10000, 25000 }) { for (double multiplier : { 0.5, 1.0, 2.0, 3.0, 5.0, 10.0 }) { for (double percentile : { 0.5, 0.75, 0.9, 0.99, 0.995, 0.999, 1.0 }) { if (lrint(percentile * (history_samples - 1)) == int(history_samples - 1) && percentile != 1.0) { // Redundant. continue; } //for (double margin_ms : { -1.0, 0.0, 1.0, 2.0, 5.0, 10.0, 20.0 }) { for (double margin_ms : { 0.0 }) { test_jitter_history(events, history_samples, multiplier, percentile, 1e-3 * margin_ms); } } } } } nageru-2.3.0/nageru/ffmpeg_capture.cpp000066400000000000000000001252741450736322200177700ustar00rootroot00000000000000#include "ffmpeg_capture.h" #include #include #include #include #include #include #include #include extern "C" { #include #include #include #include #include #include #include #include #include #include } #include #include #include #include #include #include #include #include #include "bmusb/bmusb.h" #include "shared/ffmpeg_raii.h" #include "ffmpeg_util.h" #include "flags.h" #include "image_input.h" #include "ref_counted_frame.h" #include "shared/timebase.h" #ifdef HAVE_SRT #include #endif using namespace std; using namespace std::chrono; using namespace bmusb; using namespace movit; using namespace Eigen; // Avoid deprecation warnings, but we don't want to drop FFmpeg 5.1 support just yet. #if LIBAVUTIL_VERSION_INT >= AV_VERSION_INT(57, 30, 100) #define pkt_duration duration #endif namespace { steady_clock::time_point compute_frame_start(int64_t frame_pts, int64_t pts_origin, const AVRational &video_timebase, const steady_clock::time_point &origin, double rate) { const duration pts((frame_pts - pts_origin) * double(video_timebase.num) / double(video_timebase.den)); return origin + duration_cast(pts / rate); } bool changed_since(const std::string &pathname, const timespec &ts) { if (ts.tv_sec < 0) { return false; } struct stat buf; if (stat(pathname.c_str(), &buf) != 0) { fprintf(stderr, "%s: Couldn't check for new version, leaving the old in place.\n", pathname.c_str()); return false; } return (buf.st_mtim.tv_sec != ts.tv_sec || buf.st_mtim.tv_nsec != ts.tv_nsec); } bool is_full_range(const AVPixFmtDescriptor *desc) { // This is horrible, but there's no better way that I know of. return (strchr(desc->name, 'j') != nullptr); } AVPixelFormat decide_dst_format(AVPixelFormat src_format, bmusb::PixelFormat dst_format_type) { if (dst_format_type == bmusb::PixelFormat_8BitBGRA) { return AV_PIX_FMT_BGRA; } if (dst_format_type == FFmpegCapture::PixelFormat_NV12) { return AV_PIX_FMT_NV12; } assert(dst_format_type == bmusb::PixelFormat_8BitYCbCrPlanar); // If this is a non-Y'CbCr format, just convert to 4:4:4 Y'CbCr // and be done with it. It's too strange to spend a lot of time on. // (Let's hope there's no alpha.) const AVPixFmtDescriptor *src_desc = av_pix_fmt_desc_get(src_format); if (src_desc == nullptr || src_desc->nb_components != 3 || (src_desc->flags & AV_PIX_FMT_FLAG_RGB)) { return AV_PIX_FMT_YUV444P; } // The best for us would be Cb and Cr together if possible, // but FFmpeg doesn't support that except in the special case of // NV12, so we need to go to planar even for the case of NV12. // Thus, look for the closest (but no worse) 8-bit planar Y'CbCr format // that matches in color range. (This will also include the case of // the source format already being acceptable.) bool src_full_range = is_full_range(src_desc); const char *best_format = "yuv444p"; unsigned best_score = numeric_limits::max(); for (const AVPixFmtDescriptor *desc = av_pix_fmt_desc_next(nullptr); desc; desc = av_pix_fmt_desc_next(desc)) { // Find planar Y'CbCr formats only. if (desc->nb_components != 3) continue; if (desc->flags & AV_PIX_FMT_FLAG_RGB) continue; if (!(desc->flags & AV_PIX_FMT_FLAG_PLANAR)) continue; if (desc->comp[0].plane != 0 || desc->comp[1].plane != 1 || desc->comp[2].plane != 2) continue; // 8-bit formats only. if (desc->flags & AV_PIX_FMT_FLAG_BE) continue; if (desc->comp[0].depth != 8) continue; // Same or better chroma resolution only. int chroma_w_diff = src_desc->log2_chroma_w - desc->log2_chroma_w; int chroma_h_diff = src_desc->log2_chroma_h - desc->log2_chroma_h; if (chroma_w_diff < 0 || chroma_h_diff < 0) continue; // Matching full/limited range only. if (is_full_range(desc) != src_full_range) continue; // Pick something with as little excess chroma resolution as possible. unsigned score = (1 << (chroma_w_diff)) << chroma_h_diff; if (score < best_score) { best_score = score; best_format = desc->name; } } return av_get_pix_fmt(best_format); } YCbCrFormat decode_ycbcr_format(const AVPixFmtDescriptor *desc, const AVFrame *frame, bool is_mjpeg, AVColorSpace *last_colorspace, AVChromaLocation *last_chroma_location) { YCbCrFormat format; AVColorSpace colorspace = frame->colorspace; switch (colorspace) { case AVCOL_SPC_BT709: format.luma_coefficients = YCBCR_REC_709; break; case AVCOL_SPC_BT470BG: case AVCOL_SPC_SMPTE170M: case AVCOL_SPC_SMPTE240M: format.luma_coefficients = YCBCR_REC_601; break; case AVCOL_SPC_BT2020_NCL: format.luma_coefficients = YCBCR_REC_2020; break; case AVCOL_SPC_UNSPECIFIED: format.luma_coefficients = (frame->height >= 720 ? YCBCR_REC_709 : YCBCR_REC_601); break; default: if (colorspace != *last_colorspace) { fprintf(stderr, "Unknown Y'CbCr coefficient enum %d from FFmpeg; choosing Rec. 709.\n", colorspace); } format.luma_coefficients = YCBCR_REC_709; break; } *last_colorspace = colorspace; format.full_range = is_full_range(desc); format.num_levels = 1 << desc->comp[0].depth; format.chroma_subsampling_x = 1 << desc->log2_chroma_w; format.chroma_subsampling_y = 1 << desc->log2_chroma_h; switch (frame->chroma_location) { case AVCHROMA_LOC_LEFT: format.cb_x_position = 0.0; format.cb_y_position = 0.5; break; case AVCHROMA_LOC_CENTER: format.cb_x_position = 0.5; format.cb_y_position = 0.5; break; case AVCHROMA_LOC_TOPLEFT: format.cb_x_position = 0.0; format.cb_y_position = 0.0; break; case AVCHROMA_LOC_TOP: format.cb_x_position = 0.5; format.cb_y_position = 0.0; break; case AVCHROMA_LOC_BOTTOMLEFT: format.cb_x_position = 0.0; format.cb_y_position = 1.0; break; case AVCHROMA_LOC_BOTTOM: format.cb_x_position = 0.5; format.cb_y_position = 1.0; break; default: if (frame->chroma_location != *last_chroma_location) { fprintf(stderr, "Unknown chroma location coefficient enum %d from FFmpeg; choosing center.\n", frame->chroma_location); } format.cb_x_position = 0.5; format.cb_y_position = 0.5; break; } *last_chroma_location = frame->chroma_location; if (is_mjpeg && !format.full_range) { // Limited-range MJPEG is only detected by FFmpeg whenever a special // JPEG comment is set, which means that in practice, the stream is // almost certainly generated by Futatabi. Override FFmpeg's forced // MJPEG defaults (it disregards the values set in the mux) with what // Futatabi sets. format.luma_coefficients = YCBCR_REC_709; format.cb_x_position = 0.0; format.cb_y_position = 0.5; } format.cr_x_position = format.cb_x_position; format.cr_y_position = format.cb_y_position; return format; } RGBTriplet get_neutral_color(AVDictionary *metadata) { if (metadata == nullptr) { return RGBTriplet(1.0f, 1.0f, 1.0f); } AVDictionaryEntry *entry = av_dict_get(metadata, "WhitePoint", nullptr, 0); if (entry == nullptr) { return RGBTriplet(1.0f, 1.0f, 1.0f); } unsigned x_nom, x_den, y_nom, y_den; if (sscanf(entry->value, " %u:%u , %u:%u", &x_nom, &x_den, &y_nom, &y_den) != 4) { fprintf(stderr, "WARNING: Unable to parse white point '%s', using default white point\n", entry->value); return RGBTriplet(1.0f, 1.0f, 1.0f); } double x = double(x_nom) / x_den; double y = double(y_nom) / y_den; double z = 1.0 - x - y; Matrix3d rgb_to_xyz_matrix = movit::ColorspaceConversionEffect::get_xyz_matrix(COLORSPACE_sRGB); Vector3d rgb = rgb_to_xyz_matrix.inverse() * Vector3d(x, y, z); return RGBTriplet(rgb[0], rgb[1], rgb[2]); } } // namespace FFmpegCapture::FFmpegCapture(const string &filename, unsigned width, unsigned height) : filename(filename), width(width), height(height), video_timebase{1, 1} { description = "Video: " + filename; last_frame = steady_clock::now(); avformat_network_init(); // In case someone wants this. } #ifdef HAVE_SRT FFmpegCapture::FFmpegCapture(int srt_sock, const string &stream_id) : srt_sock(srt_sock), width(0), // Don't resize; SRT streams typically have stable resolution, and should behave much like regular cards in general. height(0), pixel_format(bmusb::PixelFormat_8BitYCbCrPlanar), video_timebase{1, 1} { if (stream_id.empty()) { description = "SRT stream"; } else { description = stream_id; } play_as_fast_as_possible = true; play_once = true; last_frame = steady_clock::now(); } #endif FFmpegCapture::~FFmpegCapture() { if (has_dequeue_callbacks) { dequeue_cleanup_callback(); } swr_free(&resampler); #ifdef HAVE_SRT if (srt_sock != -1) { srt_close(srt_sock); } #endif } void FFmpegCapture::configure_card() { if (video_frame_allocator == nullptr) { owned_video_frame_allocator.reset(new MallocFrameAllocator(FRAME_SIZE, NUM_QUEUED_VIDEO_FRAMES)); set_video_frame_allocator(owned_video_frame_allocator.get()); } if (audio_frame_allocator == nullptr) { // Audio can come out in pretty large chunks, so increase from the default 1 MB. owned_audio_frame_allocator.reset(new MallocFrameAllocator(1 << 20, NUM_QUEUED_AUDIO_FRAMES)); set_audio_frame_allocator(owned_audio_frame_allocator.get()); } } void FFmpegCapture::start_bm_capture() { if (running) { return; } running = true; producer_thread_should_quit.unquit(); producer_thread = thread(&FFmpegCapture::producer_thread_func, this); } void FFmpegCapture::stop_dequeue_thread() { if (!running) { return; } running = false; producer_thread_should_quit.quit(); producer_thread.join(); } std::map FFmpegCapture::get_available_video_modes() const { // Note: This will never really be shown in the UI. VideoMode mode; char buf[256]; snprintf(buf, sizeof(buf), "%ux%u", sws_last_width, sws_last_height); mode.name = buf; mode.autodetect = false; mode.width = sws_last_width; mode.height = sws_last_height; mode.frame_rate_num = 60; mode.frame_rate_den = 1; mode.interlaced = false; return {{ 0, mode }}; } void FFmpegCapture::producer_thread_func() { char thread_name[16]; snprintf(thread_name, sizeof(thread_name), "FFmpeg_C_%d", card_index); pthread_setname_np(pthread_self(), thread_name); while (!producer_thread_should_quit.should_quit()) { string filename_copy; { lock_guard lock(filename_mu); filename_copy = filename; } string pathname; if (srt_sock == -1) { pathname = search_for_file(filename_copy); } else { pathname = description; } if (pathname.empty()) { send_disconnected_frame(); if (play_once) { break; } producer_thread_should_quit.sleep_for(seconds(1)); fprintf(stderr, "%s not found, sleeping one second and trying again...\n", filename_copy.c_str()); continue; } should_interrupt = false; if (!play_video(pathname)) { // Error. send_disconnected_frame(); if (play_once) { break; } fprintf(stderr, "Error when playing %s, sleeping one second and trying again...\n", pathname.c_str()); producer_thread_should_quit.sleep_for(seconds(1)); continue; } if (play_once) { send_disconnected_frame(); break; } // Probably just EOF, will exit the loop above on next test. } if (has_dequeue_callbacks) { dequeue_cleanup_callback(); has_dequeue_callbacks = false; } } void FFmpegCapture::send_disconnected_frame() { // Send an empty frame to signal that we have no signal anymore. FrameAllocator::Frame video_frame = video_frame_allocator->alloc_frame(); size_t frame_width = width == 0 ? global_flags.width : width; size_t frame_height = height == 0 ? global_flags.height : height; if (video_frame.data) { VideoFormat video_format; video_format.width = frame_width; video_format.height = frame_height; video_format.frame_rate_nom = 60; video_format.frame_rate_den = 1; video_format.is_connected = false; if (pixel_format == bmusb::PixelFormat_8BitBGRA) { video_format.stride = frame_width * 4; video_frame.len = frame_width * frame_height * 4; memset(video_frame.data, 0, video_frame.len); } else { video_format.stride = frame_width; current_frame_ycbcr_format.luma_coefficients = YCBCR_REC_709; current_frame_ycbcr_format.full_range = true; current_frame_ycbcr_format.num_levels = 256; current_frame_ycbcr_format.chroma_subsampling_x = 2; current_frame_ycbcr_format.chroma_subsampling_y = 2; current_frame_ycbcr_format.cb_x_position = 0.0f; current_frame_ycbcr_format.cb_y_position = 0.0f; current_frame_ycbcr_format.cr_x_position = 0.0f; current_frame_ycbcr_format.cr_y_position = 0.0f; video_frame.len = frame_width * frame_height * 2; memset(video_frame.data, 0, frame_width * frame_height); memset(video_frame.data + frame_width * frame_height, 128, frame_width * frame_height); // Valid for both NV12 and planar. } if (frame_callback != nullptr) { frame_callback(-1, AVRational{1, TIMEBASE}, -1, AVRational{1, TIMEBASE}, timecode++, video_frame, /*video_offset=*/0, video_format, FrameAllocator::Frame(), /*audio_offset=*/0, AudioFormat()); } last_frame_was_connected = false; } if (play_once) { disconnected = true; if (card_disconnected_callback != nullptr) { card_disconnected_callback(); } } } template AVPixelFormat get_hw_format(AVCodecContext *ctx, const AVPixelFormat *fmt) { bool found_config_of_right_type = false; for (int i = 0;; ++i) { // Termination condition inside loop. const AVCodecHWConfig *config = avcodec_get_hw_config(ctx->codec, i); if (config == nullptr) { // End of list. break; } if (!(config->methods & AV_CODEC_HW_CONFIG_METHOD_HW_DEVICE_CTX) || config->device_type != type) { // Not interesting for us. continue; } // We have a config of the right type, but does it actually support // the pixel format we want? (Seemingly, FFmpeg's way of signaling errors // is to just replace the pixel format with a software-decoded one, // such as yuv420p.) found_config_of_right_type = true; for (const AVPixelFormat *fmt_ptr = fmt; *fmt_ptr != -1; ++fmt_ptr) { if (config->pix_fmt == *fmt_ptr) { fprintf(stderr, "Initialized '%s' hardware decoding for codec '%s'.\n", av_hwdevice_get_type_name(type), ctx->codec->name); if (ctx->profile == FF_PROFILE_H264_BASELINE) { fprintf(stderr, "WARNING: Stream claims to be H.264 Baseline, which is generally poorly supported in hardware decoders.\n"); fprintf(stderr, " Consider encoding it as Constrained Baseline, Main or High instead.\n"); fprintf(stderr, " Decoding might fail and fall back to software.\n"); } return config->pix_fmt; } } fprintf(stderr, "Decoder '%s' supports only these pixel formats:", ctx->codec->name); unordered_set seen; for (const AVPixelFormat *fmt_ptr = fmt; *fmt_ptr != -1; ++fmt_ptr) { if (!seen.count(*fmt_ptr)) { fprintf(stderr, " %s", av_get_pix_fmt_name(*fmt_ptr)); seen.insert(*fmt_ptr); } } fprintf(stderr, " (wanted %s for hardware acceleration)\n", av_get_pix_fmt_name(config->pix_fmt)); } if (!found_config_of_right_type) { fprintf(stderr, "Decoder '%s' does not support device type '%s'.\n", ctx->codec->name, av_hwdevice_get_type_name(type)); } // We found no VA-API formats, so take the first software format. for (const AVPixelFormat *fmt_ptr = fmt; *fmt_ptr != -1; ++fmt_ptr) { if ((av_pix_fmt_desc_get(*fmt_ptr)->flags & AV_PIX_FMT_FLAG_HWACCEL) == 0) { fprintf(stderr, "Falling back to software format %s.\n", av_get_pix_fmt_name(*fmt_ptr)); return *fmt_ptr; } } // Fallback: Just return anything. (Should never really happen.) return fmt[0]; } bool FFmpegCapture::play_video(const string &pathname) { // Note: Call before open, not after; otherwise, there's a race. // (There is now, too, but it tips the correct way. We could use fstat() // if we had the file descriptor.) timespec last_modified; struct stat buf; if (stat(pathname.c_str(), &buf) != 0) { // Probably some sort of protocol, so can't stat. last_modified.tv_sec = -1; } else { last_modified = buf.st_mtim; } last_colorspace = static_cast(-1); last_chroma_location = static_cast(-1); AVFormatContextWithCloser format_ctx; if (srt_sock == -1) { // Regular file (or stream). frame_timeout_started = steady_clock::now(); frame_timeout_valid = true; format_ctx = avformat_open_input_unique(pathname.c_str(), /*fmt=*/nullptr, /*options=*/nullptr, AVIOInterruptCB{ &FFmpegCapture::interrupt_cb_thunk, this }); frame_timeout_valid = false; } else { #ifdef HAVE_SRT // SRT socket, already opened. const AVInputFormat *mpegts_fmt = av_find_input_format("mpegts"); format_ctx = avformat_open_input_unique(&FFmpegCapture::read_srt_thunk, this, mpegts_fmt, /*options=*/nullptr, AVIOInterruptCB{ &FFmpegCapture::interrupt_cb_thunk, this }); #else assert(false); #endif } if (format_ctx == nullptr) { fprintf(stderr, "%s: Error opening file\n", pathname.c_str()); return false; } if (avformat_find_stream_info(format_ctx.get(), nullptr) < 0) { fprintf(stderr, "%s: Error finding stream info\n", pathname.c_str()); return false; } int video_stream_index = find_stream_index(format_ctx.get(), AVMEDIA_TYPE_VIDEO); if (video_stream_index == -1) { fprintf(stderr, "%s: No video stream found\n", pathname.c_str()); return false; } int audio_stream_index = find_stream_index(format_ctx.get(), AVMEDIA_TYPE_AUDIO); int subtitle_stream_index = find_stream_index(format_ctx.get(), AVMEDIA_TYPE_SUBTITLE); has_last_subtitle = false; // Open video decoder. const AVCodecParameters *video_codecpar = format_ctx->streams[video_stream_index]->codecpar; const AVCodec *video_codec = avcodec_find_decoder(video_codecpar->codec_id); video_timebase = format_ctx->streams[video_stream_index]->time_base; AVCodecContextWithDeleter video_codec_ctx = avcodec_alloc_context3_unique(nullptr); if (avcodec_parameters_to_context(video_codec_ctx.get(), video_codecpar) < 0) { fprintf(stderr, "%s: Cannot fill video codec parameters\n", pathname.c_str()); return false; } if (video_codec == nullptr) { fprintf(stderr, "%s: Cannot find video decoder\n", pathname.c_str()); return false; } // Seemingly, it's not too easy to make something that just initializes // “whatever goes”, so we don't get CUDA or VULKAN or whatever here // without enumerating through several different types. // VA-API and VDPAU will do for now. We prioritize VDPAU for the // simple reason that there's a VA-API-via-VDPAU emulation for NVidia // cards that seems to work, but just hangs when trying to transfer the frame. // // Note that we don't actually check codec support beforehand, // so if you have a low-end VDPAU device but a high-end VA-API device, // you lose out on the extra codec support from the latter. AVBufferRef *hw_device_ctx = nullptr; if (av_hwdevice_ctx_create(&hw_device_ctx, AV_HWDEVICE_TYPE_VDPAU, nullptr, nullptr, 0) >= 0) { video_codec_ctx->hw_device_ctx = av_buffer_ref(hw_device_ctx); video_codec_ctx->get_format = get_hw_format; } else if (av_hwdevice_ctx_create(&hw_device_ctx, AV_HWDEVICE_TYPE_VAAPI, nullptr, nullptr, 0) >= 0) { video_codec_ctx->hw_device_ctx = av_buffer_ref(hw_device_ctx); video_codec_ctx->get_format = get_hw_format; } else { fprintf(stderr, "Failed to initialize VA-API or VDPAU for FFmpeg acceleration. Decoding video in software.\n"); } if (avcodec_open2(video_codec_ctx.get(), video_codec, nullptr) < 0) { fprintf(stderr, "%s: Cannot open video decoder\n", pathname.c_str()); return false; } unique_ptr video_codec_ctx_cleanup( video_codec_ctx.get(), avcodec_close); // Used in decode_ycbcr_format(). is_mjpeg = video_codecpar->codec_id == AV_CODEC_ID_MJPEG; // Open audio decoder, if we have audio. AVCodecContextWithDeleter audio_codec_ctx; if (audio_stream_index != -1) { audio_codec_ctx = avcodec_alloc_context3_unique(nullptr); const AVCodecParameters *audio_codecpar = format_ctx->streams[audio_stream_index]->codecpar; audio_timebase = format_ctx->streams[audio_stream_index]->time_base; if (avcodec_parameters_to_context(audio_codec_ctx.get(), audio_codecpar) < 0) { fprintf(stderr, "%s: Cannot fill audio codec parameters\n", pathname.c_str()); return false; } const AVCodec *audio_codec = avcodec_find_decoder(audio_codecpar->codec_id); if (audio_codec == nullptr) { fprintf(stderr, "%s: Cannot find audio decoder\n", pathname.c_str()); return false; } if (avcodec_open2(audio_codec_ctx.get(), audio_codec, nullptr) < 0) { fprintf(stderr, "%s: Cannot open audio decoder\n", pathname.c_str()); return false; } } unique_ptr audio_codec_ctx_cleanup( audio_codec_ctx.get(), avcodec_close); internal_rewind(); // Main loop. bool first_frame = true; int consecutive_errors = 0; while (!producer_thread_should_quit.should_quit()) { if (process_queued_commands(format_ctx.get(), pathname, last_modified, /*rewound=*/nullptr)) { return true; } if (should_interrupt.load()) { // Check as a failsafe, so that we don't need to rely on avio if we don't have to. return false; } UniqueFrame audio_frame = audio_frame_allocator->alloc_frame(); AudioFormat audio_format; int64_t audio_pts; bool error; frame_timeout_started = steady_clock::now(); frame_timeout_valid = true; AVFrameWithDeleter frame = decode_frame(format_ctx.get(), video_codec_ctx.get(), audio_codec_ctx.get(), pathname, video_stream_index, audio_stream_index, subtitle_stream_index, audio_frame.get(), &audio_format, &audio_pts, &error); frame_timeout_valid = false; if (should_interrupt.load()) { // Abort no matter whether we got a frame or not. return false; } if (error) { if (++consecutive_errors >= 100) { fprintf(stderr, "More than 100 consecutive error video frames, aborting playback.\n"); return false; } else { continue; } } else { consecutive_errors = 0; } if (frame == nullptr) { // EOF. Loop back to the start if we can. if (format_ctx->pb != nullptr && format_ctx->pb->seekable == 0) { // Not seekable (but seemingly, sometimes av_seek_frame() would return 0 anyway, // so don't try). return true; } if (av_seek_frame(format_ctx.get(), /*stream_index=*/-1, /*timestamp=*/0, /*flags=*/0) < 0) { fprintf(stderr, "%s: Rewind failed, not looping.\n", pathname.c_str()); return true; } if (video_codec_ctx != nullptr) { avcodec_flush_buffers(video_codec_ctx.get()); } if (audio_codec_ctx != nullptr) { avcodec_flush_buffers(audio_codec_ctx.get()); } // If the file has changed since last time, return to get it reloaded. // Note that depending on how you move the file into place, you might // end up corrupting the one you're already playing, so this path // might not trigger. if (changed_since(pathname, last_modified)) { return true; } internal_rewind(); continue; } VideoFormat video_format = construct_video_format(frame.get(), video_timebase); if (video_format.frame_rate_nom == 0 || video_format.frame_rate_den == 0) { // Invalid frame rate; try constructing it from the previous frame length. // (This is especially important if we are the master card, for SRT, // since it affects audio. Not all senders have good timebases // (e.g., Larix rounds first to timebase 1000 and then multiplies by // 90 from there, it seems), but it's much better to have an oscillating // value than just locking at 60. if (last_pts != 0 && frame->pts > last_pts) { int64_t pts_diff = frame->pts - last_pts; video_format.frame_rate_nom = video_timebase.den; video_format.frame_rate_den = video_timebase.num * pts_diff; } else { video_format.frame_rate_nom = 60; video_format.frame_rate_den = 1; } } UniqueFrame video_frame = make_video_frame(frame.get(), pathname, &error); if (error) { return false; } for ( ;; ) { if (last_pts == 0 && pts_origin == 0) { pts_origin = frame->pts; } steady_clock::time_point now = steady_clock::now(); if (play_as_fast_as_possible) { video_frame->received_timestamp = now; audio_frame->received_timestamp = now; next_frame_start = now; } else { next_frame_start = compute_frame_start(frame->pts, pts_origin, video_timebase, start, rate); if (first_frame && last_frame_was_connected) { // If reconnect took more than one second, this is probably a live feed, // and we should reset the resampler. (Or the rate is really, really low, // in which case a reset on the first frame is fine anyway.) if (duration(next_frame_start - last_frame).count() >= 1.0) { last_frame_was_connected = false; } } video_frame->received_timestamp = next_frame_start; // The easiest way to get all the rate conversions etc. right is to move the // audio PTS into the video PTS timebase and go from there. (We'll get some // rounding issues, but they should not be a big problem.) int64_t audio_pts_as_video_pts = av_rescale_q(audio_pts, audio_timebase, video_timebase); audio_frame->received_timestamp = compute_frame_start(audio_pts_as_video_pts, pts_origin, video_timebase, start, rate); if (audio_frame->len != 0) { // The received timestamps in Nageru are measured after we've just received the frame. // However, pts (especially audio pts) is at the _beginning_ of the frame. // If we have locked audio, the distinction doesn't really matter, as pts is // on a relative scale and a fixed offset is fine. But if we don't, we will have // a different number of samples each time, which will cause huge audio jitter // and throw off the resampler. // // In a sense, we should have compensated by adding the frame and audio lengths // to video_frame->received_timestamp and audio_frame->received_timestamp respectively, // but that would mean extra waiting in sleep_until(). All we need is that they // are correct relative to each other, though (and to the other frames we send), // so just align the end of the audio frame, and we're fine. size_t num_samples = (audio_frame->len * 8) / audio_format.bits_per_sample / audio_format.num_channels; double offset = double(num_samples) / OUTPUT_FREQUENCY - double(video_format.frame_rate_den) / video_format.frame_rate_nom; audio_frame->received_timestamp += duration_cast(duration(offset)); } if (duration(now - next_frame_start).count() >= 0.1) { // If we don't have enough CPU to keep up, or if we have a live stream // where the initial origin was somehow wrong, we could be behind indefinitely. // In particular, this will give the audio resampler problems as it tries // to speed up to reduce the delay, hitting the low end of the buffer every time. fprintf(stderr, "%s: Playback %.0f ms behind, resetting time scale\n", pathname.c_str(), 1e3 * duration(now - next_frame_start).count()); pts_origin = frame->pts; start = next_frame_start = now; timecode += TYPICAL_FPS * 2 + 1; } } bool finished_wakeup; if (play_as_fast_as_possible) { finished_wakeup = !producer_thread_should_quit.should_quit(); } else { finished_wakeup = producer_thread_should_quit.sleep_until(next_frame_start); } if (finished_wakeup) { if (audio_frame->len > 0) { assert(audio_pts != -1); } if (!last_frame_was_connected) { // We're recovering from an error (or really slow load, see above). // Make sure to get the audio resampler reset. (This is a hack; // ideally, the frame callback should just accept a way to signal // audio discontinuity.) timecode += TYPICAL_FPS * 2 + 1; } last_neutral_color = get_neutral_color(frame->metadata); if (frame_callback != nullptr) { frame_callback(frame->pts, video_timebase, audio_pts, audio_timebase, timecode++, video_frame.get_and_release(), 0, video_format, audio_frame.get_and_release(), 0, audio_format); } first_frame = false; last_frame = steady_clock::now(); last_frame_was_connected = true; break; } else { if (producer_thread_should_quit.should_quit()) break; bool rewound = false; if (process_queued_commands(format_ctx.get(), pathname, last_modified, &rewound)) { return true; } // If we just rewound, drop this frame on the floor and be done. if (rewound) { break; } // OK, we didn't, so probably a rate change. Recalculate next_frame_start, // but if it's now in the past, we'll reset the origin, so that we don't // generate a huge backlog of frames that we need to run through quickly. next_frame_start = compute_frame_start(frame->pts, pts_origin, video_timebase, start, rate); steady_clock::time_point now = steady_clock::now(); if (next_frame_start < now) { pts_origin = frame->pts; start = next_frame_start = now; } } } last_pts = frame->pts; } return true; } void FFmpegCapture::internal_rewind() { pts_origin = last_pts = 0; start = next_frame_start = steady_clock::now(); } bool FFmpegCapture::process_queued_commands(AVFormatContext *format_ctx, const std::string &pathname, timespec last_modified, bool *rewound) { // Process any queued commands from other threads. vector commands; { lock_guard lock(queue_mu); swap(commands, command_queue); } for (const QueuedCommand &cmd : commands) { switch (cmd.command) { case QueuedCommand::REWIND: if (av_seek_frame(format_ctx, /*stream_index=*/-1, /*timestamp=*/0, /*flags=*/0) < 0) { fprintf(stderr, "%s: Rewind failed, stopping play.\n", pathname.c_str()); } // If the file has changed since last time, return to get it reloaded. // Note that depending on how you move the file into place, you might // end up corrupting the one you're already playing, so this path // might not trigger. if (changed_since(pathname, last_modified)) { return true; } internal_rewind(); if (rewound != nullptr) { *rewound = true; } break; case QueuedCommand::CHANGE_RATE: // Change the origin to the last played frame. start = compute_frame_start(last_pts, pts_origin, video_timebase, start, rate); pts_origin = last_pts; rate = cmd.new_rate; play_as_fast_as_possible = (rate >= 10.0); break; } } return false; } namespace { } // namespace AVFrameWithDeleter FFmpegCapture::decode_frame(AVFormatContext *format_ctx, AVCodecContext *video_codec_ctx, AVCodecContext *audio_codec_ctx, const std::string &pathname, int video_stream_index, int audio_stream_index, int subtitle_stream_index, FrameAllocator::Frame *audio_frame, AudioFormat *audio_format, int64_t *audio_pts, bool *error) { *error = false; // Read packets until we have a frame or there are none left. bool frame_finished = false; AVFrameWithDeleter audio_avframe = av_frame_alloc_unique(); AVFrameWithDeleter video_avframe = av_frame_alloc_unique(); bool eof = false; *audio_pts = -1; bool has_audio = false; do { AVPacketWithDeleter pkt = av_packet_alloc_unique(); pkt->data = nullptr; pkt->size = 0; if (av_read_frame(format_ctx, pkt.get()) == 0) { if (pkt->stream_index == audio_stream_index && audio_callback != nullptr) { audio_callback(pkt.get(), format_ctx->streams[audio_stream_index]->time_base); } if (pkt->stream_index == video_stream_index && video_callback != nullptr) { video_callback(pkt.get(), format_ctx->streams[video_stream_index]->time_base); } if (pkt->stream_index == video_stream_index && global_flags.transcode_video) { if (avcodec_send_packet(video_codec_ctx, pkt.get()) < 0) { fprintf(stderr, "%s: Cannot send packet to video codec.\n", pathname.c_str()); *error = true; return AVFrameWithDeleter(nullptr); } } else if (pkt->stream_index == audio_stream_index && global_flags.transcode_audio) { has_audio = true; if (avcodec_send_packet(audio_codec_ctx, pkt.get()) < 0) { fprintf(stderr, "%s: Cannot send packet to audio codec.\n", pathname.c_str()); *error = true; return AVFrameWithDeleter(nullptr); } } else if (pkt->stream_index == subtitle_stream_index) { last_subtitle = string(reinterpret_cast(pkt->data), pkt->size); has_last_subtitle = true; } } else { eof = true; // Or error, but ignore that for the time being. } // Decode audio, if any. if (has_audio) { for ( ;; ) { int err = avcodec_receive_frame(audio_codec_ctx, audio_avframe.get()); if (err == 0) { if (*audio_pts == -1) { *audio_pts = audio_avframe->pts; } convert_audio(audio_avframe.get(), audio_frame, audio_format); } else if (err == AVERROR(EAGAIN)) { break; } else { fprintf(stderr, "%s: Cannot receive frame from audio codec.\n", pathname.c_str()); *error = true; return AVFrameWithDeleter(nullptr); } } } // Decode video, if we have a frame. int err = avcodec_receive_frame(video_codec_ctx, video_avframe.get()); if (err == 0) { if (video_avframe->format == AV_PIX_FMT_VAAPI || video_avframe->format == AV_PIX_FMT_VDPAU) { // Get the frame down to the CPU. (TODO: See if we can keep it // on the GPU all the way, since it will be going up again later. // However, this only works if the OpenGL GPU is the same one.) AVFrameWithDeleter sw_frame = av_frame_alloc_unique(); int err = av_hwframe_transfer_data(sw_frame.get(), video_avframe.get(), 0); if (err != 0) { fprintf(stderr, "%s: Cannot transfer hardware video frame to software.\n", pathname.c_str()); *error = true; return AVFrameWithDeleter(nullptr); } sw_frame->pts = video_avframe->pts; sw_frame->pkt_duration = video_avframe->pkt_duration; video_avframe = move(sw_frame); } frame_finished = true; break; } else if (err != AVERROR(EAGAIN)) { fprintf(stderr, "%s: Cannot receive frame from video codec.\n", pathname.c_str()); *error = true; return AVFrameWithDeleter(nullptr); } } while (!eof); if (frame_finished) return video_avframe; else return AVFrameWithDeleter(nullptr); } void FFmpegCapture::convert_audio(const AVFrame *audio_avframe, FrameAllocator::Frame *audio_frame, AudioFormat *audio_format) { // Decide on a format. If there already is one in this audio frame, // we're pretty much forced to use it. If not, we try to find an exact match. // If that still doesn't work, we default to 32-bit signed chunked // (float would be nice, but there's really no way to signal that yet). AVSampleFormat dst_format; if (audio_format->bits_per_sample == 0) { switch (audio_avframe->format) { case AV_SAMPLE_FMT_S16: case AV_SAMPLE_FMT_S16P: audio_format->bits_per_sample = 16; dst_format = AV_SAMPLE_FMT_S16; break; case AV_SAMPLE_FMT_S32: case AV_SAMPLE_FMT_S32P: default: audio_format->bits_per_sample = 32; dst_format = AV_SAMPLE_FMT_S32; break; } } else if (audio_format->bits_per_sample == 16) { dst_format = AV_SAMPLE_FMT_S16; } else if (audio_format->bits_per_sample == 32) { dst_format = AV_SAMPLE_FMT_S32; } else { assert(false); } audio_format->num_channels = 2; AVChannelLayout channel_layout = audio_avframe->ch_layout; if (!av_channel_layout_check(&channel_layout) || channel_layout.order == AV_CHANNEL_ORDER_UNSPEC) { av_channel_layout_default(&channel_layout, audio_avframe->ch_layout.nb_channels); } if (resampler == nullptr || audio_avframe->format != last_src_format || dst_format != last_dst_format || av_channel_layout_compare(&channel_layout, &last_channel_layout) != 0|| audio_avframe->sample_rate != last_sample_rate) { // TODO: When we get C++20, use AV_CHANNEL_LAYOUT_STEREO_DOWNMIX. AVChannelLayout stereo_downmix; stereo_downmix.order = AV_CHANNEL_ORDER_NATIVE; stereo_downmix.nb_channels = 2; stereo_downmix.u.mask = AV_CH_LAYOUT_STEREO_DOWNMIX; swr_free(&resampler); resampler = nullptr; int err = swr_alloc_set_opts2(&resampler, /*out_ch_layout=*/&stereo_downmix, /*out_sample_fmt=*/dst_format, /*out_sample_rate=*/OUTPUT_FREQUENCY, /*in_ch_layout=*/&channel_layout, /*in_sample_fmt=*/AVSampleFormat(audio_avframe->format), /*in_sample_rate=*/audio_avframe->sample_rate, /*log_offset=*/0, /*log_ctx=*/nullptr); if (err != 0 || resampler == nullptr) { fprintf(stderr, "Allocating resampler failed.\n"); abort(); } if (swr_init(resampler) < 0) { fprintf(stderr, "Could not open resample context.\n"); abort(); } last_src_format = AVSampleFormat(audio_avframe->format); last_dst_format = dst_format; last_channel_layout = channel_layout; last_sample_rate = audio_avframe->sample_rate; } size_t bytes_per_sample = (audio_format->bits_per_sample / 8) * 2; size_t num_samples_room = (audio_frame->size - audio_frame->len) / bytes_per_sample; uint8_t *data = audio_frame->data + audio_frame->len; int out_samples = swr_convert(resampler, &data, num_samples_room, const_cast(audio_avframe->data), audio_avframe->nb_samples); if (out_samples < 0) { fprintf(stderr, "Audio conversion failed.\n"); abort(); } audio_frame->len += out_samples * bytes_per_sample; } VideoFormat FFmpegCapture::construct_video_format(const AVFrame *frame, AVRational video_timebase) { VideoFormat video_format; video_format.width = frame_width(frame); video_format.height = frame_height(frame); if (pixel_format == bmusb::PixelFormat_8BitBGRA) { video_format.stride = frame_width(frame) * 4; } else if (pixel_format == FFmpegCapture::PixelFormat_NV12) { video_format.stride = frame_width(frame); } else { assert(pixel_format == bmusb::PixelFormat_8BitYCbCrPlanar); video_format.stride = frame_width(frame); } video_format.frame_rate_nom = video_timebase.den; video_format.frame_rate_den = frame->pkt_duration * video_timebase.num; video_format.has_signal = true; video_format.is_connected = true; return video_format; } UniqueFrame FFmpegCapture::make_video_frame(const AVFrame *frame, const string &pathname, bool *error) { *error = false; UniqueFrame video_frame(video_frame_allocator->alloc_frame()); if (video_frame->data == nullptr) { return video_frame; } if (sws_ctx == nullptr || sws_last_width != frame->width || sws_last_height != frame->height || sws_last_src_format != frame->format) { sws_dst_format = decide_dst_format(AVPixelFormat(frame->format), pixel_format); sws_ctx.reset( sws_getContext(frame->width, frame->height, AVPixelFormat(frame->format), frame_width(frame), frame_height(frame), sws_dst_format, SWS_BICUBIC, nullptr, nullptr, nullptr)); sws_last_width = frame->width; sws_last_height = frame->height; sws_last_src_format = frame->format; } if (sws_ctx == nullptr) { fprintf(stderr, "%s: Could not create scaler context\n", pathname.c_str()); *error = true; return video_frame; } uint8_t *pic_data[4] = { nullptr, nullptr, nullptr, nullptr }; int linesizes[4] = { 0, 0, 0, 0 }; if (pixel_format == bmusb::PixelFormat_8BitBGRA) { pic_data[0] = video_frame->data; linesizes[0] = frame_width(frame) * 4; video_frame->len = (frame_width(frame) * 4) * frame_height(frame); } else if (pixel_format == PixelFormat_NV12) { pic_data[0] = video_frame->data; linesizes[0] = frame_width(frame); pic_data[1] = pic_data[0] + frame_width(frame) * frame_height(frame); linesizes[1] = frame_width(frame); video_frame->len = (frame_width(frame) * 2) * frame_height(frame); const AVPixFmtDescriptor *desc = av_pix_fmt_desc_get(sws_dst_format); current_frame_ycbcr_format = decode_ycbcr_format(desc, frame, is_mjpeg, &last_colorspace, &last_chroma_location); } else { assert(pixel_format == bmusb::PixelFormat_8BitYCbCrPlanar); const AVPixFmtDescriptor *desc = av_pix_fmt_desc_get(sws_dst_format); int chroma_width = AV_CEIL_RSHIFT(int(frame_width(frame)), desc->log2_chroma_w); int chroma_height = AV_CEIL_RSHIFT(int(frame_height(frame)), desc->log2_chroma_h); pic_data[0] = video_frame->data; linesizes[0] = frame_width(frame); pic_data[1] = pic_data[0] + frame_width(frame) * frame_height(frame); linesizes[1] = chroma_width; pic_data[2] = pic_data[1] + chroma_width * chroma_height; linesizes[2] = chroma_width; video_frame->len = frame_width(frame) * frame_height(frame) + 2 * chroma_width * chroma_height; current_frame_ycbcr_format = decode_ycbcr_format(desc, frame, is_mjpeg, &last_colorspace, &last_chroma_location); } // FIXME: Currently, if the video is too high-res for one of the allocated // frames, we simply refuse to scale it here to avoid crashes. It would be better // if we could somehow signal getting larger frames, especially as 4K is a thing now. if (video_frame->len > FRAME_SIZE) { fprintf(stderr, "%s: Decoded frame would be larger than supported FRAME_SIZE (%zu > %u), not decoding.\n", pathname.c_str(), video_frame->len, FRAME_SIZE); *error = true; return video_frame; } sws_scale(sws_ctx.get(), frame->data, frame->linesize, 0, frame->height, pic_data, linesizes); return video_frame; } int FFmpegCapture::interrupt_cb_thunk(void *opaque) { return reinterpret_cast(opaque)->interrupt_cb(); } int FFmpegCapture::interrupt_cb() { // If ten seconds is gone without anything happening, we assume that // we are in a network stream that died and FFmpeg just didn't // pick it up (or perhaps it just hung, keeping the connection open). // Called back approximately every 100 ms if something is hanging, // so we get more than enough accuracy for our purposes. if (!should_interrupt && frame_timeout_valid && duration(steady_clock::now() - frame_timeout_started).count() >= 10.0) { string filename_copy; { lock_guard lock(filename_mu); filename_copy = filename; } fprintf(stderr, "%s: No frame for more than 10 seconds, restarting stream.\n", filename.c_str()); should_interrupt = true; } return should_interrupt.load(); } unsigned FFmpegCapture::frame_width(const AVFrame *frame) const { if (width == 0) { return frame->width; } else { return width; } } unsigned FFmpegCapture::frame_height(const AVFrame *frame) const { if (height == 0) { return frame->height; } else { return height; } } #ifdef HAVE_SRT int FFmpegCapture::read_srt_thunk(void *opaque, uint8_t *buf, int buf_size) { return reinterpret_cast(opaque)->read_srt(buf, buf_size); } int FFmpegCapture::read_srt(uint8_t *buf, int buf_size) { SRT_MSGCTRL mc = srt_msgctrl_default; return srt_recvmsg2(srt_sock, reinterpret_cast(buf), buf_size, &mc); } #endif nageru-2.3.0/nageru/ffmpeg_capture.h000066400000000000000000000273061450736322200174320ustar00rootroot00000000000000#ifndef _FFMPEG_CAPTURE_H #define _FFMPEG_CAPTURE_H 1 // FFmpegCapture looks much like a capture card, but the frames it spits out // come from a video in real time, looping. Because it decodes the video using // FFmpeg (thus the name), this means it can handle a very wide array of video // formats, and also things like network streaming and V4L capture, but it is // also significantly less integrated and optimized than the regular capture // cards. In particular, the frames are always scaled and converted to 8-bit // RGBA on the CPU before being sent on to the GPU. // // Since we don't really know much about the video when building the chains, // there are some limitations. In particular, frames are always assumed to be // sRGB even if the video container says something else. We could probably // try to load the video on startup and pick out the parameters at that point, // but it would require some more plumbing, and it would also fail if the file // changes parameters midway, which is allowed in some formats. // // You can get out the audio either as decoded or in raw form (Kaeru uses this). // // If there's a subtitle track, you can also get out the last subtitle at the // point of the frame. Note that once we get a video frame, we don't look for // subtitle, so if subtitles and a frame comes at the same time, you might not // see the subtitle until the next frame. #include #include #include #include #include #include #include #include #include #include #include extern "C" { #include #include #include #include #include } #include "bmusb/bmusb.h" #include "shared/ffmpeg_raii.h" #include "ref_counted_frame.h" #include "quittable_sleeper.h" struct AVFormatContext; struct AVFrame; struct AVRational; struct AVPacket; class FFmpegCapture : public bmusb::CaptureInterface { public: FFmpegCapture(const std::string &filename, unsigned width, unsigned height); #ifdef HAVE_SRT // Takes ownership of the SRT client socket. FFmpegCapture(int srt_sock, const std::string &stream_id); #endif ~FFmpegCapture(); void set_card_index(int card_index) { this->card_index = card_index; } int get_card_index() const { return card_index; } void rewind() { std::lock_guard lock(queue_mu); command_queue.push_back(QueuedCommand { QueuedCommand::REWIND }); producer_thread_should_quit.wakeup(); } void change_rate(double new_rate) { std::lock_guard lock(queue_mu); command_queue.push_back(QueuedCommand { QueuedCommand::CHANGE_RATE, new_rate }); producer_thread_should_quit.wakeup(); } std::string get_filename() const { std::lock_guard lock(filename_mu); return filename; } void change_filename(const std::string &new_filename) { std::lock_guard lock(filename_mu); filename = new_filename; should_interrupt = true; } // Will stop the stream even if it's hung on blocking I/O. void disconnect() { should_interrupt = true; } // CaptureInterface. void set_video_frame_allocator(bmusb::FrameAllocator *allocator) override { video_frame_allocator = allocator; if (owned_video_frame_allocator.get() != allocator) { owned_video_frame_allocator.reset(); } } bmusb::FrameAllocator *get_video_frame_allocator() override { return video_frame_allocator; } // Does not take ownership. void set_audio_frame_allocator(bmusb::FrameAllocator *allocator) override { audio_frame_allocator = allocator; if (owned_audio_frame_allocator.get() != allocator) { owned_audio_frame_allocator.reset(); } } bmusb::FrameAllocator *get_audio_frame_allocator() override { return audio_frame_allocator; } // FFmpegCapture-specific overload of set_frame_callback that also gives // the raw original pts from the video. Negative pts means a dummy frame. typedef std::function frame_callback_t; void set_frame_callback(frame_callback_t callback) { frame_callback = callback; } void set_frame_callback(bmusb::frame_callback_t callback) override { frame_callback = std::bind( callback, std::placeholders::_5, std::placeholders::_6, std::placeholders::_7, std::placeholders::_8, std::placeholders::_9, std::placeholders::_10, std::placeholders::_11); } // FFmpegCapture-specific callback that gives the raw audio/video. typedef std::function packet_callback_t; void set_video_callback(packet_callback_t callback) { video_callback = callback; } void set_audio_callback(packet_callback_t callback) { audio_callback = callback; } // Used to get precise information about the Y'CbCr format used // for a given frame. Only valid to call during the frame callback, // and only when receiving a frame with pixel format PixelFormat_8BitYCbCrPlanar. movit::YCbCrFormat get_current_frame_ycbcr_format() const { return current_frame_ycbcr_format; } // Only valid to call during the frame callback. std::string get_last_subtitle() const { return last_subtitle; } // Same. bool get_has_last_subtitle() const { return has_last_subtitle; } // Same. movit::RGBTriplet get_last_neutral_color() const { return last_neutral_color; } void set_dequeue_thread_callbacks(std::function init, std::function cleanup) override { dequeue_init_callback = init; dequeue_cleanup_callback = cleanup; has_dequeue_callbacks = true; } void set_card_disconnected_callback(bmusb::card_disconnected_callback_t callback) { card_disconnected_callback = callback; } std::string get_description() const override { return description; } void configure_card() override; void start_bm_capture() override; void stop_dequeue_thread() override; bool get_disconnected() const override { return disconnected; } // Only if play_once == true. int get_srt_sock() const { return srt_sock; } std::map get_available_video_modes() const override; void set_video_mode(uint32_t video_mode_id) override {} // Ignore. uint32_t get_current_video_mode() const override { return 0; } static constexpr bmusb::PixelFormat PixelFormat_NV12 = static_cast(100); // In the private range. std::set get_available_pixel_formats() const override { return std::set{ bmusb::PixelFormat_8BitBGRA, bmusb::PixelFormat_8BitYCbCrPlanar, PixelFormat_NV12 }; } void set_pixel_format(bmusb::PixelFormat pixel_format) override { this->pixel_format = pixel_format; } bmusb::PixelFormat get_current_pixel_format() const override { return pixel_format; } std::map get_available_video_inputs() const override { return { { 0, "Auto" } }; } void set_video_input(uint32_t video_input_id) override {} // Ignore. uint32_t get_current_video_input() const override { return 0; } std::map get_available_audio_inputs() const override { return { { 0, "Embedded" } }; } void set_audio_input(uint32_t audio_input_id) override {} // Ignore. uint32_t get_current_audio_input() const override { return 0; } private: void producer_thread_func(); void send_disconnected_frame(); bool play_video(const std::string &pathname); void internal_rewind(); // Returns true if there was an error. bool process_queued_commands(AVFormatContext *format_ctx, const std::string &pathname, timespec last_modified, bool *rewound); // Returns nullptr if no frame was decoded (e.g. EOF). AVFrameWithDeleter decode_frame(AVFormatContext *format_ctx, AVCodecContext *video_codec_ctx, AVCodecContext *audio_codec_ctx, const std::string &pathname, int video_stream_index, int audio_stream_index, int subtitle_stream_index, bmusb::FrameAllocator::Frame *audio_frame, bmusb::AudioFormat *audio_format, int64_t *audio_pts, bool *error); void convert_audio(const AVFrame *audio_avframe, bmusb::FrameAllocator::Frame *audio_frame, bmusb::AudioFormat *audio_format); bmusb::VideoFormat construct_video_format(const AVFrame *frame, AVRational video_timebase); UniqueFrame make_video_frame(const AVFrame *frame, const std::string &pathname, bool *error); static int interrupt_cb_thunk(void *opaque); int interrupt_cb(); #ifdef HAVE_SRT static int read_srt_thunk(void *opaque, uint8_t *buf, int buf_size); int read_srt(uint8_t *buf, int buf_size); #endif inline unsigned frame_width(const AVFrame *frame) const; inline unsigned frame_height(const AVFrame *frame) const; mutable std::mutex filename_mu; std::string description, filename; int srt_sock = -1; uint16_t timecode = 0; unsigned width, height; // 0 means keep input size. bmusb::PixelFormat pixel_format = bmusb::PixelFormat_8BitBGRA; movit::YCbCrFormat current_frame_ycbcr_format; bool running = false; int card_index = -1; double rate = 1.0; bool play_as_fast_as_possible = false; // Activated iff rate >= 10.0. std::atomic should_interrupt{false}; bool last_frame_was_connected = true; // TODO: Replace with std::optional if we go C++17. bool frame_timeout_valid = false; // If true, will time out any reads after ten seconds. std::chrono::steady_clock::time_point frame_timeout_started; // Only relevant if frame_timeout_valid == true. bool has_dequeue_callbacks = false; std::function dequeue_init_callback = nullptr; std::function dequeue_cleanup_callback = nullptr; bmusb::card_disconnected_callback_t card_disconnected_callback = nullptr; bool play_once = false; // End thread after playing. Only for SRT, since the socket is ephemeral. std::atomic disconnected{false}; bmusb::FrameAllocator *video_frame_allocator = nullptr; bmusb::FrameAllocator *audio_frame_allocator = nullptr; std::unique_ptr owned_video_frame_allocator; std::unique_ptr owned_audio_frame_allocator; frame_callback_t frame_callback = nullptr; packet_callback_t video_callback = nullptr; packet_callback_t audio_callback = nullptr; SwsContextWithDeleter sws_ctx; int sws_last_width = -1, sws_last_height = -1, sws_last_src_format = -1; AVPixelFormat sws_dst_format = AVPixelFormat(-1); // In practice, always initialized. AVRational video_timebase, audio_timebase; bool is_mjpeg = false; QuittableSleeper producer_thread_should_quit; std::thread producer_thread; int64_t pts_origin, last_pts; std::chrono::steady_clock::time_point start, next_frame_start, last_frame; std::mutex queue_mu; struct QueuedCommand { enum Command { REWIND, CHANGE_RATE } command; double new_rate; // For CHANGE_RATE. }; std::vector command_queue; // Protected by . // Audio resampler. SwrContext *resampler = nullptr; AVSampleFormat last_src_format, last_dst_format; AVChannelLayout last_channel_layout; int last_sample_rate; // Subtitles (no decoding done, really). bool has_last_subtitle = false; std::string last_subtitle; movit::RGBTriplet last_neutral_color{1.0f, 1.0f, 1.0f}; // Used for suppressing repeated warnings. Reset when a video starts playing. // -1 is strictly speaking outside the range of the enum, but hopefully, it will be alright. AVColorSpace last_colorspace = static_cast(-1); AVChromaLocation last_chroma_location = static_cast(-1); }; #endif // !defined(_FFMPEG_CAPTURE_H) nageru-2.3.0/nageru/ffmpeg_util.cpp000066400000000000000000000033441450736322200172730ustar00rootroot00000000000000#include "ffmpeg_util.h" #include #include #include #include #include #include "flags.h" using namespace std; string search_for_file(const string &filename) { if (!filename.empty() && filename[0] == '/') { // Absolute path. return filename; } // See if we match ^[a-z]:/, which is probably a URL of some sort // (FFmpeg understands various forms of these). for (size_t i = 0; i < filename.size() - 1; ++i) { if (filename[i] == ':' && filename[i + 1] == '/') { return filename; } if (!isalpha(filename[i])) { break; } } // Look for the file in all theme_dirs until we find one; // that will be the permanent resolution of this file, whether // it is actually valid or not. // We store errors from all the attempts, and show them // once we know we can't find any of them. vector errors; for (const string &dir : global_flags.theme_dirs) { string pathname = dir + "/" + filename; if (access(pathname.c_str(), O_RDONLY) == 0) { return pathname; } else { char buf[512]; snprintf(buf, sizeof(buf), "%s: %s", pathname.c_str(), strerror(errno)); errors.push_back(buf); } } for (const string &error : errors) { fprintf(stderr, "%s\n", error.c_str()); } return ""; } string search_for_file_or_die(const string &filename) { string pathname = search_for_file(filename); if (pathname.empty()) { fprintf(stderr, "Couldn't find %s in any directory in --theme-dirs, exiting.\n", filename.c_str()); abort(); } return pathname; } int find_stream_index(AVFormatContext *ctx, AVMediaType media_type) { for (unsigned i = 0; i < ctx->nb_streams; ++i) { if (ctx->streams[i]->codecpar->codec_type == media_type) { return i; } } return -1; } nageru-2.3.0/nageru/ffmpeg_util.h000066400000000000000000000012441450736322200167350ustar00rootroot00000000000000#ifndef _FFMPEG_UTIL_H #define _FFMPEG_UTIL_H 1 // Some common utilities for the two FFmpeg users (ImageInput and FFmpegCapture). #include extern "C" { #include } // Look for the file in all theme_dirs until we find one; // that will be the permanent resolution of this file, whether // it is actually valid or not. Returns an empty string on error. std::string search_for_file(const std::string &filename); // Same, but exits on error. std::string search_for_file_or_die(const std::string &filename); // Returns -1 if not found. int find_stream_index(AVFormatContext *ctx, AVMediaType media_type); #endif // !defined(_FFMPEG_UTIL_H) nageru-2.3.0/nageru/filter.cpp000066400000000000000000000235071450736322200162620ustar00rootroot00000000000000#include #include #include #include #include #include #include "defs.h" #ifdef __SSE__ #include #endif #include "filter.h" using namespace std; #ifdef __SSE__ // For SSE, we set the denormals-as-zero flag instead. #define early_undenormalise(sample) #else // !defined(__SSE__) union uint_float { float f; unsigned int i; }; #define early_undenormalise(sample) { \ uint_float uf; \ uf.f = float(sample); \ if ((uf.i&0x60000000)==0) sample=0.0f; \ } #endif // !_defined(__SSE__) Filter::Filter() { omega = M_PI; resonance = 0.01f; A = 1.0f; init(FILTER_NONE, 1); update(); } void Filter::update() { /* uses coefficients grabbed from RBJs audio eq cookbook: http://www.musicdsp.org/files/Audio-EQ-Cookbook.txt */ float sn, cs; float cutoff_freq = omega; cutoff_freq = min(cutoff_freq, (float)M_PI); cutoff_freq = max(cutoff_freq, 0.001f); calcSinCos(cutoff_freq, &sn, &cs); if (resonance <= 0) resonance = 0.001f; #ifdef __GNUC__ // Faster version of real_resonance = resonance ^ (1 / order). // pow(), at least on current GCC, is pretty slow. float real_resonance = resonance; switch (filter_order) { case 0: case 1: break; case 4: real_resonance = sqrt(real_resonance); // Fall through. case 2: real_resonance = sqrt(real_resonance); break; case 3: real_resonance = cbrt(real_resonance); break; default: assert(false); } #else float real_resonance = pow(resonance, 1.0f / filter_order); #endif float alpha = float(sn / (2 * real_resonance)); float a0 = 1 + alpha; a1 = -2 * cs; a2 = 1 - alpha; switch (filtertype) { case FILTER_NONE: a0 = b0 = 1.0f; a1 = a2 = b1 = b2 = 0.0; //identity filter break; case FILTER_LPF: b0 = (1 - cs) * 0.5f; b1 = 1 - cs; b2 = b0; // a1 = -2*cs; // a2 = 1 - alpha; break; case FILTER_HPF: b0 = (1 + cs) * 0.5f; b1 = -(1 + cs); b2 = b0; // a1 = -2*cs; // a2 = 1 - alpha; break; case FILTER_BPF: b0 = alpha; b1 = 0.0f; b2 = -alpha; // a1 = -2*cs; // a2 = 1 - alpha; break; case FILTER_NOTCH: b0 = 1.0f; b1 = -2*cs; b2 = 1.0f; // a1 = -2*cs; // a2 = 1 - alpha; break; case FILTER_APF: b0 = 1 - alpha; b1 = -2*cs; b2 = 1.0f; // a1 = -2*cs; // a2 = 1 - alpha; break; case FILTER_PEAKING_EQ: b0 = 1 + alpha * A; b1 = -2*cs; b2 = 1 - alpha * A; a0 = 1 + alpha / A; // a1 = -2*cs; a2 = 1 - alpha / A; break; case FILTER_LOW_SHELF: b0 = A * ((A + 1) - (A - 1)*cs + 2 * sqrt(A) * alpha); b1 = 2 * A * ((A - 1) - (A + 1)*cs ); b2 = A * ((A + 1) - (A - 1)*cs - 2 * sqrt(A) * alpha); a0 = (A + 1) + (A - 1)*cs + 2 * sqrt(A) * alpha ; a1 = -2 * ((A - 1) + (A + 1)*cs ); a2 = (A + 1) + (A - 1)*cs - 2 * sqrt(A) * alpha ; break; case FILTER_HIGH_SHELF: b0 = A * ((A + 1) + (A - 1)*cs + 2 * sqrt(A) * alpha); b1 = -2 * A * ((A - 1) + (A + 1)*cs ); b2 = A * ((A + 1) + (A - 1)*cs - 2 * sqrt(A) * alpha); a0 = (A + 1) - (A - 1)*cs + 2 * sqrt(A) * alpha ; a1 = 2 * ((A - 1) - (A + 1)*cs ); a2 = (A + 1) - (A - 1)*cs - 2 * sqrt(A) * alpha ; break; default: //unknown filter type assert(false); break; } const float invA0 = 1.0f / a0; b0 *= invA0; b1 *= invA0; b2 *= invA0; a1 *= invA0; a2 *= invA0; } #ifndef NDEBUG void Filter::debug() { // Feed this to gnuplot to get a graph of the frequency response. const float Fs2 = OUTPUT_FREQUENCY * 0.5f; printf("set xrange [2:%f]; ", Fs2); printf("set yrange [-80:20]; "); printf("set log x; "); printf("phasor(x) = cos(x*pi/%f)*{1,0} + sin(x*pi/%f)*{0,1}; ", Fs2, Fs2); printf("tfunc(x, b0, b1, b2, a0, a1, a2) = (b0 * phasor(x)**2 + b1 * phasor(x) + b2) / (a0 * phasor(x)**2 + a1 * phasor(x) + a2); "); printf("db(x) = 20*log10(x); "); printf("plot db(abs(tfunc(x, %f, %f, %f, %f, %f, %f))) title \"\"\n", b0, b1, b2, 1.0f, a1, a2); } #endif void Filter::init(FilterType type, int order) { filtertype = type; filter_order = order; if (filtertype == FILTER_NONE) filter_order = 0; if (filter_order == 0) filtertype = FILTER_NONE; //reset feedback buffer for (unsigned i = 0; i < filter_order; i++) { feedback[i].d0 = feedback[i].d1 = 0.0f; } } #ifdef __SSE__ void Filter::render_chunk(float *inout_buf, unsigned int n_samples) #else void Filter::render_chunk(float *inout_buf, unsigned int n_samples, unsigned stride) #endif { #ifdef __SSE__ const unsigned stride = 1; unsigned old_denormals_mode = _MM_GET_FLUSH_ZERO_MODE(); _MM_SET_FLUSH_ZERO_MODE(_MM_FLUSH_ZERO_ON); #endif assert((n_samples & 3) == 0); // make sure n_samples is divisible by 4 // Apply the filter FILTER_ORDER times. for (unsigned j = 0; j < filter_order; j++) { float d0 = feedback[j].d0; float d1 = feedback[j].d1; float *inout_ptr = inout_buf; // Render n_samples mono samples. Unrolling manually by a // factor four seemingly helps a lot, perhaps because it // lets the CPU overlap arithmetic and memory operations // better, or perhaps simply because the loop overhead is // high. for (unsigned i = n_samples >> 2; i; i--) { float in, out; in = *inout_ptr; out = b0*in + d0; *inout_ptr = out; d0 = b1*in - a1*out + d1; d1 = b2*in - a2*out; inout_ptr += stride; in = *inout_ptr; out = b0*in + d0; *inout_ptr = out; d0 = b1*in - a1*out + d1; d1 = b2*in - a2*out; inout_ptr += stride; in = *inout_ptr; out = b0*in + d0; *inout_ptr = out; d0 = b1*in - a1*out + d1; d1 = b2*in - a2*out; inout_ptr += stride; in = *inout_ptr; out = b0*in + d0; *inout_ptr = out; d0 = b1*in - a1*out + d1; d1 = b2*in - a2*out; inout_ptr += stride; } early_undenormalise(d0); //do denormalization step early_undenormalise(d1); feedback[j].d0 = d0; feedback[j].d1 = d1; } #ifdef __SSE__ _MM_SET_FLUSH_ZERO_MODE(old_denormals_mode); #endif } void Filter::render(float *inout_buf, unsigned int buf_size, float cutoff, float resonance) { //render buf_size mono samples #ifdef __SSE__ assert(buf_size % 4 == 0); #endif if (filter_order == 0) return; this->set_linear_cutoff(cutoff); this->set_resonance(resonance); this->update(); this->render_chunk(inout_buf, buf_size); } void StereoFilter::init(FilterType type, int new_order) { #ifdef __SSE__ parm_filter.init(type, new_order); memset(feedback, 0, sizeof(feedback)); #else for (unsigned i = 0; i < 2; ++i) { filters[i].init(type, new_order); } #endif } void StereoFilter::render(float *inout_left_ptr, unsigned n_samples, float cutoff, float resonance, float dbgain_normalized) { #ifdef __SSE__ if (parm_filter.filtertype == FILTER_NONE || parm_filter.filter_order == 0) return; unsigned old_denormals_mode = _MM_GET_FLUSH_ZERO_MODE(); _MM_SET_FLUSH_ZERO_MODE(_MM_FLUSH_ZERO_ON); parm_filter.set_linear_cutoff(cutoff); parm_filter.set_resonance(resonance); parm_filter.set_dbgain_normalized(dbgain_normalized); parm_filter.update(); __m128 b0 = _mm_set1_ps(parm_filter.b0); __m128 b1 = _mm_set1_ps(parm_filter.b1); __m128 b2 = _mm_set1_ps(parm_filter.b2); __m128 a1 = _mm_set1_ps(parm_filter.a1); __m128 a2 = _mm_set1_ps(parm_filter.a2); // Apply the filter FILTER_ORDER times. for (unsigned j = 0; j < parm_filter.filter_order; j++) { __m128 d0 = feedback[j].d0; __m128 d1 = feedback[j].d1; __m64 *inout_ptr = (__m64 *)inout_left_ptr; __m128 in = _mm_set1_ps(0.0f), out; for (unsigned i = n_samples; i; i--) { in = _mm_loadl_pi(in, inout_ptr); out = _mm_add_ps(_mm_mul_ps(b0, in), d0); _mm_storel_pi(inout_ptr, out); d0 = _mm_add_ps(_mm_sub_ps(_mm_mul_ps(b1, in), _mm_mul_ps(a1, out)), d1); d1 = _mm_sub_ps(_mm_mul_ps(b2, in), _mm_mul_ps(a2, out)); ++inout_ptr; } feedback[j].d0 = d0; feedback[j].d1 = d1; } _MM_SET_FLUSH_ZERO_MODE(old_denormals_mode); #else if (filters[0].filtertype == FILTER_NONE || filters[0].filter_order == 0) return; for (unsigned i = 0; i < 2; ++i) { filters[i].set_linear_cutoff(cutoff); filters[i].set_resonance(resonance); filters[i].update(); filters[i].render_chunk(inout_left_ptr, n_samples, 2); ++inout_left_ptr; } #endif } /* Find the transfer function for an IIR biquad. This is relatively basic signal processing, but for completeness, here's the rationale for the function: The basic system of an IIR biquad looks like this, for input x[n], output y[n] and constant filter coefficients [ab][0-2]: a2 y[n-2] + a1 y[n-1] + a0 y[n] = b2 x[n-2] + b1 x[n-1] + b0 x[n] Taking the discrete Fourier transform (DFT) of both sides (denoting by convention DFT{x[n]} by X[w], where w is the angular frequency, going from 0 to 2pi), yields, due to the linearity and shift properties of the DFT: a2 e^2jw Y[w] + a1 e^jw Y[w] + a0 Y[w] = b2 e^2jw X[w] + b1 e^jw X[w] + b0 Y[w] Simple factorization and reorganization yields Y[w] / X[w] = (b1 e^2jw + b1 e^jw + b0) / (a2 e^2jw + a1 e^jw + a0) and Y[w] / X[w] is by definition the filter's _transfer function_ (customarily denoted by H(w)), ie. the complex factor it applies to the frequency component w. The absolute value of the transfer function is the frequency response, ie. how much frequency w is boosted or weakened. (This derivation usually goes via the Z-transform and not the DFT, but the idea is exactly the same; the Z-transform is just a bit more general.) Sending a signal through first one filter and then through another one will naturally be equivalent to a filter with the transfer function equal to the pointwise multiplication of the two filters, so for N-order filters we need to raise the answer to the Nth power. */ complex Filter::evaluate_transfer_function(float omega) { complex z = exp(complex(0.0f, omega)); complex z2 = z * z; return pow((b0 * z2 + b1 * z + b2) / (1.0f * z2 + a1 * z + a2), filter_order); } nageru-2.3.0/nageru/filter.h000066400000000000000000000056141450736322200157260ustar00rootroot00000000000000// Filter class: // a cascaded biquad IIR filter // // Special cases for type=LPF/BPF/HPF: // // Butterworth filter: order=1, resonance=1/sqrt(2) // Linkwitz-Riley filter: order=2, resonance=1/2 #ifndef _FILTER_H #define _FILTER_H 1 #define _USE_MATH_DEFINES #include #include #ifdef __SSE__ #include #endif enum FilterType { FILTER_NONE = 0, FILTER_LPF, FILTER_HPF, FILTER_BPF, FILTER_NOTCH, FILTER_APF, // EQ filters. FILTER_PEAKING_EQ, FILTER_LOW_SHELF, FILTER_HIGH_SHELF, }; #define FILTER_MAX_ORDER 4 class Filter { friend class StereoFilter; friend class SplittingStereoFilter; public: Filter(); void init(FilterType type, int new_order); void update(); //update coefficients #ifndef NDEBUG void debug(); #endif std::complex evaluate_transfer_function(float omega); FilterType get_type() { return filtertype; } unsigned get_order() { return filter_order; } // cutoff is taken to be in the [0..pi> (see set_linear_cutoff, below). void render(float *inout_array, unsigned int buf_size, float cutoff, float resonance); // Set cutoff, from [0..pi> (where pi is the Nyquist frequency). // Overridden by render() if you use that. void set_linear_cutoff(float new_omega) { omega = new_omega; } void set_resonance(float new_resonance) { resonance = new_resonance; } // For EQ filters only. void set_dbgain_normalized(float db_gain_div_40) { A = pow(10.0f, db_gain_div_40); } #ifdef __SSE__ // We don't need the stride argument for SSE, as StereoFilter // has its own SSE implementations. void render_chunk(float *inout_buf, unsigned nSamples); #else void render_chunk(float *inout_buf, unsigned nSamples, unsigned stride = 1); #endif FilterType filtertype; private: float omega; //which is 2*Pi*frequency /SAMPLE_RATE float resonance; float A; // which is 10^(db_gain / 40) public: unsigned filter_order; private: float b0, b1, b2, a1, a2; //filter coefs struct FeedbackBuffer { float d0,d1; //feedback buffers } feedback[FILTER_MAX_ORDER]; void calcSinCos(float omega, float *sinVal, float *cosVal) { *sinVal = (float)sin(omega); *cosVal = (float)cos(omega); } }; class StereoFilter { public: void init(FilterType type, int new_order); void render(float *inout_left_ptr, unsigned n_samples, float cutoff, float resonance, float dbgain_normalized = 0.0f); #ifndef NDEBUG #ifdef __SSE__ void debug() { parm_filter.debug(); } #else void debug() { filters[0].debug(); } #endif #endif #ifdef __SSE__ FilterType get_type() { return parm_filter.get_type(); } #else FilterType get_type() { return filters[0].get_type(); } #endif private: #ifdef __SSE__ // We only use the filter to calculate coefficients; we don't actually // use its feedbacks. Filter parm_filter; struct SIMDFeedbackBuffer { __m128 d0, d1; } feedback[FILTER_MAX_ORDER]; #else Filter filters[2]; #endif }; #endif // !defined(_FILTER_H) nageru-2.3.0/nageru/flags.cpp000066400000000000000000001127661450736322200160770ustar00rootroot00000000000000#include "flags.h" #include #include #include #include #include using namespace std; Flags global_flags; // Long options that have no corresponding short option. enum LongOption { OPTION_HELP = 1000, OPTION_FULLSCREEN, OPTION_MAX_NUM_CARDS, OPTION_MULTICHANNEL, OPTION_MIDI_MAPPING, OPTION_DEFAULT_HDMI_INPUT, OPTION_FAKE_CARDS_AUDIO, OPTION_V4L_OUTPUT, OPTION_HTTP_UNCOMPRESSED_VIDEO, OPTION_HTTP_X264_VIDEO, OPTION_HTTP_AV1_VIDEO, OPTION_RECORD_X264_VIDEO, OPTION_SEPARATE_X264_DISK_ENCODE, OPTION_X264_PRESET, OPTION_X264_TUNE, OPTION_X264_SPEEDCONTROL, OPTION_X264_SPEEDCONTROL_VERBOSE, OPTION_X264_BITRATE, OPTION_X264_CRF, OPTION_X264_VBV_BUFSIZE, OPTION_X264_VBV_MAX_BITRATE, OPTION_X264_PARAM, OPTION_X264_SEPARATE_DISK_PRESET, OPTION_X264_SEPARATE_DISK_TUNE, OPTION_X264_SEPARATE_DISK_BITRATE, OPTION_X264_SEPARATE_DISK_CRF, OPTION_X264_SEPARATE_DISK_PARAM, OPTION_AV1_PRESET, OPTION_AV1_BITRATE, OPTION_AV1_FPS, OPTION_AV1_PARAM, OPTION_HTTP_MUX, OPTION_HTTP_COARSE_TIMEBASE, OPTION_HTTP_AUDIO_CODEC, OPTION_HTTP_AUDIO_BITRATE, OPTION_HTTP_PORT, OPTION_SRT_PORT, OPTION_NO_SRT, OPTION_SRT_DESTINATION, OPTION_SRT_STREAMID, OPTION_SRT_PASSPHRASE, OPTION_SRT_YOUTUBE_STREAM_KEY, OPTION_SRT_LATENCY, OPTION_NO_TRANSCODE_VIDEO, OPTION_NO_TRANSCODE_AUDIO, OPTION_DISABLE_AUDIO, OPTION_FLAT_AUDIO, OPTION_GAIN_STAGING, OPTION_DISABLE_LOCUT, OPTION_ENABLE_LOCUT, OPTION_DISABLE_GAIN_STAGING_AUTO, OPTION_ENABLE_GAIN_STAGING_AUTO, OPTION_DISABLE_COMPRESSOR, OPTION_ENABLE_COMPRESSOR, OPTION_DISABLE_LIMITER, OPTION_ENABLE_LIMITER, OPTION_DISABLE_MAKEUP_GAIN_AUTO, OPTION_ENABLE_MAKEUP_GAIN_AUTO, OPTION_DISABLE_ALSA_OUTPUT, OPTION_NO_FLUSH_PBOS, OPTION_PRINT_VIDEO_LATENCY, OPTION_MAX_INPUT_QUEUE_FRAMES, OPTION_AUDIO_QUEUE_LENGTH_MS, OPTION_OUTPUT_YCBCR_COEFFICIENTS, OPTION_OUTPUT_BUFFER_FRAMES, OPTION_OUTPUT_SLOP_FRAMES, OPTION_OUTPUT_CARD_UNSYNCHRONIZED, OPTION_TIMECODE_STREAM, OPTION_TIMECODE_STDOUT, OPTION_QUICK_CUT_KEYS, OPTION_10_BIT, OPTION_10_BIT_INPUT, OPTION_10_BIT_OUTPUT, OPTION_INPUT_YCBCR_INTERPRETATION, OPTION_MJPEG_EXPORT_CARDS, }; map parse_mjpeg_export_cards(char *optarg) { map ret; if (optarg[0] == '\0') { return ret; } unsigned stream_idx = 0; char *start = optarg; for ( ;; ) { char *end = strchr(start, ','); if (end != nullptr) { *end = '\0'; } unsigned range_begin, range_end; if (sscanf(start, "%u-%u", &range_begin, &range_end) != 2) { range_begin = range_end = atoi(start); } if (range_end < range_begin) { fprintf(stderr, "ERROR: Invalid range %u-%u in --mjpeg-export-cards=\n", range_begin, range_end); exit(1); } if (range_end >= unsigned(global_flags.max_num_cards)) { // There are situations where we could possibly want to // include FFmpeg inputs (CEF inputs are unlikely), // but they're not necessarily in 4:2:2 Y'CbCr, so it would // require more functionality the the JPEG encoder. fprintf(stderr, "ERROR: Asked for (zero-indexed) card %u in --mjpeg-export-cards=, but there are only %u cards\n", range_end, global_flags.max_num_cards); exit(1); } for (unsigned card_idx = range_begin; card_idx <= range_end; ++card_idx) { if (ret.count(card_idx)) { fprintf(stderr, "ERROR: Card %u was given twice in --mjpeg-export-cards=\n", card_idx); exit(1); } ret[card_idx] = stream_idx++; } if (end == nullptr) { break; } else { start = end + 1; } } return ret; } void usage(Program program) { if (program == PROGRAM_KAERU) { fprintf(stderr, "Usage: kaeru [OPTION]... SOURCE_URL\n"); } else { fprintf(stderr, "Usage: nageru [OPTION]...\n"); } fprintf(stderr, "\n"); fprintf(stderr, " --help print usage information\n"); if (program == PROGRAM_NAGERU) { fprintf(stderr, " --fullscreen run in full screen, with no decorations\n"); } fprintf(stderr, " -w, --width output width in pixels (default 1280)\n"); fprintf(stderr, " -h, --height output height in pixels (default 720)\n"); if (program == PROGRAM_NAGERU) { fprintf(stderr, " -c, --num-cards set minimum number of input cards (default 2)\n"); fprintf(stderr, " --max-num-cards set maximum number of input cards (default %d)\n", MAX_VIDEO_CARDS); fprintf(stderr, " -o, --output-card=CARD also output signal to the given card (default none)\n"); fprintf(stderr, " -t, --theme=FILE choose theme (default theme.lua)\n"); fprintf(stderr, " -I, --theme-dir=DIR search for theme in this directory (can be given multiple times)\n"); fprintf(stderr, " -r, --recording-dir=DIR where to store disk recording\n"); fprintf(stderr, " -v, --va-display=SPEC VA-API device for H.264 encoding\n"); fprintf(stderr, " ($DISPLAY spec or /dev/dri/render* path)\n"); fprintf(stderr, " -m, --map-signal=SIGNAL,CARD set a default card mapping (can be given multiple times)\n"); fprintf(stderr, " -M, --input-mapping=FILE start with the given audio input mapping (implies --multichannel)\n"); fprintf(stderr, " --multichannel start in multichannel audio mapping mode\n"); fprintf(stderr, " --midi-mapping=FILE start with the given MIDI controller mapping (implies --multichannel)\n"); fprintf(stderr, " --default-hdmi-input default to HDMI over SDI inputs for cards that have both\n"); fprintf(stderr, " --fake-cards-audio make fake (disconnected) cards output a simple tone\n"); fprintf(stderr, " --v4l-output=DEVICE send video (no audio) to V4L2 output/loopback\n"); fprintf(stderr, " --http-x264-video send x264-compressed video to HTTP clients\n"); fprintf(stderr, " --record-x264-video store x264-compressed video to disk (implies --http-x264-video,\n"); fprintf(stderr, " removes the need for working VA-API encoding)\n"); fprintf(stderr, " --separate-x264-disk-encode run a different x264 encoder for disk recording\n"); fprintf(stderr, " (implies --record-x264-video)\n"); } fprintf(stderr, " --x264-preset x264 quality preset (default " X264_DEFAULT_PRESET ")\n"); fprintf(stderr, " --x264-tune x264 tuning (default " X264_DEFAULT_TUNE ", can be blank)\n"); fprintf(stderr, " --x264-speedcontrol try to match x264 preset to available CPU speed\n"); fprintf(stderr, " --x264-bitrate x264 bitrate (in kilobit/sec, default %d)\n", DEFAULT_X264_OUTPUT_BIT_RATE); fprintf(stderr, " --x264-crf=VALUE quality-based VBR (-12 to 51), incompatible with --x264-bitrate\n"); fprintf(stderr, " --x264-param=NAME[,VALUE] set any x264 parameter, for fine tuning\n"); if (program == PROGRAM_NAGERU) { fprintf(stderr, " --x264-separate-disk-preset x264 quality preset (default " X264_DEFAULT_PRESET ")\n"); fprintf(stderr, " --x264-separate-disk-tune x264 tuning (default " X264_DEFAULT_TUNE ", can be blank)\n"); fprintf(stderr, " --x264-separate-disk-bitrate x264 bitrate (in kilobit/sec, default %d)\n", DEFAULT_X264_OUTPUT_BIT_RATE); fprintf(stderr, " --x264-separate-disk-crf=VALUE quality-based VBR (-12 to 51), \n"); fprintf(stderr, " incompatible with --x264-separate-disk-bitrate\n"); fprintf(stderr, " --x264-separate-disk-param=NAME[,VALUE] set any x264 parameter, for fine tuning\n"); } #ifdef HAVE_AV1 fprintf(stderr, " --http-av1-video send AV1-compressed video to HTTP clients and SRT output\n"); fprintf(stderr, " --av1-preset SVT-AV1 quality preset (default %d, from -2 to 13)\n", DEFAULT_AV1_PRESET); fprintf(stderr, " --av1-bitrate AV1 bitrate (in kilobit/sec, default %d)\n", DEFAULT_AV1_OUTPUT_BIT_RATE); fprintf(stderr, " --av1-fps=NUM[/DEN] AV1 encoded frame rate (default %d/%d)\n", DEFAULT_AV1_FPS_NUM, DEFAULT_AV1_FPS_DEN); fprintf(stderr, " --av1-param=NAME[,VALUE] set any SVT-AV1 parameter, for fine tuning\n"); #endif fprintf(stderr, " --http-mux=NAME mux to use for HTTP streams (default " DEFAULT_STREAM_MUX_NAME ")\n"); fprintf(stderr, " --http-audio-codec=NAME audio codec to use for HTTP streams and SRT output\n"); fprintf(stderr, " (default is to use the same as for the recording)\n"); fprintf(stderr, " --http-audio-bitrate=KBITS audio codec bit rate to use for HTTP streams and SRT output\n"); fprintf(stderr, " (default is %d, ignored unless --http-audio-codec is set)\n", DEFAULT_AUDIO_OUTPUT_BIT_RATE / 1000); fprintf(stderr, " --http-port=PORT which port to use for the built-in HTTP server\n"); fprintf(stderr, " (default is %d)\n", DEFAULT_HTTPD_PORT); #ifdef HAVE_SRT fprintf(stderr, " --srt-port=PORT which port to use for receiving SRT streams\n"); fprintf(stderr, " (default is %d)\n", DEFAULT_SRT_PORT); fprintf(stderr, " --no-srt disable receiving SRT streams\n"); #endif if (program == PROGRAM_KAERU) { fprintf(stderr, " --no-transcode-video copy encoded video raw from the source stream\n"); fprintf(stderr, " (experimental, must be H.264)\n"); fprintf(stderr, " --no-transcode-audio copy encoded audio raw from the source stream\n"); fprintf(stderr, " (requires --http-audio-codec= to be set)\n"); fprintf(stderr, " --disable-audio do not include any audio in the stream\n"); } if (program == PROGRAM_NAGERU) { #ifdef HAVE_SRT fprintf(stderr, " --srt-destination=HOST:PORT send HTTP video stream also to given destination\n"); fprintf(stderr, " --srt-streamid=STREAMID SRT stream identifying ID\n"); fprintf(stderr, " --srt-passphrase=PASSPHRASE SRT encryption key\n"); fprintf(stderr, " --srt-youtube-stream-key=KEY shortcut for --srt-destination=a.srt.youtube.com:2010\n"); fprintf(stderr, " --srt-streamid=#!::u=,copy=0,encoder=Nageru\n"); fprintf(stderr, " --srt-latency=MS output SRT latency in milliseconds (default is %d)\n", DEFAULT_SRT_OUTPUT_LATENCY_MS); #endif fprintf(stderr, " --flat-audio start with most audio processing turned off\n"); fprintf(stderr, " (can be overridden by e.g. --enable-limiter)\n"); fprintf(stderr, " --gain-staging=DB set initial gain staging to the given value\n"); fprintf(stderr, " (--disable-gain-staging-auto)\n"); fprintf(stderr, " --disable-locut turn off locut filter (also --enable)\n"); fprintf(stderr, " --disable-gain-staging-auto turn off automatic gain staging (also --enable)\n"); fprintf(stderr, " --disable-compressor turn off regular compressor (also --enable)\n"); fprintf(stderr, " --disable-limiter turn off limiter (also --enable)\n"); fprintf(stderr, " --disable-makeup-gain-auto turn off auto-adjustment of final makeup gain (also --enable)\n"); fprintf(stderr, " --disable-alsa-output disable audio monitoring via ALSA\n"); fprintf(stderr, " --print-video-latency print out measurements of video latency on stdout\n"); fprintf(stderr, " --max-input-queue-frames=FRAMES never keep more than FRAMES frames for each card\n"); fprintf(stderr, " (default 6, minimum 1)\n"); fprintf(stderr, " --audio-queue-length-ms=MS length of audio resampling queue (default 100.0)\n"); fprintf(stderr, " --output-ycbcr-coefficients={rec601,rec709,auto}\n"); fprintf(stderr, " Y'CbCr coefficient standard of output (default auto)\n"); fprintf(stderr, " auto is rec601, unless --output-card is used\n"); fprintf(stderr, " and a Rec. 709 mode (typically HD modes) is in use\n"); fprintf(stderr, " --output-buffer-frames=NUM number of frames in output buffer for --output-card,\n"); fprintf(stderr, " can be fractional (default 6.0); note also\n"); fprintf(stderr, " the audio queue can't be much longer than this\n"); fprintf(stderr, " --output-slop-frames=NUM if more less than this number of frames behind for\n"); fprintf(stderr, " --output-card, try to submit anyway instead of\n"); fprintf(stderr, " dropping the frame (default 0.5)\n"); fprintf(stderr, " --output-card-unsynchronized if --output-card is in use, do _not_ use it as\n"); fprintf(stderr, " master clock (may give jittery output and audio breakups)\n"); fprintf(stderr, " --timecode-stream show timestamp and timecode in stream\n"); fprintf(stderr, " --timecode-stdout show timestamp and timecode on standard output\n"); fprintf(stderr, " --quick-cut-keys enable direct cutting by Q, W, E, ... keys\n"); fprintf(stderr, " --10-bit use 10-bit color depth\n"); fprintf(stderr, " --input-ycbcr-interpretation=CARD,{rec601,rec709,auto}[,{limited,full}]\n"); fprintf(stderr, " Y'CbCr coefficient standard of card CARD (default auto)\n"); fprintf(stderr, " auto is rec601 for SD, rec709 for HD, always limited\n"); fprintf(stderr, " limited means standard 0-240/0-235 input range (for 8-bit)\n"); fprintf(stderr, " --mjpeg-export-cards=RANGE[,RANGE...]\n"); fprintf(stderr, " export the given cards in MJPEG format to /multicam.mp4,\n"); fprintf(stderr, " in the given order (ranges can be either single card indexes\n"); fprintf(stderr, " or pairs like 1-3 for camera 1,2,3; default is all cards)\n"); } } void parse_flags(Program program, int argc, char * const argv[]) { static const option long_options[] = { { "help", no_argument, 0, OPTION_HELP }, { "fullscreen", no_argument, 0, OPTION_FULLSCREEN }, { "width", required_argument, 0, 'w' }, { "height", required_argument, 0, 'h' }, { "num-cards", required_argument, 0, 'c' }, { "max-num-cards", required_argument, 0, OPTION_MAX_NUM_CARDS }, { "output-card", required_argument, 0, 'o' }, { "theme", required_argument, 0, 't' }, { "theme-dir", required_argument, 0, 'I' }, { "recording-dir", required_argument, 0, 'r' }, { "map-signal", required_argument, 0, 'm' }, { "input-mapping", required_argument, 0, 'M' }, { "va-display", required_argument, 0, 'v' }, { "multichannel", no_argument, 0, OPTION_MULTICHANNEL }, { "midi-mapping", required_argument, 0, OPTION_MIDI_MAPPING }, { "default-hdmi-input", no_argument, 0, OPTION_DEFAULT_HDMI_INPUT }, { "fake-cards-audio", no_argument, 0, OPTION_FAKE_CARDS_AUDIO }, { "v4l-output", required_argument, 0, OPTION_V4L_OUTPUT }, { "http-x264-video", no_argument, 0, OPTION_HTTP_X264_VIDEO }, { "record-x264-video", no_argument, 0, OPTION_RECORD_X264_VIDEO }, { "separate-x264-disk-encode", no_argument, 0, OPTION_SEPARATE_X264_DISK_ENCODE }, { "x264-preset", required_argument, 0, OPTION_X264_PRESET }, { "x264-tune", required_argument, 0, OPTION_X264_TUNE }, { "x264-speedcontrol", no_argument, 0, OPTION_X264_SPEEDCONTROL }, { "x264-crf", required_argument, 0, OPTION_X264_CRF }, { "x264-param", required_argument, 0, OPTION_X264_PARAM }, { "x264-separate-disk-preset", required_argument, 0, OPTION_X264_SEPARATE_DISK_PRESET }, { "x264-separate-disk-tune", required_argument, 0, OPTION_X264_SEPARATE_DISK_TUNE }, { "x264-separate-disk-bitrate", required_argument, 0, OPTION_X264_SEPARATE_DISK_BITRATE }, { "x264-separate-disk-crf", required_argument, 0, OPTION_X264_SEPARATE_DISK_CRF }, { "x264-separate-disk-param", required_argument, 0, OPTION_X264_SEPARATE_DISK_PARAM }, #ifdef HAVE_AV1 { "http-av1-video", no_argument, 0, OPTION_HTTP_AV1_VIDEO }, { "av1-preset", required_argument, 0, OPTION_AV1_PRESET }, { "av1-bitrate", required_argument, 0, OPTION_AV1_BITRATE }, { "av1-fps", required_argument, 0, OPTION_AV1_FPS }, { "av1-param", required_argument, 0, OPTION_AV1_PARAM }, #endif { "http-mux", required_argument, 0, OPTION_HTTP_MUX }, { "http-audio-codec", required_argument, 0, OPTION_HTTP_AUDIO_CODEC }, { "http-audio-bitrate", required_argument, 0, OPTION_HTTP_AUDIO_BITRATE }, { "http-port", required_argument, 0, OPTION_HTTP_PORT }, #ifdef HAVE_SRT { "srt-port", required_argument, 0, OPTION_SRT_PORT }, #endif { "no-srt", no_argument, 0, OPTION_NO_SRT }, // We silently allow this even without HAVE_SRT. #ifdef HAVE_SRT { "srt-destination", required_argument, 0, OPTION_SRT_DESTINATION }, { "srt-streamid", required_argument, 0, OPTION_SRT_STREAMID }, { "srt-passphrase", required_argument, 0, OPTION_SRT_PASSPHRASE }, { "srt-youtube-stream-key", required_argument, 0, OPTION_SRT_YOUTUBE_STREAM_KEY }, { "srt-latency", required_argument, 0, OPTION_SRT_LATENCY }, #endif { "no-transcode-video", no_argument, 0, OPTION_NO_TRANSCODE_VIDEO }, { "no-transcode-audio", no_argument, 0, OPTION_NO_TRANSCODE_AUDIO }, { "disable-audio", no_argument, 0, OPTION_DISABLE_AUDIO }, { "flat-audio", no_argument, 0, OPTION_FLAT_AUDIO }, { "gain-staging", required_argument, 0, OPTION_GAIN_STAGING }, { "disable-locut", no_argument, 0, OPTION_DISABLE_LOCUT }, { "enable-locut", no_argument, 0, OPTION_ENABLE_LOCUT }, { "disable-gain-staging-auto", no_argument, 0, OPTION_DISABLE_GAIN_STAGING_AUTO }, { "enable-gain-staging-auto", no_argument, 0, OPTION_ENABLE_GAIN_STAGING_AUTO }, { "disable-compressor", no_argument, 0, OPTION_DISABLE_COMPRESSOR }, { "enable-compressor", no_argument, 0, OPTION_ENABLE_COMPRESSOR }, { "disable-limiter", no_argument, 0, OPTION_DISABLE_LIMITER }, { "enable-limiter", no_argument, 0, OPTION_ENABLE_LIMITER }, { "disable-makeup-gain-auto", no_argument, 0, OPTION_DISABLE_MAKEUP_GAIN_AUTO }, { "enable-makeup-gain-auto", no_argument, 0, OPTION_ENABLE_MAKEUP_GAIN_AUTO }, { "disable-alsa-output", no_argument, 0, OPTION_DISABLE_ALSA_OUTPUT }, { "print-video-latency", no_argument, 0, OPTION_PRINT_VIDEO_LATENCY }, { "max-input-queue-frames", required_argument, 0, OPTION_MAX_INPUT_QUEUE_FRAMES }, { "audio-queue-length-ms", required_argument, 0, OPTION_AUDIO_QUEUE_LENGTH_MS }, { "output-ycbcr-coefficients", required_argument, 0, OPTION_OUTPUT_YCBCR_COEFFICIENTS }, { "output-buffer-frames", required_argument, 0, OPTION_OUTPUT_BUFFER_FRAMES }, { "output-slop-frames", required_argument, 0, OPTION_OUTPUT_SLOP_FRAMES }, { "output-card-unsynchronized", no_argument, 0, OPTION_OUTPUT_CARD_UNSYNCHRONIZED }, { "timecode-stream", no_argument, 0, OPTION_TIMECODE_STREAM }, { "timecode-stdout", no_argument, 0, OPTION_TIMECODE_STDOUT }, { "quick-cut-keys", no_argument, 0, OPTION_QUICK_CUT_KEYS }, { "10-bit", no_argument, 0, OPTION_10_BIT }, { "input-ycbcr-interpretation", required_argument, 0, OPTION_INPUT_YCBCR_INTERPRETATION }, { "mjpeg-export-cards", required_argument, 0, OPTION_MJPEG_EXPORT_CARDS }, // Do not explicitly signal texture data uploads (will give // display corruption, but makes it possible to run with // apitrace in real time). For developers only, so undocumented. { "no-flush-pbos", no_argument, 0, OPTION_NO_FLUSH_PBOS }, // Output speedcontrol debugging statistics. For developers only, // so undocumented (users can get this information from Prometheus // statistics, too). { "x264-speedcontrol-verbose", no_argument, 0, OPTION_X264_SPEEDCONTROL_VERBOSE }, // Deprecated variants. { "10-bit-input", no_argument, 0, OPTION_10_BIT_INPUT }, { "10-bit-output", no_argument, 0, OPTION_10_BIT_OUTPUT }, { 0, 0, 0, 0 } }; vector theme_dirs; string output_ycbcr_coefficients = "auto"; bool card_to_mjpeg_stream_export_set = false; for ( ;; ) { int option_index = 0; int c = getopt_long(argc, argv, "c:o:t:I:r:v:m:M:w:h:", long_options, &option_index); if (c == -1) { break; } switch (c) { case 'w': global_flags.width = atoi(optarg); break; case 'h': global_flags.height = atoi(optarg); break; case 'c': global_flags.min_num_cards = atoi(optarg); break; case OPTION_MAX_NUM_CARDS: global_flags.max_num_cards = atoi(optarg); break; case 'o': global_flags.output_card = atoi(optarg); break; case 't': global_flags.theme_filename = optarg; break; case 'I': theme_dirs.push_back(optarg); break; case 'r': global_flags.recording_dir = optarg; break; case 'm': { char *ptr = strchr(optarg, ','); if (ptr == nullptr) { fprintf(stderr, "ERROR: Invalid argument '%s' to --map-signal (needs a signal and a card number, separated by comma)\n", optarg); exit(1); } *ptr = '\0'; const int signal_num = atoi(optarg); const int card_num = atoi(ptr + 1); if (global_flags.default_stream_mapping.count(signal_num)) { fprintf(stderr, "ERROR: Signal %d already mapped to card %d\n", signal_num, global_flags.default_stream_mapping[signal_num]); exit(1); } global_flags.default_stream_mapping[signal_num] = card_num; break; } case 'M': global_flags.input_mapping_filename = optarg; break; case OPTION_MULTICHANNEL: global_flags.multichannel_mapping_mode = true; break; case 'v': global_flags.va_display = optarg; break; case OPTION_MIDI_MAPPING: global_flags.midi_mapping_filename = optarg; global_flags.multichannel_mapping_mode = true; break; case OPTION_DEFAULT_HDMI_INPUT: global_flags.default_hdmi_input = true; break; case OPTION_FAKE_CARDS_AUDIO: global_flags.fake_cards_audio = true; break; case OPTION_V4L_OUTPUT: global_flags.v4l_output_device = optarg; break; case OPTION_HTTP_MUX: global_flags.stream_mux_name = optarg; break; case OPTION_HTTP_AUDIO_CODEC: global_flags.stream_audio_codec_name = optarg; break; case OPTION_HTTP_AUDIO_BITRATE: global_flags.stream_audio_codec_bitrate = atoi(optarg) * 1000; break; case OPTION_HTTP_PORT: global_flags.http_port = atoi(optarg); break; #ifdef HAVE_SRT case OPTION_SRT_PORT: global_flags.srt_port = atoi(optarg); break; #endif case OPTION_NO_SRT: global_flags.srt_port = -1; break; #ifdef HAVE_SRT case OPTION_SRT_DESTINATION: { const char *ptr = strrchr(optarg, ':'); if (ptr == nullptr || strlen(optarg) < 3) { fprintf(stderr, "ERROR: --srt-destination must be of the form host:port\n"); exit(1); } global_flags.srt_destination_host = string(optarg, ptr - optarg); if (global_flags.srt_destination_host[0] == '[' && global_flags.srt_destination_host.back() == ']') { // Support [IPv6]:port, in a sort of hackish way. global_flags.srt_destination_host = global_flags.srt_destination_host.substr(1, global_flags.srt_destination_host.size() - 2); } global_flags.srt_destination_port = ptr + 1; break; } case OPTION_SRT_STREAMID: global_flags.srt_streamid = optarg; break; case OPTION_SRT_PASSPHRASE: global_flags.srt_passphrase = optarg; break; case OPTION_SRT_YOUTUBE_STREAM_KEY: global_flags.srt_destination_host = "a.srt.youtube.com"; global_flags.srt_destination_port = "2010"; global_flags.srt_streamid = string("#!::u=") + optarg + ",copy=0,encoder=Nageru " NAGERU_VERSION; break; case OPTION_SRT_LATENCY: global_flags.srt_output_latency_ms = atoi(optarg); break; #endif case OPTION_NO_TRANSCODE_VIDEO: global_flags.transcode_video = false; break; case OPTION_NO_TRANSCODE_AUDIO: global_flags.transcode_audio = false; break; case OPTION_DISABLE_AUDIO: global_flags.transcode_audio = false; global_flags.enable_audio = false; break; case OPTION_HTTP_X264_VIDEO: global_flags.x264_video_to_http = true; break; case OPTION_RECORD_X264_VIDEO: global_flags.x264_video_to_disk = true; break; case OPTION_SEPARATE_X264_DISK_ENCODE: global_flags.x264_video_to_disk = true; global_flags.x264_video_to_http = true; global_flags.x264_separate_disk_encode = true; break; case OPTION_HTTP_AV1_VIDEO: global_flags.av1_video_to_http = true; break; case OPTION_X264_PRESET: global_flags.x264_preset = optarg; break; case OPTION_X264_TUNE: global_flags.x264_tune = optarg; break; case OPTION_X264_SPEEDCONTROL: global_flags.x264_speedcontrol = true; break; case OPTION_X264_SPEEDCONTROL_VERBOSE: global_flags.x264_speedcontrol_verbose = true; break; case OPTION_X264_BITRATE: global_flags.x264_bitrate = atoi(optarg); break; case OPTION_X264_CRF: global_flags.x264_crf = atof(optarg); break; case OPTION_X264_PARAM: global_flags.x264_extra_param.push_back(optarg); break; case OPTION_X264_SEPARATE_DISK_PRESET: global_flags.x264_separate_disk_preset = optarg; break; case OPTION_X264_SEPARATE_DISK_TUNE: global_flags.x264_separate_disk_tune = optarg; break; case OPTION_X264_SEPARATE_DISK_BITRATE: global_flags.x264_separate_disk_bitrate = atoi(optarg); break; case OPTION_X264_SEPARATE_DISK_CRF: global_flags.x264_separate_disk_crf = atof(optarg); break; case OPTION_X264_SEPARATE_DISK_PARAM: global_flags.x264_separate_disk_extra_param.push_back(optarg); break; case OPTION_AV1_PRESET: global_flags.av1_preset = atoi(optarg); break; case OPTION_AV1_BITRATE: global_flags.av1_bitrate = atoi(optarg); break; case OPTION_AV1_FPS: { string str = optarg; const size_t pos = str.find('/'); if (pos == string::npos) { global_flags.av1_fps_num = stoi(str); global_flags.av1_fps_den = 1; } else { const string num = str.substr(0, pos); const string den = str.substr(pos + 1); global_flags.av1_fps_num = stoi(num); global_flags.av1_fps_den = stoi(den); } break; } case OPTION_AV1_PARAM: global_flags.av1_extra_param.push_back(optarg); break; case OPTION_FLAT_AUDIO: // If --flat-audio is given, turn off everything that messes with the sound, // except the final makeup gain. global_flags.locut_enabled = false; global_flags.gain_staging_auto = false; global_flags.compressor_enabled = false; global_flags.limiter_enabled = false; break; case OPTION_GAIN_STAGING: global_flags.initial_gain_staging_db = atof(optarg); global_flags.gain_staging_auto = false; break; case OPTION_DISABLE_LOCUT: global_flags.locut_enabled = false; break; case OPTION_ENABLE_LOCUT: global_flags.locut_enabled = true; break; case OPTION_DISABLE_GAIN_STAGING_AUTO: global_flags.gain_staging_auto = false; break; case OPTION_ENABLE_GAIN_STAGING_AUTO: global_flags.gain_staging_auto = true; break; case OPTION_DISABLE_COMPRESSOR: global_flags.compressor_enabled = false; break; case OPTION_ENABLE_COMPRESSOR: global_flags.compressor_enabled = true; break; case OPTION_DISABLE_LIMITER: global_flags.limiter_enabled = false; break; case OPTION_ENABLE_LIMITER: global_flags.limiter_enabled = true; break; case OPTION_DISABLE_MAKEUP_GAIN_AUTO: global_flags.final_makeup_gain_auto = false; break; case OPTION_ENABLE_MAKEUP_GAIN_AUTO: global_flags.final_makeup_gain_auto = true; break; case OPTION_DISABLE_ALSA_OUTPUT: global_flags.enable_alsa_output = false; break; case OPTION_NO_FLUSH_PBOS: global_flags.flush_pbos = false; break; case OPTION_PRINT_VIDEO_LATENCY: global_flags.print_video_latency = true; break; case OPTION_MAX_INPUT_QUEUE_FRAMES: global_flags.max_input_queue_frames = atoi(optarg); break; case OPTION_AUDIO_QUEUE_LENGTH_MS: global_flags.audio_queue_length_ms = atof(optarg); break; case OPTION_OUTPUT_YCBCR_COEFFICIENTS: output_ycbcr_coefficients = optarg; break; case OPTION_OUTPUT_BUFFER_FRAMES: global_flags.output_buffer_frames = atof(optarg); break; case OPTION_OUTPUT_SLOP_FRAMES: global_flags.output_slop_frames = atof(optarg); break; case OPTION_OUTPUT_CARD_UNSYNCHRONIZED: global_flags.output_card_is_master = false; break; case OPTION_TIMECODE_STREAM: global_flags.display_timecode_in_stream = true; break; case OPTION_TIMECODE_STDOUT: global_flags.display_timecode_on_stdout = true; break; case OPTION_QUICK_CUT_KEYS: global_flags.enable_quick_cut_keys = true; break; case OPTION_10_BIT_INPUT: fprintf(stderr, "NOTE: --10-bit-input is a deprecated alias for --10-bit.\n"); global_flags.bit_depth = 10; break; case OPTION_10_BIT_OUTPUT: fprintf(stderr, "NOTE: --10-bit-output is a deprecated alias for --10-bit.\n"); global_flags.bit_depth = 10; break; case OPTION_10_BIT: global_flags.bit_depth = 10; break; case OPTION_INPUT_YCBCR_INTERPRETATION: { char *ptr = strchr(optarg, ','); if (ptr == nullptr) { fprintf(stderr, "ERROR: Invalid argument '%s' to --input-ycbcr-interpretation (needs a card and an interpretation, separated by comma)\n", optarg); exit(1); } *ptr = '\0'; const int card_num = atoi(optarg); if (card_num < 0 || card_num >= MAX_VIDEO_CARDS) { fprintf(stderr, "ERROR: Invalid card number %d\n", card_num); exit(1); } YCbCrInterpretation interpretation; char *interpretation_str = ptr + 1; ptr = strchr(interpretation_str, ','); if (ptr != nullptr) { *ptr = '\0'; const char *range = ptr + 1; if (strcmp(range, "full") == 0) { interpretation.full_range = true; } else if (strcmp(range, "limited") == 0) { interpretation.full_range = false; } else { fprintf(stderr, "ERROR: Invalid Y'CbCr range '%s' (must be “full” or “limited”)\n", range); exit(1); } } if (strcmp(interpretation_str, "rec601") == 0) { interpretation.ycbcr_coefficients_auto = false; interpretation.ycbcr_coefficients = movit::YCBCR_REC_601; } else if (strcmp(interpretation_str, "rec709") == 0) { interpretation.ycbcr_coefficients_auto = false; interpretation.ycbcr_coefficients = movit::YCBCR_REC_709; } else if (strcmp(interpretation_str, "auto") == 0) { interpretation.ycbcr_coefficients_auto = true; if (interpretation.full_range) { fprintf(stderr, "ERROR: Cannot use “auto” Y'CbCr coefficients with full range\n"); exit(1); } } else { fprintf(stderr, "ERROR: Invalid Y'CbCr coefficients '%s' (must be “rec601”, “rec709” or “auto”)\n", interpretation_str); exit(1); } global_flags.ycbcr_interpretation[card_num] = interpretation; break; } case OPTION_FULLSCREEN: global_flags.fullscreen = true; break; case OPTION_MJPEG_EXPORT_CARDS: { if (card_to_mjpeg_stream_export_set) { fprintf(stderr, "ERROR: --mjpeg-export-cards given twice\n"); exit(1); } global_flags.card_to_mjpeg_stream_export = parse_mjpeg_export_cards(optarg); card_to_mjpeg_stream_export_set = true; break; } case OPTION_HELP: usage(program); exit(0); default: fprintf(stderr, "Unknown option '%s'\n", argv[option_index]); fprintf(stderr, "\n"); usage(program); exit(1); } } if (global_flags.x264_video_to_http + global_flags.av1_video_to_http > 1) { fprintf(stderr, "ERROR: --http-{x264,av1}-video are mutually incompatible\n"); exit(1); } if (global_flags.bit_depth == 10) { global_flags.x264_video_to_disk = true; // No 10-bit Quick Sync support. if (!global_flags.av1_video_to_http) { global_flags.x264_video_to_http = true; } } if (global_flags.x264_video_to_disk && !global_flags.av1_video_to_http) { global_flags.x264_video_to_http = true; // Quick Sync to HTTP but x264 to disk doesn't make sense. } if (global_flags.min_num_cards <= 0) { fprintf(stderr, "ERROR: --num-cards must be at least 1\n"); exit(1); } if (global_flags.max_num_cards <= 0) { fprintf(stderr, "ERROR: --max-num-cards must be at least 1\n"); exit(1); } if (global_flags.max_num_cards < global_flags.min_num_cards) { fprintf(stderr, "ERROR: --max-num-cards can not be lower than --num-cards\n"); exit(1); } if (global_flags.output_card < -1 || global_flags.output_card >= global_flags.max_num_cards) { fprintf(stderr, "ERROR: --output-card points to a nonexistant card\n"); exit(1); } if (global_flags.enable_audio && !global_flags.transcode_audio && global_flags.stream_audio_codec_name.empty()) { fprintf(stderr, "ERROR: If not transcoding audio, you must specify ahead-of-time what audio codec is in use\n"); fprintf(stderr, " (using --http-audio-codec).\n"); exit(1); } if (global_flags.x264_speedcontrol) { if (!global_flags.x264_preset.empty() && global_flags.x264_preset != "faster") { fprintf(stderr, "WARNING: --x264-preset is overridden by --x264-speedcontrol (implicitly uses \"faster\" as base preset)\n"); } global_flags.x264_preset = "faster"; } else if (global_flags.x264_preset.empty()) { global_flags.x264_preset = X264_DEFAULT_PRESET; } if (global_flags.x264_separate_disk_preset.empty()) { global_flags.x264_separate_disk_preset = X264_DEFAULT_PRESET; } if (!theme_dirs.empty()) { global_flags.theme_dirs = theme_dirs; } // In reality, we could probably do with any even value (we subsample // by two in some places), but it's better to be on the safe side // wrt. video codecs and such. (I'd set 16 if I could, but 1080 isn't // divisible by 16.) if (global_flags.width <= 0 || (global_flags.width % 8) != 0 || global_flags.height <= 0 || (global_flags.height % 8) != 0) { fprintf(stderr, "ERROR: --width and --height must be positive integers divisible by 8\n"); exit(1); } for (pair mapping : global_flags.default_stream_mapping) { if (mapping.second >= global_flags.max_num_cards) { fprintf(stderr, "ERROR: Signal %d mapped to card %d, which doesn't exist (try adjusting --max-num-cards)\n", mapping.first, mapping.second); exit(1); } } // Rec. 709 would be the sane thing to do, but it seems many players // just default to BT.601 coefficients no matter what. We _do_ set // the right flags, so that a player that works properly doesn't have // to guess, but it's frequently ignored. See discussions // in e.g. https://trac.ffmpeg.org/ticket/4978; the situation with // browsers is complicated and depends on things like hardware acceleration // (https://bugs.chromium.org/p/chromium/issues/detail?id=333619 for // extensive discussion). VLC generally fixed this as part of 3.0.0 // (see e.g. https://github.com/videolan/vlc/commit/bc71288b2e38c07d6921472824b92eef1aa85f7e // and https://github.com/videolan/vlc/commit/c3fc2683a9cde1d42674ebf9935dced05733a215), // but earlier versions were pretty random. // // On the other hand, HDMI/SDI output typically requires Rec. 709 for // HD resolutions (with no way of signaling anything else), which is // a conflicting demand. In this case, we typically let the HDMI/SDI // output win if it is active, but the user can override this. if (output_ycbcr_coefficients == "auto") { // Essentially: BT.709 if HDMI/SDI output is on, otherwise BT.601. global_flags.ycbcr_rec709_coefficients = false; global_flags.ycbcr_auto_coefficients = true; } else if (output_ycbcr_coefficients == "rec709") { global_flags.ycbcr_rec709_coefficients = true; global_flags.ycbcr_auto_coefficients = false; } else if (output_ycbcr_coefficients == "rec601") { global_flags.ycbcr_rec709_coefficients = false; global_flags.ycbcr_auto_coefficients = false; } else { fprintf(stderr, "ERROR: --output-ycbcr-coefficients must be “rec601”, “rec709” or “auto”\n"); exit(1); } if (global_flags.output_buffer_frames < 0.0f) { // Actually, even zero probably won't make sense; there is some internal // delay to the card. fprintf(stderr, "ERROR: --output-buffer-frames can't be negative.\n"); exit(1); } if (global_flags.output_slop_frames < 0.0f) { fprintf(stderr, "ERROR: --output-slop-frames can't be negative.\n"); exit(1); } if (global_flags.max_input_queue_frames < 1) { fprintf(stderr, "ERROR: --max-input-queue-frames must be at least 1.\n"); exit(1); } if (global_flags.max_input_queue_frames > 10) { fprintf(stderr, "WARNING: --max-input-queue-frames has little effect over 10.\n"); } if (!isinf(global_flags.x264_crf)) { // CRF mode is selected. if (global_flags.x264_bitrate != -1) { fprintf(stderr, "ERROR: --x264-bitrate and --x264-crf are mutually incompatible.\n"); exit(1); } } else if (global_flags.x264_bitrate == -1) { global_flags.x264_bitrate = DEFAULT_X264_OUTPUT_BIT_RATE; } if (!isinf(global_flags.x264_separate_disk_crf)) { // CRF mode is selected. if (global_flags.x264_separate_disk_bitrate != -1) { fprintf(stderr, "ERROR: --x264-separate-disk-bitrate and --x264-separate-disk-crf are mutually incompatible.\n"); exit(1); } } else if (global_flags.x264_separate_disk_bitrate == -1) { global_flags.x264_separate_disk_bitrate = DEFAULT_X264_OUTPUT_BIT_RATE; } if (!card_to_mjpeg_stream_export_set) { // Fill in the default mapping (export all cards, in order). for (unsigned card_idx = 0; card_idx < unsigned(global_flags.max_num_cards); ++card_idx) { global_flags.card_to_mjpeg_stream_export[card_idx] = card_idx; } } if (global_flags.srt_destination_host == "a.srt.youtube.com" && global_flags.srt_passphrase.empty()) { fprintf(stderr, "ERROR: Cannot stream to YouTube without --srt-passphrase (get it from the YouTube streaming console)\n"); exit(1); } } nageru-2.3.0/nageru/flags.h000066400000000000000000000103501450736322200155260ustar00rootroot00000000000000#ifndef _FLAGS_H #define _FLAGS_H #include #include #include #include #include "defs.h" #include "ycbcr_interpretation.h" struct Flags { int width = 1280, height = 720; int min_num_cards = 2; int max_num_cards = MAX_VIDEO_CARDS; std::string va_display; bool fake_cards_audio = false; bool x264_video_to_http = false; bool x264_video_to_disk = false; // Disables Quick Sync entirely. Implies x264_video_to_http == true. bool x264_separate_disk_encode = false; // Disables Quick Sync entirely. Implies x264_video_to_disk == true. bool av1_video_to_http = false; std::vector theme_dirs { ".", PREFIX "/share/nageru" }; std::string recording_dir = "."; std::string theme_filename = "theme.lua"; bool locut_enabled = true; bool gain_staging_auto = true; float initial_gain_staging_db = 0.0f; bool compressor_enabled = true; bool limiter_enabled = true; bool final_makeup_gain_auto = true; bool flush_pbos = true; std::string stream_mux_name = DEFAULT_STREAM_MUX_NAME; bool stream_coarse_timebase = false; std::string stream_audio_codec_name; // Blank = use the same as for the recording. int stream_audio_codec_bitrate = DEFAULT_AUDIO_OUTPUT_BIT_RATE; // Ignored if stream_audio_codec_name is blank. std::string x264_preset; // Empty will be overridden by X264_DEFAULT_PRESET, unless speedcontrol is set. std::string x264_tune = X264_DEFAULT_TUNE; bool x264_speedcontrol = false; bool x264_speedcontrol_verbose = false; int x264_bitrate = -1; // In kilobit/sec. -1 = not set = DEFAULT_X264_OUTPUT_BIT_RATE. float x264_crf = HUGE_VAL; // From 51 - QP_MAX_SPEC to 51. HUGE_VAL = not set = use x264_bitrate instead. std::vector x264_extra_param; // In “key[,value]” format. int av1_preset = DEFAULT_AV1_PRESET; int av1_bitrate = DEFAULT_AV1_OUTPUT_BIT_RATE; int av1_fps_num = DEFAULT_AV1_FPS_NUM, av1_fps_den = DEFAULT_AV1_FPS_DEN; std::vector av1_extra_param; // In “key[,value]” format. std::string x264_separate_disk_preset; // Empty will be overridden by X264_DEFAULT_PRESET, unless speedcontrol is set. std::string x264_separate_disk_tune = X264_DEFAULT_TUNE; int x264_separate_disk_bitrate = -1; float x264_separate_disk_crf = HUGE_VAL; std::vector x264_separate_disk_extra_param; // In “key[,value]” format. std::string v4l_output_device; // Empty if none. bool enable_alsa_output = true; std::map default_stream_mapping; bool multichannel_mapping_mode = false; // Implicitly true if input_mapping_filename is nonempty. std::string input_mapping_filename; // Empty for none. std::string midi_mapping_filename; // Empty for none. bool default_hdmi_input = false; bool print_video_latency = false; double audio_queue_length_ms = 100.0; bool ycbcr_rec709_coefficients = false; // Will be overridden by HDMI/SDI output if ycbcr_auto_coefficients == true. bool ycbcr_auto_coefficients = true; int output_card = -1; double output_buffer_frames = 6.0; double output_slop_frames = 0.5; bool output_card_is_master = true; int max_input_queue_frames = 6; int http_port = DEFAULT_HTTPD_PORT; int srt_port = DEFAULT_SRT_PORT; // -1 for none. bool enable_srt = true; // UI toggle; not settable from the command line. See also srt_port. bool display_timecode_in_stream = false; bool display_timecode_on_stdout = false; bool enable_quick_cut_keys = false; int bit_depth = 8; // 8 or 10. 10 implies x264_video_to_disk == true. YCbCrInterpretation ycbcr_interpretation[MAX_VIDEO_CARDS]; bool transcode_video = true; // Kaeru only. bool transcode_audio = true; // Kaeru only. bool enable_audio = true; // Kaeru only. If false, then transcode_audio is also false. bool use_zerocopy = false; // Not user-settable. bool fullscreen = false; std::map card_to_mjpeg_stream_export; // If a card is not in the map, it is not exported. std::string srt_destination_host; std::string srt_destination_port; std::string srt_streamid; std::string srt_passphrase; int srt_output_latency_ms = DEFAULT_SRT_OUTPUT_LATENCY_MS; }; extern Flags global_flags; enum Program { PROGRAM_NAGERU, PROGRAM_KAERU }; void usage(Program program); void parse_flags(Program program, int argc, char * const argv[]); #endif // !defined(_FLAGS_H) nageru-2.3.0/nageru/glwidget.cpp000066400000000000000000000340171450736322200166010ustar00rootroot00000000000000#include "glwidget.h" #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include "audio_mixer.h" #include "shared/context.h" #include "context_menus.h" #include "flags.h" #include "mainwindow.h" #include "mixer.h" #include "shared/ref_counted_gl_sync.h" class QMouseEvent; #undef Success #include #include using namespace movit; using namespace std; using namespace std::placeholders; namespace { double srgb_to_linear(double x) { if (x < 0.04045) { return x / 12.92; } else { return pow((x + 0.055) / 1.055, 2.4); } } } // namespace GLWidget::GLWidget(QWidget *parent) : QGLWidget(parent, global_share_widget) { } GLWidget::~GLWidget() { } void GLWidget::shutdown() { if (resource_pool != nullptr) { makeCurrent(); resource_pool->clean_context(); } global_mixer->remove_frame_ready_callback(output, this); } void GLWidget::grab_white_balance(unsigned channel, unsigned x, unsigned y) { // Set the white balance to neutral for the grab. It's probably going to // flicker a bit, but hopefully this display is not live anyway. global_mixer->set_wb(output, 1.0, 1.0, 1.0); global_mixer->wait_for_next_frame(); // Mark that the next paintGL() should grab the given pixel. grab_x = x; grab_y = y; grab_output = Mixer::Output(Mixer::OUTPUT_INPUT0 + channel); should_grab = true; updateGL(); } void GLWidget::initializeGL() { static once_flag flag; call_once(flag, [this]{ global_mixer = new Mixer(QGLFormat::toSurfaceFormat(format())); global_audio_mixer = global_mixer->get_audio_mixer(); global_mainwindow->mixer_created(global_mixer); global_mixer->start(); }); global_mixer->add_frame_ready_callback(output, this, [this]{ QMetaObject::invokeMethod(this, "update", Qt::AutoConnection); }); global_mixer->set_name_updated_callback(output, [this](const string &name){ emit name_updated(output, name); }); if (output == Mixer::OUTPUT_LIVE) { global_mixer->set_transition_names_updated_callback(output, [this](const vector &names){ emit transition_names_updated(names); }); } if (output >= Mixer::OUTPUT_INPUT0) { global_mixer->set_color_updated_callback(output, [this](const string &color){ emit color_updated(output, color); }); } setContextMenuPolicy(Qt::CustomContextMenu); connect(this, &QWidget::customContextMenuRequested, bind(&GLWidget::show_context_menu, this, _1)); glDisable(GL_BLEND); glDisable(GL_DEPTH_TEST); glDepthMask(GL_FALSE); } void GLWidget::resizeGL(int width, int height) { current_width = width; current_height = height; glViewport(0, 0, width, height); } void GLWidget::paintGL() { Mixer::DisplayFrame frame; if (!global_mixer->get_display_frame(output, &frame)) { glClearColor(0.0f, 1.0f, 0.0f, 1.0f); check_error(); glClear(GL_COLOR_BUFFER_BIT | GL_DEPTH_BUFFER_BIT); check_error(); return; } check_error(); glWaitSync(frame.ready_fence.get(), /*flags=*/0, GL_TIMEOUT_IGNORED); check_error(); frame.setup_chain(); check_error(); glDisable(GL_FRAMEBUFFER_SRGB); check_error(); frame.chain->render_to_fbo(0, current_width, current_height); check_error(); if (resource_pool == nullptr) { resource_pool = frame.chain->get_resource_pool(); } else { assert(resource_pool == frame.chain->get_resource_pool()); } if (should_grab) { GLfloat reference_color[4]; glReadPixels(grab_x, current_height - grab_y - 1, 1, 1, GL_BGRA, GL_FLOAT, reference_color); double r = srgb_to_linear(reference_color[2]); double g = srgb_to_linear(reference_color[1]); double b = srgb_to_linear(reference_color[0]); global_mixer->set_wb(grab_output, r, g, b); should_grab = false; } } void GLWidget::mousePressEvent(QMouseEvent *event) { emit clicked(); } void GLWidget::show_context_menu(const QPoint &pos) { if (output == Mixer::OUTPUT_LIVE) { show_live_context_menu(pos); } if (output >= Mixer::OUTPUT_INPUT0) { int signal_num = global_mixer->map_channel_to_signal(output); if (signal_num != -1) { show_preview_context_menu(signal_num, pos); } } } void GLWidget::show_live_context_menu(const QPoint &pos) { QPoint global_pos = mapToGlobal(pos); QMenu menu; // Add a submenu for selecting output card, with an action for each card. QMenu card_submenu; fill_hdmi_sdi_output_device_menu(&card_submenu); card_submenu.setTitle("HDMI/SDI output device"); menu.addMenu(&card_submenu); // Add a submenu for choosing the output resolution. Since this is // card-dependent, it is disabled if we haven't chosen a card // (but it's still there so that the user will know it exists). QMenu resolution_submenu; fill_hdmi_sdi_output_resolution_menu(&resolution_submenu); resolution_submenu.setTitle("HDMI/SDI output resolution"); menu.addMenu(&resolution_submenu); // Show the menu; if there's an action selected, it will deal with it itself. menu.exec(global_pos); } void GLWidget::show_preview_context_menu(unsigned signal_num, const QPoint &pos) { QPoint global_pos = mapToGlobal(pos); QMenu menu; // Add a submenu for selecting input card, with an action for each card. QMenu card_submenu; QActionGroup card_group(&card_submenu); QMenu interpretation_submenu; QActionGroup interpretation_group(&interpretation_submenu); QMenu video_input_submenu; QActionGroup video_input_group(&video_input_submenu); QMenu audio_input_submenu; QActionGroup audio_input_group(&audio_input_submenu); QMenu mode_submenu; QActionGroup mode_group(&mode_submenu); unsigned current_card = global_mixer->map_signal_to_card(signal_num); bool is_ffmpeg = global_mixer->card_is_ffmpeg(current_card); if (!is_ffmpeg) { // FFmpeg inputs are not connected to any card; they're locked to a given input and have a given Y'CbCr interpretatio and have a given Y'CbCr interpretation. for (unsigned card_index = 0; card_index < MAX_VIDEO_CARDS; ++card_index) { if (!global_mixer->card_is_active(card_index)) continue; if (global_mixer->card_is_cef(card_index) || global_mixer->card_is_ffmpeg(card_index)) continue; QString description(QString::fromStdString(global_mixer->get_card_description(card_index))); QAction *action = new QAction(description, &card_group); action->setCheckable(true); if (current_card == card_index) { action->setChecked(true); } action->setData(QList{"card", card_index}); card_submenu.addAction(action); } card_submenu.setTitle("Input source"); menu.addMenu(&card_submenu); // Note that this setting depends on which card is active. YCbCrInterpretation current_interpretation = global_mixer->get_input_ycbcr_interpretation(current_card); { QAction *action = new QAction("Auto", &interpretation_group); action->setCheckable(true); if (current_interpretation.ycbcr_coefficients_auto) { action->setChecked(true); } action->setData(QList{"interpretation", true, YCBCR_REC_709, false}); interpretation_submenu.addAction(action); } for (YCbCrLumaCoefficients ycbcr_coefficients : { YCBCR_REC_709, YCBCR_REC_601 }) { for (bool full_range : { false, true }) { std::string description; if (ycbcr_coefficients == YCBCR_REC_709) { description = "Rec. 709 (HD)"; } else { description = "Rec. 601 (SD)"; } if (full_range) { description += ", full range (nonstandard)"; } QAction *action = new QAction(QString::fromStdString(description), &interpretation_group); action->setCheckable(true); if (!current_interpretation.ycbcr_coefficients_auto && ycbcr_coefficients == current_interpretation.ycbcr_coefficients && full_range == current_interpretation.full_range) { action->setChecked(true); } action->setData(QList{"interpretation", false, ycbcr_coefficients, full_range}); interpretation_submenu.addAction(action); } } interpretation_submenu.setTitle("Input interpretation"); menu.addMenu(&interpretation_submenu); } // --- The choices in the next few options depend a lot on which card is active --- bool has_auto_mode = false; QAction *change_url_action = nullptr; if (is_ffmpeg) { // Add a menu to change the source URL if we're an FFmpeg card. // (The theme can still override.) change_url_action = new QAction("Change source filename/URL…", &menu); menu.addAction(change_url_action); } else { // Add a submenu for selecting video input, with an action for each input. std::map video_inputs = global_mixer->get_available_video_inputs(current_card); uint32_t current_video_input = global_mixer->get_current_video_input(current_card); for (const auto &mode : video_inputs) { QString description(QString::fromStdString(mode.second)); QAction *action = new QAction(description, &video_input_group); action->setCheckable(true); if (mode.first == current_video_input) { action->setChecked(true); } action->setData(QList{"video_input", mode.first}); video_input_submenu.addAction(action); } video_input_submenu.setTitle("Video input"); menu.addMenu(&video_input_submenu); // The same for audio input. std::map audio_inputs = global_mixer->get_available_audio_inputs(current_card); uint32_t current_audio_input = global_mixer->get_current_audio_input(current_card); for (const auto &mode : audio_inputs) { QString description(QString::fromStdString(mode.second)); QAction *action = new QAction(description, &audio_input_group); action->setCheckable(true); if (mode.first == current_audio_input) { action->setChecked(true); } action->setData(QList{"audio_input", mode.first}); audio_input_submenu.addAction(action); } audio_input_submenu.setTitle("Audio input"); menu.addMenu(&audio_input_submenu); // The same for resolution. std::map video_modes = global_mixer->get_available_video_modes(current_card); uint32_t current_video_mode = global_mixer->get_current_video_mode(current_card); for (const auto &mode : video_modes) { QString description(QString::fromStdString(mode.second.name)); QAction *action = new QAction(description, &mode_group); action->setCheckable(true); if (mode.first == current_video_mode) { action->setChecked(true); } action->setData(QList{"video_mode", mode.first}); mode_submenu.addAction(action); // TODO: Relying on the 0 value here (from bmusb.h) is ugly, it should be a named constant. if (mode.first == 0) { has_auto_mode = true; } } // Add a “scan” menu if there's no “auto” mode. if (!has_auto_mode) { QAction *action = new QAction("Scan", &mode_group); action->setData(QList{"video_mode", 0}); mode_submenu.addSeparator(); mode_submenu.addAction(action); } mode_submenu.setTitle("Input mode"); menu.addMenu(&mode_submenu); } // --- End of card-dependent choices --- // Add an audio source selector. QAction *audio_source_action = nullptr; if (global_audio_mixer->get_mapping_mode() == AudioMixer::MappingMode::SIMPLE) { audio_source_action = new QAction("Use as audio source", &menu); audio_source_action->setCheckable(true); if (global_audio_mixer->get_simple_input() == current_card) { audio_source_action->setChecked(true); audio_source_action->setEnabled(false); } menu.addAction(audio_source_action); } // And a master clock selector. QAction *master_clock_action = new QAction("Use as master clock", &menu); master_clock_action->setCheckable(true); if (global_mixer->get_output_card_index() != -1 && global_mixer->get_output_card_is_master()) { master_clock_action->setChecked(false); master_clock_action->setEnabled(false); } else if (global_mixer->get_master_clock() == signal_num) { master_clock_action->setChecked(true); master_clock_action->setEnabled(false); } menu.addAction(master_clock_action); // Show the menu and look at the result. QAction *selected_item = menu.exec(global_pos); if (audio_source_action != nullptr && selected_item == audio_source_action) { global_audio_mixer->set_simple_input(current_card); } else if (change_url_action != nullptr && selected_item == change_url_action) { // NOTE: We can't use “this” as parent, since the dialog would inherit our style sheet. bool ok; const string url = global_mixer->get_ffmpeg_filename(current_card); QString new_url = QInputDialog::getText(window(), tr("Change URL"), tr("Enter new filename/URL for the given video input:"), QLineEdit::Normal, QString::fromStdString(url), &ok); // FIXME prefill the input if (ok) { global_mixer->set_ffmpeg_filename(current_card, new_url.toStdString()); } } else if (selected_item == master_clock_action) { global_mixer->set_master_clock(signal_num); } else if (selected_item != nullptr) { QList selected = selected_item->data().toList(); if (selected[0].toString() == "video_mode") { uint32_t mode = selected[1].toUInt(nullptr); if (mode == 0 && !has_auto_mode) { global_mixer->start_mode_scanning(current_card); } else { global_mixer->set_video_mode(current_card, mode); } } else if (selected[0].toString() == "video_input") { uint32_t input = selected[1].toUInt(nullptr); global_mixer->set_video_input(current_card, input); } else if (selected[0].toString() == "audio_input") { uint32_t input = selected[1].toUInt(nullptr); global_mixer->set_audio_input(current_card, input); } else if (selected[0].toString() == "card") { unsigned card_index = selected[1].toUInt(nullptr); global_mixer->set_signal_mapping(signal_num, card_index); } else if (selected[0].toString() == "interpretation") { YCbCrInterpretation interpretation; interpretation.ycbcr_coefficients_auto = selected[1].toBool(); interpretation.ycbcr_coefficients = YCbCrLumaCoefficients(selected[2].toUInt(nullptr)); interpretation.full_range = selected[3].toBool(); global_mixer->set_input_ycbcr_interpretation(current_card, interpretation); } else { assert(false); } } } nageru-2.3.0/nageru/glwidget.h000066400000000000000000000032631450736322200162450ustar00rootroot00000000000000#ifndef GLWIDGET_H #define GLWIDGET_H #include #include #include #include #include #include "mixer.h" class QMouseEvent; class QObject; class QPoint; class QWidget; namespace movit { class ResourcePool; } // namespace movit // Note: We use the older QGLWidget instead of QOpenGLWidget as it is // much faster (does not go through a separate offscreen rendering step). // // TODO: Consider if QOpenGLWindow could do what we want. class GLWidget : public QGLWidget { Q_OBJECT public: GLWidget(QWidget *parent = 0); ~GLWidget(); void set_output(Mixer::Output output) { this->output = output; } void shutdown(); // NOTE: Will make the white balance flicker for a frame. void grab_white_balance(unsigned channel, unsigned x, unsigned y); protected: void initializeGL() override; void resizeGL(int width, int height) override; void paintGL() override; void mousePressEvent(QMouseEvent *event) override; signals: void clicked(); void transition_names_updated(std::vector transition_names); void name_updated(Mixer::Output output, const std::string &name); void color_updated(Mixer::Output output, const std::string &color); private slots: void show_context_menu(const QPoint &pos); private: void show_live_context_menu(const QPoint &pos); void show_preview_context_menu(unsigned signal_num, const QPoint &pos); Mixer::Output output; GLuint vao, program_num; GLuint position_vbo, texcoord_vbo; movit::ResourcePool *resource_pool = nullptr; int current_width = 1, current_height = 1; bool should_grab = false; unsigned grab_x, grab_y; Mixer::Output grab_output; // Should nominally be the same as output. }; #endif nageru-2.3.0/nageru/image_input.cpp000066400000000000000000000245401450736322200172740ustar00rootroot00000000000000#include "image_input.h" #include #include #include #include #include #include #include #include extern "C" { #include #include #include #include #include #include #include #include #include } #include #include #include #include #include #include #include #include #include #include #include "shared/context.h" #include "shared/ffmpeg_raii.h" #include "ffmpeg_util.h" #include "flags.h" struct SwsContext; using namespace std; ImageInput::ImageInput() : sRGBSwitchingFlatInput({movit::COLORSPACE_sRGB, movit::GAMMA_sRGB}, movit::FORMAT_RGBA_POSTMULTIPLIED_ALPHA, GL_UNSIGNED_BYTE, 1280, 720) // Resolution will be overwritten. {} ImageInput::ImageInput(const string &filename) : sRGBSwitchingFlatInput({movit::COLORSPACE_sRGB, movit::GAMMA_sRGB}, movit::FORMAT_RGBA_POSTMULTIPLIED_ALPHA, GL_UNSIGNED_BYTE, 1280, 720), // Resolution will be overwritten. pathname(search_for_file_or_die(filename)), current_image(load_image(filename, pathname)) { if (current_image == nullptr) { // Could happen even though search_for_file() returned. fprintf(stderr, "Couldn't load image, exiting.\n"); abort(); } set_width(current_image->width); set_height(current_image->height); set_texture_num(*current_image->tex); } void ImageInput::set_gl_state(GLuint glsl_program_num, const string& prefix, unsigned *sampler_num) { // See if the background thread has given us a new version of our image. // Note: The old version might still be lying around in other ImageInputs // (in fact, it's likely), but at least the total amount of memory used // is bounded. Currently we don't even share textures between them, // so there's a fair amount of OpenGL memory waste anyway (the cache // is mostly there to save startup time, not RAM). { lock_guard lock(all_images_lock); assert(all_images.count(pathname)); if (all_images[pathname] != current_image) { current_image = all_images[pathname]; set_texture_num(*current_image->tex); } } sRGBSwitchingFlatInput::set_gl_state(glsl_program_num, prefix, sampler_num); } shared_ptr ImageInput::load_image(const string &filename, const string &pathname) { lock_guard lock(all_images_lock); // Held also during loading. if (all_images.count(pathname)) { return all_images[pathname]; } all_images[pathname] = load_image_raw(pathname); return all_images[pathname]; } shared_ptr ImageInput::load_image_raw(const string &pathname) { // Note: Call before open, not after; otherwise, there's a race. // (There is now, too, but it tips the correct way. We could use fstat() // if we had the file descriptor.) struct stat buf; if (stat(pathname.c_str(), &buf) != 0) { fprintf(stderr, "%s: Error stat-ing file\n", pathname.c_str()); return nullptr; } timespec last_modified = buf.st_mtim; auto format_ctx = avformat_open_input_unique(pathname.c_str(), nullptr, nullptr); if (format_ctx == nullptr) { fprintf(stderr, "%s: Error opening file\n", pathname.c_str()); return nullptr; } if (avformat_find_stream_info(format_ctx.get(), nullptr) < 0) { fprintf(stderr, "%s: Error finding stream info\n", pathname.c_str()); return nullptr; } int stream_index = find_stream_index(format_ctx.get(), AVMEDIA_TYPE_VIDEO); if (stream_index == -1) { fprintf(stderr, "%s: No video stream found\n", pathname.c_str()); return nullptr; } const AVCodecParameters *codecpar = format_ctx->streams[stream_index]->codecpar; AVCodecContextWithDeleter codec_ctx = avcodec_alloc_context3_unique(nullptr); if (avcodec_parameters_to_context(codec_ctx.get(), codecpar) < 0) { fprintf(stderr, "%s: Cannot fill codec parameters\n", pathname.c_str()); return nullptr; } const AVCodec *codec = avcodec_find_decoder(codecpar->codec_id); if (codec == nullptr) { fprintf(stderr, "%s: Cannot find decoder\n", pathname.c_str()); return nullptr; } if (avcodec_open2(codec_ctx.get(), codec, nullptr) < 0) { fprintf(stderr, "%s: Cannot open decoder\n", pathname.c_str()); return nullptr; } unique_ptr codec_ctx_cleanup( codec_ctx.get(), avcodec_close); // Read packets until we have a frame or there are none left. int frame_finished = 0; AVFrameWithDeleter frame = av_frame_alloc_unique(); bool eof = false; do { AVPacketWithDeleter pkt = av_packet_alloc_unique(); pkt->data = nullptr; pkt->size = 0; if (av_read_frame(format_ctx.get(), pkt.get()) == 0) { if (pkt->stream_index != stream_index) { continue; } if (avcodec_send_packet(codec_ctx.get(), pkt.get()) < 0) { fprintf(stderr, "%s: Cannot send packet to codec.\n", pathname.c_str()); return nullptr; } } else { eof = true; // Or error, but ignore that for the time being. } int err = avcodec_receive_frame(codec_ctx.get(), frame.get()); if (err == 0) { frame_finished = true; break; } else if (err != AVERROR(EAGAIN)) { fprintf(stderr, "%s: Cannot receive frame from codec.\n", pathname.c_str()); return nullptr; } } while (!eof); if (!frame_finished) { fprintf(stderr, "%s: Decoder did not output frame.\n", pathname.c_str()); return nullptr; } uint8_t *pic_data[4] = {nullptr}; unique_ptr pic_data_cleanup( &pic_data[0], av_freep); int linesizes[4]; if (av_image_alloc(pic_data, linesizes, frame->width, frame->height, AV_PIX_FMT_RGBA, 1) < 0) { fprintf(stderr, "%s: Could not allocate picture data\n", pathname.c_str()); return nullptr; } unique_ptr sws_ctx( sws_getContext(frame->width, frame->height, (AVPixelFormat)frame->format, frame->width, frame->height, AV_PIX_FMT_RGBA, SWS_BICUBIC, nullptr, nullptr, nullptr), sws_freeContext); if (sws_ctx == nullptr) { fprintf(stderr, "%s: Could not create scaler context\n", pathname.c_str()); return nullptr; } sws_scale(sws_ctx.get(), frame->data, frame->linesize, 0, frame->height, pic_data, linesizes); size_t len = frame->width * frame->height * 4; unique_ptr image_data(new uint8_t[len]); av_image_copy_to_buffer(image_data.get(), len, pic_data, linesizes, AV_PIX_FMT_RGBA, frame->width, frame->height, 1); // Create and upload the texture. We always make mipmaps, since we have // generally no idea of all the different chains that might crop up. GLuint tex; glGenTextures(1, &tex); check_error(); glBindTexture(GL_TEXTURE_2D, tex); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_MIN_FILTER, GL_LINEAR_MIPMAP_NEAREST); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_S, GL_CLAMP_TO_EDGE); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_T, GL_CLAMP_TO_EDGE); check_error(); // Actual upload. glPixelStorei(GL_UNPACK_ALIGNMENT, 1); check_error(); glPixelStorei(GL_UNPACK_ROW_LENGTH, linesizes[0] / 4); check_error(); glTexImage2D(GL_TEXTURE_2D, 0, GL_SRGB8_ALPHA8, frame->width, frame->height, 0, GL_RGBA, GL_UNSIGNED_INT_8_8_8_8_REV, image_data.get()); check_error(); glPixelStorei(GL_UNPACK_ROW_LENGTH, 0); check_error(); glGenerateMipmap(GL_TEXTURE_2D); check_error(); glBindTexture(GL_TEXTURE_2D, 0); check_error(); shared_ptr image(new Image{unsigned(frame->width), unsigned(frame->height), UniqueTexture(new GLuint(tex)), last_modified}); return image; } // Fire up a thread to update all images every second. // We could do inotify, but this is good enough for now. void ImageInput::update_thread_func(QSurface *surface) { pthread_setname_np(pthread_self(), "Update_Images"); eglBindAPI(EGL_OPENGL_API); QOpenGLContext *context = create_context(surface); if (!make_current(context, surface)) { printf("Couldn't initialize OpenGL context!\n"); abort(); } struct stat buf; for ( ;; ) { { unique_lock lock(update_thread_should_quit_mu); update_thread_should_quit_modified.wait_for(lock, chrono::seconds(1), [] { return update_thread_should_quit; }); } if (update_thread_should_quit) { return; } // Go through all loaded images and see if they need to be updated. // We do one pass first through the array with no I/O, to avoid // blocking the renderer. vector> images_to_check; { unique_lock lock(all_images_lock); for (const auto &pathname_and_image : all_images) { const string pathname = pathname_and_image.first; const timespec last_modified = pathname_and_image.second->last_modified; images_to_check.emplace_back(pathname, last_modified); } } for (const auto &pathname_and_timespec : images_to_check) { const string pathname = pathname_and_timespec.first; const timespec last_modified = pathname_and_timespec.second; if (stat(pathname.c_str(), &buf) != 0) { fprintf(stderr, "%s: Couldn't check for new version, leaving the old in place.\n", pathname.c_str()); continue; } if (buf.st_mtim.tv_sec == last_modified.tv_sec && buf.st_mtim.tv_nsec == last_modified.tv_nsec) { // Not changed. continue; } shared_ptr image = load_image_raw(pathname); if (image == nullptr) { fprintf(stderr, "Couldn't load image, leaving the old in place.\n"); continue; } unique_lock lock(all_images_lock); all_images[pathname] = image; } } } void ImageInput::switch_image(const string &pathname) { #ifndef NDEBUG lock_guard lock(all_images_lock); assert(all_images.count(pathname)); #endif this->pathname = pathname; } void ImageInput::start_update_thread(QSurface *surface) { update_thread = thread(update_thread_func, surface); } void ImageInput::end_update_thread() { { lock_guard lock(update_thread_should_quit_mu); update_thread_should_quit = true; update_thread_should_quit_modified.notify_all(); } update_thread.join(); } mutex ImageInput::all_images_lock; map> ImageInput::all_images; thread ImageInput::update_thread; mutex ImageInput::update_thread_should_quit_mu; bool ImageInput::update_thread_should_quit = false; condition_variable ImageInput::update_thread_should_quit_modified; nageru-2.3.0/nageru/image_input.h000066400000000000000000000042131450736322200167340ustar00rootroot00000000000000#ifndef _IMAGE_INPUT_H #define _IMAGE_INPUT_H 1 #include #include #include #include #include #include #include #include #include #include #include #include "shared/ref_counted_texture.h" #include "tweaked_inputs.h" class QSurface; // An output that takes its input from a static image, loaded with ffmpeg. // comes from a single 2D array with chunky pixels. The image is refreshed // from disk about every second. class ImageInput : public sRGBSwitchingFlatInput { public: // For loading images. // NOTE: You will need to call start_update_thread() yourself, once per program. struct Image { unsigned width, height; UniqueTexture tex; timespec last_modified; }; static std::shared_ptr load_image(const std::string &filename, const std::string &pathname); // Actual members. ImageInput(); // Construct an empty input, which can't be used until you call switch_image(). ImageInput(const std::string &filename); std::string effect_type_id() const override { return "ImageInput"; } void set_gl_state(GLuint glsl_program_num, const std::string& prefix, unsigned *sampler_num) override; // Switch to a different image. The image must be previously loaded using load_image(). void switch_image(const std::string &pathname); std::string get_pathname() const { return pathname; } static void start_update_thread(QSurface *surface); static void end_update_thread(); private: std::string pathname; std::shared_ptr current_image; static std::shared_ptr load_image_raw(const std::string &pathname); static void update_thread_func(QSurface *surface); static std::mutex all_images_lock; static std::map> all_images; // Under all_images_lock. static std::thread update_thread; static std::mutex update_thread_should_quit_mu; static bool update_thread_should_quit; // Under thread_should_quit_mu. static std::condition_variable update_thread_should_quit_modified; // Signals when threads_should_quit is set. }; #endif // !defined(_IMAGE_INPUT_H) nageru-2.3.0/nageru/input_mapping.cpp000066400000000000000000000133241450736322200176430ustar00rootroot00000000000000#include "input_mapping.h" #include #include #include #include #include #include #include #include "audio_mixer.h" #include "state.pb.h" #include "shared/text_proto.h" using namespace std; using namespace google::protobuf; bool save_input_mapping_to_file(const map &devices, const InputMapping &input_mapping, const string &filename) { InputMappingProto mapping_proto; { map used_devices; for (const InputMapping::Bus &bus : input_mapping.buses) { if (!used_devices.count(bus.device)) { used_devices.emplace(bus.device, used_devices.size()); global_audio_mixer->serialize_device(bus.device, mapping_proto.add_device()); } BusProto *bus_proto = mapping_proto.add_bus(); bus_proto->set_name(bus.name); bus_proto->set_device_index(used_devices[bus.device]); bus_proto->set_source_channel_left(bus.source_channel[0]); bus_proto->set_source_channel_right(bus.source_channel[1]); } } return save_proto_to_file(mapping_proto, filename); } bool load_input_mapping_from_file(const map &devices, const string &filename, InputMapping *new_mapping) { InputMappingProto mapping_proto; if (!load_proto_from_file(filename, &mapping_proto)) { return false; } // Map devices in the proto to our current ones: // Get a list of all active devices. set remaining_devices; for (const auto &device_spec_and_info : devices) { remaining_devices.insert(device_spec_and_info.first); } // Now look at every device in the serialized protobuf and try to map // it to one device we haven't taken yet. This isn't a full maximal matching, // but it's good enough for our uses. vector device_mapping; for (unsigned device_index = 0; device_index < unsigned(mapping_proto.device_size()); ++device_index) { const DeviceSpecProto &device_proto = mapping_proto.device(device_index); switch (device_proto.type()) { case DeviceSpecProto::SILENCE: device_mapping.push_back(DeviceSpec{InputSourceType::SILENCE, 0}); break; case DeviceSpecProto::CAPTURE_CARD: { // First see if there's a card that matches on both index and name. DeviceSpec spec; spec.type = InputSourceType::CAPTURE_CARD; spec.index = unsigned(device_proto.index()); assert(devices.count(spec)); const DeviceInfo &dev = devices.find(spec)->second; if (remaining_devices.count(spec) && dev.display_name == device_proto.display_name()) { device_mapping.push_back(spec); remaining_devices.erase(spec); goto found_capture_card; } // Scan and see if there's a match on name alone. for (const DeviceSpec &spec : remaining_devices) { if (spec.type == InputSourceType::CAPTURE_CARD && dev.display_name == device_proto.display_name()) { device_mapping.push_back(spec); remaining_devices.erase(spec); goto found_capture_card; } } // OK, see if at least the index is free. if (remaining_devices.count(spec)) { device_mapping.push_back(spec); remaining_devices.erase(spec); goto found_capture_card; } // Give up. device_mapping.push_back(DeviceSpec{InputSourceType::SILENCE, 0}); found_capture_card: break; } case DeviceSpecProto::ALSA_INPUT: { // For ALSA, we don't really care about index, but we can use address // in its place. // First see if there's a card that matches on name, num_channels and address. for (const DeviceSpec &spec : remaining_devices) { assert(devices.count(spec)); const DeviceInfo &dev = devices.find(spec)->second; if (spec.type == InputSourceType::ALSA_INPUT && dev.alsa_name == device_proto.alsa_name() && dev.alsa_info == device_proto.alsa_info() && int(dev.num_channels) == device_proto.num_channels() && dev.alsa_address == device_proto.address()) { device_mapping.push_back(spec); remaining_devices.erase(spec); goto found_alsa_input; } } // Looser check: Ignore the address. for (const DeviceSpec &spec : remaining_devices) { assert(devices.count(spec)); const DeviceInfo &dev = devices.find(spec)->second; if (spec.type == InputSourceType::ALSA_INPUT && dev.alsa_name == device_proto.alsa_name() && dev.alsa_info == device_proto.alsa_info() && int(dev.num_channels) == device_proto.num_channels()) { device_mapping.push_back(spec); remaining_devices.erase(spec); goto found_alsa_input; } } // OK, so we couldn't map this to a device, but perhaps one is added // at some point in the future through hotplug. Create a dead card // matching this one; right now, it will give only silence, // but it could be replaced with something later. // // NOTE: There's a potential race condition here, if the card // gets inserted while we're doing the device remapping // (or perhaps more realistically, while we're reading the // input mapping from disk). DeviceSpec dead_card_spec; dead_card_spec = global_audio_mixer->create_dead_card( device_proto.alsa_name(), device_proto.alsa_info(), device_proto.num_channels()); device_mapping.push_back(dead_card_spec); found_alsa_input: break; } default: assert(false); } } for (const BusProto &bus_proto : mapping_proto.bus()) { if (bus_proto.device_index() < 0 || unsigned(bus_proto.device_index()) >= device_mapping.size()) { return false; } InputMapping::Bus bus; bus.name = bus_proto.name(); bus.device = device_mapping[bus_proto.device_index()]; bus.source_channel[0] = bus_proto.source_channel_left(); bus.source_channel[1] = bus_proto.source_channel_right(); new_mapping->buses.push_back(bus); } return true; } nageru-2.3.0/nageru/input_mapping.h000066400000000000000000000030351450736322200173060ustar00rootroot00000000000000#ifndef _INPUT_MAPPING_H #define _INPUT_MAPPING_H 1 #include #include #include #include enum class InputSourceType { SILENCE, CAPTURE_CARD, ALSA_INPUT }; struct DeviceSpec { InputSourceType type; unsigned index; bool operator== (const DeviceSpec &other) const { return type == other.type && index == other.index; } bool operator< (const DeviceSpec &other) const { if (type != other.type) return type < other.type; return index < other.index; } }; struct DeviceInfo { std::string display_name; unsigned num_channels; std::string alsa_name, alsa_info, alsa_address; // ALSA devices only, obviously. }; static inline uint64_t DeviceSpec_to_key(const DeviceSpec &device_spec) { return (uint64_t(device_spec.type) << 32) | device_spec.index; } static inline DeviceSpec key_to_DeviceSpec(uint64_t key) { return DeviceSpec{ InputSourceType(key >> 32), unsigned(key & 0xffffffff) }; } struct InputMapping { struct Bus { std::string name; DeviceSpec device; int source_channel[2] { -1, -1 }; // Left and right. -1 = none. }; std::vector buses; }; bool save_input_mapping_to_file(const std::map &devices, const InputMapping &mapping, const std::string &filename); bool load_input_mapping_from_file(const std::map &devices, const std::string &filename, InputMapping *mapping); #endif // !defined(_INPUT_MAPPING_H) nageru-2.3.0/nageru/input_mapping.ui000066400000000000000000000107511450736322200174770ustar00rootroot00000000000000 InputMappingDialog 0 0 879 583 Input mapping Device Left input Right input 0 0 30 30 .. 0 0 30 30 .. 30 30 .. 30 30 .. Qt::Horizontal 40 20 &Save… &Load… Qt::Horizontal 40 20 Qt::Horizontal QDialogButtonBox::Cancel|QDialogButtonBox::Ok nageru-2.3.0/nageru/input_mapping_dialog.cpp000066400000000000000000000304601450736322200211620ustar00rootroot00000000000000#include "input_mapping_dialog.h" #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include "alsa_pool.h" #include "defs.h" #include "shared/post_to_main_thread.h" #include "ui_input_mapping.h" using namespace std; using namespace std::placeholders; namespace { bool uses_device(const InputMapping &mapping, DeviceSpec device) { for (const InputMapping::Bus &bus : mapping.buses) { if (bus.device == device) { return true; } } return false; } } // namespace InputMappingDialog::InputMappingDialog() : ui(new Ui::InputMappingDialog), mapping(global_audio_mixer->get_input_mapping()), old_mapping(mapping), devices(global_audio_mixer->get_devices()) { for (unsigned bus_index = 0; bus_index < mapping.buses.size(); ++bus_index) { bus_settings.push_back(global_audio_mixer->get_bus_settings(bus_index)); } ui->setupUi(this); ui->table->setSelectionBehavior(QAbstractItemView::SelectRows); ui->table->setSelectionMode(QAbstractItemView::SingleSelection); // Makes implementing moving easier for now. fill_ui_from_mapping(mapping); connect(ui->table, &QTableWidget::cellChanged, this, &InputMappingDialog::cell_changed); connect(ui->ok_cancel_buttons, &QDialogButtonBox::accepted, this, &InputMappingDialog::ok_clicked); connect(ui->ok_cancel_buttons, &QDialogButtonBox::rejected, this, &InputMappingDialog::cancel_clicked); connect(ui->add_button, &QPushButton::clicked, this, &InputMappingDialog::add_clicked); connect(ui->remove_button, &QPushButton::clicked, this, &InputMappingDialog::remove_clicked); connect(ui->up_button, &QPushButton::clicked, bind(&InputMappingDialog::updown_clicked, this, -1)); connect(ui->down_button, &QPushButton::clicked, bind(&InputMappingDialog::updown_clicked, this, 1)); connect(ui->save_button, &QPushButton::clicked, this, &InputMappingDialog::save_clicked); connect(ui->load_button, &QPushButton::clicked, this, &InputMappingDialog::load_clicked); update_button_state(); connect(ui->table, &QTableWidget::itemSelectionChanged, this, &InputMappingDialog::update_button_state); saved_callback = global_audio_mixer->get_state_changed_callback(); global_audio_mixer->set_state_changed_callback([this]{ post_to_main_thread([this]{ devices = global_audio_mixer->get_devices(); for (unsigned row = 0; row < mapping.buses.size(); ++row) { fill_row_from_bus(row, mapping.buses[row]); } }); }); } InputMappingDialog::~InputMappingDialog() { global_audio_mixer->set_state_changed_callback(saved_callback); } void InputMappingDialog::fill_ui_from_mapping(const InputMapping &mapping) { ui->table->verticalHeader()->hide(); ui->table->horizontalHeader()->setSectionResizeMode(1, QHeaderView::ResizeToContents); ui->table->horizontalHeader()->setSectionResizeMode(2, QHeaderView::ResizeToContents); ui->table->horizontalHeader()->setSectionResizeMode(3, QHeaderView::ResizeToContents); ui->table->horizontalHeader()->setSectionsClickable(false); ui->table->setRowCount(mapping.buses.size()); for (unsigned row = 0; row < mapping.buses.size(); ++row) { fill_row_from_bus(row, mapping.buses[row]); } } void InputMappingDialog::fill_row_from_bus(unsigned row, const InputMapping::Bus &bus) { QString name(QString::fromStdString(bus.name)); ui->table->setItem(row, 0, new QTableWidgetItem(name)); // Card choices. If there's already a combobox here, we try to modify // the elements in-place, so that the UI doesn't go away under the user's feet // if they are in the process of choosing an item. QComboBox *card_combo = static_cast(ui->table->cellWidget(row, 1)); if (card_combo == nullptr) { card_combo = new QComboBox; } unsigned current_index = 0; if (card_combo->count() == 0) { card_combo->addItem(QString("(none) ")); } for (const auto &spec_and_info : devices) { QString label(QString::fromStdString(spec_and_info.second.display_name)); if (spec_and_info.first.type == InputSourceType::ALSA_INPUT) { ALSAPool::Device::State state = global_audio_mixer->get_alsa_card_state(spec_and_info.first.index); if (state == ALSAPool::Device::State::EMPTY) { continue; } else if (state == ALSAPool::Device::State::STARTING) { label += " (busy)"; } else if (state == ALSAPool::Device::State::DEAD) { label += " (dead)"; } } else if (!global_audio_mixer->get_active(spec_and_info.first)) { // Should nominally be skipped, but if we used it before it went away, // we'll need to allow the user to still see it. if (uses_device(mapping, spec_and_info.first) || uses_device(old_mapping, spec_and_info.first)) { label += " (dead)"; } else { continue; } } ++current_index; if (unsigned(card_combo->count()) > current_index) { card_combo->setItemText(current_index, label + " "); card_combo->setItemData(current_index, qulonglong(DeviceSpec_to_key(spec_and_info.first))); } else { card_combo->addItem( label + " ", qulonglong(DeviceSpec_to_key(spec_and_info.first))); } if (bus.device == spec_and_info.first) { card_combo->setCurrentIndex(current_index); } } // Remove any excess items from earlier. (This is only for paranoia; // they should be held, so it shouldn't matter.) while (unsigned(card_combo->count()) > current_index + 1) { card_combo->removeItem(current_index + 1); } connect(card_combo, static_cast(&QComboBox::currentIndexChanged), bind(&InputMappingDialog::card_selected, this, card_combo, row, _1)); ui->table->setCellWidget(row, 1, card_combo); setup_channel_choices_from_bus(row, bus); } void InputMappingDialog::setup_channel_choices_from_bus(unsigned row, const InputMapping::Bus &bus) { // Left and right channel. // TODO: If there's already a widget here, modify it instead of creating a new one, // as we do with card choices. for (unsigned channel = 0; channel < 2; ++channel) { QComboBox *channel_combo = new QComboBox; channel_combo->addItem(QString("(none)")); if (bus.device.type == InputSourceType::CAPTURE_CARD || bus.device.type == InputSourceType::ALSA_INPUT) { auto device_it = devices.find(bus.device); assert(device_it != devices.end()); unsigned num_device_channels = device_it->second.num_channels; for (unsigned source = 0; source < num_device_channels; ++source) { char buf[256]; snprintf(buf, sizeof(buf), "Channel %u ", source + 1); channel_combo->addItem(QString(buf)); } channel_combo->setCurrentIndex(bus.source_channel[channel] + 1); } else { assert(bus.device.type == InputSourceType::SILENCE); channel_combo->setCurrentIndex(0); } connect(channel_combo, static_cast(&QComboBox::currentIndexChanged), bind(&InputMappingDialog::channel_selected, this, row, channel, _1)); ui->table->setCellWidget(row, 2 + channel, channel_combo); } } void InputMappingDialog::ok_clicked() { global_audio_mixer->set_state_changed_callback(saved_callback); global_audio_mixer->set_input_mapping(mapping); for (unsigned bus_index = 0; bus_index < mapping.buses.size(); ++bus_index) { global_audio_mixer->set_bus_settings(bus_index, bus_settings[bus_index]); global_audio_mixer->reset_peak(bus_index); } accept(); } void InputMappingDialog::cancel_clicked() { global_audio_mixer->set_state_changed_callback(saved_callback); global_audio_mixer->set_input_mapping(old_mapping); reject(); } void InputMappingDialog::cell_changed(int row, int column) { if (column != 0) { // Spurious; only really the name column should fire these. return; } mapping.buses[row].name = ui->table->item(row, column)->text().toStdString(); } void InputMappingDialog::card_selected(QComboBox *card_combo, unsigned row, int index) { uint64_t key = card_combo->itemData(index).toULongLong(); mapping.buses[row].device = key_to_DeviceSpec(key); setup_channel_choices_from_bus(row, mapping.buses[row]); } void InputMappingDialog::channel_selected(unsigned row, unsigned channel, int index) { mapping.buses[row].source_channel[channel] = index - 1; } void InputMappingDialog::add_clicked() { QTableWidgetSelectionRange all(0, 0, ui->table->rowCount() - 1, ui->table->columnCount() - 1); ui->table->setRangeSelected(all, false); InputMapping::Bus new_bus; new_bus.name = "New input"; new_bus.device.type = InputSourceType::SILENCE; mapping.buses.push_back(new_bus); bus_settings.push_back(AudioMixer::get_default_bus_settings()); ui->table->setRowCount(mapping.buses.size()); unsigned row = mapping.buses.size() - 1; fill_row_from_bus(row, new_bus); ui->table->editItem(ui->table->item(row, 0)); // Start editing the name. update_button_state(); } void InputMappingDialog::remove_clicked() { assert(ui->table->rowCount() != 0); set> rows_to_delete; // Need to remove in reverse order. for (const QTableWidgetSelectionRange &range : ui->table->selectedRanges()) { for (int row = range.topRow(); row <= range.bottomRow(); ++row) { rows_to_delete.insert(row); } } if (rows_to_delete.empty()) { rows_to_delete.insert(ui->table->rowCount() - 1); } for (int row : rows_to_delete) { ui->table->removeRow(row); mapping.buses.erase(mapping.buses.begin() + row); bus_settings.erase(bus_settings.begin() + row); } update_button_state(); } void InputMappingDialog::updown_clicked(int direction) { assert(ui->table->selectedRanges().size() == 1); const QTableWidgetSelectionRange &range = ui->table->selectedRanges()[0]; int a_row = range.bottomRow(); int b_row = range.bottomRow() + direction; swap(mapping.buses[a_row], mapping.buses[b_row]); swap(bus_settings[a_row], bus_settings[b_row]); fill_row_from_bus(a_row, mapping.buses[a_row]); fill_row_from_bus(b_row, mapping.buses[b_row]); QTableWidgetSelectionRange a_sel(a_row, 0, a_row, ui->table->columnCount() - 1); QTableWidgetSelectionRange b_sel(b_row, 0, b_row, ui->table->columnCount() - 1); ui->table->setRangeSelected(a_sel, false); ui->table->setRangeSelected(b_sel, true); } void InputMappingDialog::save_clicked() { #if HAVE_CEF // The native file dialog uses GTK+, which interferes with CEF's use of the GLib main loop. QFileDialog::Option options(QFileDialog::DontUseNativeDialog); #else QFileDialog::Option options(QFileDialog::Option(0)); #endif QString filename = QFileDialog::getSaveFileName(this, "Save input mapping", QString(), tr("Mapping files (*.mapping)"), /*selectedFilter=*/nullptr, options); if (!filename.endsWith(".mapping")) { filename += ".mapping"; } if (!save_input_mapping_to_file(devices, mapping, filename.toStdString())) { QMessageBox box; box.setText("Could not save mapping to '" + filename + "'. Check that you have the right permissions and try again."); box.exec(); } } void InputMappingDialog::load_clicked() { #if HAVE_CEF // The native file dialog uses GTK+, which interferes with CEF's use of the GLib main loop. QFileDialog::Option options(QFileDialog::DontUseNativeDialog); #else QFileDialog::Option options(QFileDialog::Option(0)); #endif QString filename = QFileDialog::getOpenFileName(this, "Load input mapping", QString(), tr("Mapping files (*.mapping)"), /*selectedFilter=*/nullptr, options); InputMapping new_mapping; if (!load_input_mapping_from_file(devices, filename.toStdString(), &new_mapping)) { QMessageBox box; box.setText("Could not load mapping from '" + filename + "'. Check that the file exists, has the right permissions and is valid."); box.exec(); return; } mapping = new_mapping; bus_settings.clear(); for (unsigned bus_index = 0; bus_index < mapping.buses.size(); ++bus_index) { bus_settings.push_back(global_audio_mixer->get_bus_settings(bus_index)); } devices = global_audio_mixer->get_devices(); // New dead cards may have been made. fill_ui_from_mapping(mapping); } void InputMappingDialog::update_button_state() { ui->add_button->setDisabled(mapping.buses.size() >= MAX_BUSES); ui->remove_button->setDisabled(mapping.buses.size() == 0); ui->up_button->setDisabled( ui->table->selectedRanges().empty() || ui->table->selectedRanges()[0].bottomRow() == 0); ui->down_button->setDisabled( ui->table->selectedRanges().empty() || ui->table->selectedRanges()[0].bottomRow() == ui->table->rowCount() - 1); } nageru-2.3.0/nageru/input_mapping_dialog.h000066400000000000000000000031741450736322200206310ustar00rootroot00000000000000#ifndef _INPUT_MAPPING_DIALOG_H #define _INPUT_MAPPING_DIALOG_H #include #include #include #include #include "audio_mixer.h" #include "input_mapping.h" class QObject; namespace Ui { class InputMappingDialog; } // namespace Ui class QComboBox; class InputMappingDialog : public QDialog { Q_OBJECT public: InputMappingDialog(); ~InputMappingDialog(); private: void fill_ui_from_mapping(const InputMapping &mapping); void fill_row_from_bus(unsigned row, const InputMapping::Bus &bus); void setup_channel_choices_from_bus(unsigned row, const InputMapping::Bus &bus); void cell_changed(int row, int column); void card_selected(QComboBox *card_combo, unsigned row, int index); void channel_selected(unsigned row, unsigned channel, int index); void ok_clicked(); void cancel_clicked(); void add_clicked(); void remove_clicked(); void updown_clicked(int direction); void save_clicked(); void load_clicked(); void update_button_state(); Ui::InputMappingDialog *ui; InputMapping mapping; // Under edit. Will be committed on OK. // The old mapping. Will be re-committed on cancel, so that we // unhold all the unused devices (otherwise they would be // held forever). InputMapping old_mapping; // One for each bus in the mapping. Edited along with the mapping, // so that old volumes etc. are being kept in place for buses that // existed before. std::vector bus_settings; std::map devices; // Needs no lock, accessed only on the UI thread. AudioMixer::state_changed_callback_t saved_callback; }; #endif // !defined(_INPUT_MAPPING_DIALOG_H) nageru-2.3.0/nageru/input_state.h000066400000000000000000000023401450736322200167710ustar00rootroot00000000000000#ifndef _INPUT_STATE_H #define _INPUT_STATE_H 1 #include #include "defs.h" #include "ref_counted_frame.h" struct BufferedFrame { RefCountedFrame frame; unsigned field_number; }; // Encapsulates the state of all inputs at any given instant. // In particular, this is captured by Theme::get_chain(), // so that it can hold on to all the frames it needs for rendering. struct InputState { // For each card, the last five frames (or fields), with 0 being the // most recent one. Note that we only need the actual history if we have // interlaced output (for deinterlacing), so if we detect progressive input, // we immediately clear out all history and all entries will point to the same // frame. BufferedFrame buffered_frames[MAX_VIDEO_CARDS][FRAME_HISTORY_LENGTH]; // For each card, the current Y'CbCr input settings. Ignored for BGRA inputs. // If ycbcr_coefficients_auto = true for a given card, the others are ignored // for that card (SD is taken to be Rec. 601, HD is taken to be Rec. 709, // both limited range). bool ycbcr_coefficients_auto[MAX_VIDEO_CARDS]; movit::YCbCrLumaCoefficients ycbcr_coefficients[MAX_VIDEO_CARDS]; bool full_range[MAX_VIDEO_CARDS]; }; #endif // !defined(_INPUT_STATE_H) nageru-2.3.0/nageru/json.proto000066400000000000000000000004621450736322200163220ustar00rootroot00000000000000// Messages used to produce JSON (it's the simplest way we can create valid // JSON without pulling in an external JSON library). syntax = "proto2"; message Channels { repeated Channel channel = 1; } message Channel { required int32 index = 1; required string name = 2; required string color = 3; } nageru-2.3.0/nageru/kaeru.cpp000066400000000000000000000245011450736322200160770ustar00rootroot00000000000000// Kaeru (換える), a simple transcoder intended for use with Nageru. #include "audio_encoder.h" #include "basic_stats.h" #include "defs.h" #include "flags.h" #include "ffmpeg_capture.h" #include "mixer.h" #include "shared/mux.h" #include "quittable_sleeper.h" #include "shared/timebase.h" #include "x264_encoder.h" #include #include #include #include #include #include extern "C" { #include } using namespace bmusb; using namespace movit; using namespace std; using namespace std::chrono; using namespace std::placeholders; Mixer *global_mixer = nullptr; X264Encoder *global_x264_encoder = nullptr; int frame_num = 0; BasicStats *global_basic_stats = nullptr; QuittableSleeper should_quit; MuxMetrics stream_mux_metrics; namespace { int write_packet(void *opaque, uint8_t *buf, int buf_size, AVIODataMarkerType type, int64_t time) { static bool seen_sync_markers = false; static string stream_mux_header; HTTPD *httpd = (HTTPD *)opaque; if (type == AVIO_DATA_MARKER_SYNC_POINT || type == AVIO_DATA_MARKER_BOUNDARY_POINT) { seen_sync_markers = true; } else if (type == AVIO_DATA_MARKER_UNKNOWN && !seen_sync_markers) { // We don't know if this is a keyframe or not (the muxer could // avoid marking it), so we just have to make the best of it. type = AVIO_DATA_MARKER_SYNC_POINT; } HTTPD::StreamID stream_id{ HTTPD::MAIN_STREAM, 0 }; if (type == AVIO_DATA_MARKER_HEADER) { stream_mux_header.append((char *)buf, buf_size); httpd->set_header(stream_id, stream_mux_header); } else { httpd->add_data(stream_id, (char *)buf, buf_size, type == AVIO_DATA_MARKER_SYNC_POINT, time, AVRational{ AV_TIME_BASE, 1 }); } return buf_size; } } // namespace unique_ptr create_mux(HTTPD *httpd, const AVOutputFormat *oformat, X264Encoder *x264_encoder, AudioEncoder *audio_encoder) { AVFormatContext *avctx = avformat_alloc_context(); avctx->oformat = const_castoformat)>(oformat); // const_cast is a hack to work in FFmpeg both before and after 5.0. uint8_t *buf = (uint8_t *)av_malloc(MUX_BUFFER_SIZE); avctx->pb = avio_alloc_context(buf, MUX_BUFFER_SIZE, 1, httpd, nullptr, nullptr, nullptr); avctx->pb->write_data_type = &write_packet; avctx->pb->ignore_boundary_point = 1; avctx->flags = AVFMT_FLAG_CUSTOM_IO; string video_extradata = x264_encoder->get_global_headers(); // If audio is disabled (ie., we won't ever see any audio packets), // set nullptr here to also not include the stream in the mux. AVCodecParameters *audio_codecpar = global_flags.enable_audio ? audio_encoder->get_codec_parameters().release() : nullptr; unique_ptr mux; mux.reset(new Mux(avctx, global_flags.width, global_flags.height, Mux::CODEC_H264, video_extradata, audio_codecpar, get_color_space(global_flags.ycbcr_rec709_coefficients), COARSE_TIMEBASE, /*write_callback=*/nullptr, Mux::WRITE_FOREGROUND, { &stream_mux_metrics })); stream_mux_metrics.init({{ "destination", "http" }}); return mux; } void video_frame_callback(FFmpegCapture *video, X264Encoder *x264_encoder, AudioEncoder *audio_encoder, int64_t video_pts, AVRational video_timebase, int64_t audio_pts, AVRational audio_timebase, uint16_t timecode, FrameAllocator::Frame video_frame, size_t video_offset, VideoFormat video_format, FrameAllocator::Frame audio_frame, size_t audio_offset, AudioFormat audio_format) { if (video_pts >= 0 && video_frame.len > 0) { ReceivedTimestamps ts; ts.ts.push_back(steady_clock::now()); video_pts = av_rescale_q(video_pts, video_timebase, AVRational{ 1, TIMEBASE }); int64_t frame_duration = int64_t(TIMEBASE) * video_format.frame_rate_den / video_format.frame_rate_nom; x264_encoder->add_frame(video_pts, frame_duration, video->get_current_frame_ycbcr_format().luma_coefficients, video_frame.data + video_offset, ts); global_basic_stats->update(frame_num++, /*dropped_frames=*/0); } if (audio_frame.len > 0) { // FFmpegCapture takes care of this for us. assert(audio_format.num_channels == 2); assert(audio_format.sample_rate == OUTPUT_FREQUENCY); // TODO: Reduce some duplication against AudioMixer here. size_t num_samples = audio_frame.len / (audio_format.bits_per_sample / 8); vector float_samples; float_samples.resize(num_samples); if (audio_format.bits_per_sample == 16) { const int16_t *src = (const int16_t *)audio_frame.data; float *dst = &float_samples[0]; for (size_t i = 0; i < num_samples; ++i) { *dst++ = int16_t(le16toh(*src++)) * (1.0f / 32768.0f); } } else if (audio_format.bits_per_sample == 32) { const int32_t *src = (const int32_t *)audio_frame.data; float *dst = &float_samples[0]; for (size_t i = 0; i < num_samples; ++i) { *dst++ = int32_t(le32toh(*src++)) * (1.0f / 2147483648.0f); } } else { assert(false); } audio_pts = av_rescale_q(audio_pts, audio_timebase, AVRational{ 1, TIMEBASE }); audio_encoder->encode_audio(float_samples, audio_pts); } if (video_frame.owner) { video_frame.owner->release_frame(video_frame); } if (audio_frame.owner) { audio_frame.owner->release_frame(audio_frame); } } void raw_packet_callback(Mux *mux, int stream_index, const AVPacket *pkt, AVRational timebase) { mux->add_packet(*pkt, pkt->pts, pkt->dts == AV_NOPTS_VALUE ? pkt->pts : pkt->dts, timebase, stream_index); } void filter_packet_callback(Mux *mux, int stream_index, AVBSFContext *bsfctx, const AVPacket *pkt, AVRational timebase) { if (pkt->size <= 2 || pkt->data[0] != 0xff || (pkt->data[1] & 0xf0) != 0xf0) { // Not ADTS data, so just pass it through. mux->add_packet(*pkt, pkt->pts, pkt->dts == AV_NOPTS_VALUE ? pkt->pts : pkt->dts, timebase, stream_index); return; } AVPacket *in_pkt = av_packet_clone(pkt); unique_ptr in_pkt_cleanup(in_pkt, av_packet_unref); int err = av_bsf_send_packet(bsfctx, in_pkt); if (err < 0) { fprintf(stderr, "av_bsf_send_packet() failed with %d, ignoring\n", err); } for ( ;; ) { AVPacketWithDeleter out_pkt = av_packet_alloc_unique(); err = av_bsf_receive_packet(bsfctx, out_pkt.get()); if (err == AVERROR(EAGAIN)) { break; } if (err < 0) { fprintf(stderr, "av_bsf_receive_packet() failed with %d, ignoring\n", err); return; } mux->add_packet(*out_pkt, out_pkt->pts, out_pkt->dts == AV_NOPTS_VALUE ? out_pkt->pts : out_pkt->dts, timebase, stream_index); } } void adjust_bitrate(int signal) { int new_bitrate = global_flags.x264_bitrate; if (signal == SIGUSR1) { new_bitrate += 100; if (new_bitrate > 100000) { fprintf(stderr, "Ignoring SIGUSR1, can't increase bitrate below 100000 kbit/sec (currently at %d kbit/sec)\n", global_flags.x264_bitrate); } else { fprintf(stderr, "Increasing bitrate to %d kbit/sec due to SIGUSR1.\n", new_bitrate); global_flags.x264_bitrate = new_bitrate; global_x264_encoder->change_bitrate(new_bitrate); } } else if (signal == SIGUSR2) { new_bitrate -= 100; if (new_bitrate < 100) { fprintf(stderr, "Ignoring SIGUSR2, can't decrease bitrate below 100 kbit/sec (currently at %d kbit/sec)\n", global_flags.x264_bitrate); } else { fprintf(stderr, "Decreasing bitrate to %d kbit/sec due to SIGUSR2.\n", new_bitrate); global_flags.x264_bitrate = new_bitrate; global_x264_encoder->change_bitrate(new_bitrate); } } } void request_quit(int signal) { should_quit.quit(); } int main(int argc, char *argv[]) { parse_flags(PROGRAM_KAERU, argc, argv); if (optind + 1 != argc) { usage(PROGRAM_KAERU); abort(); } global_flags.max_num_cards = 1; // For latency metrics. #if LIBAVFORMAT_VERSION_INT < AV_VERSION_INT(58, 9, 100) av_register_all(); #endif avformat_network_init(); HTTPD httpd; const AVOutputFormat *oformat = av_guess_format(global_flags.stream_mux_name.c_str(), nullptr, nullptr); assert(oformat != nullptr); unique_ptr audio_encoder; if (global_flags.stream_audio_codec_name.empty()) { audio_encoder.reset(new AudioEncoder(AUDIO_OUTPUT_CODEC_NAME, DEFAULT_AUDIO_OUTPUT_BIT_RATE, oformat)); } else { audio_encoder.reset(new AudioEncoder(global_flags.stream_audio_codec_name, global_flags.stream_audio_codec_bitrate, oformat)); } unique_ptr x264_encoder(new X264Encoder(oformat, /*use_separate_disk_params=*/false)); unique_ptr http_mux = create_mux(&httpd, oformat, x264_encoder.get(), audio_encoder.get()); if (global_flags.transcode_audio) { audio_encoder->add_mux(http_mux.get()); } if (global_flags.transcode_video) { x264_encoder->add_mux(http_mux.get()); } global_x264_encoder = x264_encoder.get(); FFmpegCapture video(argv[optind], global_flags.width, global_flags.height); video.set_pixel_format(FFmpegCapture::PixelFormat_NV12); if (global_flags.transcode_video) { video.set_frame_callback(bind(video_frame_callback, &video, x264_encoder.get(), audio_encoder.get(), _1, _2, _3, _4, _5, _6, _7, _8, _9, _10, _11)); } else { video.set_video_callback(bind(raw_packet_callback, http_mux.get(), /*stream_index=*/0, _1, _2)); } if (!global_flags.transcode_audio && global_flags.enable_audio) { AVBSFContext *bsfctx = nullptr; if (strcmp(oformat->name, "mp4") == 0 && strcmp(audio_encoder->get_codec()->name, "aac") == 0) { // We need to insert the aac_adtstoasc filter, seemingly (or we will get warnings to do so). const AVBitStreamFilter *filter = av_bsf_get_by_name("aac_adtstoasc"); int err = av_bsf_alloc(filter, &bsfctx); if (err < 0) { fprintf(stderr, "av_bsf_alloc() failed with %d\n", err); exit(1); } } if (bsfctx == nullptr) { video.set_audio_callback(bind(raw_packet_callback, http_mux.get(), /*stream_index=*/1, _1, _2)); } else { video.set_audio_callback(bind(filter_packet_callback, http_mux.get(), /*stream_index=*/1, bsfctx, _1, _2)); } } video.configure_card(); video.start_bm_capture(); video.change_rate(10.0); // Play as fast as possible. BasicStats basic_stats(/*verbose=*/false, /*use_opengl=*/false); global_basic_stats = &basic_stats; httpd.start(global_flags.http_port); signal(SIGUSR1, adjust_bitrate); signal(SIGUSR2, adjust_bitrate); signal(SIGINT, request_quit); while (!should_quit.should_quit()) { should_quit.sleep_for(hours(1000)); } video.stop_dequeue_thread(); // Stop the x264 encoder before killing the mux it's writing to. global_x264_encoder = nullptr; x264_encoder.reset(); return 0; } nageru-2.3.0/nageru/lrameter.cpp000066400000000000000000000056171450736322200166120ustar00rootroot00000000000000#include "lrameter.h" #include #include #include #include #include "vu_common.h" class QPaintEvent; class QResizeEvent; using namespace std; LRAMeter::LRAMeter(QWidget *parent) : QWidget(parent) { } void LRAMeter::resizeEvent(QResizeEvent *event) { recalculate_pixmaps(); } void LRAMeter::paintEvent(QPaintEvent *event) { QPainter painter(this); float level_lufs; float range_low_lufs; float range_high_lufs; { lock_guard lock(level_mutex); level_lufs = this->level_lufs; range_low_lufs = this->range_low_lufs; range_high_lufs = this->range_high_lufs; } float level_lu = level_lufs - ref_level_lufs; float range_low_lu = range_low_lufs - ref_level_lufs; float range_high_lu = range_high_lufs - ref_level_lufs; int range_low_pos = lrint(lufs_to_pos(range_low_lu, height())); int range_high_pos = lrint(lufs_to_pos(range_high_lu, height())); QRect top_off_rect(0, 0, width(), range_high_pos); QRect on_rect(0, range_high_pos, width(), range_low_pos - range_high_pos); QRect bottom_off_rect(0, range_low_pos, width(), height() - range_low_pos); painter.drawPixmap(top_off_rect, off_pixmap, top_off_rect); painter.drawPixmap(on_rect, on_pixmap, on_rect); painter.drawPixmap(bottom_off_rect, off_pixmap, bottom_off_rect); // Draw the target area (+/-1 LU is allowed EBU range). // It turns green when we're within. int min_y = lrint(lufs_to_pos(1.0f, height())); int max_y = lrint(lufs_to_pos(-1.0f, height())); // FIXME: This outlining isn't so pretty. { QPen pen(Qt::black); pen.setWidth(5); painter.setPen(pen); painter.drawRect(2, min_y, width() - 5, max_y - min_y); } { QPen pen; if (level_lu >= -1.0f && level_lu <= 1.0f) { pen.setColor(Qt::green); } else { pen.setColor(Qt::red); } pen.setWidth(3); painter.setPen(pen); painter.drawRect(2, min_y, width() - 5, max_y - min_y); } // Draw the integrated loudness meter, in the same color as the target area. int y = lrint(lufs_to_pos(level_lu, height())); { QPen pen(Qt::black); pen.setWidth(5); painter.setPen(pen); painter.drawRect(2, y, width() - 5, 1); } { QPen pen; if (level_lu >= -1.0f && level_lu <= 1.0f) { pen.setColor(Qt::green); } else { pen.setColor(Qt::red); } pen.setWidth(3); painter.setPen(pen); painter.drawRect(2, y, width() - 5, 1); } } void LRAMeter::recalculate_pixmaps() { const int margin = 5; on_pixmap = QPixmap(width(), height()); QPainter on_painter(&on_pixmap); on_painter.fillRect(0, 0, width(), height(), parentWidget()->palette().window()); draw_vu_meter(on_painter, width(), height(), margin, 2.0, true, min_level, max_level, /*flip=*/false); off_pixmap = QPixmap(width(), height()); QPainter off_painter(&off_pixmap); off_painter.fillRect(0, 0, width(), height(), parentWidget()->palette().window()); draw_vu_meter(off_painter, width(), height(), margin, 2.0, false, min_level, max_level, /*flip=*/false); } nageru-2.3.0/nageru/lrameter.h000066400000000000000000000025631450736322200162540ustar00rootroot00000000000000#ifndef LRAMETER_H #define LRAMETER_H #include #include #include #include #include #include "vu_common.h" class QObject; class QPaintEvent; class QResizeEvent; class LRAMeter : public QWidget { Q_OBJECT public: LRAMeter(QWidget *parent); void set_levels(float level_lufs, float range_low_lufs, float range_high_lufs) { std::lock_guard lock(level_mutex); this->level_lufs = level_lufs; this->range_low_lufs = range_low_lufs; this->range_high_lufs = range_high_lufs; QMetaObject::invokeMethod(this, "update", Qt::AutoConnection); } double lufs_to_pos(float level_lu, int height) { return ::lufs_to_pos(level_lu, height, min_level, max_level); } void set_min_level(float min_level) { this->min_level = min_level; recalculate_pixmaps(); } void set_max_level(float max_level) { this->max_level = max_level; recalculate_pixmaps(); } void set_ref_level(float ref_level_lufs) { this->ref_level_lufs = ref_level_lufs; } private: void resizeEvent(QResizeEvent *event) override; void paintEvent(QPaintEvent *event) override; void recalculate_pixmaps(); std::mutex level_mutex; float level_lufs = -HUGE_VAL; float range_low_lufs = -HUGE_VAL; float range_high_lufs = -HUGE_VAL; float min_level = -18.0f, max_level = 9.0f, ref_level_lufs = -23.0f; QPixmap on_pixmap, off_pixmap; }; #endif nageru-2.3.0/nageru/lua_utils.h000066400000000000000000000043271450736322200164420ustar00rootroot00000000000000#ifndef _LUA_UTILS_H #define _LUA_UTILS_H 1 #include #include #include #include class LuaRefWithDeleter { public: LuaRefWithDeleter(std::mutex *m, lua_State *L, int ref) : m(m), L(L), ref(ref) {} ~LuaRefWithDeleter() { std::lock_guard lock(*m); luaL_unref(L, LUA_REGISTRYINDEX, ref); } int get() const { return ref; } private: LuaRefWithDeleter(const LuaRefWithDeleter &) = delete; std::mutex *m; lua_State *L; int ref; }; template int wrap_lua_object(lua_State* L, const char *class_name, Args&&... args) { // Construct the C++ object and put it on the stack. void *mem = lua_newuserdata(L, sizeof(T)); new(mem) T(std::forward(args)...); // Look up the metatable named , and set it on the new object. luaL_getmetatable(L, class_name); lua_setmetatable(L, -2); return 1; } // Like wrap_lua_object, but the object is not owned by Lua; ie. it's not freed // by Lua GC. This is typically the case for Effects, which are owned by EffectChain // and expected to be destructed by it. The object will be of type T** instead of T* // when exposed to Lua. // // Note that we currently leak if you allocate an Effect in this way and never call // add_effect. We should see if there's a way to e.g. set __gc on it at construction time // and then release that once add_effect() takes ownership. template int wrap_lua_object_nonowned(lua_State* L, const char *class_name, Args&&... args) { // Construct the pointer ot the C++ object and put it on the stack. T **obj = (T **)lua_newuserdata(L, sizeof(T *)); *obj = new T(std::forward(args)...); // Look up the metatable named , and set it on the new object. luaL_getmetatable(L, class_name); lua_setmetatable(L, -2); return 1; } template int wrap_lua_existing_object_nonowned(lua_State* L, const char *class_name, T *ptr) { // Construct the pointer ot the C++ object and put it on the stack. T **obj = (T **)lua_newuserdata(L, sizeof(T *)); *obj = ptr; // Look up the metatable named , and set it on the new object. luaL_getmetatable(L, class_name); lua_setmetatable(L, -2); return 1; } #endif // !defined(_LUA_UTILS_H) nageru-2.3.0/nageru/main.cpp000066400000000000000000000100041450736322200157050ustar00rootroot00000000000000extern "C" { #include } #include #include #include #include #include // IWYU pragma: keep #include #include #include #include #include #include #ifdef HAVE_CEF #include #include #include #include #endif #ifdef HAVE_SRT #include #endif #include "basic_stats.h" #ifdef HAVE_CEF #include "nageru_cef_app.h" #endif #include "shared/context.h" #include "flags.h" #include "image_input.h" #include "mainwindow.h" #include "mixer.h" #include "quicksync_encoder.h" #ifdef HAVE_CEF CefRefPtr cef_app; #endif int main(int argc, char *argv[]) { #ifdef HAVE_CEF // Let CEF have first priority on parsing the command line, because we might be // launched as a CEF sub-process. CefMainArgs main_args(argc, argv); cef_app = CefRefPtr(new NageruCefApp()); int err = CefExecuteProcess(main_args, cef_app.get(), nullptr); if (err >= 0) { return err; } // CEF wants to use GLib for its main loop, which interferes with Qt's use of it. // The alternative is trying to integrate CEF into Qt's main loop, but that requires // fairly extensive cross-thread communication and that parts of CEF runs on Qt's UI // thread. setenv("QT_NO_GLIB", "1", 0); #endif parse_flags(PROGRAM_NAGERU, argc, argv); if (global_flags.va_display.empty() && !global_flags.x264_video_to_disk) { // The user didn't specify a VA-API display, but we need one. // See if the default works, and if not, let's try to help // the user by seeing if there's any that would work automatically. global_flags.va_display = QuickSyncEncoder::get_usable_va_display(); } // The OpenGL widgets do not work well with the native Wayland integration. setenv("QT_QPA_PLATFORM", "xcb", 0); if ((global_flags.va_display.empty() || global_flags.va_display[0] != '/') && !global_flags.x264_video_to_disk) { // We normally use EGL for zerocopy, but if we use VA against DRM // instead of against X11, we turn it off, and then don't need EGL. setenv("QT_XCB_GL_INTEGRATION", "xcb_egl", 0); } setlinebuf(stdout); #if LIBAVFORMAT_VERSION_INT < AV_VERSION_INT(58, 9, 100) av_register_all(); #endif #ifdef HAVE_SRT if (global_flags.srt_port >= 0 || !global_flags.srt_destination_host.empty()) { srt_startup(); } #endif QCoreApplication::setAttribute(Qt::AA_ShareOpenGLContexts, true); QSurfaceFormat fmt; fmt.setDepthBufferSize(0); fmt.setStencilBufferSize(0); fmt.setProfile(QSurfaceFormat::CoreProfile); fmt.setMajorVersion(3); fmt.setMinorVersion(1); // Turn off vsync, since Qt generally gives us at most frame rate // (display frequency) / (number of QGLWidgets active). fmt.setSwapInterval(0); QSurfaceFormat::setDefaultFormat(fmt); QGLFormat::setDefaultFormat(QGLFormat::fromSurfaceFormat(fmt)); QApplication app(argc, argv); global_share_widget = new QGLWidget(); if (!global_share_widget->isValid()) { fprintf(stderr, "Failed to initialize OpenGL. Nageru needs at least OpenGL 3.1 to function properly.\n"); abort(); } MainWindow mainWindow; mainWindow.resize(QSize(1500, 910)); mainWindow.show(); app.installEventFilter(&mainWindow); // For white balance color picking. // Even on an otherwise unloaded system, it would seem writing the recording // to disk (potentially terabytes of data as time goes by) causes Nageru // to be pushed out of RAM. If we have the right privileges, simply lock us // into memory for better realtime behavior. if (mlockall(MCL_CURRENT | MCL_FUTURE) == -1) { perror("mlockall()"); fprintf(stderr, "Failed to lock Nageru into RAM. You probably want to\n"); fprintf(stderr, "increase \"memlock\" for your user in limits.conf\n"); fprintf(stderr, "for better realtime behavior.\n"); uses_mlock = false; } else { uses_mlock = true; } int rc = app.exec(); delete global_mixer; #ifdef HAVE_SRT if (global_flags.srt_port >= 0) { srt_cleanup(); } #endif return rc; } nageru-2.3.0/nageru/mainwindow.cpp000066400000000000000000001640361450736322200171540ustar00rootroot00000000000000#include "mainwindow.h" #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include "shared/aboutdialog.h" #include "alsa_pool.h" #include "analyzer.h" #include "clickable_label.h" #include "context_menus.h" #include "correlation_meter.h" #include "shared/disk_space_estimator.h" #include "ellipsis_label.h" #include "flags.h" #include "glwidget.h" #include "input_mapping.h" #include "input_mapping_dialog.h" #include "lrameter.h" #include "nageru_midi_mapping.pb.h" #include "midi_mapping_dialog.h" #include "mixer.h" #include "nonlinear_fader.h" #include "shared/post_to_main_thread.h" #include "ui_audio_expanded_view.h" #include "ui_audio_miniview.h" #include "ui_display.h" #include "ui_mainwindow.h" #include "vumeter.h" using namespace std; using namespace std::chrono; using namespace std::placeholders; Q_DECLARE_METATYPE(std::string); Q_DECLARE_METATYPE(std::vector); MainWindow *global_mainwindow = nullptr; // -0.1 dBFS is EBU peak limit. We use it consistently, even for the bus meters // (which don't calculate interpolate peak, and in general don't follow EBU recommendations). constexpr float peak_limit_dbfs = -0.1f; namespace { void schedule_cut_signal(int ignored) { global_mixer->schedule_cut(); } void quit_signal(int ignored) { global_mainwindow->close(); } void slave_knob(QDial *master, QDial *slave) { QWidget::connect(master, &QDial::valueChanged, [slave](int value){ slave->blockSignals(true); slave->setValue(value); slave->blockSignals(false); }); QWidget::connect(slave, &QDial::valueChanged, [master](int value){ master->setValue(value); }); } void slave_checkbox(QCheckBox *master, QCheckBox *slave) { QWidget::connect(master, &QCheckBox::stateChanged, [slave](int state){ slave->blockSignals(true); slave->setCheckState(Qt::CheckState(state)); slave->blockSignals(false); }); QWidget::connect(slave, &QCheckBox::stateChanged, [master](int state){ master->setCheckState(Qt::CheckState(state)); }); } void slave_fader(NonLinearFader *master, NonLinearFader *slave) { QWidget::connect(master, &NonLinearFader::dbValueChanged, [slave](double value) { slave->blockSignals(true); slave->setDbValue(value); slave->blockSignals(false); }); QWidget::connect(slave, &NonLinearFader::dbValueChanged, [master](double value){ master->setDbValue(value); }); } constexpr unsigned DB_WITH_SIGN = 0x1; constexpr unsigned DB_BARE = 0x2; string format_db(double db, unsigned flags) { string text; if (flags & DB_WITH_SIGN) { if (isfinite(db)) { char buf[256]; snprintf(buf, sizeof(buf), "%+.1f", db); text = buf; } else if (db < 0.0) { text = "-∞"; } else { // Should never happen, really. text = "+∞"; } } else { if (isfinite(db)) { char buf[256]; snprintf(buf, sizeof(buf), "%.1f", db); text = buf; } else if (db < 0.0) { text = "-∞"; } else { // Should never happen, really. text = "∞"; } } if (!(flags & DB_BARE)) { text += " dB"; } return text; } void set_peak_label(QLabel *peak_label, float peak_db) { peak_label->setText(QString::fromStdString(format_db(peak_db, DB_BARE))); if (peak_db > peak_limit_dbfs) { peak_label->setStyleSheet("QLabel { background-color: red; color: white; }"); } else { peak_label->setStyleSheet(""); } } string get_bus_desc_label(const InputMapping::Bus &bus) { string suffix; if (bus.device.type == InputSourceType::ALSA_INPUT) { ALSAPool::Device::State state = global_audio_mixer->get_alsa_card_state(bus.device.index); if (state == ALSAPool::Device::State::STARTING) { suffix = " (busy)"; } else if (state == ALSAPool::Device::State::DEAD) { suffix = " (dead)"; } } return bus.name + suffix; } } // namespace MainWindow::MainWindow() : ui(new Ui::MainWindow), midi_mapper(this) { global_mainwindow = this; ui->setupUi(this); global_disk_space_estimator = new DiskSpaceEstimator(bind(&MainWindow::report_disk_space, this, _1, _2, _3)); disk_free_label = new QLabel(this); disk_free_label->setStyleSheet("QLabel {padding-right: 5px;}"); ui->menuBar->setCornerWidget(disk_free_label); QActionGroup *audio_mapping_group = new QActionGroup(this); ui->simple_audio_mode->setActionGroup(audio_mapping_group); ui->multichannel_audio_mode->setActionGroup(audio_mapping_group); ui->me_live->set_output(Mixer::OUTPUT_LIVE); ui->me_preview->set_output(Mixer::OUTPUT_PREVIEW); // The menus. connect(ui->cut_action, &QAction::triggered, this, &MainWindow::cut_triggered); connect(ui->exit_action, &QAction::triggered, this, &MainWindow::exit_triggered); connect(ui->manual_action, &QAction::triggered, this, &MainWindow::manual_triggered); connect(ui->about_action, &QAction::triggered, this, &MainWindow::about_triggered); connect(ui->open_analyzer_action, &QAction::triggered, this, &MainWindow::open_analyzer_triggered); connect(ui->simple_audio_mode, &QAction::triggered, this, &MainWindow::simple_audio_mode_triggered); connect(ui->multichannel_audio_mode, &QAction::triggered, this, &MainWindow::multichannel_audio_mode_triggered); connect(ui->input_mapping_action, &QAction::triggered, this, &MainWindow::input_mapping_triggered); connect(ui->midi_mapping_action, &QAction::triggered, this, &MainWindow::midi_mapping_triggered); connect(ui->timecode_stream_action, &QAction::triggered, this, &MainWindow::timecode_stream_triggered); connect(ui->timecode_stdout_action, &QAction::triggered, this, &MainWindow::timecode_stdout_triggered); ui->timecode_stream_action->setChecked(global_flags.display_timecode_in_stream); ui->timecode_stdout_action->setChecked(global_flags.display_timecode_on_stdout); if (global_flags.x264_video_to_http && isinf(global_flags.x264_crf)) { connect(ui->x264_bitrate_action, &QAction::triggered, this, &MainWindow::x264_bitrate_triggered); } else { ui->x264_bitrate_action->setEnabled(false); } connect(ui->video_menu, &QMenu::aboutToShow, [this]{ fill_hdmi_sdi_output_device_menu(ui->hdmi_sdi_output_device_menu); fill_hdmi_sdi_output_resolution_menu(ui->hdmi_sdi_output_resolution_menu); }); // Hook up the transition buttons. (Keyboard shortcuts are set in set_transition_names().) // TODO: Make them dynamic. connect(ui->transition_btn1, &QPushButton::clicked, bind(&MainWindow::transition_clicked, this, 0)); connect(ui->transition_btn2, &QPushButton::clicked, bind(&MainWindow::transition_clicked, this, 1)); connect(ui->transition_btn3, &QPushButton::clicked, bind(&MainWindow::transition_clicked, this, 2)); // Aiee... transition_btn1 = ui->transition_btn1; transition_btn2 = ui->transition_btn2; transition_btn3 = ui->transition_btn3; qRegisterMetaType("std::string"); qRegisterMetaType>("std::vector"); connect(ui->me_live, &GLWidget::transition_names_updated, this, &MainWindow::set_transition_names); qRegisterMetaType("Mixer::Output"); connect(ui->me_live, &GLWidget::name_updated, this, &MainWindow::update_channel_name); connect(ui->me_preview, &GLWidget::name_updated, this, &MainWindow::update_channel_name); // Hook up the prev/next buttons on the audio views. connect(ui->compact_prev_page, &QAbstractButton::clicked, this, &MainWindow::prev_page); connect(ui->compact_next_page, &QAbstractButton::clicked, this, &MainWindow::next_page); connect(ui->full_prev_page, &QAbstractButton::clicked, this, &MainWindow::prev_page); connect(ui->full_next_page, &QAbstractButton::clicked, this, &MainWindow::next_page); connect(ui->video_grid_prev_page, &QAbstractButton::clicked, this, &MainWindow::prev_page); connect(ui->video_grid_next_page, &QAbstractButton::clicked, this, &MainWindow::next_page); // And bind the same to PgUp/PgDown. connect(new QShortcut(QKeySequence::MoveToNextPage, this), &QShortcut::activated, this, &MainWindow::next_page); connect(new QShortcut(QKeySequence::MoveToPreviousPage, this), &QShortcut::activated, this, &MainWindow::prev_page); // When the audio view changes, move the previews. connect(ui->audio_views, &QStackedWidget::currentChanged, bind(&MainWindow::audio_view_changed, this, _1)); if (global_flags.enable_quick_cut_keys) { ui->quick_cut_enable_action->setChecked(true); } connect(ui->quick_cut_enable_action, &QAction::changed, [this](){ global_flags.enable_quick_cut_keys = ui->quick_cut_enable_action->isChecked(); }); #if HAVE_SRT if (global_flags.srt_port >= 0) { char title[256]; snprintf(title, sizeof(title), "Accept new SRT connections on port %d", global_flags.srt_port); ui->srt_enable_action->setChecked(true); ui->srt_enable_action->setText(title); connect(ui->srt_enable_action, &QAction::changed, [this](){ global_flags.enable_srt = ui->srt_enable_action->isChecked(); }); } else { ui->srt_enable_action->setChecked(false); ui->srt_enable_action->setEnabled(false); ui->srt_enable_action->setText("Accept new SRT connections"); } #else ui->srt_enable_action->setChecked(false); ui->srt_enable_action->setEnabled(false); ui->srt_enable_action->setText("Accept new SRT connections"); #endif last_audio_level_callback = steady_clock::now() - seconds(1); if (!global_flags.midi_mapping_filename.empty()) { MIDIMappingProto midi_mapping; if (!load_midi_mapping_from_file(global_flags.midi_mapping_filename, &midi_mapping)) { fprintf(stderr, "Couldn't load MIDI mapping '%s'; exiting.\n", global_flags.midi_mapping_filename.c_str()); ::abort(); } midi_mapper.set_midi_mapping(midi_mapping); } midi_mapper.refresh_highlights(); midi_mapper.refresh_lights(); if (global_flags.fullscreen) { QMainWindow::showFullScreen(); } } void MainWindow::prev_page() { if (global_audio_mixer->get_mapping_mode() == AudioMixer::MappingMode::MULTICHANNEL) { ui->audio_views->setCurrentIndex((ui->audio_views->currentIndex() + 2) % 3); } else { ui->audio_views->setCurrentIndex(2 - ui->audio_views->currentIndex()); // Switch between 0 and 2. } } void MainWindow::next_page() { if (global_audio_mixer->get_mapping_mode() == AudioMixer::MappingMode::MULTICHANNEL) { ui->audio_views->setCurrentIndex((ui->audio_views->currentIndex() + 1) % 3); } else { ui->audio_views->setCurrentIndex(2 - ui->audio_views->currentIndex()); // Switch between 0 and 2. } } void MainWindow::resizeEvent(QResizeEvent* event) { QMainWindow::resizeEvent(event); // Ask for a relayout, but only after the event loop is done doing relayout // on everything else. QMetaObject::invokeMethod(this, "relayout", Qt::QueuedConnection); } void MainWindow::mixer_created(Mixer *mixer) { // Make the previews. unsigned num_previews = mixer->get_num_channels(); const char qwerty[] = "QWERTYUIOP"; for (unsigned i = 0; i < num_previews; ++i) { Mixer::Output output = Mixer::Output(Mixer::OUTPUT_INPUT0 + i); QWidget *preview = new QWidget(this); // Will be connected to a layout immediately after the loop. Ui::Display *ui_display = new Ui::Display; ui_display->setupUi(preview); ui_display->label->setText(mixer->get_channel_name(output).c_str()); ui_display->display->set_output(output); previews.push_back(ui_display); // Hook up the click. connect(ui_display->display, &GLWidget::clicked, bind(&MainWindow::channel_clicked, this, i)); // Let the theme update the text whenever the resolution or color changed. connect(ui_display->display, &GLWidget::name_updated, this, &MainWindow::update_channel_name); connect(ui_display->display, &GLWidget::color_updated, this, &MainWindow::update_channel_color); // Hook up the keyboard key. QShortcut *shortcut = nullptr; if (i < 9) { shortcut = new QShortcut(QKeySequence(Qt::Key_1 + i), this); } else if (i == 9) { shortcut = new QShortcut(QKeySequence(Qt::Key_0), this); } if (shortcut != nullptr) { connect(shortcut, &QShortcut::activated, bind(&MainWindow::channel_clicked, this, i)); } // Hook up the quick-cut key. if (i < strlen(qwerty)) { QShortcut *shortcut = new QShortcut(QKeySequence(qwerty[i]), this); connect(shortcut, &QShortcut::activated, bind(&MainWindow::quick_cut_activated, this, i)); } // Hook up the white balance button (irrelevant if invisible). ui_display->wb_button->setVisible(mixer->get_supports_set_wb(output)); connect(ui_display->wb_button, &QPushButton::clicked, bind(&MainWindow::wb_button_clicked, this, i)); } // Connect the previews to the correct layout. audio_view_changed(ui->audio_views->currentIndex()); global_audio_mixer->set_state_changed_callback(bind(&MainWindow::audio_state_changed, this)); slave_knob(ui->locut_cutoff_knob, ui->locut_cutoff_knob_2); slave_knob(ui->limiter_threshold_knob, ui->limiter_threshold_knob_2); slave_knob(ui->makeup_gain_knob, ui->makeup_gain_knob_2); slave_checkbox(ui->makeup_gain_auto_checkbox, ui->makeup_gain_auto_checkbox_2); slave_checkbox(ui->limiter_enabled, ui->limiter_enabled_2); reset_audio_mapping_ui(); // TODO: Fetch all of the values these for completeness, // not just the enable knobs implied by flags. ui->limiter_enabled->setChecked(global_audio_mixer->get_limiter_enabled()); ui->makeup_gain_auto_checkbox->setChecked(global_audio_mixer->get_final_makeup_gain_auto()); // Controls used only for simple audio fetch their state from the first bus. constexpr unsigned simple_bus_index = 0; if (global_audio_mixer->get_mapping_mode() == AudioMixer::MappingMode::SIMPLE) { ui->locut_enabled->setChecked(global_audio_mixer->get_locut_enabled(simple_bus_index)); ui->gainstaging_knob->setValue(global_audio_mixer->get_gain_staging_db(simple_bus_index)); ui->gainstaging_auto_checkbox->setChecked(global_audio_mixer->get_gain_staging_auto(simple_bus_index)); ui->compressor_enabled->setChecked(global_audio_mixer->get_compressor_enabled(simple_bus_index)); ui->compressor_threshold_db_display->setText( QString::fromStdString(format_db(mixer->get_audio_mixer()->get_compressor_threshold_dbfs(simple_bus_index), DB_WITH_SIGN))); } connect(ui->locut_enabled, &QCheckBox::stateChanged, [this](int state){ global_audio_mixer->set_locut_enabled(simple_bus_index, state == Qt::Checked); midi_mapper.refresh_lights(); }); connect(ui->gainstaging_knob, &QAbstractSlider::valueChanged, bind(&MainWindow::gain_staging_knob_changed, this, simple_bus_index, _1)); connect(ui->gainstaging_auto_checkbox, &QCheckBox::stateChanged, [this](int state){ global_audio_mixer->set_gain_staging_auto(simple_bus_index, state == Qt::Checked); midi_mapper.refresh_lights(); }); connect(ui->compressor_threshold_knob, &QDial::valueChanged, bind(&MainWindow::compressor_threshold_knob_changed, this, simple_bus_index, _1)); connect(ui->compressor_enabled, &QCheckBox::stateChanged, [this](int state){ global_audio_mixer->set_compressor_enabled(simple_bus_index, state == Qt::Checked); midi_mapper.refresh_lights(); }); // Global mastering controls. QString limiter_threshold_label( QString::fromStdString(format_db(mixer->get_audio_mixer()->get_limiter_threshold_dbfs(), DB_WITH_SIGN))); ui->limiter_threshold_db_display->setText(limiter_threshold_label); ui->limiter_threshold_db_display_2->setText(limiter_threshold_label); connect(ui->locut_cutoff_knob, &QDial::valueChanged, this, &MainWindow::cutoff_knob_changed); cutoff_knob_changed(ui->locut_cutoff_knob->value()); connect(ui->makeup_gain_knob, &QAbstractSlider::valueChanged, this, &MainWindow::final_makeup_gain_knob_changed); connect(ui->makeup_gain_auto_checkbox, &QCheckBox::stateChanged, [this](int state){ global_audio_mixer->set_final_makeup_gain_auto(state == Qt::Checked); midi_mapper.refresh_lights(); }); connect(ui->limiter_threshold_knob, &QDial::valueChanged, this, &MainWindow::limiter_threshold_knob_changed); connect(ui->limiter_enabled, &QCheckBox::stateChanged, [this](int state){ global_audio_mixer->set_limiter_enabled(state == Qt::Checked); midi_mapper.refresh_lights(); }); connect(ui->reset_meters_button, &QPushButton::clicked, this, &MainWindow::reset_meters_button_clicked); // Even though we have a reset button right next to it, the fact that // the expanded audio view labels are clickable makes it natural to // click this one as well. connect(ui->peak_display, &ClickableLabel::clicked, this, &MainWindow::reset_meters_button_clicked); mixer->get_audio_mixer()->set_audio_level_callback(bind(&MainWindow::audio_level_callback, this, _1, _2, _3, _4, _5, _6, _7, _8)); midi_mapper.refresh_highlights(); midi_mapper.refresh_lights(); midi_mapper.start_thread(); analyzer.reset(new Analyzer); global_mixer->set_theme_menu_callback(bind(&MainWindow::setup_theme_menu, this)); setup_theme_menu(); struct sigaction act; memset(&act, 0, sizeof(act)); act.sa_handler = schedule_cut_signal; act.sa_flags = SA_RESTART; sigaction(SIGHUP, &act, nullptr); // Mostly for debugging. Don't override SIGINT, that's so evil if // shutdown isn't instant. memset(&act, 0, sizeof(act)); act.sa_handler = quit_signal; act.sa_flags = SA_RESTART; sigaction(SIGUSR1, &act, nullptr); } void MainWindow::reset_audio_mapping_ui() { bool simple = (global_audio_mixer->get_mapping_mode() == AudioMixer::MappingMode::SIMPLE); ui->simple_audio_mode->setChecked(simple); ui->multichannel_audio_mode->setChecked(!simple); ui->input_mapping_action->setEnabled(!simple); ui->midi_mapping_action->setEnabled(!simple); ui->locut_enabled->setVisible(simple); ui->gainstaging_label->setVisible(simple); ui->gainstaging_knob->setVisible(simple); ui->gainstaging_db_display->setVisible(simple); ui->gainstaging_auto_checkbox->setVisible(simple); ui->compressor_threshold_label->setVisible(simple); ui->compressor_threshold_knob->setVisible(simple); ui->compressor_threshold_db_display->setVisible(simple); ui->compressor_enabled->setVisible(simple); setup_audio_miniview(); setup_audio_expanded_view(); if (simple) { ui->compact_label->setText("Compact audio view (1/2) "); ui->video_grid_label->setText("Video grid display (2/2) "); if (ui->audio_views->currentIndex() == 1) { // Full audio view is not available in simple mode. ui->audio_views->setCurrentIndex(0); } } else { ui->compact_label->setText("Compact audio view (1/3) "); ui->full_label->setText("Full audio view (2/3) "); ui->video_grid_label->setText("Video grid display (3/3) "); } midi_mapper.refresh_highlights(); midi_mapper.refresh_lights(); } void MainWindow::setup_audio_miniview() { // Remove any existing channels. for (QLayoutItem *item; (item = ui->faders->takeAt(0)) != nullptr; ) { delete item->widget(); delete item; } audio_miniviews.clear(); if (global_audio_mixer->get_mapping_mode() == AudioMixer::MappingMode::SIMPLE) { return; } // Set up brand new ones from the input mapping. InputMapping mapping = global_audio_mixer->get_input_mapping(); audio_miniviews.resize(mapping.buses.size()); for (unsigned bus_index = 0; bus_index < mapping.buses.size(); ++bus_index) { QWidget *channel = new QWidget(this); Ui::AudioMiniView *ui_audio_miniview = new Ui::AudioMiniView; ui_audio_miniview->setupUi(channel); ui_audio_miniview->bus_desc_label->setFullText( QString::fromStdString(get_bus_desc_label(mapping.buses[bus_index]))); audio_miniviews[bus_index] = ui_audio_miniview; // Set up the peak meter. VUMeter *peak_meter = ui_audio_miniview->peak_meter; peak_meter->set_min_level(-30.0f); peak_meter->set_max_level(0.0f); peak_meter->set_ref_level(0.0f); ui_audio_miniview->fader->setDbValue(global_audio_mixer->get_fader_volume(bus_index)); ui->faders->addWidget(channel); connect(ui_audio_miniview->fader, &NonLinearFader::dbValueChanged, bind(&MainWindow::mini_fader_changed, this, bus_index, _1)); connect(ui_audio_miniview->peak_display_label, &ClickableLabel::clicked, [bus_index]() { global_audio_mixer->reset_peak(bus_index); }); } } void MainWindow::setup_audio_expanded_view() { // Remove any existing channels. for (QLayoutItem *item; (item = ui->buses->takeAt(0)) != nullptr; ) { delete item->widget(); delete item; } audio_expanded_views.clear(); if (global_audio_mixer->get_mapping_mode() == AudioMixer::MappingMode::SIMPLE) { return; } // Set up brand new ones from the input mapping. InputMapping mapping = global_audio_mixer->get_input_mapping(); audio_expanded_views.resize(mapping.buses.size()); for (unsigned bus_index = 0; bus_index < mapping.buses.size(); ++bus_index) { QWidget *channel = new QWidget(this); Ui::AudioExpandedView *ui_audio_expanded_view = new Ui::AudioExpandedView; ui_audio_expanded_view->setupUi(channel); ui_audio_expanded_view->bus_desc_label->setFullText( QString::fromStdString(get_bus_desc_label(mapping.buses[bus_index]))); audio_expanded_views[bus_index] = ui_audio_expanded_view; update_stereo_knob_and_label(bus_index, lrintf(100.0f * global_audio_mixer->get_stereo_width(bus_index))); update_eq_label(bus_index, EQ_BAND_TREBLE, global_audio_mixer->get_eq(bus_index, EQ_BAND_TREBLE)); update_eq_label(bus_index, EQ_BAND_MID, global_audio_mixer->get_eq(bus_index, EQ_BAND_MID)); update_eq_label(bus_index, EQ_BAND_BASS, global_audio_mixer->get_eq(bus_index, EQ_BAND_BASS)); ui_audio_expanded_view->fader->setDbValue(global_audio_mixer->get_fader_volume(bus_index)); ui_audio_expanded_view->mute_button->setChecked(global_audio_mixer->get_mute(bus_index)); connect(ui_audio_expanded_view->mute_button, &QPushButton::toggled, bind(&MainWindow::mute_button_toggled, this, bus_index, _1)); ui->buses->addWidget(channel); ui_audio_expanded_view->locut_enabled->setChecked(global_audio_mixer->get_locut_enabled(bus_index)); connect(ui_audio_expanded_view->locut_enabled, &QCheckBox::stateChanged, [this, bus_index](int state){ global_audio_mixer->set_locut_enabled(bus_index, state == Qt::Checked); midi_mapper.refresh_lights(); }); connect(ui_audio_expanded_view->stereo_width_knob, &QDial::valueChanged, bind(&MainWindow::stereo_width_knob_changed, this, bus_index, _1)); connect(ui_audio_expanded_view->treble_knob, &QDial::valueChanged, bind(&MainWindow::eq_knob_changed, this, bus_index, EQ_BAND_TREBLE, _1)); connect(ui_audio_expanded_view->mid_knob, &QDial::valueChanged, bind(&MainWindow::eq_knob_changed, this, bus_index, EQ_BAND_MID, _1)); connect(ui_audio_expanded_view->bass_knob, &QDial::valueChanged, bind(&MainWindow::eq_knob_changed, this, bus_index, EQ_BAND_BASS, _1)); ui_audio_expanded_view->gainstaging_knob->setValue(global_audio_mixer->get_gain_staging_db(bus_index)); ui_audio_expanded_view->gainstaging_auto_checkbox->setChecked(global_audio_mixer->get_gain_staging_auto(bus_index)); ui_audio_expanded_view->compressor_enabled->setChecked(global_audio_mixer->get_compressor_enabled(bus_index)); connect(ui_audio_expanded_view->gainstaging_knob, &QAbstractSlider::valueChanged, bind(&MainWindow::gain_staging_knob_changed, this, bus_index, _1)); connect(ui_audio_expanded_view->gainstaging_auto_checkbox, &QCheckBox::stateChanged, [this, bus_index](int state){ global_audio_mixer->set_gain_staging_auto(bus_index, state == Qt::Checked); midi_mapper.refresh_lights(); }); connect(ui_audio_expanded_view->compressor_threshold_knob, &QDial::valueChanged, bind(&MainWindow::compressor_threshold_knob_changed, this, bus_index, _1)); connect(ui_audio_expanded_view->compressor_enabled, &QCheckBox::stateChanged, [this, bus_index](int state){ global_audio_mixer->set_compressor_enabled(bus_index, state == Qt::Checked); midi_mapper.refresh_lights(); }); slave_fader(audio_miniviews[bus_index]->fader, ui_audio_expanded_view->fader); // Set up the peak meter. VUMeter *peak_meter = ui_audio_expanded_view->peak_meter; peak_meter->set_min_level(-30.0f); peak_meter->set_max_level(0.0f); peak_meter->set_ref_level(0.0f); connect(ui_audio_expanded_view->peak_display_label, &ClickableLabel::clicked, [this, bus_index]() { global_audio_mixer->reset_peak(bus_index); midi_mapper.refresh_lights(); }); } update_cutoff_labels(global_audio_mixer->get_locut_cutoff()); } void MainWindow::mixer_shutting_down() { ui->me_live->shutdown(); ui->me_preview->shutdown(); for (Ui::Display *display : previews) { display->display->shutdown(); } analyzer->mixer_shutting_down(); } void MainWindow::cut_triggered() { global_mixer->schedule_cut(); } void MainWindow::x264_bitrate_triggered() { bool ok; int new_bitrate = QInputDialog::getInt(this, "Change x264 bitrate", "Choose new bitrate for x264 HTTP output (from 100–100,000 kbit/sec):", global_flags.x264_bitrate, /*min=*/100, /*max=*/100000, /*step=*/100, &ok); if (ok && new_bitrate >= 100 && new_bitrate <= 100000) { global_flags.x264_bitrate = new_bitrate; global_mixer->change_x264_bitrate(new_bitrate); } } void MainWindow::exit_triggered() { close(); } void MainWindow::manual_triggered() { if (!QDesktopServices::openUrl(QUrl("https://nageru.sesse.net/doc/"))) { QMessageBox msgbox; msgbox.setText("Could not launch manual in web browser.\nPlease see https://nageru.sesse.net/doc/ manually."); msgbox.exec(); } } void MainWindow::about_triggered() { AboutDialog("Nageru", "Realtime video mixer").exec(); } void MainWindow::open_analyzer_triggered() { analyzer->show(); } void MainWindow::simple_audio_mode_triggered() { if (global_audio_mixer->get_mapping_mode() == AudioMixer::MappingMode::SIMPLE) { return; } unsigned card_index = global_audio_mixer->get_simple_input(); if (card_index == numeric_limits::max()) { QMessageBox::StandardButton reply = QMessageBox::question(this, "Mapping too complex", "The current audio mapping is too complicated to be representable in simple mode, " "and will be discarded if you proceed. Really go to simple audio mode?", QMessageBox::Yes | QMessageBox::No); if (reply == QMessageBox::No) { ui->simple_audio_mode->setChecked(false); ui->multichannel_audio_mode->setChecked(true); return; } card_index = 0; } global_audio_mixer->set_simple_input(/*card_index=*/card_index); reset_audio_mapping_ui(); } void MainWindow::multichannel_audio_mode_triggered() { if (global_audio_mixer->get_mapping_mode() == AudioMixer::MappingMode::MULTICHANNEL) { return; } // Take the generated input mapping from the simple input, // and set it as a normal multichannel mapping, which causes // the mode to go to multichannel. global_audio_mixer->set_input_mapping(global_audio_mixer->get_input_mapping()); reset_audio_mapping_ui(); } void MainWindow::input_mapping_triggered() { if (InputMappingDialog().exec() == QDialog::Accepted) { setup_audio_miniview(); setup_audio_expanded_view(); } midi_mapper.refresh_highlights(); midi_mapper.refresh_lights(); } void MainWindow::midi_mapping_triggered() { MIDIMappingDialog(&midi_mapper).exec(); } void MainWindow::timecode_stream_triggered() { global_mixer->set_display_timecode_in_stream(ui->timecode_stream_action->isChecked()); } void MainWindow::timecode_stdout_triggered() { global_mixer->set_display_timecode_on_stdout(ui->timecode_stdout_action->isChecked()); } void MainWindow::gain_staging_knob_changed(unsigned bus_index, int value) { if (bus_index == 0) { ui->gainstaging_auto_checkbox->setCheckState(Qt::Unchecked); } if (bus_index < audio_expanded_views.size()) { audio_expanded_views[bus_index]->gainstaging_auto_checkbox->setCheckState(Qt::Unchecked); } float gain_db = value * 0.1f; global_audio_mixer->set_gain_staging_db(bus_index, gain_db); // The label will be updated by the audio level callback. } void MainWindow::final_makeup_gain_knob_changed(int value) { ui->makeup_gain_auto_checkbox->setCheckState(Qt::Unchecked); float gain_db = value * 0.1f; global_audio_mixer->set_final_makeup_gain_db(gain_db); // The label will be updated by the audio level callback. } void MainWindow::cutoff_knob_changed(int value) { float octaves = value * 0.1f; float cutoff_hz = 20.0 * pow(2.0, octaves); global_audio_mixer->set_locut_cutoff(cutoff_hz); update_cutoff_labels(cutoff_hz); } void MainWindow::update_cutoff_labels(float cutoff_hz) { char buf[256]; snprintf(buf, sizeof(buf), "%ld Hz", lrintf(cutoff_hz)); ui->locut_cutoff_display->setText(buf); ui->locut_cutoff_display_2->setText(buf); for (unsigned bus_index = 0; bus_index < audio_expanded_views.size(); ++bus_index) { audio_expanded_views[bus_index]->locut_enabled->setText( QString("Lo-cut: ") + buf); } } void MainWindow::report_disk_space(off_t free_bytes, double estimated_seconds_left, double file_length_seconds) { char time_str[256]; if (estimated_seconds_left < 60.0) { strcpy(time_str, "Less than a minute"); } else if (estimated_seconds_left < 1800.0) { // Less than half an hour: Xm Ys (red). int s = lrintf(estimated_seconds_left); int m = s / 60; s %= 60; snprintf(time_str, sizeof(time_str), "%dm %ds", m, s); } else if (estimated_seconds_left < 3600.0) { // Less than an hour: Xm. int m = lrintf(estimated_seconds_left / 60.0); snprintf(time_str, sizeof(time_str), "%dm", m); } else if (estimated_seconds_left < 36000.0) { // Less than ten hours: Xh Ym. int m = lrintf(estimated_seconds_left / 60.0); int h = m / 60; m %= 60; snprintf(time_str, sizeof(time_str), "%dh %dm", h, m); } else { // More than ten hours: Xh. int h = lrintf(estimated_seconds_left / 3600.0); snprintf(time_str, sizeof(time_str), "%dh", h); } char buf[256]; snprintf(buf, sizeof(buf), "Disk free: %'.0f MB (approx. %s)", free_bytes / 1048576.0, time_str); // NOTE: The default formatter does not use file_length_seconds for anything, // but the theme might want to do so. std::string label = global_mixer->format_status_line(buf, file_length_seconds); post_to_main_thread([this, label]{ disk_free_label->setText(QString::fromStdString(label)); ui->menuBar->setCornerWidget(disk_free_label); // Need to set this again for the sizing to get right. }); } void MainWindow::stereo_width_knob_changed(unsigned bus_index, int value) { float stereo_width = value * 0.01f; global_audio_mixer->set_stereo_width(bus_index, stereo_width); update_stereo_label(bus_index, value); } void MainWindow::eq_knob_changed(unsigned bus_index, EQBand band, int value) { float gain_db = value * 0.1f; global_audio_mixer->set_eq(bus_index, band, gain_db); update_eq_label(bus_index, band, gain_db); } void MainWindow::update_stereo_knob_and_label(unsigned bus_index, int stereo_width_percent) { Ui::AudioExpandedView *view = audio_expanded_views[bus_index]; if (global_audio_mixer->is_mono(bus_index)) { view->stereo_width_knob->setEnabled(false); view->stereo_width_label->setEnabled(false); } else { view->stereo_width_knob->setEnabled(true); view->stereo_width_label->setEnabled(true); } view->stereo_width_knob->setValue(stereo_width_percent); update_stereo_label(bus_index, stereo_width_percent); } void MainWindow::update_stereo_label(unsigned bus_index, int stereo_width_percent) { Ui::AudioExpandedView *view = audio_expanded_views[bus_index]; if (global_audio_mixer->is_mono(bus_index)) { view->stereo_width_label->setText("Mono"); } else { char buf[256]; snprintf(buf, sizeof(buf), "Stereo: %d%%", stereo_width_percent); view->stereo_width_label->setText(buf); } } void MainWindow::update_eq_label(unsigned bus_index, EQBand band, float gain_db) { Ui::AudioExpandedView *view = audio_expanded_views[bus_index]; string db_string = format_db(gain_db, DB_WITH_SIGN); switch (band) { case EQ_BAND_TREBLE: view->treble_label->setText(QString::fromStdString("Treble: " + db_string)); break; case EQ_BAND_MID: view->mid_label->setText(QString::fromStdString("Mid: " + db_string)); break; case EQ_BAND_BASS: view->bass_label->setText(QString::fromStdString("Bass: " + db_string)); break; default: assert(false); } } void MainWindow::setup_theme_menu() { Theme::MenuEntry *root_menu = global_mixer->get_theme_menu(); // Remove the old menu, if any. if (theme_menu != nullptr) { ui->menuBar->removeAction(theme_menu->menuAction()); theme_menu = nullptr; } if (root_menu != nullptr) { assert(root_menu->is_submenu); if (!root_menu->submenu.empty()) { theme_menu = new QMenu("&Theme"); fill_menu_from_theme_menu(root_menu->submenu, theme_menu); ui->menuBar->insertMenu(ui->menu_Help->menuAction(), theme_menu); } } } void MainWindow::fill_menu_from_theme_menu(const vector> &entries, QMenu *menu) { for (const unique_ptr &entry : entries) { if (entry->is_submenu) { QMenu *submenu = new QMenu(QString::fromStdString(entry->text)); fill_menu_from_theme_menu(entry->submenu, submenu); menu->addMenu(submenu); continue; } QAction *action = menu->addAction(QString::fromStdString(entry->text)); if (entry->entry.flags == Theme::MenuEntry::CHECKABLE) { action->setCheckable(true); } else if (entry->entry.flags == Theme::MenuEntry::CHECKED) { action->setCheckable(true); action->setChecked(true); } connect(action, &QAction::triggered, [lua_ref = entry->entry.lua_ref] { global_mixer->theme_menu_entry_clicked(lua_ref); }); } } void MainWindow::limiter_threshold_knob_changed(int value) { float threshold_dbfs = value * 0.1f; global_audio_mixer->set_limiter_threshold_dbfs(threshold_dbfs); ui->limiter_threshold_db_display->setText( QString::fromStdString(format_db(threshold_dbfs, DB_WITH_SIGN))); ui->limiter_threshold_db_display_2->setText( QString::fromStdString(format_db(threshold_dbfs, DB_WITH_SIGN))); } void MainWindow::compressor_threshold_knob_changed(unsigned bus_index, int value) { float threshold_dbfs = value * 0.1f; global_audio_mixer->set_compressor_threshold_dbfs(bus_index, threshold_dbfs); QString label(QString::fromStdString(format_db(threshold_dbfs, DB_WITH_SIGN))); if (bus_index == 0) { ui->compressor_threshold_db_display->setText(label); } if (bus_index < audio_expanded_views.size()) { audio_expanded_views[bus_index]->compressor_threshold_db_display->setText(label); } } void MainWindow::mini_fader_changed(int bus, double volume_db) { QString label(QString::fromStdString(format_db(volume_db, DB_WITH_SIGN))); audio_miniviews[bus]->fader_label->setText(label); audio_expanded_views[bus]->fader_label->setText(label); global_audio_mixer->set_fader_volume(bus, volume_db); } void MainWindow::mute_button_toggled(int bus, bool checked) { global_audio_mixer->set_mute(bus, checked); midi_mapper.refresh_lights(); } void MainWindow::reset_meters_button_clicked() { global_audio_mixer->reset_meters(); ui->peak_display->setText(QString::fromStdString(format_db(-HUGE_VAL, DB_WITH_SIGN | DB_BARE))); ui->peak_display->setStyleSheet(""); } void MainWindow::audio_level_callback(float level_lufs, float peak_db, vector bus_levels, float global_level_lufs, float range_low_lufs, float range_high_lufs, float final_makeup_gain_db, float correlation) { steady_clock::time_point now = steady_clock::now(); // The meters are somewhat inefficient to update. Only update them // every 100 ms or so (we get updates every 5–20 ms). Note that this // means that the digital peak meters are ever so slightly too low // (each update won't be a faithful representation of the highest peak // since the previous update, since there are frames we won't draw), // but the _peak_ of the peak meters will be correct (it's tracked in // AudioMixer, not here), and that's much more important. double last_update_age = duration(now - last_audio_level_callback).count(); if (last_update_age < 0.100) { return; } last_audio_level_callback = now; post_to_main_thread([=]() { ui->vu_meter->set_level(level_lufs); for (unsigned bus_index = 0; bus_index < bus_levels.size(); ++bus_index) { if (bus_index < audio_miniviews.size()) { const AudioMixer::BusLevel &level = bus_levels[bus_index]; Ui::AudioMiniView *miniview = audio_miniviews[bus_index]; miniview->peak_meter->set_level( level.current_level_dbfs[0], level.current_level_dbfs[1]); miniview->peak_meter->set_peak( level.peak_level_dbfs[0], level.peak_level_dbfs[1]); set_peak_label(miniview->peak_display_label, level.historic_peak_dbfs); Ui::AudioExpandedView *view = audio_expanded_views[bus_index]; view->peak_meter->set_level( level.current_level_dbfs[0], level.current_level_dbfs[1]); view->peak_meter->set_peak( level.peak_level_dbfs[0], level.peak_level_dbfs[1]); view->reduction_meter->set_reduction_db(level.compressor_attenuation_db); view->gainstaging_knob->blockSignals(true); view->gainstaging_knob->setValue(lrintf(level.gain_staging_db * 10.0f)); view->gainstaging_knob->blockSignals(false); view->gainstaging_db_display->setText( QString("Gain: ") + QString::fromStdString(format_db(level.gain_staging_db, DB_WITH_SIGN))); set_peak_label(view->peak_display_label, level.historic_peak_dbfs); midi_mapper.set_has_peaked(bus_index, level.historic_peak_dbfs >= -0.1f); } } ui->lra_meter->set_levels(global_level_lufs, range_low_lufs, range_high_lufs); ui->correlation_meter->set_correlation(correlation); ui->peak_display->setText(QString::fromStdString(format_db(peak_db, DB_BARE))); set_peak_label(ui->peak_display, peak_db); // NOTE: Will be invisible when using multitrack audio. if (!bus_levels.empty()) { ui->gainstaging_knob->blockSignals(true); ui->gainstaging_knob->setValue(lrintf(bus_levels[0].gain_staging_db * 10.0f)); ui->gainstaging_knob->blockSignals(false); ui->gainstaging_db_display->setText( QString::fromStdString(format_db(bus_levels[0].gain_staging_db, DB_WITH_SIGN))); } ui->makeup_gain_knob->blockSignals(true); ui->makeup_gain_knob->setValue(lrintf(final_makeup_gain_db * 10.0f)); ui->makeup_gain_knob->blockSignals(false); ui->makeup_gain_db_display->setText( QString::fromStdString(format_db(final_makeup_gain_db, DB_WITH_SIGN))); ui->makeup_gain_db_display_2->setText( QString::fromStdString(format_db(final_makeup_gain_db, DB_WITH_SIGN))); // Peak labels could have changed. midi_mapper.refresh_lights(); }); } void MainWindow::relayout() { int height = ui->vertical_layout->geometry().height(); if (height <= 0) { // Seemingly this can happen and must be ignored. return; } double remaining_height = height; // Allocate the height; the most important part is to keep the main displays // at the right aspect if at all possible. double me_width = ui->me_preview->width(); double me_height = me_width * double(global_flags.height) / double(global_flags.width) + ui->label_preview->height() + ui->preview_vertical_layout->spacing(); // TODO: Scale the widths when we need to do this. if (me_height / double(height) > 0.8) { me_height = height * 0.8; } remaining_height -= me_height + ui->vertical_layout->spacing(); // Space between the M/E displays and the audio strip. remaining_height -= ui->vertical_layout->spacing(); // The label above the audio strip. double compact_label_height = ui->compact_label->minimumHeight() + ui->compact_audio_layout->spacing(); remaining_height -= compact_label_height; // The previews will be constrained by the remaining height, and the width. double preview_label_height = previews[0]->label->minimumSize().height() + previews[0]->main_vertical_layout->spacing(); int preview_total_width = ui->preview_displays->geometry().width() - (previews.size() - 1) * ui->preview_displays->spacing(); double preview_height = min(remaining_height - preview_label_height, (preview_total_width / double(previews.size())) * double(global_flags.height) / double(global_flags.width)); remaining_height -= preview_height + preview_label_height + ui->vertical_layout->spacing(); ui->vertical_layout->setStretch(0, lrintf(me_height)); ui->vertical_layout->setStretch(1, lrintf(compact_label_height) + lrintf(remaining_height) + lrintf(preview_height + preview_label_height)); // Audio strip and previews together. ui->compact_audio_layout->setStretch(0, lrintf(compact_label_height)); ui->compact_audio_layout->setStretch(1, lrintf(remaining_height)); // Audio strip. ui->compact_audio_layout->setStretch(2, lrintf(preview_height + preview_label_height)); if (current_audio_view == 0) { // Compact audio view. // Set the widths for the previews. double preview_width = preview_height * double(global_flags.width) / double(global_flags.height); for (unsigned i = 0; i < previews.size(); ++i) { ui->preview_displays->setStretch(i, lrintf(preview_width)); } // The preview horizontal spacer. double remaining_preview_width = preview_total_width - previews.size() * preview_width; ui->preview_displays->setStretch(previews.size(), lrintf(remaining_preview_width)); } else if (current_audio_view == 2) { // Video grid view. // QGridLayout doesn't do it for us, since we need to be able to remove rows // or columns as the grid changes, and it won't do that. Thus, position everything // by hand. constexpr int spacing = 6; int grid_width = ui->preview_displays_grid->geometry().width(); int grid_height = ui->preview_displays_grid->geometry().height(); int best_preview_width = 0; unsigned best_num_rows = 1, best_num_cols = 1; for (unsigned num_rows = 1; num_rows <= previews.size(); ++num_rows) { int num_cols = (previews.size() + num_rows - 1) / num_rows; int max_preview_height = (grid_height - spacing * (num_rows - 1)) / num_rows - preview_label_height; int max_preview_width = (grid_width - spacing * (num_cols - 1)) / num_cols; int preview_width = std::min(max_preview_width, max_preview_height * double(global_flags.width) / double(global_flags.height)); if (preview_width > best_preview_width) { best_preview_width = preview_width; best_num_rows = num_rows; best_num_cols = num_cols; } } double cell_height = lrintf(best_preview_width * double(global_flags.height) / double(global_flags.width)) + preview_label_height; remaining_height = grid_height - best_num_rows * cell_height - (best_num_rows - 1) * spacing; int cell_width = best_preview_width; int remaining_width = grid_width - best_num_cols * cell_width - (best_num_cols - 1) * spacing; for (unsigned i = 0; i < previews.size(); ++i) { int col_idx = i % best_num_cols; int row_idx = i / best_num_cols; double top = remaining_height * 0.5f + row_idx * (cell_height + spacing); double bottom = top + cell_height; double left = remaining_width * 0.5f + col_idx * (cell_width + spacing); double right = left + cell_width; QRect rect; rect.setTop(lrintf(top)); rect.setBottom(lrintf(bottom)); rect.setLeft(lrintf(left)); rect.setRight(lrintf(right)); QWidget *display = static_cast(previews[i]->frame->parent()); display->setGeometry(rect); display->show(); } } } void MainWindow::set_locut(float value) { set_relative_value(ui->locut_cutoff_knob, value); } void MainWindow::set_limiter_threshold(float value) { set_relative_value(ui->limiter_threshold_knob, value); } void MainWindow::set_makeup_gain(float value) { set_relative_value(ui->makeup_gain_knob, value); } void MainWindow::set_stereo_width(unsigned bus_idx, float value) { set_relative_value_if_exists(bus_idx, &Ui::AudioExpandedView::stereo_width_knob, value); } void MainWindow::set_treble(unsigned bus_idx, float value) { set_relative_value_if_exists(bus_idx, &Ui::AudioExpandedView::treble_knob, value); } void MainWindow::set_eq_absolute(unsigned bus_idx, EQBand eq_band, float value_db) { if (eq_band == EQ_BAND_TREBLE) { set_db_value_if_exists(bus_idx, &Ui::AudioExpandedView::treble_knob, value_db); } else if (eq_band == EQ_BAND_MID) { set_db_value_if_exists(bus_idx, &Ui::AudioExpandedView::mid_knob, value_db); } else if (eq_band == EQ_BAND_BASS) { set_db_value_if_exists(bus_idx, &Ui::AudioExpandedView::bass_knob, value_db); } else { assert(false); } } void MainWindow::set_mid(unsigned bus_idx, float value) { set_relative_value_if_exists(bus_idx, &Ui::AudioExpandedView::mid_knob, value); } void MainWindow::set_bass(unsigned bus_idx, float value) { set_relative_value_if_exists(bus_idx, &Ui::AudioExpandedView::bass_knob, value); } void MainWindow::set_gain(unsigned bus_idx, float value) { set_relative_value_if_exists(bus_idx, &Ui::AudioExpandedView::gainstaging_knob, value); } void MainWindow::set_compressor_threshold(unsigned bus_idx, float value) { set_relative_value_if_exists(bus_idx, &Ui::AudioExpandedView::compressor_threshold_knob, value); } void MainWindow::set_fader(unsigned bus_idx, float value) { set_relative_value_if_exists(bus_idx, &Ui::AudioExpandedView::fader, value); } void MainWindow::set_fader_absolute(unsigned bus_idx, float value_db) { if (global_audio_mixer != nullptr && global_audio_mixer->get_mapping_mode() == AudioMixer::MappingMode::MULTICHANNEL && bus_idx < audio_expanded_views.size()) { audio_expanded_views[bus_idx]->fader->setDbValue(value_db); } } void MainWindow::toggle_mute(unsigned bus_idx) { click_button_if_exists(bus_idx, &Ui::AudioExpandedView::mute_button); } void MainWindow::toggle_locut(unsigned bus_idx) { click_button_if_exists(bus_idx, &Ui::AudioExpandedView::locut_enabled); } void MainWindow::toggle_auto_gain_staging(unsigned bus_idx) { click_button_if_exists(bus_idx, &Ui::AudioExpandedView::gainstaging_auto_checkbox); } void MainWindow::toggle_compressor(unsigned bus_idx) { click_button_if_exists(bus_idx, &Ui::AudioExpandedView::compressor_enabled); } void MainWindow::clear_peak(unsigned bus_idx) { post_to_main_thread([=]{ if (global_audio_mixer->get_mapping_mode() == AudioMixer::MappingMode::MULTICHANNEL) { global_audio_mixer->reset_peak(bus_idx); midi_mapper.set_has_peaked(bus_idx, false); midi_mapper.refresh_lights(); } }); } void MainWindow::clear_all_highlights() { post_to_main_thread([this]{ highlight_locut(false); highlight_limiter_threshold(false); highlight_makeup_gain(false); highlight_toggle_limiter(false); highlight_toggle_auto_makeup_gain(false); for (unsigned bus_idx = 0; bus_idx < audio_expanded_views.size(); ++bus_idx) { highlight_treble(bus_idx, false); highlight_mid(bus_idx, false); highlight_bass(bus_idx, false); highlight_gain(bus_idx, false); highlight_compressor_threshold(bus_idx, false); highlight_fader(bus_idx, false); highlight_mute(bus_idx, false); highlight_toggle_locut(bus_idx, false); highlight_toggle_auto_gain_staging(bus_idx, false); highlight_toggle_compressor(bus_idx, false); } }); } void MainWindow::toggle_limiter() { if (global_audio_mixer->get_mapping_mode() == AudioMixer::MappingMode::MULTICHANNEL) { ui->limiter_enabled->click(); } } void MainWindow::toggle_auto_makeup_gain() { if (global_audio_mixer->get_mapping_mode() == AudioMixer::MappingMode::MULTICHANNEL) { ui->makeup_gain_auto_checkbox->click(); } } void MainWindow::switch_video_channel(int channel_number) { global_mixer->channel_clicked(channel_number); } void MainWindow::apply_transition(int transition_number) { global_mixer->transition_clicked(transition_number); } void MainWindow::prev_audio_view() { post_to_main_thread([this]{ prev_page(); }); } void MainWindow::next_audio_view() { post_to_main_thread([this]{ next_page(); }); } void MainWindow::begin_new_segment() { global_mixer->schedule_cut(); } void MainWindow::exit() { post_to_main_thread([this]{ close(); }); } void MainWindow::highlight_locut(bool highlight) { post_to_main_thread([this, highlight]{ highlight_control(ui->locut_cutoff_knob, highlight); highlight_control(ui->locut_cutoff_knob_2, highlight); }); } void MainWindow::highlight_limiter_threshold(bool highlight) { post_to_main_thread([this, highlight]{ highlight_control(ui->limiter_threshold_knob, highlight); highlight_control(ui->limiter_threshold_knob_2, highlight); }); } void MainWindow::highlight_makeup_gain(bool highlight) { post_to_main_thread([this, highlight]{ highlight_control(ui->makeup_gain_knob, highlight); highlight_control(ui->makeup_gain_knob_2, highlight); }); } void MainWindow::highlight_stereo_width(unsigned bus_idx, bool highlight) { highlight_control_if_exists(bus_idx, &Ui::AudioExpandedView::stereo_width_knob, highlight); } void MainWindow::highlight_treble(unsigned bus_idx, bool highlight) { highlight_control_if_exists(bus_idx, &Ui::AudioExpandedView::treble_knob, highlight); } void MainWindow::highlight_mid(unsigned bus_idx, bool highlight) { highlight_control_if_exists(bus_idx, &Ui::AudioExpandedView::mid_knob, highlight); } void MainWindow::highlight_bass(unsigned bus_idx, bool highlight) { highlight_control_if_exists(bus_idx, &Ui::AudioExpandedView::bass_knob, highlight); } void MainWindow::highlight_gain(unsigned bus_idx, bool highlight) { highlight_control_if_exists(bus_idx, &Ui::AudioExpandedView::gainstaging_knob, highlight); } void MainWindow::highlight_compressor_threshold(unsigned bus_idx, bool highlight) { highlight_control_if_exists(bus_idx, &Ui::AudioExpandedView::compressor_threshold_knob, highlight); } void MainWindow::highlight_fader(unsigned bus_idx, bool highlight) { highlight_control_if_exists(bus_idx, &Ui::AudioExpandedView::fader, highlight); } void MainWindow::highlight_mute(unsigned bus_idx, bool highlight) { highlight_control_if_exists(bus_idx, &Ui::AudioExpandedView::mute_button, highlight, /*is_mute_btton=*/true); } void MainWindow::highlight_toggle_locut(unsigned bus_idx, bool highlight) { highlight_control_if_exists(bus_idx, &Ui::AudioExpandedView::locut_enabled, highlight); } void MainWindow::highlight_toggle_auto_gain_staging(unsigned bus_idx, bool highlight) { highlight_control_if_exists(bus_idx, &Ui::AudioExpandedView::gainstaging_auto_checkbox, highlight); } void MainWindow::highlight_toggle_compressor(unsigned bus_idx, bool highlight) { highlight_control_if_exists(bus_idx, &Ui::AudioExpandedView::compressor_enabled, highlight); } void MainWindow::highlight_toggle_limiter(bool highlight) { post_to_main_thread([this, highlight]{ highlight_control(ui->limiter_enabled, highlight); highlight_control(ui->limiter_enabled_2, highlight); }); } void MainWindow::highlight_toggle_auto_makeup_gain(bool highlight) { post_to_main_thread([this, highlight]{ highlight_control(ui->makeup_gain_auto_checkbox, highlight); highlight_control(ui->makeup_gain_auto_checkbox_2, highlight); }); } template void MainWindow::set_relative_value(T *control, float value) { post_to_main_thread([control, value]{ control->setValue(lrintf(control->minimum() + value * (control->maximum() - control->minimum()))); }); } template void MainWindow::set_relative_value_if_exists(unsigned bus_idx, T *(Ui_AudioExpandedView::*control), float value) { if (global_audio_mixer != nullptr && global_audio_mixer->get_mapping_mode() == AudioMixer::MappingMode::MULTICHANNEL && bus_idx < audio_expanded_views.size()) { set_relative_value(audio_expanded_views[bus_idx]->*control, value); } } void MainWindow::set_db_value_if_exists(unsigned bus_idx, QDial *(Ui_AudioExpandedView::*control), float value_db) { post_to_main_thread([this, bus_idx, control, value_db]{ if (global_audio_mixer != nullptr && global_audio_mixer->get_mapping_mode() == AudioMixer::MappingMode::MULTICHANNEL && bus_idx < audio_expanded_views.size()) { int value = lrintf(value_db * 10.0f); (audio_expanded_views[bus_idx]->*control)->setValue(value); } }); } template void MainWindow::click_button_if_exists(unsigned bus_idx, T *(Ui_AudioExpandedView::*control)) { post_to_main_thread([this, bus_idx, control]{ if (global_audio_mixer != nullptr && global_audio_mixer->get_mapping_mode() == AudioMixer::MappingMode::MULTICHANNEL && bus_idx < audio_expanded_views.size()) { (audio_expanded_views[bus_idx]->*control)->click(); } }); } template void MainWindow::highlight_control(T *control, bool highlight) { if (control == nullptr) { return; } if (global_audio_mixer == nullptr || global_audio_mixer->get_mapping_mode() != AudioMixer::MappingMode::MULTICHANNEL) { highlight = false; } if (highlight) { control->setStyleSheet("background: rgb(0,255,0,80)"); } else { control->setStyleSheet(""); } } template void MainWindow::highlight_mute_control(T *control, bool highlight) { if (control == nullptr) { return; } if (global_audio_mixer == nullptr || global_audio_mixer->get_mapping_mode() != AudioMixer::MappingMode::MULTICHANNEL) { highlight = false; } if (highlight) { control->setStyleSheet("QPushButton { background: rgb(0,255,0,80); } QPushButton:checked { background: rgba(255,80,0,140); }"); } else { control->setStyleSheet("QPushButton:checked { background: rgba(255,0,0,80); }"); } } template void MainWindow::highlight_control_if_exists(unsigned bus_idx, T *(Ui_AudioExpandedView::*control), bool highlight, bool is_mute_button) { post_to_main_thread([this, bus_idx, control, highlight, is_mute_button]{ if (bus_idx < audio_expanded_views.size()) { if (is_mute_button) { highlight_mute_control(audio_expanded_views[bus_idx]->*control, highlight); } else { highlight_control(audio_expanded_views[bus_idx]->*control, highlight); } } }); } void MainWindow::set_transition_names(vector transition_names) { if (transition_names.size() < 1 || transition_names[0].empty()) { transition_btn1->setText(QString("")); } else { transition_btn1->setText(QString::fromStdString(transition_names[0] + " (J)")); ui->transition_btn1->setShortcut(QKeySequence("J")); } if (transition_names.size() < 2 || transition_names[1].empty()) { transition_btn2->setText(QString("")); } else { transition_btn2->setText(QString::fromStdString(transition_names[1] + " (K)")); ui->transition_btn2->setShortcut(QKeySequence("K")); } if (transition_names.size() < 3 || transition_names[2].empty()) { transition_btn3->setText(QString("")); } else { transition_btn3->setText(QString::fromStdString(transition_names[2] + " (L)")); ui->transition_btn3->setShortcut(QKeySequence("L")); } } void MainWindow::update_channel_name(Mixer::Output output, const string &name) { if (output == Mixer::OUTPUT_LIVE) { ui->label_live->setText(name.c_str()); } else if (output == Mixer::OUTPUT_PREVIEW) { ui->label_preview->setText(name.c_str()); } else if (output >= Mixer::OUTPUT_INPUT0) { unsigned channel = output - Mixer::OUTPUT_INPUT0; previews[channel]->label->setText(name.c_str()); } analyzer->update_channel_name(output, name); } void MainWindow::update_channel_color(Mixer::Output output, const string &color) { if (output >= Mixer::OUTPUT_INPUT0) { unsigned channel = output - Mixer::OUTPUT_INPUT0; previews[channel]->frame->setStyleSheet(QString::fromStdString("background-color:" + color)); } } void MainWindow::transition_clicked(int transition_number) { global_mixer->transition_clicked(transition_number); } void MainWindow::channel_clicked(int channel_number) { if (current_wb_pick_display == channel_number) { // The picking was already done from eventFilter(), since we don't get // the mouse pointer here. } else { global_mixer->channel_clicked(channel_number); } } void MainWindow::quick_cut_activated(int channel_number) { if (!global_flags.enable_quick_cut_keys) { return; } global_mixer->channel_clicked(channel_number); global_mixer->transition_clicked(0); } void MainWindow::wb_button_clicked(int channel_number) { current_wb_pick_display = channel_number; QApplication::setOverrideCursor(Qt::CrossCursor); } void MainWindow::audio_view_changed(int audio_view) { if (audio_view == current_audio_view) { return; } if (audio_view == 0) { // Compact audio view. (1, full audio view, has no video previews.) for (unsigned i = 0; i < previews.size(); ++i) { QWidget *display = static_cast(previews[i]->frame->parent()); ui->preview_displays->insertWidget(i, display, 1); } } else if (audio_view == 2) { // Video grid display. for (unsigned i = 0; i < previews.size(); ++i) { QWidget *display = static_cast(previews[i]->frame->parent()); display->setParent(ui->preview_displays_grid); display->show(); } } current_audio_view = audio_view; // Ask for a relayout, but only after the event loop is done doing relayout // on everything else. QMetaObject::invokeMethod(this, "relayout", Qt::QueuedConnection); } bool MainWindow::eventFilter(QObject *watched, QEvent *event) { if (current_wb_pick_display != -1 && event->type() == QEvent::MouseButtonRelease && watched->isWidgetType()) { QApplication::restoreOverrideCursor(); if (watched == previews[current_wb_pick_display]->display) { const QMouseEvent *mouse_event = (QMouseEvent *)event; previews[current_wb_pick_display]->display->grab_white_balance( current_wb_pick_display, mouse_event->x(), mouse_event->y()); } else { // The user clicked on something else, give up. // (The click goes through, which might not be ideal, but, yes.) current_wb_pick_display = -1; } } return false; } void MainWindow::closeEvent(QCloseEvent *event) { if (global_mixer->get_num_connected_clients() > 0) { QMessageBox::StandardButton reply = QMessageBox::question(this, "Nageru", "There are clients connected. Do you really want to quit?", QMessageBox::Yes | QMessageBox::No); if (reply != QMessageBox::Yes) { event->ignore(); return; } } analyzer->hide(); global_mixer->quit(); mixer_shutting_down(); event->accept(); } void MainWindow::audio_state_changed() { post_to_main_thread([this]{ if (global_audio_mixer->get_mapping_mode() == AudioMixer::MappingMode::SIMPLE) { return; } InputMapping mapping = global_audio_mixer->get_input_mapping(); for (unsigned bus_index = 0; bus_index < mapping.buses.size(); ++bus_index) { string label = get_bus_desc_label(mapping.buses[bus_index]); audio_miniviews[bus_index]->bus_desc_label->setFullText( QString::fromStdString(label)); audio_expanded_views[bus_index]->bus_desc_label->setFullText( QString::fromStdString(label)); } }); } nageru-2.3.0/nageru/mainwindow.h000066400000000000000000000161071450736322200166140ustar00rootroot00000000000000#ifndef MAINWINDOW_H #define MAINWINDOW_H #include #include #include #include #include #include #include #include "analyzer.h" #include "audio_mixer.h" #include "midi_mapper.h" #include "mixer.h" class QDial; class QEvent; class QObject; class QResizeEvent; class Ui_AudioExpandedView; namespace Ui { class AudioExpandedView; class AudioMiniView; class Display; class MainWindow; } // namespace Ui class QLabel; class QPushButton; class MainWindow : public QMainWindow, public ControllerReceiver { Q_OBJECT public: MainWindow(); void resizeEvent(QResizeEvent *event) override; void mixer_created(Mixer *mixer); // Used to release FBOs on the global ResourcePool. Call after the // mixer has been shut down but not destroyed yet. void mixer_shutting_down(); public slots: void cut_triggered(); void x264_bitrate_triggered(); void exit_triggered(); void manual_triggered(); void about_triggered(); void open_analyzer_triggered(); void simple_audio_mode_triggered(); void multichannel_audio_mode_triggered(); void input_mapping_triggered(); void midi_mapping_triggered(); void timecode_stream_triggered(); void timecode_stdout_triggered(); void transition_clicked(int transition_number); void channel_clicked(int channel_number); void quick_cut_activated(int channel_number); void wb_button_clicked(int channel_number); void audio_view_changed(int audio_view); void set_transition_names(std::vector transition_names); void update_channel_name(Mixer::Output output, const std::string &name); void update_channel_color(Mixer::Output output, const std::string &color); void gain_staging_knob_changed(unsigned bus_index, int value); void final_makeup_gain_knob_changed(int value); void cutoff_knob_changed(int value); void stereo_width_knob_changed(unsigned bus_index, int value); void eq_knob_changed(unsigned bus_index, EQBand band, int value); void limiter_threshold_knob_changed(int value); void compressor_threshold_knob_changed(unsigned bus_index, int value); void mini_fader_changed(int bus, double db_volume); void mute_button_toggled(int bus, bool checked); void reset_meters_button_clicked(); void relayout(); // ControllerReceiver interface. void set_locut(float value) override; void set_limiter_threshold(float value) override; void set_makeup_gain(float value) override; void set_stereo_width(unsigned bus_idx, float value) override; void set_treble(unsigned bus_idx, float value) override; void set_mid(unsigned bus_idx, float value) override; void set_bass(unsigned bus_idx, float value) override; void set_eq_absolute(unsigned bus_idx, EQBand eq_band, float value_db); void set_gain(unsigned bus_idx, float value) override; void set_compressor_threshold(unsigned bus_idx, float value) override; void set_fader(unsigned bus_idx, float value) override; void set_fader_absolute(unsigned bus_idx, float value_db); // Used by the theme only. void toggle_mute(unsigned bus_idx) override; void toggle_locut(unsigned bus_idx) override; void toggle_auto_gain_staging(unsigned bus_idx) override; void toggle_compressor(unsigned bus_idx) override; void clear_peak(unsigned bus_idx) override; void toggle_limiter() override; void toggle_auto_makeup_gain() override; void switch_video_channel(int channel_number) override; void apply_transition(int transition_number) override; void prev_audio_view() override; void next_audio_view() override; void begin_new_segment() override; void exit() override; void clear_all_highlights() override; void highlight_locut(bool highlight) override; void highlight_limiter_threshold(bool highlight) override; void highlight_makeup_gain(bool highlight) override; void highlight_stereo_width(unsigned bus_idx, bool highlight) override; void highlight_treble(unsigned bus_idx, bool highlight) override; void highlight_mid(unsigned bus_idx, bool highlight) override; void highlight_bass(unsigned bus_idx, bool highlight) override; void highlight_gain(unsigned bus_idx, bool highlight) override; void highlight_compressor_threshold(unsigned bus_idx, bool highlight) override; void highlight_fader(unsigned bus_idx, bool highlight) override; void highlight_mute(unsigned bus_idx, bool highlight) override; void highlight_toggle_locut(unsigned bus_idx, bool highlight) override; void highlight_toggle_auto_gain_staging(unsigned bus_idx, bool highlight) override; void highlight_toggle_compressor(unsigned bus_idx, bool highlight) override; void highlight_clear_peak(unsigned bus_idx, bool highlight) override {} // We don't mark this currently. void highlight_toggle_limiter(bool highlight) override; void highlight_toggle_auto_makeup_gain(bool highlight) override; // Raw receivers are not used. void controller_changed(unsigned controller) override {} void note_on(unsigned note) override {} private: void reset_audio_mapping_ui(); void setup_audio_miniview(); void setup_audio_expanded_view(); bool eventFilter(QObject *watched, QEvent *event) override; void closeEvent(QCloseEvent *event) override; void update_cutoff_labels(float cutoff_hz); void update_stereo_knob_and_label(unsigned bus_index, int stereo_width_percent); void update_stereo_label(unsigned bus_index, int stereo_width_percent); void update_eq_label(unsigned bus_index, EQBand band, float gain_db); void setup_theme_menu(); void fill_menu_from_theme_menu(const std::vector> &entries, QMenu *menu); void prev_page(); void next_page(); // Called from DiskSpaceEstimator. void report_disk_space(off_t free_bytes, double estimated_seconds_left, double file_length_seconds); // Called from the mixer. void audio_level_callback(float level_lufs, float peak_db, std::vector bus_levels, float global_level_lufs, float range_low_lufs, float range_high_lufs, float final_makeup_gain_db, float correlation); std::chrono::steady_clock::time_point last_audio_level_callback; void audio_state_changed(); template void set_relative_value(T *control, float value); template void set_relative_value_if_exists(unsigned bus_idx, T *Ui_AudioExpandedView::*control, float value); void set_db_value_if_exists(unsigned bus_idx, QDial *Ui_AudioExpandedView::*control, float value_db); template void click_button_if_exists(unsigned bus_idx, T *Ui_AudioExpandedView::*control); template void highlight_control(T *control, bool highlight); template void highlight_mute_control(T *control, bool highlight); template void highlight_control_if_exists(unsigned bus_idx, T *(Ui_AudioExpandedView::*control), bool highlight, bool is_mute_button = false); Ui::MainWindow *ui; QLabel *disk_free_label; QMenu *theme_menu = nullptr; QPushButton *transition_btn1, *transition_btn2, *transition_btn3; std::vector previews; std::vector audio_miniviews; std::vector audio_expanded_views; int current_wb_pick_display = -1; int current_audio_view = -1; MIDIMapper midi_mapper; std::unique_ptr analyzer; }; extern MainWindow *global_mainwindow; #endif nageru-2.3.0/nageru/mainwindow.ui000066400000000000000000001573541450736322200170140ustar00rootroot00000000000000 MainWindow 0 0 1089 664 Nageru true 0 0 0 1 1 Preview Qt::AlignCenter 25 0 20 0 0 115 0 16777215 16777215 Cut 0 0 115 0 16777215 16777215 Fade 0 0 115 0 16777215 16777215 Wipe 0 1 1 16 9 16 9 Live Qt::AlignCenter 0 0 0 0 14 255 255 255 239 0 4 255 255 255 239 0 4 239 0 4 239 0 4 true 0 4 0 0 1 16 0 1 0 0 0 255 255 255 5 239 111 255 255 255 5 239 111 5 239 111 5 239 111 true 30 0 -0.0 Qt::AlignCenter 3 0 0 0 24 0 255 255 255 0 239 219 255 255 255 0 239 219 0 239 219 0 239 219 true 30 20 RST false 0 0 0 0 0 8 0 0 0 0 0 0 Compact audio view (1/3) Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter true 15 15 ... true Qt::LeftArrow 15 15 ... true Qt::RightArrow 6 0 QFrame::NoFrame Qt::ScrollBarAlwaysOff true 0 0 524 238 0 0 0 0 0 QLayout::SetFixedSize Qt::Horizontal 40 20 0 64 64 16777215 64 -400 0 -260 30.000000000000000 true Auto true Compr. threshold Gain staging Qt::AlignCenter -26.0 dB Qt::AlignCenter 64 64 16777215 64 -300 300 60.000000000000000 true -0.0 dB Qt::AlignCenter -14.0 dB Qt::AlignCenter Enabled true Auto true 64 64 16777215 64 -400 0 -140 30.000000000000000 true 120 Hz Qt::AlignCenter Enabled true -0.0 dB Qt::AlignCenter Enabled true Lo-cut (24dB/oct) Qt::Vertical QSizePolicy::Expanding 20 40 Qt::Vertical 20 40 64 64 16777215 64 -150 150 30.000000000000000 true Limiter threshold Qt::AlignCenter Makeup gain Qt::AlignCenter 0 0 64 64 16777215 64 60 26 Qt::Horizontal QSizePolicy::Preferred 0 40 0 0 0 0 0 Full audio view (2/3) Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter true 15 15 ... true Qt::LeftArrow 15 15 ... true Qt::RightArrow 6 0 QFrame::NoFrame Qt::ScrollBarAlwaysOff true 0 0 46 20 0 0 0 0 0 QLayout::SetFixedSize Qt::Horizontal 723 20 0 120 Hz Qt::AlignCenter -0.0 dB Qt::AlignCenter -14.0 dB Qt::AlignCenter 0 0 64 64 16777215 64 60 26 Enabled true 64 64 16777215 64 -400 0 -140 30.000000000000000 true Auto true Qt::Vertical 20 40 Lo-cut (24dB/oct) Qt::Vertical QSizePolicy::Expanding 20 40 64 64 16777215 64 -150 150 30.000000000000000 true Limiter threshold Qt::AlignCenter Makeup gain Qt::AlignCenter 0 0 0 0 0 Video grid display (3/3) Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter true 15 15 ... true Qt::LeftArrow 15 15 ... true Qt::RightArrow 0 0 1089 20 &Video Display &time code HDMI/SDI output device HDMI/SDI output resolution &Help &Audio &Exit &Begin new video segment &About Nageru… Change &x264 bitrate… &Input mapping… true true Simple true Multichannel Setup MIDI controller… Online &manual… true In &stream true On standard &output Open frame &analyzer… true Enable &quick-cut keys (Q, W, E, etc.) true true Accept new SRT connections on port 9710 VUMeter QWidget
vumeter.h
1
ClickableLabel QLabel
clickable_label.h
GLWidget QWidget
glwidget.h
LRAMeter QWidget
lrameter.h
1
CorrelationMeter QWidget
correlation_meter.h
1
nageru-2.3.0/nageru/midi_mapper.cpp000066400000000000000000000377271450736322200172740ustar00rootroot00000000000000#include "midi_mapper.h" #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include "audio_mixer.h" #include "nageru_midi_mapping.pb.h" #include "shared/midi_device.h" #include "shared/midi_mapper_util.h" #include "shared/text_proto.h" using namespace google::protobuf; using namespace std; using namespace std::placeholders; MIDIMapper::MIDIMapper(ControllerReceiver *receiver) : receiver(receiver), mapping_proto(new MIDIMappingProto), midi_device(this) { } MIDIMapper::~MIDIMapper() {} bool load_midi_mapping_from_file(const string &filename, MIDIMappingProto *new_mapping) { return load_proto_from_file(filename, new_mapping); } bool save_midi_mapping_to_file(const MIDIMappingProto &mapping_proto, const string &filename) { return save_proto_to_file(mapping_proto, filename); } void MIDIMapper::set_midi_mapping(const MIDIMappingProto &new_mapping) { lock_guard lock(mu); if (mapping_proto) { mapping_proto->CopyFrom(new_mapping); } else { mapping_proto.reset(new MIDIMappingProto(new_mapping)); } num_controller_banks = min(max(mapping_proto->num_controller_banks(), 1), 5); current_controller_bank = 0; receiver->clear_all_highlights(); update_highlights(); } void MIDIMapper::start_thread() { midi_device.start_thread(); } const MIDIMappingProto &MIDIMapper::get_current_mapping() const { lock_guard lock(mu); return *mapping_proto; } ControllerReceiver *MIDIMapper::set_receiver(ControllerReceiver *new_receiver) { lock_guard lock(mu); swap(receiver, new_receiver); return new_receiver; // Now old receiver. } void MIDIMapper::controller_received(int controller, int value_int) { const float value = map_controller_to_float(controller, value_int); receiver->controller_changed(controller); // Global controllers. match_controller(controller, MIDIMappingBusProto::kLocutFieldNumber, MIDIMappingProto::kLocutBankFieldNumber, value, bind(&ControllerReceiver::set_locut, receiver, _2)); match_controller(controller, MIDIMappingBusProto::kLimiterThresholdFieldNumber, MIDIMappingProto::kLimiterThresholdBankFieldNumber, value, bind(&ControllerReceiver::set_limiter_threshold, receiver, _2)); match_controller(controller, MIDIMappingBusProto::kMakeupGainFieldNumber, MIDIMappingProto::kMakeupGainBankFieldNumber, value, bind(&ControllerReceiver::set_makeup_gain, receiver, _2)); // Bus controllers. match_controller(controller, MIDIMappingBusProto::kStereoWidthFieldNumber, MIDIMappingProto::kStereoWidthBankFieldNumber, value, bind(&ControllerReceiver::set_stereo_width, receiver, _1, _2)); match_controller(controller, MIDIMappingBusProto::kTrebleFieldNumber, MIDIMappingProto::kTrebleBankFieldNumber, value, bind(&ControllerReceiver::set_treble, receiver, _1, _2)); match_controller(controller, MIDIMappingBusProto::kMidFieldNumber, MIDIMappingProto::kMidBankFieldNumber, value, bind(&ControllerReceiver::set_mid, receiver, _1, _2)); match_controller(controller, MIDIMappingBusProto::kBassFieldNumber, MIDIMappingProto::kBassBankFieldNumber, value, bind(&ControllerReceiver::set_bass, receiver, _1, _2)); match_controller(controller, MIDIMappingBusProto::kGainFieldNumber, MIDIMappingProto::kGainBankFieldNumber, value, bind(&ControllerReceiver::set_gain, receiver, _1, _2)); match_controller(controller, MIDIMappingBusProto::kCompressorThresholdFieldNumber, MIDIMappingProto::kCompressorThresholdBankFieldNumber, value, bind(&ControllerReceiver::set_compressor_threshold, receiver, _1, _2)); match_controller(controller, MIDIMappingBusProto::kFaderFieldNumber, MIDIMappingProto::kFaderBankFieldNumber, value, bind(&ControllerReceiver::set_fader, receiver, _1, _2)); } void MIDIMapper::note_on_received(int note) { lock_guard lock(mu); receiver->note_on(note); for (size_t bus_idx = 0; bus_idx < size_t(mapping_proto->bus_mapping_size()); ++bus_idx) { const MIDIMappingBusProto &bus_mapping = mapping_proto->bus_mapping(bus_idx); if (bus_mapping.has_prev_bank() && bus_mapping.prev_bank().note_number() == note) { current_controller_bank = (current_controller_bank + num_controller_banks - 1) % num_controller_banks; update_highlights(); update_lights_lock_held(); } if (bus_mapping.has_next_bank() && bus_mapping.next_bank().note_number() == note) { current_controller_bank = (current_controller_bank + 1) % num_controller_banks; update_highlights(); update_lights_lock_held(); } if (bus_mapping.has_select_bank_1() && bus_mapping.select_bank_1().note_number() == note) { current_controller_bank = 0; update_highlights(); update_lights_lock_held(); } if (bus_mapping.has_select_bank_2() && bus_mapping.select_bank_2().note_number() == note && num_controller_banks >= 2) { current_controller_bank = 1; update_highlights(); update_lights_lock_held(); } if (bus_mapping.has_select_bank_3() && bus_mapping.select_bank_3().note_number() == note && num_controller_banks >= 3) { current_controller_bank = 2; update_highlights(); update_lights_lock_held(); } if (bus_mapping.has_select_bank_4() && bus_mapping.select_bank_4().note_number() == note && num_controller_banks >= 4) { current_controller_bank = 3; update_highlights(); update_lights_lock_held(); } if (bus_mapping.has_select_bank_5() && bus_mapping.select_bank_5().note_number() == note && num_controller_banks >= 5) { current_controller_bank = 4; update_highlights(); update_lights_lock_held(); } } match_button(note, MIDIMappingBusProto::kToggleLocutFieldNumber, MIDIMappingProto::kToggleLocutBankFieldNumber, bind(&ControllerReceiver::toggle_locut, receiver, _1)); match_button(note, MIDIMappingBusProto::kToggleAutoGainStagingFieldNumber, MIDIMappingProto::kToggleAutoGainStagingBankFieldNumber, bind(&ControllerReceiver::toggle_auto_gain_staging, receiver, _1)); match_button(note, MIDIMappingBusProto::kToggleCompressorFieldNumber, MIDIMappingProto::kToggleCompressorBankFieldNumber, bind(&ControllerReceiver::toggle_compressor, receiver, _1)); match_button(note, MIDIMappingBusProto::kClearPeakFieldNumber, MIDIMappingProto::kClearPeakBankFieldNumber, bind(&ControllerReceiver::clear_peak, receiver, _1)); match_button(note, MIDIMappingBusProto::kToggleMuteFieldNumber, MIDIMappingProto::kClearPeakBankFieldNumber, bind(&ControllerReceiver::toggle_mute, receiver, _1)); match_button(note, MIDIMappingBusProto::kToggleLimiterFieldNumber, MIDIMappingProto::kToggleLimiterBankFieldNumber, bind(&ControllerReceiver::toggle_limiter, receiver)); match_button(note, MIDIMappingBusProto::kToggleAutoMakeupGainFieldNumber, MIDIMappingProto::kToggleAutoMakeupGainBankFieldNumber, bind(&ControllerReceiver::toggle_auto_makeup_gain, receiver)); match_button(note, MIDIMappingBusProto::kSwitchVideoChannelFieldNumber, MIDIMappingProto::kSwitchVideoChannelBankFieldNumber, bind(&ControllerReceiver::switch_video_channel, receiver, _1)); match_button(note, MIDIMappingBusProto::kApplyTransitionFieldNumber, MIDIMappingProto::kApplyTransitionBankFieldNumber, bind(&ControllerReceiver::apply_transition, receiver, _1)); match_button(note, MIDIMappingBusProto::kPrevAudioViewFieldNumber, MIDIMappingProto::kPrevAudioViewBankFieldNumber, bind(&ControllerReceiver::prev_audio_view, receiver)); match_button(note, MIDIMappingBusProto::kNextAudioViewFieldNumber, MIDIMappingProto::kNextAudioViewBankFieldNumber, bind(&ControllerReceiver::prev_audio_view, receiver)); match_button(note, MIDIMappingBusProto::kBeginNewVideoSegmentFieldNumber, MIDIMappingProto::kBeginNewVideoSegmentBankFieldNumber, bind(&ControllerReceiver::begin_new_segment, receiver)); match_button(note, MIDIMappingBusProto::kExitFieldNumber, MIDIMappingProto::kExitBankFieldNumber, bind(&ControllerReceiver::exit, receiver)); } void MIDIMapper::update_num_subscribers(unsigned num_subscribers) { num_subscribed_ports = num_subscribers; update_highlights(); } void MIDIMapper::match_controller(int controller, int field_number, int bank_field_number, float value, function func) { if (bank_mismatch(bank_field_number)) { return; } for (size_t bus_idx = 0; bus_idx < size_t(mapping_proto->bus_mapping_size()); ++bus_idx) { const MIDIMappingBusProto &bus_mapping = mapping_proto->bus_mapping(bus_idx); if (match_controller_helper(bus_mapping, field_number, controller)) { func(bus_idx, value); } } } void MIDIMapper::match_button(int note, int field_number, int bank_field_number, function func) { if (bank_mismatch(bank_field_number)) { return; } for (size_t bus_idx = 0; bus_idx < size_t(mapping_proto->bus_mapping_size()); ++bus_idx) { const MIDIMappingBusProto &bus_mapping = mapping_proto->bus_mapping(bus_idx); if (match_button_helper(bus_mapping, field_number, note)) { func(bus_idx); } } } bool MIDIMapper::has_active_controller(unsigned bus_idx, int field_number, int bank_field_number) { if (bank_mismatch(bank_field_number)) { return false; } const MIDIMappingBusProto &bus_mapping = mapping_proto->bus_mapping(bus_idx); const FieldDescriptor *descriptor = bus_mapping.GetDescriptor()->FindFieldByNumber(field_number); const Reflection *bus_reflection = bus_mapping.GetReflection(); return bus_reflection->HasField(bus_mapping, descriptor); } bool MIDIMapper::bank_mismatch(int bank_field_number) { return !match_bank_helper(*mapping_proto, bank_field_number, current_controller_bank); } void MIDIMapper::refresh_highlights() { receiver->clear_all_highlights(); update_highlights(); } void MIDIMapper::refresh_lights() { lock_guard lock(mu); update_lights_lock_held(); } void MIDIMapper::update_highlights() { if (num_subscribed_ports.load() == 0) { receiver->clear_all_highlights(); return; } // Global controllers. bool highlight_locut = false; bool highlight_limiter_threshold = false; bool highlight_makeup_gain = false; bool highlight_toggle_limiter = false; bool highlight_toggle_auto_makeup_gain = false; for (size_t bus_idx = 0; bus_idx < size_t(mapping_proto->bus_mapping_size()); ++bus_idx) { if (has_active_controller( bus_idx, MIDIMappingBusProto::kLocutFieldNumber, MIDIMappingProto::kLocutBankFieldNumber)) { highlight_locut = true; } if (has_active_controller( bus_idx, MIDIMappingBusProto::kLimiterThresholdFieldNumber, MIDIMappingProto::kLimiterThresholdBankFieldNumber)) { highlight_limiter_threshold = true; } if (has_active_controller( bus_idx, MIDIMappingBusProto::kMakeupGainFieldNumber, MIDIMappingProto::kMakeupGainBankFieldNumber)) { highlight_makeup_gain = true; } if (has_active_controller( bus_idx, MIDIMappingBusProto::kToggleLimiterFieldNumber, MIDIMappingProto::kToggleLimiterBankFieldNumber)) { highlight_toggle_limiter = true; } if (has_active_controller( bus_idx, MIDIMappingBusProto::kToggleAutoMakeupGainFieldNumber, MIDIMappingProto::kToggleAutoMakeupGainBankFieldNumber)) { highlight_toggle_auto_makeup_gain = true; } } receiver->highlight_locut(highlight_locut); receiver->highlight_limiter_threshold(highlight_limiter_threshold); receiver->highlight_makeup_gain(highlight_makeup_gain); receiver->highlight_toggle_limiter(highlight_toggle_limiter); receiver->highlight_toggle_auto_makeup_gain(highlight_toggle_auto_makeup_gain); // Per-bus controllers. for (size_t bus_idx = 0; bus_idx < size_t(mapping_proto->bus_mapping_size()); ++bus_idx) { receiver->highlight_stereo_width(bus_idx, has_active_controller( bus_idx, MIDIMappingBusProto::kStereoWidthFieldNumber, MIDIMappingProto::kStereoWidthBankFieldNumber)); receiver->highlight_treble(bus_idx, has_active_controller( bus_idx, MIDIMappingBusProto::kTrebleFieldNumber, MIDIMappingProto::kTrebleBankFieldNumber)); receiver->highlight_mid(bus_idx, has_active_controller( bus_idx, MIDIMappingBusProto::kMidFieldNumber, MIDIMappingProto::kMidBankFieldNumber)); receiver->highlight_bass(bus_idx, has_active_controller( bus_idx, MIDIMappingBusProto::kBassFieldNumber, MIDIMappingProto::kBassBankFieldNumber)); receiver->highlight_gain(bus_idx, has_active_controller( bus_idx, MIDIMappingBusProto::kGainFieldNumber, MIDIMappingProto::kGainBankFieldNumber)); receiver->highlight_compressor_threshold(bus_idx, has_active_controller( bus_idx, MIDIMappingBusProto::kCompressorThresholdFieldNumber, MIDIMappingProto::kCompressorThresholdBankFieldNumber)); receiver->highlight_fader(bus_idx, has_active_controller( bus_idx, MIDIMappingBusProto::kFaderFieldNumber, MIDIMappingProto::kFaderBankFieldNumber)); receiver->highlight_mute(bus_idx, has_active_controller( bus_idx, MIDIMappingBusProto::kToggleMuteFieldNumber, MIDIMappingProto::kToggleMuteBankFieldNumber)); receiver->highlight_toggle_locut(bus_idx, has_active_controller( bus_idx, MIDIMappingBusProto::kToggleLocutFieldNumber, MIDIMappingProto::kToggleLocutBankFieldNumber)); receiver->highlight_toggle_auto_gain_staging(bus_idx, has_active_controller( bus_idx, MIDIMappingBusProto::kToggleAutoGainStagingFieldNumber, MIDIMappingProto::kToggleAutoGainStagingBankFieldNumber)); receiver->highlight_toggle_compressor(bus_idx, has_active_controller( bus_idx, MIDIMappingBusProto::kToggleCompressorFieldNumber, MIDIMappingProto::kToggleCompressorBankFieldNumber)); } } void MIDIMapper::update_lights_lock_held() { if (global_audio_mixer == nullptr) { return; } map active_lights; // Desired state. if (current_controller_bank == 0) { activate_lights_all_buses(MIDIMappingBusProto::kBank1IsSelectedFieldNumber, &active_lights); } if (current_controller_bank == 1) { activate_lights_all_buses(MIDIMappingBusProto::kBank2IsSelectedFieldNumber, &active_lights); } if (current_controller_bank == 2) { activate_lights_all_buses(MIDIMappingBusProto::kBank3IsSelectedFieldNumber, &active_lights); } if (current_controller_bank == 3) { activate_lights_all_buses(MIDIMappingBusProto::kBank4IsSelectedFieldNumber, &active_lights); } if (current_controller_bank == 4) { activate_lights_all_buses(MIDIMappingBusProto::kBank5IsSelectedFieldNumber, &active_lights); } if (global_audio_mixer->get_limiter_enabled()) { activate_lights_all_buses(MIDIMappingBusProto::kLimiterIsOnFieldNumber, &active_lights); } if (global_audio_mixer->get_final_makeup_gain_auto()) { activate_lights_all_buses(MIDIMappingBusProto::kAutoMakeupGainIsOnFieldNumber, &active_lights); } unsigned num_buses = min(global_audio_mixer->num_buses(), mapping_proto->bus_mapping_size()); for (unsigned bus_idx = 0; bus_idx < num_buses; ++bus_idx) { const MIDIMappingBusProto &bus_mapping = mapping_proto->bus_mapping(bus_idx); if (global_audio_mixer->get_mute(bus_idx)) { activate_mapped_light(bus_mapping, MIDIMappingBusProto::kIsMutedFieldNumber, &active_lights); } if (global_audio_mixer->get_locut_enabled(bus_idx)) { activate_mapped_light(bus_mapping, MIDIMappingBusProto::kLocutIsOnFieldNumber, &active_lights); } if (global_audio_mixer->get_gain_staging_auto(bus_idx)) { activate_mapped_light(bus_mapping, MIDIMappingBusProto::kAutoGainStagingIsOnFieldNumber, &active_lights); } if (global_audio_mixer->get_compressor_enabled(bus_idx)) { activate_mapped_light(bus_mapping, MIDIMappingBusProto::kCompressorIsOnFieldNumber, &active_lights); } if (has_peaked[bus_idx]) { activate_mapped_light(bus_mapping, MIDIMappingBusProto::kHasPeakedFieldNumber, &active_lights); } } midi_device.update_lights(active_lights); } void MIDIMapper::activate_lights_all_buses(int field_number, map *active_lights) { for (size_t bus_idx = 0; bus_idx < size_t(mapping_proto->bus_mapping_size()); ++bus_idx) { const MIDIMappingBusProto &bus_mapping = mapping_proto->bus_mapping(bus_idx); activate_mapped_light(bus_mapping, field_number, active_lights); } } nageru-2.3.0/nageru/midi_mapper.h000066400000000000000000000125051450736322200167240ustar00rootroot00000000000000#ifndef _MIDI_MAPPER_H #define _MIDI_MAPPER_H 1 // MIDIMapper is a class that gets incoming MIDI messages from mixer // controllers (ie., it is not meant to be used with regular instruments) // via MIDIDevice, interprets them according to a device-specific, user-defined // mapping, and calls back into a receiver (typically the MainWindow). // This way, it is possible to control audio functionality using physical // pots and faders instead of the mouse. #include #include #include #include #include #include #include #include "defs.h" #include "shared/midi_device.h" class MIDIMappingProto; // Interface for receiving interpreted controller messages. class ControllerReceiver { public: virtual ~ControllerReceiver() {} // All values are [0.0, 1.0]. virtual void set_locut(float value) = 0; virtual void set_limiter_threshold(float value) = 0; virtual void set_makeup_gain(float value) = 0; virtual void set_stereo_width(unsigned bus_idx, float value) = 0; virtual void set_treble(unsigned bus_idx, float value) = 0; virtual void set_mid(unsigned bus_idx, float value) = 0; virtual void set_bass(unsigned bus_idx, float value) = 0; virtual void set_gain(unsigned bus_idx, float value) = 0; virtual void set_compressor_threshold(unsigned bus_idx, float value) = 0; virtual void set_fader(unsigned bus_idx, float value) = 0; virtual void toggle_mute(unsigned bus_idx) = 0; virtual void toggle_locut(unsigned bus_idx) = 0; virtual void toggle_auto_gain_staging(unsigned bus_idx) = 0; virtual void toggle_compressor(unsigned bus_idx) = 0; virtual void clear_peak(unsigned bus_idx) = 0; virtual void toggle_limiter() = 0; virtual void toggle_auto_makeup_gain() = 0; // Non-audio events. virtual void switch_video_channel(int channel_number) = 0; virtual void apply_transition(int transition_number) = 0; virtual void prev_audio_view() = 0; virtual void next_audio_view() = 0; virtual void begin_new_segment() = 0; virtual void exit() = 0; // Signals to highlight controls to mark them to the user // as MIDI-controllable (or not). virtual void clear_all_highlights() = 0; virtual void highlight_locut(bool highlight) = 0; virtual void highlight_limiter_threshold(bool highlight) = 0; virtual void highlight_makeup_gain(bool highlight) = 0; virtual void highlight_stereo_width(unsigned bus_idx, bool highlight) = 0; virtual void highlight_treble(unsigned bus_idx, bool highlight) = 0; virtual void highlight_mid(unsigned bus_idx, bool highlight) = 0; virtual void highlight_bass(unsigned bus_idx, bool highlight) = 0; virtual void highlight_gain(unsigned bus_idx, bool highlight) = 0; virtual void highlight_compressor_threshold(unsigned bus_idx, bool highlight) = 0; virtual void highlight_fader(unsigned bus_idx, bool highlight) = 0; virtual void highlight_mute(unsigned bus_idx, bool highlight) = 0; virtual void highlight_toggle_locut(unsigned bus_idx, bool highlight) = 0; virtual void highlight_toggle_auto_gain_staging(unsigned bus_idx, bool highlight) = 0; virtual void highlight_toggle_compressor(unsigned bus_idx, bool highlight) = 0; virtual void highlight_clear_peak(unsigned bus_idx, bool highlight) = 0; virtual void highlight_toggle_limiter(bool highlight) = 0; virtual void highlight_toggle_auto_makeup_gain(bool highlight) = 0; // Raw events; used for the editor dialog only. virtual void controller_changed(unsigned controller) = 0; virtual void note_on(unsigned note) = 0; }; class MIDIMapper : public MIDIReceiver { public: MIDIMapper(ControllerReceiver *receiver); virtual ~MIDIMapper(); void set_midi_mapping(const MIDIMappingProto &new_mapping); void start_thread(); const MIDIMappingProto &get_current_mapping() const; // Overwrites and returns the previous value. ControllerReceiver *set_receiver(ControllerReceiver *new_receiver); void refresh_highlights(); void refresh_lights(); void set_has_peaked(unsigned bus_idx, bool has_peaked) { this->has_peaked[bus_idx] = has_peaked; } // MIDIReceiver. void controller_received(int controller, int value) override; void note_on_received(int note) override; void update_num_subscribers(unsigned num_subscribers) override; private: void match_controller(int controller, int field_number, int bank_field_number, float value, std::function func); void match_button(int note, int field_number, int bank_field_number, std::function func); bool has_active_controller(unsigned bus_idx, int field_number, int bank_field_number); // Also works for buttons. bool bank_mismatch(int bank_field_number); void update_highlights(); void update_lights_lock_held(); void activate_lights_all_buses(int field_number, std::map *active_lights); std::atomic should_quit{false}; std::atomic has_peaked[MAX_BUSES] {{ false }}; mutable std::mutex mu; ControllerReceiver *receiver; // Under . std::unique_ptr mapping_proto; // Under . int num_controller_banks; // Under . std::atomic current_controller_bank{0}; std::atomic num_subscribed_ports{0}; MIDIDevice midi_device; }; bool load_midi_mapping_from_file(const std::string &filename, MIDIMappingProto *new_mapping); bool save_midi_mapping_to_file(const MIDIMappingProto &mapping_proto, const std::string &filename); #endif // !defined(_MIDI_MAPPER_H) nageru-2.3.0/nageru/midi_mapping.ui000066400000000000000000000053221450736322200172600ustar00rootroot00000000000000 MIDIMappingDialog 0 0 879 583 MIDI controller setup 1 Add or change a mapping by clicking in the cell, then moving the corresponding control on your MIDI device. Guess &bus Guess &group Qt::Horizontal 40 20 &Save… &Load… Qt::Horizontal 40 20 Qt::Horizontal QDialogButtonBox::Cancel|QDialogButtonBox::Ok nageru-2.3.0/nageru/midi_mapping_dialog.cpp000066400000000000000000000610111450736322200207410ustar00rootroot00000000000000#include "midi_mapping_dialog.h" #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include "shared/controller_spin_box.h" #include "midi_mapper.h" #include "nageru_midi_mapping.pb.h" #include "shared/midi_mapper_util.h" #include "shared/post_to_main_thread.h" #include "ui_midi_mapping.h" class QObject; using namespace google::protobuf; using namespace std; vector per_bus_controllers = { { "Stereo width", MIDIMappingBusProto::kStereoWidthFieldNumber, MIDIMappingProto::kStereoWidthBankFieldNumber }, { "Treble", MIDIMappingBusProto::kTrebleFieldNumber, MIDIMappingProto::kTrebleBankFieldNumber }, { "Mid", MIDIMappingBusProto::kMidFieldNumber, MIDIMappingProto::kMidBankFieldNumber }, { "Bass", MIDIMappingBusProto::kBassFieldNumber, MIDIMappingProto::kBassBankFieldNumber }, { "Gain", MIDIMappingBusProto::kGainFieldNumber, MIDIMappingProto::kGainBankFieldNumber }, { "Compressor threshold", MIDIMappingBusProto::kCompressorThresholdFieldNumber, MIDIMappingProto::kCompressorThresholdBankFieldNumber}, { "Fader", MIDIMappingBusProto::kFaderFieldNumber, MIDIMappingProto::kFaderBankFieldNumber } }; vector per_bus_buttons = { { "Toggle mute", MIDIMappingBusProto::kToggleMuteFieldNumber, MIDIMappingProto::kToggleMuteBankFieldNumber }, { "Toggle locut", MIDIMappingBusProto::kToggleLocutFieldNumber, MIDIMappingProto::kToggleLocutBankFieldNumber }, { "Togle auto gain staging", MIDIMappingBusProto::kToggleAutoGainStagingFieldNumber, MIDIMappingProto::kToggleAutoGainStagingBankFieldNumber }, { "Togle compressor", MIDIMappingBusProto::kToggleCompressorFieldNumber, MIDIMappingProto::kToggleCompressorBankFieldNumber }, { "Clear peak", MIDIMappingBusProto::kClearPeakFieldNumber, MIDIMappingProto::kClearPeakBankFieldNumber } }; vector per_bus_lights = { { "Is muted", MIDIMappingBusProto::kIsMutedFieldNumber, 0 }, { "Locut is on", MIDIMappingBusProto::kLocutIsOnFieldNumber, 0 }, { "Auto gain staging is on", MIDIMappingBusProto::kAutoGainStagingIsOnFieldNumber, 0 }, { "Compressor is on", MIDIMappingBusProto::kCompressorIsOnFieldNumber, 0 }, { "Bus has peaked", MIDIMappingBusProto::kHasPeakedFieldNumber, 0 } }; vector global_controllers = { { "Locut cutoff", MIDIMappingBusProto::kLocutFieldNumber, MIDIMappingProto::kLocutBankFieldNumber }, { "Limiter threshold", MIDIMappingBusProto::kLimiterThresholdFieldNumber, MIDIMappingProto::kLimiterThresholdBankFieldNumber }, { "Makeup gain", MIDIMappingBusProto::kMakeupGainFieldNumber, MIDIMappingProto::kMakeupGainBankFieldNumber } }; vector global_buttons = { { "Previous bank", MIDIMappingBusProto::kPrevBankFieldNumber, 0 }, { "Next bank", MIDIMappingBusProto::kNextBankFieldNumber, 0 }, { "Select bank 1", MIDIMappingBusProto::kSelectBank1FieldNumber, 0 }, { "Select bank 2", MIDIMappingBusProto::kSelectBank2FieldNumber, 0 }, { "Select bank 3", MIDIMappingBusProto::kSelectBank3FieldNumber, 0 }, { "Select bank 4", MIDIMappingBusProto::kSelectBank4FieldNumber, 0 }, { "Select bank 5", MIDIMappingBusProto::kSelectBank5FieldNumber, 0 }, { "Toggle limiter", MIDIMappingBusProto::kToggleLimiterFieldNumber, MIDIMappingProto::kToggleLimiterBankFieldNumber }, { "Toggle auto makeup gain", MIDIMappingBusProto::kToggleAutoMakeupGainFieldNumber, MIDIMappingProto::kToggleAutoMakeupGainBankFieldNumber } }; vector global_lights = { { "Bank 1 is selected", MIDIMappingBusProto::kBank1IsSelectedFieldNumber, 0 }, { "Bank 2 is selected", MIDIMappingBusProto::kBank2IsSelectedFieldNumber, 0 }, { "Bank 3 is selected", MIDIMappingBusProto::kBank3IsSelectedFieldNumber, 0 }, { "Bank 4 is selected", MIDIMappingBusProto::kBank4IsSelectedFieldNumber, 0 }, { "Bank 5 is selected", MIDIMappingBusProto::kBank5IsSelectedFieldNumber, 0 }, { "Limiter is on", MIDIMappingBusProto::kLimiterIsOnFieldNumber, 0 }, { "Auto makeup gain is on", MIDIMappingBusProto::kAutoMakeupGainIsOnFieldNumber, 0 }, }; vector global_video = { { "Switch video channel", MIDIMappingBusProto::kSwitchVideoChannelFieldNumber, MIDIMappingProto::kSwitchVideoChannelBankFieldNumber }, { "Apply transition", MIDIMappingBusProto::kApplyTransitionFieldNumber, MIDIMappingProto::kApplyTransitionBankFieldNumber }, }; vector main_ui = { { "Previous audio view", MIDIMappingBusProto::kPrevAudioViewFieldNumber, MIDIMappingProto::kPrevAudioViewBankFieldNumber }, { "Next audio view", MIDIMappingBusProto::kNextAudioViewFieldNumber, MIDIMappingProto::kNextAudioViewBankFieldNumber }, { "Begin new video segment", MIDIMappingBusProto::kBeginNewVideoSegmentFieldNumber, MIDIMappingProto::kBeginNewVideoSegmentBankFieldNumber }, { "Exit Nageru", MIDIMappingBusProto::kExitFieldNumber, MIDIMappingProto::kExitBankFieldNumber }, }; namespace { int get_bank(const MIDIMappingProto &mapping_proto, int bank_field_number, int default_value) { const FieldDescriptor *bank_descriptor = mapping_proto.GetDescriptor()->FindFieldByNumber(bank_field_number); const Reflection *reflection = mapping_proto.GetReflection(); if (!reflection->HasField(mapping_proto, bank_descriptor)) { return default_value; } return reflection->GetInt32(mapping_proto, bank_descriptor); } int get_controller_mapping(const MIDIMappingProto &mapping_proto, size_t bus_idx, int field_number, int default_value) { if (bus_idx >= size_t(mapping_proto.bus_mapping_size())) { return default_value; } const MIDIMappingBusProto &bus_mapping = mapping_proto.bus_mapping(bus_idx); return get_controller_mapping_helper(bus_mapping, field_number, default_value); } int get_button_mapping(const MIDIMappingProto &mapping_proto, size_t bus_idx, int field_number, int default_value) { if (bus_idx >= size_t(mapping_proto.bus_mapping_size())) { return default_value; } const MIDIMappingBusProto &bus_mapping = mapping_proto.bus_mapping(bus_idx); return get_button_mapping_helper(bus_mapping, field_number, default_value); } int get_light_mapping(const MIDIMappingProto &mapping_proto, size_t bus_idx, int field_number, int default_value) { if (bus_idx >= size_t(mapping_proto.bus_mapping_size())) { return default_value; } const MIDIMappingBusProto &bus_mapping = mapping_proto.bus_mapping(bus_idx); const FieldDescriptor *descriptor = bus_mapping.GetDescriptor()->FindFieldByNumber(field_number); const Reflection *bus_reflection = bus_mapping.GetReflection(); if (!bus_reflection->HasField(bus_mapping, descriptor)) { return default_value; } const MIDILightProto &bus_proto = static_cast(bus_reflection->GetMessage(bus_mapping, descriptor)); return bus_proto.note_number(); } } // namespace MIDIMappingDialog::MIDIMappingDialog(MIDIMapper *mapper) : ui(new Ui::MIDIMappingDialog), mapper(mapper) { ui->setupUi(this); const MIDIMappingProto mapping_proto = mapper->get_current_mapping(); // Take a copy. old_receiver = mapper->set_receiver(this); QStringList labels; labels << ""; labels << "Controller bank"; for (unsigned bus_idx = 0; bus_idx < num_buses; ++bus_idx) { char buf[256]; snprintf(buf, sizeof(buf), "Bus %d", bus_idx + 1); labels << buf; } labels << ""; ui->treeWidget->setColumnCount(num_buses + 3); ui->treeWidget->setHeaderLabels(labels); add_controls("Per-bus controllers", ControlType::CONTROLLER, SpinnerGroup::PER_BUS_CONTROLLERS, mapping_proto, per_bus_controllers); add_controls("Per-bus buttons", ControlType::BUTTON, SpinnerGroup::PER_BUS_BUTTONS, mapping_proto, per_bus_buttons); add_controls("Per-bus lights", ControlType::LIGHT, SpinnerGroup::PER_BUS_LIGHTS, mapping_proto, per_bus_lights); add_controls("Video mixing", ControlType::BUTTON, SpinnerGroup::GLOBAL_BUTTONS, mapping_proto, global_video); add_controls("Global controllers", ControlType::CONTROLLER, SpinnerGroup::GLOBAL_CONTROLLERS, mapping_proto, global_controllers); add_controls("Global buttons", ControlType::BUTTON, SpinnerGroup::GLOBAL_BUTTONS, mapping_proto, global_buttons); add_controls("Main UI", ControlType::BUTTON, SpinnerGroup::GLOBAL_BUTTONS, mapping_proto, main_ui); add_controls("Global lights", ControlType::LIGHT, SpinnerGroup::GLOBAL_LIGHTS, mapping_proto, global_lights); fill_controls_from_mapping(mapping_proto); // Auto-resize every column but the last. for (unsigned column_idx = 0; column_idx < num_buses + 3; ++column_idx) { ui->treeWidget->resizeColumnToContents(column_idx); } connect(ui->guess_bus_button, &QPushButton::clicked, bind(&MIDIMappingDialog::guess_clicked, this, false)); connect(ui->guess_group_button, &QPushButton::clicked, bind(&MIDIMappingDialog::guess_clicked, this, true)); connect(ui->ok_cancel_buttons, &QDialogButtonBox::accepted, this, &MIDIMappingDialog::ok_clicked); connect(ui->ok_cancel_buttons, &QDialogButtonBox::rejected, this, &MIDIMappingDialog::cancel_clicked); connect(ui->save_button, &QPushButton::clicked, this, &MIDIMappingDialog::save_clicked); connect(ui->load_button, &QPushButton::clicked, this, &MIDIMappingDialog::load_clicked); update_guess_button_state(); } MIDIMappingDialog::~MIDIMappingDialog() { mapper->set_receiver(old_receiver); mapper->refresh_highlights(); } bool MIDIMappingDialog::eventFilter(QObject *obj, QEvent *event) { if (event->type() == QEvent::FocusIn || event->type() == QEvent::FocusOut) { // We ignore the guess buttons themselves; it should be allowed // to navigate from a spinner to focus on a button (to click it). if (obj != ui->guess_bus_button && obj != ui->guess_group_button) { update_guess_button_state(); } } return false; } void MIDIMappingDialog::guess_clicked(bool limit_to_group) { FocusInfo focus = find_focus(); if (focus.bus_idx == -1) { // The guess button probably took the focus away from us. focus = last_focus; } assert(focus.bus_idx != -1); // The button should have been disabled. pair bus_and_offset = guess_offset(focus.bus_idx, limit_to_group ? focus.spinner_group : SpinnerGroup::ALL_GROUPS); const int source_bus_idx = bus_and_offset.first; const int offset = bus_and_offset.second; assert(source_bus_idx != -1); // The button should have been disabled. for (const auto &field_number_and_spinner : spinners[focus.bus_idx]) { int field_number = field_number_and_spinner.first; QSpinBox *spinner = field_number_and_spinner.second.spinner; SpinnerGroup this_spinner_group = field_number_and_spinner.second.group; if (limit_to_group && this_spinner_group != focus.spinner_group) { continue; } assert(spinners[source_bus_idx].count(field_number)); QSpinBox *source_spinner = spinners[source_bus_idx][field_number].spinner; assert(spinners[source_bus_idx][field_number].group == this_spinner_group); if (source_spinner->value() != -1) { spinner->setValue(source_spinner->value() + offset); } } // See if we can find a “next” bus to move the focus to. const int next_bus_idx = focus.bus_idx + (focus.bus_idx - source_bus_idx); // Note: Could become e.g. -1. for (const InstantiatedSpinner &is : controller_spinners) { if (int(is.bus_idx) == next_bus_idx && is.field_number == focus.field_number) { is.spinner->setFocus(); } } for (const InstantiatedSpinner &is : button_spinners) { if (int(is.bus_idx) == next_bus_idx && is.field_number == focus.field_number) { is.spinner->setFocus(); } } for (const InstantiatedSpinner &is : light_spinners) { if (int(is.bus_idx) == next_bus_idx && is.field_number == focus.field_number) { is.spinner->setFocus(); } } } void MIDIMappingDialog::ok_clicked() { unique_ptr new_mapping = construct_mapping_proto_from_ui(); mapper->set_midi_mapping(*new_mapping); mapper->set_receiver(old_receiver); accept(); } void MIDIMappingDialog::cancel_clicked() { mapper->set_receiver(old_receiver); reject(); } void MIDIMappingDialog::save_clicked() { #if HAVE_CEF // The native file dialog uses GTK+, which interferes with CEF's use of the GLib main loop. QFileDialog::Options options(QFileDialog::DontUseNativeDialog); #else QFileDialog::Options options; #endif unique_ptr new_mapping = construct_mapping_proto_from_ui(); QString filename = QFileDialog::getSaveFileName(this, "Save MIDI mapping", QString(), tr("Mapping files (*.midimapping)"), /*selectedFilter=*/nullptr, options); if (!filename.endsWith(".midimapping")) { filename += ".midimapping"; } if (!save_midi_mapping_to_file(*new_mapping, filename.toStdString())) { QMessageBox box; box.setText("Could not save mapping to '" + filename + "'. Check that you have the right permissions and try again."); box.exec(); } } void MIDIMappingDialog::load_clicked() { #if HAVE_CEF // The native file dialog uses GTK+, which interferes with CEF's use of the GLib main loop. QFileDialog::Options options(QFileDialog::DontUseNativeDialog); #else QFileDialog::Options options; #endif QString filename = QFileDialog::getOpenFileName(this, "Load MIDI mapping", QString(), tr("Mapping files (*.midimapping)"), /*selectedFilter=*/nullptr, options); MIDIMappingProto new_mapping; if (!load_midi_mapping_from_file(filename.toStdString(), &new_mapping)) { QMessageBox box; box.setText("Could not load mapping from '" + filename + "'. Check that the file exists, has the right permissions and is valid."); box.exec(); return; } fill_controls_from_mapping(new_mapping); } namespace { template T *get_mutable_bus_message(MIDIMappingProto *mapping_proto, unsigned bus_idx, int field_number) { while (size_t(mapping_proto->bus_mapping_size()) <= bus_idx) { mapping_proto->add_bus_mapping(); } MIDIMappingBusProto *bus_mapping = mapping_proto->mutable_bus_mapping(bus_idx); const FieldDescriptor *descriptor = bus_mapping->GetDescriptor()->FindFieldByNumber(field_number); const Reflection *bus_reflection = bus_mapping->GetReflection(); return static_cast(bus_reflection->MutableMessage(bus_mapping, descriptor)); } } // namespace unique_ptr MIDIMappingDialog::construct_mapping_proto_from_ui() { unique_ptr mapping_proto(new MIDIMappingProto); for (const InstantiatedSpinner &is : controller_spinners) { const int val = is.spinner->value(); if (val == -1) { continue; } MIDIControllerProto *controller_proto = get_mutable_bus_message(mapping_proto.get(), is.bus_idx, is.field_number); controller_proto->set_controller_number(val); } for (const InstantiatedSpinner &is : button_spinners) { const int val = is.spinner->value(); if (val == -1) { continue; } MIDIButtonProto *button_proto = get_mutable_bus_message(mapping_proto.get(), is.bus_idx, is.field_number); button_proto->set_note_number(val); } for (const InstantiatedSpinner &is : light_spinners) { const int val = is.spinner->value(); if (val == -1) { continue; } MIDILightProto *light_proto = get_mutable_bus_message(mapping_proto.get(), is.bus_idx, is.field_number); light_proto->set_note_number(val); } int highest_bank_used = 0; // 1-indexed. for (const InstantiatedComboBox &ic : bank_combo_boxes) { const int val = ic.combo_box->currentIndex(); highest_bank_used = std::max(highest_bank_used, val); if (val == 0) { continue; } const FieldDescriptor *descriptor = mapping_proto->GetDescriptor()->FindFieldByNumber(ic.field_number); const Reflection *bus_reflection = mapping_proto->GetReflection(); bus_reflection->SetInt32(mapping_proto.get(), descriptor, val - 1); } mapping_proto->set_num_controller_banks(highest_bank_used); return mapping_proto; } void MIDIMappingDialog::add_bank_selector(QTreeWidgetItem *item, const MIDIMappingProto &mapping_proto, int bank_field_number) { if (bank_field_number == 0) { return; } QComboBox *bank_selector = new QComboBox(this); bank_selector->addItems(QStringList() << "" << "Bank 1" << "Bank 2" << "Bank 3" << "Bank 4" << "Bank 5"); bank_selector->setAutoFillBackground(true); bank_combo_boxes.push_back(InstantiatedComboBox{ bank_selector, bank_field_number }); ui->treeWidget->setItemWidget(item, 1, bank_selector); } void MIDIMappingDialog::add_controls(const string &heading, MIDIMappingDialog::ControlType control_type, MIDIMappingDialog::SpinnerGroup spinner_group, const MIDIMappingProto &mapping_proto, const vector &controls) { QTreeWidgetItem *heading_item = new QTreeWidgetItem(ui->treeWidget); heading_item->setText(0, QString::fromStdString(heading)); heading_item->setFirstColumnSpanned(true); heading_item->setExpanded(true); for (const Control &control : controls) { QTreeWidgetItem *item = new QTreeWidgetItem(heading_item); heading_item->addChild(item); add_bank_selector(item, mapping_proto, control.bank_field_number); item->setText(0, QString::fromStdString(control.label + " ")); for (unsigned bus_idx = 0; bus_idx < num_buses; ++bus_idx) { QSpinBox *spinner; if (control_type == ControlType::CONTROLLER) { spinner = new ControllerSpinBox(this); spinner->setRange(-1, 128); // 128 for pitch bend. } else { spinner = new QSpinBox(this); spinner->setRange(-1, 127); } spinner->setAutoFillBackground(true); spinner->setSpecialValueText("\u200d"); // Zero-width joiner (ie., empty). spinner->installEventFilter(this); // So we know when the focus changes. ui->treeWidget->setItemWidget(item, bus_idx + 2, spinner); if (control_type == ControlType::CONTROLLER) { controller_spinners.push_back(InstantiatedSpinner{ spinner, bus_idx, spinner_group, control.field_number }); } else if (control_type == ControlType::BUTTON) { button_spinners.push_back(InstantiatedSpinner{ spinner, bus_idx, spinner_group, control.field_number }); } else { assert(control_type == ControlType::LIGHT); light_spinners.push_back(InstantiatedSpinner{ spinner, bus_idx, spinner_group, control.field_number }); } spinners[bus_idx][control.field_number] = SpinnerAndGroup{ spinner, spinner_group }; connect(spinner, static_cast(&QSpinBox::valueChanged), bind(&MIDIMappingDialog::update_guess_button_state, this)); } } ui->treeWidget->addTopLevelItem(heading_item); } void MIDIMappingDialog::fill_controls_from_mapping(const MIDIMappingProto &mapping_proto) { for (const InstantiatedSpinner &is : controller_spinners) { is.spinner->setValue(get_controller_mapping(mapping_proto, is.bus_idx, is.field_number, -1)); } for (const InstantiatedSpinner &is : button_spinners) { is.spinner->setValue(get_button_mapping(mapping_proto, is.bus_idx, is.field_number, -1)); } for (const InstantiatedSpinner &is : light_spinners) { is.spinner->setValue(get_light_mapping(mapping_proto, is.bus_idx, is.field_number, -1)); } for (const InstantiatedComboBox &ic : bank_combo_boxes) { ic.combo_box->setCurrentIndex(get_bank(mapping_proto, ic.field_number, -1) + 1); } } void MIDIMappingDialog::controller_changed(unsigned controller) { post_to_main_thread([=]{ for (const InstantiatedSpinner &is : controller_spinners) { if (is.spinner->hasFocus()) { is.spinner->setValue(controller); is.spinner->selectAll(); } } }); } void MIDIMappingDialog::note_on(unsigned note) { post_to_main_thread([=]{ for (const InstantiatedSpinner &is : button_spinners) { if (is.spinner->hasFocus()) { is.spinner->setValue(note); is.spinner->selectAll(); } } for (const InstantiatedSpinner &is : light_spinners) { if (is.spinner->hasFocus()) { is.spinner->setValue(note); is.spinner->selectAll(); } } }); } pair MIDIMappingDialog::guess_offset(unsigned bus_idx, MIDIMappingDialog::SpinnerGroup spinner_group) { constexpr pair not_found(-1, 0); if (bus_is_empty(bus_idx, spinner_group)) { return not_found; } // See if we can find a non-empty bus to source from (prefer from the left). unsigned source_bus_idx; if (bus_idx > 0 && !bus_is_empty(bus_idx - 1, spinner_group)) { source_bus_idx = bus_idx - 1; } else if (bus_idx < num_buses - 1 && !bus_is_empty(bus_idx + 1, spinner_group)) { source_bus_idx = bus_idx + 1; } else { return not_found; } // See if we can find a consistent offset. bool found_offset = false; int offset = 0; int minimum_allowed_offset = numeric_limits::min(); int maximum_allowed_offset = numeric_limits::max(); for (const auto &field_number_and_spinner : spinners[bus_idx]) { int field_number = field_number_and_spinner.first; QSpinBox *spinner = field_number_and_spinner.second.spinner; SpinnerGroup this_spinner_group = field_number_and_spinner.second.group; assert(spinners[source_bus_idx].count(field_number)); QSpinBox *source_spinner = spinners[source_bus_idx][field_number].spinner; assert(spinners[source_bus_idx][field_number].group == this_spinner_group); if (spinner_group != SpinnerGroup::ALL_GROUPS && spinner_group != this_spinner_group) { continue; } if (spinner->value() == -1) { if (source_spinner->value() != -1) { // If the source value is e.g. 3, offset can't be less than -2 or larger than 124. // Otherwise, we'd extrapolate values outside [1..127]. minimum_allowed_offset = max(minimum_allowed_offset, 1 - source_spinner->value()); maximum_allowed_offset = min(maximum_allowed_offset, 127 - source_spinner->value()); } continue; } if (source_spinner->value() == -1) { // The bus has a controller set that the source bus doesn't set. return not_found; } if (source_spinner->value() == MIDIReceiver::PITCH_BEND_CONTROLLER) { // It's impossible to interpolate across the pitch bend. return not_found; } int candidate_offset = spinner->value() - source_spinner->value(); if (!found_offset) { offset = candidate_offset; found_offset = true; } else if (candidate_offset != offset) { return not_found; } } if (!found_offset) { // Given that the bus wasn't empty, this shouldn't happen. assert(false); return not_found; } if (offset < minimum_allowed_offset || offset > maximum_allowed_offset) { return not_found; } return make_pair(source_bus_idx, offset); } bool MIDIMappingDialog::bus_is_empty(unsigned bus_idx, SpinnerGroup spinner_group) { for (const auto &field_number_and_spinner : spinners[bus_idx]) { QSpinBox *spinner = field_number_and_spinner.second.spinner; SpinnerGroup this_spinner_group = field_number_and_spinner.second.group; if (spinner_group != SpinnerGroup::ALL_GROUPS && spinner_group != this_spinner_group) { continue; } if (spinner->value() != -1) { return false; } } return true; } void MIDIMappingDialog::update_guess_button_state() { FocusInfo focus = find_focus(); if (focus.bus_idx < 0) { return; } { pair bus_and_offset = guess_offset(focus.bus_idx, SpinnerGroup::ALL_GROUPS); ui->guess_bus_button->setEnabled(bus_and_offset.first != -1); } { pair bus_and_offset = guess_offset(focus.bus_idx, focus.spinner_group); ui->guess_group_button->setEnabled(bus_and_offset.first != -1); } last_focus = focus; } MIDIMappingDialog::FocusInfo MIDIMappingDialog::find_focus() const { for (const InstantiatedSpinner &is : controller_spinners) { if (is.spinner->hasFocus()) { return FocusInfo{ int(is.bus_idx), is.spinner_group, is.field_number }; } } for (const InstantiatedSpinner &is : button_spinners) { if (is.spinner->hasFocus()) { return FocusInfo{ int(is.bus_idx), is.spinner_group, is.field_number }; } } for (const InstantiatedSpinner &is : light_spinners) { if (is.spinner->hasFocus()) { return FocusInfo{ int(is.bus_idx), is.spinner_group, is.field_number }; } } return FocusInfo{ -1, SpinnerGroup::ALL_GROUPS, -1 }; } nageru-2.3.0/nageru/midi_mapping_dialog.h000066400000000000000000000136271450736322200204200ustar00rootroot00000000000000#ifndef _MIDI_MAPPING_DIALOG_H #define _MIDI_MAPPING_DIALOG_H #include #include #include #include #include #include #include #include #include "midi_mapper.h" class QEvent; class QObject; namespace Ui { class MIDIMappingDialog; } // namespace Ui class MIDIMappingProto; class QComboBox; class QSpinBox; class QTreeWidgetItem; class MIDIMappingDialog : public QDialog, public ControllerReceiver { Q_OBJECT public: MIDIMappingDialog(MIDIMapper *mapper); ~MIDIMappingDialog(); bool eventFilter(QObject *obj, QEvent *event) override; // For use in midi_mapping_dialog.cpp only. struct Control { std::string label; int field_number; // In MIDIMappingBusProto. int bank_field_number; // In MIDIMappingProto. }; // ControllerReceiver interface. We only implement the raw events. // All values are [0.0, 1.0]. void set_locut(float value) override {} void set_limiter_threshold(float value) override {} void set_makeup_gain(float value) override {} void set_stereo_width(unsigned bus_idx, float value) override {} void set_treble(unsigned bus_idx, float value) override {} void set_mid(unsigned bus_idx, float value) override {} void set_bass(unsigned bus_idx, float value) override {} void set_gain(unsigned bus_idx, float value) override {} void set_compressor_threshold(unsigned bus_idx, float value) override {} void set_fader(unsigned bus_idx, float value) override {} void toggle_mute(unsigned bus_idx) override {} void toggle_locut(unsigned bus_idx) override {} void toggle_auto_gain_staging(unsigned bus_idx) override {} void toggle_compressor(unsigned bus_idx) override {} void clear_peak(unsigned bus_idx) override {} void toggle_limiter() override {} void toggle_auto_makeup_gain() override {} void clear_all_highlights() override {} void highlight_locut(bool highlight) override {} void highlight_limiter_threshold(bool highlight) override {} void highlight_makeup_gain(bool highlight) override {} void highlight_stereo_width(unsigned bus_idx, bool highlight) override {} void highlight_treble(unsigned bus_idx, bool highlight) override {} void highlight_mid(unsigned bus_idx, bool highlight) override {} void highlight_bass(unsigned bus_idx, bool highlight) override {} void highlight_gain(unsigned bus_idx, bool highlight) override {} void highlight_compressor_threshold(unsigned bus_idx, bool highlight) override {} void highlight_fader(unsigned bus_idx, bool highlight) override {} void highlight_mute(unsigned bus_idx, bool highlight) override {} void highlight_toggle_locut(unsigned bus_idx, bool highlight) override {} void highlight_toggle_auto_gain_staging(unsigned bus_idx, bool highlight) override {} void highlight_toggle_compressor(unsigned bus_idx, bool highlight) override {} void highlight_clear_peak(unsigned bus_idx, bool highlight) override {} void highlight_toggle_limiter(bool highlight) override {} void highlight_toggle_auto_makeup_gain(bool highlight) override {} void switch_video_channel(int channel_number) override {} void apply_transition(int transition_number) override {} void prev_audio_view() override {} void next_audio_view() override {} void begin_new_segment() override {} void exit() override {} // Raw events; used for the editor dialog only. void controller_changed(unsigned controller) override; void note_on(unsigned note) override; public slots: void guess_clicked(bool limit_to_group); void ok_clicked(); void cancel_clicked(); void save_clicked(); void load_clicked(); private: static constexpr unsigned num_buses = 8; // Each spinner belongs to exactly one group, corresponding to the // subheadings in the UI. This is so that we can extrapolate data // across only single groups if need be. enum class SpinnerGroup { ALL_GROUPS = -1, PER_BUS_CONTROLLERS, PER_BUS_BUTTONS, PER_BUS_LIGHTS, GLOBAL_CONTROLLERS, GLOBAL_BUTTONS, GLOBAL_LIGHTS }; void add_bank_selector(QTreeWidgetItem *item, const MIDIMappingProto &mapping_proto, int bank_field_number); enum class ControlType { CONTROLLER, BUTTON, LIGHT }; void add_controls(const std::string &heading, ControlType control_type, SpinnerGroup spinner_group, const MIDIMappingProto &mapping_proto, const std::vector &controls); void fill_controls_from_mapping(const MIDIMappingProto &mapping_proto); // Tries to find a source bus and an offset to it that would give // a consistent offset for the rest of the mappings in this bus. // Returns -1 for the bus if no consistent offset can be found. std::pair guess_offset(unsigned bus_idx, SpinnerGroup spinner_group); bool bus_is_empty(unsigned bus_idx, SpinnerGroup spinner_group); void update_guess_button_state(); struct FocusInfo { int bus_idx; // -1 for none. SpinnerGroup spinner_group; int field_number; }; FocusInfo find_focus() const; std::unique_ptr construct_mapping_proto_from_ui(); Ui::MIDIMappingDialog *ui; MIDIMapper *mapper; ControllerReceiver *old_receiver; FocusInfo last_focus{-1, SpinnerGroup::ALL_GROUPS, -1}; // All controllers actually laid out on the grid (we need to store them // so that we can move values back and forth between the controls and // the protobuf on save/load). struct InstantiatedSpinner { QSpinBox *spinner; unsigned bus_idx; SpinnerGroup spinner_group; int field_number; // In MIDIMappingBusProto. }; struct InstantiatedComboBox { QComboBox *combo_box; int field_number; // In MIDIMappingProto. }; std::vector controller_spinners; std::vector button_spinners; std::vector light_spinners; std::vector bank_combo_boxes; // Keyed on bus index, then field number. struct SpinnerAndGroup { QSpinBox *spinner; SpinnerGroup group; }; std::map> spinners; }; #endif // !defined(_MIDI_MAPPING_DIALOG_H) nageru-2.3.0/nageru/mixer.cpp000066400000000000000000002462221450736322200161220ustar00rootroot00000000000000#undef Success #include "mixer.h" #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include "DeckLinkAPI.h" #include "LinuxCOM.h" #include "alsa_output.h" #include "basic_stats.h" #include "bmusb/bmusb.h" #include "bmusb/fake_capture.h" #ifdef HAVE_CEF #include "cef_capture.h" #endif #include "chroma_subsampler.h" #include "shared/context.h" #include "decklink_capture.h" #include "decklink_output.h" #include "decklink_util.h" #include "defs.h" #include "shared/disk_space_estimator.h" #include "ffmpeg_capture.h" #include "flags.h" #include "image_input.h" #include "input_mapping.h" #include "shared/metrics.h" #include "shared/va_display.h" #include "mjpeg_encoder.h" #include "pbo_frame_allocator.h" #include "shared/ref_counted_gl_sync.h" #include "resampling_queue.h" #include "shared/timebase.h" #include "timecode_renderer.h" #include "v210_converter.h" #include "video_encoder.h" #undef Status #include #include "json.pb.h" #ifdef HAVE_SRT // Must come after CEF, since it includes , which has #defines // that conflict with CEF logging constants. #include #endif class IDeckLink; class QOpenGLContext; using namespace movit; using namespace std; using namespace std::chrono; using namespace std::placeholders; using namespace bmusb; Mixer *global_mixer = nullptr; namespace { void insert_new_frame(RefCountedFrame frame, unsigned field_num, bool interlaced, unsigned card_index, InputState *input_state) { if (interlaced) { for (unsigned frame_num = FRAME_HISTORY_LENGTH; frame_num --> 1; ) { // :-) input_state->buffered_frames[card_index][frame_num] = input_state->buffered_frames[card_index][frame_num - 1]; } input_state->buffered_frames[card_index][0] = { frame, field_num }; } else { for (unsigned frame_num = 0; frame_num < FRAME_HISTORY_LENGTH; ++frame_num) { input_state->buffered_frames[card_index][frame_num] = { frame, field_num }; } } } void ensure_texture_resolution(PBOFrameAllocator::Userdata *userdata, unsigned field, unsigned width, unsigned height, unsigned cbcr_width, unsigned cbcr_height, unsigned v210_width) { bool first; switch (userdata->pixel_format) { case PixelFormat_10BitYCbCr: first = userdata->tex_v210[field] == 0 || userdata->tex_444[field] == 0; break; case PixelFormat_8BitYCbCr: first = userdata->tex_y[field] == 0 || userdata->tex_cbcr[field] == 0; break; case PixelFormat_8BitBGRA: first = userdata->tex_rgba[field] == 0; break; case PixelFormat_8BitYCbCrPlanar: first = userdata->tex_y[field] == 0 || userdata->tex_cb[field] == 0 || userdata->tex_cr[field] == 0; break; default: assert(false); } const bool recreate_main_texture = first || width != userdata->last_width[field] || height != userdata->last_height[field] || cbcr_width != userdata->last_cbcr_width[field] || cbcr_height != userdata->last_cbcr_height[field]; const bool recreate_v210_texture = global_flags.bit_depth > 8 && (first || v210_width != userdata->last_v210_width[field] || height != userdata->last_height[field]); if (recreate_main_texture) { // We changed resolution since last use of this texture, so we need to create // a new object. Note that this each card has its own PBOFrameAllocator, // we don't need to worry about these flip-flopping between resolutions. switch (userdata->pixel_format) { case PixelFormat_10BitYCbCr: glBindTexture(GL_TEXTURE_2D, userdata->tex_444[field]); check_error(); glTexImage2D(GL_TEXTURE_2D, 0, GL_RGB10_A2, width, height, 0, GL_RGBA, GL_UNSIGNED_INT_2_10_10_10_REV, nullptr); check_error(); break; case PixelFormat_8BitYCbCr: { glBindTexture(GL_TEXTURE_2D, userdata->tex_cbcr[field]); check_error(); glTexImage2D(GL_TEXTURE_2D, 0, GL_RG8, cbcr_width, height, 0, GL_RG, GL_UNSIGNED_BYTE, nullptr); check_error(); glBindTexture(GL_TEXTURE_2D, userdata->tex_y[field]); check_error(); glTexImage2D(GL_TEXTURE_2D, 0, GL_R8, width, height, 0, GL_RED, GL_UNSIGNED_BYTE, nullptr); check_error(); break; } case PixelFormat_8BitYCbCrPlanar: { glBindTexture(GL_TEXTURE_2D, userdata->tex_y[field]); check_error(); glTexImage2D(GL_TEXTURE_2D, 0, GL_R8, width, height, 0, GL_RED, GL_UNSIGNED_BYTE, nullptr); check_error(); glBindTexture(GL_TEXTURE_2D, userdata->tex_cb[field]); check_error(); glTexImage2D(GL_TEXTURE_2D, 0, GL_R8, cbcr_width, cbcr_height, 0, GL_RED, GL_UNSIGNED_BYTE, nullptr); check_error(); glBindTexture(GL_TEXTURE_2D, userdata->tex_cr[field]); check_error(); glTexImage2D(GL_TEXTURE_2D, 0, GL_R8, cbcr_width, cbcr_height, 0, GL_RED, GL_UNSIGNED_BYTE, nullptr); check_error(); break; } case PixelFormat_8BitBGRA: glBindTexture(GL_TEXTURE_2D, userdata->tex_rgba[field]); check_error(); // NOTE: sRGB may be disabled by sRGBSwitchingFlatInput. glTexImage2D(GL_TEXTURE_2D, 0, GL_SRGB8_ALPHA8, width, height, 0, GL_BGRA, GL_UNSIGNED_INT_8_8_8_8_REV, nullptr); check_error(); break; default: assert(false); } userdata->last_width[field] = width; userdata->last_height[field] = height; userdata->last_cbcr_width[field] = cbcr_width; userdata->last_cbcr_height[field] = cbcr_height; } if (recreate_v210_texture) { // Same as above; we need to recreate the texture. glBindTexture(GL_TEXTURE_2D, userdata->tex_v210[field]); check_error(); glTexImage2D(GL_TEXTURE_2D, 0, GL_RGB10_A2, v210_width, height, 0, GL_RGBA, GL_UNSIGNED_INT_2_10_10_10_REV, nullptr); check_error(); userdata->last_v210_width[field] = v210_width; userdata->last_height[field] = height; } } void upload_texture(GLuint tex, GLuint width, GLuint height, GLuint stride, bool interlaced_stride, GLenum format, GLenum type, GLintptr offset) { if (interlaced_stride) { stride *= 2; } if (global_flags.flush_pbos) { glFlushMappedBufferRange(GL_PIXEL_UNPACK_BUFFER, offset, stride * height); check_error(); } glBindTexture(GL_TEXTURE_2D, tex); check_error(); if (interlaced_stride) { glPixelStorei(GL_UNPACK_ROW_LENGTH, width * 2); check_error(); } else { glPixelStorei(GL_UNPACK_ROW_LENGTH, 0); check_error(); } glTexSubImage2D(GL_TEXTURE_2D, 0, 0, 0, width, height, format, type, BUFFER_OFFSET(offset)); check_error(); glBindTexture(GL_TEXTURE_2D, 0); check_error(); glPixelStorei(GL_UNPACK_ROW_LENGTH, 0); check_error(); } } // namespace void JitterHistory::register_metrics(const vector> &labels) { global_metrics.add("input_underestimated_jitter_frames", labels, &metric_input_underestimated_jitter_frames); global_metrics.add("input_estimated_max_jitter_seconds", labels, &metric_input_estimated_max_jitter_seconds, Metrics::TYPE_GAUGE); } void JitterHistory::unregister_metrics(const vector> &labels) { global_metrics.remove("input_underestimated_jitter_frames", labels); global_metrics.remove("input_estimated_max_jitter_seconds", labels); } void JitterHistory::frame_arrived(steady_clock::time_point now, int64_t frame_duration, size_t dropped_frames) { if (frame_duration != last_duration) { // If the frame rate changed, the input clock is also going to change, // so our historical data doesn't make much sense anymore. // Also, format changes typically introduce blips that are not representative // of the typical frame stream. (We make the assumption that format changes // don't happen all the time in regular use; if they did, we should probably // rather keep the history so that we take jitter they may introduce into account.) clear(); last_duration = frame_duration; } if (expected_timestamp > steady_clock::time_point::min()) { expected_timestamp += dropped_frames * nanoseconds(frame_duration * 1000000000 / TIMEBASE); double jitter_seconds = fabs(duration(expected_timestamp - now).count()); history.push_back(orders.insert(jitter_seconds)); if (jitter_seconds > estimate_max_jitter()) { ++metric_input_underestimated_jitter_frames; } metric_input_estimated_max_jitter_seconds = estimate_max_jitter(); if (history.size() > history_length) { orders.erase(history.front()); history.pop_front(); } assert(history.size() <= history_length); } expected_timestamp = now + nanoseconds(frame_duration * 1000000000 / TIMEBASE); } double JitterHistory::estimate_max_jitter() const { if (orders.empty()) { return 0.0; } size_t elem_idx = lrint((orders.size() - 1) * percentile); if (percentile <= 0.5) { return *next(orders.begin(), elem_idx) * multiplier; } else { return *prev(orders.end(), orders.size() - elem_idx) * multiplier; } } void QueueLengthPolicy::register_metrics(const vector> &labels) { global_metrics.add("input_queue_safe_length_frames", labels, &metric_input_queue_safe_length_frames, Metrics::TYPE_GAUGE); } void QueueLengthPolicy::unregister_metrics(const vector> &labels) { global_metrics.remove("input_queue_safe_length_frames", labels); } void QueueLengthPolicy::update_policy(steady_clock::time_point now, steady_clock::time_point expected_next_input_frame, int64_t input_frame_duration, int64_t master_frame_duration, double max_input_card_jitter_seconds, double max_master_card_jitter_seconds) { double input_frame_duration_seconds = input_frame_duration / double(TIMEBASE); double master_frame_duration_seconds = master_frame_duration / double(TIMEBASE); // Figure out when we can expect the next frame for this card, assuming // worst-case jitter (ie., the frame is maximally late). double seconds_until_next_frame = max(duration(expected_next_input_frame - now).count() + max_input_card_jitter_seconds, 0.0); // How many times are the master card expected to tick in that time? // We assume the master clock has worst-case jitter but not any rate // discrepancy, ie., it ticks as early as possible every time, but not // cumulatively. double frames_needed = (seconds_until_next_frame + max_master_card_jitter_seconds) / master_frame_duration_seconds; // As a special case, if the master card ticks faster than the input card, // we expect the queue to drain by itself even without dropping. But if // the difference is small (e.g. 60 Hz master and 59.94 input), it would // go slowly enough that the effect wouldn't really be appreciable. // We account for this by looking at the situation five frames ahead, // assuming everything else is the same. double frames_allowed; if (master_frame_duration < input_frame_duration) { frames_allowed = frames_needed + 5 * (input_frame_duration_seconds - master_frame_duration_seconds) / master_frame_duration_seconds; } else { frames_allowed = frames_needed; } safe_queue_length = max(floor(frames_allowed), 0); metric_input_queue_safe_length_frames = safe_queue_length; } Mixer::Mixer(const QSurfaceFormat &format) : httpd(), mixer_surface(create_surface(format)), h264_encoder_surface(create_surface(format)), decklink_output_surface(create_surface(format)), image_update_surface(create_surface(format)) { memcpy(ycbcr_interpretation, global_flags.ycbcr_interpretation, sizeof(ycbcr_interpretation)); CHECK(init_movit(MOVIT_SHADER_DIR, MOVIT_DEBUG_OFF)); check_error(); if (!epoxy_has_gl_extension("GL_EXT_texture_sRGB_decode") || !epoxy_has_gl_extension("GL_ARB_sampler_objects")) { fprintf(stderr, "Nageru requires GL_EXT_texture_sRGB_decode and GL_ARB_sampler_objects to run.\n"); exit(1); } // Since we allow non-bouncing 4:2:2 YCbCrInputs, effective subpixel precision // will be halved when sampling them, and we need to compensate here. movit_texel_subpixel_precision /= 2.0; resource_pool.reset(new ResourcePool); for (unsigned i = 0; i < NUM_OUTPUTS; ++i) { output_channel[i].parent = this; output_channel[i].channel = i; } ImageFormat inout_format; inout_format.color_space = COLORSPACE_sRGB; inout_format.gamma_curve = GAMMA_sRGB; // Matches the 4:2:0 format created by the main chain. YCbCrFormat ycbcr_format; ycbcr_format.chroma_subsampling_x = 2; ycbcr_format.chroma_subsampling_y = 2; if (global_flags.ycbcr_rec709_coefficients) { ycbcr_format.luma_coefficients = YCBCR_REC_709; } else { ycbcr_format.luma_coefficients = YCBCR_REC_601; } ycbcr_format.full_range = false; ycbcr_format.num_levels = 1 << global_flags.bit_depth; ycbcr_format.cb_x_position = 0.0f; ycbcr_format.cr_x_position = 0.0f; ycbcr_format.cb_y_position = 0.5f; ycbcr_format.cr_y_position = 0.5f; // Initialize the neutral colors to sane values. for (unsigned i = 0; i < MAX_VIDEO_CARDS; ++i) { last_received_neutral_color[i] = RGBTriplet(1.0f, 1.0f, 1.0f); } // Display chain; shows the live output produced by the main chain (or rather, a copy of it). display_chain.reset(new EffectChain(global_flags.width, global_flags.height, resource_pool.get())); check_error(); GLenum type = global_flags.bit_depth > 8 ? GL_UNSIGNED_SHORT : GL_UNSIGNED_BYTE; display_input = new YCbCrInput(inout_format, ycbcr_format, global_flags.width, global_flags.height, YCBCR_INPUT_SPLIT_Y_AND_CBCR, type); display_chain->add_input(display_input); display_chain->add_output(inout_format, OUTPUT_ALPHA_FORMAT_POSTMULTIPLIED); display_chain->set_dither_bits(0); // Don't bother. display_chain->finalize(); video_encoder.reset(new VideoEncoder(resource_pool.get(), h264_encoder_surface, global_flags.va_display, global_flags.width, global_flags.height, &httpd, global_disk_space_estimator)); if (!global_flags.card_to_mjpeg_stream_export.empty()) { mjpeg_encoder.reset(new MJPEGEncoder(&httpd, global_flags.va_display)); } // Must be instantiated after VideoEncoder has initialized global_flags.use_zerocopy. theme.reset(new Theme(global_flags.theme_filename, global_flags.theme_dirs, resource_pool.get())); // Must be instantiated after the theme, as the theme decides the number of FFmpeg inputs. std::vector video_inputs = theme->get_video_inputs(); audio_mixer.reset(new AudioMixer); httpd.add_endpoint("/channels", bind(&Mixer::get_channels_json, this), HTTPD::ALLOW_ALL_ORIGINS); for (int channel_idx = 0; channel_idx < theme->get_num_channels(); ++channel_idx) { char url[256]; snprintf(url, sizeof(url), "/channels/%d/color", channel_idx + 2); httpd.add_endpoint(url, bind(&Mixer::get_channel_color_http, this, unsigned(channel_idx + 2)), HTTPD::ALLOW_ALL_ORIGINS); } // Start listening for clients only once VideoEncoder has written its header, if any. httpd.start(global_flags.http_port); // First try initializing the then PCI devices, then USB, then // fill up with fake cards until we have the desired number of cards. unsigned num_pci_devices = 0; unsigned card_index = 0; { IDeckLinkIterator *decklink_iterator = CreateDeckLinkIteratorInstance(); if (decklink_iterator != nullptr) { for ( ; card_index < unsigned(global_flags.max_num_cards); ++card_index) { IDeckLink *decklink; if (decklink_iterator->Next(&decklink) != S_OK) { break; } if (!decklink_card_is_active(decklink, card_index)) { fprintf(stderr, "DeckLink card %u is inactive in current profile, skipping (try changing it in Desktop Video Setup)\n", card_index); decklink->Release(); continue; } DeckLinkCapture *capture = new DeckLinkCapture(decklink, card_index); DeckLinkOutput *output = new DeckLinkOutput(resource_pool.get(), decklink_output_surface, global_flags.width, global_flags.height, card_index); if (!output->set_device(decklink, capture->get_input())) { delete output; output = nullptr; } configure_card(card_index, capture, CardType::LIVE_CARD, output, /*is_srt_card=*/false); ++num_pci_devices; } decklink_iterator->Release(); fprintf(stderr, "Found %u DeckLink PCI card(s).\n", num_pci_devices); } else { fprintf(stderr, "DeckLink drivers not found. Probing for USB cards only.\n"); } } unsigned num_usb_devices = BMUSBCapture::num_cards(); for (unsigned usb_card_index = 0; usb_card_index < num_usb_devices && card_index < unsigned(global_flags.max_num_cards); ++usb_card_index, ++card_index) { BMUSBCapture *capture = new BMUSBCapture(usb_card_index); capture->set_card_disconnected_callback(bind(&Mixer::bm_hotplug_remove, this, card_index)); configure_card(card_index, capture, CardType::LIVE_CARD, /*output=*/nullptr, /*is_srt_card=*/false); } fprintf(stderr, "Found %u USB card(s).\n", num_usb_devices); // Fill up with fake cards for as long as we can, so that the FFmpeg // and HTML cards always come last. unsigned num_fake_cards = 0; #ifdef HAVE_CEF size_t num_html_inputs = theme->get_html_inputs().size(); #else size_t num_html_inputs = 0; #endif for ( ; card_index < MAX_VIDEO_CARDS - video_inputs.size() - num_html_inputs; ++card_index) { // Only bother to activate fake capture cards to satisfy the minimum. bool is_active = card_index < unsigned(global_flags.min_num_cards) || cards[card_index].force_active; if (is_active) { FakeCapture *capture = new FakeCapture(global_flags.width, global_flags.height, FAKE_FPS, OUTPUT_FREQUENCY, card_index, global_flags.fake_cards_audio); configure_card(card_index, capture, CardType::FAKE_CAPTURE, /*output=*/nullptr, /*is_srt_card=*/false); ++num_fake_cards; } else { configure_card(card_index, nullptr, CardType::FAKE_CAPTURE, /*output=*/nullptr, /*is_srt_card=*/false); } } if (num_fake_cards > 0) { fprintf(stderr, "Initialized %u fake cards.\n", num_fake_cards); } // Initialize all video inputs the theme asked for. for (unsigned video_card_index = 0; video_card_index < video_inputs.size(); ++card_index, ++video_card_index) { if (card_index >= MAX_VIDEO_CARDS) { fprintf(stderr, "ERROR: Not enough card slots available for the videos the theme requested.\n"); abort(); } configure_card(card_index, video_inputs[video_card_index], CardType::FFMPEG_INPUT, /*output=*/nullptr, /*is_srt_card=*/false); video_inputs[video_card_index]->set_card_index(card_index); } num_video_inputs = video_inputs.size(); #ifdef HAVE_CEF // Same, for HTML inputs. std::vector html_inputs = theme->get_html_inputs(); for (unsigned html_card_index = 0; html_card_index < html_inputs.size(); ++card_index, ++html_card_index) { if (card_index >= MAX_VIDEO_CARDS) { fprintf(stderr, "ERROR: Not enough card slots available for the HTML inputs the theme requested.\n"); abort(); } configure_card(card_index, html_inputs[html_card_index], CardType::CEF_INPUT, /*output=*/nullptr, /*is_srt_card=*/false); html_inputs[html_card_index]->set_card_index(card_index); } num_html_inputs = html_inputs.size(); #endif BMUSBCapture::set_card_connected_callback(bind(&Mixer::bm_hotplug_add, this, _1)); BMUSBCapture::start_bm_thread(); #ifdef HAVE_SRT if (global_flags.srt_port >= 0) { start_srt(); } #endif chroma_subsampler.reset(new ChromaSubsampler(resource_pool.get())); if (global_flags.bit_depth > 8) { if (!v210Converter::has_hardware_support()) { fprintf(stderr, "ERROR: --ten-bit-input requires support for OpenGL compute shaders\n"); fprintf(stderr, " (OpenGL 4.3, or GL_ARB_compute_shader + GL_ARB_shader_image_load_store).\n"); abort(); } v210_converter.reset(new v210Converter()); // These are all the widths listed in the Blackmagic SDK documentation // (section 2.7.3, “Display Modes”). v210_converter->precompile_shader(720); v210_converter->precompile_shader(1280); v210_converter->precompile_shader(1920); v210_converter->precompile_shader(2048); v210_converter->precompile_shader(3840); v210_converter->precompile_shader(4096); } if (global_flags.bit_depth > 8) { if (!v210Converter::has_hardware_support()) { fprintf(stderr, "ERROR: --ten-bit-output requires support for OpenGL compute shaders\n"); fprintf(stderr, " (OpenGL 4.3, or GL_ARB_compute_shader + GL_ARB_shader_image_load_store).\n"); abort(); } } timecode_renderer.reset(new TimecodeRenderer(resource_pool.get(), global_flags.width, global_flags.height)); display_timecode_in_stream = global_flags.display_timecode_in_stream; display_timecode_on_stdout = global_flags.display_timecode_on_stdout; if (global_flags.enable_alsa_output) { alsa.reset(new ALSAOutput(OUTPUT_FREQUENCY, /*num_channels=*/2)); } output_card_is_master = global_flags.output_card_is_master; if (global_flags.output_card != -1) { desired_output_card_index = global_flags.output_card; set_output_card_internal(global_flags.output_card); } output_jitter_history.register_metrics({{ "card", "output" }}); ImageInput::start_update_thread(image_update_surface); } Mixer::~Mixer() { ImageInput::end_update_thread(); if (mjpeg_encoder != nullptr) { mjpeg_encoder->stop(); } httpd.stop(); BMUSBCapture::stop_bm_thread(); for (unsigned card_index = 0; card_index < MAX_VIDEO_CARDS; ++card_index) { if (cards[card_index].capture != nullptr) { // Active. cards[card_index].capture->stop_dequeue_thread(); } if (cards[card_index].output) { cards[card_index].output->end_output(); cards[card_index].output.reset(); } } video_encoder.reset(nullptr); } void Mixer::configure_card(unsigned card_index, CaptureInterface *capture, CardType card_type, DeckLinkOutput *output, bool is_srt_card) { bool is_active = capture != nullptr; if (!is_active) { assert(card_type == CardType::FAKE_CAPTURE); } CaptureCard *card = &cards[card_index]; if (card->capture != nullptr) { card_mutex.unlock(); // The dequeue thread could be waiting for bm_frame(). card->capture->stop_dequeue_thread(); card_mutex.lock(); } card->capture.reset(capture); card->is_fake_capture = (card_type == CardType::FAKE_CAPTURE); if (card->is_fake_capture) { card->fake_capture_counter = fake_capture_counter++; } card->is_cef_capture = (card_type == CardType::CEF_INPUT); card->may_have_dropped_last_frame = false; card->type = card_type; if (card->output.get() != output) { card->output.reset(output); } PixelFormat pixel_format; if (card_type == CardType::FFMPEG_INPUT) { pixel_format = capture->get_current_pixel_format(); } else if (card_type == CardType::CEF_INPUT) { pixel_format = PixelFormat_8BitBGRA; } else if (global_flags.bit_depth > 8) { pixel_format = PixelFormat_10BitYCbCr; } else { pixel_format = PixelFormat_8BitYCbCr; } if (is_active) { card->capture->set_frame_callback(bind(&Mixer::bm_frame, this, card_index, _1, _2, _3, _4, _5, _6, _7)); if (card->frame_allocator == nullptr) { card->frame_allocator.reset(new PBOFrameAllocator(pixel_format, FRAME_SIZE, global_flags.width, global_flags.height, card_index, mjpeg_encoder.get())); } else { // The format could have changed, but we cannot reset the allocator // and create a new one from scratch, since there may be allocated // frames from it that expect to call release_frame() on it. // Instead, ask the allocator to create new frames for us and discard // any old ones as they come back. This takes the mutex while // allocating, but nothing should really be sending frames in there // right now anyway (start_bm_capture() has not been called yet). card->frame_allocator->reconfigure(pixel_format, FRAME_SIZE, global_flags.width, global_flags.height, card_index, mjpeg_encoder.get()); } card->capture->set_video_frame_allocator(card->frame_allocator.get()); if (card->surface == nullptr) { card->surface = create_surface_with_same_format(mixer_surface); } while (!card->new_frames.empty()) card->new_frames.pop_front(); card->last_timecode = -1; card->capture->set_pixel_format(pixel_format); card->capture->configure_card(); // NOTE: start_bm_capture() happens in thread_func(). } if (is_srt_card) { assert(card_type == CardType::FFMPEG_INPUT); } DeviceSpec device{InputSourceType::CAPTURE_CARD, card_index}; unsigned num_channels = card_type == CardType::LIVE_CARD ? 8 : 2; if (is_active) { audio_mixer->set_device_parameters(device, card->capture->get_description(), card_type, num_channels, /*active=*/true); } else { // Note: Keeps the previous name, if any. char name[32]; snprintf(name, sizeof(name), "Fake card %u", card_index + 1); audio_mixer->set_device_parameters(device, name, card_type, num_channels, /*active=*/false); } audio_mixer->reset_resampler(device); audio_mixer->trigger_state_changed_callback(); // Unregister old metrics, if any. if (!card->labels.empty()) { const vector> &labels = card->labels; card->jitter_history.unregister_metrics(labels); card->queue_length_policy.unregister_metrics(labels); global_metrics.remove_if_exists("input_received_frames", labels); global_metrics.remove_if_exists("input_dropped_frames_jitter", labels); global_metrics.remove_if_exists("input_dropped_frames_error", labels); global_metrics.remove_if_exists("input_dropped_frames_resets", labels); global_metrics.remove_if_exists("input_queue_length_frames", labels); global_metrics.remove_if_exists("input_queue_duped_frames", labels); global_metrics.remove_if_exists("input_has_signal_bool", labels); global_metrics.remove_if_exists("input_is_connected_bool", labels); global_metrics.remove_if_exists("input_interlaced_bool", labels); global_metrics.remove_if_exists("input_width_pixels", labels); global_metrics.remove_if_exists("input_height_pixels", labels); global_metrics.remove_if_exists("input_frame_rate_nom", labels); global_metrics.remove_if_exists("input_frame_rate_den", labels); global_metrics.remove_if_exists("input_sample_rate_hz", labels); card->srt_metrics.deinit(labels); } if (is_active) { // Register metrics. vector> labels; char card_name[64]; snprintf(card_name, sizeof(card_name), "%d", card_index); labels.emplace_back("card", card_name); switch (card_type) { case CardType::LIVE_CARD: labels.emplace_back("cardtype", "live"); break; case CardType::FAKE_CAPTURE: labels.emplace_back("cardtype", "fake"); break; case CardType::FFMPEG_INPUT: if (is_srt_card) { labels.emplace_back("cardtype", "srt"); } else { labels.emplace_back("cardtype", "ffmpeg"); } break; case CardType::CEF_INPUT: labels.emplace_back("cardtype", "cef"); break; default: assert(false); } card->jitter_history.register_metrics(labels); card->queue_length_policy.register_metrics(labels); global_metrics.add("input_received_frames", labels, &card->metric_input_received_frames); global_metrics.add("input_dropped_frames_jitter", labels, &card->metric_input_dropped_frames_jitter); global_metrics.add("input_dropped_frames_error", labels, &card->metric_input_dropped_frames_error); global_metrics.add("input_dropped_frames_resets", labels, &card->metric_input_resets); global_metrics.add("input_queue_length_frames", labels, &card->metric_input_queue_length_frames, Metrics::TYPE_GAUGE); global_metrics.add("input_queue_duped_frames", labels, &card->metric_input_duped_frames); global_metrics.add("input_has_signal_bool", labels, &card->metric_input_has_signal_bool, Metrics::TYPE_GAUGE); global_metrics.add("input_is_connected_bool", labels, &card->metric_input_is_connected_bool, Metrics::TYPE_GAUGE); global_metrics.add("input_interlaced_bool", labels, &card->metric_input_interlaced_bool, Metrics::TYPE_GAUGE); global_metrics.add("input_width_pixels", labels, &card->metric_input_width_pixels, Metrics::TYPE_GAUGE); global_metrics.add("input_height_pixels", labels, &card->metric_input_height_pixels, Metrics::TYPE_GAUGE); global_metrics.add("input_frame_rate_nom", labels, &card->metric_input_frame_rate_nom, Metrics::TYPE_GAUGE); global_metrics.add("input_frame_rate_den", labels, &card->metric_input_frame_rate_den, Metrics::TYPE_GAUGE); global_metrics.add("input_sample_rate_hz", labels, &card->metric_input_sample_rate_hz, Metrics::TYPE_GAUGE); if (is_srt_card) { card->srt_metrics.init(labels); } card->labels = labels; } else { card->labels.clear(); } } void Mixer::set_output_card_internal(int card_index) { // We don't really need to take card_mutex, since we're in the mixer // thread and don't mess with any queues (which is the only thing that happens // from other threads), but it's probably the safest in the long run. unique_lock lock(card_mutex); if (output_card_index != -1) { // Switch the old card from output to input. CaptureCard *old_card = &cards[output_card_index]; old_card->output->end_output(); // Stop the fake card that we put into place. // This needs to _not_ happen under the mutex, to avoid deadlock // (delivering the last frame needs to take the mutex). CaptureInterface *fake_capture = old_card->capture.get(); lock.unlock(); fake_capture->stop_dequeue_thread(); lock.lock(); old_card->capture = move(old_card->parked_capture); // TODO: reset the metrics old_card->is_fake_capture = false; old_card->capture->start_bm_capture(); } if (card_index != -1) { CaptureCard *card = &cards[card_index]; CaptureInterface *capture = card->capture.get(); // TODO: DeckLinkCapture::stop_dequeue_thread can actually take // several seconds to complete (blocking on DisableVideoInput); // see if we can maybe do it asynchronously. lock.unlock(); capture->stop_dequeue_thread(); lock.lock(); card->parked_capture = move(card->capture); CaptureInterface *fake_capture = new FakeCapture(global_flags.width, global_flags.height, FAKE_FPS, OUTPUT_FREQUENCY, card_index, global_flags.fake_cards_audio); configure_card(card_index, fake_capture, CardType::FAKE_CAPTURE, card->output.release(), /*is_srt_card=*/false); card->jitter_history.clear(); card->capture->start_bm_capture(); desired_output_video_mode = output_video_mode = card->output->pick_video_mode(desired_output_video_mode); card->output->start_output(desired_output_video_mode, pts_int, /*is_master_card=*/output_card_is_master); } output_card_index = card_index; output_jitter_history.clear(); } namespace { int unwrap_timecode(uint16_t current_wrapped, int last) { uint16_t last_wrapped = last & 0xffff; if (current_wrapped > last_wrapped) { return (last & ~0xffff) | current_wrapped; } else { return 0x10000 + ((last & ~0xffff) | current_wrapped); } } } // namespace void Mixer::bm_frame(unsigned card_index, uint16_t timecode, FrameAllocator::Frame video_frame, size_t video_offset, VideoFormat video_format, FrameAllocator::Frame audio_frame, size_t audio_offset, AudioFormat audio_format) { DeviceSpec device{InputSourceType::CAPTURE_CARD, card_index}; CaptureCard *card = &cards[card_index]; ++card->metric_input_received_frames; card->metric_input_has_signal_bool = video_format.has_signal; card->metric_input_is_connected_bool = video_format.is_connected; card->metric_input_interlaced_bool = video_format.interlaced; card->metric_input_width_pixels = video_format.width; card->metric_input_height_pixels = video_format.height; card->metric_input_frame_rate_nom = video_format.frame_rate_nom; card->metric_input_frame_rate_den = video_format.frame_rate_den; card->metric_input_sample_rate_hz = audio_format.sample_rate; if (is_mode_scanning[card_index]) { if (video_format.has_signal) { // Found a stable signal, so stop scanning. is_mode_scanning[card_index] = false; } else { static constexpr double switch_time_s = 0.1; // Should be enough time for the signal to stabilize. steady_clock::time_point now = steady_clock::now(); double sec_since_last_switch = duration(steady_clock::now() - last_mode_scan_change[card_index]).count(); if (sec_since_last_switch > switch_time_s) { // It isn't this mode; try the next one. mode_scanlist_index[card_index]++; mode_scanlist_index[card_index] %= mode_scanlist[card_index].size(); cards[card_index].capture->set_video_mode(mode_scanlist[card_index][mode_scanlist_index[card_index]]); last_mode_scan_change[card_index] = now; } } } int64_t frame_length = int64_t(TIMEBASE) * video_format.frame_rate_den / video_format.frame_rate_nom; assert(frame_length > 0); size_t num_samples = (audio_frame.len > audio_offset) ? (audio_frame.len - audio_offset) / audio_format.num_channels / (audio_format.bits_per_sample / 8) : 0; if (num_samples > OUTPUT_FREQUENCY / 10 && card->type != CardType::FFMPEG_INPUT) { printf("%s: Dropping frame with implausible audio length (len=%d, offset=%d) [timecode=0x%04x video_len=%d video_offset=%d video_format=%x)\n", description_for_card(card_index).c_str(), int(audio_frame.len), int(audio_offset), timecode, int(video_frame.len), int(video_offset), video_format.id); if (video_frame.owner) { video_frame.owner->release_frame(video_frame); } if (audio_frame.owner) { audio_frame.owner->release_frame(audio_frame); } return; } int dropped_frames = 0; if (card->last_timecode != -1) { dropped_frames = unwrap_timecode(timecode, card->last_timecode) - card->last_timecode - 1; } // Number of samples per frame if we need to insert silence. // (Could be nonintegral, but resampling will save us then.) const int silence_samples = OUTPUT_FREQUENCY * video_format.frame_rate_den / video_format.frame_rate_nom; if (dropped_frames > TYPICAL_FPS * 2) { fprintf(stderr, "%s lost more than two seconds (or time code jumping around; from 0x%04x to 0x%04x), resetting resampler\n", description_for_card(card_index).c_str(), card->last_timecode, timecode); audio_mixer->reset_resampler(device); dropped_frames = 0; ++card->metric_input_resets; } else if (dropped_frames > 0) { // Insert silence as needed. fprintf(stderr, "%s dropped %d frame(s) (before timecode 0x%04x), inserting silence.\n", description_for_card(card_index).c_str(), dropped_frames, timecode); card->metric_input_dropped_frames_error += dropped_frames; bool success; do { success = audio_mixer->add_silence(device, silence_samples, dropped_frames); } while (!success); } if (num_samples > 0) { audio_mixer->add_audio(device, audio_frame.data + audio_offset, num_samples, audio_format, audio_frame.received_timestamp); // Audio for the MJPEG stream. We don't resample; audio that's not in 48 kHz // just gets dropped for now. // // Only bother doing MJPEG encoding if there are any connected clients // that want the stream. if (httpd.get_num_connected_multicam_clients() > 0 || httpd.get_num_connected_siphon_clients(card_index) > 0) { vector converted_samples = convert_audio_to_fixed32(audio_frame.data + audio_offset, num_samples, audio_format, 2); lock_guard lock(card_mutex); if (card->new_raw_audio.empty()) { card->new_raw_audio = move(converted_samples); } else { // For raw audio, we don't really synchronize audio and video; // we just put the audio in frame by frame, and if a video frame is // dropped, we still keep the audio, which means it will be added // to the beginning of the next frame. It would probably be better // to move the audio pts earlier to show this, but most players can // live with some jitter, and in a lot of ways, it's much nicer for // Futatabi to have all audio locked to a video frame. card->new_raw_audio.insert(card->new_raw_audio.end(), converted_samples.begin(), converted_samples.end()); // Truncate to one second, just to be sure we don't have infinite buildup in case of weirdness. if (card->new_raw_audio.size() > OUTPUT_FREQUENCY * 2) { size_t excess_samples = card->new_raw_audio.size() - OUTPUT_FREQUENCY * 2; card->new_raw_audio.erase(card->new_raw_audio.begin(), card->new_raw_audio.begin() + excess_samples); } } } } // Done with the audio, so release it. if (audio_frame.owner) { audio_frame.owner->release_frame(audio_frame); } card->last_timecode = timecode; PBOFrameAllocator::Userdata *userdata = (PBOFrameAllocator::Userdata *)video_frame.userdata; if (card->type == CardType::FFMPEG_INPUT && userdata != nullptr) { FFmpegCapture *ffmpeg_capture = static_cast(card->capture.get()); userdata->has_last_subtitle = ffmpeg_capture->get_has_last_subtitle(); userdata->last_subtitle = ffmpeg_capture->get_last_subtitle(); } #ifdef HAVE_SRT if (card->type == CardType::FFMPEG_INPUT) { int srt_sock = static_cast(card->capture.get())->get_srt_sock(); if (srt_sock != -1) { card->srt_metrics.update_srt_stats(srt_sock); } } #endif size_t y_offset, cbcr_offset; size_t expected_length = video_format.stride * (video_format.height + video_format.extra_lines_top + video_format.extra_lines_bottom); if (userdata != nullptr && userdata->pixel_format == PixelFormat_8BitYCbCrPlanar) { // The calculation above is wrong for planar Y'CbCr, so just override it. assert(card->type == CardType::FFMPEG_INPUT); assert(video_offset == 0); expected_length = video_frame.len; userdata->ycbcr_format = (static_cast(card->capture.get()))->get_current_frame_ycbcr_format(); y_offset = 0; cbcr_offset = video_format.width * video_format.height; } else { // All the other Y'CbCr formats are 4:2:2. y_offset = video_frame.size / 2 + video_offset / 2; cbcr_offset = video_offset / 2; } if (video_frame.len - video_offset == 0 || video_frame.len - video_offset != expected_length) { if (video_frame.len != 0) { printf("%s: Dropping video frame with wrong length (%zu; expected %zu)\n", description_for_card(card_index).c_str(), video_frame.len - video_offset, expected_length); } if (video_frame.owner) { video_frame.owner->release_frame(video_frame); } // Still send on the information that we _had_ a frame, even though it's corrupted, // so that pts can go up accordingly. { lock_guard lock(card_mutex); CaptureCard::NewFrame new_frame; new_frame.frame = RefCountedFrame(FrameAllocator::Frame()); new_frame.length = frame_length; new_frame.interlaced = false; new_frame.dropped_frames = dropped_frames; new_frame.received_timestamp = video_frame.received_timestamp; card->new_frames.push_back(move(new_frame)); card->jitter_history.frame_arrived(video_frame.received_timestamp, frame_length, dropped_frames); } card->new_frames_changed.notify_all(); return; } unsigned num_fields = video_format.interlaced ? 2 : 1; steady_clock::time_point frame_upload_start; if (video_format.interlaced) { // Send the two fields along as separate frames; the other side will need to add // a deinterlacer to actually get this right. assert(video_format.height % 2 == 0); video_format.height /= 2; assert(frame_length % 2 == 0); frame_length /= 2; num_fields = 2; frame_upload_start = steady_clock::now(); } assert(userdata != nullptr); userdata->last_interlaced = video_format.interlaced; userdata->last_has_signal = video_format.has_signal; userdata->last_is_connected = video_format.is_connected; userdata->last_frame_rate_nom = video_format.frame_rate_nom; userdata->last_frame_rate_den = video_format.frame_rate_den; RefCountedFrame frame(video_frame); // Send the frames on to the main thread, which will upload and process htem. // It is entirely possible to upload them in the same thread (and it might even be // faster, depending on the GPU and driver), but it appears to be trickling // driver bugs very easily. // // Note that this means we must hold on to the actual frame data in // until the upload is done, but we hold on to much longer than that // (in fact, all the way until we no longer use the texture in rendering). for (unsigned field = 0; field < num_fields; ++field) { if (field == 1) { // Don't upload the second field as fast as we can; wait until // the field time has approximately passed. (Otherwise, we could // get timing jitter against the other sources, and possibly also // against the video display, although the latter is not as critical.) // This requires our system clock to be reasonably close to the // video clock, but that's not an unreasonable assumption. steady_clock::time_point second_field_start = frame_upload_start + nanoseconds(frame_length * 1000000000 / TIMEBASE); this_thread::sleep_until(second_field_start); } { lock_guard lock(card_mutex); CaptureCard::NewFrame new_frame; new_frame.frame = frame; new_frame.length = frame_length; new_frame.field = field; new_frame.interlaced = video_format.interlaced; new_frame.dropped_frames = dropped_frames; new_frame.received_timestamp = video_frame.received_timestamp; // Ignore the audio timestamp. new_frame.video_format = video_format; new_frame.video_offset = video_offset; new_frame.y_offset = y_offset; new_frame.cbcr_offset = cbcr_offset; new_frame.texture_uploaded = false; if (card->type == CardType::FFMPEG_INPUT) { FFmpegCapture *ffmpeg_capture = static_cast(card->capture.get()); new_frame.neutral_color = ffmpeg_capture->get_last_neutral_color(); } card->new_frames.push_back(move(new_frame)); card->jitter_history.frame_arrived(video_frame.received_timestamp, frame_length, dropped_frames); card->may_have_dropped_last_frame = false; } card->new_frames_changed.notify_all(); } } void Mixer::upload_texture_for_frame( int field, bmusb::VideoFormat video_format, size_t y_offset, size_t cbcr_offset, size_t video_offset, PBOFrameAllocator::Userdata *userdata) { size_t cbcr_width, cbcr_height; if (userdata != nullptr && userdata->pixel_format == PixelFormat_8BitYCbCrPlanar) { cbcr_width = video_format.width / userdata->ycbcr_format.chroma_subsampling_x; cbcr_height = video_format.height / userdata->ycbcr_format.chroma_subsampling_y; } else { // All the other Y'CbCr formats are 4:2:2. cbcr_width = video_format.width / 2; cbcr_height = video_format.height; } bool interlaced_stride = video_format.interlaced && (video_format.second_field_start == 1); if (video_format.interlaced) { cbcr_height /= 2; } unsigned field_start_line; if (field == 1) { field_start_line = video_format.second_field_start; } else { field_start_line = video_format.extra_lines_top; } // For anything not FRAME_FORMAT_YCBCR_10BIT, v210_width will be nonsensical but not used. size_t v210_width = video_format.stride / sizeof(uint32_t); ensure_texture_resolution(userdata, field, video_format.width, video_format.height, cbcr_width, cbcr_height, v210_width); glBindBuffer(GL_PIXEL_UNPACK_BUFFER, userdata->pbo); check_error(); switch (userdata->pixel_format) { case PixelFormat_10BitYCbCr: { size_t field_start = video_offset + video_format.stride * field_start_line; upload_texture(userdata->tex_v210[field], v210_width, video_format.height, video_format.stride, interlaced_stride, GL_RGBA, GL_UNSIGNED_INT_2_10_10_10_REV, field_start); v210_converter->convert(userdata->tex_v210[field], userdata->tex_444[field], video_format.width, video_format.height); break; } case PixelFormat_8BitYCbCr: { size_t field_y_start = y_offset + video_format.width * field_start_line; size_t field_cbcr_start = cbcr_offset + cbcr_width * field_start_line * sizeof(uint16_t); // Make up our own strides, since we are interleaving. upload_texture(userdata->tex_y[field], video_format.width, video_format.height, video_format.width, interlaced_stride, GL_RED, GL_UNSIGNED_BYTE, field_y_start); upload_texture(userdata->tex_cbcr[field], cbcr_width, cbcr_height, cbcr_width * sizeof(uint16_t), interlaced_stride, GL_RG, GL_UNSIGNED_BYTE, field_cbcr_start); break; } case PixelFormat_8BitYCbCrPlanar: { assert(field_start_line == 0); // We don't really support interlaced here. size_t field_y_start = y_offset; size_t field_cb_start = cbcr_offset; size_t field_cr_start = cbcr_offset + cbcr_width * cbcr_height; // Make up our own strides, since we are interleaving. upload_texture(userdata->tex_y[field], video_format.width, video_format.height, video_format.width, interlaced_stride, GL_RED, GL_UNSIGNED_BYTE, field_y_start); upload_texture(userdata->tex_cb[field], cbcr_width, cbcr_height, cbcr_width, interlaced_stride, GL_RED, GL_UNSIGNED_BYTE, field_cb_start); upload_texture(userdata->tex_cr[field], cbcr_width, cbcr_height, cbcr_width, interlaced_stride, GL_RED, GL_UNSIGNED_BYTE, field_cr_start); break; } case PixelFormat_8BitBGRA: { size_t field_start = video_offset + video_format.stride * field_start_line; upload_texture(userdata->tex_rgba[field], video_format.width, video_format.height, video_format.stride, interlaced_stride, GL_BGRA, GL_UNSIGNED_INT_8_8_8_8_REV, field_start); // These could be asked to deliver mipmaps at any time. glBindTexture(GL_TEXTURE_2D, userdata->tex_rgba[field]); check_error(); glGenerateMipmap(GL_TEXTURE_2D); check_error(); glBindTexture(GL_TEXTURE_2D, 0); check_error(); break; } default: assert(false); } glBindBuffer(GL_PIXEL_UNPACK_BUFFER, 0); check_error(); } void Mixer::bm_hotplug_add(libusb_device *dev) { lock_guard lock(hotplug_mutex); hotplugged_cards.push_back(dev); } void Mixer::bm_hotplug_remove(unsigned card_index) { cards[card_index].new_frames_changed.notify_all(); } void Mixer::thread_func() { pthread_setname_np(pthread_self(), "Mixer_OpenGL"); eglBindAPI(EGL_OPENGL_API); QOpenGLContext *context = create_context(mixer_surface); if (!make_current(context, mixer_surface)) { printf("oops\n"); abort(); } // Start the actual capture. (We don't want to do it before we're actually ready // to process output frames.) for (unsigned card_index = 0; card_index < MAX_VIDEO_CARDS; ++card_index) { if (int(card_index) != output_card_index && cards[card_index].capture != nullptr) { cards[card_index].capture->start_bm_capture(); } } BasicStats basic_stats(/*verbose=*/true, /*use_opengl=*/true); int stats_dropped_frames = 0; while (!should_quit) { if (desired_output_card_index != output_card_index) { set_output_card_internal(desired_output_card_index); } if (output_card_index != -1 && desired_output_video_mode != output_video_mode) { DeckLinkOutput *output = cards[output_card_index].output.get(); output->end_output(); desired_output_video_mode = output_video_mode = output->pick_video_mode(desired_output_video_mode); output->start_output(desired_output_video_mode, pts_int, /*is_master_card=*/output_card_is_master); } { lock_guard lock(card_mutex); handle_hotplugged_cards(); } CaptureCard::NewFrame new_frames[MAX_VIDEO_CARDS]; bool has_new_frame[MAX_VIDEO_CARDS] = { false }; bool master_card_is_output; unsigned master_card_index; if (output_card_index != -1 && output_card_is_master) { master_card_is_output = true; master_card_index = output_card_index; } else { master_card_is_output = false; master_card_index = theme->map_signal_to_card(master_clock_channel); assert(master_card_index < MAX_VIDEO_CARDS); } vector raw_audio[MAX_VIDEO_CARDS]; // For MJPEG encoding. OutputFrameInfo output_frame_info = get_one_frame_from_each_card(master_card_index, master_card_is_output, new_frames, has_new_frame, raw_audio); schedule_audio_resampling_tasks(output_frame_info.dropped_frames, output_frame_info.num_samples, output_frame_info.frame_duration, output_frame_info.is_preroll, output_frame_info.frame_timestamp); stats_dropped_frames += output_frame_info.dropped_frames; for (unsigned card_index = 0; card_index < MAX_VIDEO_CARDS; ++card_index) { if (card_index == master_card_index || !has_new_frame[card_index]) { continue; } if (new_frames[card_index].frame->len == 0) { ++new_frames[card_index].dropped_frames; } if (new_frames[card_index].dropped_frames > 0) { printf("%s dropped %d frames before this\n", description_for_card(card_index).c_str(), int(new_frames[card_index].dropped_frames)); } } // If the first card is reporting a corrupted or otherwise dropped frame, // just increase the pts (skipping over this frame) and don't try to compute anything new. if (!master_card_is_output && new_frames[master_card_index].frame != nullptr && // Timeout. new_frames[master_card_index].frame->len == 0) { ++stats_dropped_frames; pts_int += new_frames[master_card_index].length; continue; } for (unsigned card_index = 0; card_index < MAX_VIDEO_CARDS; ++card_index) { if (!has_new_frame[card_index] || new_frames[card_index].frame->len == 0) continue; CaptureCard::NewFrame *new_frame = &new_frames[card_index]; assert(new_frame->frame != nullptr); insert_new_frame(new_frame->frame, new_frame->field, new_frame->interlaced, card_index, &input_state); check_error(); // The new texture might need uploading before use. if (!new_frame->texture_uploaded) { upload_texture_for_frame(new_frame->field, new_frame->video_format, new_frame->y_offset, new_frame->cbcr_offset, new_frame->video_offset, (PBOFrameAllocator::Userdata *)new_frame->frame->userdata); new_frame->texture_uploaded = true; } // Only set the white balance if it actually changed. This means that the user // is free to override the white balance in a video with no white balance information // actually set (ie. r=g=b=1 all the time), or one where the white point is wrong, // but frame-to-frame decisions will be heeded. We do this pretty much as late // as possible (ie., after picking out the frame from the buffer), so that we are sure // that the change takes effect on exactly the right frame. if (fabs(new_frame->neutral_color.r - last_received_neutral_color[card_index].r) > 1e-3 || fabs(new_frame->neutral_color.g - last_received_neutral_color[card_index].g) > 1e-3 || fabs(new_frame->neutral_color.b - last_received_neutral_color[card_index].b) > 1e-3) { theme->set_wb_for_card(card_index, new_frame->neutral_color.r, new_frame->neutral_color.g, new_frame->neutral_color.b); last_received_neutral_color[card_index] = new_frame->neutral_color; } if (new_frame->frame->data_copy != nullptr && mjpeg_encoder->should_encode_mjpeg_for_card(card_index)) { RGBTriplet neutral_color = theme->get_white_balance_for_card(card_index); mjpeg_encoder->upload_frame(pts_int, card_index, new_frame->frame, new_frame->video_format, new_frame->y_offset, new_frame->cbcr_offset, move(raw_audio[card_index]), neutral_color); } } int64_t frame_duration = output_frame_info.frame_duration; render_one_frame(frame_duration); { lock_guard lock(frame_num_mutex); ++frame_num; } frame_num_updated.notify_all(); pts_int += frame_duration; basic_stats.update(frame_num, stats_dropped_frames); // if (frame_num % 100 == 0) chain->print_phase_timing(); if (should_cut.exchange(false)) { // Test and clear. video_encoder->do_cut(frame_num); } #if 0 // Reset every 100 frames, so that local variations in frame times // (especially for the first few frames, when the shaders are // compiled etc.) don't make it hard to measure for the entire // remaining duration of the program. if (frame == 10000) { frame = 0; start = now; } #endif check_error(); } resource_pool->clean_context(); } bool Mixer::input_card_is_master_clock(unsigned card_index, unsigned master_card_index) const { if (output_card_index != -1 && output_card_is_master) { // The output card (ie., cards[output_card_index].output) is the master clock, // so no input card (ie., cards[card_index].capture) is. return false; } return (card_index == master_card_index); } void Mixer::trim_queue(CaptureCard *card, size_t safe_queue_length) { // Count the number of frames in the queue, including any frames // we dropped. It's hard to know exactly how we should deal with // dropped (corrupted) input frames; they don't help our goal of // avoiding starvation, but they still add to the problem of latency. // Since dropped frames is going to mean a bump in the signal anyway, // we err on the side of having more stable latency instead. unsigned queue_length = 0; for (const CaptureCard::NewFrame &frame : card->new_frames) { queue_length += frame.dropped_frames + 1; } // If needed, drop frames until the queue is below the safe limit. // We prefer to drop from the head, because all else being equal, // we'd like more recent frames (less latency). unsigned dropped_frames = 0; while (queue_length > safe_queue_length) { assert(!card->new_frames.empty()); assert(queue_length > card->new_frames.front().dropped_frames); queue_length -= card->new_frames.front().dropped_frames; if (queue_length <= safe_queue_length) { // No need to drop anything. break; } card->new_frames.pop_front(); card->new_frames_changed.notify_all(); --queue_length; ++dropped_frames; if (queue_length == 0 && card->is_cef_capture) { card->may_have_dropped_last_frame = true; } } card->metric_input_dropped_frames_jitter += dropped_frames; card->metric_input_queue_length_frames = queue_length; #if 0 if (dropped_frames > 0) { fprintf(stderr, "Card %u dropped %u frame(s) to keep latency down.\n", card_index, dropped_frames); } #endif } pair Mixer::get_channels_json() { Channels ret; for (int channel_idx = 0; channel_idx < theme->get_num_channels(); ++channel_idx) { Channel *channel = ret.add_channel(); channel->set_index(channel_idx + 2); channel->set_name(theme->get_channel_name(channel_idx + 2)); channel->set_color(theme->get_channel_color(channel_idx + 2)); } string contents; google::protobuf::util::MessageToJsonString(ret, &contents); // Ignore any errors. return make_pair(contents, "text/json"); } pair Mixer::get_channel_color_http(unsigned channel_idx) { return make_pair(theme->get_channel_color(channel_idx), "text/plain"); } Mixer::OutputFrameInfo Mixer::get_one_frame_from_each_card(unsigned master_card_index, bool master_card_is_output, CaptureCard::NewFrame new_frames[MAX_VIDEO_CARDS], bool has_new_frame[MAX_VIDEO_CARDS], vector raw_audio[MAX_VIDEO_CARDS]) { OutputFrameInfo output_frame_info; constexpr steady_clock::duration master_card_timeout = milliseconds(200); start: unique_lock lock(card_mutex, defer_lock); bool timed_out = false; if (master_card_is_output) { // Clocked to the output, so wait for it to be ready for the next frame. cards[master_card_index].output->wait_for_frame(pts_int, &output_frame_info.dropped_frames, &output_frame_info.frame_duration, &output_frame_info.is_preroll, &output_frame_info.frame_timestamp); lock.lock(); } else { // Wait for the master card to have a new frame. output_frame_info.is_preroll = false; lock.lock(); timed_out = !cards[master_card_index].new_frames_changed.wait_for(lock, master_card_timeout, [this, master_card_index] { return !cards[master_card_index].new_frames.empty() || cards[master_card_index].capture == nullptr || cards[master_card_index].capture->get_disconnected(); }); if (timed_out) { fprintf(stderr, "WARNING: Master card (%s) did not deliver a frame for %u ms, creating a fake one.\n", description_for_card(master_card_index).c_str(), unsigned(duration_cast(master_card_timeout).count())); } } if (timed_out) { // The master card stalled for 200 ms (possible when it's e.g. // an SRT card). Send a frame no matter what; this also makes sure // any other cards get to empty their queues, and in general, // that we make _some_ sort of forward progress. handle_hotplugged_cards(); } else if (master_card_is_output) { handle_hotplugged_cards(); } else if (cards[master_card_index].new_frames.empty()) { // We were woken up, but not due to a new frame. Deal with it // and then restart. assert(cards[master_card_index].capture == nullptr || cards[master_card_index].capture->get_disconnected()); handle_hotplugged_cards(); lock.unlock(); goto start; } for (unsigned card_index = 0; card_index < MAX_VIDEO_CARDS; ++card_index) { CaptureCard *card = &cards[card_index]; if (card->new_frames.empty()) { // Starvation. ++card->metric_input_duped_frames; #ifdef HAVE_CEF if (card->is_cef_capture && card->may_have_dropped_last_frame) { // Unlike other sources, CEF is not guaranteed to send us a steady // stream of frames, so we'll have to ask it to repaint the frame // we dropped. (may_have_dropped_last_frame is set whenever we // trim the queue completely away, and cleared when we actually // get a new frame.) ((CEFCapture *)card->capture.get())->request_new_frame(/*ignore_if_locked=*/true); } #endif } else { new_frames[card_index] = move(card->new_frames.front()); has_new_frame[card_index] = true; card->new_frames.pop_front(); card->new_frames_changed.notify_all(); } raw_audio[card_index] = move(card->new_raw_audio); } if (timed_out) { // Pretend the frame happened a while ago and was only processed now, // so that we get the duration sort-of right. This isn't ideal. output_frame_info.dropped_frames = 0; // Hard to define, really. output_frame_info.frame_duration = lrint(TIMEBASE * duration(master_card_timeout).count()); output_frame_info.frame_timestamp = steady_clock::now() - master_card_timeout; } else if (!master_card_is_output) { output_frame_info.frame_timestamp = new_frames[master_card_index].received_timestamp; output_frame_info.dropped_frames = new_frames[master_card_index].dropped_frames; output_frame_info.frame_duration = new_frames[master_card_index].length; } if (!output_frame_info.is_preroll) { output_jitter_history.frame_arrived(output_frame_info.frame_timestamp, output_frame_info.frame_duration, output_frame_info.dropped_frames); } for (unsigned card_index = 0; card_index < MAX_VIDEO_CARDS; ++card_index) { CaptureCard *card = &cards[card_index]; if (has_new_frame[card_index] && !input_card_is_master_clock(card_index, master_card_index) && !output_frame_info.is_preroll) { card->queue_length_policy.update_policy( output_frame_info.frame_timestamp, card->jitter_history.get_expected_next_frame(), new_frames[master_card_index].length, output_frame_info.frame_duration, card->jitter_history.estimate_max_jitter(), output_jitter_history.estimate_max_jitter()); trim_queue(card, min(global_flags.max_input_queue_frames, card->queue_length_policy.get_safe_queue_length())); } } // This might get off by a fractional sample when changing master card // between ones with different frame rates, but that's fine. int64_t num_samples_times_timebase = int64_t(OUTPUT_FREQUENCY) * output_frame_info.frame_duration + fractional_samples; output_frame_info.num_samples = num_samples_times_timebase / TIMEBASE; fractional_samples = num_samples_times_timebase % TIMEBASE; assert(output_frame_info.num_samples >= 0); if (timed_out) { DeviceSpec device{InputSourceType::CAPTURE_CARD, master_card_index}; bool success; do { success = audio_mixer->add_silence(device, output_frame_info.num_samples, /*dropped_frames=*/0); } while (!success); } return output_frame_info; } void Mixer::handle_hotplugged_cards() { // Check for cards that have been disconnected since last frame. for (unsigned card_index = 0; card_index < MAX_VIDEO_CARDS; ++card_index) { CaptureCard *card = &cards[card_index]; if (card->capture != nullptr && card->capture->get_disconnected()) { bool is_active = card_index < unsigned(global_flags.min_num_cards) || cards[card_index].force_active; if (is_active) { fprintf(stderr, "Card %u went away, replacing with a fake card.\n", card_index); FakeCapture *capture = new FakeCapture(global_flags.width, global_flags.height, FAKE_FPS, OUTPUT_FREQUENCY, card_index, global_flags.fake_cards_audio); configure_card(card_index, capture, CardType::FAKE_CAPTURE, /*output=*/nullptr, /*is_srt_card=*/false); card->jitter_history.clear(); card->capture->start_bm_capture(); } else { // NOTE: The theme might end up forcing the card back at some later point // (ie., force_active is false now, but might immediately be true again on // e.g. the next frame). That should be rare, though, so we don't bother // adjusting the message. fprintf(stderr, "Card %u went away, removing. (To keep a fake card, increase --num-cards.)\n", card_index); theme->remove_card(card_index); configure_card(card_index, /*capture=*/nullptr, CardType::FAKE_CAPTURE, /*output=*/nullptr, /*is_srt_card=*/false); card->jitter_history.clear(); } } } // Count how many active cards we already have. Used below to check that we // don't go past the max_cards limit set by the user. Note that (non-SRT) video // and HTML “cards” don't count towards this limit. int num_video_cards = 0; for (unsigned card_index = 0; card_index < MAX_VIDEO_CARDS; ++card_index) { CaptureCard *card = &cards[card_index]; if (card->type == CardType::LIVE_CARD || is_srt_card(card)) { ++num_video_cards; } } // Check for cards that have been connected since last frame. vector hotplugged_cards_copy; #ifdef HAVE_SRT vector hotplugged_srt_cards_copy; #endif { lock_guard lock(hotplug_mutex); swap(hotplugged_cards, hotplugged_cards_copy); #ifdef HAVE_SRT swap(hotplugged_srt_cards, hotplugged_srt_cards_copy); #endif } for (libusb_device *new_dev : hotplugged_cards_copy) { // Look for a fake capture card where we can stick this in. int free_card_index = -1; for (unsigned card_index = 0; card_index < MAX_VIDEO_CARDS; ++card_index) { if (cards[card_index].is_fake_capture) { free_card_index = card_index; break; } } if (free_card_index == -1 || num_video_cards >= global_flags.max_num_cards) { fprintf(stderr, "New card plugged in, but no free slots -- ignoring.\n"); libusb_unref_device(new_dev); } else { // BMUSBCapture takes ownership. fprintf(stderr, "New card plugged in, choosing slot %d.\n", free_card_index); CaptureCard *card = &cards[free_card_index]; BMUSBCapture *capture = new BMUSBCapture(free_card_index, new_dev); configure_card(free_card_index, capture, CardType::LIVE_CARD, /*output=*/nullptr, /*is_srt_card=*/false); card->jitter_history.clear(); capture->set_card_disconnected_callback(bind(&Mixer::bm_hotplug_remove, this, free_card_index)); capture->start_bm_capture(); } } #ifdef HAVE_SRT // Same, for SRT inputs. for (SRTSOCKET sock : hotplugged_srt_cards_copy) { char name[256]; int namelen = sizeof(name); srt_getsockopt(sock, /*ignored=*/0, SRTO_STREAMID, name, &namelen); string stream_id(name, namelen); // Look for a fake capture card where we can stick this in. // Prioritize ones that previously held SRT streams with the // same stream ID, if any exist -- and it multiple exist, // take the one that disconnected the last. int first_free_card_index = -1, last_matching_free_card_index = -1; for (unsigned card_index = 0; card_index < MAX_VIDEO_CARDS; ++card_index) { CaptureCard *card = &cards[card_index]; if (!card->is_fake_capture) { continue; } if (first_free_card_index == -1) { first_free_card_index = card_index; } if (card->last_srt_stream_id == stream_id && (last_matching_free_card_index == -1 || card->fake_capture_counter > cards[last_matching_free_card_index].fake_capture_counter)) { last_matching_free_card_index = card_index; } } const int free_card_index = (last_matching_free_card_index != -1) ? last_matching_free_card_index : first_free_card_index; if (free_card_index == -1 || num_video_cards >= global_flags.max_num_cards) { if (stream_id.empty()) { stream_id = "no name"; } fprintf(stderr, "New SRT stream connected (%s), but no free slots -- ignoring.\n", stream_id.c_str()); srt_close(sock); } else { // FFmpegCapture takes ownership. if (stream_id.empty()) { fprintf(stderr, "New unnamed SRT stream connected, choosing slot %d.\n", free_card_index); } else { fprintf(stderr, "New SRT stream connected (%s), choosing slot %d.\n", stream_id.c_str(), free_card_index); } CaptureCard *card = &cards[free_card_index]; FFmpegCapture *capture = new FFmpegCapture(sock, stream_id); capture->set_card_index(free_card_index); configure_card(free_card_index, capture, CardType::FFMPEG_INPUT, /*output=*/nullptr, /*is_srt_card=*/true); card->srt_metrics.update_srt_stats(sock); // Initial zero stats. card->last_srt_stream_id = stream_id; card->jitter_history.clear(); capture->set_card_disconnected_callback(bind(&Mixer::bm_hotplug_remove, this, free_card_index)); capture->start_bm_capture(); } } #endif // Finally, newly forced-to-active fake capture cards. for (unsigned card_index = 0; card_index < MAX_VIDEO_CARDS; ++card_index) { CaptureCard *card = &cards[card_index]; if (card->capture == nullptr && card->force_active) { FakeCapture *capture = new FakeCapture(global_flags.width, global_flags.height, FAKE_FPS, OUTPUT_FREQUENCY, card_index, global_flags.fake_cards_audio); configure_card(card_index, capture, CardType::FAKE_CAPTURE, /*output=*/nullptr, /*is_srt_card=*/false); card->jitter_history.clear(); card->capture->start_bm_capture(); } } } void Mixer::schedule_audio_resampling_tasks(unsigned dropped_frames, int num_samples_per_frame, int length_per_frame, bool is_preroll, steady_clock::time_point frame_timestamp) { // Resample the audio as needed, including from previously dropped frames. for (unsigned frame_num = 0; frame_num < dropped_frames + 1; ++frame_num) { const bool dropped_frame = (frame_num != dropped_frames); { // Signal to the audio thread to process this frame. // Note that if the frame is a dropped frame, we signal that // we don't want to use this frame as base for adjusting // the resampler rate. The reason for this is that the timing // of these frames is often way too late; they typically don't // “arrive” before we synthesize them. Thus, we could end up // in a situation where we have inserted e.g. five audio frames // into the queue before we then start pulling five of them // back out. This makes ResamplingQueue overestimate the delay, // causing undue resampler changes. (We _do_ use the last, // non-dropped frame; perhaps we should just discard that as well, // since dropped frames are expected to be rare, and it might be // better to just wait until we have a slightly more normal situation). lock_guard lock(audio_mutex); bool adjust_rate = !dropped_frame && !is_preroll; audio_task_queue.push(AudioTask{pts_int, num_samples_per_frame, adjust_rate, frame_timestamp}); audio_task_queue_changed.notify_one(); } if (dropped_frame) { // For dropped frames, increase the pts. Note that if the format changed // in the meantime, we have no way of detecting that; we just have to // assume the frame length is always the same. pts_int += length_per_frame; } } } void Mixer::render_one_frame(int64_t duration) { // Determine the time code for this frame before we start rendering. string timecode_text = timecode_renderer->get_timecode_text(double(pts_int) / TIMEBASE, frame_num); if (display_timecode_on_stdout) { printf("Timecode: '%s'\n", timecode_text.c_str()); } // Update Y'CbCr settings for all cards. { lock_guard lock(card_mutex); for (unsigned card_index = 0; card_index < MAX_VIDEO_CARDS; ++card_index) { YCbCrInterpretation *interpretation = &ycbcr_interpretation[card_index]; input_state.ycbcr_coefficients_auto[card_index] = interpretation->ycbcr_coefficients_auto; input_state.ycbcr_coefficients[card_index] = interpretation->ycbcr_coefficients; input_state.full_range[card_index] = interpretation->full_range; } } // Get the main chain from the theme, and set its state immediately. Theme::Chain theme_main_chain = theme->get_chain(0, pts(), global_flags.width, global_flags.height, input_state); EffectChain *chain = theme_main_chain.chain; theme_main_chain.setup_chain(); //theme_main_chain.chain->enable_phase_timing(true); // If HDMI/SDI output is active and the user has requested auto mode, // its mode overrides the existing Y'CbCr setting for the chain. YCbCrLumaCoefficients ycbcr_output_coefficients; if (global_flags.ycbcr_auto_coefficients && output_card_index != -1) { ycbcr_output_coefficients = cards[output_card_index].output->preferred_ycbcr_coefficients(); } else { ycbcr_output_coefficients = global_flags.ycbcr_rec709_coefficients ? YCBCR_REC_709 : YCBCR_REC_601; } // TODO: Reduce the duplication against theme.cpp. YCbCrFormat output_ycbcr_format; output_ycbcr_format.chroma_subsampling_x = 1; output_ycbcr_format.chroma_subsampling_y = 1; output_ycbcr_format.luma_coefficients = ycbcr_output_coefficients; output_ycbcr_format.full_range = false; output_ycbcr_format.num_levels = 1 << global_flags.bit_depth; chain->change_ycbcr_output_format(output_ycbcr_format); // Render main chain. If we're using zerocopy Quick Sync encoding // (the default case), we take an extra copy of the created outputs, // so that we can display it back to the screen later (it's less memory // bandwidth than writing and reading back an RGBA texture, even at 16-bit). // Ideally, we'd like to avoid taking copies and just use the main textures // for display as well, but they're just views into VA-API memory and must be // unmapped during encoding, so we can't use them for display, unfortunately. GLuint y_tex, cbcr_full_tex, cbcr_tex; GLuint y_copy_tex, cbcr_copy_tex = 0; GLuint y_display_tex, cbcr_display_tex; GLenum y_type = (global_flags.bit_depth > 8) ? GL_R16 : GL_R8; GLenum cbcr_type = (global_flags.bit_depth > 8) ? GL_RG16 : GL_RG8; const bool is_zerocopy = video_encoder->is_zerocopy(); if (is_zerocopy) { cbcr_full_tex = resource_pool->create_2d_texture(cbcr_type, global_flags.width, global_flags.height); y_copy_tex = resource_pool->create_2d_texture(y_type, global_flags.width, global_flags.height); cbcr_copy_tex = resource_pool->create_2d_texture(cbcr_type, global_flags.width / 2, global_flags.height / 2); y_display_tex = y_copy_tex; cbcr_display_tex = cbcr_copy_tex; // y_tex and cbcr_tex will be given by VideoEncoder. } else { cbcr_full_tex = resource_pool->create_2d_texture(cbcr_type, global_flags.width, global_flags.height); y_tex = resource_pool->create_2d_texture(y_type, global_flags.width, global_flags.height); cbcr_tex = resource_pool->create_2d_texture(cbcr_type, global_flags.width / 2, global_flags.height / 2); y_display_tex = y_tex; cbcr_display_tex = cbcr_tex; } const int64_t av_delay = lrint(global_flags.audio_queue_length_ms * 0.001 * TIMEBASE); // Corresponds to the delay in ResamplingQueue. bool got_frame = video_encoder->begin_frame(pts_int + av_delay, duration, ycbcr_output_coefficients, theme_main_chain.input_frames, &y_tex, &cbcr_tex); assert(got_frame); GLuint fbo; if (is_zerocopy) { fbo = resource_pool->create_fbo(y_tex, cbcr_full_tex, y_copy_tex); } else { fbo = resource_pool->create_fbo(y_tex, cbcr_full_tex); } check_error(); chain->render_to_fbo(fbo, global_flags.width, global_flags.height); if (display_timecode_in_stream) { // Render the timecode on top. timecode_renderer->render_timecode(fbo, timecode_text); } resource_pool->release_fbo(fbo); if (is_zerocopy) { chroma_subsampler->subsample_chroma(cbcr_full_tex, global_flags.width, global_flags.height, cbcr_tex, cbcr_copy_tex); } else { chroma_subsampler->subsample_chroma(cbcr_full_tex, global_flags.width, global_flags.height, cbcr_tex); } if (output_card_index != -1) { cards[output_card_index].output->send_frame(y_tex, cbcr_full_tex, ycbcr_output_coefficients, theme_main_chain.input_frames, pts_int, duration); } resource_pool->release_2d_texture(cbcr_full_tex); // Set the right state for the Y' and CbCr textures we use for display. glBindFramebuffer(GL_FRAMEBUFFER, 0); glBindTexture(GL_TEXTURE_2D, y_display_tex); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_MIN_FILTER, GL_LINEAR); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_S, GL_CLAMP_TO_EDGE); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_T, GL_CLAMP_TO_EDGE); glBindTexture(GL_TEXTURE_2D, cbcr_display_tex); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_MIN_FILTER, GL_LINEAR); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_S, GL_CLAMP_TO_EDGE); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_T, GL_CLAMP_TO_EDGE); RefCountedGLsync fence = video_encoder->end_frame(); // The live frame pieces the Y'CbCr texture copies back into RGB and displays them. // It owns y_display_tex and cbcr_display_tex now (whichever textures they are). DisplayFrame live_frame; live_frame.chain = display_chain.get(); live_frame.setup_chain = [this, y_display_tex, cbcr_display_tex]{ display_input->set_texture_num(0, y_display_tex); display_input->set_texture_num(1, cbcr_display_tex); }; live_frame.ready_fence = fence; live_frame.input_frames = {}; live_frame.temp_textures = { y_display_tex, cbcr_display_tex }; output_channel[OUTPUT_LIVE].output_frame(move(live_frame)); // Set up preview and any additional channels. for (int i = 1; i < theme->get_num_channels() + 2; ++i) { DisplayFrame display_frame; Theme::Chain chain = theme->get_chain(i, pts(), global_flags.width, global_flags.height, input_state); // FIXME: dimensions display_frame.chain = move(chain.chain); display_frame.setup_chain = move(chain.setup_chain); display_frame.ready_fence = fence; display_frame.input_frames = move(chain.input_frames); display_frame.temp_textures = {}; output_channel[i].output_frame(move(display_frame)); } } void Mixer::audio_thread_func() { pthread_setname_np(pthread_self(), "Mixer_Audio"); while (!should_quit) { AudioTask task; { unique_lock lock(audio_mutex); audio_task_queue_changed.wait(lock, [this]{ return should_quit || !audio_task_queue.empty(); }); if (should_quit) { return; } task = audio_task_queue.front(); audio_task_queue.pop(); } ResamplingQueue::RateAdjustmentPolicy rate_adjustment_policy = task.adjust_rate ? ResamplingQueue::ADJUST_RATE : ResamplingQueue::DO_NOT_ADJUST_RATE; vector samples_out = audio_mixer->get_output( task.frame_timestamp, task.num_samples, rate_adjustment_policy); // Send the samples to the sound card, then add them to the output. if (alsa) { alsa->write(samples_out); } if (output_card_index != -1) { const int64_t av_delay = lrint(global_flags.audio_queue_length_ms * 0.001 * TIMEBASE); // Corresponds to the delay in ResamplingQueue. cards[output_card_index].output->send_audio(task.pts_int + av_delay, samples_out); } video_encoder->add_audio(task.pts_int, move(samples_out)); } } void Mixer::release_display_frame(DisplayFrame *frame) { for (GLuint texnum : frame->temp_textures) { resource_pool->release_2d_texture(texnum); } frame->temp_textures.clear(); frame->ready_fence.reset(); frame->input_frames.clear(); } void Mixer::start() { mixer_thread = thread(&Mixer::thread_func, this); audio_thread = thread(&Mixer::audio_thread_func, this); } void Mixer::quit() { should_quit = true; audio_task_queue_changed.notify_one(); mixer_thread.join(); audio_thread.join(); #ifdef HAVE_SRT if (global_flags.srt_port >= 0) { // There's seemingly no other reasonable way to wake up the thread // (libsrt's epoll equivalent is busy-waiting). int sock = srt_create_socket(); if (sock != -1) { sockaddr_in6 addr; memset(&addr, 0, sizeof(addr)); addr.sin6_family = AF_INET6; addr.sin6_addr = IN6ADDR_LOOPBACK_INIT; addr.sin6_port = htons(global_flags.srt_port); srt_connect(sock, (sockaddr *)&addr, sizeof(addr)); srt_close(sock); } srt_thread.join(); } #endif } void Mixer::transition_clicked(int transition_num) { theme->transition_clicked(transition_num, pts()); } void Mixer::channel_clicked(int preview_num) { theme->channel_clicked(preview_num); } YCbCrInterpretation Mixer::get_input_ycbcr_interpretation(unsigned card_index) const { lock_guard lock(card_mutex); return ycbcr_interpretation[card_index]; } void Mixer::set_input_ycbcr_interpretation(unsigned card_index, const YCbCrInterpretation &interpretation) { lock_guard lock(card_mutex); ycbcr_interpretation[card_index] = interpretation; } void Mixer::start_mode_scanning(unsigned card_index) { assert(card_index < MAX_VIDEO_CARDS); if (cards[card_index].capture == nullptr) { // Inactive card. Should never happen. return; } if (is_mode_scanning[card_index]) { return; } is_mode_scanning[card_index] = true; mode_scanlist[card_index].clear(); for (const auto &mode : cards[card_index].capture->get_available_video_modes()) { mode_scanlist[card_index].push_back(mode.first); } assert(!mode_scanlist[card_index].empty()); mode_scanlist_index[card_index] = 0; cards[card_index].capture->set_video_mode(mode_scanlist[card_index][0]); last_mode_scan_change[card_index] = steady_clock::now(); } map Mixer::get_available_output_video_modes() const { assert(desired_output_card_index != -1); lock_guard lock(card_mutex); return cards[desired_output_card_index].output->get_available_video_modes(); } string Mixer::get_ffmpeg_filename(unsigned card_index) const { assert(card_index < MAX_VIDEO_CARDS); assert(cards[card_index].type == CardType::FFMPEG_INPUT); return ((FFmpegCapture *)(cards[card_index].capture.get()))->get_filename(); } void Mixer::set_ffmpeg_filename(unsigned card_index, const string &filename) { assert(card_index < MAX_VIDEO_CARDS); assert(cards[card_index].type == CardType::FFMPEG_INPUT); ((FFmpegCapture *)(cards[card_index].capture.get()))->change_filename(filename); } void Mixer::wait_for_next_frame() { unique_lock lock(frame_num_mutex); unsigned old_frame_num = frame_num; frame_num_updated.wait_for(lock, seconds(1), // Timeout is just in case. [old_frame_num, this]{ return this->frame_num > old_frame_num; }); } Mixer::OutputChannel::~OutputChannel() { if (has_current_frame) { parent->release_display_frame(¤t_frame); } if (has_ready_frame) { parent->release_display_frame(&ready_frame); } } void Mixer::OutputChannel::output_frame(DisplayFrame &&frame) { // Store this frame for display. Remove the ready frame if any // (it was seemingly never used). { lock_guard lock(frame_mutex); if (has_ready_frame) { parent->release_display_frame(&ready_frame); } ready_frame = move(frame); has_ready_frame = true; // Call the callbacks under the mutex (they should be short), // so that we don't race against a callback removal. for (const auto &key_and_callback : new_frame_ready_callbacks) { key_and_callback.second(); } } // Reduce the number of callbacks by filtering duplicates. The reason // why we bother doing this is that Qt seemingly can get into a state // where its builds up an essentially unbounded queue of signals, // consuming more and more memory, and there's no good way of collapsing // user-defined signals or limiting the length of the queue. if (transition_names_updated_callback) { vector transition_names = global_mixer->get_transition_names(); bool changed = false; if (transition_names.size() != last_transition_names.size()) { changed = true; } else { for (unsigned i = 0; i < transition_names.size(); ++i) { if (transition_names[i] != last_transition_names[i]) { changed = true; break; } } } if (changed) { transition_names_updated_callback(transition_names); last_transition_names = transition_names; } } if (name_updated_callback) { string name = global_mixer->get_channel_name(channel); if (name != last_name) { name_updated_callback(name); last_name = name; } } if (color_updated_callback) { string color = global_mixer->get_channel_color(channel); if (color != last_color) { color_updated_callback(color); last_color = color; } } } bool Mixer::OutputChannel::get_display_frame(DisplayFrame *frame) { lock_guard lock(frame_mutex); if (!has_current_frame && !has_ready_frame) { return false; } if (has_current_frame && has_ready_frame) { // We have a new ready frame. Toss the current one. parent->release_display_frame(¤t_frame); has_current_frame = false; } if (has_ready_frame) { assert(!has_current_frame); current_frame = move(ready_frame); ready_frame.ready_fence.reset(); // Drop the refcount. ready_frame.input_frames.clear(); // Drop the refcounts. has_current_frame = true; has_ready_frame = false; } *frame = current_frame; return true; } void Mixer::OutputChannel::add_frame_ready_callback(void *key, Mixer::new_frame_ready_callback_t callback) { lock_guard lock(frame_mutex); new_frame_ready_callbacks[key] = callback; } void Mixer::OutputChannel::remove_frame_ready_callback(void *key) { lock_guard lock(frame_mutex); new_frame_ready_callbacks.erase(key); } void Mixer::OutputChannel::set_transition_names_updated_callback(Mixer::transition_names_updated_callback_t callback) { transition_names_updated_callback = callback; } void Mixer::OutputChannel::set_name_updated_callback(Mixer::name_updated_callback_t callback) { name_updated_callback = callback; } void Mixer::OutputChannel::set_color_updated_callback(Mixer::color_updated_callback_t callback) { color_updated_callback = callback; } #ifdef HAVE_SRT void Mixer::start_srt() { SRTSOCKET sock = srt_create_socket(); sockaddr_in6 addr; memset(&addr, 0, sizeof(addr)); addr.sin6_family = AF_INET6; addr.sin6_port = htons(global_flags.srt_port); int zero = 0; int err = srt_setsockopt(sock, /*level=*/0, SRTO_IPV6ONLY, &zero, sizeof(zero)); if (err != 0) { fprintf(stderr, "srt_setsockopt(SRTO_IPV6ONLY): %s\n", srt_getlasterror_str()); abort(); } err = srt_bind(sock, (sockaddr *)&addr, sizeof(addr)); if (err != 0) { fprintf(stderr, "srt_bind: %s\n", srt_getlasterror_str()); abort(); } err = srt_listen(sock, MAX_VIDEO_CARDS); if (err != 0) { fprintf(stderr, "srt_listen: %s\n", srt_getlasterror_str()); abort(); } srt_thread = thread([this, sock] { sockaddr_in6 addr; for ( ;; ) { int sa_len = sizeof(addr); int clientsock = srt_accept(sock, (sockaddr *)&addr, &sa_len); if (should_quit) { if (clientsock != -1) { srt_close(clientsock); } break; } if (!global_flags.enable_srt) { // Runtime UI toggle. // Perhaps not as good as never listening in the first place, // but much simpler to turn on and off. srt_close(clientsock); continue; } lock_guard lock(hotplug_mutex); hotplugged_srt_cards.push_back(clientsock); } srt_close(sock); }); } #endif string Mixer::description_for_card(unsigned card_index) { CaptureCard *card = &cards[card_index]; if (card->capture == nullptr) { // Should never be called for inactive cards, but OK. char buf[256]; snprintf(buf, sizeof(buf), "Inactive capture card %u", card_index); return buf; } if (card->type != CardType::FFMPEG_INPUT) { char buf[256]; snprintf(buf, sizeof(buf), "Capture card %u (%s)", card_index, card->capture->get_description().c_str()); return buf; } // Number (non-SRT) FFmpeg inputs from zero, separately from the capture cards, // since it's not too obvious for the user that they are “cards”. unsigned ffmpeg_index = 0; for (unsigned i = 0; i < card_index; ++i) { CaptureCard *other_card = &cards[i]; if (other_card->type == CardType::FFMPEG_INPUT && !is_srt_card(other_card)) { ++ffmpeg_index; } } char buf[256]; snprintf(buf, sizeof(buf), "Video input %u (%s)", ffmpeg_index, card->capture->get_description().c_str()); return buf; } bool Mixer::is_srt_card(const Mixer::CaptureCard *card) { #ifdef HAVE_SRT if (card->type == CardType::FFMPEG_INPUT) { int srt_sock = static_cast(card->capture.get())->get_srt_sock(); return srt_sock != -1; } #endif return false; } mutex RefCountedGLsync::fence_lock; nageru-2.3.0/nageru/mixer.h000066400000000000000000000515751450736322200155740ustar00rootroot00000000000000#ifndef _MIXER_H #define _MIXER_H 1 // The actual video mixer, running in its own separate background thread. #include #include #undef Success #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include "audio_mixer.h" #include "bmusb/bmusb.h" #include "defs.h" #include "ffmpeg_capture.h" #include "shared/httpd.h" #include "input_state.h" #include "libusb.h" #include "pbo_frame_allocator.h" #include "queue_length_policy.h" #include "ref_counted_frame.h" #include "shared/ref_counted_gl_sync.h" #include "srt_metrics.h" #include "theme.h" #include "shared/timebase.h" #include "video_encoder.h" #include "ycbcr_interpretation.h" class ALSAOutput; class ChromaSubsampler; class DeckLinkOutput; class MJPEGEncoder; class QSurface; class QSurfaceFormat; class TimecodeRenderer; class v210Converter; namespace movit { class Effect; class EffectChain; class ResourcePool; class YCbCrInput; } // namespace movit class Mixer { public: // The surface format is used for offscreen destinations for OpenGL contexts we need. Mixer(const QSurfaceFormat &format); ~Mixer(); void start(); void quit(); void transition_clicked(int transition_num); void channel_clicked(int preview_num); enum Output { OUTPUT_LIVE = 0, OUTPUT_PREVIEW, OUTPUT_INPUT0, // 1, 2, 3, up to 15 follow numerically. NUM_OUTPUTS = 18 }; struct DisplayFrame { // The chain for rendering this frame. To render a display frame, // first wait for , then call // to wire up all the inputs, and then finally call // chain->render_to_screen() or similar. movit::EffectChain *chain; std::function setup_chain; // Asserted when all the inputs are ready; you cannot render the chain // before this. RefCountedGLsync ready_fence; // Holds on to all the input frames needed for this display frame, // so they are not released while still rendering. std::vector input_frames; // Textures that should be released back to the resource pool // when this frame disappears, if any. // TODO: Refcount these as well? std::vector temp_textures; }; // Implicitly frees the previous one if there's a new frame available. bool get_display_frame(Output output, DisplayFrame *frame) { return output_channel[output].get_display_frame(frame); } // NOTE: Callbacks will be called with a mutex held, so you should probably // not do real work in them. typedef std::function new_frame_ready_callback_t; void add_frame_ready_callback(Output output, void *key, new_frame_ready_callback_t callback) { output_channel[output].add_frame_ready_callback(key, callback); } void remove_frame_ready_callback(Output output, void *key) { output_channel[output].remove_frame_ready_callback(key); } // TODO: Should this really be per-channel? Shouldn't it just be called for e.g. the live output? typedef std::function &)> transition_names_updated_callback_t; void set_transition_names_updated_callback(Output output, transition_names_updated_callback_t callback) { output_channel[output].set_transition_names_updated_callback(callback); } typedef std::function name_updated_callback_t; void set_name_updated_callback(Output output, name_updated_callback_t callback) { output_channel[output].set_name_updated_callback(callback); } typedef std::function color_updated_callback_t; void set_color_updated_callback(Output output, color_updated_callback_t callback) { output_channel[output].set_color_updated_callback(callback); } std::vector get_transition_names() { return theme->get_transition_names(pts()); } unsigned get_num_channels() const { return theme->get_num_channels(); } std::string get_channel_name(unsigned channel) const { return theme->get_channel_name(channel); } std::string get_channel_color(unsigned channel) const { return theme->get_channel_color(channel); } int map_channel_to_signal(unsigned channel) const { return theme->map_channel_to_signal(channel); } int map_signal_to_card(int signal) { return theme->map_signal_to_card(signal); } unsigned get_master_clock() const { return master_clock_channel; } void set_master_clock(unsigned channel) { master_clock_channel = channel; } void set_signal_mapping(int signal, int card) { return theme->set_signal_mapping(signal, card); } YCbCrInterpretation get_input_ycbcr_interpretation(unsigned card_index) const; void set_input_ycbcr_interpretation(unsigned card_index, const YCbCrInterpretation &interpretation); bool get_supports_set_wb(unsigned channel) const { return theme->get_supports_set_wb(channel); } void set_wb(unsigned channel, double r, double g, double b) const { theme->set_wb(channel, r, g, b); } std::string format_status_line(const std::string &disk_space_left_text, double file_length_seconds) { return theme->format_status_line(disk_space_left_text, file_length_seconds); } // Note: You can also get this through the global variable global_audio_mixer. AudioMixer *get_audio_mixer() { return audio_mixer.get(); } const AudioMixer *get_audio_mixer() const { return audio_mixer.get(); } void schedule_cut() { should_cut = true; } std::string get_card_description(unsigned card_index) const { assert(card_index < MAX_VIDEO_CARDS); return cards[card_index].capture->get_description(); } // The difference between this and the previous function is that if a card // is used as the current output, get_card_description() will return the // fake card that's replacing it for input, whereas this function will return // the card's actual name. std::string get_output_card_description(unsigned card_index) const { assert(card_can_be_used_as_output(card_index)); assert(card_index < MAX_VIDEO_CARDS); if (cards[card_index].parked_capture) { return cards[card_index].parked_capture->get_description(); } else { return cards[card_index].capture->get_description(); } } bool card_can_be_used_as_output(unsigned card_index) const { assert(card_index < MAX_VIDEO_CARDS); return cards[card_index].output != nullptr && cards[card_index].capture != nullptr; } bool card_is_cef(unsigned card_index) const { assert(card_index < MAX_VIDEO_CARDS); return cards[card_index].type == CardType::CEF_INPUT; } bool card_is_ffmpeg(unsigned card_index) const { assert(card_index < MAX_VIDEO_CARDS); if (cards[card_index].type != CardType::FFMPEG_INPUT) { return false; } #ifdef HAVE_SRT // SRT inputs are more like regular inputs than FFmpeg inputs, // so show them as such. (This allows the user to right-click // to select a different input.) return static_cast(cards[card_index].capture.get())->get_srt_sock() == -1; #else return true; #endif } bool card_is_active(unsigned card_index) const { assert(card_index < MAX_VIDEO_CARDS); std::lock_guard lock(card_mutex); return cards[card_index].capture != nullptr; } void force_card_active(unsigned card_index) { // handle_hotplugged_cards() will pick this up. std::lock_guard lock(card_mutex); cards[card_index].force_active = true; } std::map get_available_video_modes(unsigned card_index) const { assert(card_index < MAX_VIDEO_CARDS); return cards[card_index].capture->get_available_video_modes(); } uint32_t get_current_video_mode(unsigned card_index) const { assert(card_index < MAX_VIDEO_CARDS); return cards[card_index].capture->get_current_video_mode(); } void set_video_mode(unsigned card_index, uint32_t mode) { assert(card_index < MAX_VIDEO_CARDS); cards[card_index].capture->set_video_mode(mode); } void start_mode_scanning(unsigned card_index); std::map get_available_video_inputs(unsigned card_index) const { assert(card_index < MAX_VIDEO_CARDS); return cards[card_index].capture->get_available_video_inputs(); } uint32_t get_current_video_input(unsigned card_index) const { assert(card_index < MAX_VIDEO_CARDS); return cards[card_index].capture->get_current_video_input(); } void set_video_input(unsigned card_index, uint32_t input) { assert(card_index < MAX_VIDEO_CARDS); cards[card_index].capture->set_video_input(input); } std::map get_available_audio_inputs(unsigned card_index) const { assert(card_index < MAX_VIDEO_CARDS); return cards[card_index].capture->get_available_audio_inputs(); } uint32_t get_current_audio_input(unsigned card_index) const { assert(card_index < MAX_VIDEO_CARDS); return cards[card_index].capture->get_current_audio_input(); } void set_audio_input(unsigned card_index, uint32_t input) { assert(card_index < MAX_VIDEO_CARDS); cards[card_index].capture->set_audio_input(input); } std::string get_ffmpeg_filename(unsigned card_index) const; void set_ffmpeg_filename(unsigned card_index, const std::string &filename); void change_x264_bitrate(unsigned rate_kbit) { video_encoder->change_x264_bitrate(rate_kbit); } int get_output_card_index() const { // -1 = no output, just stream. return desired_output_card_index; } void set_output_card(int card_index) { // -1 = no output, just stream. desired_output_card_index = card_index; } bool get_output_card_is_master() const { return output_card_is_master; } std::map get_available_output_video_modes() const; uint32_t get_output_video_mode() const { return desired_output_video_mode; } void set_output_video_mode(uint32_t mode) { desired_output_video_mode = mode; } void set_display_timecode_in_stream(bool enable) { display_timecode_in_stream = enable; } void set_display_timecode_on_stdout(bool enable) { display_timecode_on_stdout = enable; } int64_t get_num_connected_clients() const { return httpd.get_num_connected_clients(); } Theme::MenuEntry *get_theme_menu() { return theme->get_theme_menu(); } void theme_menu_entry_clicked(int lua_ref) { return theme->theme_menu_entry_clicked(lua_ref); } void set_theme_menu_callback(std::function callback) { theme->set_theme_menu_callback(callback); } void wait_for_next_frame(); private: struct CaptureCard; void configure_card(unsigned card_index, bmusb::CaptureInterface *capture, CardType card_type, DeckLinkOutput *output, bool is_srt_card); void set_output_card_internal(int card_index); // Should only be called from the mixer thread. void bm_frame(unsigned card_index, uint16_t timecode, bmusb::FrameAllocator::Frame video_frame, size_t video_offset, bmusb::VideoFormat video_format, bmusb::FrameAllocator::Frame audio_frame, size_t audio_offset, bmusb::AudioFormat audio_format); void upload_texture_for_frame( int field, bmusb::VideoFormat video_format, size_t y_offset, size_t cbcr_offset, size_t video_offset, PBOFrameAllocator::Userdata *userdata); void bm_hotplug_add(libusb_device *dev); void bm_hotplug_remove(unsigned card_index); void place_rectangle(movit::Effect *resample_effect, movit::Effect *padding_effect, float x0, float y0, float x1, float y1); void thread_func(); void handle_hotplugged_cards(); void schedule_audio_resampling_tasks(unsigned dropped_frames, int num_samples_per_frame, int length_per_frame, bool is_preroll, std::chrono::steady_clock::time_point frame_timestamp); std::string get_timecode_text() const; void render_one_frame(int64_t duration); void audio_thread_func(); void release_display_frame(DisplayFrame *frame); #ifdef HAVE_SRT void start_srt(); #endif double pts() { return double(pts_int) / TIMEBASE; } void trim_queue(CaptureCard *card, size_t safe_queue_length); std::pair get_channels_json(); std::pair get_channel_color_http(unsigned channel_idx); HTTPD httpd; unsigned num_video_inputs, num_html_inputs = 0; QSurface *mixer_surface, *h264_encoder_surface, *decklink_output_surface, *image_update_surface; std::unique_ptr resource_pool; std::unique_ptr theme; std::atomic audio_source_channel{0}; std::atomic master_clock_channel{0}; // Gets overridden by if output_card_is_master == true. int output_card_index = -1; // -1 for none. uint32_t output_video_mode = -1; bool output_card_is_master = false; // Only relevant if output_card_index != -1. // The mechanics of changing the output card and modes are so intricately connected // with the work the mixer thread is doing. Thus, we don't change it directly, // we just set this variable instead, which signals to the mixer thread that // it should do the change before the next frame. This simplifies locking // considerations immensely. std::atomic desired_output_card_index{-1}; std::atomic desired_output_video_mode{0}; std::unique_ptr display_chain; std::unique_ptr chroma_subsampler; std::unique_ptr v210_converter; std::unique_ptr video_encoder; std::unique_ptr mjpeg_encoder; std::unique_ptr timecode_renderer; std::atomic display_timecode_in_stream{false}; std::atomic display_timecode_on_stdout{false}; // Effects part of . Owned by . movit::YCbCrInput *display_input; int64_t pts_int = 0; // In TIMEBASE units. mutable std::mutex frame_num_mutex; std::condition_variable frame_num_updated; unsigned frame_num = 0; // Under . // Accumulated errors in number of 1/TIMEBASE audio samples. If OUTPUT_FREQUENCY divided by // frame rate is integer, will always stay zero. unsigned fractional_samples = 0; // Monotonic counter that lets us know which slot was last turned into // a fake capture. Used for SRT re-plugging. unsigned fake_capture_counter = 0; mutable std::mutex card_mutex; bool has_bmusb_thread = false; struct CaptureCard { // If nullptr, the card is inactive, and will be hidden in the UI. // Only fake capture cards can be inactive. std::unique_ptr capture; // If true, card must always be active (typically because it's one of the // first cards, or because the theme has explicitly asked for it). bool force_active = false; bool is_fake_capture; // If is_fake_capture is true, contains a monotonic timer value for when // it was last changed. Otherwise undefined. Used for SRT re-plugging. int fake_capture_counter; std::string last_srt_stream_id = ""; // Used for SRT re-plugging. CardType type; std::unique_ptr output; // CEF only delivers frames when it actually has a change. // If we trim the queue for latency reasons, we could thus // end up in a situation trimming a frame that was meant to // be displayed for a long time, which is really suboptimal. // Thus, if we drop the last frame we have, may_have_dropped_last_frame // is set to true, and the next starvation event will trigger // us requestin a CEF repaint. bool is_cef_capture, may_have_dropped_last_frame = false; // If this card is used for output (ie., output_card_index points to it), // it cannot simultaneously be uesd for capture, so gets replaced // by a FakeCapture. However, since reconstructing the real capture object // with all its state can be annoying, it is not being deleted, just stopped // and moved here. std::unique_ptr parked_capture; std::unique_ptr frame_allocator; // Stuff for the OpenGL context (for texture uploading). QSurface *surface = nullptr; struct NewFrame { RefCountedFrame frame; int64_t length; // In TIMEBASE units. bool interlaced; unsigned field; // Which field (0 or 1) of the frame to use. Always 0 for progressive. bool texture_uploaded = false; unsigned dropped_frames = 0; // Number of dropped frames before this one. std::chrono::steady_clock::time_point received_timestamp = std::chrono::steady_clock::time_point::min(); movit::RGBTriplet neutral_color{1.0f, 1.0f, 1.0f}; // Used for MJPEG encoding, and texture upload. // width=0 or height=0 means a broken frame, ie., do not upload. bmusb::VideoFormat video_format; size_t video_offset, y_offset, cbcr_offset; }; std::deque new_frames; std::condition_variable new_frames_changed; // Set whenever new_frames is changed. QueueLengthPolicy queue_length_policy; // Refers to the "new_frames" queue. std::vector new_raw_audio; int last_timecode = -1; // Unwrapped. JitterHistory jitter_history; // Metrics. std::vector> labels; std::atomic metric_input_received_frames{0}; std::atomic metric_input_duped_frames{0}; std::atomic metric_input_dropped_frames_jitter{0}; std::atomic metric_input_dropped_frames_error{0}; std::atomic metric_input_resets{0}; std::atomic metric_input_queue_length_frames{0}; std::atomic metric_input_has_signal_bool{-1}; std::atomic metric_input_is_connected_bool{-1}; std::atomic metric_input_interlaced_bool{-1}; std::atomic metric_input_width_pixels{-1}; std::atomic metric_input_height_pixels{-1}; std::atomic metric_input_frame_rate_nom{-1}; std::atomic metric_input_frame_rate_den{-1}; std::atomic metric_input_sample_rate_hz{-1}; #ifdef HAVE_SRT SRTMetrics srt_metrics; #endif }; JitterHistory output_jitter_history; CaptureCard cards[MAX_VIDEO_CARDS]; // Protected by . YCbCrInterpretation ycbcr_interpretation[MAX_VIDEO_CARDS]; // Protected by . movit::RGBTriplet last_received_neutral_color[MAX_VIDEO_CARDS]; // Used by the mixer thread only. Constructor-initialiezd. std::unique_ptr audio_mixer; // Same as global_audio_mixer (see audio_mixer.h). bool input_card_is_master_clock(unsigned card_index, unsigned master_card_index) const; struct OutputFrameInfo { int dropped_frames; // Since last frame. int num_samples; // Audio samples needed for this output frame. int64_t frame_duration; // In TIMEBASE units. bool is_preroll; std::chrono::steady_clock::time_point frame_timestamp; }; OutputFrameInfo get_one_frame_from_each_card(unsigned master_card_index, bool master_card_is_output, CaptureCard::NewFrame new_frames[MAX_VIDEO_CARDS], bool has_new_frame[MAX_VIDEO_CARDS], std::vector raw_audio[MAX_VIDEO_CARDS]); std::string description_for_card(unsigned card_index); static bool is_srt_card(const CaptureCard *card); InputState input_state; // Cards we have been noticed about being hotplugged, but haven't tried adding yet. // Protected by its own mutex. std::mutex hotplug_mutex; std::vector hotplugged_cards; #ifdef HAVE_SRT std::vector hotplugged_srt_cards; #endif class OutputChannel { public: ~OutputChannel(); void output_frame(DisplayFrame &&frame); bool get_display_frame(DisplayFrame *frame); void add_frame_ready_callback(void *key, new_frame_ready_callback_t callback); void remove_frame_ready_callback(void *key); void set_transition_names_updated_callback(transition_names_updated_callback_t callback); void set_name_updated_callback(name_updated_callback_t callback); void set_color_updated_callback(color_updated_callback_t callback); private: friend class Mixer; unsigned channel; Mixer *parent = nullptr; // Not owned. std::mutex frame_mutex; DisplayFrame current_frame, ready_frame; // protected by bool has_current_frame = false, has_ready_frame = false; // protected by std::map new_frame_ready_callbacks; // protected by transition_names_updated_callback_t transition_names_updated_callback; name_updated_callback_t name_updated_callback; color_updated_callback_t color_updated_callback; std::vector last_transition_names; std::string last_name, last_color; }; OutputChannel output_channel[NUM_OUTPUTS]; std::thread mixer_thread; std::thread audio_thread; #ifdef HAVE_SRT std::thread srt_thread; #endif std::atomic should_quit{false}; std::atomic should_cut{false}; std::unique_ptr alsa; struct AudioTask { int64_t pts_int; int num_samples; bool adjust_rate; std::chrono::steady_clock::time_point frame_timestamp; }; std::mutex audio_mutex; std::condition_variable audio_task_queue_changed; std::queue audio_task_queue; // Under audio_mutex. // For mode scanning. bool is_mode_scanning[MAX_VIDEO_CARDS]{ false }; std::vector mode_scanlist[MAX_VIDEO_CARDS]; unsigned mode_scanlist_index[MAX_VIDEO_CARDS]{ 0 }; std::chrono::steady_clock::time_point last_mode_scan_change[MAX_VIDEO_CARDS]; }; extern Mixer *global_mixer; #endif // !defined(_MIXER_H) nageru-2.3.0/nageru/mjpeg_encoder.cpp000066400000000000000000001117771450736322200176050ustar00rootroot00000000000000#include "mjpeg_encoder.h" #include #include #include #if __SSE2__ #include #endif #include extern "C" { #include #include } #include "defs.h" #include "shared/ffmpeg_raii.h" #include "flags.h" #include "shared/httpd.h" #include "shared/memcpy_interleaved.h" #include "shared/metrics.h" #include "pbo_frame_allocator.h" #include "shared/timebase.h" #include "shared/va_display.h" #include #include #include #include using namespace Eigen; using namespace bmusb; using namespace movit; using namespace std; static VAImageFormat uyvy_format, nv12_format; extern void memcpy_with_pitch(uint8_t *dst, const uint8_t *src, size_t src_width, size_t dst_pitch, size_t height); // The inverse of memcpy_interleaved(), with (slow) support for pitch. void interleave_with_pitch(uint8_t *dst, const uint8_t *src1, const uint8_t *src2, size_t src_width, size_t dst_pitch, size_t height) { #if __SSE2__ if (dst_pitch == src_width * 2 && (src_width * height) % 16 == 0) { __m128i *dptr = reinterpret_cast<__m128i *>(dst); const __m128i *sptr1 = reinterpret_cast(src1); const __m128i *sptr2 = reinterpret_cast(src2); for (size_t i = 0; i < src_width * height / 16; ++i) { __m128i data1 = _mm_loadu_si128(sptr1++); __m128i data2 = _mm_loadu_si128(sptr2++); _mm_storeu_si128(dptr++, _mm_unpacklo_epi8(data1, data2)); _mm_storeu_si128(dptr++, _mm_unpackhi_epi8(data1, data2)); } return; } #endif for (size_t y = 0; y < height; ++y) { uint8_t *dptr = dst + y * dst_pitch; const uint8_t *sptr1 = src1 + y * src_width; const uint8_t *sptr2 = src2 + y * src_width; for (size_t x = 0; x < src_width; ++x) { *dptr++ = *sptr1++; *dptr++ = *sptr2++; } } } // From libjpeg (although it's of course identical between implementations). static const int jpeg_natural_order[DCTSIZE2] = { 0, 1, 8, 16, 9, 2, 3, 10, 17, 24, 32, 25, 18, 11, 4, 5, 12, 19, 26, 33, 40, 48, 41, 34, 27, 20, 13, 6, 7, 14, 21, 28, 35, 42, 49, 56, 57, 50, 43, 36, 29, 22, 15, 23, 30, 37, 44, 51, 58, 59, 52, 45, 38, 31, 39, 46, 53, 60, 61, 54, 47, 55, 62, 63, }; struct VectorDestinationManager { jpeg_destination_mgr pub; std::vector dest; VectorDestinationManager() { pub.init_destination = init_destination_thunk; pub.empty_output_buffer = empty_output_buffer_thunk; pub.term_destination = term_destination_thunk; } static void init_destination_thunk(j_compress_ptr ptr) { ((VectorDestinationManager *)(ptr->dest))->init_destination(); } inline void init_destination() { make_room(0); } static boolean empty_output_buffer_thunk(j_compress_ptr ptr) { return ((VectorDestinationManager *)(ptr->dest))->empty_output_buffer(); } inline bool empty_output_buffer() { make_room(dest.size()); // Should ignore pub.free_in_buffer! return true; } inline void make_room(size_t bytes_used) { dest.resize(bytes_used + 4096); dest.resize(dest.capacity()); pub.next_output_byte = dest.data() + bytes_used; pub.free_in_buffer = dest.size() - bytes_used; } static void term_destination_thunk(j_compress_ptr ptr) { ((VectorDestinationManager *)(ptr->dest))->term_destination(); } inline void term_destination() { dest.resize(dest.size() - pub.free_in_buffer); } }; static_assert(std::is_standard_layout::value, ""); int MJPEGEncoder::write_packet2_thunk(void *opaque, uint8_t *buf, int buf_size, AVIODataMarkerType type, int64_t time) { WritePacket2Context *ctx = (WritePacket2Context *)opaque; return ctx->mjpeg_encoder->write_packet2(ctx->stream_id, buf, buf_size, type, time); } int MJPEGEncoder::write_packet2(HTTPD::StreamID stream_id, uint8_t *buf, int buf_size, AVIODataMarkerType type, int64_t time) { string *mux_header = &streams[stream_id].mux_header; if (type == AVIO_DATA_MARKER_HEADER) { mux_header->append((char *)buf, buf_size); httpd->set_header(stream_id, *mux_header); } else { httpd->add_data(stream_id, (char *)buf, buf_size, /*keyframe=*/true, AV_NOPTS_VALUE, AVRational{ AV_TIME_BASE, 1 }); } return buf_size; } namespace { void add_video_stream(AVFormatContext *avctx) { AVStream *stream = avformat_new_stream(avctx, nullptr); if (stream == nullptr) { fprintf(stderr, "avformat_new_stream() failed\n"); abort(); } // FFmpeg is very picky about having audio at 1/48000 timebase, // no matter what we write. Even though we'd prefer our usual 1/120000, // put the video on the same one, so that we can have locked audio. stream->time_base = AVRational{ 1, OUTPUT_FREQUENCY }; stream->codecpar->codec_type = AVMEDIA_TYPE_VIDEO; stream->codecpar->codec_id = AV_CODEC_ID_MJPEG; // Used for aspect ratio only. Can change without notice (the mux won't care). stream->codecpar->width = global_flags.width; stream->codecpar->height = global_flags.height; // TODO: We could perhaps use the interpretation for each card here // (or at least the command-line flags) instead of the defaults, // but what would we do when they change? stream->codecpar->color_primaries = AVCOL_PRI_BT709; stream->codecpar->color_trc = AVCOL_TRC_IEC61966_2_1; stream->codecpar->color_space = AVCOL_SPC_BT709; stream->codecpar->color_range = AVCOL_RANGE_MPEG; stream->codecpar->chroma_location = AVCHROMA_LOC_LEFT; stream->codecpar->field_order = AV_FIELD_PROGRESSIVE; } void add_audio_stream(AVFormatContext *avctx) { AVStream *stream = avformat_new_stream(avctx, nullptr); if (stream == nullptr) { fprintf(stderr, "avformat_new_stream() failed\n"); abort(); } stream->time_base = AVRational{ 1, OUTPUT_FREQUENCY }; stream->codecpar->codec_type = AVMEDIA_TYPE_AUDIO; stream->codecpar->codec_id = AV_CODEC_ID_PCM_S32LE; stream->codecpar->ch_layout.order = AV_CHANNEL_ORDER_NATIVE; stream->codecpar->ch_layout.nb_channels = 2; stream->codecpar->ch_layout.u.mask = AV_CH_LAYOUT_STEREO; stream->codecpar->sample_rate = OUTPUT_FREQUENCY; } void finalize_mux(AVFormatContext *avctx) { AVDictionary *options = NULL; vector> opts = MUX_OPTS; for (pair opt : opts) { av_dict_set(&options, opt.first.c_str(), opt.second.c_str(), 0); } if (avformat_write_header(avctx, &options) < 0) { fprintf(stderr, "avformat_write_header() failed\n"); abort(); } } } // namespace MJPEGEncoder::MJPEGEncoder(HTTPD *httpd, const string &va_display) : httpd(httpd) { create_ffmpeg_context(HTTPD::StreamID{ HTTPD::MULTICAM_STREAM, 0 }); for (unsigned stream_idx = 0; stream_idx < MAX_VIDEO_CARDS; ++stream_idx) { create_ffmpeg_context(HTTPD::StreamID{ HTTPD::SIPHON_STREAM, stream_idx }); } add_stream(HTTPD::StreamID{ HTTPD::MULTICAM_STREAM, 0 }); // Initialize VA-API. VAConfigID config_id_422, config_id_420; string error; va_dpy = try_open_va(va_display, { VAProfileJPEGBaseline }, VAEntrypointEncPicture, { { "4:2:2", VA_RT_FORMAT_YUV422, VA_FOURCC_UYVY, &config_id_422, &uyvy_format }, // We'd prefer VA_FOURCC_I420, but it's not supported by Intel's driver. { "4:2:0", VA_RT_FORMAT_YUV420, VA_FOURCC_NV12, &config_id_420, &nv12_format } }, /*chosen_profile=*/nullptr, &error); if (va_dpy == nullptr) { fprintf(stderr, "Could not initialize VA-API for MJPEG encoding: %s. JPEGs will be encoded in software if needed.\n", error.c_str()); } encoder_thread = thread(&MJPEGEncoder::encoder_thread_func, this); if (va_dpy != nullptr) { va_pool.reset(new VAResourcePool(va_dpy->va_dpy, uyvy_format, nv12_format, config_id_422, config_id_420, /*with_data_buffer=*/true)); va_receiver_thread = thread(&MJPEGEncoder::va_receiver_thread_func, this); } global_metrics.add("mjpeg_frames", {{ "status", "dropped" }, { "reason", "zero_size" }}, &metric_mjpeg_frames_zero_size_dropped); global_metrics.add("mjpeg_frames", {{ "status", "dropped" }, { "reason", "interlaced" }}, &metric_mjpeg_frames_interlaced_dropped); global_metrics.add("mjpeg_frames", {{ "status", "dropped" }, { "reason", "unsupported_pixel_format" }}, &metric_mjpeg_frames_unsupported_pixel_format_dropped); global_metrics.add("mjpeg_frames", {{ "status", "dropped" }, { "reason", "oversized" }}, &metric_mjpeg_frames_oversized_dropped); global_metrics.add("mjpeg_frames", {{ "status", "dropped" }, { "reason", "overrun" }}, &metric_mjpeg_overrun_dropped); global_metrics.add("mjpeg_frames", {{ "status", "submitted" }}, &metric_mjpeg_overrun_submitted); running = true; } MJPEGEncoder::~MJPEGEncoder() { for (auto &id_and_stream : streams) { av_free(id_and_stream.second.avctx->pb->buffer); } global_metrics.remove("mjpeg_frames", {{ "status", "dropped" }, { "reason", "zero_size" }}); global_metrics.remove("mjpeg_frames", {{ "status", "dropped" }, { "reason", "interlaced" }}); global_metrics.remove("mjpeg_frames", {{ "status", "dropped" }, { "reason", "unsupported_pixel_format" }}); global_metrics.remove("mjpeg_frames", {{ "status", "dropped" }, { "reason", "oversized" }}); global_metrics.remove("mjpeg_frames", {{ "status", "dropped" }, { "reason", "overrun" }}); global_metrics.remove("mjpeg_frames", {{ "status", "submitted" }}); } void MJPEGEncoder::stop() { if (!running) { return; } running = false; should_quit = true; any_frames_to_be_encoded.notify_all(); any_frames_encoding.notify_all(); encoder_thread.join(); if (va_dpy != nullptr) { va_receiver_thread.join(); } } namespace { bool is_uyvy(RefCountedFrame frame) { PBOFrameAllocator::Userdata *userdata = (PBOFrameAllocator::Userdata *)frame->userdata; return userdata->pixel_format == PixelFormat_8BitYCbCr && frame->interleaved; } bool is_i420(RefCountedFrame frame) { PBOFrameAllocator::Userdata *userdata = (PBOFrameAllocator::Userdata *)frame->userdata; return userdata->pixel_format == PixelFormat_8BitYCbCrPlanar && userdata->ycbcr_format.chroma_subsampling_x == 2 && userdata->ycbcr_format.chroma_subsampling_y == 2; } } // namespace void MJPEGEncoder::upload_frame(int64_t pts, unsigned card_index, RefCountedFrame frame, const bmusb::VideoFormat &video_format, size_t y_offset, size_t cbcr_offset, vector audio, const RGBTriplet &white_balance) { if (video_format.width == 0 || video_format.height == 0) { ++metric_mjpeg_frames_zero_size_dropped; return; } if (video_format.interlaced) { fprintf(stderr, "Card %u: Ignoring JPEG encoding for interlaced frame\n", card_index); ++metric_mjpeg_frames_interlaced_dropped; return; } if (!is_uyvy(frame) && !is_i420(frame)) { fprintf(stderr, "Card %u: Ignoring JPEG encoding for unsupported pixel format\n", card_index); ++metric_mjpeg_frames_unsupported_pixel_format_dropped; return; } if (video_format.width > 4096 || video_format.height > 4096) { fprintf(stderr, "Card %u: Ignoring JPEG encoding for oversized frame\n", card_index); ++metric_mjpeg_frames_oversized_dropped; return; } lock_guard lock(mu); if (frames_to_be_encoded.size() + frames_encoding.size() > 50) { fprintf(stderr, "WARNING: MJPEG encoding doesn't keep up, discarding frame.\n"); ++metric_mjpeg_overrun_dropped; return; } ++metric_mjpeg_overrun_submitted; frames_to_be_encoded.push(QueuedFrame{ pts, card_index, frame, video_format, y_offset, cbcr_offset, move(audio), white_balance }); any_frames_to_be_encoded.notify_all(); } bool MJPEGEncoder::should_encode_mjpeg_for_card(unsigned card_index) { // Only bother doing MJPEG encoding if there are any connected clients // that want the stream. if (httpd->get_num_connected_multicam_clients() == 0 && httpd->get_num_connected_siphon_clients(card_index) == 0) { return false; } auto it = global_flags.card_to_mjpeg_stream_export.find(card_index); return (it != global_flags.card_to_mjpeg_stream_export.end()); } void MJPEGEncoder::encoder_thread_func() { pthread_setname_np(pthread_self(), "MJPEG_Encode"); posix_memalign((void **)&tmp_y, 4096, 4096 * 8); posix_memalign((void **)&tmp_cbcr, 4096, 4096 * 8); posix_memalign((void **)&tmp_cb, 4096, 4096 * 8); posix_memalign((void **)&tmp_cr, 4096, 4096 * 8); for (;;) { QueuedFrame qf; { unique_lock lock(mu); any_frames_to_be_encoded.wait(lock, [this] { return !frames_to_be_encoded.empty() || should_quit; }); if (should_quit) break; qf = move(frames_to_be_encoded.front()); frames_to_be_encoded.pop(); } assert(global_flags.card_to_mjpeg_stream_export.count(qf.card_index)); // Or should_encode_mjpeg_for_card() would have returned false. int stream_index = global_flags.card_to_mjpeg_stream_export[qf.card_index]; if (va_dpy != nullptr) { // Will call back in the receiver thread. encode_jpeg_va(move(qf)); } else { update_siphon_streams(); HTTPD::StreamID multicam_id{ HTTPD::MULTICAM_STREAM, 0 }; HTTPD::StreamID siphon_id{ HTTPD::SIPHON_STREAM, qf.card_index }; assert(streams.count(multicam_id)); // Write audio before video, since Futatabi expects it. if (qf.audio.size() > 0) { write_audio_packet(streams[multicam_id].avctx.get(), qf.pts, stream_index + global_flags.card_to_mjpeg_stream_export.size(), qf.audio); if (streams.count(siphon_id)) { write_audio_packet(streams[siphon_id].avctx.get(), qf.pts, /*stream_index=*/1, qf.audio); } } // Encode synchronously, in the same thread. vector jpeg = encode_jpeg_libjpeg(qf); write_mjpeg_packet(streams[multicam_id].avctx.get(), qf.pts, stream_index, jpeg.data(), jpeg.size()); if (streams.count(siphon_id)) { write_mjpeg_packet(streams[siphon_id].avctx.get(), qf.pts, /*stream_index=*/0, jpeg.data(), jpeg.size()); } } } free(tmp_y); free(tmp_cbcr); free(tmp_cb); free(tmp_cr); } void MJPEGEncoder::write_mjpeg_packet(AVFormatContext *avctx, int64_t pts, unsigned stream_index, const uint8_t *jpeg, size_t jpeg_size) { AVPacket pkt; memset(&pkt, 0, sizeof(pkt)); pkt.buf = nullptr; pkt.data = const_cast(jpeg); pkt.size = jpeg_size; pkt.stream_index = stream_index; pkt.flags = AV_PKT_FLAG_KEY; AVRational time_base = avctx->streams[pkt.stream_index]->time_base; pkt.pts = pkt.dts = av_rescale_q(pts, AVRational{ 1, TIMEBASE }, time_base); pkt.duration = 0; if (av_write_frame(avctx, &pkt) < 0) { fprintf(stderr, "av_write_frame() failed\n"); abort(); } } void MJPEGEncoder::write_audio_packet(AVFormatContext *avctx, int64_t pts, unsigned stream_index, const vector &audio) { AVPacket pkt; memset(&pkt, 0, sizeof(pkt)); pkt.buf = nullptr; pkt.data = reinterpret_cast(const_cast(&audio[0])); pkt.size = audio.size() * sizeof(audio[0]); pkt.stream_index = stream_index; pkt.flags = AV_PKT_FLAG_KEY; AVRational time_base = avctx->streams[pkt.stream_index]->time_base; pkt.pts = pkt.dts = av_rescale_q(pts, AVRational{ 1, TIMEBASE }, time_base); size_t num_stereo_samples = audio.size() / 2; pkt.duration = av_rescale_q(num_stereo_samples, AVRational{ 1, OUTPUT_FREQUENCY }, time_base); if (av_write_frame(avctx, &pkt) < 0) { fprintf(stderr, "av_write_frame() failed\n"); abort(); } } class VABufferDestroyer { public: VABufferDestroyer(VADisplay dpy, VABufferID buf) : dpy(dpy), buf(buf) {} ~VABufferDestroyer() { VAStatus va_status = vaDestroyBuffer(dpy, buf); CHECK_VASTATUS(va_status, "vaDestroyBuffer"); } private: VADisplay dpy; VABufferID buf; }; namespace { void push16(uint16_t val, string *str) { str->push_back(val >> 8); str->push_back(val & 0xff); } void push32(uint32_t val, string *str) { str->push_back(val >> 24); str->push_back((val >> 16) & 0xff); str->push_back((val >> 8) & 0xff); str->push_back(val & 0xff); } } // namespace void MJPEGEncoder::init_jpeg(unsigned width, unsigned height, const RGBTriplet &white_balance, VectorDestinationManager *dest, jpeg_compress_struct *cinfo, int y_h_samp_factor, int y_v_samp_factor) { jpeg_error_mgr jerr; cinfo->err = jpeg_std_error(&jerr); jpeg_create_compress(cinfo); cinfo->dest = (jpeg_destination_mgr *)dest; cinfo->input_components = 3; jpeg_set_defaults(cinfo); jpeg_set_quality(cinfo, quality, /*force_baseline=*/false); cinfo->image_width = width; cinfo->image_height = height; cinfo->raw_data_in = true; jpeg_set_colorspace(cinfo, JCS_YCbCr); cinfo->comp_info[0].h_samp_factor = y_h_samp_factor; cinfo->comp_info[0].v_samp_factor = y_v_samp_factor; cinfo->comp_info[1].h_samp_factor = 1; cinfo->comp_info[1].v_samp_factor = 1; cinfo->comp_info[2].h_samp_factor = 1; cinfo->comp_info[2].v_samp_factor = 1; cinfo->CCIR601_sampling = true; // Seems to be mostly ignored by libjpeg, though. jpeg_start_compress(cinfo, true); if (fabs(white_balance.r - 1.0f) > 1e-3 || fabs(white_balance.g - 1.0f) > 1e-3 || fabs(white_balance.b - 1.0f) > 1e-3) { // Convert from (linear) RGB to XYZ. Matrix3d rgb_to_xyz_matrix = movit::ColorspaceConversionEffect::get_xyz_matrix(COLORSPACE_sRGB); Vector3d xyz = rgb_to_xyz_matrix * Vector3d(white_balance.r, white_balance.g, white_balance.b); // Convert from XYZ to xyz by normalizing. xyz /= (xyz[0] + xyz[1] + xyz[2]); // Create a very rudimentary EXIF header to hold our white point. string exif; // Exif header, followed by some padding. exif = "Exif"; push16(0, &exif); // TIFF header first: exif += "MM"; // Big endian. // Magic number. push16(42, &exif); // Offset of first IFD (relative to the MM, immediately after the header). push32(exif.size() - 6 + 4, &exif); // Now the actual IFD. // One entry. push16(1, &exif); // WhitePoint tag ID. push16(0x13e, &exif); // Rational type. push16(5, &exif); // Two values (x and y; z is implicit due to normalization). push32(2, &exif); // Offset (relative to the MM, immediately after the last IFD). push32(exif.size() - 6 + 8, &exif); // No more IFDs. push32(0, &exif); // The actual values. push32(lrintf(xyz[0] * 10000.0f), &exif); push32(10000, &exif); push32(lrintf(xyz[1] * 10000.0f), &exif); push32(10000, &exif); jpeg_write_marker(cinfo, JPEG_APP0 + 1, (const JOCTET *)exif.data(), exif.size()); } // This comment marker is private to FFmpeg. It signals limited Y'CbCr range // (and nothing else). jpeg_write_marker(cinfo, JPEG_COM, (const JOCTET *)"CS=ITU601", strlen("CS=ITU601")); } vector MJPEGEncoder::get_jpeg_header(unsigned width, unsigned height, const RGBTriplet &white_balance, int y_h_samp_factor, int y_v_samp_factor, jpeg_compress_struct *cinfo) { VectorDestinationManager dest; init_jpeg(width, height, white_balance, &dest, cinfo, y_h_samp_factor, y_v_samp_factor); // Make a dummy black image; there's seemingly no other easy way of // making libjpeg outputting all of its headers. assert(y_v_samp_factor <= 2); // Or we'd need larger JSAMPROW arrays below. size_t block_height_y = 8 * y_v_samp_factor; size_t block_height_cbcr = 8; JSAMPROW yptr[16], cbptr[16], crptr[16]; JSAMPARRAY data[3] = { yptr, cbptr, crptr }; memset(tmp_y, 0, 4096); memset(tmp_cb, 0, 4096); memset(tmp_cr, 0, 4096); for (unsigned yy = 0; yy < block_height_y; ++yy) { yptr[yy] = tmp_y; } for (unsigned yy = 0; yy < block_height_cbcr; ++yy) { cbptr[yy] = tmp_cb; crptr[yy] = tmp_cr; } for (unsigned y = 0; y < height; y += block_height_y) { jpeg_write_raw_data(cinfo, data, block_height_y); } jpeg_finish_compress(cinfo); // We're only interested in the header, not the data after it. dest.term_destination(); for (size_t i = 0; i < dest.dest.size() - 1; ++i) { if (dest.dest[i] == 0xff && dest.dest[i + 1] == 0xda) { // Start of scan (SOS). unsigned len = dest.dest[i + 2] * 256 + dest.dest[i + 3]; dest.dest.resize(i + len + 2); break; } } return dest.dest; } MJPEGEncoder::VAData MJPEGEncoder::get_va_data_for_parameters(unsigned width, unsigned height, unsigned y_h_samp_factor, unsigned y_v_samp_factor, const RGBTriplet &white_balance) { VAKey key{width, height, y_h_samp_factor, y_v_samp_factor, white_balance}; if (va_data_for_parameters.count(key)) { return va_data_for_parameters[key]; } // Use libjpeg to generate a header and set sane defaults for e.g. // quantization tables. Then do the actual encode with VA-API. jpeg_compress_struct cinfo; vector jpeg_header = get_jpeg_header(width, height, white_balance, y_h_samp_factor, y_v_samp_factor, &cinfo); // Picture parameters. VAEncPictureParameterBufferJPEG pic_param; memset(&pic_param, 0, sizeof(pic_param)); pic_param.reconstructed_picture = VA_INVALID_ID; pic_param.picture_width = cinfo.image_width; pic_param.picture_height = cinfo.image_height; for (int component_idx = 0; component_idx < cinfo.num_components; ++component_idx) { const jpeg_component_info *comp = &cinfo.comp_info[component_idx]; pic_param.component_id[component_idx] = comp->component_id; pic_param.quantiser_table_selector[component_idx] = comp->quant_tbl_no; } pic_param.num_components = cinfo.num_components; pic_param.num_scan = 1; pic_param.sample_bit_depth = 8; pic_param.coded_buf = VA_INVALID_ID; // To be filled out by caller. pic_param.pic_flags.bits.huffman = 1; pic_param.quality = 50; // Don't scale the given quantization matrices. (See gen8_mfc_jpeg_fqm_state) // Quantization matrices. VAQMatrixBufferJPEG q; memset(&q, 0, sizeof(q)); q.load_lum_quantiser_matrix = true; q.load_chroma_quantiser_matrix = true; for (int quant_tbl_idx = 0; quant_tbl_idx < min(4, NUM_QUANT_TBLS); ++quant_tbl_idx) { const JQUANT_TBL *qtbl = cinfo.quant_tbl_ptrs[quant_tbl_idx]; assert((qtbl == nullptr) == (quant_tbl_idx >= 2)); if (qtbl == nullptr) continue; uint8_t *qmatrix = (quant_tbl_idx == 0) ? q.lum_quantiser_matrix : q.chroma_quantiser_matrix; for (int i = 0; i < 64; ++i) { if (qtbl->quantval[i] > 255) { fprintf(stderr, "Baseline JPEG only!\n"); abort(); } qmatrix[i] = qtbl->quantval[jpeg_natural_order[i]]; } } // Huffman tables (arithmetic is not supported). VAHuffmanTableBufferJPEGBaseline huff; memset(&huff, 0, sizeof(huff)); for (int huff_tbl_idx = 0; huff_tbl_idx < min(2, NUM_HUFF_TBLS); ++huff_tbl_idx) { const JHUFF_TBL *ac_hufftbl = cinfo.ac_huff_tbl_ptrs[huff_tbl_idx]; const JHUFF_TBL *dc_hufftbl = cinfo.dc_huff_tbl_ptrs[huff_tbl_idx]; if (ac_hufftbl == nullptr) { assert(dc_hufftbl == nullptr); huff.load_huffman_table[huff_tbl_idx] = 0; } else { assert(dc_hufftbl != nullptr); huff.load_huffman_table[huff_tbl_idx] = 1; for (int i = 0; i < 16; ++i) { huff.huffman_table[huff_tbl_idx].num_dc_codes[i] = dc_hufftbl->bits[i + 1]; } for (int i = 0; i < 12; ++i) { huff.huffman_table[huff_tbl_idx].dc_values[i] = dc_hufftbl->huffval[i]; } for (int i = 0; i < 16; ++i) { huff.huffman_table[huff_tbl_idx].num_ac_codes[i] = ac_hufftbl->bits[i + 1]; } for (int i = 0; i < 162; ++i) { huff.huffman_table[huff_tbl_idx].ac_values[i] = ac_hufftbl->huffval[i]; } } } // Slice parameters (metadata about the slice). VAEncSliceParameterBufferJPEG parms; memset(&parms, 0, sizeof(parms)); for (int component_idx = 0; component_idx < cinfo.num_components; ++component_idx) { const jpeg_component_info *comp = &cinfo.comp_info[component_idx]; parms.components[component_idx].component_selector = comp->component_id; parms.components[component_idx].dc_table_selector = comp->dc_tbl_no; parms.components[component_idx].ac_table_selector = comp->ac_tbl_no; if (parms.components[component_idx].dc_table_selector > 1 || parms.components[component_idx].ac_table_selector > 1) { fprintf(stderr, "Uses too many Huffman tables\n"); abort(); } } parms.num_components = cinfo.num_components; parms.restart_interval = cinfo.restart_interval; jpeg_destroy_compress(&cinfo); VAData ret; ret.jpeg_header = move(jpeg_header); ret.pic_param = pic_param; ret.q = q; ret.huff = huff; ret.parms = parms; va_data_for_parameters[key] = ret; return ret; } void MJPEGEncoder::encode_jpeg_va(QueuedFrame &&qf) { PBOFrameAllocator::Userdata *userdata = (PBOFrameAllocator::Userdata *)qf.frame->userdata; unsigned width = qf.video_format.width; unsigned height = qf.video_format.height; VAResourcePool::VAResources resources; ReleaseVAResources release; if (userdata->data_copy_current_src == PBOFrameAllocator::Userdata::FROM_VA_API) { assert(is_uyvy(qf.frame)); resources = move(userdata->va_resources); release = move(userdata->va_resources_release); } else { assert(userdata->data_copy_current_src == PBOFrameAllocator::Userdata::FROM_MALLOC); if (is_uyvy(qf.frame)) { resources = va_pool->get_va_resources(width, height, VA_FOURCC_UYVY); } else { assert(is_i420(qf.frame)); resources = va_pool->get_va_resources(width, height, VA_FOURCC_NV12); } release = ReleaseVAResources(va_pool.get(), resources); } int y_h_samp_factor, y_v_samp_factor; if (is_uyvy(qf.frame)) { // 4:2:2 (sample Y' twice as often horizontally as Cb or Cr, vertical is left alone). y_h_samp_factor = 2; y_v_samp_factor = 1; } else { // 4:2:0 (sample Y' twice as often as Cb or Cr, in both directions) assert(is_i420(qf.frame)); y_h_samp_factor = 2; y_v_samp_factor = 2; } VAData va_data = get_va_data_for_parameters(width, height, y_h_samp_factor, y_v_samp_factor, qf.white_balance); va_data.pic_param.coded_buf = resources.data_buffer; VABufferID pic_param_buffer; VAStatus va_status = vaCreateBuffer(va_dpy->va_dpy, resources.context, VAEncPictureParameterBufferType, sizeof(va_data.pic_param), 1, &va_data.pic_param, &pic_param_buffer); CHECK_VASTATUS(va_status, "vaCreateBuffer"); VABufferDestroyer destroy_pic_param(va_dpy->va_dpy, pic_param_buffer); VABufferID q_buffer; va_status = vaCreateBuffer(va_dpy->va_dpy, resources.context, VAQMatrixBufferType, sizeof(va_data.q), 1, &va_data.q, &q_buffer); CHECK_VASTATUS(va_status, "vaCreateBuffer"); VABufferDestroyer destroy_iq(va_dpy->va_dpy, q_buffer); VABufferID huff_buffer; va_status = vaCreateBuffer(va_dpy->va_dpy, resources.context, VAHuffmanTableBufferType, sizeof(va_data.huff), 1, &va_data.huff, &huff_buffer); CHECK_VASTATUS(va_status, "vaCreateBuffer"); VABufferDestroyer destroy_huff(va_dpy->va_dpy, huff_buffer); VABufferID slice_param_buffer; va_status = vaCreateBuffer(va_dpy->va_dpy, resources.context, VAEncSliceParameterBufferType, sizeof(va_data.parms), 1, &va_data.parms, &slice_param_buffer); CHECK_VASTATUS(va_status, "vaCreateBuffer"); VABufferDestroyer destroy_slice_param(va_dpy->va_dpy, slice_param_buffer); if (userdata->data_copy_current_src == PBOFrameAllocator::Userdata::FROM_VA_API) { // The pixel data is already put into the image by the caller. va_status = vaUnmapBuffer(va_dpy->va_dpy, resources.image.buf); CHECK_VASTATUS(va_status, "vaUnmapBuffer"); } else { assert(userdata->data_copy_current_src == PBOFrameAllocator::Userdata::FROM_MALLOC); // Upload the pixel data. uint8_t *surface_p = nullptr; vaMapBuffer(va_dpy->va_dpy, resources.image.buf, (void **)&surface_p); if (is_uyvy(qf.frame)) { size_t field_start_line = qf.video_format.extra_lines_top; // No interlacing support. size_t field_start = qf.cbcr_offset * 2 + qf.video_format.width * field_start_line * 2; const uint8_t *src = qf.frame->data_copy + field_start; uint8_t *dst = (unsigned char *)surface_p + resources.image.offsets[0]; memcpy_with_pitch(dst, src, qf.video_format.width * 2, resources.image.pitches[0], qf.video_format.height); } else { assert(is_i420(qf.frame)); assert(!qf.frame->interleaved); // Makes no sense for I420. size_t field_start_line = qf.video_format.extra_lines_top; // No interlacing support. const uint8_t *y_src = qf.frame->data + qf.video_format.width * field_start_line; const uint8_t *cb_src = y_src + width * height; const uint8_t *cr_src = cb_src + (width / 2) * (height / 2); uint8_t *y_dst = (unsigned char *)surface_p + resources.image.offsets[0]; uint8_t *cbcr_dst = (unsigned char *)surface_p + resources.image.offsets[1]; memcpy_with_pitch(y_dst, y_src, qf.video_format.width, resources.image.pitches[0], qf.video_format.height); interleave_with_pitch(cbcr_dst, cb_src, cr_src, qf.video_format.width / 2, resources.image.pitches[1], qf.video_format.height / 2); } va_status = vaUnmapBuffer(va_dpy->va_dpy, resources.image.buf); CHECK_VASTATUS(va_status, "vaUnmapBuffer"); } qf.frame->data_copy = nullptr; // Seemingly vaPutImage() (which triggers a GPU copy) is much nicer to the // CPU than vaDeriveImage() and copying directly into the GPU's buffers. // Exactly why is unclear, but it seems to involve L3 cache usage when there // are many high-res (1080p+) images in play. va_status = vaPutImage(va_dpy->va_dpy, resources.surface, resources.image.image_id, 0, 0, width, height, 0, 0, width, height); CHECK_VASTATUS(va_status, "vaPutImage"); // Finally, stick in the JPEG header. VAEncPackedHeaderParameterBuffer header_parm; header_parm.type = VAEncPackedHeaderRawData; header_parm.bit_length = 8 * va_data.jpeg_header.size(); VABufferID header_parm_buffer; va_status = vaCreateBuffer(va_dpy->va_dpy, resources.context, VAEncPackedHeaderParameterBufferType, sizeof(header_parm), 1, &header_parm, &header_parm_buffer); CHECK_VASTATUS(va_status, "vaCreateBuffer"); VABufferDestroyer destroy_header(va_dpy->va_dpy, header_parm_buffer); VABufferID header_data_buffer; va_status = vaCreateBuffer(va_dpy->va_dpy, resources.context, VAEncPackedHeaderDataBufferType, va_data.jpeg_header.size(), 1, va_data.jpeg_header.data(), &header_data_buffer); CHECK_VASTATUS(va_status, "vaCreateBuffer"); VABufferDestroyer destroy_header_data(va_dpy->va_dpy, header_data_buffer); va_status = vaBeginPicture(va_dpy->va_dpy, resources.context, resources.surface); CHECK_VASTATUS(va_status, "vaBeginPicture"); va_status = vaRenderPicture(va_dpy->va_dpy, resources.context, &pic_param_buffer, 1); CHECK_VASTATUS(va_status, "vaRenderPicture(pic_param)"); va_status = vaRenderPicture(va_dpy->va_dpy, resources.context, &q_buffer, 1); CHECK_VASTATUS(va_status, "vaRenderPicture(q)"); va_status = vaRenderPicture(va_dpy->va_dpy, resources.context, &huff_buffer, 1); CHECK_VASTATUS(va_status, "vaRenderPicture(huff)"); va_status = vaRenderPicture(va_dpy->va_dpy, resources.context, &slice_param_buffer, 1); CHECK_VASTATUS(va_status, "vaRenderPicture(slice_param)"); va_status = vaRenderPicture(va_dpy->va_dpy, resources.context, &header_parm_buffer, 1); CHECK_VASTATUS(va_status, "vaRenderPicture(header_parm)"); va_status = vaRenderPicture(va_dpy->va_dpy, resources.context, &header_data_buffer, 1); CHECK_VASTATUS(va_status, "vaRenderPicture(header_data)"); va_status = vaEndPicture(va_dpy->va_dpy, resources.context); CHECK_VASTATUS(va_status, "vaEndPicture"); qf.resources = move(resources); qf.resource_releaser = move(release); lock_guard lock(mu); frames_encoding.push(move(qf)); any_frames_encoding.notify_all(); } void MJPEGEncoder::va_receiver_thread_func() { pthread_setname_np(pthread_self(), "MJPEG_Receive"); for (;;) { QueuedFrame qf; { unique_lock lock(mu); any_frames_encoding.wait(lock, [this] { return !frames_encoding.empty() || should_quit; }); if (should_quit) return; qf = move(frames_encoding.front()); frames_encoding.pop(); } update_siphon_streams(); assert(global_flags.card_to_mjpeg_stream_export.count(qf.card_index)); // Or should_encode_mjpeg_for_card() would have returned false. int stream_index = global_flags.card_to_mjpeg_stream_export[qf.card_index]; HTTPD::StreamID multicam_id{ HTTPD::MULTICAM_STREAM, 0 }; HTTPD::StreamID siphon_id{ HTTPD::SIPHON_STREAM, qf.card_index }; assert(streams.count(multicam_id)); assert(streams[multicam_id].avctx != nullptr); // Write audio before video, since Futatabi expects it. if (qf.audio.size() > 0) { write_audio_packet(streams[multicam_id].avctx.get(), qf.pts, stream_index + global_flags.card_to_mjpeg_stream_export.size(), qf.audio); if (streams.count(siphon_id)) { write_audio_packet(streams[siphon_id].avctx.get(), qf.pts, /*stream_index=*/1, qf.audio); } } VAStatus va_status = vaSyncSurface(va_dpy->va_dpy, qf.resources.surface); CHECK_VASTATUS(va_status, "vaSyncSurface"); VACodedBufferSegment *segment; va_status = vaMapBuffer(va_dpy->va_dpy, qf.resources.data_buffer, (void **)&segment); CHECK_VASTATUS(va_status, "vaMapBuffer"); const uint8_t *coded_buf = reinterpret_cast(segment->buf); write_mjpeg_packet(streams[multicam_id].avctx.get(), qf.pts, stream_index, coded_buf, segment->size); if (streams.count(siphon_id)) { write_mjpeg_packet(streams[siphon_id].avctx.get(), qf.pts, /*stream_index=*/0, coded_buf, segment->size); } va_status = vaUnmapBuffer(va_dpy->va_dpy, qf.resources.data_buffer); CHECK_VASTATUS(va_status, "vaUnmapBuffer"); } } vector MJPEGEncoder::encode_jpeg_libjpeg(const QueuedFrame &qf) { unsigned width = qf.video_format.width; unsigned height = qf.video_format.height; VectorDestinationManager dest; jpeg_compress_struct cinfo; size_t field_start_line = qf.video_format.extra_lines_top; // No interlacing support. PBOFrameAllocator::Userdata *userdata = (PBOFrameAllocator::Userdata *)qf.frame->userdata; if (userdata->pixel_format == PixelFormat_8BitYCbCr) { init_jpeg(width, height, qf.white_balance, &dest, &cinfo, /*y_h_samp_factor=*/2, /*y_v_samp_factor=*/1); assert(qf.frame->interleaved); size_t field_start = qf.cbcr_offset * 2 + qf.video_format.width * field_start_line * 2; JSAMPROW yptr[8], cbptr[8], crptr[8]; JSAMPARRAY data[3] = { yptr, cbptr, crptr }; for (unsigned y = 0; y < qf.video_format.height; y += 8) { const uint8_t *src; src = qf.frame->data_copy + field_start + y * qf.video_format.width * 2; memcpy_interleaved(tmp_cbcr, tmp_y, src, qf.video_format.width * 8 * 2); memcpy_interleaved(tmp_cb, tmp_cr, tmp_cbcr, qf.video_format.width * 8); for (unsigned yy = 0; yy < 8; ++yy) { yptr[yy] = tmp_y + yy * width; cbptr[yy] = tmp_cb + yy * width / 2; crptr[yy] = tmp_cr + yy * width / 2; } jpeg_write_raw_data(&cinfo, data, /*num_lines=*/8); } } else { assert(userdata->pixel_format == PixelFormat_8BitYCbCrPlanar); const movit::YCbCrFormat &ycbcr = userdata->ycbcr_format; init_jpeg(width, height, qf.white_balance, &dest, &cinfo, ycbcr.chroma_subsampling_x, ycbcr.chroma_subsampling_y); assert(ycbcr.chroma_subsampling_y <= 2); // Or we'd need larger JSAMPROW arrays below. size_t field_start_line = qf.video_format.extra_lines_top; // No interlacing support. const uint8_t *y_start = qf.frame->data + qf.video_format.width * field_start_line; const uint8_t *cb_start = y_start + width * height; const uint8_t *cr_start = cb_start + (width / ycbcr.chroma_subsampling_x) * (height / ycbcr.chroma_subsampling_y); size_t block_height_y = 8 * ycbcr.chroma_subsampling_y; size_t block_height_cbcr = 8; JSAMPROW yptr[16], cbptr[16], crptr[16]; JSAMPARRAY data[3] = { yptr, cbptr, crptr }; for (unsigned y = 0; y < qf.video_format.height; y += block_height_y) { for (unsigned yy = 0; yy < block_height_y; ++yy) { yptr[yy] = const_cast(y_start) + (y + yy) * width; } unsigned cbcr_y = y / ycbcr.chroma_subsampling_y; for (unsigned yy = 0; yy < block_height_cbcr; ++yy) { cbptr[yy] = const_cast(cb_start) + (cbcr_y + yy) * width / ycbcr.chroma_subsampling_x; crptr[yy] = const_cast(cr_start) + (cbcr_y + yy) * width / ycbcr.chroma_subsampling_x; } jpeg_write_raw_data(&cinfo, data, block_height_y); } } jpeg_finish_compress(&cinfo); return dest.dest; } void MJPEGEncoder::add_stream(HTTPD::StreamID stream_id) { AVFormatContextWithCloser avctx; // Set up the mux. We don't use the Mux wrapper, because it's geared towards // a situation with only one video stream (and possibly one audio stream) // with known width/height, and we don't need the extra functionality it provides. avctx.reset(avformat_alloc_context()); avctx->oformat = av_guess_format("nut", nullptr, nullptr); uint8_t *buf = (uint8_t *)av_malloc(MUX_BUFFER_SIZE); avctx->pb = avio_alloc_context(buf, MUX_BUFFER_SIZE, 1, &ffmpeg_contexts[stream_id], nullptr, nullptr, nullptr); avctx->pb->write_data_type = &MJPEGEncoder::write_packet2_thunk; avctx->flags = AVFMT_FLAG_CUSTOM_IO; if (stream_id.type == HTTPD::MULTICAM_STREAM) { for (unsigned card_idx = 0; card_idx < global_flags.card_to_mjpeg_stream_export.size(); ++card_idx) { add_video_stream(avctx.get()); } for (unsigned card_idx = 0; card_idx < global_flags.card_to_mjpeg_stream_export.size(); ++card_idx) { add_audio_stream(avctx.get()); } } else { assert(stream_id.type == HTTPD::SIPHON_STREAM); add_video_stream(avctx.get()); add_audio_stream(avctx.get()); } finalize_mux(avctx.get()); Stream s; s.avctx = move(avctx); streams[stream_id] = move(s); } void MJPEGEncoder::update_siphon_streams() { // Bring the list of streams into sync with what the clients need. for (auto it = streams.begin(); it != streams.end(); ) { if (it->first.type != HTTPD::SIPHON_STREAM) { ++it; continue; } if (httpd->get_num_connected_siphon_clients(it->first.index) == 0) { av_free(it->second.avctx->pb->buffer); streams.erase(it++); } else { ++it; } } for (unsigned stream_idx = 0; stream_idx < MAX_VIDEO_CARDS; ++stream_idx) { HTTPD::StreamID stream_id{ HTTPD::SIPHON_STREAM, stream_idx }; if (streams.count(stream_id) == 0 && httpd->get_num_connected_siphon_clients(stream_idx) > 0) { add_stream(stream_id); } } } void MJPEGEncoder::create_ffmpeg_context(HTTPD::StreamID stream_id) { ffmpeg_contexts.emplace(stream_id, WritePacket2Context{ this, stream_id }); } nageru-2.3.0/nageru/mjpeg_encoder.h000066400000000000000000000133121450736322200172340ustar00rootroot00000000000000#ifndef _MJPEG_ENCODER_H #define _MJPEG_ENCODER_H 1 #include "defs.h" #include "shared/ffmpeg_raii.h" #include "shared/httpd.h" #include "shared/va_resource_pool.h" #include "ref_counted_frame.h" extern "C" { #include } // extern "C" #include #include #include #include #include #include #include #include #include #include #include struct jpeg_compress_struct; struct VADisplayWithCleanup; struct VectorDestinationManager; #define CHECK_VASTATUS(va_status, func) \ if (va_status != VA_STATUS_SUCCESS) { \ fprintf(stderr, "%s:%d (%s) failed: %s\n", __func__, __LINE__, func, vaErrorStr(va_status)); \ exit(1); \ } class MJPEGEncoder { public: MJPEGEncoder(HTTPD *httpd, const std::string &va_display); ~MJPEGEncoder(); void stop(); void upload_frame(int64_t pts, unsigned card_index, RefCountedFrame frame, const bmusb::VideoFormat &video_format, size_t y_offset, size_t cbcr_offset, std::vector audio, const movit::RGBTriplet &white_balance); bool using_vaapi() const { return va_dpy != nullptr; } bool should_encode_mjpeg_for_card(unsigned card_index); VAResourcePool *get_va_pool() const { return va_pool.get(); } private: static constexpr int quality = 90; struct QueuedFrame { int64_t pts; unsigned card_index; RefCountedFrame frame; bmusb::VideoFormat video_format; size_t y_offset, cbcr_offset; std::vector audio; movit::RGBTriplet white_balance; // Only for frames in the process of being encoded by VA-API. VAResourcePool::VAResources resources; ReleaseVAResources resource_releaser; }; void encoder_thread_func(); void va_receiver_thread_func(); void encode_jpeg_va(QueuedFrame &&qf); std::vector encode_jpeg_libjpeg(const QueuedFrame &qf); void write_mjpeg_packet(AVFormatContext *avctx, int64_t pts, unsigned stream_index, const uint8_t *jpeg, size_t jpeg_size); void write_audio_packet(AVFormatContext *avctx, int64_t pts, unsigned stream_index, const std::vector &audio); void init_jpeg(unsigned width, unsigned height, const movit::RGBTriplet &white_balance, VectorDestinationManager *dest, jpeg_compress_struct *cinfo, int y_h_samp_factor, int y_v_samp_factor); std::vector get_jpeg_header(unsigned width, unsigned height, const movit::RGBTriplet &white_balance, int y_h_samp_factor, int y_v_samp_factor, jpeg_compress_struct *cinfo); void add_stream(HTTPD::StreamID stream_id); // Can only be called from the constructor, or the thread owning . void update_siphon_streams(); // Same. void create_ffmpeg_context(HTTPD::StreamID stream_id); struct WritePacket2Context { MJPEGEncoder *mjpeg_encoder; HTTPD::StreamID stream_id; }; std::map ffmpeg_contexts; // Statically set up, so we never need to worry about dangling pointers. static int write_packet2_thunk(void *opaque, uint8_t *buf, int buf_size, AVIODataMarkerType type, int64_t time); int write_packet2(HTTPD::StreamID stream_id, uint8_t *buf, int buf_size, AVIODataMarkerType type, int64_t time); std::thread encoder_thread, va_receiver_thread; std::mutex mu; std::queue frames_to_be_encoded; // Under mu. std::condition_variable any_frames_to_be_encoded; // Governs changes in both frames_to_be_encoded and frames_under_encoding std::queue frames_encoding; // Under mu. Used for VA-API only. std::condition_variable any_frames_encoding; struct Stream { AVFormatContextWithCloser avctx; std::string mux_header; }; std::map streams; // Owned by the VA-API receiver thread if VA-API is active, or the encoder thread if not. HTTPD *httpd; std::atomic should_quit{false}; bool running = false; std::unique_ptr va_dpy; std::unique_ptr va_pool; struct VAKey { unsigned width, height, y_h_samp_factor, y_v_samp_factor; movit::RGBTriplet white_balance; bool operator< (const VAKey &other) const { if (width != other.width) return width < other.width; if (height != other.height) return height < other.height; if (y_h_samp_factor != other.y_h_samp_factor) return y_h_samp_factor < other.y_h_samp_factor; if (y_v_samp_factor != other.y_v_samp_factor) return y_v_samp_factor < other.y_v_samp_factor; if (white_balance.r != other.white_balance.r) return white_balance.r < other.white_balance.r; if (white_balance.g != other.white_balance.g) return white_balance.g < other.white_balance.g; return white_balance.b < other.white_balance.b; } }; struct VAData { std::vector jpeg_header; VAEncPictureParameterBufferJPEG pic_param; VAQMatrixBufferJPEG q; VAHuffmanTableBufferJPEGBaseline huff; VAEncSliceParameterBufferJPEG parms; }; std::map va_data_for_parameters; VAData get_va_data_for_parameters(unsigned width, unsigned height, unsigned y_h_samp_factor, unsigned y_v_samp_factor, const movit::RGBTriplet &white_balance); uint8_t *tmp_y, *tmp_cbcr, *tmp_cb, *tmp_cr; // Private to the encoder thread. Used by the libjpeg backend only. std::atomic metric_mjpeg_frames_zero_size_dropped{0}; std::atomic metric_mjpeg_frames_interlaced_dropped{0}; std::atomic metric_mjpeg_frames_unsupported_pixel_format_dropped{0}; std::atomic metric_mjpeg_frames_oversized_dropped{0}; std::atomic metric_mjpeg_overrun_dropped{0}; std::atomic metric_mjpeg_overrun_submitted{0}; friend class PBOFrameAllocator; // FIXME }; #endif // !defined(_MJPEG_ENCODER_H) nageru-2.3.0/nageru/nageru_cef_app.cpp000066400000000000000000000032431450736322200177260ustar00rootroot00000000000000#include #include #include #include #include #include #include "nageru_cef_app.h" using namespace std; void NageruCefApp::OnBeforeCommandLineProcessing( const CefString& process_type, CefRefPtr command_line) { command_line->AppendSwitch("disable-gpu"); command_line->AppendSwitch("disable-gpu-compositing"); command_line->AppendSwitch("enable-begin-frame-scheduling"); // https://bitbucket.org/chromiumembedded/cef/issues/2717/xmlhttprequest-empty-responsetext command_line->AppendSwitch("disable-web-security"); } void NageruCefApp::initialize_cef() { unique_lock lock(cef_mutex); if (cef_thread_refcount++ == 0) { cef_thread = thread(&NageruCefApp::cef_thread_func, this); } cef_initialized_cond.wait(lock, [this]{ return cef_initialized; }); } void NageruCefApp::close_browser(CefRefPtr browser) { lock_guard lock(cef_mutex); browser->GetHost()->CloseBrowser(/*force_close=*/true); } void NageruCefApp::unref_cef() { unique_lock lock(cef_mutex); if (--cef_thread_refcount == 0) { CefPostTask(TID_UI, new CEFTaskAdapter(&CefQuitMessageLoop)); lock.unlock(); cef_thread.join(); } } void NageruCefApp::cef_thread_func() { CefMainArgs main_args; CefSettings settings; //settings.log_severity = LOGSEVERITY_VERBOSE; settings.windowless_rendering_enabled = true; settings.no_sandbox = true; settings.command_line_args_disabled = false; CefInitialize(main_args, settings, this, nullptr); { lock_guard lock(cef_mutex); cef_initialized = true; } cef_initialized_cond.notify_all(); CefRunMessageLoop(); CefShutdown(); } nageru-2.3.0/nageru/nageru_cef_app.h000066400000000000000000000062171450736322200173770ustar00rootroot00000000000000#ifndef _NAGERU_CEF_APP_H #define _NAGERU_CEF_APP_H 1 // NageruCefApp deals with global state around CEF, in particular the global // CEF event loop. CEF is pretty picky about which threads everything runs on; // in particular, the documentation says CefExecute, CefInitialize and // CefRunMessageLoop must all be on the main thread (ie., the first thread // created). However, Qt wants to run _its_ event loop on this thread, too, // and integrating the two has proved problematic (see also the comment in // main.cpp). It seems that as long as you don't have two GLib loops running, // it's completely fine in practice to have a separate thread for the main loop // (running CefInitialize, CefRunMessageLoop, and finally CefDestroy). // Many other tasks (like most things related to interacting with browsers) // have to be run from the message loop, but that's fine; CEF gives us tools // to post tasks to it. #include #include #include #include #include #include #include #include #include #include #include #include // Takes in arbitrary lambdas and converts them to something CefPostTask() will accept. class CEFTaskAdapter : public CefTask { public: CEFTaskAdapter(const std::function&& func) : func(std::move(func)) {} void Execute() override { func(); } private: std::function func; IMPLEMENT_REFCOUNTING(CEFTaskAdapter); }; // Runs and stops the CEF event loop, and also makes some startup tasks. class NageruCefApp : public CefApp, public CefRenderProcessHandler, public CefBrowserProcessHandler { public: NageruCefApp() {} // Starts up the CEF main loop if it does not already run, and blocks until // CEF is properly initialized. You can call initialize_ref() multiple times, // which will then increase the refcount. void initialize_cef(); // If the refcount goes to zero, shut down the main loop and uninitialize CEF. void unref_cef(); // Closes the given browser, and blocks until it is done closing. // // NOTE: We can't call unref_cef() from close_browser(), since // CefRefPtr does not support move semantics, so it would have a // refcount of either zero or two going into close_browser (not one, // as it should). The latter means the caller would hold on to an extra // reference to the browser (which triggers an assert failure), and the // former would mean that the browser gets deleted before it's closed. void close_browser(CefRefPtr browser); CefRefPtr GetRenderProcessHandler() override { return this; } CefRefPtr GetBrowserProcessHandler() override { return this; } void OnBeforeCommandLineProcessing(const CefString& process_type, CefRefPtr command_line) override; private: void cef_thread_func(); std::thread cef_thread; std::mutex cef_mutex; int cef_thread_refcount = 0; // Under . bool cef_initialized = false; // Under . std::condition_variable cef_initialized_cond; IMPLEMENT_REFCOUNTING(NageruCefApp); }; #endif // !defined(_NAGERU_CEF_APP_H) nageru-2.3.0/nageru/nageru_midi_mapping.proto000066400000000000000000000117121450736322200213470ustar00rootroot00000000000000// Mappings from MIDI controllers to the UI. (We don't really build // a more complicated data structure than this in Nageru itself either; // we just edit and match directly against the protobuf.) syntax = "proto2"; import "midi_mapping.proto"; // All the mappings for a given a bus. message MIDIMappingBusProto { // TODO: If we need support for lots of buses (i.e., more than the typical eight // on a mixer), add a system for bus banks, like we have for controller banks. // optional int32 bus_bank = 1; optional MIDIControllerProto stereo_width = 37; optional MIDIControllerProto treble = 2; optional MIDIControllerProto mid = 3; optional MIDIControllerProto bass = 4; optional MIDIControllerProto gain = 5; optional MIDIControllerProto compressor_threshold = 6; optional MIDIControllerProto fader = 7; optional MIDIButtonProto toggle_mute = 8; optional MIDIButtonProto toggle_locut = 9; optional MIDIButtonProto toggle_auto_gain_staging = 10; optional MIDIButtonProto toggle_compressor = 11; optional MIDIButtonProto clear_peak = 12; // These are really global (controller bank change affects all buses), // but it's not uncommon that we'd want one button per bus to switch banks. // E.g., if the user binds the “mute” button to “next bank”, they'd want every // mute button on the mixer to do that, so they need one mapping per bus. optional MIDIButtonProto prev_bank = 13; optional MIDIButtonProto next_bank = 14; optional MIDIButtonProto select_bank_1 = 15; optional MIDIButtonProto select_bank_2 = 16; optional MIDIButtonProto select_bank_3 = 17; optional MIDIButtonProto select_bank_4 = 18; optional MIDIButtonProto select_bank_5 = 19; optional MIDIButtonProto toggle_limiter = 20; optional MIDIButtonProto toggle_auto_makeup_gain = 21; // Video mixing. optional MIDIButtonProto switch_video_channel = 38; optional MIDIButtonProto apply_transition = 39; // Main UI. Really global, but see the comment on lo-cut etc. above. optional MIDIButtonProto prev_audio_view = 40; optional MIDIButtonProto next_audio_view = 41; optional MIDIButtonProto begin_new_video_segment = 42; optional MIDIButtonProto exit = 43; // These are also global (they belong to the master bus), and unlike // the bank change commands, one would usually have only one of each, // but there's no reason to limit them to one each, and the editor UI // becomes simpler if they are the treated the same way as the bank // commands. optional MIDIControllerProto locut = 22; optional MIDIControllerProto limiter_threshold = 23; optional MIDIControllerProto makeup_gain = 24; // Per-bus lights. optional MIDILightProto is_muted = 25; optional MIDILightProto locut_is_on = 26; optional MIDILightProto auto_gain_staging_is_on = 27; optional MIDILightProto compressor_is_on = 28; optional MIDILightProto has_peaked = 29; // Global lights. Same logic as above for why they're in this proto. optional MIDILightProto bank_1_is_selected = 30; optional MIDILightProto bank_2_is_selected = 31; optional MIDILightProto bank_3_is_selected = 32; optional MIDILightProto bank_4_is_selected = 33; optional MIDILightProto bank_5_is_selected = 34; optional MIDILightProto limiter_is_on = 35; optional MIDILightProto auto_makeup_gain_is_on = 36; } // The top-level protobuf, containing all the bus mappings, as well as // more global settings. // // Since a typical mixer will have fewer physical controls than what Nageru // could use, Nageru supports so-called controller banks. A mapping can // optionally belong to a bank, and if so, that mapping is only active when // that bank is selected. The user can then select the current bank using // other mappings, typically by having some mixer button assigned to // “next bank”. This yields effective multiplexing of lesser-used controls. message MIDIMappingProto { optional int32 num_controller_banks = 1 [default = 0]; // Max 5. // Bus controller banks. optional int32 stereo_width_bank = 19; optional int32 treble_bank = 2; optional int32 mid_bank = 3; optional int32 bass_bank = 4; optional int32 gain_bank = 5; optional int32 compressor_threshold_bank = 6; optional int32 fader_bank = 7; // Bus button banks. optional int32 toggle_mute_bank = 8; optional int32 toggle_locut_bank = 9; optional int32 toggle_auto_gain_staging_bank = 10; optional int32 toggle_compressor_bank = 11; optional int32 clear_peak_bank = 12; // Bus (not non-audio) buttons. optional int32 switch_video_channel_bank = 24; optional int32 apply_transition_bank = 25; // Global controller banks. optional int32 locut_bank = 13; optional int32 limiter_threshold_bank = 14; optional int32 makeup_gain_bank = 15; // Global buttons. optional int32 toggle_limiter_bank = 16; optional int32 toggle_auto_makeup_gain_bank = 17; // Global non-audio buttons. optional int32 prev_audio_view_bank = 20; optional int32 next_audio_view_bank = 21; optional int32 begin_new_video_segment_bank = 22; optional int32 exit_bank = 23; repeated MIDIMappingBusProto bus_mapping = 18; } nageru-2.3.0/nageru/nonlinear_fader.cpp000066400000000000000000000056141450736322200201220ustar00rootroot00000000000000#include "nonlinear_fader.h" #include #include #include #include #include #include #include #include #include #include #include "piecewise_interpolator.h" class QPaintEvent; class QWidget; using namespace std; namespace { PiecewiseInterpolator interpolator({ // The main area is from +6 to -12 dB (18 dB), and we use half the slider range for it. // Adjust slightly so that the MIDI controller value of 106 becomes exactly 0.0 dB // (cf. map_controller_to_float()); otherwise, we'd miss ever so slightly, which is // really frustrating. { 6.0, 1.0 }, { -12.0, 1.0 - (1.0 - 106.5/127.0) * 3.0 }, // About 0.492. // -12 to -21 is half the range (9 dB). Halve. { -21.0, 0.325 }, // -21 to -30 (9 dB) gets the same range as the previous one. { -30.0, 0.25 }, // -30 to -48 (18 dB) gets half of half. { -48.0, 0.125 }, // -48 to -84 (36 dB) gets half of half of half. { -84.0, 0.0 }, }); } // namespace NonLinearFader::NonLinearFader(QWidget *parent) : QSlider(parent) { update_slider_position(); } void NonLinearFader::setDbValue(double db) { db_value = db; update_slider_position(); emit dbValueChanged(db); } void NonLinearFader::paintEvent(QPaintEvent *event) { QStyleOptionSlider opt; this->initStyleOption(&opt); QRect gr = this->style()->subControlRect(QStyle::CC_Slider, &opt, QStyle::SC_SliderGroove, this); QRect sr = this->style()->subControlRect(QStyle::CC_Slider, &opt, QStyle::SC_SliderHandle, this); // FIXME: Where does the slider_length / 2 come from? I can't really find it // in the Qt code, but it seems to match up with reality. int slider_length = sr.height(); int slider_max = gr.top() + (slider_length / 2); int slider_min = gr.bottom() + (slider_length / 2) - slider_length + 1; QPainter p(this); // Draw some ticks every 6 dB. // FIXME: Find a way to make the slider wider, so that we have more space for tickmarks // and some dB numbering. int x_margin = 5; p.setPen(Qt::darkGray); for (int db = -84; db <= 6; db += 6) { int y = slider_min + lrint(interpolator.db_to_fraction(db) * (slider_max - slider_min)); p.drawLine(QPoint(0, y), QPoint(gr.left() - x_margin, y)); p.drawLine(QPoint(gr.right() + x_margin, y), QPoint(width() - 1, y)); } QSlider::paintEvent(event); } void NonLinearFader::sliderChange(SliderChange change) { QSlider::sliderChange(change); if (change == QAbstractSlider::SliderValueChange && !inhibit_updates) { if (value() == 0) { db_value = -HUGE_VAL; } else { double frac = double(value() - minimum()) / (maximum() - minimum()); db_value = interpolator.fraction_to_db(frac); } emit dbValueChanged(db_value); } } void NonLinearFader::update_slider_position() { inhibit_updates = true; double val = interpolator.db_to_fraction(db_value) * (maximum() - minimum()) + minimum(); setValue(lrint(val)); inhibit_updates = false; } nageru-2.3.0/nageru/nonlinear_fader.h000066400000000000000000000011151450736322200175570ustar00rootroot00000000000000#ifndef _NONLINEAR_FADER_H #define _NONLINEAR_FADER_H 1 #include #include #include class QObject; class QPaintEvent; class QWidget; class NonLinearFader : public QSlider { Q_OBJECT public: NonLinearFader(QWidget *parent); void setDbValue(double db); signals: void dbValueChanged(double db); protected: void paintEvent(QPaintEvent *event) override; void sliderChange(SliderChange change) override; private: void update_slider_position(); bool inhibit_updates = false; double db_value = 0.0; }; #endif // !defined(_NONLINEAR_FADER_H) nageru-2.3.0/nageru/patches/000077500000000000000000000000001450736322200157115ustar00rootroot00000000000000nageru-2.3.0/nageru/patches/zita-resampler-sse.diff000066400000000000000000000332431450736322200222770ustar00rootroot00000000000000diff -ur orig/zita-resampler-1.3.0/libs/resampler.cc zita-resampler-1.3.0/libs/resampler.cc --- orig/zita-resampler-1.3.0/libs/resampler.cc 2012-10-26 22:58:55.000000000 +0200 +++ zita-resampler-1.3.0/libs/resampler.cc 2016-09-05 00:30:34.520191288 +0200 @@ -24,6 +24,10 @@ #include #include +#ifdef __SSE2__ +#include +#endif + static unsigned int gcd (unsigned int a, unsigned int b) { @@ -47,6 +51,118 @@ return 1; } +#ifdef __SSE2__ + +static inline float calc_mono_sample_sse (unsigned int hl, + const float *c1, + const float *c2, + const float *q1, + const float *q2) +{ + unsigned int i; + __m128 denorm, s, w1, w2, shuf; + + denorm = _mm_set1_ps (1e-20f); + s = denorm; + for (i = 0; i < hl; i += 4) + { + q2 -= 4; + + // s += *q1 * c1 [i]; + w1 = _mm_loadu_ps (&c1 [i]); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (q1), w1)); + + // s += *q2 * c2 [i]; + w2 = _mm_loadu_ps (&c2 [i]); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (q2), _mm_shuffle_ps (w2, w2, _MM_SHUFFLE (0, 1, 2, 3)))); + + q1 += 4; + } + s = _mm_sub_ps (s, denorm); + + // Add all the elements of s together into one. Adapted from + // http://stackoverflow.com/questions/6996764/fastest-way-to-do-horizontal-float-vector-sum-on-x86 + shuf = _mm_shuffle_ps (s, s, _MM_SHUFFLE (2, 3, 0, 1)); + s = _mm_add_ps (s, shuf); + s = _mm_add_ss (s, _mm_movehl_ps (shuf, s)); + return _mm_cvtss_f32 (s); +} + +// Note: This writes four floats instead of two (the last two are garbage). +// The caller will need to make sure there is room for all four. +static inline void calc_stereo_sample_sse (unsigned int hl, + const float *c1, + const float *c2, + const float *q1, + const float *q2, + float *out_data) +{ + unsigned int i; + __m128 denorm, s, w1, w2; + + denorm = _mm_set1_ps (1e-20f); + s = denorm; + for (i = 0; i < hl; i += 4) + { + q2 -= 8; + + // s += *q1 * c1 [i]; + w1 = _mm_loadu_ps (&c1 [i]); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (q1), _mm_unpacklo_ps (w1, w1))); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (q1 + 4), _mm_unpackhi_ps (w1, w1))); + + // s += *q2 * c2 [i]; + w2 = _mm_loadu_ps (&c2 [i]); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (q2 + 4), _mm_shuffle_ps (w2, w2, _MM_SHUFFLE (0, 0, 1, 1)))); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (q2), _mm_shuffle_ps (w2, w2, _MM_SHUFFLE (2, 2, 3, 3)))); + + q1 += 8; + } + s = _mm_sub_ps (s, denorm); + s = _mm_add_ps (s, _mm_shuffle_ps (s, s, _MM_SHUFFLE (1, 0, 3, 2))); + + _mm_storeu_ps (out_data, s); +} + +static inline void calc_quad_sample_sse (int hl, + int nchan, + const float *c1, + const float *c2, + const float *q1, + const float *q2, + float *out_data) +{ + int i; + __m128 denorm, s, w1, w2; + + denorm = _mm_set1_ps (1e-20f); + s = denorm; + for (i = 0; i < hl; i += 4) + { + q2 -= 4 * nchan; + + // s += *p1 * _c1 [i]; + w1 = _mm_loadu_ps (&c1 [i]); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (q1), _mm_shuffle_ps (w1, w1, _MM_SHUFFLE (0, 0, 0, 0)))); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (q1 + nchan), _mm_shuffle_ps (w1, w1, _MM_SHUFFLE (1, 1, 1, 1)))); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (q1 + 2 * nchan), _mm_shuffle_ps (w1, w1, _MM_SHUFFLE (2, 2, 2, 2)))); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (q1 + 3 * nchan), _mm_shuffle_ps (w1, w1, _MM_SHUFFLE (3, 3, 3, 3)))); + + // s += *p2 * _c2 [i]; + w2 = _mm_loadu_ps (&c2 [i]); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (q2 + 3 * nchan), _mm_shuffle_ps (w2, w2, _MM_SHUFFLE (0, 0, 0, 0)))); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (q2 + 2 * nchan), _mm_shuffle_ps (w2, w2, _MM_SHUFFLE (1, 1, 1, 1)))); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (q2 + nchan), _mm_shuffle_ps (w2, w2, _MM_SHUFFLE (2, 2, 2, 2)))); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (q2), _mm_shuffle_ps (w2, w2, _MM_SHUFFLE (3, 3, 3, 3)))); + + q1 += 4 * nchan; + } + s = _mm_sub_ps (s, denorm); + + _mm_storeu_ps (out_data, s); +} +#endif + Resampler::Resampler (void) : _table (0), @@ -213,18 +329,42 @@ { float *c1 = _table->_ctab + hl * ph; float *c2 = _table->_ctab + hl * (np - ph); - for (c = 0; c < _nchan; c++) +#ifdef __SSE2__ + if ((hl % 4) == 0 && _nchan == 1) + { + *out_data++ = calc_mono_sample_sse (hl, c1, c2, p1, p2); + } + else if ((hl % 4) == 0 && _nchan == 2) { - float *q1 = p1 + c; - float *q2 = p2 + c; - float s = 1e-20f; - for (i = 0; i < hl; i++) + if (out_count >= 2) + { + calc_stereo_sample_sse (hl, c1, c2, p1, p2, out_data); + } + else + { + float tmp[4]; + calc_stereo_sample_sse (hl, c1, c2, p1, p2, tmp); + out_data[0] = tmp[0]; + out_data[1] = tmp[1]; + } + out_data += 2; + } + else +#endif + { + for (c = 0; c < _nchan; c++) { - q2 -= _nchan; - s += *q1 * c1 [i] + *q2 * c2 [i]; - q1 += _nchan; + float *q1 = p1 + c; + float *q2 = p2 + c; + float s = 1e-20f; + for (i = 0; i < hl; i++) + { + q2 -= _nchan; + s += *q1 * c1 [i] + *q2 * c2 [i]; + q1 += _nchan; + } + *out_data++ = s - 1e-20f; } - *out_data++ = s - 1e-20f; } } else diff -ur orig/zita-resampler-1.3.0/libs/vresampler.cc zita-resampler-1.3.0/libs/vresampler.cc --- orig/zita-resampler-1.3.0/libs/vresampler.cc 2012-10-26 22:58:55.000000000 +0200 +++ zita-resampler-1.3.0/libs/vresampler.cc 2016-09-05 00:33:53.907511211 +0200 @@ -25,6 +25,152 @@ #include +#ifdef __SSE2__ + +#include + +static inline float calc_mono_sample_sse (int hl, + float b, + const float *p1, + const float *p2, + const float *q1, + const float *q2) +{ + int i; + __m128 denorm, bs, s, c1, c2, w1, w2, shuf; + + denorm = _mm_set1_ps (1e-25f); + bs = _mm_set1_ps (b); + s = denorm; + for (i = 0; i < hl; i += 4) + { + p2 -= 4; + + // _c1 [i] = q1 [i] + b * (q1 [i + hl] - q1 [i]); + w1 = _mm_loadu_ps (&q1 [i]); + w2 = _mm_loadu_ps (&q1 [i + hl]); + c1 = _mm_add_ps (w1, _mm_mul_ps(bs, _mm_sub_ps (w2, w1))); + + // _c2 [i] = q2 [i] + b * (q2 [i - hl] - q2 [i]); + w1 = _mm_loadu_ps (&q2 [i]); + w2 = _mm_loadu_ps (&q2 [i - hl]); + c2 = _mm_add_ps (w1, _mm_mul_ps(bs, _mm_sub_ps (w2, w1))); + + // s += *p1 * _c1 [i]; + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (p1), c1)); + + // s += *p2 * _c2 [i]; + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (p2), _mm_shuffle_ps (c2, c2, _MM_SHUFFLE (0, 1, 2, 3)))); + + p1 += 4; + } + s = _mm_sub_ps (s, denorm); + + // Add all the elements of s together into one. Adapted from + // http://stackoverflow.com/questions/6996764/fastest-way-to-do-horizontal-float-vector-sum-on-x86 + shuf = _mm_shuffle_ps (s, s, _MM_SHUFFLE (2, 3, 0, 1)); + s = _mm_add_ps (s, shuf); + s = _mm_add_ss (s, _mm_movehl_ps (shuf, s)); + return _mm_cvtss_f32 (s); +} + +// Note: This writes four floats instead of two (the last two are garbage). +// The caller will need to make sure there is room for all four. +static inline void calc_stereo_sample_sse (int hl, + float b, + const float *p1, + const float *p2, + const float *q1, + const float *q2, + float *out_data) +{ + int i; + __m128 denorm, bs, s, c1, c2, w1, w2; + + denorm = _mm_set1_ps (1e-25f); + bs = _mm_set1_ps (b); + s = denorm; + for (i = 0; i < hl; i += 4) + { + p2 -= 8; + + // _c1 [i] = q1 [i] + b * (q1 [i + hl] - q1 [i]); + w1 = _mm_loadu_ps (&q1 [i]); + w2 = _mm_loadu_ps (&q1 [i + hl]); + c1 = _mm_add_ps (w1, _mm_mul_ps(bs, _mm_sub_ps (w2, w1))); + + // _c2 [i] = q2 [i] + b * (q2 [i - hl] - q2 [i]); + w1 = _mm_loadu_ps (&q2 [i]); + w2 = _mm_loadu_ps (&q2 [i - hl]); + c2 = _mm_add_ps (w1, _mm_mul_ps(bs, _mm_sub_ps (w2, w1))); + + // s += *p1 * _c1 [i]; + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (p1), _mm_unpacklo_ps (c1, c1))); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (p1 + 4), _mm_unpackhi_ps (c1, c1))); + + // s += *p2 * _c2 [i]; + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (p2 + 4), _mm_shuffle_ps (c2, c2, _MM_SHUFFLE (0, 0, 1, 1)))); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (p2), _mm_shuffle_ps (c2, c2, _MM_SHUFFLE (2, 2, 3, 3)))); + + p1 += 8; + } + s = _mm_sub_ps (s, denorm); + s = _mm_add_ps (s, _mm_shuffle_ps (s, s, _MM_SHUFFLE (1, 0, 3, 2))); + + _mm_storeu_ps (out_data, s); +} + +static inline void calc_quad_sample_sse (int hl, + int nchan, + float b, + const float *p1, + const float *p2, + const float *q1, + const float *q2, + float *out_data) +{ + int i; + __m128 denorm, bs, s, c1, c2, w1, w2; + + denorm = _mm_set1_ps (1e-25f); + bs = _mm_set1_ps (b); + s = denorm; + for (i = 0; i < hl; i += 4) + { + p2 -= 4 * nchan; + + // _c1 [i] = q1 [i] + b * (q1 [i + hl] - q1 [i]); + w1 = _mm_loadu_ps (&q1 [i]); + w2 = _mm_loadu_ps (&q1 [i + hl]); + c1 = _mm_add_ps (w1, _mm_mul_ps(bs, _mm_sub_ps (w2, w1))); + + // _c2 [i] = q2 [i] + b * (q2 [i - hl] - q2 [i]); + w1 = _mm_loadu_ps (&q2 [i]); + w2 = _mm_loadu_ps (&q2 [i - hl]); + c2 = _mm_add_ps (w1, _mm_mul_ps(bs, _mm_sub_ps (w2, w1))); + + // s += *p1 * _c1 [i]; + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (p1), _mm_shuffle_ps (c1, c1, _MM_SHUFFLE (0, 0, 0, 0)))); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (p1 + nchan), _mm_shuffle_ps (c1, c1, _MM_SHUFFLE (1, 1, 1, 1)))); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (p1 + 2 * nchan), _mm_shuffle_ps (c1, c1, _MM_SHUFFLE (2, 2, 2, 2)))); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (p1 + 3 * nchan), _mm_shuffle_ps (c1, c1, _MM_SHUFFLE (3, 3, 3, 3)))); + + // s += *p2 * _c2 [i]; + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (p2 + 3 * nchan), _mm_shuffle_ps (c2, c2, _MM_SHUFFLE (0, 0, 0, 0)))); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (p2 + 2 * nchan), _mm_shuffle_ps (c2, c2, _MM_SHUFFLE (1, 1, 1, 1)))); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (p2 + nchan), _mm_shuffle_ps (c2, c2, _MM_SHUFFLE (2, 2, 2, 2)))); + s = _mm_add_ps (s, _mm_mul_ps (_mm_loadu_ps (p2), _mm_shuffle_ps (c2, c2, _MM_SHUFFLE (3, 3, 3, 3)))); + + p1 += 4 * nchan; + } + s = _mm_sub_ps (s, denorm); + + _mm_storeu_ps (out_data, s); +} + +#endif + + VResampler::VResampler (void) : _table (0), _nchan (0), @@ -163,7 +309,7 @@ int VResampler::process (void) { - unsigned int k, np, in, nr, n, c; + unsigned int j, k, np, in, nr, n, c; int i, hl, nz; double ph, dp, dd; float a, b, *p1, *p2, *q1, *q2; @@ -212,23 +358,55 @@ a = 1.0f - b; q1 = _table->_ctab + hl * k; q2 = _table->_ctab + hl * (np - k); - for (i = 0; i < hl; i++) +#ifdef __SSE2__ + if ((hl % 4) == 0 && _nchan == 1) + { + *out_data++ = calc_mono_sample_sse (hl, b, p1, p2, q1, q2); + } + else if ((hl % 4) == 0 && _nchan == 2) { - _c1 [i] = a * q1 [i] + b * q1 [i + hl]; - _c2 [i] = a * q2 [i] + b * q2 [i - hl]; + if (out_count >= 2) + { + calc_stereo_sample_sse (hl, b, p1, p2, q1, q2, out_data); + } + else + { + float tmp[4]; + calc_stereo_sample_sse (hl, b, p1, p2, q1, q2, tmp); + out_data[0] = tmp[0]; + out_data[1] = tmp[1]; + } + out_data += 2; + } + else if ((hl % 4) == 0 && (_nchan % 4) == 0) + { + for (j = 0; j < _nchan; j += 4) + { + calc_quad_sample_sse (hl, _nchan, b, p1 + j, p2 + j, q1, q2, out_data + j); + } + out_data += _nchan; } - for (c = 0; c < _nchan; c++) + else +#endif { - q1 = p1 + c; - q2 = p2 + c; - a = 1e-25f; for (i = 0; i < hl; i++) { - q2 -= _nchan; - a += *q1 * _c1 [i] + *q2 * _c2 [i]; - q1 += _nchan; + _c1 [i] = a * q1 [i] + b * q1 [i + hl]; + _c2 [i] = a * q2 [i] + b * q2 [i - hl]; + } + for (c = 0; c < _nchan; c++) + { + q1 = p1 + c; + q2 = p2 + c; + a = 1e-25f; + for (i = 0; i < hl; i++) + { + q2 -= _nchan; + a += *q1 * _c1 [i] + *q2 * _c2 [i]; + q1 += _nchan; + } + *out_data++ = a - 1e-25f; } - *out_data++ = a - 1e-25f; } } else nageru-2.3.0/nageru/pbo_frame_allocator.cpp000066400000000000000000000336651450736322200207750ustar00rootroot00000000000000#include "pbo_frame_allocator.h" #include #include #include #include #include #include #include "flags.h" #include "mjpeg_encoder.h" #include "v210_converter.h" #include "shared/va_display.h" using namespace std; namespace { void set_clamp_to_edge() { glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_MIN_FILTER, GL_LINEAR); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_S, GL_CLAMP_TO_EDGE); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_T, GL_CLAMP_TO_EDGE); check_error(); } } // namespace PBOFrameAllocator::PBOFrameAllocator(bmusb::PixelFormat pixel_format, size_t frame_size, GLuint width, GLuint height, unsigned card_index, MJPEGEncoder *mjpeg_encoder, size_t num_queued_frames, GLenum buffer, GLenum permissions, GLenum map_bits) : card_index(card_index), mjpeg_encoder(mjpeg_encoder), pixel_format(pixel_format), buffer(buffer), frame_size(frame_size), num_queued_frames(num_queued_frames), width(width), height(height), permissions(permissions), map_bits(map_bits) { userdata.reset(new Userdata[num_queued_frames]); for (size_t i = 0; i < num_queued_frames; ++i) { init_frame(i, frame_size, width, height, permissions, map_bits, generation); } glBindBuffer(buffer, 0); check_error(); glBindTexture(GL_TEXTURE_2D, 0); check_error(); } void PBOFrameAllocator::init_frame(size_t frame_idx, size_t frame_size, GLuint width, GLuint height, GLenum permissions, GLenum map_bits, int generation) { GLuint pbo; glGenBuffers(1, &pbo); check_error(); glBindBuffer(buffer, pbo); check_error(); glBufferStorage(buffer, frame_size, nullptr, permissions | GL_MAP_PERSISTENT_BIT); check_error(); Frame frame; frame.data = (uint8_t *)glMapBufferRange(buffer, 0, frame_size, permissions | map_bits | GL_MAP_PERSISTENT_BIT); frame.data2 = frame.data + frame_size / 2; check_error(); frame.size = frame_size; Userdata *ud = &userdata[frame_idx]; frame.userdata = ud; ud->generation = generation; ud->pbo = pbo; ud->pixel_format = pixel_format; ud->data_copy_malloc = new uint8_t[frame_size]; frame.owner = this; // For 8-bit non-planar Y'CbCr, we ask the driver to split Y' and Cb/Cr // into separate textures. For 10-bit, the input format (v210) // is complicated enough that we need to interpolate up to 4:4:4, // which we do in a compute shader ourselves. For BGRA, the data // is already 4:4:4:4. frame.interleaved = (pixel_format == bmusb::PixelFormat_8BitYCbCr); // Create textures. We don't allocate any data for the second field at this point // (just create the texture state with the samplers), since our default assumed // resolution is progressive. switch (pixel_format) { case bmusb::PixelFormat_8BitYCbCr: glGenTextures(2, ud->tex_y); check_error(); glGenTextures(2, ud->tex_cbcr); check_error(); break; case bmusb::PixelFormat_10BitYCbCr: glGenTextures(2, ud->tex_v210); check_error(); glGenTextures(2, ud->tex_444); check_error(); break; case bmusb::PixelFormat_8BitBGRA: glGenTextures(2, ud->tex_rgba); check_error(); break; case bmusb::PixelFormat_8BitYCbCrPlanar: glGenTextures(2, ud->tex_y); check_error(); glGenTextures(2, ud->tex_cb); check_error(); glGenTextures(2, ud->tex_cr); check_error(); break; default: assert(false); } ud->last_width[0] = width; ud->last_height[0] = height; ud->last_cbcr_width[0] = width / 2; ud->last_cbcr_height[0] = height; ud->last_v210_width[0] = 0; ud->last_width[1] = 0; ud->last_height[1] = 0; ud->last_cbcr_width[1] = 0; ud->last_cbcr_height[1] = 0; ud->last_v210_width[1] = 0; ud->last_interlaced = false; ud->last_has_signal = false; ud->last_is_connected = false; for (unsigned field = 0; field < 2; ++field) { switch (pixel_format) { case bmusb::PixelFormat_10BitYCbCr: { const size_t v210_width = v210Converter::get_minimum_v210_texture_width(width); // Seemingly we need to set the minification filter even though // shader image loads don't use them, or NVIDIA will just give us // zero back. glBindTexture(GL_TEXTURE_2D, ud->tex_v210[field]); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_MIN_FILTER, GL_LINEAR); check_error(); if (field == 0) { ud->last_v210_width[0] = v210_width; glTexImage2D(GL_TEXTURE_2D, 0, GL_RGB10_A2, v210_width, height, 0, GL_RGBA, GL_UNSIGNED_INT_2_10_10_10_REV, nullptr); check_error(); } glBindTexture(GL_TEXTURE_2D, ud->tex_444[field]); check_error(); set_clamp_to_edge(); if (field == 0) { glTexImage2D(GL_TEXTURE_2D, 0, GL_RGB10_A2, width, height, 0, GL_RGBA, GL_UNSIGNED_INT_2_10_10_10_REV, nullptr); check_error(); } break; } case bmusb::PixelFormat_8BitYCbCr: glBindTexture(GL_TEXTURE_2D, ud->tex_y[field]); check_error(); set_clamp_to_edge(); if (field == 0) { glTexImage2D(GL_TEXTURE_2D, 0, GL_R8, width, height, 0, GL_RED, GL_UNSIGNED_BYTE, nullptr); check_error(); } glBindTexture(GL_TEXTURE_2D, ud->tex_cbcr[field]); check_error(); set_clamp_to_edge(); if (field == 0) { glTexImage2D(GL_TEXTURE_2D, 0, GL_RG8, width / 2, height, 0, GL_RG, GL_UNSIGNED_BYTE, nullptr); check_error(); } break; case bmusb::PixelFormat_8BitBGRA: glBindTexture(GL_TEXTURE_2D, ud->tex_rgba[field]); check_error(); set_clamp_to_edge(); if (field == 0) { glTexImage2D(GL_TEXTURE_2D, 0, GL_SRGB8_ALPHA8, width, height, 0, GL_BGRA, GL_UNSIGNED_INT_8_8_8_8_REV, nullptr); check_error(); } break; case bmusb::PixelFormat_8BitYCbCrPlanar: glBindTexture(GL_TEXTURE_2D, ud->tex_y[field]); check_error(); set_clamp_to_edge(); if (field == 0) { glTexImage2D(GL_TEXTURE_2D, 0, GL_R8, width, height, 0, GL_RED, GL_UNSIGNED_BYTE, nullptr); check_error(); } glBindTexture(GL_TEXTURE_2D, ud->tex_cb[field]); check_error(); set_clamp_to_edge(); if (field == 0) { glTexImage2D(GL_TEXTURE_2D, 0, GL_R8, width / 2, height, 0, GL_RED, GL_UNSIGNED_BYTE, nullptr); check_error(); } glBindTexture(GL_TEXTURE_2D, ud->tex_cr[field]); check_error(); set_clamp_to_edge(); if (field == 0) { glTexImage2D(GL_TEXTURE_2D, 0, GL_R8, width / 2, height, 0, GL_RED, GL_UNSIGNED_BYTE, nullptr); check_error(); } break; default: assert(false); } } freelist.push(frame); } PBOFrameAllocator::~PBOFrameAllocator() { while (!freelist.empty()) { Frame frame = freelist.front(); freelist.pop(); destroy_frame(&frame); } } void PBOFrameAllocator::destroy_frame(Frame *frame) { Userdata *ud = (Userdata *)frame->userdata; delete[] ud->data_copy_malloc; GLuint pbo = ud->pbo; glBindBuffer(buffer, pbo); check_error(); glUnmapBuffer(buffer); check_error(); glBindBuffer(buffer, 0); check_error(); glDeleteBuffers(1, &pbo); check_error(); switch (ud->pixel_format) { case bmusb::PixelFormat_10BitYCbCr: glDeleteTextures(2, ud->tex_v210); check_error(); glDeleteTextures(2, ud->tex_444); check_error(); break; case bmusb::PixelFormat_8BitYCbCr: glDeleteTextures(2, ud->tex_y); check_error(); glDeleteTextures(2, ud->tex_cbcr); check_error(); break; case bmusb::PixelFormat_8BitBGRA: glDeleteTextures(2, ud->tex_rgba); check_error(); break; case bmusb::PixelFormat_8BitYCbCrPlanar: glDeleteTextures(2, ud->tex_y); check_error(); glDeleteTextures(2, ud->tex_cb); check_error(); glDeleteTextures(2, ud->tex_cr); check_error(); break; default: assert(false); } if (ud->generation != generation) { auto it = lingering_generations.find(ud->generation); assert(it != lingering_generations.end()); if (--it->second.num_frames_left == 0) { lingering_generations.erase(it); // Deallocates the userdata block. } } } //static int sumsum = 0; bmusb::FrameAllocator::Frame PBOFrameAllocator::alloc_frame() { Frame vf; lock_guard lock(freelist_mutex); // Meh. if (freelist.empty()) { printf("Frame overrun (no more spare PBO frames), dropping frame!\n"); } else { //fprintf(stderr, "freelist has %d allocated\n", ++sumsum); vf = freelist.front(); freelist.pop(); // Meh. } vf.len = 0; vf.overflow = 0; if (mjpeg_encoder != nullptr && mjpeg_encoder->should_encode_mjpeg_for_card(card_index) && vf.userdata != nullptr) { Userdata *ud = (Userdata *)vf.userdata; vf.data_copy = ud->data_copy_malloc; ud->data_copy_current_src = Userdata::FROM_MALLOC; } else { vf.data_copy = nullptr; } return vf; } bmusb::FrameAllocator::Frame PBOFrameAllocator::create_frame(size_t width, size_t height, size_t stride) { Frame vf; { lock_guard lock(freelist_mutex); if (freelist.empty()) { printf("Frame overrun (no more spare PBO frames), dropping frame!\n"); vf.len = 0; vf.overflow = 0; return vf; } else { vf = freelist.front(); freelist.pop(); } } vf.len = 0; vf.overflow = 0; Userdata *userdata = (Userdata *)vf.userdata; if (mjpeg_encoder != nullptr && mjpeg_encoder->should_encode_mjpeg_for_card(card_index)) { if (mjpeg_encoder->using_vaapi()) { VADisplay va_dpy = mjpeg_encoder->va_dpy->va_dpy; VAResourcePool::VAResources resources = mjpeg_encoder->get_va_pool()->get_va_resources(width, height, VA_FOURCC_UYVY); // Only used by DeckLinkCapture, so always 4:2:2. ReleaseVAResources release(mjpeg_encoder->get_va_pool(), resources); if (resources.image.pitches[0] == stride) { userdata->va_resources = move(resources); userdata->va_resources_release = move(release); VAStatus va_status = vaMapBuffer(va_dpy, resources.image.buf, (void **)&vf.data_copy); CHECK_VASTATUS(va_status, "vaMapBuffer"); vf.data_copy += resources.image.offsets[0]; userdata->data_copy_current_src = Userdata::FROM_VA_API; } else { printf("WARNING: Could not copy directly into VA-API MJPEG buffer for %zu x %zu, since producer and consumer disagreed on stride (%zu != %d).\n", width, height, stride, resources.image.pitches[0]); vf.data_copy = userdata->data_copy_malloc; userdata->data_copy_current_src = Userdata::FROM_MALLOC; } } else { vf.data_copy = userdata->data_copy_malloc; userdata->data_copy_current_src = Userdata::FROM_MALLOC; } } else { vf.data_copy = nullptr; } return vf; } void PBOFrameAllocator::release_frame(Frame frame) { if (frame.overflow > 0) { printf("%d bytes overflow after last (PBO) frame\n", int(frame.overflow)); } #if 0 // Poison the page. (Note that this might be bogus if you don't have an OpenGL context.) memset(frame.data, 0, frame.size); Userdata *userdata = (Userdata *)frame.userdata; for (unsigned field = 0; field < 2; ++field) { glBindTexture(GL_TEXTURE_2D, userdata->tex_y[field]); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_MIN_FILTER, GL_LINEAR); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_S, GL_CLAMP_TO_EDGE); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_T, GL_CLAMP_TO_EDGE); check_error(); glTexImage2D(GL_TEXTURE_2D, 0, GL_R8, userdata->last_width[field], userdata->last_height[field], 0, GL_RED, GL_UNSIGNED_BYTE, nullptr); check_error(); glBindTexture(GL_TEXTURE_2D, userdata->tex_cbcr[field]); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_MIN_FILTER, GL_LINEAR); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_S, GL_CLAMP_TO_EDGE); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_T, GL_CLAMP_TO_EDGE); check_error(); glTexImage2D(GL_TEXTURE_2D, 0, GL_RG8, userdata->last_width[field] / 2, userdata->last_height[field], 0, GL_RED, GL_UNSIGNED_BYTE, nullptr); check_error(); } #endif { // In case we never got to upload the frame to MJPEGEncoder. Userdata *userdata = (Userdata *)frame.userdata; VAResourcePool::VAResources resources __attribute__((unused)) = move(userdata->va_resources); ReleaseVAResources release = move(userdata->va_resources_release); if (frame.data_copy != nullptr && userdata->data_copy_current_src == Userdata::FROM_VA_API) { VADisplay va_dpy = mjpeg_encoder->va_dpy->va_dpy; VAStatus va_status = vaUnmapBuffer(va_dpy, resources.image.buf); CHECK_VASTATUS(va_status, "vaUnmapBuffer"); frame.data_copy = nullptr; } } lock_guard lock(freelist_mutex); Userdata *userdata = (Userdata *)frame.userdata; if (userdata->generation == generation) { freelist.push(frame); } else { destroy_frame(&frame); } //--sumsum; } void PBOFrameAllocator::reconfigure(bmusb::PixelFormat pixel_format, size_t frame_size, GLuint width, GLuint height, unsigned card_index, MJPEGEncoder *mjpeg_encoder, size_t num_queued_frames, GLenum buffer, GLenum permissions, GLenum map_bits) { if (pixel_format == this->pixel_format && frame_size == this->frame_size && width == this->width && height == this->height && card_index == this->card_index && mjpeg_encoder == this->mjpeg_encoder && num_queued_frames == this->num_queued_frames && buffer == this->buffer && permissions == this->permissions && map_bits == this->map_bits) { return; } lock_guard lock(freelist_mutex); lingering_generations[generation] = LingeringGeneration{ move(userdata), this->num_queued_frames }; ++generation; while (!freelist.empty()) { Frame frame = freelist.front(); freelist.pop(); destroy_frame(&frame); } this->pixel_format = pixel_format; this->frame_size = frame_size; this->width = width; this->height = height; this->card_index = card_index; this->mjpeg_encoder = mjpeg_encoder; this->num_queued_frames = num_queued_frames; this->buffer = buffer; this->permissions = permissions; this->map_bits = map_bits; userdata.reset(new Userdata[num_queued_frames]); for (size_t i = 0; i < num_queued_frames; ++i) { init_frame(i, frame_size, width, height, permissions, map_bits, generation); } // There may still be frames out with the old configuration // (for instance, living in GLWidget); they will be destroyed // when they come back in release_frame(). } nageru-2.3.0/nageru/pbo_frame_allocator.h000066400000000000000000000111711450736322200204260ustar00rootroot00000000000000#ifndef _PBO_FRAME_ALLOCATOR #define _PBO_FRAME_ALLOCATOR 1 #include #include #include #include #include #include #include #include "bmusb/bmusb.h" #include "mjpeg_encoder.h" class MJPEGEncoder; // An allocator that allocates straight into OpenGL pinned memory. // Meant for video frames only. We use a queue rather than a stack, // since we want to maximize pipelineability. class PBOFrameAllocator : public bmusb::FrameAllocator { public: // Note: You need to have an OpenGL context when calling // the constructor. PBOFrameAllocator(bmusb::PixelFormat pixel_format, size_t frame_size, GLuint width, GLuint height, unsigned card_index, MJPEGEncoder *mjpeg_encoder = nullptr, size_t num_queued_frames = 16, GLenum buffer = GL_PIXEL_UNPACK_BUFFER_ARB, GLenum permissions = GL_MAP_WRITE_BIT, GLenum map_bits = GL_MAP_FLUSH_EXPLICIT_BIT); ~PBOFrameAllocator() override; Frame alloc_frame() override; Frame create_frame(size_t width, size_t height, size_t stride) override; void release_frame(Frame frame) override; // NOTE: Does not check the buffer types; they are just assumed to be compatible. void reconfigure(bmusb::PixelFormat pixel_format, size_t frame_size, GLuint width, GLuint height, unsigned card_index, MJPEGEncoder *mjpeg_encoder = nullptr, size_t num_queued_frames = 16, GLenum buffer = GL_PIXEL_UNPACK_BUFFER_ARB, GLenum permissions = GL_MAP_WRITE_BIT, GLenum map_bits = GL_MAP_FLUSH_EXPLICIT_BIT); struct Userdata { GLuint pbo; // NOTE: These frames typically go into LiveInputWrapper, which is // configured to accept one type of frame only. In other words, // the existence of a format field doesn't mean you can set it // freely at runtime. bmusb::PixelFormat pixel_format; // Used only for PixelFormat_8BitYCbCrPlanar. movit::YCbCrFormat ycbcr_format; // The second set is only used for the second field of interlaced inputs. GLuint tex_y[2], tex_cbcr[2]; // For PixelFormat_8BitYCbCr. GLuint tex_cb[2], tex_cr[2]; // For PixelFormat_8BitYCbCrPlanar (which also uses tex_y). GLuint tex_v210[2], tex_444[2]; // For PixelFormat_10BitYCbCr. GLuint tex_rgba[2]; // For PixelFormat_8BitBGRA. GLuint last_width[2], last_height[2]; GLuint last_cbcr_width[2], last_cbcr_height[2]; GLuint last_v210_width[2]; // PixelFormat_10BitYCbCr. bool last_interlaced, last_has_signal, last_is_connected; unsigned last_frame_rate_nom, last_frame_rate_den; bool has_last_subtitle = false; std::string last_subtitle; movit::RGBTriplet white_balance{1.0f, 1.0f, 1.0f}; // These are the source of the “data_copy” member in Frame, // used for MJPEG encoding. There are three possibilities: // // - MJPEG encoding is not active (at all, or for this specific // card). Then data_copy is nullptr, and what's in here // does not matter at all. // - We can encode directly into VA-API buffers (ie., VA-API // is active, and nothing strange happened wrt. strides); // then va_resources, va_resources_release and va_image // are fetched from MJPEGEncoder at create_frame() and released // back when the frame is uploaded (or would have been). // In this case, data_copy points into the mapped VAImage. // - If not, data_copy points to data_copy_malloc, and is copied // from there into VA-API buffers (by MJPEGEncoder) if needed. enum { FROM_MALLOC, FROM_VA_API } data_copy_current_src; uint8_t *data_copy_malloc; VAResourcePool::VAResources va_resources; ReleaseVAResources va_resources_release; int generation; }; private: void init_frame(size_t frame_idx, size_t frame_size, GLuint width, GLuint height, GLenum permissions, GLenum map_bits, int generation); void destroy_frame(Frame *frame); unsigned card_index; MJPEGEncoder *mjpeg_encoder; bmusb::PixelFormat pixel_format; std::mutex freelist_mutex; std::queue freelist; GLenum buffer; std::unique_ptr userdata; // Used only for reconfigure(), to check whether we can do without. size_t frame_size; size_t num_queued_frames; GLuint width, height; GLenum permissions; GLenum map_bits; int generation = 0; // Under freelist_mutex. struct LingeringGeneration { std::unique_ptr userdata; size_t num_frames_left; }; std::map lingering_generations; }; #endif // !defined(_PBO_FRAME_ALLOCATOR) nageru-2.3.0/nageru/piecewise_interpolator.cpp000066400000000000000000000024121450736322200215440ustar00rootroot00000000000000#include "piecewise_interpolator.h" #include double PiecewiseInterpolator::fraction_to_db(double db) const { if (db >= control_points[0].fraction) { return control_points[0].db_value; } if (db <= control_points.back().fraction) { return control_points.back().db_value; } for (unsigned i = 1; i < control_points.size(); ++i) { const double x0 = control_points[i].fraction; const double x1 = control_points[i - 1].fraction; const double y0 = control_points[i].db_value; const double y1 = control_points[i - 1].db_value; if (db >= x0 && db <= x1) { const double t = (db - x0) / (x1 - x0); return y0 + t * (y1 - y0); } } assert(false); } double PiecewiseInterpolator::db_to_fraction(double x) const { if (x >= control_points[0].db_value) { return control_points[0].fraction; } if (x <= control_points.back().db_value) { return control_points.back().fraction; } for (unsigned i = 1; i < control_points.size(); ++i) { const double x0 = control_points[i].db_value; const double x1 = control_points[i - 1].db_value; const double y0 = control_points[i].fraction; const double y1 = control_points[i - 1].fraction; if (x >= x0 && x <= x1) { const double t = (x - x0) / (x1 - x0); return y0 + t * (y1 - y0); } } assert(false); } nageru-2.3.0/nageru/piecewise_interpolator.h000066400000000000000000000013421450736322200212120ustar00rootroot00000000000000#ifndef _PIECEWISE_INTERPOLATOR_H #define _PIECEWISE_INTERPOLATOR_H // A class to do piecewise linear interpolation of one scale to another // (and back). Typically used to implement nonlinear dB mappings for sliders // or meters, thus the nomenclature. #include class PiecewiseInterpolator { public: // Both dB and fraction values must go from high to low. struct ControlPoint { double db_value; double fraction; }; PiecewiseInterpolator(const std::vector &control_points) : control_points(control_points) {} double fraction_to_db(double db) const; double db_to_fraction(double x) const; private: const std::vector control_points; }; #endif // !defined(_PIECEWISE_INTERPOLATOR_H) nageru-2.3.0/nageru/print_latency.cpp000066400000000000000000000112631450736322200176440ustar00rootroot00000000000000#include "print_latency.h" #include "flags.h" #include "shared/metrics.h" #include "mixer.h" #include #include #include #include using namespace std; using namespace std::chrono; ReceivedTimestamps find_received_timestamp(const vector &input_frames) { assert(input_frames.size() == MAX_VIDEO_CARDS * FRAME_HISTORY_LENGTH); ReceivedTimestamps ts; for (unsigned card_index = 0; card_index < MAX_VIDEO_CARDS; ++card_index) { for (unsigned frame_index = 0; frame_index < FRAME_HISTORY_LENGTH; ++frame_index) { const RefCountedFrame &input_frame = input_frames[card_index * FRAME_HISTORY_LENGTH + frame_index]; if (input_frame == nullptr || (frame_index > 0 && input_frame.get() == input_frames[card_index * FRAME_HISTORY_LENGTH + frame_index - 1].get())) { ts.ts.push_back(steady_clock::time_point::min()); } else { ts.ts.push_back(input_frame->received_timestamp); } } } return ts; } void LatencyHistogram::init(const string &measuring_point) { summaries.resize(MAX_VIDEO_CARDS * FRAME_HISTORY_LENGTH * 2); for (unsigned card_index = 0; card_index < MAX_VIDEO_CARDS; ++card_index) { char card_index_str[64]; snprintf(card_index_str, sizeof(card_index_str), "%u", card_index); summaries[card_index].resize(FRAME_HISTORY_LENGTH); for (unsigned frame_index = 0; frame_index < FRAME_HISTORY_LENGTH; ++frame_index) { char frame_index_str[64]; snprintf(frame_index_str, sizeof(frame_index_str), "%u", frame_index); vector quantiles{0.01, 0.1, 0.25, 0.5, 0.75, 0.9, 0.99}; summaries[card_index][frame_index].reset(new Summary[3]); summaries[card_index][frame_index][0].init(quantiles, 60.0); summaries[card_index][frame_index][1].init(quantiles, 60.0); summaries[card_index][frame_index][2].init(quantiles, 60.0); global_metrics.add("latency_seconds", {{ "measuring_point", measuring_point }, { "card", card_index_str }, { "frame_age", frame_index_str }, { "frame_type", "i/p" }}, &summaries[card_index][frame_index][0], Metrics::PRINT_WHEN_NONEMPTY); global_metrics.add("latency_seconds", {{ "measuring_point", measuring_point }, { "card", card_index_str }, { "frame_age", frame_index_str }, { "frame_type", "b" }}, &summaries[card_index][frame_index][1], Metrics::PRINT_WHEN_NONEMPTY); global_metrics.add("latency_seconds", {{ "measuring_point", measuring_point }, { "card", card_index_str }, { "frame_age", frame_index_str }, { "frame_type", "total" }}, &summaries[card_index][frame_index][2], Metrics::PRINT_WHEN_NONEMPTY); } } } void print_latency(const char *header, const ReceivedTimestamps &received_ts, bool is_b_frame, int *frameno, LatencyHistogram *histogram) { if (received_ts.ts.empty()) return; const steady_clock::time_point now = steady_clock::now(); if (global_mixer == nullptr) { // Kaeru. assert(received_ts.ts.size() == 1); steady_clock::time_point ts = received_ts.ts[0]; if (ts != steady_clock::time_point::min()) { duration latency = now - ts; histogram->summaries[0][0][is_b_frame].count_event(latency.count()); histogram->summaries[0][0][2].count_event(latency.count()); } } else { assert(received_ts.ts.size() == MAX_VIDEO_CARDS * FRAME_HISTORY_LENGTH); for (unsigned card_index = 0; card_index < MAX_VIDEO_CARDS; ++card_index) { for (unsigned frame_index = 0; frame_index < FRAME_HISTORY_LENGTH; ++frame_index) { steady_clock::time_point ts = received_ts.ts[card_index * FRAME_HISTORY_LENGTH + frame_index]; if (ts == steady_clock::time_point::min()) { continue; } duration latency = now - ts; histogram->summaries[card_index][frame_index][is_b_frame].count_event(latency.count()); histogram->summaries[card_index][frame_index][2].count_event(latency.count()); } } } // 101 is chosen so that it's prime, which is unlikely to get the same frame type every time. if (global_flags.print_video_latency && (++*frameno % 101) == 0) { // Find min and max timestamp of all input frames that have a timestamp. steady_clock::time_point min_ts = steady_clock::time_point::max(), max_ts = steady_clock::time_point::min(); for (const auto &ts : received_ts.ts) { if (ts > steady_clock::time_point::min()) { min_ts = min(min_ts, ts); max_ts = max(max_ts, ts); } } duration lowest_latency = now - max_ts; duration highest_latency = now - min_ts; printf("%-60s %4.0f ms (lowest-latency input), %4.0f ms (highest-latency input)", header, 1e3 * lowest_latency.count(), 1e3 * highest_latency.count()); if (is_b_frame) { printf(" [on B-frame; potential extra latency]\n"); } else { printf("\n"); } } } nageru-2.3.0/nageru/print_latency.h000066400000000000000000000023271450736322200173120ustar00rootroot00000000000000#ifndef _PRINT_LATENCY_H #define _PRINT_LATENCY_H 1 // A small utility function to print the latency between two end points // (typically when the frame was received from the video card, and some // point when the frame is ready to be output in some form). #include #include #include #include "ref_counted_frame.h" #include "shared/metrics.h" // Since every output frame is based on multiple input frames, we need // more than one start timestamp; one for each input. // For all of these, steady_clock::time_point::min() is used for “not set”. struct ReceivedTimestamps { std::vector ts; }; struct LatencyHistogram { void init(const std::string &measuring_point); // Initializes histograms and registers them in global_metrics. // Indices: card number, frame history number, b-frame or not (1/0, where 2 counts both). std::vector>> summaries; }; ReceivedTimestamps find_received_timestamp(const std::vector &input_frames); void print_latency(const char *header, const ReceivedTimestamps &received_ts, bool is_b_frame, int *frameno, LatencyHistogram *histogram); #endif // !defined(_PRINT_LATENCY_H) nageru-2.3.0/nageru/queue_length_policy.h000066400000000000000000000117351450736322200205060ustar00rootroot00000000000000#ifndef _QUEUE_LENGTH_POLICY_H #define _QUEUE_LENGTH_POLICY_H 1 #include #include #include #include // A class to estimate the future jitter. Used in QueueLengthPolicy (see below). // // There are many ways to estimate jitter; I've tested a few ones (and also // some algorithms that don't explicitly model jitter) with different // parameters on some real-life data in experiments/queue_drop_policy.cpp. // This is one based on simple order statistics where I've added some margin in // the number of starvation events; I believe that about one every hour would // probably be acceptable, but this one typically goes lower than that, at the // cost of 2–3 ms extra latency. (If the queue is hard-limited to one frame, it's // possible to get ~10 ms further down, but this would mean framedrops every // second or so.) The general strategy is: Take the 99.9-percentile jitter over // last 5000 frames, multiply by two, and that's our worst-case jitter // estimate. The fact that we're not using the max value means that we could // actually even throw away very late frames immediately, which means we only // get one user-visible event instead of seeing something both when the frame // arrives late (duplicate frame) and then again when we drop. class JitterHistory { private: static constexpr size_t history_length = 5000; static constexpr double percentile = 0.999; static constexpr double multiplier = 2.0; public: void register_metrics(const std::vector> &labels); void unregister_metrics(const std::vector> &labels); void clear() { history.clear(); orders.clear(); expected_timestamp = std::chrono::steady_clock::time_point::min(); } void frame_arrived(std::chrono::steady_clock::time_point now, int64_t frame_duration, size_t dropped_frames); std::chrono::steady_clock::time_point get_expected_next_frame() const { return expected_timestamp; } double estimate_max_jitter() const; private: // A simple O(k) based algorithm for getting the k-th largest or // smallest element from our window; we simply keep the multiset // ordered (insertions and deletions are O(n) as always) and then // iterate from one of the sides. If we had larger values of k, // we could go for a more complicated setup with two sets or heaps // (one increasing and one decreasing) that we keep balanced around // the point, or it is possible to reimplement std::set with // counts in each node. However, since k=5, we don't need this. std::multiset orders; std::deque::iterator> history; std::chrono::steady_clock::time_point expected_timestamp = std::chrono::steady_clock::time_point::min(); int64_t last_duration = 0; // Metrics. There are no direct summaries for jitter, since we already have latency summaries. std::atomic metric_input_underestimated_jitter_frames{0}; std::atomic metric_input_estimated_max_jitter_seconds{0.0 / 0.0}; }; // For any card that's not the master (where we pick out the frames as they // come, as fast as we can process), there's going to be a queue. The question // is when we should drop frames from that queue (apart from the obvious // dropping if the 16-frame queue should become full), especially given that // the frame rate could be lower or higher than the master (either subtly or // dramatically). We have two (conflicting) demands: // // 1. We want to avoid starving the queue. // 2. We don't want to add more delay than is needed. // // Our general strategy is to drop as many frames as we can (helping for #2) // that we think is safe for #1 given jitter. To this end, we measure the // deviation from the expected arrival time for all cards, and use that for // continuous jitter estimation. // // We then drop everything from the queue that we're sure we won't need to // serve the output in the time before the next frame arrives. Typically, // this means the queue will contain 0 or 1 frames, although more is also // possible if the jitter is very high. class QueueLengthPolicy { public: QueueLengthPolicy() {} void register_metrics(const std::vector> &labels); void unregister_metrics(const std::vector> &labels); // Call after picking out a frame, so 0 means starvation. // Note that the policy has no memory; everything is given in as parameters. void update_policy(std::chrono::steady_clock::time_point now, std::chrono::steady_clock::time_point expected_next_input_frame, int64_t input_frame_duration, int64_t master_frame_duration, double max_input_card_jitter_seconds, double max_master_card_jitter_seconds); unsigned get_safe_queue_length() const { return safe_queue_length; } private: unsigned safe_queue_length = 0; // Can never go below zero. // Metrics. std::atomic metric_input_queue_safe_length_frames{1}; }; #endif // !defined(_QUEUE_LENGTH_POLICY_H) nageru-2.3.0/nageru/quicksync_encoder.cpp000066400000000000000000002273021450736322200205040ustar00rootroot00000000000000#include "quicksync_encoder.h" #include #include // Must be above the Xlib includes. #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include extern "C" { #include #include #include #include } // namespace #include "audio_encoder.h" #include "shared/context.h" #include "defs.h" #include "shared/disk_space_estimator.h" #include "shared/ffmpeg_raii.h" #include "flags.h" #include "shared/mux.h" #include "print_latency.h" #include "quicksync_encoder_impl.h" #include "ref_counted_frame.h" #include "shared/timebase.h" #include "x264_encoder.h" using namespace movit; using namespace std; using namespace std::chrono; using namespace std::placeholders; class QOpenGLContext; class QSurface; namespace { // These need to survive several QuickSyncEncoderImpl instances, // so they are outside. once_flag quick_sync_metrics_inited; LatencyHistogram mixer_latency_histogram, qs_latency_histogram; MuxMetrics current_file_mux_metrics, total_mux_metrics; std::atomic metric_current_file_start_time_seconds{0.0 / 0.0}; std::atomic metric_quick_sync_stalled_frames{0}; } // namespace #define CHECK_VASTATUS(va_status, func) \ if (va_status != VA_STATUS_SUCCESS) { \ fprintf(stderr, "%s:%d (%s) failed with %d\n", __func__, __LINE__, func, va_status); \ abort(); \ } #undef BUFFER_OFFSET #define BUFFER_OFFSET(i) ((char *)NULL + (i)) //#include "loadsurface.h" #define NAL_REF_IDC_NONE 0 #define NAL_REF_IDC_LOW 1 #define NAL_REF_IDC_MEDIUM 2 #define NAL_REF_IDC_HIGH 3 #define NAL_NON_IDR 1 #define NAL_IDR 5 #define NAL_SPS 7 #define NAL_PPS 8 #define NAL_SEI 6 #define SLICE_TYPE_P 0 #define SLICE_TYPE_B 1 #define SLICE_TYPE_I 2 #define IS_P_SLICE(type) (SLICE_TYPE_P == (type)) #define IS_B_SLICE(type) (SLICE_TYPE_B == (type)) #define IS_I_SLICE(type) (SLICE_TYPE_I == (type)) #define ENTROPY_MODE_CAVLC 0 #define ENTROPY_MODE_CABAC 1 #define PROFILE_IDC_BASELINE 66 #define PROFILE_IDC_MAIN 77 #define PROFILE_IDC_HIGH 100 #define BITSTREAM_ALLOCATE_STEPPING 4096 static constexpr unsigned int MaxFrameNum = (2<<16); static constexpr unsigned int MaxPicOrderCntLsb = (2<<8); static constexpr unsigned int Log2MaxFrameNum = 16; static constexpr unsigned int Log2MaxPicOrderCntLsb = 8; using namespace std; // Supposedly vaRenderPicture() is supposed to destroy the buffer implicitly, // but if we don't delete it here, we get leaks. The GStreamer implementation // does the same. static void render_picture_and_delete(VADisplay dpy, VAContextID context, VABufferID *buffers, int num_buffers) { VAStatus va_status = vaRenderPicture(dpy, context, buffers, num_buffers); CHECK_VASTATUS(va_status, "vaRenderPicture"); for (int i = 0; i < num_buffers; ++i) { va_status = vaDestroyBuffer(dpy, buffers[i]); CHECK_VASTATUS(va_status, "vaDestroyBuffer"); } } static unsigned int va_swap32(unsigned int val) { unsigned char *pval = (unsigned char *)&val; return ((pval[0] << 24) | (pval[1] << 16) | (pval[2] << 8) | (pval[3] << 0)); } static void bitstream_start(bitstream *bs) { bs->max_size_in_dword = BITSTREAM_ALLOCATE_STEPPING; bs->buffer = (unsigned int *)calloc(bs->max_size_in_dword * sizeof(int), 1); bs->bit_offset = 0; } static void bitstream_end(bitstream *bs) { int pos = (bs->bit_offset >> 5); int bit_offset = (bs->bit_offset & 0x1f); int bit_left = 32 - bit_offset; if (bit_offset) { bs->buffer[pos] = va_swap32((bs->buffer[pos] << bit_left)); } } static void bitstream_put_ui(bitstream *bs, unsigned int val, int size_in_bits) { int pos = (bs->bit_offset >> 5); int bit_offset = (bs->bit_offset & 0x1f); int bit_left = 32 - bit_offset; if (!size_in_bits) return; bs->bit_offset += size_in_bits; if (bit_left > size_in_bits) { bs->buffer[pos] = (bs->buffer[pos] << size_in_bits | val); } else { size_in_bits -= bit_left; if (bit_left >= 32) { bs->buffer[pos] = (val >> size_in_bits); } else { bs->buffer[pos] = (bs->buffer[pos] << bit_left) | (val >> size_in_bits); } bs->buffer[pos] = va_swap32(bs->buffer[pos]); if (pos + 1 == bs->max_size_in_dword) { bs->max_size_in_dword += BITSTREAM_ALLOCATE_STEPPING; bs->buffer = (unsigned int *)realloc(bs->buffer, bs->max_size_in_dword * sizeof(unsigned int)); } bs->buffer[pos + 1] = val; } } static void bitstream_put_ue(bitstream *bs, unsigned int val) { int size_in_bits = 0; int tmp_val = ++val; while (tmp_val) { tmp_val >>= 1; size_in_bits++; } bitstream_put_ui(bs, 0, size_in_bits - 1); // leading zero bitstream_put_ui(bs, val, size_in_bits); } static void bitstream_put_se(bitstream *bs, int val) { unsigned int new_val; if (val <= 0) new_val = -2 * val; else new_val = 2 * val - 1; bitstream_put_ue(bs, new_val); } static void bitstream_byte_aligning(bitstream *bs, int bit) { int bit_offset = (bs->bit_offset & 0x7); int bit_left = 8 - bit_offset; int new_val; if (!bit_offset) return; assert(bit == 0 || bit == 1); if (bit) new_val = (1 << bit_left) - 1; else new_val = 0; bitstream_put_ui(bs, new_val, bit_left); } static void rbsp_trailing_bits(bitstream *bs) { bitstream_put_ui(bs, 1, 1); bitstream_byte_aligning(bs, 0); } static void nal_start_code_prefix(bitstream *bs) { bitstream_put_ui(bs, 0x00000001, 32); } static void nal_header(bitstream *bs, int nal_ref_idc, int nal_unit_type) { bitstream_put_ui(bs, 0, 1); /* forbidden_zero_bit: 0 */ bitstream_put_ui(bs, nal_ref_idc, 2); bitstream_put_ui(bs, nal_unit_type, 5); } void QuickSyncEncoderImpl::sps_rbsp(YCbCrLumaCoefficients ycbcr_coefficients, bitstream *bs) { int profile_idc = PROFILE_IDC_BASELINE; if (h264_profile == VAProfileH264High) profile_idc = PROFILE_IDC_HIGH; else if (h264_profile == VAProfileH264Main) profile_idc = PROFILE_IDC_MAIN; bitstream_put_ui(bs, profile_idc, 8); /* profile_idc */ bitstream_put_ui(bs, !!(constraint_set_flag & 1), 1); /* constraint_set0_flag */ bitstream_put_ui(bs, !!(constraint_set_flag & 2), 1); /* constraint_set1_flag */ bitstream_put_ui(bs, !!(constraint_set_flag & 4), 1); /* constraint_set2_flag */ bitstream_put_ui(bs, !!(constraint_set_flag & 8), 1); /* constraint_set3_flag */ bitstream_put_ui(bs, 0, 4); /* reserved_zero_4bits */ bitstream_put_ui(bs, seq_param.level_idc, 8); /* level_idc */ bitstream_put_ue(bs, seq_param.seq_parameter_set_id); /* seq_parameter_set_id */ if ( profile_idc == PROFILE_IDC_HIGH) { bitstream_put_ue(bs, 1); /* chroma_format_idc = 1, 4:2:0 */ bitstream_put_ue(bs, 0); /* bit_depth_luma_minus8 */ bitstream_put_ue(bs, 0); /* bit_depth_chroma_minus8 */ bitstream_put_ui(bs, 0, 1); /* qpprime_y_zero_transform_bypass_flag */ bitstream_put_ui(bs, 0, 1); /* seq_scaling_matrix_present_flag */ } bitstream_put_ue(bs, seq_param.seq_fields.bits.log2_max_frame_num_minus4); /* log2_max_frame_num_minus4 */ bitstream_put_ue(bs, seq_param.seq_fields.bits.pic_order_cnt_type); /* pic_order_cnt_type */ if (seq_param.seq_fields.bits.pic_order_cnt_type == 0) bitstream_put_ue(bs, seq_param.seq_fields.bits.log2_max_pic_order_cnt_lsb_minus4); /* log2_max_pic_order_cnt_lsb_minus4 */ else { assert(0); } bitstream_put_ue(bs, seq_param.max_num_ref_frames); /* num_ref_frames */ bitstream_put_ui(bs, 0, 1); /* gaps_in_frame_num_value_allowed_flag */ bitstream_put_ue(bs, seq_param.picture_width_in_mbs - 1); /* pic_width_in_mbs_minus1 */ bitstream_put_ue(bs, seq_param.picture_height_in_mbs - 1); /* pic_height_in_map_units_minus1 */ bitstream_put_ui(bs, seq_param.seq_fields.bits.frame_mbs_only_flag, 1); /* frame_mbs_only_flag */ if (!seq_param.seq_fields.bits.frame_mbs_only_flag) { assert(0); } bitstream_put_ui(bs, seq_param.seq_fields.bits.direct_8x8_inference_flag, 1); /* direct_8x8_inference_flag */ bitstream_put_ui(bs, seq_param.frame_cropping_flag, 1); /* frame_cropping_flag */ if (seq_param.frame_cropping_flag) { bitstream_put_ue(bs, seq_param.frame_crop_left_offset); /* frame_crop_left_offset */ bitstream_put_ue(bs, seq_param.frame_crop_right_offset); /* frame_crop_right_offset */ bitstream_put_ue(bs, seq_param.frame_crop_top_offset); /* frame_crop_top_offset */ bitstream_put_ue(bs, seq_param.frame_crop_bottom_offset); /* frame_crop_bottom_offset */ } //if ( frame_bit_rate < 0 ) { //TODO EW: the vui header isn't correct if ( false ) { bitstream_put_ui(bs, 0, 1); /* vui_parameters_present_flag */ } else { // See H.264 annex E for the definition of this header. bitstream_put_ui(bs, 1, 1); /* vui_parameters_present_flag */ bitstream_put_ui(bs, 0, 1); /* aspect_ratio_info_present_flag */ bitstream_put_ui(bs, 0, 1); /* overscan_info_present_flag */ bitstream_put_ui(bs, 1, 1); /* video_signal_type_present_flag */ { bitstream_put_ui(bs, 5, 3); /* video_format (5 = Unspecified) */ bitstream_put_ui(bs, 0, 1); /* video_full_range_flag */ bitstream_put_ui(bs, 1, 1); /* colour_description_present_flag */ { bitstream_put_ui(bs, 1, 8); /* colour_primaries (1 = BT.709) */ bitstream_put_ui(bs, 13, 8); /* transfer_characteristics (13 = sRGB) */ if (ycbcr_coefficients == YCBCR_REC_709) { bitstream_put_ui(bs, 1, 8); /* matrix_coefficients (1 = BT.709) */ } else { assert(ycbcr_coefficients == YCBCR_REC_601); bitstream_put_ui(bs, 6, 8); /* matrix_coefficients (6 = BT.601/SMPTE 170M) */ } } } bitstream_put_ui(bs, 0, 1); /* chroma_loc_info_present_flag */ bitstream_put_ui(bs, 1, 1); /* timing_info_present_flag */ { bitstream_put_ui(bs, 1, 32); // FPS bitstream_put_ui(bs, TIMEBASE * 2, 32); // FPS bitstream_put_ui(bs, 1, 1); } bitstream_put_ui(bs, 1, 1); /* nal_hrd_parameters_present_flag */ { // hrd_parameters bitstream_put_ue(bs, 0); /* cpb_cnt_minus1 */ bitstream_put_ui(bs, 4, 4); /* bit_rate_scale */ bitstream_put_ui(bs, 6, 4); /* cpb_size_scale */ bitstream_put_ue(bs, frame_bitrate - 1); /* bit_rate_value_minus1[0] */ bitstream_put_ue(bs, frame_bitrate*8 - 1); /* cpb_size_value_minus1[0] */ bitstream_put_ui(bs, 1, 1); /* cbr_flag[0] */ bitstream_put_ui(bs, 23, 5); /* initial_cpb_removal_delay_length_minus1 */ bitstream_put_ui(bs, 23, 5); /* cpb_removal_delay_length_minus1 */ bitstream_put_ui(bs, 23, 5); /* dpb_output_delay_length_minus1 */ bitstream_put_ui(bs, 23, 5); /* time_offset_length */ } bitstream_put_ui(bs, 0, 1); /* vcl_hrd_parameters_present_flag */ bitstream_put_ui(bs, 0, 1); /* low_delay_hrd_flag */ bitstream_put_ui(bs, 0, 1); /* pic_struct_present_flag */ bitstream_put_ui(bs, 0, 1); /* bitstream_restriction_flag */ } rbsp_trailing_bits(bs); /* rbsp_trailing_bits */ } void QuickSyncEncoderImpl::pps_rbsp(bitstream *bs) { bitstream_put_ue(bs, pic_param.pic_parameter_set_id); /* pic_parameter_set_id */ bitstream_put_ue(bs, pic_param.seq_parameter_set_id); /* seq_parameter_set_id */ bitstream_put_ui(bs, pic_param.pic_fields.bits.entropy_coding_mode_flag, 1); /* entropy_coding_mode_flag */ bitstream_put_ui(bs, 0, 1); /* pic_order_present_flag: 0 */ bitstream_put_ue(bs, 0); /* num_slice_groups_minus1 */ bitstream_put_ue(bs, pic_param.num_ref_idx_l0_active_minus1); /* num_ref_idx_l0_active_minus1 */ bitstream_put_ue(bs, pic_param.num_ref_idx_l1_active_minus1); /* num_ref_idx_l1_active_minus1 1 */ bitstream_put_ui(bs, pic_param.pic_fields.bits.weighted_pred_flag, 1); /* weighted_pred_flag: 0 */ bitstream_put_ui(bs, pic_param.pic_fields.bits.weighted_bipred_idc, 2); /* weighted_bipred_idc: 0 */ bitstream_put_se(bs, pic_param.pic_init_qp - 26); /* pic_init_qp_minus26 */ bitstream_put_se(bs, 0); /* pic_init_qs_minus26 */ bitstream_put_se(bs, 0); /* chroma_qp_index_offset */ bitstream_put_ui(bs, pic_param.pic_fields.bits.deblocking_filter_control_present_flag, 1); /* deblocking_filter_control_present_flag */ bitstream_put_ui(bs, 0, 1); /* constrained_intra_pred_flag */ bitstream_put_ui(bs, 0, 1); /* redundant_pic_cnt_present_flag */ /* more_rbsp_data */ bitstream_put_ui(bs, pic_param.pic_fields.bits.transform_8x8_mode_flag, 1); /*transform_8x8_mode_flag */ bitstream_put_ui(bs, 0, 1); /* pic_scaling_matrix_present_flag */ bitstream_put_se(bs, pic_param.second_chroma_qp_index_offset ); /*second_chroma_qp_index_offset */ rbsp_trailing_bits(bs); } void QuickSyncEncoderImpl::slice_header(bitstream *bs) { int first_mb_in_slice = slice_param.macroblock_address; bitstream_put_ue(bs, first_mb_in_slice); /* first_mb_in_slice: 0 */ bitstream_put_ue(bs, slice_param.slice_type); /* slice_type */ bitstream_put_ue(bs, slice_param.pic_parameter_set_id); /* pic_parameter_set_id: 0 */ bitstream_put_ui(bs, pic_param.frame_num, seq_param.seq_fields.bits.log2_max_frame_num_minus4 + 4); /* frame_num */ /* frame_mbs_only_flag == 1 */ if (!seq_param.seq_fields.bits.frame_mbs_only_flag) { /* FIXME: */ assert(0); } if (pic_param.pic_fields.bits.idr_pic_flag) bitstream_put_ue(bs, slice_param.idr_pic_id); /* idr_pic_id: 0 */ if (seq_param.seq_fields.bits.pic_order_cnt_type == 0) { bitstream_put_ui(bs, pic_param.CurrPic.TopFieldOrderCnt, seq_param.seq_fields.bits.log2_max_pic_order_cnt_lsb_minus4 + 4); /* pic_order_present_flag == 0 */ } else { /* FIXME: */ assert(0); } /* redundant_pic_cnt_present_flag == 0 */ /* slice type */ if (IS_P_SLICE(slice_param.slice_type)) { bitstream_put_ui(bs, slice_param.num_ref_idx_active_override_flag, 1); /* num_ref_idx_active_override_flag: */ if (slice_param.num_ref_idx_active_override_flag) bitstream_put_ue(bs, slice_param.num_ref_idx_l0_active_minus1); /* ref_pic_list_reordering */ bitstream_put_ui(bs, 0, 1); /* ref_pic_list_reordering_flag_l0: 0 */ } else if (IS_B_SLICE(slice_param.slice_type)) { bitstream_put_ui(bs, slice_param.direct_spatial_mv_pred_flag, 1); /* direct_spatial_mv_pred: 1 */ bitstream_put_ui(bs, slice_param.num_ref_idx_active_override_flag, 1); /* num_ref_idx_active_override_flag: */ if (slice_param.num_ref_idx_active_override_flag) { bitstream_put_ue(bs, slice_param.num_ref_idx_l0_active_minus1); bitstream_put_ue(bs, slice_param.num_ref_idx_l1_active_minus1); } /* ref_pic_list_reordering */ bitstream_put_ui(bs, 0, 1); /* ref_pic_list_reordering_flag_l0: 0 */ bitstream_put_ui(bs, 0, 1); /* ref_pic_list_reordering_flag_l1: 0 */ } if ((pic_param.pic_fields.bits.weighted_pred_flag && IS_P_SLICE(slice_param.slice_type)) || ((pic_param.pic_fields.bits.weighted_bipred_idc == 1) && IS_B_SLICE(slice_param.slice_type))) { /* FIXME: fill weight/offset table */ assert(0); } /* dec_ref_pic_marking */ if (pic_param.pic_fields.bits.reference_pic_flag) { /* nal_ref_idc != 0 */ unsigned char no_output_of_prior_pics_flag = 0; unsigned char long_term_reference_flag = 0; unsigned char adaptive_ref_pic_marking_mode_flag = 0; if (pic_param.pic_fields.bits.idr_pic_flag) { bitstream_put_ui(bs, no_output_of_prior_pics_flag, 1); /* no_output_of_prior_pics_flag: 0 */ bitstream_put_ui(bs, long_term_reference_flag, 1); /* long_term_reference_flag: 0 */ } else { bitstream_put_ui(bs, adaptive_ref_pic_marking_mode_flag, 1); /* adaptive_ref_pic_marking_mode_flag: 0 */ } } if (pic_param.pic_fields.bits.entropy_coding_mode_flag && !IS_I_SLICE(slice_param.slice_type)) bitstream_put_ue(bs, slice_param.cabac_init_idc); /* cabac_init_idc: 0 */ bitstream_put_se(bs, slice_param.slice_qp_delta); /* slice_qp_delta: 0 */ /* ignore for SP/SI */ if (pic_param.pic_fields.bits.deblocking_filter_control_present_flag) { bitstream_put_ue(bs, slice_param.disable_deblocking_filter_idc); /* disable_deblocking_filter_idc: 0 */ if (slice_param.disable_deblocking_filter_idc != 1) { bitstream_put_se(bs, slice_param.slice_alpha_c0_offset_div2); /* slice_alpha_c0_offset_div2: 2 */ bitstream_put_se(bs, slice_param.slice_beta_offset_div2); /* slice_beta_offset_div2: 2 */ } } if (pic_param.pic_fields.bits.entropy_coding_mode_flag) { bitstream_byte_aligning(bs, 1); } } int QuickSyncEncoderImpl::build_packed_pic_buffer(unsigned char **header_buffer) { bitstream bs; bitstream_start(&bs); nal_start_code_prefix(&bs); nal_header(&bs, NAL_REF_IDC_HIGH, NAL_PPS); pps_rbsp(&bs); bitstream_end(&bs); *header_buffer = (unsigned char *)bs.buffer; return bs.bit_offset; } int QuickSyncEncoderImpl::build_packed_seq_buffer(YCbCrLumaCoefficients ycbcr_coefficients, unsigned char **header_buffer) { bitstream bs; bitstream_start(&bs); nal_start_code_prefix(&bs); nal_header(&bs, NAL_REF_IDC_HIGH, NAL_SPS); sps_rbsp(ycbcr_coefficients, &bs); bitstream_end(&bs); *header_buffer = (unsigned char *)bs.buffer; return bs.bit_offset; } int QuickSyncEncoderImpl::build_packed_slice_buffer(unsigned char **header_buffer) { bitstream bs; int is_idr = !!pic_param.pic_fields.bits.idr_pic_flag; int is_ref = !!pic_param.pic_fields.bits.reference_pic_flag; bitstream_start(&bs); nal_start_code_prefix(&bs); if (IS_I_SLICE(slice_param.slice_type)) { nal_header(&bs, NAL_REF_IDC_HIGH, is_idr ? NAL_IDR : NAL_NON_IDR); } else if (IS_P_SLICE(slice_param.slice_type)) { nal_header(&bs, NAL_REF_IDC_MEDIUM, NAL_NON_IDR); } else { assert(IS_B_SLICE(slice_param.slice_type)); nal_header(&bs, is_ref ? NAL_REF_IDC_LOW : NAL_REF_IDC_NONE, NAL_NON_IDR); } slice_header(&bs); bitstream_end(&bs); *header_buffer = (unsigned char *)bs.buffer; return bs.bit_offset; } /* Assume frame sequence is: Frame#0, #1, #2, ..., #M, ..., #X, ... (encoding order) 1) period between Frame #X and Frame #N = #X - #N 2) 0 means infinite for intra_period/intra_idr_period, and 0 is invalid for ip_period 3) intra_idr_period % intra_period (intra_period > 0) and intra_period % ip_period must be 0 4) intra_period and intra_idr_period take precedence over ip_period 5) if ip_period > 1, intra_period and intra_idr_period are not the strict periods of I/IDR frames, see bellow examples ------------------------------------------------------------------- intra_period intra_idr_period ip_period frame sequence (intra_period/intra_idr_period/ip_period) 0 ignored 1 IDRPPPPPPP ... (No IDR/I any more) 0 ignored >=2 IDR(PBB)(PBB)... (No IDR/I any more) 1 0 ignored IDRIIIIIII... (No IDR any more) 1 1 ignored IDR IDR IDR IDR... 1 >=2 ignored IDRII IDRII IDR... (1/3/ignore) >=2 0 1 IDRPPP IPPP I... (3/0/1) >=2 0 >=2 IDR(PBB)(PBB)(IBB) (6/0/3) (PBB)(IBB)(PBB)(IBB)... >=2 >=2 1 IDRPPPPP IPPPPP IPPPPP (6/18/1) IDRPPPPP IPPPPP IPPPPP... >=2 >=2 >=2 {IDR(PBB)(PBB)(IBB)(PBB)(IBB)(PBB)} (6/18/3) {IDR(PBB)(PBB)(IBB)(PBB)(IBB)(PBB)}... {IDR(PBB)(PBB)(IBB)(PBB)} (6/12/3) {IDR(PBB)(PBB)(IBB)(PBB)}... {IDR(PBB)(PBB)} (6/6/3) {IDR(PBB)(PBB)}. */ #define FRAME_P 0 #define FRAME_B 1 #define FRAME_I 2 #define FRAME_IDR 7 void encoding2display_order( int encoding_order, int intra_period, int intra_idr_period, int ip_period, int *displaying_order, int *frame_type) { int encoding_order_gop = 0; if (intra_period == 1) { /* all are I/IDR frames */ *displaying_order = encoding_order; if (intra_idr_period == 0) *frame_type = (encoding_order == 0)?FRAME_IDR:FRAME_I; else *frame_type = (encoding_order % intra_idr_period == 0)?FRAME_IDR:FRAME_I; return; } if (intra_period == 0) intra_idr_period = 0; if (ip_period == 1) { // No B-frames, sequence is like IDR PPPPP IPPPPP. encoding_order_gop = (intra_idr_period == 0) ? encoding_order : (encoding_order % intra_idr_period); *displaying_order = encoding_order; if (encoding_order_gop == 0) { /* the first frame */ *frame_type = FRAME_IDR; } else if (intra_period != 0 && /* have I frames */ encoding_order_gop >= 2 && (encoding_order_gop % intra_period == 0)) { *frame_type = FRAME_I; } else { *frame_type = FRAME_P; } return; } // We have B-frames. Sequence is like IDR (PBB)(PBB)(IBB)(PBB). encoding_order_gop = (intra_idr_period == 0) ? encoding_order : (encoding_order % (intra_idr_period + 1)); if (encoding_order_gop == 0) { /* the first frame */ *frame_type = FRAME_IDR; *displaying_order = encoding_order; } else if (((encoding_order_gop - 1) % ip_period) != 0) { /* B frames */ *frame_type = FRAME_B; *displaying_order = encoding_order - 1; } else if (intra_period != 0 && /* have I frames */ encoding_order_gop >= 2 && ((encoding_order_gop - 1) / ip_period % (intra_period / ip_period)) == 0) { *frame_type = FRAME_I; *displaying_order = encoding_order + ip_period - 1; } else { *frame_type = FRAME_P; *displaying_order = encoding_order + ip_period - 1; } } // General pts/dts strategy: // // Getting pts and dts right with variable frame rate (VFR) and B-frames can be a // bit tricky. This strategy roughly matches what x264 seems to do: We take in // the pts as the frames are encoded, and reuse that as dts in the same order, // slightly offset. // // If we don't have B-frames (only I and P), this means pts == dts always. // This is the simple case. Now consider the case with a single B-frame: // // I B P B P // pts: 30 40 50 60 70 // // Since we always inherently encode P-frames before B-frames, this means that // we see them in this order, which we can _almost_ use for dts: // // dts: 30 50 40 70 60 // // the only problem here is that for the B-frames, pts < dts. We solve this by // priming the queue at the very start with some made-up dts: // // I B P B P // pts: 30 40 50 60 70 // dts: xx 30 50 40 70 60 // // Now we have all the desirable properties: pts >= dts, successive dts delta // is never larger than the decoder can figure out (assuming, of course, // the pts has that property), and there's minimal lag between pts and dts. // For the made-up dts, we assume 1/60 sec per frame, which should generally // be reasonable. dts can go negative, but this is corrected using global_delay() // by delaying both pts and dts (although we probably don't need to). // // If there's more than one B-frame possible, we simply insert more of them // (here shown with some irregular spacing, assuming B-frames don't depend // on each other and simply go back-to-front): // // I B B B P B B B P // pts: 30 40 55 60 65 66 67 68 80 // dts: xx yy zz 30 65 60 55 40 80 68 67 66 class DTSReorderer { public: DTSReorderer(int num_b_frames) : num_b_frames(num_b_frames) {} void push_pts(int64_t pts) { if (buf.empty() && num_b_frames > 0) { // First frame. int64_t base_dts = pts - num_b_frames * (TIMEBASE / TYPICAL_FPS); for (int i = 0; i < num_b_frames; ++i) { buf.push(base_dts + i * (TIMEBASE / TYPICAL_FPS)); } } buf.push(pts); } int64_t pop_dts() { assert(!buf.empty()); int64_t dts = buf.front(); buf.pop(); return dts; } private: const int num_b_frames; queue buf; }; void QuickSyncEncoderImpl::enable_zerocopy_if_possible() { if (global_flags.x264_video_to_disk) { // Quick Sync is entirely disabled. use_zerocopy = false; } else if (global_flags.x264_video_to_http) { use_zerocopy = false; } else if (global_flags.av1_video_to_http) { use_zerocopy = false; } else if (!global_flags.v4l_output_device.empty()) { use_zerocopy = false; } else { use_zerocopy = true; } global_flags.use_zerocopy = use_zerocopy; } static unique_ptr try_open_va_h264(const string &va_display, VAProfile *h264_profile, string *error) { return try_open_va(va_display, { VAProfileH264High, VAProfileH264Main, VAProfileH264ConstrainedBaseline }, VAEntrypointEncSlice, /*desired_configs=*/{}, h264_profile, error); } int QuickSyncEncoderImpl::init_va(const string &va_display) { string error; va_dpy = try_open_va_h264(va_display, &h264_profile, &error); if (va_dpy == nullptr) { fprintf(stderr, "error: %s\n", error.c_str()); abort(); } if (!va_dpy->can_use_zerocopy) { use_zerocopy = false; } switch (h264_profile) { case VAProfileH264ConstrainedBaseline: constraint_set_flag |= (1 << 0 | 1 << 1); /* Annex A.2.2 */ ip_period = 1; break; case VAProfileH264Main: constraint_set_flag |= (1 << 1); /* Annex A.2.2 */ break; case VAProfileH264High: constraint_set_flag |= (1 << 3); /* Annex A.2.4 */ break; default: h264_profile = VAProfileH264ConstrainedBaseline; ip_period = 1; constraint_set_flag |= (1 << 0); /* Annex A.2.1 */ break; } VAConfigAttrib attrib[VAConfigAttribTypeMax]; /* find out the format for the render target, and rate control mode */ for (unsigned i = 0; i < VAConfigAttribTypeMax; i++) attrib[i].type = (VAConfigAttribType)i; VAStatus va_status = vaGetConfigAttributes(va_dpy->va_dpy, h264_profile, VAEntrypointEncSlice, &attrib[0], VAConfigAttribTypeMax); CHECK_VASTATUS(va_status, "vaGetConfigAttributes"); /* check the interested configattrib */ if ((attrib[VAConfigAttribRTFormat].value & VA_RT_FORMAT_YUV420) == 0) { printf("Not find desired YUV420 RT format\n"); abort(); } else { config_attrib[config_attrib_num].type = VAConfigAttribRTFormat; config_attrib[config_attrib_num].value = VA_RT_FORMAT_YUV420; config_attrib_num++; } if (attrib[VAConfigAttribRateControl].value != VA_ATTRIB_NOT_SUPPORTED) { if (!(attrib[VAConfigAttribRateControl].value & VA_RC_CQP)) { fprintf(stderr, "ERROR: VA-API encoder does not support CQP mode.\n"); abort(); } config_attrib[config_attrib_num].type = VAConfigAttribRateControl; config_attrib[config_attrib_num].value = VA_RC_CQP; config_attrib_num++; } if (attrib[VAConfigAttribEncPackedHeaders].value != VA_ATTRIB_NOT_SUPPORTED) { int tmp = attrib[VAConfigAttribEncPackedHeaders].value; h264_packedheader = 1; config_attrib[config_attrib_num].type = VAConfigAttribEncPackedHeaders; config_attrib[config_attrib_num].value = VA_ENC_PACKED_HEADER_NONE; if (tmp & VA_ENC_PACKED_HEADER_SEQUENCE) { config_attrib[config_attrib_num].value |= VA_ENC_PACKED_HEADER_SEQUENCE; } if (tmp & VA_ENC_PACKED_HEADER_PICTURE) { config_attrib[config_attrib_num].value |= VA_ENC_PACKED_HEADER_PICTURE; } if (tmp & VA_ENC_PACKED_HEADER_SLICE) { config_attrib[config_attrib_num].value |= VA_ENC_PACKED_HEADER_SLICE; } if (tmp & VA_ENC_PACKED_HEADER_MISC) { config_attrib[config_attrib_num].value |= VA_ENC_PACKED_HEADER_MISC; } enc_packed_header_idx = config_attrib_num; config_attrib_num++; } if (attrib[VAConfigAttribEncInterlaced].value != VA_ATTRIB_NOT_SUPPORTED) { config_attrib[config_attrib_num].type = VAConfigAttribEncInterlaced; config_attrib[config_attrib_num].value = VA_ENC_PACKED_HEADER_NONE; config_attrib_num++; } if (attrib[VAConfigAttribEncMaxRefFrames].value != VA_ATTRIB_NOT_SUPPORTED) { h264_maxref = attrib[VAConfigAttribEncMaxRefFrames].value; } return 0; } int QuickSyncEncoderImpl::setup_encode() { if (!global_flags.x264_video_to_disk) { VAStatus va_status; VASurfaceID *tmp_surfaceid; int codedbuf_size; VASurfaceID src_surface[SURFACE_NUM]; VASurfaceID ref_surface[SURFACE_NUM]; va_status = vaCreateConfig(va_dpy->va_dpy, h264_profile, VAEntrypointEncSlice, &config_attrib[0], config_attrib_num, &config_id); CHECK_VASTATUS(va_status, "vaCreateConfig"); /* create source surfaces */ va_status = vaCreateSurfaces(va_dpy->va_dpy, VA_RT_FORMAT_YUV420, frame_width_mbaligned, frame_height_mbaligned, &src_surface[0], SURFACE_NUM, NULL, 0); CHECK_VASTATUS(va_status, "vaCreateSurfaces"); /* create reference surfaces */ va_status = vaCreateSurfaces(va_dpy->va_dpy, VA_RT_FORMAT_YUV420, frame_width_mbaligned, frame_height_mbaligned, &ref_surface[0], SURFACE_NUM, NULL, 0); CHECK_VASTATUS(va_status, "vaCreateSurfaces"); tmp_surfaceid = (VASurfaceID *)calloc(2 * SURFACE_NUM, sizeof(VASurfaceID)); memcpy(tmp_surfaceid, src_surface, SURFACE_NUM * sizeof(VASurfaceID)); memcpy(tmp_surfaceid + SURFACE_NUM, ref_surface, SURFACE_NUM * sizeof(VASurfaceID)); for (int i = 0; i < SURFACE_NUM; i++) { gl_surfaces[i].src_surface = src_surface[i]; gl_surfaces[i].ref_surface = ref_surface[i]; } /* Create a context for this encode pipe */ va_status = vaCreateContext(va_dpy->va_dpy, config_id, frame_width_mbaligned, frame_height_mbaligned, VA_PROGRESSIVE, tmp_surfaceid, 2 * SURFACE_NUM, &context_id); CHECK_VASTATUS(va_status, "vaCreateContext"); free(tmp_surfaceid); codedbuf_size = (frame_width_mbaligned * frame_height_mbaligned * 400) / (16*16); for (int i = 0; i < SURFACE_NUM; i++) { /* create coded buffer once for all * other VA buffers which won't be used again after vaRenderPicture. * so APP can always vaCreateBuffer for every frame * but coded buffer need to be mapped and accessed after vaRenderPicture/vaEndPicture * so VA won't maintain the coded buffer */ va_status = vaCreateBuffer(va_dpy->va_dpy, context_id, VAEncCodedBufferType, codedbuf_size, 1, NULL, &gl_surfaces[i].coded_buf); CHECK_VASTATUS(va_status, "vaCreateBuffer"); } } /* create OpenGL objects */ for (int i = 0; i < SURFACE_NUM; i++) { if (use_zerocopy) { gl_surfaces[i].y_tex = resource_pool->create_2d_texture(GL_R8, 1, 1); gl_surfaces[i].cbcr_tex = resource_pool->create_2d_texture(GL_RG8, 1, 1); } else { size_t bytes_per_pixel = (global_flags.bit_depth > 8) ? 2 : 1; // Generate a PBO to read into. It doesn't necessarily fit 1:1 with the VA-API // buffers, due to potentially differing pitch. glGenBuffers(1, &gl_surfaces[i].pbo); glBindBuffer(GL_PIXEL_PACK_BUFFER, gl_surfaces[i].pbo); glBufferStorage(GL_PIXEL_PACK_BUFFER, frame_width * frame_height * 2 * bytes_per_pixel, nullptr, GL_MAP_READ_BIT | GL_MAP_WRITE_BIT | GL_MAP_PERSISTENT_BIT); uint8_t *ptr = (uint8_t *)glMapBufferRange(GL_PIXEL_PACK_BUFFER, 0, frame_width * frame_height * 2 * bytes_per_pixel, GL_MAP_READ_BIT | GL_MAP_PERSISTENT_BIT); gl_surfaces[i].y_offset = 0; gl_surfaces[i].cbcr_offset = frame_width * frame_height * bytes_per_pixel; gl_surfaces[i].y_ptr = ptr + gl_surfaces[i].y_offset; gl_surfaces[i].cbcr_ptr = ptr + gl_surfaces[i].cbcr_offset; glBindBuffer(GL_PIXEL_PACK_BUFFER, 0); } } return 0; } // Given a list like 1 9 3 0 2 8 4 and a pivot element 3, will produce // // 2 1 0 [3] 4 8 9 template static void sort_two(T *begin, T *end, const T &pivot, const C &less_than) { T *middle = partition(begin, end, [&](const T &elem) { return less_than(elem, pivot); }); sort(begin, middle, [&](const T &a, const T &b) { return less_than(b, a); }); sort(middle, end, less_than); } void QuickSyncEncoderImpl::update_ReferenceFrames(int current_display_frame, int frame_type) { if (frame_type == FRAME_B) return; pic_param.CurrPic.frame_idx = current_ref_frame_num; CurrentCurrPic.flags = VA_PICTURE_H264_SHORT_TERM_REFERENCE; lock_guard lock(storage_task_queue_mutex); // Insert the new frame at the start of the reference queue. reference_frames.push_front(ReferenceFrame{ CurrentCurrPic, current_display_frame }); if (reference_frames.size() > num_ref_frames) { // The back frame frame is no longer in use as a reference. int display_frame_num = reference_frames.back().display_number; assert(surface_for_frame.count(display_frame_num)); release_gl_surface(display_frame_num); reference_frames.pop_back(); } // Mark this frame in use as a reference. assert(surface_for_frame.count(current_display_frame)); ++surface_for_frame[current_display_frame]->refcount; current_ref_frame_num++; if (current_ref_frame_num > MaxFrameNum) current_ref_frame_num = 0; } void QuickSyncEncoderImpl::update_RefPicList_P(VAPictureH264 RefPicList0_P[MAX_NUM_REF2]) { const auto descending_by_frame_idx = [](const VAPictureH264 &a, const VAPictureH264 &b) { return a.frame_idx > b.frame_idx; }; for (size_t i = 0; i < reference_frames.size(); ++i) { RefPicList0_P[i] = reference_frames[i].pic; } sort(&RefPicList0_P[0], &RefPicList0_P[reference_frames.size()], descending_by_frame_idx); } void QuickSyncEncoderImpl::update_RefPicList_B(VAPictureH264 RefPicList0_B[MAX_NUM_REF2], VAPictureH264 RefPicList1_B[MAX_NUM_REF2]) { const auto ascending_by_top_field_order_cnt = [](const VAPictureH264 &a, const VAPictureH264 &b) { return a.TopFieldOrderCnt < b.TopFieldOrderCnt; }; const auto descending_by_top_field_order_cnt = [](const VAPictureH264 &a, const VAPictureH264 &b) { return a.TopFieldOrderCnt > b.TopFieldOrderCnt; }; for (size_t i = 0; i < reference_frames.size(); ++i) { RefPicList0_B[i] = reference_frames[i].pic; RefPicList1_B[i] = reference_frames[i].pic; } sort_two(&RefPicList0_B[0], &RefPicList0_B[reference_frames.size()], CurrentCurrPic, ascending_by_top_field_order_cnt); sort_two(&RefPicList1_B[0], &RefPicList1_B[reference_frames.size()], CurrentCurrPic, descending_by_top_field_order_cnt); } int QuickSyncEncoderImpl::render_sequence() { VABufferID seq_param_buf, rc_param_buf, render_id[2]; VAStatus va_status; VAEncMiscParameterBuffer *misc_param; VAEncMiscParameterRateControl *misc_rate_ctrl; seq_param.level_idc = 41 /*SH_LEVEL_3*/; seq_param.picture_width_in_mbs = frame_width_mbaligned / 16; seq_param.picture_height_in_mbs = frame_height_mbaligned / 16; seq_param.bits_per_second = frame_bitrate; seq_param.intra_period = intra_period; seq_param.intra_idr_period = intra_idr_period; seq_param.ip_period = ip_period; seq_param.max_num_ref_frames = num_ref_frames; seq_param.seq_fields.bits.frame_mbs_only_flag = 1; seq_param.time_scale = TIMEBASE * 2; seq_param.num_units_in_tick = 1; /* Tc = num_units_in_tick / scale */ seq_param.seq_fields.bits.log2_max_pic_order_cnt_lsb_minus4 = Log2MaxPicOrderCntLsb - 4; seq_param.seq_fields.bits.log2_max_frame_num_minus4 = Log2MaxFrameNum - 4;; seq_param.seq_fields.bits.frame_mbs_only_flag = 1; seq_param.seq_fields.bits.chroma_format_idc = 1; seq_param.seq_fields.bits.direct_8x8_inference_flag = 1; if (frame_width != frame_width_mbaligned || frame_height != frame_height_mbaligned) { seq_param.frame_cropping_flag = 1; seq_param.frame_crop_left_offset = 0; seq_param.frame_crop_right_offset = (frame_width_mbaligned - frame_width)/2; seq_param.frame_crop_top_offset = 0; seq_param.frame_crop_bottom_offset = (frame_height_mbaligned - frame_height)/2; } va_status = vaCreateBuffer(va_dpy->va_dpy, context_id, VAEncSequenceParameterBufferType, sizeof(seq_param), 1, &seq_param, &seq_param_buf); CHECK_VASTATUS(va_status, "vaCreateBuffer"); va_status = vaCreateBuffer(va_dpy->va_dpy, context_id, VAEncMiscParameterBufferType, sizeof(VAEncMiscParameterBuffer) + sizeof(VAEncMiscParameterRateControl), 1, NULL, &rc_param_buf); CHECK_VASTATUS(va_status, "vaCreateBuffer"); vaMapBuffer(va_dpy->va_dpy, rc_param_buf, (void **)&misc_param); misc_param->type = VAEncMiscParameterTypeRateControl; misc_rate_ctrl = (VAEncMiscParameterRateControl *)misc_param->data; memset(misc_rate_ctrl, 0, sizeof(*misc_rate_ctrl)); misc_rate_ctrl->bits_per_second = frame_bitrate; misc_rate_ctrl->target_percentage = 66; misc_rate_ctrl->window_size = 1000; misc_rate_ctrl->initial_qp = initial_qp; misc_rate_ctrl->min_qp = minimal_qp; misc_rate_ctrl->basic_unit_size = 0; vaUnmapBuffer(va_dpy->va_dpy, rc_param_buf); render_id[0] = seq_param_buf; render_id[1] = rc_param_buf; render_picture_and_delete(va_dpy->va_dpy, context_id, &render_id[0], 2); return 0; } static int calc_poc(int pic_order_cnt_lsb, int frame_type) { static int PicOrderCntMsb_ref = 0, pic_order_cnt_lsb_ref = 0; int prevPicOrderCntMsb, prevPicOrderCntLsb; int PicOrderCntMsb, TopFieldOrderCnt; if (frame_type == FRAME_IDR) prevPicOrderCntMsb = prevPicOrderCntLsb = 0; else { prevPicOrderCntMsb = PicOrderCntMsb_ref; prevPicOrderCntLsb = pic_order_cnt_lsb_ref; } if ((pic_order_cnt_lsb < prevPicOrderCntLsb) && ((prevPicOrderCntLsb - pic_order_cnt_lsb) >= (int)(MaxPicOrderCntLsb / 2))) PicOrderCntMsb = prevPicOrderCntMsb + MaxPicOrderCntLsb; else if ((pic_order_cnt_lsb > prevPicOrderCntLsb) && ((pic_order_cnt_lsb - prevPicOrderCntLsb) > (int)(MaxPicOrderCntLsb / 2))) PicOrderCntMsb = prevPicOrderCntMsb - MaxPicOrderCntLsb; else PicOrderCntMsb = prevPicOrderCntMsb; TopFieldOrderCnt = PicOrderCntMsb + pic_order_cnt_lsb; if (frame_type != FRAME_B) { PicOrderCntMsb_ref = PicOrderCntMsb; pic_order_cnt_lsb_ref = pic_order_cnt_lsb; } return TopFieldOrderCnt; } int QuickSyncEncoderImpl::render_picture(GLSurface *surf, int frame_type, int display_frame_num, int gop_start_display_frame_num) { VABufferID pic_param_buf; VAStatus va_status; size_t i = 0; pic_param.CurrPic.picture_id = surf->ref_surface; pic_param.CurrPic.frame_idx = current_ref_frame_num; pic_param.CurrPic.flags = 0; pic_param.CurrPic.TopFieldOrderCnt = calc_poc((display_frame_num - gop_start_display_frame_num) % MaxPicOrderCntLsb, frame_type); pic_param.CurrPic.BottomFieldOrderCnt = pic_param.CurrPic.TopFieldOrderCnt; CurrentCurrPic = pic_param.CurrPic; for (i = 0; i < reference_frames.size(); i++) { pic_param.ReferenceFrames[i] = reference_frames[i].pic; } for (i = reference_frames.size(); i < MAX_NUM_REF1; i++) { pic_param.ReferenceFrames[i].picture_id = VA_INVALID_SURFACE; pic_param.ReferenceFrames[i].flags = VA_PICTURE_H264_INVALID; } pic_param.pic_fields.bits.idr_pic_flag = (frame_type == FRAME_IDR); pic_param.pic_fields.bits.reference_pic_flag = (frame_type != FRAME_B); pic_param.pic_fields.bits.entropy_coding_mode_flag = h264_entropy_mode; pic_param.pic_fields.bits.deblocking_filter_control_present_flag = 1; pic_param.frame_num = current_ref_frame_num; // FIXME: is this correct? pic_param.coded_buf = surf->coded_buf; pic_param.last_picture = false; // FIXME pic_param.pic_init_qp = initial_qp; va_status = vaCreateBuffer(va_dpy->va_dpy, context_id, VAEncPictureParameterBufferType, sizeof(pic_param), 1, &pic_param, &pic_param_buf); CHECK_VASTATUS(va_status, "vaCreateBuffer"); render_picture_and_delete(va_dpy->va_dpy, context_id, &pic_param_buf, 1); return 0; } int QuickSyncEncoderImpl::render_packedsequence(YCbCrLumaCoefficients ycbcr_coefficients) { VAEncPackedHeaderParameterBuffer packedheader_param_buffer; VABufferID packedseq_para_bufid, packedseq_data_bufid, render_id[2]; unsigned int length_in_bits; unsigned char *packedseq_buffer = NULL; VAStatus va_status; length_in_bits = build_packed_seq_buffer(ycbcr_coefficients, &packedseq_buffer); packedheader_param_buffer.type = VAEncPackedHeaderSequence; packedheader_param_buffer.bit_length = length_in_bits; /*length_in_bits*/ packedheader_param_buffer.has_emulation_bytes = 0; va_status = vaCreateBuffer(va_dpy->va_dpy, context_id, VAEncPackedHeaderParameterBufferType, sizeof(packedheader_param_buffer), 1, &packedheader_param_buffer, &packedseq_para_bufid); CHECK_VASTATUS(va_status, "vaCreateBuffer"); va_status = vaCreateBuffer(va_dpy->va_dpy, context_id, VAEncPackedHeaderDataBufferType, (length_in_bits + 7) / 8, 1, packedseq_buffer, &packedseq_data_bufid); CHECK_VASTATUS(va_status, "vaCreateBuffer"); render_id[0] = packedseq_para_bufid; render_id[1] = packedseq_data_bufid; render_picture_and_delete(va_dpy->va_dpy, context_id, render_id, 2); free(packedseq_buffer); return 0; } int QuickSyncEncoderImpl::render_packedpicture() { VAEncPackedHeaderParameterBuffer packedheader_param_buffer; VABufferID packedpic_para_bufid, packedpic_data_bufid, render_id[2]; unsigned int length_in_bits; unsigned char *packedpic_buffer = NULL; VAStatus va_status; length_in_bits = build_packed_pic_buffer(&packedpic_buffer); packedheader_param_buffer.type = VAEncPackedHeaderPicture; packedheader_param_buffer.bit_length = length_in_bits; packedheader_param_buffer.has_emulation_bytes = 0; va_status = vaCreateBuffer(va_dpy->va_dpy, context_id, VAEncPackedHeaderParameterBufferType, sizeof(packedheader_param_buffer), 1, &packedheader_param_buffer, &packedpic_para_bufid); CHECK_VASTATUS(va_status, "vaCreateBuffer"); va_status = vaCreateBuffer(va_dpy->va_dpy, context_id, VAEncPackedHeaderDataBufferType, (length_in_bits + 7) / 8, 1, packedpic_buffer, &packedpic_data_bufid); CHECK_VASTATUS(va_status, "vaCreateBuffer"); render_id[0] = packedpic_para_bufid; render_id[1] = packedpic_data_bufid; render_picture_and_delete(va_dpy->va_dpy, context_id, render_id, 2); free(packedpic_buffer); return 0; } void QuickSyncEncoderImpl::render_packedslice() { VAEncPackedHeaderParameterBuffer packedheader_param_buffer; VABufferID packedslice_para_bufid, packedslice_data_bufid, render_id[2]; unsigned int length_in_bits; unsigned char *packedslice_buffer = NULL; VAStatus va_status; length_in_bits = build_packed_slice_buffer(&packedslice_buffer); packedheader_param_buffer.type = VAEncPackedHeaderSlice; packedheader_param_buffer.bit_length = length_in_bits; packedheader_param_buffer.has_emulation_bytes = 0; va_status = vaCreateBuffer(va_dpy->va_dpy, context_id, VAEncPackedHeaderParameterBufferType, sizeof(packedheader_param_buffer), 1, &packedheader_param_buffer, &packedslice_para_bufid); CHECK_VASTATUS(va_status, "vaCreateBuffer"); va_status = vaCreateBuffer(va_dpy->va_dpy, context_id, VAEncPackedHeaderDataBufferType, (length_in_bits + 7) / 8, 1, packedslice_buffer, &packedslice_data_bufid); CHECK_VASTATUS(va_status, "vaCreateBuffer"); render_id[0] = packedslice_para_bufid; render_id[1] = packedslice_data_bufid; render_picture_and_delete(va_dpy->va_dpy, context_id, render_id, 2); free(packedslice_buffer); } int QuickSyncEncoderImpl::render_slice(int encoding_frame_num, int display_frame_num, int gop_start_display_frame_num, int frame_type) { VABufferID slice_param_buf; VAStatus va_status; int i; /* one frame, one slice */ slice_param.macroblock_address = 0; slice_param.num_macroblocks = frame_width_mbaligned * frame_height_mbaligned/(16*16); /* Measured by MB */ slice_param.slice_type = (frame_type == FRAME_IDR)?2:frame_type; if (frame_type == FRAME_IDR) { if (encoding_frame_num != 0) ++slice_param.idr_pic_id; } else if (frame_type == FRAME_P) { VAPictureH264 RefPicList0_P[MAX_NUM_REF2]; update_RefPicList_P(RefPicList0_P); int refpiclist0_max = h264_maxref & 0xffff; memcpy(slice_param.RefPicList0, RefPicList0_P, refpiclist0_max*sizeof(VAPictureH264)); for (i = refpiclist0_max; i < MAX_NUM_REF2; i++) { slice_param.RefPicList0[i].picture_id = VA_INVALID_SURFACE; slice_param.RefPicList0[i].flags = VA_PICTURE_H264_INVALID; } } else if (frame_type == FRAME_B) { VAPictureH264 RefPicList0_B[MAX_NUM_REF2], RefPicList1_B[MAX_NUM_REF2]; update_RefPicList_B(RefPicList0_B, RefPicList1_B); int refpiclist0_max = h264_maxref & 0xffff; int refpiclist1_max = (h264_maxref >> 16) & 0xffff; memcpy(slice_param.RefPicList0, RefPicList0_B, refpiclist0_max*sizeof(VAPictureH264)); for (i = refpiclist0_max; i < MAX_NUM_REF2; i++) { slice_param.RefPicList0[i].picture_id = VA_INVALID_SURFACE; slice_param.RefPicList0[i].flags = VA_PICTURE_H264_INVALID; } memcpy(slice_param.RefPicList1, RefPicList1_B, refpiclist1_max*sizeof(VAPictureH264)); for (i = refpiclist1_max; i < MAX_NUM_REF2; i++) { slice_param.RefPicList1[i].picture_id = VA_INVALID_SURFACE; slice_param.RefPicList1[i].flags = VA_PICTURE_H264_INVALID; } } slice_param.slice_alpha_c0_offset_div2 = 0; slice_param.slice_beta_offset_div2 = 0; slice_param.direct_spatial_mv_pred_flag = 1; slice_param.pic_order_cnt_lsb = (display_frame_num - gop_start_display_frame_num) % MaxPicOrderCntLsb; if (h264_packedheader && config_attrib[enc_packed_header_idx].value & VA_ENC_PACKED_HEADER_SLICE) render_packedslice(); va_status = vaCreateBuffer(va_dpy->va_dpy, context_id, VAEncSliceParameterBufferType, sizeof(slice_param), 1, &slice_param, &slice_param_buf); CHECK_VASTATUS(va_status, "vaCreateBuffer"); render_picture_and_delete(va_dpy->va_dpy, context_id, &slice_param_buf, 1); return 0; } void QuickSyncEncoderImpl::save_codeddata(GLSurface *surf, storage_task task) { VACodedBufferSegment *buf_list = NULL; VAStatus va_status; string data; va_status = vaMapBuffer(va_dpy->va_dpy, surf->coded_buf, (void **)(&buf_list)); CHECK_VASTATUS(va_status, "vaMapBuffer"); while (buf_list != NULL) { data.append(reinterpret_cast(buf_list->buf), buf_list->size); buf_list = (VACodedBufferSegment *) buf_list->next; } vaUnmapBuffer(va_dpy->va_dpy, surf->coded_buf); static int frameno = 0; print_latency("Current Quick Sync latency (video inputs → disk mux):", task.received_ts, (task.frame_type == FRAME_B), &frameno, &qs_latency_histogram); { // Add video. AVPacket pkt; memset(&pkt, 0, sizeof(pkt)); pkt.buf = nullptr; pkt.data = reinterpret_cast(&data[0]); pkt.size = data.size(); pkt.stream_index = 0; if (task.frame_type == FRAME_IDR) { pkt.flags = AV_PKT_FLAG_KEY; } else { pkt.flags = 0; } pkt.duration = task.duration; if (file_mux) { file_mux->add_packet(pkt, task.pts + global_delay(), task.dts + global_delay()); } if (!global_flags.x264_video_to_http && !global_flags.av1_video_to_http) { http_mux->add_packet(pkt, task.pts + global_delay(), task.dts + global_delay()); if (srt_mux != nullptr) { srt_mux->add_packet(pkt, task.pts + global_delay(), task.dts + global_delay()); } } } } // this is weird. but it seems to put a new frame onto the queue void QuickSyncEncoderImpl::storage_task_enqueue(storage_task task) { assert(task.pts >= task.dts); lock_guard lock(storage_task_queue_mutex); storage_task_queue.push(move(task)); storage_task_queue_changed.notify_all(); } void QuickSyncEncoderImpl::storage_task_thread() { pthread_setname_np(pthread_self(), "QS_Storage"); for ( ;; ) { storage_task current; GLSurface *surf; { // wait until there's an encoded frame unique_lock lock(storage_task_queue_mutex); storage_task_queue_changed.wait(lock, [this]{ return storage_thread_should_quit || !storage_task_queue.empty(); }); if (storage_thread_should_quit && storage_task_queue.empty()) return; current = move(storage_task_queue.front()); storage_task_queue.pop(); surf = surface_for_frame[current.display_order]; assert(surf != nullptr); } VAStatus va_status; size_t display_order = current.display_order; vector ref_display_frame_numbers = move(current.ref_display_frame_numbers); // waits for data, then saves it to disk. va_status = vaSyncSurface(va_dpy->va_dpy, surf->src_surface); CHECK_VASTATUS(va_status, "vaSyncSurface"); save_codeddata(surf, move(current)); // Unlock the frame, and all its references. { lock_guard lock(storage_task_queue_mutex); release_gl_surface(display_order); for (size_t frame_num : ref_display_frame_numbers) { release_gl_surface(frame_num); } } } } void QuickSyncEncoderImpl::release_encode() { for (unsigned i = 0; i < SURFACE_NUM; i++) { VAStatus va_status = vaDestroyBuffer(va_dpy->va_dpy, gl_surfaces[i].coded_buf); CHECK_VASTATUS(va_status, "vaDestroyBuffer"); va_status = vaDestroySurfaces(va_dpy->va_dpy, &gl_surfaces[i].src_surface, 1); CHECK_VASTATUS(va_status, "vaDestroySurfaces"); va_status = vaDestroySurfaces(va_dpy->va_dpy, &gl_surfaces[i].ref_surface, 1); CHECK_VASTATUS(va_status, "vaDestroySurfaces"); } VAStatus va_status = vaDestroyContext(va_dpy->va_dpy, context_id); CHECK_VASTATUS(va_status, "vaDestroyContext"); va_status = vaDestroyConfig(va_dpy->va_dpy, config_id); CHECK_VASTATUS(va_status, "vaDestroyConfig"); } void QuickSyncEncoderImpl::release_gl_resources() { assert(is_shutdown); if (has_released_gl_resources) { return; } for (unsigned i = 0; i < SURFACE_NUM; i++) { if (use_zerocopy) { resource_pool->release_2d_texture(gl_surfaces[i].y_tex); resource_pool->release_2d_texture(gl_surfaces[i].cbcr_tex); } else { glBindBuffer(GL_PIXEL_PACK_BUFFER, gl_surfaces[i].pbo); glUnmapBuffer(GL_PIXEL_PACK_BUFFER); glBindBuffer(GL_PIXEL_PACK_BUFFER, 0); glDeleteBuffers(1, &gl_surfaces[i].pbo); } } has_released_gl_resources = true; } QuickSyncEncoderImpl::QuickSyncEncoderImpl(const std::string &filename, ResourcePool *resource_pool, QSurface *surface, const string &va_display, int width, int height, const AVOutputFormat *oformat, VideoCodecInterface *http_encoder, VideoCodecInterface *disk_encoder, DiskSpaceEstimator *disk_space_estimator) : current_storage_frame(0), resource_pool(resource_pool), surface(surface), http_encoder(http_encoder), disk_encoder(disk_encoder), frame_width(width), frame_height(height), disk_space_estimator(disk_space_estimator) { file_audio_encoder.reset(new AudioEncoder(AUDIO_OUTPUT_CODEC_NAME, DEFAULT_AUDIO_OUTPUT_BIT_RATE, oformat)); open_output_file(filename); file_audio_encoder->add_mux(file_mux.get()); frame_width_mbaligned = (frame_width + 15) & (~15); frame_height_mbaligned = (frame_height + 15) & (~15); //print_input(); if (global_flags.x264_video_to_http || global_flags.x264_video_to_disk) { assert(http_encoder != nullptr); assert(disk_encoder != nullptr); } else if (global_flags.av1_video_to_http) { assert(http_encoder != nullptr); } else { assert(http_encoder == nullptr); assert(disk_encoder == nullptr); } enable_zerocopy_if_possible(); if (!global_flags.x264_video_to_disk) { init_va(va_display); } setup_encode(); if (!global_flags.x264_video_to_disk) { memset(&seq_param, 0, sizeof(seq_param)); memset(&pic_param, 0, sizeof(pic_param)); memset(&slice_param, 0, sizeof(slice_param)); } if (!global_flags.v4l_output_device.empty()) { v4l_output.reset(new V4LOutput(global_flags.v4l_output_device.c_str(), width, height)); } call_once(quick_sync_metrics_inited, [](){ mixer_latency_histogram.init("mixer"); qs_latency_histogram.init("quick_sync"); current_file_mux_metrics.init({{ "destination", "current_file" }}); total_mux_metrics.init({{ "destination", "files_total" }}); global_metrics.add("current_file_start_time_seconds", &metric_current_file_start_time_seconds, Metrics::TYPE_GAUGE); global_metrics.add("quick_sync_stalled_frames", &metric_quick_sync_stalled_frames); }); storage_thread = thread(&QuickSyncEncoderImpl::storage_task_thread, this); encode_thread = thread([this]{ QOpenGLContext *context = create_context(this->surface); eglBindAPI(EGL_OPENGL_API); if (!make_current(context, this->surface)) { printf("display=%p surface=%p context=%p curr=%p err=%d\n", eglGetCurrentDisplay(), this->surface, context, eglGetCurrentContext(), eglGetError()); abort(); } encode_thread_func(); delete_context(context); }); } QuickSyncEncoderImpl::~QuickSyncEncoderImpl() { shutdown(); release_gl_resources(); } QuickSyncEncoderImpl::GLSurface *QuickSyncEncoderImpl::allocate_gl_surface() { for (unsigned i = 0; i < SURFACE_NUM; ++i) { if (gl_surfaces[i].refcount == 0) { ++gl_surfaces[i].refcount; return &gl_surfaces[i]; } } return nullptr; } void QuickSyncEncoderImpl::release_gl_surface(size_t display_frame_num) { assert(surface_for_frame.count(display_frame_num)); QuickSyncEncoderImpl::GLSurface *surf = surface_for_frame[display_frame_num]; if (--surf->refcount == 0) { assert(surface_for_frame.count(display_frame_num)); surface_for_frame.erase(display_frame_num); storage_task_queue_changed.notify_all(); } } bool QuickSyncEncoderImpl::is_zerocopy() const { return use_zerocopy; } bool QuickSyncEncoderImpl::begin_frame(int64_t pts, int64_t duration, YCbCrLumaCoefficients ycbcr_coefficients, const vector &input_frames, GLuint *y_tex, GLuint *cbcr_tex) { assert(!is_shutdown); GLSurface *surf = nullptr; { // Wait until this frame slot is done encoding. unique_lock lock(storage_task_queue_mutex); surf = allocate_gl_surface(); if (surf == nullptr) { fprintf(stderr, "Warning: No free slots for frame %d, rendering has to wait for H.264 encoder\n", current_storage_frame); ++metric_quick_sync_stalled_frames; storage_task_queue_changed.wait(lock, [this, &surf]{ if (storage_thread_should_quit) return true; surf = allocate_gl_surface(); return surf != nullptr; }); } if (storage_thread_should_quit) return false; assert(surf != nullptr); surface_for_frame[current_storage_frame] = surf; } if (use_zerocopy) { *y_tex = surf->y_tex; *cbcr_tex = surf->cbcr_tex; } else { surf->y_tex = *y_tex; surf->cbcr_tex = *cbcr_tex; } if (!global_flags.x264_video_to_disk) { VAStatus va_status = vaDeriveImage(va_dpy->va_dpy, surf->src_surface, &surf->surface_image); CHECK_VASTATUS(va_status, "vaDeriveImage"); if (use_zerocopy) { VABufferInfo buf_info; buf_info.mem_type = VA_SURFACE_ATTRIB_MEM_TYPE_DRM_PRIME; // or VA_SURFACE_ATTRIB_MEM_TYPE_KERNEL_DRM? va_status = vaAcquireBufferHandle(va_dpy->va_dpy, surf->surface_image.buf, &buf_info); CHECK_VASTATUS(va_status, "vaAcquireBufferHandle"); // Create Y image. surf->y_egl_image = EGL_NO_IMAGE_KHR; EGLint y_attribs[] = { EGL_WIDTH, frame_width, EGL_HEIGHT, frame_height, EGL_LINUX_DRM_FOURCC_EXT, fourcc_code('R', '8', ' ', ' '), EGL_DMA_BUF_PLANE0_FD_EXT, EGLint(buf_info.handle), EGL_DMA_BUF_PLANE0_OFFSET_EXT, EGLint(surf->surface_image.offsets[0]), EGL_DMA_BUF_PLANE0_PITCH_EXT, EGLint(surf->surface_image.pitches[0]), EGL_NONE }; surf->y_egl_image = eglCreateImageKHR(eglGetCurrentDisplay(), EGL_NO_CONTEXT, EGL_LINUX_DMA_BUF_EXT, NULL, y_attribs); assert(surf->y_egl_image != EGL_NO_IMAGE_KHR); // Associate Y image to a texture. glBindTexture(GL_TEXTURE_2D, *y_tex); glEGLImageTargetTexture2DOES(GL_TEXTURE_2D, surf->y_egl_image); // Create CbCr image. surf->cbcr_egl_image = EGL_NO_IMAGE_KHR; EGLint cbcr_attribs[] = { EGL_WIDTH, frame_width / 2, EGL_HEIGHT, frame_height / 2, EGL_LINUX_DRM_FOURCC_EXT, fourcc_code('G', 'R', '8', '8'), EGL_DMA_BUF_PLANE0_FD_EXT, EGLint(buf_info.handle), EGL_DMA_BUF_PLANE0_OFFSET_EXT, EGLint(surf->surface_image.offsets[1]), EGL_DMA_BUF_PLANE0_PITCH_EXT, EGLint(surf->surface_image.pitches[1]), EGL_NONE }; surf->cbcr_egl_image = eglCreateImageKHR(eglGetCurrentDisplay(), EGL_NO_CONTEXT, EGL_LINUX_DMA_BUF_EXT, NULL, cbcr_attribs); assert(surf->cbcr_egl_image != EGL_NO_IMAGE_KHR); // Associate CbCr image to a texture. glBindTexture(GL_TEXTURE_2D, *cbcr_tex); glEGLImageTargetTexture2DOES(GL_TEXTURE_2D, surf->cbcr_egl_image); } } current_video_frame = PendingFrame{ {}, input_frames, pts, duration, ycbcr_coefficients }; return true; } void QuickSyncEncoderImpl::add_audio(int64_t pts, vector audio) { lock_guard lock(file_audio_encoder_mutex); assert(!is_shutdown); file_audio_encoder->encode_audio(audio, pts + global_delay()); } RefCountedGLsync QuickSyncEncoderImpl::end_frame() { assert(!is_shutdown); if (!use_zerocopy) { GLenum type = global_flags.bit_depth > 8 ? GL_UNSIGNED_SHORT : GL_UNSIGNED_BYTE; GLSurface *surf; { lock_guard lock(storage_task_queue_mutex); surf = surface_for_frame[current_storage_frame]; assert(surf != nullptr); } glPixelStorei(GL_PACK_ROW_LENGTH, 0); check_error(); glBindBuffer(GL_PIXEL_PACK_BUFFER, surf->pbo); check_error(); glBindTexture(GL_TEXTURE_2D, surf->y_tex); check_error(); glGetTexImage(GL_TEXTURE_2D, 0, GL_RED, type, BUFFER_OFFSET(surf->y_offset)); check_error(); glBindTexture(GL_TEXTURE_2D, surf->cbcr_tex); check_error(); glGetTexImage(GL_TEXTURE_2D, 0, GL_RG, type, BUFFER_OFFSET(surf->cbcr_offset)); check_error(); // We don't own these; the caller does. surf->y_tex = surf->cbcr_tex = 0; glBindTexture(GL_TEXTURE_2D, 0); check_error(); glBindBuffer(GL_PIXEL_PACK_BUFFER, 0); check_error(); glMemoryBarrier(GL_TEXTURE_UPDATE_BARRIER_BIT | GL_CLIENT_MAPPED_BUFFER_BARRIER_BIT); check_error(); } RefCountedGLsync fence = RefCountedGLsync(GL_SYNC_GPU_COMMANDS_COMPLETE, /*flags=*/0); check_error(); glFlush(); // Make the H.264 thread see the fence as soon as possible. check_error(); { lock_guard lock(frame_queue_mutex); current_video_frame.fence = fence; pending_video_frames.push(move(current_video_frame)); ++current_storage_frame; } frame_queue_nonempty.notify_all(); return fence; } void QuickSyncEncoderImpl::shutdown() { if (is_shutdown) { return; } { lock_guard lock(frame_queue_mutex); encode_thread_should_quit = true; frame_queue_nonempty.notify_all(); } encode_thread.join(); { lock_guard lock(storage_task_queue_mutex); storage_thread_should_quit = true; frame_queue_nonempty.notify_all(); storage_task_queue_changed.notify_all(); } storage_thread.join(); // Encode any leftover audio in the queues, and also any delayed frames. { lock_guard lock(file_audio_encoder_mutex); file_audio_encoder->encode_last_audio(); } if (!global_flags.x264_video_to_disk) { release_encode(); va_dpy.reset(); } is_shutdown = true; } void QuickSyncEncoderImpl::close_file() { file_mux.reset(); metric_current_file_start_time_seconds = 0.0 / 0.0; } void QuickSyncEncoderImpl::open_output_file(const std::string &filename) { AVFormatContext *avctx = avformat_alloc_context(); avctx->oformat = av_guess_format(NULL, filename.c_str(), NULL); avctx->url = strdup(filename.c_str()); string url = "file:" + filename; int ret = avio_open2(&avctx->pb, url.c_str(), AVIO_FLAG_WRITE, &avctx->interrupt_callback, NULL); if (ret < 0) { char tmp[AV_ERROR_MAX_STRING_SIZE]; fprintf(stderr, "%s: avio_open2() failed: %s\n", filename.c_str(), av_make_error_string(tmp, sizeof(tmp), ret)); abort(); } string video_extradata; // FIXME: See other comment about global headers. if (global_flags.x264_video_to_disk) { video_extradata = disk_encoder->get_global_headers(); } current_file_mux_metrics.reset(); { lock_guard lock(file_audio_encoder_mutex); AVCodecParametersWithDeleter audio_codecpar = file_audio_encoder->get_codec_parameters(); file_mux.reset(new Mux(avctx, frame_width, frame_height, Mux::CODEC_H264, video_extradata, audio_codecpar.get(), get_color_space(global_flags.ycbcr_rec709_coefficients), TIMEBASE, std::bind(&DiskSpaceEstimator::report_append, disk_space_estimator, filename, _1), Mux::WRITE_BACKGROUND, { ¤t_file_mux_metrics, &total_mux_metrics })); } metric_current_file_start_time_seconds = get_timestamp_for_metrics(); if (global_flags.x264_video_to_disk) { disk_encoder->add_mux(file_mux.get()); } } void QuickSyncEncoderImpl::encode_thread_func() { pthread_setname_np(pthread_self(), "QS_Encode"); DTSReorderer dts_reorder_buf(ip_period - 1); int64_t last_dts = -1; int gop_start_display_frame_num = 0; for (int display_frame_num = 0; ; ++display_frame_num) { // Wait for the frame to be in the queue. Note that this only means // we started rendering it. PendingFrame frame; { unique_lock lock(frame_queue_mutex); frame_queue_nonempty.wait(lock, [this]{ return encode_thread_should_quit || !pending_video_frames.empty(); }); if (encode_thread_should_quit && pending_video_frames.empty()) { // We may have queued frames left in the reorder buffer // that were supposed to be B-frames, but have no P-frame // to be encoded against. If so, encode them all as // P-frames instead. Note that this happens under the mutex, // but nobody else uses it at this point, since we're shutting down, // so there's no contention. encode_remaining_frames_as_p(quicksync_encoding_frame_num, gop_start_display_frame_num, last_dts); return; } else { frame = move(pending_video_frames.front()); pending_video_frames.pop(); } } dts_reorder_buf.push_pts(frame.pts); // Pass the frame on to x264 (or uncompressed to HTTP) as needed. // Note that this implicitly waits for the frame to be done rendering. pass_frame(frame, display_frame_num, frame.pts, frame.duration); if (global_flags.x264_video_to_disk) { lock_guard lock(storage_task_queue_mutex); release_gl_surface(display_frame_num); continue; } reorder_buffer[display_frame_num] = move(frame); // Now encode as many QuickSync frames as we can using the frames we have available. // (It could be zero, or it could be multiple.) FIXME: make a function. for ( ;; ) { int frame_type, quicksync_display_frame_num; encoding2display_order(quicksync_encoding_frame_num, intra_period, intra_idr_period, ip_period, &quicksync_display_frame_num, &frame_type); if (!reorder_buffer.count(quicksync_display_frame_num)) { break; } frame = move(reorder_buffer[quicksync_display_frame_num]); reorder_buffer.erase(quicksync_display_frame_num); if (frame_type == FRAME_IDR) { // Release any reference frames from the previous GOP. { lock_guard lock(storage_task_queue_mutex); for (const ReferenceFrame &frame : reference_frames) { release_gl_surface(frame.display_number); } } reference_frames.clear(); current_ref_frame_num = 0; gop_start_display_frame_num = quicksync_display_frame_num; } const int64_t dts = dts_reorder_buf.pop_dts(); last_dts = dts; encode_frame(frame, quicksync_encoding_frame_num, quicksync_display_frame_num, gop_start_display_frame_num, frame_type, frame.pts, dts, frame.duration, frame.ycbcr_coefficients); ++quicksync_encoding_frame_num; } } } void QuickSyncEncoderImpl::encode_remaining_frames_as_p(int encoding_frame_num, int gop_start_display_frame_num, int64_t last_dts) { if (reorder_buffer.empty()) { return; } for (auto &pending_frame : reorder_buffer) { int display_frame_num = pending_frame.first; assert(display_frame_num > 0); PendingFrame frame = move(pending_frame.second); int64_t dts = last_dts + (TIMEBASE / TYPICAL_FPS); encode_frame(frame, encoding_frame_num++, display_frame_num, gop_start_display_frame_num, FRAME_P, frame.pts, dts, frame.duration, frame.ycbcr_coefficients); last_dts = dts; } } void memcpy_with_pitch(uint8_t *dst, const uint8_t *src, size_t src_width, size_t dst_pitch, size_t height) { if (src_width == dst_pitch) { memcpy(dst, src, src_width * height); } else { for (size_t y = 0; y < height; ++y) { const uint8_t *sptr = src + y * src_width; uint8_t *dptr = dst + y * dst_pitch; memcpy(dptr, sptr, src_width); } } } void QuickSyncEncoderImpl::pass_frame(QuickSyncEncoderImpl::PendingFrame frame, int display_frame_num, int64_t pts, int64_t duration) { // Wait for the GPU to be done with the frame. GLenum sync_status; do { sync_status = glClientWaitSync(frame.fence.get(), 0, 0); check_error(); if (sync_status == GL_TIMEOUT_EXPIRED) { // NVIDIA likes to busy-wait; yield instead. this_thread::sleep_for(milliseconds(1)); } } while (sync_status == GL_TIMEOUT_EXPIRED); assert(sync_status != GL_WAIT_FAILED); ReceivedTimestamps received_ts = find_received_timestamp(frame.input_frames); static int frameno = 0; print_latency("Current mixer latency (video inputs → ready for encode):", received_ts, false, &frameno, &mixer_latency_histogram); // Release back any input frames we needed to render this frame. frame.input_frames.clear(); GLSurface *surf; { lock_guard lock(storage_task_queue_mutex); surf = surface_for_frame[display_frame_num]; assert(surf != nullptr); } uint8_t *data = reinterpret_cast(surf->y_ptr); if (http_encoder != nullptr) { http_encoder->add_frame(pts, duration, frame.ycbcr_coefficients, data, received_ts); } if (disk_encoder != nullptr && disk_encoder != http_encoder) { disk_encoder->add_frame(pts, duration, frame.ycbcr_coefficients, data, received_ts); } if (v4l_output != nullptr) { v4l_output->send_frame(data); } } void QuickSyncEncoderImpl::encode_frame(QuickSyncEncoderImpl::PendingFrame frame, int encoding_frame_num, int display_frame_num, int gop_start_display_frame_num, int frame_type, int64_t pts, int64_t dts, int64_t duration, YCbCrLumaCoefficients ycbcr_coefficients) { const ReceivedTimestamps received_ts = find_received_timestamp(frame.input_frames); GLSurface *surf; { lock_guard lock(storage_task_queue_mutex); surf = surface_for_frame[display_frame_num]; assert(surf != nullptr); } VAStatus va_status; if (use_zerocopy) { eglDestroyImageKHR(eglGetCurrentDisplay(), surf->y_egl_image); eglDestroyImageKHR(eglGetCurrentDisplay(), surf->cbcr_egl_image); va_status = vaReleaseBufferHandle(va_dpy->va_dpy, surf->surface_image.buf); CHECK_VASTATUS(va_status, "vaReleaseBufferHandle"); } else { // Upload the frame to VA-API. unsigned char *surface_p = nullptr; vaMapBuffer(va_dpy->va_dpy, surf->surface_image.buf, (void **)&surface_p); unsigned char *va_y_ptr = (unsigned char *)surface_p + surf->surface_image.offsets[0]; memcpy_with_pitch(va_y_ptr, surf->y_ptr, frame_width, surf->surface_image.pitches[0], frame_height); unsigned char *va_cbcr_ptr = (unsigned char *)surface_p + surf->surface_image.offsets[1]; memcpy_with_pitch(va_cbcr_ptr, surf->cbcr_ptr, (frame_width / 2) * sizeof(uint16_t), surf->surface_image.pitches[1], frame_height / 2); va_status = vaUnmapBuffer(va_dpy->va_dpy, surf->surface_image.buf); CHECK_VASTATUS(va_status, "vaUnmapBuffer"); } va_status = vaDestroyImage(va_dpy->va_dpy, surf->surface_image.image_id); CHECK_VASTATUS(va_status, "vaDestroyImage"); // Schedule the frame for encoding. VASurfaceID va_surface = surf->src_surface; va_status = vaBeginPicture(va_dpy->va_dpy, context_id, va_surface); CHECK_VASTATUS(va_status, "vaBeginPicture"); if (frame_type == FRAME_IDR) { // FIXME: If the mux wants global headers, we should not put the // SPS/PPS before each IDR frame, but rather put it into the // codec extradata (formatted differently?). // // NOTE: If we change ycbcr_coefficients, it will not take effect // before the next IDR frame. This is acceptable, as it should only // happen on a mode change, which is rare. render_sequence(); render_picture(surf, frame_type, display_frame_num, gop_start_display_frame_num); if (h264_packedheader) { render_packedsequence(ycbcr_coefficients); render_packedpicture(); } } else { //render_sequence(); render_picture(surf, frame_type, display_frame_num, gop_start_display_frame_num); } render_slice(encoding_frame_num, display_frame_num, gop_start_display_frame_num, frame_type); va_status = vaEndPicture(va_dpy->va_dpy, context_id); CHECK_VASTATUS(va_status, "vaEndPicture"); update_ReferenceFrames(display_frame_num, frame_type); vector ref_display_frame_numbers; // Lock the references for this frame; otherwise, they could be // rendered to before this frame is done encoding. { lock_guard lock(storage_task_queue_mutex); for (const ReferenceFrame &frame : reference_frames) { assert(surface_for_frame.count(frame.display_number)); ++surface_for_frame[frame.display_number]->refcount; ref_display_frame_numbers.push_back(frame.display_number); } } // so now the data is done encoding (well, async job kicked off)... // we send that to the storage thread storage_task tmp; tmp.display_order = display_frame_num; tmp.frame_type = frame_type; tmp.pts = pts; tmp.dts = dts; tmp.duration = duration; tmp.ycbcr_coefficients = ycbcr_coefficients; tmp.received_ts = received_ts; tmp.ref_display_frame_numbers = move(ref_display_frame_numbers); storage_task_enqueue(move(tmp)); } // Proxy object. QuickSyncEncoder::QuickSyncEncoder(const std::string &filename, ResourcePool *resource_pool, QSurface *surface, const string &va_display, int width, int height, const AVOutputFormat *oformat, VideoCodecInterface *http_encoder, VideoCodecInterface *disk_encoder, DiskSpaceEstimator *disk_space_estimator) : impl(new QuickSyncEncoderImpl(filename, resource_pool, surface, va_display, width, height, oformat, http_encoder, disk_encoder, disk_space_estimator)) {} // Must be defined here because unique_ptr<> destructor needs to know the impl. QuickSyncEncoder::~QuickSyncEncoder() {} void QuickSyncEncoder::add_audio(int64_t pts, vector audio) { impl->add_audio(pts, audio); } bool QuickSyncEncoder::is_zerocopy() const { return impl->is_zerocopy(); } bool QuickSyncEncoder::begin_frame(int64_t pts, int64_t duration, YCbCrLumaCoefficients ycbcr_coefficients, const vector &input_frames, GLuint *y_tex, GLuint *cbcr_tex) { return impl->begin_frame(pts, duration, ycbcr_coefficients, input_frames, y_tex, cbcr_tex); } RefCountedGLsync QuickSyncEncoder::end_frame() { return impl->end_frame(); } void QuickSyncEncoder::shutdown() { impl->shutdown(); } void QuickSyncEncoder::close_file() { impl->shutdown(); } void QuickSyncEncoder::set_http_mux(Mux *mux) { impl->set_http_mux(mux); } void QuickSyncEncoder::set_srt_mux(Mux *mux) { impl->set_srt_mux(mux); } int64_t QuickSyncEncoder::global_delay() const { return impl->global_delay(); } string QuickSyncEncoder::get_usable_va_display() { // Reduce the amount of chatter while probing, // unless the user has specified otherwise. bool need_env_reset = false; if (getenv("LIBVA_MESSAGING_LEVEL") == nullptr) { setenv("LIBVA_MESSAGING_LEVEL", "0", true); need_env_reset = true; } // First try the default (ie., whatever $DISPLAY is set to). unique_ptr va_dpy = try_open_va_h264("", nullptr, nullptr); if (va_dpy != nullptr) { if (need_env_reset) { unsetenv("LIBVA_MESSAGING_LEVEL"); } return ""; } fprintf(stderr, "No --va-display was given, and the X11 display did not expose a VA-API H.264 encoder.\n"); // Try all /dev/dri/render* in turn. TODO: Accept /dev/dri/card*, too? glob_t g; int err = glob("/dev/dri/renderD*", 0, nullptr, &g); if (err != 0) { fprintf(stderr, "Couldn't list render nodes (%s) when trying to autodetect a replacement.\n", strerror(errno)); } else { for (size_t i = 0; i < g.gl_pathc; ++i) { string path = g.gl_pathv[i]; va_dpy = try_open_va_h264(path, nullptr, nullptr); if (va_dpy != nullptr) { fprintf(stderr, "Autodetected %s as a suitable replacement; using it.\n", path.c_str()); globfree(&g); if (need_env_reset) { unsetenv("LIBVA_MESSAGING_LEVEL"); } return path; } } } fprintf(stderr, "No suitable VA-API H.264 encoders were found in /dev/dri; giving up.\n"); fprintf(stderr, "Note that if you are using an Intel CPU with an external GPU,\n"); fprintf(stderr, "you may need to enable the integrated Intel GPU in your BIOS\n"); fprintf(stderr, "to expose Quick Sync. Alternatively, you can use --record-x264-video\n"); fprintf(stderr, "to use software instead of hardware H.264 encoding, at the expense\n"); fprintf(stderr, "of increased CPU usage and possibly bit rate.\n"); abort(); } nageru-2.3.0/nageru/quicksync_encoder.h000066400000000000000000000075341450736322200201540ustar00rootroot00000000000000// Hardware H.264 encoding via VAAPI. Also orchestrates the H.264 encoding // in general; this is unfortunate, and probably needs a cleanup. In particular, // even if you don't actually use Quick Sync for anything, this class // (or actually, QuickSyncEncoderImpl) still takes on a pretty central role. // // Heavily modified based on example code by Intel. Intel's original copyright // and license is reproduced below: // // Copyright (c) 2007-2013 Intel Corporation. All Rights Reserved. // // Permission is hereby granted, free of charge, to any person obtaining a // copy of this software and associated documentation files (the // "Software"), to deal in the Software without restriction, including // without limitation the rights to use, copy, modify, merge, publish, // distribute, sub license, and/or sell copies of the Software, and to // permit persons to whom the Software is furnished to do so, subject to // the following conditions: // // The above copyright notice and this permission notice (including the // next paragraph) shall be included in all copies or substantial portions // of the Software. // // THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS // OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF // MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NON-INFRINGEMENT. // IN NO EVENT SHALL PRECISION INSIGHT AND/OR ITS SUPPLIERS BE LIABLE FOR // ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, // TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE // SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. #ifndef _H264ENCODE_H #define _H264ENCODE_H #include #include #include #include #include #include #include extern "C" { #include } #include "shared/ref_counted_gl_sync.h" class DiskSpaceEstimator; class Mux; class QSurface; class QuickSyncEncoderImpl; class RefCountedFrame; class VideoCodecInterface; namespace movit { class ResourcePool; } // namespace movit // This is just a pimpl, because including anything X11-related in a .h file // tends to trip up Qt. All the real logic is in QuickSyncEncoderImpl, // defined in quicksync_encoder_impl.h. // // This class is _not_ thread-safe, except where mentioned. class QuickSyncEncoder { public: QuickSyncEncoder(const std::string &filename, movit::ResourcePool *resource_pool, QSurface *surface, const std::string &va_display, int width, int height, const AVOutputFormat *oformat, VideoCodecInterface *http_encoder, VideoCodecInterface *disk_encoder, DiskSpaceEstimator *disk_space_estimator); ~QuickSyncEncoder(); void set_http_mux(Mux *mux); // Does not take ownership. Must be called unless x264 is used for the stream. void set_srt_mux(Mux *mux); // Does not take ownership. Must be called if SRT is to be used, unless x264 is used for the stream. void add_audio(int64_t pts, std::vector audio); // Thread-safe. bool is_zerocopy() const; // Thread-safe. // See VideoEncoder::begin_frame(). bool begin_frame(int64_t pts, int64_t duration, movit::YCbCrLumaCoefficients ycbcr_coefficients, const std::vector &input_frames, GLuint *y_tex, GLuint *cbcr_tex); RefCountedGLsync end_frame(); void shutdown(); // Blocking. Does not require an OpenGL context. void close_file(); // Does not require an OpenGL context. Must be run after shutdown. void release_gl_resources(); // Requires an OpenGL context. Must be run after shutdown. int64_t global_delay() const; // So we never get negative dts. // Tries to autodetect a device with a usable VA-API H.264 encoder. // Tries first the default X11 display, then every /dev/dri/renderD* node in turn. // Dies if none could be found. static std::string get_usable_va_display(); private: std::unique_ptr impl; }; #endif nageru-2.3.0/nageru/quicksync_encoder_impl.h000066400000000000000000000211311450736322200211620ustar00rootroot00000000000000#ifndef _QUICKSYNC_ENCODER_IMPL_H #define _QUICKSYNC_ENCODER_IMPL_H 1 #include #include #include #include #include #include #include #include #include #include #include #include #include "audio_encoder.h" #include "defs.h" #include "shared/timebase.h" #include "print_latency.h" #include "shared/ref_counted_gl_sync.h" #include "shared/va_display.h" #include "v4l_output.h" #define SURFACE_NUM 16 /* 16 surfaces for source YUV */ #define MAX_NUM_REF1 16 // Seemingly a hardware-fixed value, not related to SURFACE_NUM #define MAX_NUM_REF2 32 // Seemingly a hardware-fixed value, not related to SURFACE_NUM struct __bitstream { unsigned int *buffer; int bit_offset; int max_size_in_dword; }; typedef struct __bitstream bitstream; namespace movit { class ResourcePool; } class DiskSpaceEstimator; class QSurface; class VideoCodecInterface; class QuickSyncEncoderImpl { public: QuickSyncEncoderImpl(const std::string &filename, movit::ResourcePool *resource_pool, QSurface *surface, const std::string &va_display, int width, int height, const AVOutputFormat *oformat, VideoCodecInterface *http_encoder, VideoCodecInterface *disk_encoder, DiskSpaceEstimator *disk_space_estimator); ~QuickSyncEncoderImpl(); void add_audio(int64_t pts, std::vector audio); bool is_zerocopy() const; bool begin_frame(int64_t pts, int64_t duration, movit::YCbCrLumaCoefficients ycbcr_coefficients, const std::vector &input_frames, GLuint *y_tex, GLuint *cbcr_tex); RefCountedGLsync end_frame(); void shutdown(); void close_file(); void release_gl_resources(); void set_http_mux(Mux *mux) { http_mux = mux; } void set_srt_mux(Mux *mux) { srt_mux = mux; } // So we never get negative dts. int64_t global_delay() const { return int64_t(ip_period - 1) * (TIMEBASE / TYPICAL_FPS); } private: struct storage_task { unsigned long long display_order; int frame_type; std::vector audio; int64_t pts, dts, duration; movit::YCbCrLumaCoefficients ycbcr_coefficients; ReceivedTimestamps received_ts; std::vector ref_display_frame_numbers; }; struct PendingFrame { RefCountedGLsync fence; std::vector input_frames; int64_t pts, duration; movit::YCbCrLumaCoefficients ycbcr_coefficients; }; struct GLSurface { // Only if x264_video_to_disk == false. VASurfaceID src_surface, ref_surface; VABufferID coded_buf; VAImage surface_image; // Only if use_zerocopy == true (which implies x264_video_to_disk == false). GLuint y_tex, cbcr_tex; EGLImage y_egl_image, cbcr_egl_image; // Only if use_zerocopy == false. GLuint pbo; uint8_t *y_ptr, *cbcr_ptr; size_t y_offset, cbcr_offset; // Surfaces can be busy (have refcount > 0) for a variety of // reasons: First of all because they belong to a frame that's // under encoding. But also reference frames take refcounts; // while a frame is being encoded, all its reference frames // also have increased refcounts so that they are not dropped. // Similarly, just being in increases the // refcount. Until it is back to zero, the surface cannot be given // out for encoding another frame. Use release_gl_surface() // to reduce the refcount, which will free the surface if // the refcount reaches zero. // // Protected by storage_task_queue_mutex. int refcount = 0; }; void open_output_file(const std::string &filename); void encode_thread_func(); void encode_remaining_frames_as_p(int encoding_frame_num, int gop_start_display_frame_num, int64_t last_dts); void pass_frame(PendingFrame frame, int display_frame_num, int64_t pts, int64_t duration); void encode_frame(PendingFrame frame, int encoding_frame_num, int display_frame_num, int gop_start_display_frame_num, int frame_type, int64_t pts, int64_t dts, int64_t duration, movit::YCbCrLumaCoefficients ycbcr_coefficients); void storage_task_thread(); void storage_task_enqueue(storage_task task); void save_codeddata(GLSurface *surf, storage_task task); int render_packedsequence(movit::YCbCrLumaCoefficients ycbcr_coefficients); int render_packedpicture(); void render_packedslice(); int render_sequence(); int render_picture(GLSurface *surf, int frame_type, int display_frame_num, int gop_start_display_frame_num); void sps_rbsp(movit::YCbCrLumaCoefficients ycbcr_coefficients, bitstream *bs); void pps_rbsp(bitstream *bs); int build_packed_pic_buffer(unsigned char **header_buffer); int render_slice(int encoding_frame_num, int display_frame_num, int gop_start_display_frame_num, int frame_type); void slice_header(bitstream *bs); int build_packed_seq_buffer(movit::YCbCrLumaCoefficients ycbcr_coefficients, unsigned char **header_buffer); int build_packed_slice_buffer(unsigned char **header_buffer); int init_va(const std::string &va_display); void enable_zerocopy_if_possible(); int setup_encode(); void release_encode(); void update_ReferenceFrames(int current_display_frame, int frame_type); void update_RefPicList_P(VAPictureH264 RefPicList0_P[MAX_NUM_REF2]); void update_RefPicList_B(VAPictureH264 RefPicList0_B[MAX_NUM_REF2], VAPictureH264 RefPicList1_B[MAX_NUM_REF2]); GLSurface *allocate_gl_surface(); void release_gl_surface(size_t display_frame_num); bool is_shutdown = false; bool has_released_gl_resources = false; std::atomic use_zerocopy{false}; std::thread encode_thread, storage_thread; std::mutex storage_task_queue_mutex; std::condition_variable storage_task_queue_changed; std::queue storage_task_queue; // protected by storage_task_queue_mutex bool storage_thread_should_quit = false; // protected by storage_task_queue_mutex std::mutex frame_queue_mutex; std::condition_variable frame_queue_nonempty; bool encode_thread_should_quit = false; // under frame_queue_mutex int current_storage_frame; PendingFrame current_video_frame; // Used only between begin_frame() and end_frame(). std::queue pending_video_frames; // under frame_queue_mutex movit::ResourcePool *resource_pool; QSurface *surface; // Frames that are done rendering and passed on to x264 (if enabled), // but have not been encoded by Quick Sync yet, and thus also not freed. // The key is the display frame number. std::map reorder_buffer; int quicksync_encoding_frame_num = 0; std::mutex file_audio_encoder_mutex; std::unique_ptr file_audio_encoder; VideoCodecInterface *http_encoder; // nullptr if not using x264/SVT-AV1. VideoCodecInterface *disk_encoder; std::unique_ptr v4l_output; // nullptr if not using V4L2 output. Mux* http_mux = nullptr; // To the HTTP server. Mux* srt_mux = nullptr; // To the remote SRT endpoint, if any. std::unique_ptr file_mux; // To local disk. // Encoder parameters std::unique_ptr va_dpy; VAProfile h264_profile = (VAProfile)~0; VAConfigAttrib config_attrib[VAConfigAttribTypeMax]; int config_attrib_num = 0, enc_packed_header_idx; GLSurface gl_surfaces[SURFACE_NUM]; // For all frames in encoding (refcount > 0), a pointer into gl_surfaces // for the surface used for that frame. Protected by storage_task_queue_mutex. // The key is display frame number. std::unordered_map surface_for_frame; VAConfigID config_id; VAContextID context_id; VAEncSequenceParameterBufferH264 seq_param; VAEncPictureParameterBufferH264 pic_param; VAEncSliceParameterBufferH264 slice_param; VAPictureH264 CurrentCurrPic; struct ReferenceFrame { VAPictureH264 pic; int display_number; // To track reference counts. }; std::deque reference_frames; // Static quality settings. static constexpr unsigned int frame_bitrate = 15000000 / 60; // Doesn't really matter; only initial_qp does. static constexpr unsigned int num_ref_frames = 2; static constexpr int initial_qp = 15; static constexpr int minimal_qp = 0; static constexpr int intra_period = 30; static constexpr int intra_idr_period = TYPICAL_FPS; // About a second; more at lower frame rates. Not ideal. // Quality settings that are meant to be static, but might be overridden // by the profile. int constraint_set_flag = 0; int h264_packedheader = 0; /* support pack header? */ int h264_maxref = (1<<16|1); int h264_entropy_mode = 1; /* cabac */ int ip_period = 3; unsigned int current_ref_frame_num = 0; // Encoding frame order within this GOP, sans B-frames. int frame_width; int frame_height; int frame_width_mbaligned; int frame_height_mbaligned; DiskSpaceEstimator *disk_space_estimator; }; #endif // !defined(_QUICKSYNC_ENCODER_IMPL_H) nageru-2.3.0/nageru/quittable_sleeper.h000066400000000000000000000033621450736322200201500ustar00rootroot00000000000000#ifndef _QUITTABLE_SLEEPER #define _QUITTABLE_SLEEPER 1 // A class that assists with fast shutdown of threads. You can set // a flag that says the thread should quit, which it can then check // in a loop -- and if the thread sleeps (using the sleep_* functions // on the class), that sleep will immediately be aborted. // // All member functions on this class are thread-safe. #include #include #include class QuittableSleeper { public: void quit() { std::lock_guard l(mu); should_quit_var = true; quit_cond.notify_all(); } void unquit() { std::lock_guard l(mu); should_quit_var = false; } void wakeup() { std::lock_guard l(mu); should_wakeup_var = true; quit_cond.notify_all(); } bool should_quit() const { std::lock_guard l(mu); return should_quit_var; } // Returns false if woken up early. template bool sleep_for(const std::chrono::duration &duration) { std::chrono::steady_clock::time_point t = std::chrono::steady_clock::now() + std::chrono::duration_cast(duration); return sleep_until(t); } // Returns false if woken up early. template bool sleep_until(const std::chrono::time_point &t) { std::unique_lock lock(mu); quit_cond.wait_until(lock, t, [this]{ return should_quit_var || should_wakeup_var; }); if (should_wakeup_var) { should_wakeup_var = false; return false; } return !should_quit_var; } private: mutable std::mutex mu; bool should_quit_var = false, should_wakeup_var = false; std::condition_variable quit_cond; }; #endif // !defined(_QUITTABLE_SLEEPER) nageru-2.3.0/nageru/ref.raw000066400000000000000000002400001450736322200155450ustar00rootroot00000000000000˶!X~7q7vd8Ye9櫸f_I9չg9CisL!:k1:en";o;~6}Cɻ;<%i0M㺊CGTا=6RY_*>/L>䘯nE==̑>2|X*upڽ-Gw=>B|fq`=>:C>ٽSg==` }>UқrTֽBH=]>Dm.)w=;> >ݲA#׽z_=6=ڀ>_-lDUؽX=W>ۯNߜB= > >U뮾ؽd=^=>RVؽqz]= >zlYBp`=$>&Ք>b!,ٽӹi==K>aB ٽb=ؕ>J&}=E >Z>Yfٽn=w=H>1GCٽbg=X_> ;-g=>>ٽ%Ws=d=>Vg}ٽ%l=>/Iei O=ц>Vd>sٽx=O=~j>ѯ ٽp=j>w믾yp 6=^>> iڽ |=9=K>Pp-ٽ u==>毾*|P =>j>Kڽƀ="=\+>O`{(ڽDz=q>8⯾Vlv @=r>>nڽ&=3 = >*;yaڽy~=C>ݯŸg h=fP>m> ڽp==>֡ ڽwŁ=v>ٯ#I| ƿ=,>H>B\ڽ<==Š>0eu ڽq=>ԯn4 =>m>t*۽ ==>#-r ۽qY=Dw>"Яà;I =>>﮾a۽S==u>p @۽d=>˯0Lb=ո>vj> 뮾}۽V=v=L>%eF nw۽J݊=u>Iǯk{==>c>c殾۽֐=T=">< ܭ۽=>¯/Ä=c>yc>ᮾܽ=i1=>  ۽P=Mo>*)=7>ޛ>@ݮ9ܽH=^ =lɏ>_ gܽԃ= >bc\$=>X>خnܽ{==>бXNܽ$=e>)2Ü=ؑ>dҜ><Ԯ ܽ==j>hMm˂ܽ'ޕ=ߝ>8p=\>J>Ϯܽԛ=K=7>mTܽ=Y>ѭUϨB=8t>i>lˮ ݽ=h=A>ޤLQ(ܽB'=ў>e5=}?>8>Ǯ^>ݽ^=_;=Γ>ݽ#E=4H>== >>®qݽn9=& =ꗔ>C9MRݽ^=8>Bjd=ѕ>#>ݽR==H_>zݽs=R3>5sEy=?>>Z ݽ.f=9=$>eा/'=ݽG=o>4ݤ}B=[>D >5< ޽u=s=>-ݽs=>)` =>?> IIݽAR==6>⣾rS۽= >7 %8=Eѕ>ѳ>cDٽa= =]'>CX׽=9>)DW-=x>1>Sս==>bI%pӽơ=>咦,=m> >^0vѽ젥==F>J|iϽ=ӧ>v嚾6* 5=>K>LͽX=4=>+˽]==>vjGLG=3>>>Jɽ==s!>~i,Ƚ= ݒ> nݵ3,c=纋>>X?Oƽ|=w=->U㽭Ľٜ=>2/kܽ=+lj>M:>lu½X==?>Kv6޽b=8>Pm׽=ه>>)U9)=i߷=V>7ٽ5@=m>ԔzDҽ=m>A>dےǻ==s><%XԽ =>cIߋͽH3=? >{>#5g,=;G=㕂>\<Ͻȶ=ۄ>`,ɽ~=/>M>Eze==w>釾ʽ5=Z>û4 ĽҪ=FW>n(>7ފױO=Ԭ=}>:mƽ\GԔ=8>I$?/=}> >sO˦Aۗ=<(=9z>-a½xp=> =my>S>ͅʅrd==v>:,㳽=~>:=u>{>Xs=="s> ~C= z>||=VXr>w> po=T[=Lo>yae1= v>GGtx]=rn>s>R'}p{ =ӟ=96l>#udu=r>{Itī=lk>Vo>mxfp=T=gh>oq|/P=7n>DwW1pq=h>l>s=ޚ=re>cm\>݊=ej>r*lB=d>Jh>soe3k=q=` b>ii0ܗg=\f>Xn6h󣠽 U=8Ya>Ed>c.k1= =^>Ȁe|T=b>EjRd\=^>N`>[f_=j=}[>8a@ʞ<5Hx=KH_>Qe`誙Ա=Z>F]>bۑ؈=zY=eX>v]U=[>a\Nyl=W>Y>#^uCP= =:U>:,Zۄ=I(X>] Y.='7V>Z·ȅ= Ȍ=6R>OVDr =RT>YlUwӏ*=WQ>+R>١V#8@=S=O>lRt{=>@Q>5UQXˆ=BN>^O>NRQć渂=SV=K>1jOQb~*~=M>QZNv=6K>L>N\31=,)=H>[K_A4N5{=J>MJ,Dž=5H>H>HC3݁K@x=IG>4EJ~GPăUn=-E>ҕG9E|== C>2EX!Ku=D>*F^1DEC|=MB>NB>D|8y==$@>AJz/Xr=@>C@R|x=h?>*?>}@=Tx-v={=G=>>m0v7fo=o=>\?b=v5t=<>g<>8 =s$s= pw=5s:>S;yqul=q:>*<:qMp=v9>m9>u9Gop=ns=7>x_8tÑmJi=7>S8mo7F|lLl=I6> 6>M[6Vfkm={o=K4>FM5Vo`if=4>>5ka4Ctgh=D14>3>d36?gj=k=/2>H2!sjECec=1>QI2`1bd&e=Oz1>X/0>/+c5g=g=/>P/me8a`=.>C/+m.׾]ha=k.>S->@,_*_~d=c=V,>f,u`@]]=k,>,Z+ Y]=p',>Ճ*>]);[$a=;`=;*>)Z[y[Y^[=2E)>f(1(G}TrZ=R)>'>h&_W40^=\='>s&0_WUQ%X=&>%%P V=&>%>#S?[=qX=%>A#RfQ KU=#> ##KR=m$>4V"> ORX=aXU=">8!{NNutR=%!>) g eGxO=!>>3 6LbjU=/Q= >Њj1J6yJO=>VVGY>@~HR=VN=>F?FL=>J+?H=y>@>E&O=iJ=w@>RnA;mCJ=}f> 3;ME=>>.uAL=ˈG=>K=?AG=+>!/CQ7!B=8>>4E>>I=4D==>iG9<D=o>3o>=>C>":"G=U@=3>*,.6Q9A=>/X;=ݐ>[>7UD===o>g?s26 ?=ؠ>{ Nr6,j8=I>6U> h4A=:=>u 6.2U<=G > ZR (N5= > >$, >1G>=A[7=ao > V>+@/Ѧ9=U > `:%0>2= >R > $. <= B4== >e#',6= >6"!8/=ؠ >=v>ot+.V9=!41= >0$[$)TX4=t>jsx>,=fx>:>>!(6=d1.=2>Ar!&1=@> CUYO)=xW>*>'%3=9+=B>#M/=>B/j&=>>>NC"pO1=8M(=>1 a,=<=C#=8,>=3rm.=;k%=Ƕ>)=j=?] =!>_l=;,="=d=SvS2p'==:N)=&==R=>}EP|)==i=+~$=g}=sI 5A=ME=+J=_6~&=3=|=>m"={=Ok‘;y C=[=Q=U潐b$=K==)꽕 T='=rfU3=='i=^S!=h== {3\==t!" K=:=n=`z޽moa== =#Af;n==Yݽh==R=|ڽ =^=V=e߽ T=\=VٽJ޽.=A= =ֽv ax===޷۽O 7M='a= ֽڽI ==b= :ӽ G =F ==ؽ4='=:cҽ׽C7 ==D=؜ϽS[=- == Խߎ='=ν~ӽ=|=>:=̽UgI=T= = ѽLy>M=,=B˽=нT3Me===,Ƚd ===ͽN# =(=ǽ̽弨 =ʏ=K=)Žݝ==.=A:ʽx =k=dĽ;ɽDἧm<,==$Q =.=(=tƽ=a=^ ~Žpܼ_<==т =<=ýgAL=!=޽%^ؼU<ŋ=L=}F>=r-<G=lBܼ==Pu{b%Լ9:#ļK&/t<=b>RF<>@=Յ= лV<<=t=s﮼F<orƒ$ʊ=-Mvʦy_<|H=DETBɁ<+P=I3=;ڈX}?MPzNf)Zf-<p9=667Dn<@=o#=-Nf<6<*=);bb<Æ6=&34Aj<== =+R{zrf =!"SF@It|<=#SK$FA: }$<=<k1>7;<>E<<C+5U<>*۸+)<c<缰4+<=<)<%&).L<<{<<̾ <=<W:075<I<<α"0ucW<=hj3*T"<=4 H@2,Y_$hjW>@![u-%H<"=4<}*a&Z+<(=+b"@0V_<2=b =$<%u=pؔ r><5<'=l피c;<%=ZzɊw2 AރH@<4=%W0=EL6M=:=0!񥼴Y=$%/𢼘Q=#;|]M=J=sN.E]Fk<*gM=E1^h<M= 1|.2U=e7!q;Ἴn#||<\==U[sy<ְ\=?> >x综—w<^=$\=?{=侼¿*{y<`=[|]=>C翼Cpm=Uk=?J7Wʼׇ<珈<:l=(KՌ̼kʼ\w=Tq-ּ1BӼڋ=\ͺ߼8ۼ<=^J]2ܼ\`<=gU=N_Рݼz~ܟ<| ֲ<`=\=(Ϝ<< =wpҴz<ݜ=gڻ֯<7=o=7 <r & <5=,pk0k<=M=7~|<~,<=τ0o<= *S'p<=-=(*n3<΄=6JU=pؼ,=6<ƃ=ƽ뼣V<=bR˽X^䪼W2=z=%=ټ-='C<=Uǽ\.<=q̽fZ<իX3=No=4= Uڼ‘.=P<=ȽYAЧ<=]ͽX^fǬZY4=e=D=*ۼ /=L_<=ɽ⠼'<=ܴνcG-\5=^=V=7!ݼ0=zo<=Bʽ<=Ͻj̰P`6=MW=Sj=ER޼K{1=l<=!{ԽA~:=J=H=Ľ*o5=<9=нF#_< =ս)Eo;=K=T=4ŽFfYp6=<=xѽ kT<=ֽ½lΕ<=L==ƽXr7==<-= ҽO[.𧼚J<~= ؽý-==0P=Q=bǽ_u8=!Խ8٨B<#=$9ٽĽkB>=SU===eȽ#|y9=p>ȀR=+h<=a-<=YNjIOS=NC=X彰kLS=>[Ѽ]Y==9=V彃x>S=1"<p=@T<Hn<^=%q_Ѽ#Y=h=[9=V{;S=¼<0\=8qr${ѼFY==Z8=WpQ2S=#¼<[=}q&CѼY==G8=X}0S=<~x=>_?,¼<[=q'ὕѼ+Y==Z8=Xk.S==vC\a¼̛= 9=^d#S=U὘ѼLY=!=c9=Di)S=f<=?OüIüfὗѼ6Y=:=n:=oNES=$=\XüZS=P0= olļK=m=6̽SeH<5=j=Zн<5==F޽tӼ4K3==c.̽ S~UL =.=%ϽEU<Ą==@ӽ ¼<=i=ὧؼNA ==)罔ϽU==^c⽳ؼOfe =n=Q置+н3U<==ӽhüĽ<5=,=Xm⽡ؼOi ==U5нU=&=+{8ټ{ QF =F=нXCVg=:мټDReD =w =ZCҽVɼrUT =5$=eҽ`WG<=y;=սʼ|Tӹ =.=~ӽW^<=G=սl_˼A彪Wڼ8T =a2=ӽxWT<͸=K=%ս˼=D=S彟bڼT =16=p,ӽW<=VP=o.սп˼ ӽW}<=T=7սJ˼<0== m彞sڼ U =;=ɛpGӽWl<)=V=b;ս̼!< ,=,=u&yڼQU ===9PӽnWC\<= Y=?ս6̼~A=轔aӽWA:<=\=OHսxM̼ <7=b=9ڼHU- =B=-vjӽW#)<=^=Lսe̼@<==×ڼNXU) =OD=7VsӽZW<=w`=Pս}̼_<=`=cڼgU =E=?#|ӽWH<=7b=Tս̼1<=aͽǽѶSaG^=m=[c=lr伈&=-=B1彟'==>n=Ҵ1g5=l^==,&̡(0L=i>FF뽸+=4>=뽱#z%&=S=2K=v-CEN=0>I콐ߏ+=@>F ='%:>)=%U==,5XgM=z>G!]+=:>Y=-&ً)=U=Ba=V@-fM=`I>@y+=>'6=::e&')=TV==W-(N=f>Q\P2 .B,=k%>K=&B*=2V==g).gN=>!%v- ,=fp>V=fh'(*=W= =gLy.xN='">P ,=>=gF'*=^W==_.ZGO=j>4Bs 7-=>y=7H([X+=W=YM=BJ/a.O=ɳ>H g-=R>d =j*:(,+=%X=#=/eP=>J !-=T>=()b,=*lX=f{=H0LgP=/F>˶ B0.=J>x0=Y)o,=X==Жt0#nP=>ddW# ă.=^6>=5 *.,=l!Y=Ϊ=m07 =)Q=~> p.=>5W=܊|z*+-=A|Y=8C=m3jZ1) Q=h#>X 3+/=?>=#*!-=aY== 1$ Q=m>J1j K/=>o=b)]+-=3Z=6u=>/2+ MR=> /=h>\=We+BF.='Z==2 R=>]3E)0=">ǩ=3?,A.=Z=ި=n3N CS=oM>h2 ~0=~>?=@,n/=H[=EC=ɽp3! tS=>Hq-!n0=Q>=&#-d/=[=/=, ]3Pv S=>ZW*1=>l=$-/=G\=y=\F4 h;T=?/>װG1=>j=G].$0=`\=>=4f T=z>igQl61=";>='z.0=\=\=5{ T=>l\u1=)>>-=1.ڃ0=\==#5< T=ކ>yn8fu|.1=d@>B=K.@0=\=]='5T=>z1=L>=.0=\==ty95$T=X>)zؕ1=L>Ĩ=kf.0=\==:53T=~>yř'1=L>w=.G0=\='=:5BT={>ys֏1=L>;=.0=\=m=(9;5QZT=#y>x<1=L>=Z.|0=\==f;5`T=kv>xq1=M>œ=c,.x0= v\="= O<5oT=s>wa1=9M>= .ct0=Kj\==#<5CT= q>#wiR1=JM>~=-/p0=^\==Q%=5`T=`n>vɱ[C1=NM>o=/k0=%S\=6=u'i>5uT=k> v.Ƶy41=KM>[=2/Tg0=G\=p=)>5T=i>u%1=JM>Qz=N*/b0=Z<\==+?5{T=lf>u1=6M>;u=>5/o^0=1\==-'@5ȨT=c>ste1=5M>+p=0K@/!Z0=%\==/@5DT=)a>sx0=@M> k=jK/U0=\=D=1:A5'CT=^>s0=ZM>f=cW/Q0=g\==04B5qT=[> sNw0=|M>Xa=5b/ r@0=M>\=0m/:F0=[==7B5nT=V>p¹0=M>W= yw/D@0=[=j=,9B5"ɣT=AT>o0=M>5S=# /):0=[==:B51ǢT=Q>nS`0=M>N=r ߋ/30=[==<%C5@T=5O>mp b0=rM>I=/-0='[=.=S=`C5OqT=L>lbgy0=KM>2E=/'0=Q[=N=>C5^>T=8J>kYi0=>M>@=m/ 0=S[==@C5mIT=G>j]Y0=FM>;=C/0=*[==AiD5}7T=KE>iH0=XM>d7=/^0=[==]CD5H;T=B>hh80=A>=6//=߄[=_=P955"3T=g@>h 9(0=J?>=//=v[=3=8 35řT==>Qg0==>=b/@/=qh[= =805bT=;>fl0=:>=[//=MZ[==7.5 T=-9>eC/=8>=-//=XL[= =6I,5T=6>d^ /=e6> =p]/q/=>[==J6)5lT=o4>'dq$&/=04>M=//=0[==5'5T=2>Uc,/=2>=//=q#[== 5%5RpT=/>bV =2B/=/>B=y/-/= [==4J$5ɐT=c->a p8w/=->=Z//=[==4"5$LT=+>)at>/=+>== o0e/= Z=*=t3 5h T=(>\`KD/=e)>= 0X/=Z=N=2Y5T=q&>t_7Ipy/=?'>&=ަ0T/=tZ=y=25Y!T="$>}^e(Oj/=&%>=+f0w/=sZ==H185,T=!>]aTZ/= #>U=r!0}/=Z=Վ=o05q8T=>q\W!YK/= >ݘ=x'0t/=Z= =/5CAT=Y>l[a$^Pu=-.0l/=Z=B=.5iODT=>gZH'd2-/=><= 40-c/=Z==-5ZYT=>WY*Fi/=>=G+;0~Z/=:Z==- 5KfT=>EX,]n/=>w=u~A0Q/=Z=|=9, 5}qT=j>,W/cs#/=>o=xG0,I/=yZ=x=]+A5|T=1>V2\x.=>^g=rMN0@/=FmZ=t=}*c5"^T=> U5V}.=>_=lT08/=q`Z=/q=)5T= >T8|.=>V=g[0//=zSZ=m=(4kRT= >S;.=>ON=-ab0'/=+R?.= >E=J[i0/=8Z=vf='4mT=U>IQEC.= >,==lUp0/=x+Z=b=&4xߏT=>Z[0.=>4=Ow0 /=+Z=M_=C&'4T= >WZxR.=>4,=I,0&/=Z=[=%U4AT=>TY~.=>#=D0.=Z=YQXl.=>u=>>݌0>.=Y=T=$$4T=>=NWNZ.=>Y=8t0.=GY=1Q=d#4k>T=>+KV[H.=>M =20;.=Y=M="C4 {T=>H_UE7.= >X=:-A0.=jY=1J=!4xT=r>ET%.=>s='0C.=/Y=F= 4* @uT=W>BRX.=3>=$"0.=Y=2C=' 4+qT=2> ?Q!.=K>=0.=Y=?=47nT=><<Q-=c>=D0.=-Y=S<=4BVjT= >t9+P;[-=|>s=0,.=Y=8=R4RNhfT=>6qO--=>=w0.=Y=Y5=4Z9bT=<>f4N(-=>=H 0.=1|Y=1=bU4e]T=r>!2jNm]-=>=q~0.=pY=.=4lqYT=>/N-=>=^ 0.=5eY=7+=P4|LUT=:>-Mcd-=>/=n0!.=YY='=4rPT=>w+M{-=@>[=S0v.=sNY=$=d4LT=>O)L{k-=m>=09m.=BCY='+LI[-=>=v0c.=8Y==4*DT=>$KJ-=>1= 0Z.=,Y==q4!@T=L>"sK:-=>O=1Q.=1!Y==4 R[ K *-=?>M=i< 1H.=Y==48T=>Jsp-=>F=1@.= Y==4,5T=H>gI-=>3==-17.=X==vj4F1T=>IK,=>P{=N1..=nX=u =4=Z.T=>=:H,=Z>wt=#1~&.=X==4++T=|>#G,=>m=(1(.=X==C48'T=>E",=>g=-1.=4X==p4$T=h>,Dh,=Y>`=]31 .=X==4!T=> ZC ,=>Z=a81B.=%X==4<#hT=x>cB ?,=>vS=v>1-=vX== $4-8T=>aSA,=b>L=D1-=ѨX==\)4M8!T=>2@z,=>;F=I1v-=8X=="4BT=> ?zk,=,>?=&N1q-=ՓX=V=4LKT=>S=\,=>*9= T1-=rX==4VuT=->p2=1Y1-=5X==G4a T=>&;\=,=s>H,=2^1-=tX==04Lk T=R>09 -,=>%={c1r-=|jX=>=i 94uT=|>8$,=\>=ؔLi1V-=I`X== g4T=y>7R'G,=>h=bn1(-=UX== Ȭ4T=Iv>6*+=N>=׋t1-=KX=:=` 4S=r>6-+=ɾ> =d"z1ģ-=@AX== |4IS=o>)51D+=E>=R1j-=I7X== a4S=l>|Z45i+=ƻ>=N1-=-X=0=s q4,S=oi>Dd39+=I>p={T1Q-=%$X==4GS=zf>o2=+=ʸ>7=u 1w-=gX==4 S=1e>6-zҶ+=>/=kX11*/=W= ^=j0h9O= >|uo-=>j=D-K.= T==o;Eb=:>% ۼ;%=n==a,׽>X=(x=߽Ǽ&<<}=޽<мҼO<=<=N߽$Ӽ<Ք= =RN dȼ =F]=sмru<<=佗AؼIۼd)<=^&彦mܼ=:MݼS<"==R潂<Ѽ}6ټdݼC <ə= dȟݼv8<= =M@EѼ(< void release_refcounted_frame(bmusb::FrameAllocator::Frame *frame) { if (frame->owner) { frame->owner->release_frame(*frame); } delete frame; } nageru-2.3.0/nageru/ref_counted_frame.h000066400000000000000000000036251450736322200201100ustar00rootroot00000000000000#ifndef _REF_COUNTED_FRAME_H #define _REF_COUNTED_FRAME_H 1 // A wrapper around FrameAllocator::Frame that is automatically refcounted; // when the refcount goes to zero, the frame is given back to the allocator. // // Note that the important point isn't really the pointer to the Frame itself, // it's the resources it's representing that need to go back to the allocator. // // FIXME: There's an issue here in that we could be releasing a frame while // we're still uploading textures from it, causing it to be written to in // another thread. (Thankfully, it goes to the back of the queue, and there's // usually a render in-between, meaning it's fairly unlikely that someone // actually managed to get to that race.) We should probably have some mechanism // for registering fences. #include #include "bmusb/bmusb.h" void release_refcounted_frame(bmusb::FrameAllocator::Frame *frame); typedef std::shared_ptr RefCountedFrameBase; class RefCountedFrame : public RefCountedFrameBase { public: RefCountedFrame() {} RefCountedFrame(const bmusb::FrameAllocator::Frame &frame) : RefCountedFrameBase(new bmusb::FrameAllocator::Frame(frame), release_refcounted_frame) {} }; // Similar to RefCountedFrame, but as unique_ptr instead of shared_ptr. struct Unique_frame_deleter { void operator() (bmusb::FrameAllocator::Frame *frame) const { release_refcounted_frame(frame); } }; typedef std::unique_ptr UniqueFrameBase; class UniqueFrame : public UniqueFrameBase { public: UniqueFrame() {} UniqueFrame(const bmusb::FrameAllocator::Frame &frame) : UniqueFrameBase(new bmusb::FrameAllocator::Frame(frame)) {} bmusb::FrameAllocator::Frame get_and_release() { bmusb::FrameAllocator::Frame *ptr = release(); bmusb::FrameAllocator::Frame frame = *ptr; delete ptr; return frame; } }; #endif // !defined(_REF_COUNTED_FRAME_H) nageru-2.3.0/nageru/resampling_queue.cpp000066400000000000000000000202471450736322200203400ustar00rootroot00000000000000// Parts of the code is adapted from Adriaensen's project Zita-ajbridge // (as of November 2015), although it has been heavily reworked for this use // case. Original copyright follows: // // Copyright (C) 2012-2015 Fons Adriaensen // // This program is free software; you can redistribute it and/or modify // it under the terms of the GNU General Public License as published by // the Free Software Foundation; either version 3 of the License, or // (at your option) any later version. // // This program is distributed in the hope that it will be useful, // but WITHOUT ANY WARRANTY; without even the implied warranty of // MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the // GNU General Public License for more details. // // You should have received a copy of the GNU General Public License // along with this program. If not, see . #include "resampling_queue.h" #include #include #include #include #include #include #include using namespace std; using namespace std::chrono; ResamplingQueue::ResamplingQueue(const std::string &debug_description, unsigned freq_in, unsigned freq_out, unsigned num_channels, double expected_delay_seconds) : debug_description(debug_description), freq_in(freq_in), freq_out(freq_out), num_channels(num_channels), current_estimated_freq_in(freq_in), ratio(double(freq_out) / double(freq_in)), expected_delay(expected_delay_seconds * OUTPUT_FREQUENCY) { vresampler.setup(ratio, num_channels, /*hlen=*/32); // Prime the resampler so there's no more delay. vresampler.inp_count = vresampler.inpsize() / 2 - 1; vresampler.out_count = 1048576; vresampler.process (); } void ResamplingQueue::add_input_samples(steady_clock::time_point ts, const float *samples, ssize_t num_samples, ResamplingQueue::RateAdjustmentPolicy rate_adjustment_policy) { if (num_samples == 0) { return; } assert(duration(ts.time_since_epoch()).count() >= 0.0); bool good_sample = (rate_adjustment_policy == ADJUST_RATE); if (good_sample && a1.good_sample) { a0 = a1; } a1.ts = ts; a1.input_samples_received += num_samples; a1.good_sample = good_sample; if (a0.good_sample && a1.good_sample) { current_estimated_freq_in = (a1.input_samples_received - a0.input_samples_received) / duration(a1.ts - a0.ts).count(); if (!(current_estimated_freq_in >= 0.0)) { fprintf(stderr, "%s: PANIC: Input audio clock going backwards, ignoring.\n", debug_description.c_str()); current_estimated_freq_in = freq_in; } // Bound the frequency, so that a single wild result won't throw the filter off guard. current_estimated_freq_in = min(current_estimated_freq_in, 1.2 * freq_in); current_estimated_freq_in = max(current_estimated_freq_in, 0.8 * freq_in); } buffer.insert(buffer.end(), samples, samples + num_samples * num_channels); } bool ResamplingQueue::get_output_samples(steady_clock::time_point ts, float *samples, ssize_t num_samples, ResamplingQueue::RateAdjustmentPolicy rate_adjustment_policy) { assert(num_samples > 0); if (a1.input_samples_received == 0) { // No data yet, just return zeros. memset(samples, 0, num_samples * num_channels * sizeof(float)); return true; } // This can happen when we get dropped frames on the master card. if (duration(ts.time_since_epoch()).count() <= 0.0) { rate_adjustment_policy = DO_NOT_ADJUST_RATE; } if (rate_adjustment_policy == ADJUST_RATE && (a0.good_sample || a1.good_sample)) { // Estimate the current number of input samples produced at // this instant in time, by extrapolating from the last known // good point. Note that we could be extrapolating backward or // forward, depending on the timing of the calls. const InputPoint &base_point = a1.good_sample ? a1 : a0; assert(duration(base_point.ts.time_since_epoch()).count() >= 0.0); // NOTE: Due to extrapolation, input_samples_received can // actually go negative here the few first calls (ie., we asked // about a timestamp where we hadn't actually started producing // samples yet), but that is harmless. const double input_samples_received = base_point.input_samples_received + current_estimated_freq_in * duration(ts - base_point.ts).count(); // Estimate the number of input samples _consumed_ after we've run the resampler. const double input_samples_consumed = total_consumed_samples + num_samples / (ratio * rcorr); double actual_delay = input_samples_received - input_samples_consumed; actual_delay += vresampler.inpdist(); // Delay in the resampler itself. double err = actual_delay - expected_delay; if (first_output) { // Before the very first block, insert artificial delay based on our initial estimate, // so that we don't need a long period to stabilize at the beginning. if (err < 0.0) { int delay_samples_to_add = lrintf(-err); for (ssize_t i = 0; i < delay_samples_to_add * int(num_channels); ++i) { buffer.push_front(0.0f); } total_consumed_samples -= delay_samples_to_add; // Equivalent to increasing input_samples_received on a0 and a1. err += delay_samples_to_add; } else if (err > 0.0) { int delay_samples_to_remove = min(lrintf(err), buffer.size() / num_channels); buffer.erase(buffer.begin(), buffer.begin() + delay_samples_to_remove * num_channels); total_consumed_samples += delay_samples_to_remove; err -= delay_samples_to_remove; } } first_output = false; // Compute loop filter coefficients for the two filters. We need to compute them // every time, since they depend on the number of samples the user asked for. // // The loop bandwidth is at 0.02 Hz; our jitter is pretty large // since none of the threads involved run at real-time priority. // However, the first four seconds, we use a larger loop bandwidth (2 Hz), // because there's a lot going on during startup, and thus the // initial estimate might be tainted by jitter during that phase, // and we want to converge faster. // // NOTE: The above logic might only hold during Nageru startup // (we start ResamplingQueues also when we e.g. switch sound sources), // but in general, a little bit of increased timing jitter is acceptable // right after a setup change like this. double loop_bandwidth_hz = (total_consumed_samples < 4 * int(freq_in)) ? 0.2 : 0.02; // Set filters. The first filter much wider than the first one (20x as wide). double w = (2.0 * M_PI) * loop_bandwidth_hz * num_samples / freq_out; double w0 = 1.0 - exp(-20.0 * w); double w1 = w * 1.5 / num_samples / ratio; double w2 = w / 1.5; // Filter through the loop filter to find the correction ratio. z1 += w0 * (w1 * err - z1); z2 += w0 * (z1 - z2); z3 += w2 * z2; rcorr = 1.0 - z2 - z3; if (rcorr > 1.05) rcorr = 1.05; if (rcorr < 0.95) rcorr = 0.95; assert(!isnan(rcorr)); vresampler.set_rratio(rcorr); } // Finally actually resample, producing exactly output samples. vresampler.out_data = samples; vresampler.out_count = num_samples; while (vresampler.out_count > 0) { if (buffer.empty()) { // This should never happen unless delay is set way too low, // or we're dropping a lot of data. fprintf(stderr, "%s: PANIC: Out of input samples to resample, still need %d output samples! (correction factor is %f)\n", debug_description.c_str(), int(vresampler.out_count), rcorr); memset(vresampler.out_data, 0, vresampler.out_count * num_channels * sizeof(float)); // Reset the loop filter. z1 = z2 = z3 = 0.0; return false; } float inbuf[1024]; size_t num_input_samples = sizeof(inbuf) / (sizeof(float) * num_channels); if (num_input_samples * num_channels > buffer.size()) { num_input_samples = buffer.size() / num_channels; } copy(buffer.begin(), buffer.begin() + num_input_samples * num_channels, inbuf); vresampler.inp_count = num_input_samples; vresampler.inp_data = inbuf; int err = vresampler.process(); assert(err == 0); size_t consumed_samples = num_input_samples - vresampler.inp_count; total_consumed_samples += consumed_samples; buffer.erase(buffer.begin(), buffer.begin() + consumed_samples * num_channels); } return true; } nageru-2.3.0/nageru/resampling_queue.h000066400000000000000000000116521450736322200200050ustar00rootroot00000000000000#ifndef _RESAMPLING_QUEUE_H #define _RESAMPLING_QUEUE_H 1 // Takes in samples from an input source, possibly with jitter, and outputs a fixed number // of samples every iteration. Used to a) change sample rates if needed, and b) deal with // input sources that don't have audio locked to video. For every input video // frame, you call add_input_samples() with the received time point of the video frame, // taken to be the _end_ point of the frame's audio. When you want to _output_ a finished // frame with audio, you get_output_samples() with the number of samples you want, and will // get exactly that number of samples back. If the input and output clocks are not in sync, // the audio will be stretched for you. (If they are _very_ out of sync, this will come through // as a pitch shift.) Of course, the process introduces some delay; you specify a target delay // (typically measured in milliseconds, although more is fine) and the algorithm works to // provide exactly that. // // A/V sync is a much harder problem than one would intuitively assume. This implementation // is based on a 2012 paper by Fons Adriaensen, “Controlling adaptive resampling” // (http://kokkinizita.linuxaudio.org/papers/adapt-resamp.pdf). The paper gives an algorithm // that converges to jitter of <100 ns; the basic idea is to measure the _rate_ the input // queue fills and is drained (as opposed to the length of the queue itself), and smoothly // adjust the resampling rate so that it reaches steady state at the desired delay. // // Parts of the code is adapted from Adriaensen's project Zita-ajbridge (based on the same // algorithm), although it has been heavily reworked for this use case. Original copyright follows: // // Copyright (C) 2012-2015 Fons Adriaensen // // This program is free software; you can redistribute it and/or modify // it under the terms of the GNU General Public License as published by // the Free Software Foundation; either version 3 of the License, or // (at your option) any later version. // // This program is distributed in the hope that it will be useful, // but WITHOUT ANY WARRANTY; without even the implied warranty of // MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the // GNU General Public License for more details. // // You should have received a copy of the GNU General Public License // along with this program. If not, see . #include #include #include #include #include #include "defs.h" #include "input_mapping.h" class ResamplingQueue { public: // debug_description is for diagnostic output only. ResamplingQueue(const std::string &debug_description, unsigned freq_in, unsigned freq_out, unsigned num_channels, double expected_delay_seconds); // If policy is DO_NOT_ADJUST_RATE, the resampling rate will not be changed. // This is primarily useful if you have an extraordinary situation, such as // dropped frames. enum RateAdjustmentPolicy { DO_NOT_ADJUST_RATE, ADJUST_RATE }; void add_input_samples(std::chrono::steady_clock::time_point ts, const float *samples, ssize_t num_samples, RateAdjustmentPolicy rate_adjustment_policy); // Returns false if underrun. bool get_output_samples(std::chrono::steady_clock::time_point ts, float *samples, ssize_t num_samples, RateAdjustmentPolicy rate_adjustment_policy); private: void init_loop_filter(double bandwidth_hz); VResampler vresampler; std::string debug_description; unsigned freq_in, freq_out, num_channels; bool first_output = true; struct InputPoint { // Equivalent to t_a0 or t_a1 in the paper. std::chrono::steady_clock::time_point ts; // Number of samples that have been written to the queue (in total) // at this time point. Equivalent to k_a0 or k_a1 in the paper. size_t input_samples_received = 0; // Set to false if we should not use the timestamp from this sample // (e.g. if it is from a dropped frame and thus bad). In particular, // we will not use it for updateing current_estimated_freq_in. bool good_sample = false; }; InputPoint a0, a1; // The current rate at which we seem to get input samples, in Hz. // For an ideal input, identical to freq_in. double current_estimated_freq_in; ssize_t total_consumed_samples = 0; // Filter state for the loop filter. double z1 = 0.0, z2 = 0.0, z3 = 0.0; // Ratio between the two frequencies. const double ratio; // Current correction ratio. ratio * rcorr gives the true ratio, // so values above 1.0 means to pitch down (consume input samples slower). double rcorr = 1.0; // How much delay we are expected to have, in input samples. // If actual delay drifts too much away from this, we will start // changing the resampling ratio to compensate. const double expected_delay; // Input samples not yet fed into the resampler. // TODO: Use a circular buffer instead, for efficiency. std::deque buffer; }; #endif // !defined(_RESAMPLING_QUEUE_H) nageru-2.3.0/nageru/rgb_histogram.cpp000066400000000000000000000054361450736322200176250ustar00rootroot00000000000000#include "rgb_histogram.h" #include #include class QPaintEvent; class QResizeEvent; using namespace std; static constexpr int margin_left = 16; static constexpr int margin_top = 14; static constexpr int margin_right = 14; static constexpr int margin_bottom = 25; RGBHistogram::RGBHistogram(QWidget *parent) : QWidget(parent), red(256, 0.0), green(256, 0.0), blue(256, 0.0) { } void RGBHistogram::set_histograms(std::vector red, std::vector green, std::vector blue) { assert(red.size() == 256); assert(green.size() == 256); assert(blue.size() == 256); this->red = std::move(red); this->green = std::move(green); this->blue = std::move(blue); repaint(); } void RGBHistogram::paintEvent(QPaintEvent *event) { QPainter painter(this); painter.fillRect(0, 0, width(), height(), Qt::white); painter.setRenderHints(QPainter::Antialiasing); double max = 0.0; for (unsigned i = 0; i < 256; ++i) { max = std::max(max, red[i]); max = std::max(max, green[i]); max = std::max(max, blue[i]); } // Draw the graphs. (We'd like to get rid of the bottom line, but that's just cosmetic.) painter.setPen(QPen(Qt::red)); painter.setBrush(QBrush(QColor(255, 127, 127, 80))); draw(red, max, Qt::GlobalColor::red, &painter); painter.setPen(QPen(Qt::green)); painter.setBrush(QBrush(QColor(127, 255, 127, 80))); draw(green, max, Qt::GlobalColor::green, &painter); painter.setPen(QPen(Qt::blue)); painter.setBrush(QBrush(QColor(127, 127, 255, 80))); draw(blue, max, Qt::GlobalColor::blue, &painter); // Draw the tick lines. int w = (width() - 1) - margin_left - margin_right; painter.setPen(QPen(Qt::black)); painter.setBrush(QBrush()); for (int i = 0; i < 256; i += 10) { int th = (i % 50 == 0) ? 5 : 2; double x = (i / 255.0) * w + margin_left; double y = (height() - 1) - margin_top - margin_bottom; painter.drawLine(QPointF(x, y + margin_top), QPointF(x, y + margin_top - th)); } // And the axis labels. for (int i = 0; i < 256; i += 50) { char buf[16]; snprintf(buf, sizeof(buf), "%d", i); double x = (i / 255.0) * w + margin_left; double y = (height() - 1) - margin_top - margin_bottom; painter.drawText(QRectF(x - 20, y + margin_top, 40, margin_bottom), Qt::AlignCenter | Qt::AlignTop, QString(buf)); } } void RGBHistogram::draw(const vector &v, double max, Qt::GlobalColor color, QPainter *painter) { int w = (width() - 1) - margin_left - margin_right; int h = (height() - 1) - margin_top - margin_bottom; QPointF points[258]; points[0] = QPointF(margin_left, margin_top + h); for (int i = 0; i < 256; ++i) { double x = (i / 255.0) * w + margin_left; double y = (1.0 - (v[i] / max)) * h + margin_top; points[i + 1] = QPointF(x, y); } points[257] = QPointF(margin_left + w, margin_top + h); painter->drawPolygon(points, 258); } nageru-2.3.0/nageru/rgb_histogram.h000066400000000000000000000011241450736322200172600ustar00rootroot00000000000000#ifndef RGB_HISTOGRAM_H #define RGB_HISTOGRAM_H #include #include #include #include #include "vu_common.h" class QObject; class QPaintEvent; class QResizeEvent; class RGBHistogram : public QWidget { Q_OBJECT public: RGBHistogram(QWidget *parent); void set_histograms(std::vector red, std::vector green, std::vector blue); private: void paintEvent(QPaintEvent *event) override; void draw(const std::vector &v, double max, Qt::GlobalColor color, QPainter *painter); std::vector red, green, blue; }; #endif nageru-2.3.0/nageru/scene.cpp000066400000000000000000001065311450736322200160710ustar00rootroot00000000000000#include extern "C" { #include #include } #ifdef HAVE_CEF #include "cef_capture.h" #endif #include "ffmpeg_capture.h" #include "flags.h" #include "image_input.h" #include "input_state.h" #include "lua_utils.h" #include "scene.h" #include "theme.h" using namespace movit; using namespace std; static bool display(Block *block, lua_State *L, int idx); EffectType current_type(const Block *block) { return block->alternatives[block->currently_chosen_alternative]->effect_type; } int find_index_of(const Block *block, EffectType val) { for (size_t idx = 0; idx < block->alternatives.size(); ++idx) { if (block->alternatives[idx]->effect_type == val) { return idx; } } return -1; } string get_declaration_point(lua_State *L) { lua_Debug ar; lua_getstack(L, 1, &ar); lua_getinfo(L, "nSl", &ar); char buf[256]; snprintf(buf, sizeof(buf), "%s:%d", ar.source, ar.currentline); return buf; } Scene::Scene(Theme *theme, float aspect_nom, float aspect_denom) : theme(theme), aspect_nom(aspect_nom), aspect_denom(aspect_denom), resource_pool(theme->get_resource_pool()) {} size_t Scene::compute_chain_number(bool is_main_chain) const { assert(chains.size() > 0); assert(chains.size() % 2 == 0); bitset<256> disabled = find_disabled_blocks(size_t(-1)); size_t chain_number = compute_chain_number_for_block(blocks.size() - 1, disabled); assert(chain_number < chains.size() / 2); if (is_main_chain) { chain_number += chains.size() / 2; } return chain_number; } size_t Scene::compute_chain_number_for_block(size_t block_idx, const bitset<256> &disabled) const { Block *block = blocks[block_idx]; size_t chain_number; size_t currently_chosen_alternative; if (disabled.test(block_idx)) { // It doesn't matter, so pick the canonical choice // (this is the only one that is actually instantiated). currently_chosen_alternative = block->canonical_alternative; } else { currently_chosen_alternative = block->currently_chosen_alternative; } assert(currently_chosen_alternative < block->alternatives.size()); if (block_idx == 0) { assert(block->cardinality_base == 1); chain_number = currently_chosen_alternative; } else { chain_number = compute_chain_number_for_block(block_idx - 1, disabled) + block->cardinality_base * currently_chosen_alternative; } return chain_number; } bitset<256> Scene::find_disabled_blocks(size_t chain_idx) const { assert(blocks.size() < 256); // The find_disabled_blocks() recursion logic needs only one pass by itself, // but the disabler logic is not so smart, so we just run multiple times // until it converges. bitset<256> prev, ret; do { find_disabled_blocks(chain_idx, blocks.size() - 1, /*currently_disabled=*/false, &ret); prev = ret; // Propagate DISABLE_IF_OTHER_DISABLED constraints (we can always do this). for (Block *block : blocks) { if (ret.test(block->idx)) continue; // Already disabled. EffectType chosen_type = block->alternatives[block->chosen_alternative(chain_idx)]->effect_type; if (chosen_type == IDENTITY_EFFECT) { ret.set(block->idx); continue; } for (const Block::Disabler &disabler : block->disablers) { Block *other = blocks[disabler.block_idx]; EffectType chosen_type = other->alternatives[other->chosen_alternative(chain_idx)]->effect_type; bool other_disabled = ret.test(disabler.block_idx) || chosen_type == IDENTITY_EFFECT; if (other_disabled && disabler.condition == Block::Disabler::DISABLE_IF_OTHER_DISABLED) { ret.set(block->idx); break; } } } // We cannot propagate DISABLE_IF_OTHER_ENABLED in all cases; // the problem is that if A is disabled if B is enabled, // then we cannot disable A unless we actually know for sure // that B _is_ enabled. (E.g., imagine that B is disabled // if C is enabled -- we couldn't disable A before we knew if // C was enabled or not!) // // We could probably fix a fair amount of these, but the // primary use case for DISABLE_IF_OTHER_ENABLED is really // mutual exclusion; A must be disabled if B is enabled // _and_ vice versa. These loops cannot be automatically // resolved; it would depend on what A and B is. Thus, // we simply declare this kind of constraint to be a promise // from the user, not something that we'll solve for them. } while (prev != ret); return ret; } void Scene::find_disabled_blocks(size_t chain_idx, size_t block_idx, bool currently_disabled, bitset<256> *disabled) const { if (currently_disabled) { disabled->set(block_idx); } Block *block = blocks[block_idx]; EffectType chosen_type = block->alternatives[block->chosen_alternative(chain_idx)]->effect_type; for (size_t input_idx = 0; input_idx < block->inputs.size(); ++input_idx) { if (chosen_type == IDENTITY_EFFECT && input_idx > 0) { // Multi-input effect that has been replaced by // IdentityEffect, so every effect but the first are // disabled and will not participate in the chain. find_disabled_blocks(chain_idx, block->inputs[input_idx], /*currently_disabled=*/true, disabled); } else { // Just keep on recursing down. find_disabled_blocks(chain_idx, block->inputs[input_idx], currently_disabled, disabled); } } } bool Scene::is_noncanonical_chain(size_t chain_idx) const { bitset<256> disabled = find_disabled_blocks(chain_idx); assert(blocks.size() < 256); for (size_t block_idx = 0; block_idx < blocks.size(); ++block_idx) { Block *block = blocks[block_idx]; if (disabled.test(block_idx) && block->chosen_alternative(chain_idx) != block->canonical_alternative) { return true; } // Test if we're supposed to be disabled by some other block being enabled; // the disabled bit mask does not fully capture this. if (!disabled.test(block_idx)) { for (const Block::Disabler &disabler : block->disablers) { if (disabler.condition == Block::Disabler::DISABLE_IF_OTHER_ENABLED && !disabled.test(disabler.block_idx)) { return true; } } // Auto white balance is always disabled for image inputs. if (block->white_balance_controller_block != nullptr) { const Block *input = block->white_balance_controller_block; if (input->alternatives[input->chosen_alternative(chain_idx)]->effect_type == IMAGE_INPUT) { return true; } } } } return false; } int Scene::add_input(lua_State* L) { assert(lua_gettop(L) == 1 || lua_gettop(L) == 2); Scene *scene = (Scene *)luaL_checkudata(L, 1, "Scene"); Block *block = new Block; block->declaration_point = get_declaration_point(L); block->idx = scene->blocks.size(); if (lua_gettop(L) == 1) { // No parameter given, so a flexible input. block->alternatives.emplace_back(new EffectBlueprint(LIVE_INPUT_YCBCR)); block->alternatives.emplace_back(new EffectBlueprint(LIVE_INPUT_YCBCR_WITH_DEINTERLACE)); block->alternatives.emplace_back(new EffectBlueprint(LIVE_INPUT_YCBCR_PLANAR)); block->alternatives.emplace_back(new EffectBlueprint(LIVE_INPUT_BGRA)); block->alternatives.emplace_back(new EffectBlueprint(IMAGE_INPUT)); } else { // Input of a given type. We'll specialize it here, plus connect the input as given. if (lua_isnumber(L, 2)) { block->alternatives.emplace_back(new EffectBlueprint(LIVE_INPUT_YCBCR)); block->alternatives.emplace_back(new EffectBlueprint(LIVE_INPUT_YCBCR_WITH_DEINTERLACE)); #ifdef HAVE_SRT if (global_flags.srt_port >= 0) { block->alternatives.emplace_back(new EffectBlueprint(LIVE_INPUT_YCBCR_PLANAR)); } #endif #ifdef HAVE_CEF } else if (luaL_testudata(L, 2, "HTMLInput")) { block->alternatives.emplace_back(new EffectBlueprint(LIVE_INPUT_BGRA)); #endif } else if (luaL_testudata(L, 2, "VideoInput")) { FFmpegCapture *capture = *(FFmpegCapture **)luaL_checkudata(L, 2, "VideoInput"); if (capture->get_current_pixel_format() == bmusb::PixelFormat_8BitYCbCrPlanar) { block->alternatives.emplace_back(new EffectBlueprint(LIVE_INPUT_YCBCR_PLANAR)); } else { assert(capture->get_current_pixel_format() == bmusb::PixelFormat_8BitBGRA); block->alternatives.emplace_back(new EffectBlueprint(LIVE_INPUT_BGRA)); } } else if (luaL_testudata(L, 2, "ImageInput")) { block->alternatives.emplace_back(new EffectBlueprint(IMAGE_INPUT)); } else { luaL_error(L, "add_input() called with something that's not a signal (a signal number, a HTML input, or a VideoInput)"); } bool ok = display(block, L, 2); assert(ok); } block->is_input = true; scene->blocks.push_back(block); return wrap_lua_existing_object_nonowned(L, "Block", block); } Block *Scene::find_block_from_arg(lua_State *L, Scene *scene, int idx) { if (luaL_testudata(L, idx, "Block")) { return *(Block **)luaL_checkudata(L, idx, "Block"); } else { EffectBlueprint *blueprint = *(EffectBlueprint **)luaL_checkudata(L, idx, "EffectBlueprint"); // Search through all the blocks to figure out which one contains this effect. for (Block *block : scene->blocks) { if (find(block->alternatives.begin(), block->alternatives.end(), blueprint) != block->alternatives.end()) { return block; } } luaL_error(L, "Input effect in parameter #%d has not been added to this scene", idx - 1); return nullptr; // Dead code. } } void Scene::find_inputs_for_block(lua_State *L, Scene *scene, Block *block, int first_input_idx) { if (lua_gettop(L) == first_input_idx - 1) { // Implicitly the last added effect. assert(!scene->blocks.empty()); block->inputs.push_back(scene->blocks.size() - 1); return; } for (int idx = first_input_idx; idx <= lua_gettop(L); ++idx) { block->inputs.push_back(find_block_from_arg(L, scene, idx)->idx); } } int Scene::add_effect(lua_State* L) { assert(lua_gettop(L) >= 2); Scene *scene = (Scene *)luaL_checkudata(L, 1, "Scene"); Block *block = new Block; block->declaration_point = get_declaration_point(L); block->idx = scene->blocks.size(); if (lua_istable(L, 2)) { size_t len = lua_objlen(L, 2); for (size_t i = 0; i < len; ++i) { lua_rawgeti(L, 2, i + 1); EffectBlueprint *blueprint = *(EffectBlueprint **)luaL_checkudata(L, -1, "EffectBlueprint"); block->alternatives.push_back(blueprint); lua_settop(L, -2); } } else { EffectBlueprint *blueprint = *(EffectBlueprint **)luaL_checkudata(L, 2, "EffectBlueprint"); block->alternatives.push_back(blueprint); } int identity_index = find_index_of(block, IDENTITY_EFFECT); if (identity_index == -1) { block->canonical_alternative = 0; } else { // Pick the IdentityEffect as the canonical alternative, in case it // helps us disable more stuff. block->canonical_alternative = identity_index; } find_inputs_for_block(L, scene, block); scene->blocks.push_back(block); return wrap_lua_existing_object_nonowned(L, "Block", block); } int Scene::add_optional_effect(lua_State* L) { assert(lua_gettop(L) >= 2); Scene *scene = (Scene *)luaL_checkudata(L, 1, "Scene"); Block *block = new Block; block->declaration_point = get_declaration_point(L); block->idx = scene->blocks.size(); EffectBlueprint *blueprint = *(EffectBlueprint **)luaL_checkudata(L, 2, "EffectBlueprint"); block->alternatives.push_back(blueprint); // An IdentityEffect will be the alternative for when the effect is disabled. block->alternatives.push_back(new EffectBlueprint(IDENTITY_EFFECT)); block->canonical_alternative = 1; find_inputs_for_block(L, scene, block); scene->blocks.push_back(block); return wrap_lua_existing_object_nonowned(L, "Block", block); } const Block *Scene::find_root_input_block(lua_State *L, const Block *block) { if (block->is_input) { assert(block->inputs.size() == 0); return block; } const Block *ret = nullptr; for (size_t input_idx : block->inputs) { const Block *parent = find_root_input_block(L, blocks[input_idx]); if (parent != nullptr) { if (ret != nullptr) { luaL_error(L, "add_white_balance() was connected to more than one input"); } ret = parent; } } return ret; } int Scene::add_white_balance(lua_State* L) { assert(lua_gettop(L) >= 1); Scene *scene = (Scene *)luaL_checkudata(L, 1, "Scene"); Block *block = new Block; block->declaration_point = get_declaration_point(L); block->idx = scene->blocks.size(); block->alternatives.push_back(new EffectBlueprint(WHITE_BALANCE_EFFECT)); block->alternatives.push_back(new EffectBlueprint(IDENTITY_EFFECT)); block->canonical_alternative = 1; if (lua_gettop(L) == 1) { // The last added effect is implicitly both the input and gives the white balance controller. assert(!scene->blocks.empty()); block->inputs.push_back(scene->blocks.size() - 1); block->white_balance_controller_block = scene->find_root_input_block(L, block); } else if (lua_gettop(L) == 2) { // The given effect is both the input and the white balance controller. block->inputs.push_back(find_block_from_arg(L, scene, 2)->idx); block->white_balance_controller_block = scene->find_root_input_block(L, block); } else if (lua_gettop(L) == 3) { // We have explicit input and white balance controller. block->inputs.push_back(find_block_from_arg(L, scene, 2)->idx); block->white_balance_controller_block = find_block_from_arg(L, scene, 3); } else { luaL_error(L, "add_white_balance([input], [white_balance_controller]) takes zero, one or two arguments"); } if (block->white_balance_controller_block == nullptr || !block->white_balance_controller_block->is_input) { luaL_error(L, "add_white_balance() does not get its white balance from an input"); } scene->blocks.push_back(block); return wrap_lua_existing_object_nonowned(L, "Block", block); } Effect *Scene::instantiate_effects(const Block *block, size_t chain_idx, Scene::Instantiation *instantiation) { // Find the chosen alternative for this block in this instance. EffectType chosen_type = block->alternatives[block->chosen_alternative(chain_idx)]->effect_type; vector inputs; for (size_t input_idx : block->inputs) { inputs.push_back(instantiate_effects(blocks[input_idx], chain_idx, instantiation)); // As a special case, we allow IdentityEffect to take only one input // even if the other alternative (or alternatives) is multi-input. // Thus, even if there are more than one inputs, instantiate only // the first one. if (chosen_type == IDENTITY_EFFECT) { break; } } Effect *effect; switch (chosen_type) { case LIVE_INPUT_YCBCR: case LIVE_INPUT_YCBCR_WITH_DEINTERLACE: case LIVE_INPUT_YCBCR_PLANAR: case LIVE_INPUT_BGRA: { bool deinterlace = (chosen_type == LIVE_INPUT_YCBCR_WITH_DEINTERLACE); bool override_bounce = !deinterlace; // For most chains, this will be fine. Reconsider if we see real problems somewhere; it's better than having the user try to understand it. bmusb::PixelFormat pixel_format; if (chosen_type == LIVE_INPUT_BGRA) { pixel_format = bmusb::PixelFormat_8BitBGRA; } else if (chosen_type == LIVE_INPUT_YCBCR_PLANAR) { pixel_format = bmusb::PixelFormat_8BitYCbCrPlanar; } else if (global_flags.bit_depth > 8) { pixel_format = bmusb::PixelFormat_10BitYCbCr; } else { pixel_format = bmusb::PixelFormat_8BitYCbCr; } LiveInputWrapper *input = new LiveInputWrapper(theme, instantiation->chain.get(), pixel_format, override_bounce, deinterlace, /*user_connectable=*/true); effect = input->get_effect(); // Adds itself to the chain, so no need to call add_effect(). instantiation->inputs.emplace(block->idx, input); break; } case IMAGE_INPUT: { ImageInput *input = new ImageInput; instantiation->chain->add_input(input); instantiation->image_inputs.emplace(block->idx, input); effect = input; break; } default: effect = instantiate_effect(instantiation->chain.get(), chosen_type); instantiation->chain->add_effect(effect, inputs); break; } instantiation->effects.emplace(block->idx, effect); return effect; } int Scene::finalize(lua_State* L) { bool only_one_mode = false; bool chosen_mode = false; if (lua_gettop(L) == 2) { only_one_mode = true; chosen_mode = checkbool(L, 2); } else { assert(lua_gettop(L) == 1); } Scene *scene = (Scene *)luaL_checkudata(L, 1, "Scene"); Theme *theme = get_theme_updata(L); size_t base = 1; for (Block *block : scene->blocks) { block->cardinality_base = base; base *= block->alternatives.size(); } const size_t cardinality = base; size_t real_cardinality = 0; for (size_t chain_idx = 0; chain_idx < cardinality; ++chain_idx) { if (!scene->is_noncanonical_chain(chain_idx)) { ++real_cardinality; } } const size_t total_cardinality = real_cardinality * (only_one_mode ? 1 : 2); if (total_cardinality > 400) { print_warning(L, "The given Scene will instantiate %zu different versions. This will take a lot of time and RAM to compile; see if you could limit some options by e.g. locking the input type in some cases (by giving a fixed input to add_input()).\n", total_cardinality); } Block *output_block = scene->blocks.back(); for (bool is_main_chain : { false, true }) { for (size_t chain_idx = 0; chain_idx < cardinality; ++chain_idx) { if ((only_one_mode && is_main_chain != chosen_mode) || scene->is_noncanonical_chain(chain_idx)) { scene->chains.emplace_back(); continue; } Scene::Instantiation instantiation; instantiation.chain.reset(new EffectChain(scene->aspect_nom, scene->aspect_denom, theme->get_resource_pool())); scene->instantiate_effects(output_block, chain_idx, &instantiation); add_outputs_and_finalize(instantiation.chain.get(), is_main_chain); scene->chains.emplace_back(move(instantiation)); } } return 0; } int find_card_to_connect(Theme *theme, lua_State *L, const Block *block) { if (block->signal_type_to_connect == Block::CONNECT_SIGNAL) { return theme->map_signal_to_card(block->signal_to_connect); #ifdef HAVE_CEF } else if (block->signal_type_to_connect == Block::CONNECT_CEF) { return block->cef_to_connect->get_card_index(); #endif } else if (block->signal_type_to_connect == Block::CONNECT_VIDEO) { return block->video_to_connect->get_card_index(); } else if (block->signal_type_to_connect == Block::CONNECT_NONE) { luaL_error(L, "An input in a scene was not connected to anything (forgot to call display())"); } else { assert(false); } return -1; } std::pair> Scene::get_chain(Theme *theme, lua_State *L, unsigned num, const InputState &input_state) { // For video inputs, pick the right interlaced/progressive version // based on the current state of the signals. InputStateInfo info(input_state); for (Block *block : blocks) { if (block->is_input && block->signal_type_to_connect == Block::CONNECT_SIGNAL) { int card_index = theme->map_signal_to_card(block->signal_to_connect); if (info.last_interlaced[card_index]) { assert(info.last_pixel_format[card_index] == bmusb::PixelFormat_8BitYCbCr || info.last_pixel_format[card_index] == bmusb::PixelFormat_10BitYCbCr); block->currently_chosen_alternative = find_index_of(block, LIVE_INPUT_YCBCR_WITH_DEINTERLACE); } else if (info.last_pixel_format[card_index] == bmusb::PixelFormat_8BitYCbCrPlanar) { block->currently_chosen_alternative = find_index_of(block, LIVE_INPUT_YCBCR_PLANAR); } else if (info.last_pixel_format[card_index] == bmusb::PixelFormat_8BitBGRA) { block->currently_chosen_alternative = find_index_of(block, LIVE_INPUT_BGRA); } else { block->currently_chosen_alternative = find_index_of(block, LIVE_INPUT_YCBCR); } if (block->currently_chosen_alternative == -1) { fprintf(stderr, "ERROR: Input connected to a video card pixel format that it was not ready for.\n"); abort(); } } } // Find all auto white balance blocks, turn on and off the effect as needed, // and fetch the actual white balance set (it is stored in Theme). map> white_balance; for (size_t block_idx = 0; block_idx < blocks.size(); ++block_idx) { Block *block = blocks[block_idx]; const Block *input = block->white_balance_controller_block; if (input == nullptr) { continue; // Not an auto white balance block. } EffectType chosen_type = current_type(input); if (chosen_type == IMAGE_INPUT) { // Image inputs never get white balance applied. block->currently_chosen_alternative = find_index_of(block, IDENTITY_EFFECT); continue; } assert(chosen_type == LIVE_INPUT_YCBCR || chosen_type == LIVE_INPUT_YCBCR_WITH_DEINTERLACE || chosen_type == LIVE_INPUT_YCBCR_PLANAR || chosen_type == LIVE_INPUT_BGRA); int card_idx = find_card_to_connect(theme, L, input); RGBTriplet wb = theme->get_white_balance_for_card(card_idx); if (fabs(wb.r - 1.0) < 1e-3 && fabs(wb.g - 1.0) < 1e-3 && fabs(wb.b - 1.0) < 1e-3) { // Neutral white balance. block->currently_chosen_alternative = find_index_of(block, IDENTITY_EFFECT); } else { block->currently_chosen_alternative = find_index_of(block, WHITE_BALANCE_EFFECT); white_balance.emplace(block, array{ wb.r, wb.g, wb.b }); } } // Pick out the right chain based on the current selections, // and snapshot all the set variables so that we can set them // in the prepare function even if they're being changed by // the Lua code later. bool is_main_chain = (num == 0); size_t chain_idx = compute_chain_number(is_main_chain); if (is_noncanonical_chain(chain_idx)) { // This should be due to promise_to_disable_if_enabled(). Find out what // happened, to give the user some help. bitset<256> disabled = find_disabled_blocks(chain_idx); for (size_t block_idx = 0; block_idx < blocks.size(); ++block_idx) { Block *block = blocks[block_idx]; if (disabled.test(block_idx)) continue; for (const Block::Disabler &disabler : block->disablers) { if (disabler.condition == Block::Disabler::DISABLE_IF_OTHER_ENABLED && !disabled.test(disabler.block_idx)) { fprintf(stderr, "Promise declared at %s violated.\n", disabler.declaration_point.c_str()); abort(); } } } assert(false); // Something else happened, seemingly. } const Scene::Instantiation &instantiation = chains[chain_idx]; EffectChain *effect_chain = instantiation.chain.get(); map cards_to_connect; map images_to_select; map, int> int_to_set; map, float> float_to_set; map, array> vec3_to_set; map, array> vec4_to_set; for (const auto &index_and_input : instantiation.inputs) { Block *block = blocks[index_and_input.first]; EffectType chosen_type = current_type(block); if (chosen_type == LIVE_INPUT_YCBCR || chosen_type == LIVE_INPUT_YCBCR_WITH_DEINTERLACE || chosen_type == LIVE_INPUT_YCBCR_PLANAR || chosen_type == LIVE_INPUT_BGRA) { LiveInputWrapper *input = index_and_input.second; cards_to_connect.emplace(input, find_card_to_connect(theme, L, block)); } } for (const auto &index_and_input : instantiation.image_inputs) { Block *block = blocks[index_and_input.first]; ImageInput *input = index_and_input.second; if (current_type(block) == IMAGE_INPUT) { images_to_select.emplace(input, block->pathname); } } for (const auto &index_and_effect : instantiation.effects) { Block *block = blocks[index_and_effect.first]; Effect *effect = index_and_effect.second; bool missing_width = (current_type(block) == RESIZE_EFFECT || current_type(block) == RESAMPLE_EFFECT || current_type(block) == PADDING_EFFECT); bool missing_height = missing_width; // Get the effects currently set on the block. if (current_type(block) != IDENTITY_EFFECT) { // Ignore settings on optional effects. if (block->int_parameters.count("width") && block->int_parameters["width"] > 0) { missing_width = false; } if (block->int_parameters.count("height") && block->int_parameters["height"] > 0) { missing_height = false; } for (const auto &key_and_tuple : block->int_parameters) { int_to_set.emplace(make_pair(effect, key_and_tuple.first), key_and_tuple.second); } for (const auto &key_and_tuple : block->float_parameters) { float_to_set.emplace(make_pair(effect, key_and_tuple.first), key_and_tuple.second); } if (white_balance.count(block)) { vec3_to_set.emplace(make_pair(effect, "neutral_color"), white_balance[block]); } for (const auto &key_and_tuple : block->vec3_parameters) { vec3_to_set.emplace(make_pair(effect, key_and_tuple.first), key_and_tuple.second); } for (const auto &key_and_tuple : block->vec4_parameters) { vec4_to_set.emplace(make_pair(effect, key_and_tuple.first), key_and_tuple.second); } } // Parameters set on the blueprint itself override those that are set for the block, // so they are set afterwards. if (!block->alternatives.empty()) { EffectBlueprint *blueprint = block->alternatives[block->currently_chosen_alternative]; if (blueprint->int_parameters.count("width") && blueprint->int_parameters["width"] > 0) { missing_width = false; } if (blueprint->int_parameters.count("height") && blueprint->int_parameters["height"] > 0) { missing_height = false; } for (const auto &key_and_tuple : blueprint->int_parameters) { int_to_set[make_pair(effect, key_and_tuple.first)] = key_and_tuple.second; } for (const auto &key_and_tuple : blueprint->float_parameters) { float_to_set[make_pair(effect, key_and_tuple.first)] = key_and_tuple.second; } for (const auto &key_and_tuple : blueprint->vec3_parameters) { vec3_to_set[make_pair(effect, key_and_tuple.first)] = key_and_tuple.second; } for (const auto &key_and_tuple : blueprint->vec4_parameters) { vec4_to_set[make_pair(effect, key_and_tuple.first)] = key_and_tuple.second; } } if (missing_width || missing_height) { fprintf(stderr, "WARNING: Unset or nonpositive width/height for effect declared at %s " "when getting scene for signal %u; setting to 1x1 to avoid crash.\n", block->declaration_point.c_str(), num); int_to_set[make_pair(effect, "width")] = 1; int_to_set[make_pair(effect, "height")] = 1; } } lua_pop(L, 1); auto setup_chain = [L, theme, cards_to_connect, images_to_select, int_to_set, float_to_set, vec3_to_set, vec4_to_set, input_state]{ lock_guard lock(theme->m); // Set up state, including connecting cards. for (const auto &input_and_card : cards_to_connect) { LiveInputWrapper *input = input_and_card.first; input->connect_card(input_and_card.second, input_state); } for (const auto &input_and_filename : images_to_select) { input_and_filename.first->switch_image(input_and_filename.second); } for (const auto &effect_and_key_and_value : int_to_set) { Effect *effect = effect_and_key_and_value.first.first; const string &key = effect_and_key_and_value.first.second; const int value = effect_and_key_and_value.second; if (!effect->set_int(key, value)) { luaL_error(L, "Effect refused set_int(\"%s\", %d) (invalid key?)", key.c_str(), value); } } for (const auto &effect_and_key_and_value : float_to_set) { Effect *effect = effect_and_key_and_value.first.first; const string &key = effect_and_key_and_value.first.second; const float value = effect_and_key_and_value.second; if (!effect->set_float(key, value)) { luaL_error(L, "Effect refused set_float(\"%s\", %f) (invalid key?)", key.c_str(), value); } } for (const auto &effect_and_key_and_value : vec3_to_set) { Effect *effect = effect_and_key_and_value.first.first; const string &key = effect_and_key_and_value.first.second; const float *value = effect_and_key_and_value.second.data(); if (!effect->set_vec3(key, value)) { luaL_error(L, "Effect refused set_vec3(\"%s\", %f, %f, %f) (invalid key?)", key.c_str(), value[0], value[1], value[2]); } } for (const auto &effect_and_key_and_value : vec4_to_set) { Effect *effect = effect_and_key_and_value.first.first; const string &key = effect_and_key_and_value.first.second; const float *value = effect_and_key_and_value.second.data(); if (!effect->set_vec4(key, value)) { luaL_error(L, "Effect refused set_vec4(\"%s\", %f, %f, %f, %f) (invalid key?)", key.c_str(), value[0], value[1], value[2], value[3]); } } }; return make_pair(effect_chain, move(setup_chain)); } bool display(Block *block, lua_State *L, int idx) { if (lua_isnumber(L, idx)) { int signal_idx = luaL_checknumber(L, idx); block->signal_type_to_connect = Block::CONNECT_SIGNAL; block->signal_to_connect = signal_idx; block->currently_chosen_alternative = find_index_of(block, LIVE_INPUT_YCBCR); // Will be changed to deinterlaced at get_chain() time if needed. return true; #ifdef HAVE_CEF } else if (luaL_testudata(L, idx, "HTMLInput")) { CEFCapture *capture = *(CEFCapture **)luaL_checkudata(L, idx, "HTMLInput"); block->signal_type_to_connect = Block::CONNECT_CEF; block->cef_to_connect = capture; block->currently_chosen_alternative = find_index_of(block, LIVE_INPUT_BGRA); assert(capture->get_current_pixel_format() == bmusb::PixelFormat_8BitBGRA); return true; #endif } else if (luaL_testudata(L, idx, "VideoInput")) { FFmpegCapture *capture = *(FFmpegCapture **)luaL_checkudata(L, idx, "VideoInput"); block->signal_type_to_connect = Block::CONNECT_VIDEO; block->video_to_connect = capture; if (capture->get_current_pixel_format() == bmusb::PixelFormat_8BitYCbCrPlanar) { block->currently_chosen_alternative = find_index_of(block, LIVE_INPUT_YCBCR_PLANAR); } else { assert(capture->get_current_pixel_format() == bmusb::PixelFormat_8BitBGRA); block->currently_chosen_alternative = find_index_of(block, LIVE_INPUT_BGRA); } return true; } else if (luaL_testudata(L, idx, "ImageInput")) { ImageInput *image = *(ImageInput **)luaL_checkudata(L, idx, "ImageInput"); block->signal_type_to_connect = Block::CONNECT_NONE; block->currently_chosen_alternative = find_index_of(block, IMAGE_INPUT); block->pathname = image->get_pathname(); return true; } else { return false; } } int Block_display(lua_State* L) { assert(lua_gettop(L) == 2); Block *block = *(Block **)luaL_checkudata(L, 1, "Block"); if (!block->is_input) { luaL_error(L, "display() called on something that isn't an input"); } bool ok = display(block, L, 2); if (!ok) { luaL_error(L, "display() called with something that's not a signal (a signal number, a HTML input, or a VideoInput)"); } if (block->currently_chosen_alternative == -1) { luaL_error(L, "display() called on an input whose type was fixed at construction time, with a signal of different type"); } return 0; } int Block_choose(lua_State* L) { assert(lua_gettop(L) == 2); Block *block = *(Block **)luaL_checkudata(L, 1, "Block"); int alternative_idx = -1; if (lua_isnumber(L, 2)) { alternative_idx = luaL_checknumber(L, 2); } else if (lua_istable(L, 2)) { // See if it's an Effect metatable (e.g. foo:choose(ResampleEffect)) lua_getfield(L, 2, "__effect_type_id"); if (lua_isnumber(L, -1)) { EffectType effect_type = EffectType(luaL_checknumber(L, -1)); alternative_idx = find_index_of(block, effect_type); } lua_pop(L, 1); } if (alternative_idx == -1) { luaL_error(L, "choose() called with something that was not an index or an effect type (e.g. ResampleEffect) that was part of the alternatives"); } assert(alternative_idx >= 0); assert(size_t(alternative_idx) < block->alternatives.size()); block->currently_chosen_alternative = alternative_idx; return wrap_lua_existing_object_nonowned(L, "EffectBlueprint", block->alternatives[alternative_idx]); } int Block_enable(lua_State *L) { assert(lua_gettop(L) == 1); Block *block = *(Block **)luaL_checkudata(L, 1, "Block"); if (block->alternatives.size() != 2 || block->alternatives[1]->effect_type != IDENTITY_EFFECT) { luaL_error(L, "enable() called on something that wasn't added with add_optional_effect()"); } block->currently_chosen_alternative = 0; // The actual effect. return 0; } int Block_enable_if(lua_State *L) { assert(lua_gettop(L) == 2); Block *block = *(Block **)luaL_checkudata(L, 1, "Block"); if (block->alternatives.size() != 2 || block->alternatives[1]->effect_type != IDENTITY_EFFECT) { luaL_error(L, "enable_if() called on something that wasn't added with add_optional_effect()"); } bool enabled = checkbool(L, 2); block->currently_chosen_alternative = enabled ? 0 : 1; return 0; } int Block_disable(lua_State *L) { assert(lua_gettop(L) == 1); Block *block = *(Block **)luaL_checkudata(L, 1, "Block"); block->currently_chosen_alternative = find_index_of(block, IDENTITY_EFFECT); if (block->currently_chosen_alternative == -1) { luaL_error(L, "disable() called on something that didn't have an IdentityEffect fallback (try add_optional_effect())"); } assert(block->currently_chosen_alternative != -1); return 0; } int Block_always_disable_if_disabled(lua_State *L) { assert(lua_gettop(L) == 2); Block *block = *(Block **)luaL_checkudata(L, 1, "Block"); Block *disabler_block = *(Block **)luaL_checkudata(L, 2, "Block"); int my_alternative = find_index_of(block, IDENTITY_EFFECT); int their_alternative = find_index_of(disabler_block, IDENTITY_EFFECT); if (my_alternative == -1) { luaL_error(L, "always_disable_if_disabled() called on something that didn't have an IdentityEffect fallback (try add_optional_effect())"); } if (their_alternative == -1) { luaL_error(L, "always_disable_if_disabled() with an argument that didn't have an IdentityEffect fallback (try add_optional_effect())"); } // The declaration point isn't actually used, but it's nice for completeness. block->disablers.push_back(Block::Disabler{ disabler_block->idx, Block::Disabler::DISABLE_IF_OTHER_DISABLED, get_declaration_point(L) }); lua_pop(L, 2); return 0; } int Block_promise_to_disable_if_enabled(lua_State *L) { assert(lua_gettop(L) == 2); Block *block = *(Block **)luaL_checkudata(L, 1, "Block"); Block *disabler_block = *(Block **)luaL_checkudata(L, 2, "Block"); int my_alternative = find_index_of(block, IDENTITY_EFFECT); int their_alternative = find_index_of(disabler_block, IDENTITY_EFFECT); if (my_alternative == -1) { luaL_error(L, "promise_to_disable_if_enabled() called on something that didn't have an IdentityEffect fallback (try add_optional_effect())"); } if (their_alternative == -1) { luaL_error(L, "promise_to_disable_if_enabled() with an argument that didn't have an IdentityEffect fallback (try add_optional_effect())"); } block->disablers.push_back(Block::Disabler{ disabler_block->idx, Block::Disabler::DISABLE_IF_OTHER_ENABLED, get_declaration_point(L) }); lua_pop(L, 2); return 0; } int Block_set_int(lua_State *L) { assert(lua_gettop(L) == 3); Block *block = *(Block **)luaL_checkudata(L, 1, "Block"); string key = checkstdstring(L, 2); float value = luaL_checknumber(L, 3); // TODO: check validity already here, if possible? block->int_parameters[key] = value; return 0; } int Block_set_float(lua_State *L) { assert(lua_gettop(L) == 3); Block *block = *(Block **)luaL_checkudata(L, 1, "Block"); string key = checkstdstring(L, 2); float value = luaL_checknumber(L, 3); // TODO: check validity already here, if possible? block->float_parameters[key] = value; return 0; } int Block_set_vec3(lua_State *L) { assert(lua_gettop(L) == 5); Block *block = *(Block **)luaL_checkudata(L, 1, "Block"); string key = checkstdstring(L, 2); array v; v[0] = luaL_checknumber(L, 3); v[1] = luaL_checknumber(L, 4); v[2] = luaL_checknumber(L, 5); // TODO: check validity already here, if possible? block->vec3_parameters[key] = v; return 0; } int Block_set_vec4(lua_State *L) { assert(lua_gettop(L) == 6); Block *block = *(Block **)luaL_checkudata(L, 1, "Block"); string key = checkstdstring(L, 2); array v; v[0] = luaL_checknumber(L, 3); v[1] = luaL_checknumber(L, 4); v[2] = luaL_checknumber(L, 5); v[3] = luaL_checknumber(L, 6); // TODO: check validity already here, if possible? block->vec4_parameters[key] = v; return 0; } nageru-2.3.0/nageru/scene.h000066400000000000000000000207601450736322200155350ustar00rootroot00000000000000#ifndef _SCENE_H #define _SCENE_H 1 // A Scene is an equivalent of an EffectChain, but each part is not a single // Effect. (The name itself does not carry any specific meaning above that // of what an EffectChain is; it was just chosen as a more intuitive name than // an EffectChain when we had to change anyway.) Instead, it is a “block”, // which can hold one or more effect alternatives, e.g., one block could hold // ResizeEffect or IdentityEffect (effectively doing nothing), or many // different input types. On finalization, every different combination of // block alternatives are tried, and one EffectChain is generated for each. // This also goes for whether the scene is destined for preview outputs // (directly to screen, RGBA) or live (Y'CbCr output). #include #include #include #include #include #include #include class CEFCapture; struct EffectBlueprint; class FFmpegCapture; class ImageInput; struct InputState; class LiveInputWrapper; class Theme; struct lua_State; namespace movit { class Effect; class EffectChain; class ResourcePool; } // namespace movit struct Block { // Index into the parent Scene's list of blocks. using Index = size_t; Index idx = 0; // Each instantiation is indexed by the chosen alternative for each block. // These are combined into one big variable-base number, ranging from 0 // to (B_0*B_1*B_2*...*B_n)-1, where B_i is the number of alternatives for // block number i and n is the index of the last block. // // The actual index, given alternatives A_0, A_1, A_2, ..., is given as // // A_0 + B_0 * (A_1 + B_1 * (A_2 + B_2 * (...))) // // where each A_i can of course range from 0 to B_i-1. In other words, // the first block gets the lowest “bits” (or trits, or quats...) of the // index number, the second block gets the ones immediately above, // and so on. Thus, there are no holes in the sequence. // // Expanding the formula above gives the equivalent index // // A_0 + A_1 * B_0 + A_2 * B_0 * B_1 + A_3 * ... // // or // // A_0 * C_0 + A_1 * C_1 + A_2 * C_2 + A_3 * ... // // where C_0 = 0 and C_(i+1) = C_i * B_i. In other words, C_i is // the product of the cardinalities of each previous effect; if we // are e.g. at the third index and there have been C_2 = 3 * 5 = 15 // different alternatives for constructing the scene so far // (with possible indexes 0..14), it is only logical that if we // want three new options (B_2 = 3), we must add 0, 15 or 30 to // the index. (Then the local possible indexes become 0..44 and // C_3 = 45, of course.) Given an index number k, we can then get our // own local “bits” of the index, giving the alternative for this // block, by doing (k / 15) % 3. // // This specific member contains the value of C_i for this block. // (B_i is alternatives.size().) Not set before finalize() has run. size_t cardinality_base = 0; // Find the chosen alternative for this block in a given instance. int chosen_alternative(size_t chain_idx) const { if (chain_idx == size_t(-1)) { return currently_chosen_alternative; } else { return (chain_idx / cardinality_base) % alternatives.size(); } } std::vector alternatives; // Must all have the same amount of inputs. Pointers to make things easier for Lua. std::vector inputs; // One for each input of alternatives[0] (ie., typically 0 or 1, occasionally 2). // If any of these effects are disabled (IdentityEffect chosen) // or enabled (not chosen) as determined by , so should this one. struct Disabler { Index block_idx; enum { DISABLE_IF_OTHER_DISABLED, // This a promise from the user; ie., we don't disable automatically // (see comments in find_disabled_blocks()). DISABLE_IF_OTHER_ENABLED } condition; std::string declaration_point; // For error messages. }; std::vector disablers; int currently_chosen_alternative = 0; // What alternative to use if the block is disabled. // Points to an alternative with IDENTITY_EFFECT if it exists // (to disable as much as possible), otherwise 0. int canonical_alternative = 0; bool is_input = false; // For LIVE_INPUT* only. We can't just always populate signal_to_connect, // since when we set this, CEF and video signals may not have numbers yet. // FIXME: Perhaps it would be simpler if they just did? enum { CONNECT_NONE, CONNECT_SIGNAL, CONNECT_CEF, CONNECT_VIDEO } signal_type_to_connect = CONNECT_NONE; int signal_to_connect = 0; // For CONNECT_SIGNAL. #ifdef HAVE_CEF CEFCapture *cef_to_connect = nullptr; // For CONNECT_CEF. #endif FFmpegCapture *video_to_connect = nullptr; // For CONNECT_VIDEO. std::string pathname; // For IMAGE_INPUT only. // Parameters to set on the effect prior to render. // Will be set _before_ the ones from the EffectBlueprint, so that // the latter takes priority. std::map int_parameters; std::map float_parameters; std::map> vec3_parameters; std::map> vec4_parameters; std::string declaration_point; // For error messages. // Only for AUTO_WHITE_BALANCE_EFFECT. Points to the parent block with is_input = true, // so that we know which signal to get the white balance from. const Block *white_balance_controller_block = nullptr; }; int Block_display(lua_State* L); int Block_choose(lua_State* L); int Block_enable(lua_State *L); int Block_enable_if(lua_State *L); int Block_disable(lua_State *L); int Block_always_disable_if_disabled(lua_State *L); int Block_promise_to_disable_if_enabled(lua_State *L); int Block_set_int(lua_State *L); int Block_set_float(lua_State *L); int Block_set_vec3(lua_State *L); int Block_set_vec4(lua_State *L); class Scene { private: std::vector blocks; // The last one represents the output node (after finalization). Pointers to make things easier for Lua. struct Instantiation { std::unique_ptr chain; std::map effects; // So that we can set parameters. std::map inputs; // So that we can connect signals. std::map image_inputs; // So that we can connect signals. }; std::vector chains; // Indexed by combination of each block's chosen alternative. See Block for information. Theme *theme; float aspect_nom, aspect_denom; movit::ResourcePool *resource_pool; movit::Effect *instantiate_effects(const Block *block, size_t chain_idx, Instantiation *instantiation); size_t compute_chain_number_for_block(size_t block_idx, const std::bitset<256> &disabled) const; static void find_inputs_for_block(lua_State *L, Scene *scene, Block *block, int first_input_idx = 3); static Block *find_block_from_arg(lua_State *L, Scene *scene, int idx); // Find out which blocks (indexed by position in the “blocks” array), // if any, are disabled in a given instantiation. A disabled block is // one that will not be instantiated at all, because it is a secondary // (ie., not the first) input of some multi-input effect that was replaced // with IdentityEffect in the given instantiation. // // Set chain_idx to size_t(-1) to use whatever is in each block's // currently_chosen_alternative. std::bitset<256> find_disabled_blocks(size_t chain_idx) const; void find_disabled_blocks(size_t chain_idx, size_t block_idx, bool currently_disabled, std::bitset<256> *disabled) const; // If a block is disabled, it should always have canonical_alternative chosen, // so that we don't instantiate a bunch of irrelevant duplicates that // differ only in disabled blocks. You can check this property with // is_noncanonical_chain() and then avoid instantiating the ones where // it returns true. bool is_noncanonical_chain(size_t chain_idx) const; // For a given block, find any parents it may have that are inputs. // If there is more than one, throws an error. If there are zero, // returns nullptr (should probably also be an error). const Block *find_root_input_block(lua_State *L, const Block *block); public: Scene(Theme *theme, float aspect_nom, float aspect_denom); size_t compute_chain_number(bool is_main_chain) const; std::pair> get_chain(Theme *theme, lua_State *L, unsigned num, const InputState &input_state); static int add_input(lua_State *L); static int add_effect(lua_State *L); static int add_optional_effect(lua_State *L); static int add_white_balance(lua_State *L); static int finalize(lua_State *L); }; #endif // !defined(_SCENE_H) nageru-2.3.0/nageru/scripts/000077500000000000000000000000001450736322200157515ustar00rootroot00000000000000nageru-2.3.0/nageru/scripts/compile_cef_dll_wrapper.sh000077500000000000000000000004601450736322200231500ustar00rootroot00000000000000#! /bin/sh set -e BUILD_DIR="$1" CEF_DIR="$2" CMAKE="$3" OUTPUT="$4" STAMP="$5" ! [ -d "$BUILD_DIR" ] || rm -r "$BUILD_DIR" mkdir "$BUILD_DIR" ( cd "$BUILD_DIR" && $CMAKE -G Ninja "$CEF_DIR" && ninja libcef_dll_wrapper ) cp "$BUILD_DIR"/libcef_dll_wrapper/libcef_dll_wrapper.a "$OUTPUT" touch "$STAMP" nageru-2.3.0/nageru/scripts/setup_nageru_symlink.sh000077500000000000000000000001561450736322200225610ustar00rootroot00000000000000#! /bin/sh set -e ln -sf ${MESON_INSTALL_PREFIX}/lib/nageru/nageru ${MESON_INSTALL_DESTDIR_PREFIX}/bin/nageru nageru-2.3.0/nageru/simple.lua000066400000000000000000000110621450736322200162560ustar00rootroot00000000000000-- The theme is what decides what's actually shown on screen, what kind of -- transitions are available (if any), and what kind of inputs there are, -- if any. In general, it drives the entire display logic by creating Movit -- chains (called “scenes”), setting their parameters and then deciding which -- to show when. -- -- Themes are written in Lua, which reflects a simplified form of the Movit API -- where all the low-level details (such as texture formats) and alternatives -- (e.g. turning scaling on or off) are handled by the C++ side and you -- generally just build scenes. -- -- This is a much simpler theme than the default theme; it only allows you to -- switch between inputs and set white balance, no transitions or the likes. -- Thus, it should be simpler to understand. local input_neutral_color = {{0.5, 0.5, 0.5}, {0.5, 0.5, 0.5}} local live_signal_num = 0 local preview_signal_num = 1 local img = ImageInput.new("bg.jpeg") local scene = Scene.new(16, 9) local input = scene:add_input() local wb_effect = scene:add_effect(WhiteBalanceEffect.new()) scene:finalize() -- Set some global state. Unless marked otherwise, these can only be set once, -- at the start of the program. Nageru.set_num_channels(2) -- Sets, for each channel, which signal it corresponds to (starting from 0). -- The information is used for whether right-click on the channel should bring up -- an input selector or not. Only call this for channels that actually correspond -- directly to a signal (ie., live inputs, not live (0) or preview (1)). Nageru.set_channel_signal(2, 0) Nageru.set_channel_signal(3, 1) -- Set whether a given channel supports setting white balance. (Default is false.) Nageru.set_supports_wb(2, true) Nageru.set_supports_wb(3, true) -- These can be set at any time. Nageru.set_channel_name(2, "First input") Nageru.set_channel_name(3, "Second input") -- API ENTRY POINT -- Called every frame. Returns the color (if any) to paint around the given -- channel. Returns a CSS color (typically to mark live and preview signals); -- "transparent" is allowed. -- Will never be called for live (0) or preview (1). function channel_color(channel) return "transparent" end -- API ENTRY POINT -- Gets called with a new gray point when the white balance is changing. -- The color is in linear light (not sRGB gamma). function set_wb(channel, red, green, blue) if channel == 2 then input_neutral_color[1] = { red, green, blue } elseif channel == 3 then input_neutral_color[2] = { red, green, blue } end end -- API ENTRY POINT -- Called every frame. function get_transitions(t) if live_signal_num == preview_signal_num then -- No transitions possible. return {} else return {"Cut"} end end -- API ENTRY POINT -- Called when the user clicks a transition button. For our case, -- we only do cuts, so we ignore the parameters; just switch live and preview. function transition_clicked(num, t) local temp = live_signal_num live_signal_num = preview_signal_num preview_signal_num = temp end -- API ENTRY POINT function channel_clicked(num) preview_signal_num = num end -- API ENTRY POINT -- Called every frame. Get the scene for displaying at input , -- where 0 is live, 1 is preview, 2 is the first channel to display -- in the bottom bar, and so on up to num_channels()+1. t is the -- current time in seconds. width and height are the dimensions of -- the output, although you can ignore them if you don't need them -- (they're useful if you want to e.g. know what to resample by). -- -- is an object which you can query for information -- about the signals at the point of the current frame. In particular, -- you can call get_frame_width() and get_frame_height() for any -- signal number, and use that to e.g. see if you wish to enable -- a scaler or not. (You can also use get_width() and get_height(), -- which return the _field_ size. This has half the height for -- interlaced signals.) -- -- You should return the scene to use, after having set any parameters you -- want to set (through set_int() etc.). The parameters will be snapshot -- at return time and used during rendering. function get_scene(num, t, width, height, signals) local signal_num if num == 0 then -- Live (right pane). signal_num = live_signal_num elseif num == 1 then -- Preview (left pane). signal_num = preview_signal_num else -- One of the two previews (bottom panes). signal_num = num - 2 end if num == 3 then input:display(img) else input:display(signal_num) end local color = input_neutral_color[signal_num + 1] wb_effect:set_vec3("neutral_color", color[1], color[2], color[3]) return scene end nageru-2.3.0/nageru/srt_metrics.cpp000066400000000000000000000261411450736322200173300ustar00rootroot00000000000000#include "srt_metrics.h" #include "shared/metrics.h" #include using namespace std; void SRTMetrics::init(const vector> &labels) { // Global measurements (counters). global_metrics.add("srt_uptime_seconds", labels, &metric_srt_uptime_seconds); global_metrics.add("srt_send_duration_seconds", labels, &metric_srt_send_duration_seconds); global_metrics.add("srt_sent_bytes", labels, &metric_srt_sent_bytes); global_metrics.add("srt_received_bytes", labels, &metric_srt_received_bytes); vector> packet_labels = labels; packet_labels.emplace_back("type", "normal"); global_metrics.add("srt_sent_packets", packet_labels, &metric_srt_sent_packets_normal); global_metrics.add("srt_received_packets", packet_labels, &metric_srt_received_packets_normal); packet_labels.back().second = "lost"; global_metrics.add("srt_sent_packets", packet_labels, &metric_srt_sent_packets_lost); global_metrics.add("srt_received_packets", packet_labels, &metric_srt_received_packets_lost); packet_labels.back().second = "retransmitted"; global_metrics.add("srt_sent_packets", packet_labels, &metric_srt_sent_packets_retransmitted); global_metrics.add("srt_sent_bytes", packet_labels, &metric_srt_sent_bytes_retransmitted); packet_labels.back().second = "ack"; global_metrics.add("srt_sent_packets", packet_labels, &metric_srt_sent_packets_ack); global_metrics.add("srt_received_packets", packet_labels, &metric_srt_received_packets_ack); packet_labels.back().second = "nak"; global_metrics.add("srt_sent_packets", packet_labels, &metric_srt_sent_packets_nak); global_metrics.add("srt_received_packets", packet_labels, &metric_srt_received_packets_nak); packet_labels.back().second = "dropped"; global_metrics.add("srt_sent_packets", packet_labels, &metric_srt_sent_packets_dropped); global_metrics.add("srt_received_packets", packet_labels, &metric_srt_received_packets_dropped); global_metrics.add("srt_sent_bytes", packet_labels, &metric_srt_sent_bytes_dropped); global_metrics.add("srt_received_bytes", packet_labels, &metric_srt_received_bytes_dropped); packet_labels.back().second = "undecryptable"; global_metrics.add("srt_received_packets", packet_labels, &metric_srt_received_packets_undecryptable); global_metrics.add("srt_received_bytes", packet_labels, &metric_srt_received_bytes_undecryptable); global_metrics.add("srt_filter_sent_extra_packets", labels, &metric_srt_filter_sent_packets); global_metrics.add("srt_filter_received_extra_packets", labels, &metric_srt_filter_received_extra_packets); global_metrics.add("srt_filter_received_rebuilt_packets", labels, &metric_srt_filter_received_rebuilt_packets); global_metrics.add("srt_filter_received_lost_packets", labels, &metric_srt_filter_received_lost_packets); // Instant measurements (gauges). global_metrics.add("srt_packet_sending_period_seconds", labels, &metric_srt_packet_sending_period_seconds, Metrics::TYPE_GAUGE); global_metrics.add("srt_flow_window_packets", labels, &metric_srt_flow_window_packets, Metrics::TYPE_GAUGE); global_metrics.add("srt_congestion_window_packets", labels, &metric_srt_congestion_window_packets, Metrics::TYPE_GAUGE); global_metrics.add("srt_flight_size_packets", labels, &metric_srt_flight_size_packets, Metrics::TYPE_GAUGE); global_metrics.add("srt_rtt_seconds", labels, &metric_srt_rtt_seconds, Metrics::TYPE_GAUGE); global_metrics.add("srt_estimated_bandwidth_bits_per_second", labels, &metric_srt_estimated_bandwidth_bits_per_second, Metrics::TYPE_GAUGE); global_metrics.add("srt_bandwidth_ceiling_bits_per_second", labels, &metric_srt_bandwidth_ceiling_bits_per_second, Metrics::TYPE_GAUGE); global_metrics.add("srt_send_buffer_available_bytes", labels, &metric_srt_send_buffer_available_bytes, Metrics::TYPE_GAUGE); global_metrics.add("srt_receive_buffer_available_bytes", labels, &metric_srt_receive_buffer_available_bytes, Metrics::TYPE_GAUGE); global_metrics.add("srt_mss_bytes", labels, &metric_srt_mss_bytes, Metrics::TYPE_GAUGE); global_metrics.add("srt_sender_unacked_packets", labels, &metric_srt_sender_unacked_packets, Metrics::TYPE_GAUGE); global_metrics.add("srt_sender_unacked_bytes", labels, &metric_srt_sender_unacked_bytes, Metrics::TYPE_GAUGE); global_metrics.add("srt_sender_unacked_timespan_seconds", labels, &metric_srt_sender_unacked_timespan_seconds, Metrics::TYPE_GAUGE); global_metrics.add("srt_sender_delivery_delay_seconds", labels, &metric_srt_sender_delivery_delay_seconds, Metrics::TYPE_GAUGE); global_metrics.add("srt_receiver_unacked_packets", labels, &metric_srt_receiver_unacked_packets, Metrics::TYPE_GAUGE); global_metrics.add("srt_receiver_unacked_bytes", labels, &metric_srt_receiver_unacked_bytes, Metrics::TYPE_GAUGE); global_metrics.add("srt_receiver_unacked_timespan_seconds", labels, &metric_srt_receiver_unacked_timespan_seconds, Metrics::TYPE_GAUGE); global_metrics.add("srt_receiver_delivery_delay_seconds", labels, &metric_srt_receiver_delivery_delay_seconds, Metrics::TYPE_GAUGE); } void SRTMetrics::deinit(const vector> &labels) { // Global measurements (counters). global_metrics.remove_if_exists("srt_uptime_seconds", labels); global_metrics.remove_if_exists("srt_send_duration_seconds", labels); global_metrics.remove_if_exists("srt_sent_bytes", labels); global_metrics.remove_if_exists("srt_received_bytes", labels); vector> packet_labels = labels; packet_labels.emplace_back("type", "normal"); global_metrics.remove_if_exists("srt_sent_packets", packet_labels); global_metrics.remove_if_exists("srt_received_packets", packet_labels); packet_labels.back().second = "lost"; global_metrics.remove_if_exists("srt_sent_packets", packet_labels); global_metrics.remove_if_exists("srt_received_packets", packet_labels); packet_labels.back().second = "retransmitted"; global_metrics.remove_if_exists("srt_sent_packets", packet_labels); global_metrics.remove_if_exists("srt_sent_bytes", packet_labels); packet_labels.back().second = "ack"; global_metrics.remove_if_exists("srt_sent_packets", packet_labels); global_metrics.remove_if_exists("srt_received_packets", packet_labels); packet_labels.back().second = "nak"; global_metrics.remove_if_exists("srt_sent_packets", packet_labels); global_metrics.remove_if_exists("srt_received_packets", packet_labels); packet_labels.back().second = "dropped"; global_metrics.remove_if_exists("srt_sent_packets", packet_labels); global_metrics.remove_if_exists("srt_received_packets", packet_labels); global_metrics.remove_if_exists("srt_sent_bytes", packet_labels); global_metrics.remove_if_exists("srt_received_bytes", packet_labels); packet_labels.back().second = "undecryptable"; global_metrics.remove_if_exists("srt_received_packets", packet_labels); global_metrics.remove_if_exists("srt_received_bytes", packet_labels); global_metrics.remove_if_exists("srt_filter_sent_extra_packets", labels); global_metrics.remove_if_exists("srt_filter_received_extra_packets", labels); global_metrics.remove_if_exists("srt_filter_received_rebuilt_packets", labels); global_metrics.remove_if_exists("srt_filter_received_lost_packets", labels); // Instant measurements (gauges). global_metrics.remove_if_exists("srt_packet_sending_period_seconds", labels); global_metrics.remove_if_exists("srt_flow_window_packets", labels); global_metrics.remove_if_exists("srt_congestion_window_packets", labels); global_metrics.remove_if_exists("srt_flight_size_packets", labels); global_metrics.remove_if_exists("srt_rtt_seconds", labels); global_metrics.remove_if_exists("srt_estimated_bandwidth_bits_per_second", labels); global_metrics.remove_if_exists("srt_bandwidth_ceiling_bits_per_second", labels); global_metrics.remove_if_exists("srt_send_buffer_available_bytes", labels); global_metrics.remove_if_exists("srt_receive_buffer_available_bytes", labels); global_metrics.remove_if_exists("srt_mss_bytes", labels); global_metrics.remove_if_exists("srt_sender_unacked_packets", labels); global_metrics.remove_if_exists("srt_sender_unacked_bytes", labels); global_metrics.remove_if_exists("srt_sender_unacked_timespan_seconds", labels); global_metrics.remove_if_exists("srt_sender_delivery_delay_seconds", labels); global_metrics.remove_if_exists("srt_receiver_unacked_packets", labels); global_metrics.remove_if_exists("srt_receiver_unacked_bytes", labels); global_metrics.remove_if_exists("srt_receiver_unacked_timespan_seconds", labels); global_metrics.remove_if_exists("srt_receiver_delivery_delay_seconds", labels); } #ifdef HAVE_SRT void SRTMetrics::update_srt_stats(int srt_sock) { SRT_TRACEBSTATS stats; srt_bistats(srt_sock, &stats, /*clear=*/0, /*instantaneous=*/1); metric_srt_uptime_seconds = stats.msTimeStamp * 1e-3; metric_srt_send_duration_seconds = stats.usSndDurationTotal * 1e-6; metric_srt_sent_bytes = stats.byteSentTotal; metric_srt_received_bytes = stats.byteRecvTotal; metric_srt_sent_packets_normal = stats.pktSentTotal; metric_srt_received_packets_normal = stats.pktRecvTotal; metric_srt_sent_packets_lost = stats.pktSndLossTotal; metric_srt_received_packets_lost = stats.pktRcvLossTotal; metric_srt_sent_packets_retransmitted = stats.pktRetransTotal; metric_srt_sent_bytes_retransmitted = stats.byteRetransTotal; metric_srt_sent_packets_ack = stats.pktSentACKTotal; metric_srt_received_packets_ack = stats.pktRecvACKTotal; metric_srt_sent_packets_nak = stats.pktSentNAKTotal; metric_srt_received_packets_nak = stats.pktRecvNAKTotal; metric_srt_sent_packets_dropped = stats.pktSndDropTotal; metric_srt_received_packets_dropped = stats.pktRcvDropTotal; metric_srt_sent_bytes_dropped = stats.byteSndDropTotal; metric_srt_received_bytes_dropped = stats.byteRcvDropTotal; metric_srt_received_packets_undecryptable = stats.pktRcvUndecryptTotal; metric_srt_received_bytes_undecryptable = stats.byteRcvUndecryptTotal; metric_srt_filter_sent_packets = stats.pktSndFilterExtraTotal; metric_srt_filter_received_extra_packets = stats.pktRcvFilterExtraTotal; metric_srt_filter_received_rebuilt_packets = stats.pktRcvFilterSupplyTotal; metric_srt_filter_received_lost_packets = stats.pktRcvFilterLossTotal; // Gauges. metric_srt_packet_sending_period_seconds = stats.usPktSndPeriod * 1e-6; metric_srt_flow_window_packets = stats.pktFlowWindow; metric_srt_congestion_window_packets = stats.pktCongestionWindow; metric_srt_flight_size_packets = stats.pktFlightSize; metric_srt_rtt_seconds = stats.msRTT * 1e-3; metric_srt_estimated_bandwidth_bits_per_second = stats.mbpsBandwidth * 1e6; metric_srt_bandwidth_ceiling_bits_per_second = stats.mbpsMaxBW * 1e6; metric_srt_send_buffer_available_bytes = stats.byteAvailSndBuf; metric_srt_receive_buffer_available_bytes = stats.byteAvailRcvBuf; metric_srt_mss_bytes = stats.byteMSS; metric_srt_sender_unacked_packets = stats.pktSndBuf; metric_srt_sender_unacked_bytes = stats.byteSndBuf; metric_srt_sender_unacked_timespan_seconds = stats.msSndBuf * 1e-3; metric_srt_sender_delivery_delay_seconds = stats.msSndTsbPdDelay * 1e-3; metric_srt_receiver_unacked_packets = stats.pktRcvBuf; metric_srt_receiver_unacked_bytes = stats.byteRcvBuf; metric_srt_receiver_unacked_timespan_seconds = stats.msRcvBuf * 1e-3; metric_srt_receiver_delivery_delay_seconds = stats.msRcvTsbPdDelay * 1e-3; } #endif nageru-2.3.0/nageru/srt_metrics.h000066400000000000000000000060651450736322200170000ustar00rootroot00000000000000#ifndef _SRT_METRICS_H #define _SRT_METRICS_H 1 #include #include #include #include // Metrics related to an SRT stream (input or output). struct SRTMetrics { std::atomic metric_srt_uptime_seconds{0.0 / 0.0}; std::atomic metric_srt_send_duration_seconds{0.0 / 0.0}; std::atomic metric_srt_sent_bytes{-1}; std::atomic metric_srt_received_bytes{-1}; std::atomic metric_srt_sent_packets_normal{-1}; std::atomic metric_srt_received_packets_normal{-1}; std::atomic metric_srt_sent_packets_lost{-1}; std::atomic metric_srt_received_packets_lost{-1}; std::atomic metric_srt_sent_packets_retransmitted{-1}; std::atomic metric_srt_sent_bytes_retransmitted{-1}; std::atomic metric_srt_sent_packets_ack{-1}; std::atomic metric_srt_received_packets_ack{-1}; std::atomic metric_srt_sent_packets_nak{-1}; std::atomic metric_srt_received_packets_nak{-1}; std::atomic metric_srt_sent_packets_dropped{-1}; std::atomic metric_srt_received_packets_dropped{-1}; std::atomic metric_srt_sent_bytes_dropped{-1}; std::atomic metric_srt_received_bytes_dropped{-1}; std::atomic metric_srt_received_packets_undecryptable{-1}; std::atomic metric_srt_received_bytes_undecryptable{-1}; std::atomic metric_srt_filter_received_extra_packets{-1}; std::atomic metric_srt_filter_received_rebuilt_packets{-1}; std::atomic metric_srt_filter_received_lost_packets{-1}; std::atomic metric_srt_packet_sending_period_seconds{0.0 / 0.0}; std::atomic metric_srt_flow_window_packets{-1}; std::atomic metric_srt_congestion_window_packets{-1}; std::atomic metric_srt_flight_size_packets{-1}; std::atomic metric_srt_rtt_seconds{0.0 / 0.0}; std::atomic metric_srt_estimated_bandwidth_bits_per_second{0.0 / 0.0}; std::atomic metric_srt_bandwidth_ceiling_bits_per_second{0.0 / 0.0}; std::atomic metric_srt_send_buffer_available_bytes{-1}; std::atomic metric_srt_receive_buffer_available_bytes{-1}; std::atomic metric_srt_mss_bytes{-1}; std::atomic metric_srt_sender_unacked_packets{-1}; std::atomic metric_srt_sender_unacked_bytes{-1}; std::atomic metric_srt_sender_unacked_timespan_seconds{0.0 / 0.0}; std::atomic metric_srt_sender_delivery_delay_seconds{0.0 / 0.0}; std::atomic metric_srt_receiver_unacked_packets{-1}; std::atomic metric_srt_receiver_unacked_bytes{-1}; std::atomic metric_srt_receiver_unacked_timespan_seconds{0.0 / 0.0}; std::atomic metric_srt_receiver_delivery_delay_seconds{0.0 / 0.0}; std::atomic metric_srt_filter_sent_packets{-1}; // Registers in global_metrics. void init(const std::vector> &labels); // Unregisters similarly. void deinit(const std::vector> &labels); void update_srt_stats(int srt_sock); }; #endif nageru-2.3.0/nageru/state.proto000066400000000000000000000023171450736322200164720ustar00rootroot00000000000000// Used to serialize state between runs. Currently only audio input mappings, // but in theory we could do the entire mix, video inputs, etc. syntax = "proto2"; // Similar to DeviceSpec, but only devices that are used are stored, // and contains additional information that will help us try to map // to the right device even if the devices have moved around. message DeviceSpecProto { // Members from DeviceSpec itself. enum InputSourceType { SILENCE = 0; CAPTURE_CARD = 1; ALSA_INPUT = 2; }; optional InputSourceType type = 1; optional int32 index = 2; // Additional information. optional string display_name = 3; optional string alsa_name = 4; // Only for ALSA devices. optional string alsa_info = 5; // Only for ALSA devices. optional int32 num_channels = 6; // Only for ALSA devices. optional string address = 7; // Only for ALSA devices. } // Corresponds to InputMapping::Bus. message BusProto { optional string name = 1; optional int32 device_index = 2; // Index into the "devices" array. optional int32 source_channel_left = 3; optional int32 source_channel_right = 4; } // Corresponds to InputMapping. message InputMappingProto { repeated DeviceSpecProto device = 1; repeated BusProto bus = 2; } nageru-2.3.0/nageru/stereocompressor.cpp000066400000000000000000000112471450736322200204110ustar00rootroot00000000000000#include "stereocompressor.h" #include #include #include using namespace std; namespace { // Implement a less accurate but faster pow(x, y). We use the standard identity // // x^y = exp(y * ln(x)) // // with the ranges: // // x in 1..(1/threshold) // y in -1..0 // // Assume threshold goes from 0 to -40 dB. That means 1/threshold = 100, // so input to ln(x) can be 1..100. Worst case for end accuracy is y=-1. // To get a good minimax approximation (not the least wrt. continuity // at x=1), I had to make a piecewise linear function for the two ranges: // // with(numapprox): // f1 := minimax(ln, 1..6, [3, 3], x -> 1/x, 'maxerror'); // f2 := minimax(ln, 6..100, [3, 3], x -> 1/x, 'maxerror'); // f := x -> piecewise(x < 6, f1(x), f2(x)); // // (Continuity: Error is down to the 1e-6 range for x=1, difference between // f1 and f2 range at the crossover point is in the 1e-5 range. The cutoff // point at x=6 is chosen to get maxerror pretty close between f1 and f2.) // // Maximum output of ln(x) here is of course ln(100) ~= 4.605. So we can find // an approximation for exp over the range -4.605..0, where we care mostly // about the relative error: // // g := minimax(exp, -ln(100)..0, [3, 3], x -> 1/exp(x), 'maxerror'); // // We can find the worst-case error in dB from this through a simple plot: // // dbdiff := (x, y) -> abs(20 * log10(x / y)); // plot(dbdiff(g(-f(x)), 1/x), x=1..100); // // which readily shows the error never to be above ~0.001 dB or so // (actually 0.00119 dB, for the case of x=100). y=-1 remains the worst case, // it would seem. // // If we cared even more about speed, we could probably fuse y into // the coefficients for ln_nom and postgain into the coefficients for ln_den. // But if so, we should probably rather just SIMD the entire thing instead. inline float fastpow(float x, float y) { float ln_nom, ln_den; if (x < 6.0f) { ln_nom = -0.059237648f + (-0.0165117771f + (0.06818859075f + 0.007560968243f * x) * x) * x; ln_den = 0.0202509098f + (0.08419174188f + (0.03647189417f + 0.001642577975f * x) * x) * x; } else { ln_nom = -0.005430534f + (0.00633589178f + (0.0006319155549f + 0.4789541675e-5f * x) * x) * x; ln_den = 0.0064785099f + (0.003219629109f + (0.0001531823694f + 0.6884656640e-6f * x) * x) * x; } float v = y * ln_nom / ln_den; float exp_nom = 0.2195097621f + (0.08546059868f + (0.01208501759f + 0.0006173448113f * v) * v) * v; float exp_den = 0.2194980791f + (-0.1343051968f + (0.03556072737f - 0.006174398513f * v) * v) * v; return exp_nom / exp_den; } inline float compressor_knee(float x, float threshold, float inv_threshold, float inv_ratio_minus_one, float postgain) { assert(inv_ratio_minus_one <= 0.0f); if (x > threshold) { return postgain * fastpow(x * inv_threshold, inv_ratio_minus_one); } else { return postgain; } } } // namespace void StereoCompressor::process(float *buf, size_t num_samples, float threshold, float ratio, float attack_time, float release_time, float makeup_gain) { float attack_increment = float(pow(2.0f, 1.0f / (attack_time * sample_rate + 1))); if (attack_time == 0.0f) attack_increment = 100000; // For instant attack reaction. const float release_increment = float(pow(2.0f, -1.0f / (release_time * sample_rate + 1))); const float peak_increment = float(pow(2.0f, -1.0f / (0.003f * sample_rate + 1))); float inv_ratio_minus_one = 1.0f / ratio - 1.0f; if (ratio > 63) inv_ratio_minus_one = -1.0f; // Infinite ratio. float inv_threshold = 1.0f / threshold; float *left_ptr = buf; float *right_ptr = buf + 1; if (inv_ratio_minus_one >= 0.0) { for (size_t i = 0; i < num_samples; ++i) { *left_ptr *= makeup_gain; left_ptr += 2; *right_ptr *= makeup_gain; right_ptr += 2; } return; } float peak_level = this->peak_level; float compr_level = this->compr_level; for (size_t i = 0; i < num_samples; ++i) { if (fabs(*left_ptr) > peak_level) peak_level = float(fabs(*left_ptr)); if (fabs(*right_ptr) > peak_level) peak_level = float(fabs(*right_ptr)); if (peak_level > compr_level) { compr_level = min(compr_level * attack_increment, peak_level); } else { compr_level = max(compr_level * release_increment, 0.0001f); } float scalefactor_with_gain = compressor_knee(compr_level, threshold, inv_threshold, inv_ratio_minus_one, makeup_gain); *left_ptr *= scalefactor_with_gain; left_ptr += 2; *right_ptr *= scalefactor_with_gain; right_ptr += 2; peak_level = max(peak_level * peak_increment, 0.0001f); } // Store attenuation level for debug/visualization. scalefactor = compressor_knee(compr_level, threshold, inv_threshold, inv_ratio_minus_one, 1.0f); this->peak_level = peak_level; this->compr_level = compr_level; } nageru-2.3.0/nageru/stereocompressor.h000066400000000000000000000024761450736322200200620ustar00rootroot00000000000000#ifndef _STEREOCOMPRESSOR_H #define _STEREOCOMPRESSOR_H 1 #include // A simple compressor based on absolute values, with independent // attack/release times. There is no sidechain or lookahead, but the // peak value is shared between both channels. // // The compressor was originally written by, and is copyrighted by, Rune Holm. // It has been adapted and relicensed under GPLv3 (or, at your option, // any later version) for Nageru, so that its license matches the rest of the code. class StereoCompressor { public: StereoCompressor(float sample_rate) : sample_rate(sample_rate) { reset(); } void reset() { peak_level = compr_level = 0.1f; scalefactor = 0.0f; } // Process interleaved stereo data in-place. // Attack and release times are in seconds. void process(float *buf, size_t num_samples, float threshold, float ratio, float attack_time, float release_time, float makeup_gain); // Last level estimated (after attack/decay applied). float get_level() { return compr_level; } // Last attenuation factor applied, e.g. if 5x compression is currently applied, // this number will be 0.2. float get_attenuation() { return scalefactor; } private: float sample_rate; float peak_level; float compr_level; float scalefactor; }; #endif /* !defined(_STEREOCOMPRESSOR_H) */ nageru-2.3.0/nageru/theme.cpp000066400000000000000000002062521450736322200160770ustar00rootroot00000000000000#include "theme.h" #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include #include "audio_mixer.h" #include "defs.h" #ifdef HAVE_CEF #include "cef_capture.h" #endif #include "ffmpeg_capture.h" #include "flags.h" #include "image_input.h" #include "input_state.h" #include "lua_utils.h" #include "mainwindow.h" #include "pbo_frame_allocator.h" #include "scene.h" class Mixer; namespace movit { class ResourcePool; } // namespace movit using namespace std; using namespace movit; extern Mixer *global_mixer; constexpr unsigned Theme::MenuEntry::CHECKABLE; constexpr unsigned Theme::MenuEntry::CHECKED; Theme *get_theme_updata(lua_State* L) { luaL_checktype(L, lua_upvalueindex(1), LUA_TLIGHTUSERDATA); return (Theme *)lua_touserdata(L, lua_upvalueindex(1)); } void print_warning(lua_State* L, const char *format, ...) { char buf[4096]; va_list ap; va_start(ap, format); vsnprintf(buf, sizeof(buf), format, ap); va_end(ap); lua_Debug ar; lua_getstack(L, 1, &ar); lua_getinfo(L, "nSl", &ar); fprintf(stderr, "WARNING: %s:%d: %s", ar.source, ar.currentline, buf); } int ThemeMenu_set(lua_State *L) { Theme *theme = get_theme_updata(L); return theme->set_theme_menu(L); } InputStateInfo::InputStateInfo(const InputState &input_state) { for (unsigned signal_num = 0; signal_num < MAX_VIDEO_CARDS; ++signal_num) { BufferedFrame frame = input_state.buffered_frames[signal_num][0]; if (frame.frame == nullptr) { last_width[signal_num] = last_height[signal_num] = 0; last_interlaced[signal_num] = false; last_has_signal[signal_num] = false; last_is_connected[signal_num] = false; continue; } const PBOFrameAllocator::Userdata *userdata = (const PBOFrameAllocator::Userdata *)frame.frame->userdata; last_width[signal_num] = userdata->last_width[frame.field_number]; last_height[signal_num] = userdata->last_height[frame.field_number]; last_interlaced[signal_num] = userdata->last_interlaced; last_has_signal[signal_num] = userdata->last_has_signal; last_is_connected[signal_num] = userdata->last_is_connected; last_frame_rate_nom[signal_num] = userdata->last_frame_rate_nom; last_frame_rate_den[signal_num] = userdata->last_frame_rate_den; last_pixel_format[signal_num] = userdata->pixel_format; has_last_subtitle[signal_num] = userdata->has_last_subtitle; last_subtitle[signal_num] = userdata->last_subtitle; } } // An effect that does nothing. class IdentityEffect : public Effect { public: IdentityEffect() {} string effect_type_id() const override { return "IdentityEffect"; } string output_fragment_shader() override { return read_file("identity.frag"); } }; Effect *instantiate_effect(EffectChain *chain, EffectType effect_type) { switch (effect_type) { case IDENTITY_EFFECT: return new IdentityEffect; case WHITE_BALANCE_EFFECT: case AUTO_WHITE_BALANCE_EFFECT: return new WhiteBalanceEffect; case RESAMPLE_EFFECT: return new ResampleEffect; case PADDING_EFFECT: return new PaddingEffect; case INTEGRAL_PADDING_EFFECT: return new IntegralPaddingEffect; case OVERLAY_EFFECT: return new OverlayEffect; case RESIZE_EFFECT: return new ResizeEffect; case MULTIPLY_EFFECT: return new MultiplyEffect; case MIX_EFFECT: return new MixEffect; case LIFT_GAMMA_GAIN_EFFECT: return new LiftGammaGainEffect; case BLUR_EFFECT: return new BlurEffect; case UNSHARP_MASK_EFFECT: return new UnsharpMaskEffect; default: fprintf(stderr, "Unhandled effect type %d\n", effect_type); abort(); } } namespace { Effect *get_effect_from_blueprint(EffectChain *chain, lua_State *L, int idx) { EffectBlueprint *blueprint = *(EffectBlueprint **)luaL_checkudata(L, idx, "EffectBlueprint"); if (blueprint->effect != nullptr) { luaL_error(L, "An effect can currently only be added to one chain.\n"); } Effect *effect = instantiate_effect(chain, blueprint->effect_type); // Set the parameters that were deferred earlier. for (const auto &kv : blueprint->int_parameters) { if (!effect->set_int(kv.first, kv.second)) { luaL_error(L, "Effect refused set_int(\"%s\", %d) (invalid key?)", kv.first.c_str(), kv.second); } } for (const auto &kv : blueprint->float_parameters) { if (!effect->set_float(kv.first, kv.second)) { luaL_error(L, "Effect refused set_float(\"%s\", %f) (invalid key?)", kv.first.c_str(), kv.second); } } for (const auto &kv : blueprint->vec3_parameters) { if (!effect->set_vec3(kv.first, kv.second.data())) { luaL_error(L, "Effect refused set_vec3(\"%s\", %f, %f, %f) (invalid key?)", kv.first.c_str(), kv.second[0], kv.second[1], kv.second[2]); } } for (const auto &kv : blueprint->vec4_parameters) { if (!effect->set_vec4(kv.first, kv.second.data())) { luaL_error(L, "Effect refused set_vec4(\"%s\", %f, %f, %f, %f) (invalid key?)", kv.first.c_str(), kv.second[0], kv.second[1], kv.second[2], kv.second[3]); } } blueprint->effect = effect; return effect; } InputStateInfo *get_input_state_info(lua_State *L, int idx) { if (luaL_testudata(L, idx, "InputStateInfo")) { return (InputStateInfo *)lua_touserdata(L, idx); } luaL_error(L, "Error: Index #%d was not InputStateInfo\n", idx); return nullptr; } } // namespace bool checkbool(lua_State* L, int idx) { luaL_checktype(L, idx, LUA_TBOOLEAN); return lua_toboolean(L, idx); } string checkstdstring(lua_State *L, int index) { size_t len; const char* cstr = lua_tolstring(L, index, &len); return string(cstr, len); } namespace { int Scene_new(lua_State* L) { assert(lua_gettop(L) == 2); Theme *theme = get_theme_updata(L); int aspect_w = luaL_checknumber(L, 1); int aspect_h = luaL_checknumber(L, 2); return wrap_lua_object(L, "Scene", theme, aspect_w, aspect_h); } int Scene_gc(lua_State* L) { assert(lua_gettop(L) == 1); Scene *chain = (Scene *)luaL_checkudata(L, 1, "Scene"); chain->~Scene(); return 0; } } // namespace void add_outputs_and_finalize(EffectChain *chain, bool is_main_chain) { // Add outputs as needed. // NOTE: If you change any details about the output format, you will need to // also update what's given to the muxer (HTTPD::Mux constructor) and // what's put in the H.264 stream (sps_rbsp()). ImageFormat inout_format; inout_format.color_space = COLORSPACE_REC_709; // Output gamma is tricky. We should output Rec. 709 for TV, except that // we expect to run with web players and others that don't really care and // just output with no conversion. So that means we'll need to output sRGB, // even though H.264 has no setting for that (we use “unspecified”). inout_format.gamma_curve = GAMMA_sRGB; if (is_main_chain) { YCbCrFormat output_ycbcr_format; // We actually output 4:2:0 and/or 4:2:2 in the end, but chroma subsampling // happens in a pass not run by Movit (see ChromaSubsampler::subsample_chroma()). output_ycbcr_format.chroma_subsampling_x = 1; output_ycbcr_format.chroma_subsampling_y = 1; // This will be overridden if HDMI/SDI output is in force. if (global_flags.ycbcr_rec709_coefficients) { output_ycbcr_format.luma_coefficients = YCBCR_REC_709; } else { output_ycbcr_format.luma_coefficients = YCBCR_REC_601; } output_ycbcr_format.full_range = false; output_ycbcr_format.num_levels = 1 << global_flags.bit_depth; GLenum type = global_flags.bit_depth > 8 ? GL_UNSIGNED_SHORT : GL_UNSIGNED_BYTE; chain->add_ycbcr_output(inout_format, OUTPUT_ALPHA_FORMAT_POSTMULTIPLIED, output_ycbcr_format, YCBCR_OUTPUT_SPLIT_Y_AND_CBCR, type); // If we're using zerocopy video encoding (so the destination // Y texture is owned by VA-API and will be unavailable for // display), add a copy, where we'll only be using the Y component. if (global_flags.use_zerocopy) { chain->add_ycbcr_output(inout_format, OUTPUT_ALPHA_FORMAT_POSTMULTIPLIED, output_ycbcr_format, YCBCR_OUTPUT_INTERLEAVED, type); // Add a copy where we'll only be using the Y component. } chain->set_dither_bits(global_flags.bit_depth > 8 ? 16 : 8); chain->set_output_origin(OUTPUT_ORIGIN_TOP_LEFT); } else { chain->add_output(inout_format, OUTPUT_ALPHA_FORMAT_POSTMULTIPLIED); } chain->finalize(); } namespace { int EffectChain_new(lua_State* L) { assert(lua_gettop(L) == 2); Theme *theme = get_theme_updata(L); int aspect_w = luaL_checknumber(L, 1); int aspect_h = luaL_checknumber(L, 2); return wrap_lua_object(L, "EffectChain", aspect_w, aspect_h, theme->get_resource_pool()); } int EffectChain_gc(lua_State* L) { assert(lua_gettop(L) == 1); EffectChain *chain = (EffectChain *)luaL_checkudata(L, 1, "EffectChain"); chain->~EffectChain(); return 0; } int EffectChain_add_live_input(lua_State* L) { assert(lua_gettop(L) == 3); Theme *theme = get_theme_updata(L); EffectChain *chain = (EffectChain *)luaL_checkudata(L, 1, "EffectChain"); bool override_bounce = checkbool(L, 2); bool deinterlace = checkbool(L, 3); bmusb::PixelFormat pixel_format = global_flags.bit_depth > 8 ? bmusb::PixelFormat_10BitYCbCr : bmusb::PixelFormat_8BitYCbCr; // Needs to be nonowned to match add_video_input (see below). return wrap_lua_object_nonowned(L, "LiveInputWrapper", theme, chain, pixel_format, override_bounce, deinterlace, /*user_connectable=*/true); } int EffectChain_add_video_input(lua_State* L) { assert(lua_gettop(L) == 3); Theme *theme = get_theme_updata(L); EffectChain *chain = (EffectChain *)luaL_checkudata(L, 1, "EffectChain"); FFmpegCapture **capture = (FFmpegCapture **)luaL_checkudata(L, 2, "VideoInput"); bool deinterlace = checkbool(L, 3); // These need to be nonowned, so that the LiveInputWrapper still exists // and can feed frames to the right EffectChain even if the Lua code // doesn't care about the object anymore. (If we change this, we'd need // to also unregister the signal connection on __gc.) int ret = wrap_lua_object_nonowned( L, "LiveInputWrapper", theme, chain, (*capture)->get_current_pixel_format(), /*override_bounce=*/false, deinterlace, /*user_connectable=*/false); if (ret == 1) { Theme *theme = get_theme_updata(L); LiveInputWrapper **live_input = (LiveInputWrapper **)lua_touserdata(L, -1); theme->register_video_signal_connection(chain, *live_input, *capture); } return ret; } #ifdef HAVE_CEF int EffectChain_add_html_input(lua_State* L) { assert(lua_gettop(L) == 2); Theme *theme = get_theme_updata(L); EffectChain *chain = (EffectChain *)luaL_checkudata(L, 1, "EffectChain"); CEFCapture **capture = (CEFCapture **)luaL_checkudata(L, 2, "HTMLInput"); // These need to be nonowned, so that the LiveInputWrapper still exists // and can feed frames to the right EffectChain even if the Lua code // doesn't care about the object anymore. (If we change this, we'd need // to also unregister the signal connection on __gc.) int ret = wrap_lua_object_nonowned( L, "LiveInputWrapper", theme, chain, (*capture)->get_current_pixel_format(), /*override_bounce=*/false, /*deinterlace=*/false, /*user_connectable=*/false); if (ret == 1) { Theme *theme = get_theme_updata(L); LiveInputWrapper **live_input = (LiveInputWrapper **)lua_touserdata(L, -1); theme->register_html_signal_connection(chain, *live_input, *capture); } return ret; } #endif int EffectChain_add_effect(lua_State* L) { assert(lua_gettop(L) >= 2); EffectChain *chain = (EffectChain *)luaL_checkudata(L, 1, "EffectChain"); // TODO: Better error reporting. Effect *effect; if (luaL_testudata(L, 2, "ImageInput")) { effect = *(ImageInput **)luaL_checkudata(L, 2, "ImageInput"); } else { effect = get_effect_from_blueprint(chain, L, 2); } if (lua_gettop(L) == 2) { if (effect->num_inputs() == 0) { chain->add_input((Input *)effect); } else { chain->add_effect(effect); } } else { vector inputs; for (int idx = 3; idx <= lua_gettop(L); ++idx) { if (luaL_testudata(L, idx, "LiveInputWrapper")) { LiveInputWrapper **input = (LiveInputWrapper **)lua_touserdata(L, idx); inputs.push_back((*input)->get_effect()); } else if (luaL_testudata(L, idx, "ImageInput")) { ImageInput *image = *(ImageInput **)luaL_checkudata(L, idx, "ImageInput"); inputs.push_back(image); } else { EffectBlueprint *blueprint = *(EffectBlueprint **)luaL_checkudata(L, idx, "EffectBlueprint"); assert(blueprint->effect != nullptr); // Parent must be added to the graph. inputs.push_back(blueprint->effect); } } chain->add_effect(effect, inputs); } lua_settop(L, 2); // Return the effect itself. // Make sure Lua doesn't garbage-collect it away. lua_pushvalue(L, -1); luaL_ref(L, LUA_REGISTRYINDEX); // TODO: leak? return 1; } int EffectChain_finalize(lua_State* L) { assert(lua_gettop(L) == 2); EffectChain *chain = (EffectChain *)luaL_checkudata(L, 1, "EffectChain"); bool is_main_chain = checkbool(L, 2); add_outputs_and_finalize(chain, is_main_chain); return 0; } int LiveInputWrapper_connect_signal(lua_State* L) { assert(lua_gettop(L) == 2); LiveInputWrapper **input = (LiveInputWrapper **)luaL_checkudata(L, 1, "LiveInputWrapper"); int signal_num = luaL_checknumber(L, 2); bool success = (*input)->connect_signal(signal_num); if (!success) { print_warning(L, "Calling connect_signal() on a video or HTML input. Ignoring.\n"); } return 0; } int ImageInput_new(lua_State* L) { assert(lua_gettop(L) == 1); string filename = checkstdstring(L, 1); return wrap_lua_object_nonowned(L, "ImageInput", filename); } int VideoInput_new(lua_State* L) { assert(lua_gettop(L) == 2); string filename = checkstdstring(L, 1); int pixel_format = luaL_checknumber(L, 2); if (pixel_format != bmusb::PixelFormat_8BitYCbCrPlanar && pixel_format != bmusb::PixelFormat_8BitBGRA) { print_warning(L, "Invalid enum %d used for video format, choosing Y'CbCr.\n", pixel_format); pixel_format = bmusb::PixelFormat_8BitYCbCrPlanar; } int ret = wrap_lua_object_nonowned(L, "VideoInput", filename, global_flags.width, global_flags.height); if (ret == 1) { FFmpegCapture **capture = (FFmpegCapture **)lua_touserdata(L, -1); (*capture)->set_pixel_format(bmusb::PixelFormat(pixel_format)); Theme *theme = get_theme_updata(L); theme->register_video_input(*capture); } return ret; } int VideoInput_rewind(lua_State* L) { assert(lua_gettop(L) == 1); FFmpegCapture **video_input = (FFmpegCapture **)luaL_checkudata(L, 1, "VideoInput"); (*video_input)->rewind(); return 0; } int VideoInput_disconnect(lua_State* L) { assert(lua_gettop(L) == 1); FFmpegCapture **video_input = (FFmpegCapture **)luaL_checkudata(L, 1, "VideoInput"); (*video_input)->disconnect(); return 0; } int VideoInput_change_rate(lua_State* L) { assert(lua_gettop(L) == 2); FFmpegCapture **video_input = (FFmpegCapture **)luaL_checkudata(L, 1, "VideoInput"); double new_rate = luaL_checknumber(L, 2); (*video_input)->change_rate(new_rate); return 0; } int VideoInput_get_signal_num(lua_State* L) { assert(lua_gettop(L) == 1); FFmpegCapture **video_input = (FFmpegCapture **)luaL_checkudata(L, 1, "VideoInput"); lua_pushnumber(L, -1 - (*video_input)->get_card_index()); return 1; } int HTMLInput_new(lua_State* L) { #ifdef HAVE_CEF assert(lua_gettop(L) == 1); string url = checkstdstring(L, 1); int ret = wrap_lua_object_nonowned(L, "HTMLInput", url, global_flags.width, global_flags.height); if (ret == 1) { CEFCapture **capture = (CEFCapture **)lua_touserdata(L, -1); Theme *theme = get_theme_updata(L); theme->register_html_input(*capture); } return ret; #else fprintf(stderr, "This version of Nageru has been compiled without CEF support.\n"); fprintf(stderr, "HTMLInput is not available.\n"); abort(); #endif } #ifdef HAVE_CEF int HTMLInput_set_url(lua_State* L) { assert(lua_gettop(L) == 2); CEFCapture **video_input = (CEFCapture **)luaL_checkudata(L, 1, "HTMLInput"); string new_url = checkstdstring(L, 2); (*video_input)->set_url(new_url); return 0; } int HTMLInput_reload(lua_State* L) { assert(lua_gettop(L) == 1); CEFCapture **video_input = (CEFCapture **)luaL_checkudata(L, 1, "HTMLInput"); (*video_input)->reload(); return 0; } int HTMLInput_set_max_fps(lua_State* L) { assert(lua_gettop(L) == 2); CEFCapture **video_input = (CEFCapture **)luaL_checkudata(L, 1, "HTMLInput"); int max_fps = lrint(luaL_checknumber(L, 2)); (*video_input)->set_max_fps(max_fps); return 0; } int HTMLInput_execute_javascript_async(lua_State* L) { assert(lua_gettop(L) == 2); CEFCapture **video_input = (CEFCapture **)luaL_checkudata(L, 1, "HTMLInput"); string js = checkstdstring(L, 2); (*video_input)->execute_javascript_async(js); return 0; } int HTMLInput_resize(lua_State* L) { assert(lua_gettop(L) == 3); CEFCapture **video_input = (CEFCapture **)luaL_checkudata(L, 1, "HTMLInput"); unsigned width = lrint(luaL_checknumber(L, 2)); unsigned height = lrint(luaL_checknumber(L, 3)); (*video_input)->resize(width, height); return 0; } int HTMLInput_get_signal_num(lua_State* L) { assert(lua_gettop(L) == 1); CEFCapture **video_input = (CEFCapture **)luaL_checkudata(L, 1, "HTMLInput"); lua_pushnumber(L, -1 - (*video_input)->get_card_index()); return 1; } #endif int IdentityEffect_new(lua_State* L) { assert(lua_gettop(L) == 0); return wrap_lua_object_nonowned(L, "EffectBlueprint", IDENTITY_EFFECT); } int WhiteBalanceEffect_new(lua_State* L) { assert(lua_gettop(L) == 0); return wrap_lua_object_nonowned(L, "EffectBlueprint", WHITE_BALANCE_EFFECT); } int ResampleEffect_new(lua_State* L) { assert(lua_gettop(L) == 0); return wrap_lua_object_nonowned(L, "EffectBlueprint", RESAMPLE_EFFECT); } int PaddingEffect_new(lua_State* L) { assert(lua_gettop(L) == 0); return wrap_lua_object_nonowned(L, "EffectBlueprint", PADDING_EFFECT); } int IntegralPaddingEffect_new(lua_State* L) { assert(lua_gettop(L) == 0); return wrap_lua_object_nonowned(L, "EffectBlueprint", INTEGRAL_PADDING_EFFECT); } int OverlayEffect_new(lua_State* L) { assert(lua_gettop(L) == 0); return wrap_lua_object_nonowned(L, "EffectBlueprint", OVERLAY_EFFECT); } int ResizeEffect_new(lua_State* L) { assert(lua_gettop(L) == 0); return wrap_lua_object_nonowned(L, "EffectBlueprint", RESIZE_EFFECT); } int MultiplyEffect_new(lua_State* L) { assert(lua_gettop(L) == 0); return wrap_lua_object_nonowned(L, "EffectBlueprint", MULTIPLY_EFFECT); } int MixEffect_new(lua_State* L) { assert(lua_gettop(L) == 0); return wrap_lua_object_nonowned(L, "EffectBlueprint", MIX_EFFECT); } int LiftGammaGainEffect_new(lua_State* L) { assert(lua_gettop(L) == 0); return wrap_lua_object_nonowned(L, "EffectBlueprint", LIFT_GAMMA_GAIN_EFFECT); } int BlurEffect_new(lua_State* L) { assert(lua_gettop(L) == 0); return wrap_lua_object_nonowned(L, "EffectBlueprint", BLUR_EFFECT); } int UnsharpMaskEffect_new(lua_State* L) { assert(lua_gettop(L) == 0); return wrap_lua_object_nonowned(L, "EffectBlueprint", UNSHARP_MASK_EFFECT); } int InputStateInfo_get_width(lua_State* L) { assert(lua_gettop(L) == 2); InputStateInfo *input_state_info = get_input_state_info(L, 1); Theme *theme = get_theme_updata(L); int card_idx = theme->map_signal_to_card(luaL_checknumber(L, 2)); lua_pushnumber(L, input_state_info->last_width[card_idx]); return 1; } int InputStateInfo_get_height(lua_State* L) { assert(lua_gettop(L) == 2); InputStateInfo *input_state_info = get_input_state_info(L, 1); Theme *theme = get_theme_updata(L); int card_idx = theme->map_signal_to_card(luaL_checknumber(L, 2)); lua_pushnumber(L, input_state_info->last_height[card_idx]); return 1; } int InputStateInfo_get_frame_height(lua_State* L) { assert(lua_gettop(L) == 2); InputStateInfo *input_state_info = get_input_state_info(L, 1); Theme *theme = get_theme_updata(L); int card_idx = theme->map_signal_to_card(luaL_checknumber(L, 2)); unsigned height = input_state_info->last_height[card_idx]; if (input_state_info->last_interlaced[card_idx]) { height *= 2; } lua_pushnumber(L, height); return 1; } int InputStateInfo_get_interlaced(lua_State* L) { assert(lua_gettop(L) == 2); InputStateInfo *input_state_info = get_input_state_info(L, 1); Theme *theme = get_theme_updata(L); int card_idx = theme->map_signal_to_card(luaL_checknumber(L, 2)); lua_pushboolean(L, input_state_info->last_interlaced[card_idx]); return 1; } int InputStateInfo_get_has_signal(lua_State* L) { assert(lua_gettop(L) == 2); InputStateInfo *input_state_info = get_input_state_info(L, 1); Theme *theme = get_theme_updata(L); int card_idx = theme->map_signal_to_card(luaL_checknumber(L, 2)); lua_pushboolean(L, input_state_info->last_has_signal[card_idx]); return 1; } int InputStateInfo_get_is_connected(lua_State* L) { assert(lua_gettop(L) == 2); InputStateInfo *input_state_info = get_input_state_info(L, 1); Theme *theme = get_theme_updata(L); int card_idx = theme->map_signal_to_card(luaL_checknumber(L, 2)); lua_pushboolean(L, input_state_info->last_is_connected[card_idx]); return 1; } int InputStateInfo_get_frame_rate_nom(lua_State* L) { assert(lua_gettop(L) == 2); InputStateInfo *input_state_info = get_input_state_info(L, 1); Theme *theme = get_theme_updata(L); int card_idx = theme->map_signal_to_card(luaL_checknumber(L, 2)); lua_pushnumber(L, input_state_info->last_frame_rate_nom[card_idx]); return 1; } int InputStateInfo_get_frame_rate_den(lua_State* L) { assert(lua_gettop(L) == 2); InputStateInfo *input_state_info = get_input_state_info(L, 1); Theme *theme = get_theme_updata(L); int card_idx = theme->map_signal_to_card(luaL_checknumber(L, 2)); lua_pushnumber(L, input_state_info->last_frame_rate_den[card_idx]); return 1; } int InputStateInfo_get_last_subtitle(lua_State* L) { assert(lua_gettop(L) == 2); InputStateInfo *input_state_info = get_input_state_info(L, 1); Theme *theme = get_theme_updata(L); int card_idx = theme->map_signal_to_card(luaL_checknumber(L, 2)); if (!input_state_info->has_last_subtitle[card_idx]) { lua_pushnil(L); } else { lua_pushstring(L, input_state_info->last_subtitle[card_idx].c_str()); } return 1; } namespace { // Helper function to write e.g. “60” or “59.94”. string format_frame_rate(int nom, int den) { char buf[256]; if (nom % den == 0) { snprintf(buf, sizeof(buf), "%d", nom / den); } else { snprintf(buf, sizeof(buf), "%.2f", double(nom) / den); } return buf; } // Helper function to write e.g. “720p60”. string get_human_readable_resolution(const InputStateInfo *input_state_info, int signal_num) { char buf[256]; if (input_state_info->last_interlaced[signal_num]) { snprintf(buf, sizeof(buf), "%di", input_state_info->last_height[signal_num] * 2); // Show field rate instead of frame rate; really for cosmetics only // (and actually contrary to EBU recommendations, although in line // with typical user expectations). return buf + format_frame_rate(input_state_info->last_frame_rate_nom[signal_num] * 2, input_state_info->last_frame_rate_den[signal_num]); } else { snprintf(buf, sizeof(buf), "%dp", input_state_info->last_height[signal_num]); return buf + format_frame_rate(input_state_info->last_frame_rate_nom[signal_num], input_state_info->last_frame_rate_den[signal_num]); } } } // namespace int InputStateInfo_get_human_readable_resolution(lua_State* L) { assert(lua_gettop(L) == 2); InputStateInfo *input_state_info = get_input_state_info(L, 1); Theme *theme = get_theme_updata(L); int card_idx = theme->map_signal_to_card(luaL_checknumber(L, 2)); string str; if (!input_state_info->last_is_connected[card_idx]) { str = "disconnected"; } else if (input_state_info->last_height[card_idx] <= 0) { str = "no signal"; } else if (!input_state_info->last_has_signal[card_idx]) { if (input_state_info->last_height[card_idx] == 525) { // Special mode for the USB3 cards. str = "no signal"; } else { str = get_human_readable_resolution(input_state_info, card_idx) + ", no signal"; } } else { str = get_human_readable_resolution(input_state_info, card_idx); } lua_pushstring(L, str.c_str()); return 1; } int EffectBlueprint_set_int(lua_State *L) { assert(lua_gettop(L) == 3); EffectBlueprint *blueprint = *(EffectBlueprint **)luaL_checkudata(L, 1, "EffectBlueprint"); string key = checkstdstring(L, 2); float value = luaL_checknumber(L, 3); if (blueprint->effect != nullptr) { if (!blueprint->effect->set_int(key, value)) { luaL_error(L, "Effect refused set_int(\"%s\", %d) (invalid key?)", key.c_str(), int(value)); } } else { // TODO: check validity already here, if possible? blueprint->int_parameters[key] = value; } return 0; } int EffectBlueprint_set_float(lua_State *L) { assert(lua_gettop(L) == 3); EffectBlueprint *blueprint = *(EffectBlueprint **)luaL_checkudata(L, 1, "EffectBlueprint"); string key = checkstdstring(L, 2); float value = luaL_checknumber(L, 3); if (blueprint->effect != nullptr) { if (!blueprint->effect->set_float(key, value)) { luaL_error(L, "Effect refused set_float(\"%s\", %d) (invalid key?)", key.c_str(), int(value)); } } else { // TODO: check validity already here, if possible? blueprint->float_parameters[key] = value; } return 0; } int EffectBlueprint_set_vec3(lua_State *L) { assert(lua_gettop(L) == 5); EffectBlueprint *blueprint = *(EffectBlueprint **)luaL_checkudata(L, 1, "EffectBlueprint"); string key = checkstdstring(L, 2); array v; v[0] = luaL_checknumber(L, 3); v[1] = luaL_checknumber(L, 4); v[2] = luaL_checknumber(L, 5); if (blueprint->effect != nullptr) { if (!blueprint->effect->set_vec3(key, v.data())) { luaL_error(L, "Effect refused set_vec3(\"%s\", %f, %f, %f) (invalid key?)", key.c_str(), v[0], v[1], v[2]); } } else { // TODO: check validity already here, if possible? blueprint->vec3_parameters[key] = v; } return 0; } int EffectBlueprint_set_vec4(lua_State *L) { assert(lua_gettop(L) == 6); EffectBlueprint *blueprint = *(EffectBlueprint **)luaL_checkudata(L, 1, "EffectBlueprint"); string key = checkstdstring(L, 2); array v; v[0] = luaL_checknumber(L, 3); v[1] = luaL_checknumber(L, 4); v[2] = luaL_checknumber(L, 5); v[3] = luaL_checknumber(L, 6); if (blueprint->effect != nullptr) { if (!blueprint->effect->set_vec4(key, v.data())) { luaL_error(L, "Effect refused set_vec4(\"%s\", %f, %f, %f, %f) (invalid key?)", key.c_str(), v[0], v[1], v[2], v[3]); } } else { // TODO: check validity already here, if possible? blueprint->vec4_parameters[key] = v; } return 0; } const luaL_Reg Scene_funcs[] = { { "new", Scene_new }, { "__gc", Scene_gc }, { "add_input", Scene::add_input }, { "add_white_balance", Scene::add_white_balance }, { "add_effect", Scene::add_effect }, { "add_optional_effect", Scene::add_optional_effect }, { "finalize", Scene::finalize }, { NULL, NULL } }; const luaL_Reg Block_funcs[] = { { "display", Block_display }, { "choose", Block_choose }, { "enable", Block_enable }, { "enable_if", Block_enable_if }, { "disable", Block_disable }, { "always_disable_if_disabled", Block_always_disable_if_disabled }, { "promise_to_disable_if_enabled", Block_promise_to_disable_if_enabled }, { "set_int", Block_set_int }, { "set_float", Block_set_float }, { "set_vec3", Block_set_vec3 }, { "set_vec4", Block_set_vec4 }, { NULL, NULL } }; const luaL_Reg EffectBlueprint_funcs[] = { // NOTE: No new() function; that's for the individual effects. { "set_int", EffectBlueprint_set_int }, { "set_float", EffectBlueprint_set_float }, { "set_vec3", EffectBlueprint_set_vec3 }, { "set_vec4", EffectBlueprint_set_vec4 }, { NULL, NULL } }; const luaL_Reg EffectChain_funcs[] = { { "new", EffectChain_new }, { "__gc", EffectChain_gc }, { "add_live_input", EffectChain_add_live_input }, { "add_video_input", EffectChain_add_video_input }, #ifdef HAVE_CEF { "add_html_input", EffectChain_add_html_input }, #endif { "add_effect", EffectChain_add_effect }, { "finalize", EffectChain_finalize }, { NULL, NULL } }; const luaL_Reg LiveInputWrapper_funcs[] = { { "connect_signal", LiveInputWrapper_connect_signal }, { NULL, NULL } }; const luaL_Reg ImageInput_funcs[] = { { "new", ImageInput_new }, { NULL, NULL } }; const luaL_Reg VideoInput_funcs[] = { { "new", VideoInput_new }, { "rewind", VideoInput_rewind }, { "disconnect", VideoInput_disconnect }, { "change_rate", VideoInput_change_rate }, { "get_signal_num", VideoInput_get_signal_num }, { NULL, NULL } }; const luaL_Reg HTMLInput_funcs[] = { { "new", HTMLInput_new }, #ifdef HAVE_CEF { "set_url", HTMLInput_set_url }, { "reload", HTMLInput_reload }, { "set_max_fps", HTMLInput_set_max_fps }, { "execute_javascript_async", HTMLInput_execute_javascript_async }, { "resize", HTMLInput_resize }, { "get_signal_num", HTMLInput_get_signal_num }, #endif { NULL, NULL } }; // Effects. // All of these are solely for new(); the returned metatable will be that of // EffectBlueprint, and Effect (returned from add_effect()) is its own type. const luaL_Reg IdentityEffect_funcs[] = { { "new", IdentityEffect_new }, { NULL, NULL } }; const luaL_Reg WhiteBalanceEffect_funcs[] = { { "new", WhiteBalanceEffect_new }, { NULL, NULL } }; const luaL_Reg ResampleEffect_funcs[] = { { "new", ResampleEffect_new }, { NULL, NULL } }; const luaL_Reg PaddingEffect_funcs[] = { { "new", PaddingEffect_new }, { NULL, NULL } }; const luaL_Reg IntegralPaddingEffect_funcs[] = { { "new", IntegralPaddingEffect_new }, { NULL, NULL } }; const luaL_Reg OverlayEffect_funcs[] = { { "new", OverlayEffect_new }, { NULL, NULL } }; const luaL_Reg ResizeEffect_funcs[] = { { "new", ResizeEffect_new }, { NULL, NULL } }; const luaL_Reg MultiplyEffect_funcs[] = { { "new", MultiplyEffect_new }, { NULL, NULL } }; const luaL_Reg MixEffect_funcs[] = { { "new", MixEffect_new }, { NULL, NULL } }; const luaL_Reg LiftGammaGainEffect_funcs[] = { { "new", LiftGammaGainEffect_new }, { NULL, NULL } }; const luaL_Reg BlurEffect_funcs[] = { { "new", BlurEffect_new }, { NULL, NULL } }; const luaL_Reg UnsharpMaskEffect_funcs[] = { { "new", UnsharpMaskEffect_new }, { NULL, NULL } }; // End of effects. const luaL_Reg InputStateInfo_funcs[] = { { "get_width", InputStateInfo_get_width }, { "get_height", InputStateInfo_get_height }, { "get_frame_width", InputStateInfo_get_width }, // Same as get_width(). { "get_frame_height", InputStateInfo_get_frame_height }, { "get_interlaced", InputStateInfo_get_interlaced }, { "get_has_signal", InputStateInfo_get_has_signal }, { "get_is_connected", InputStateInfo_get_is_connected }, { "get_frame_rate_nom", InputStateInfo_get_frame_rate_nom }, { "get_frame_rate_den", InputStateInfo_get_frame_rate_den }, { "get_last_subtitle", InputStateInfo_get_last_subtitle }, { "get_human_readable_resolution", InputStateInfo_get_human_readable_resolution }, { NULL, NULL } }; const luaL_Reg ThemeMenu_funcs[] = { { "set", ThemeMenu_set }, { NULL, NULL } }; } // namespace LiveInputWrapper::LiveInputWrapper( Theme *theme, EffectChain *chain, bmusb::PixelFormat pixel_format, bool override_bounce, bool deinterlace, bool user_connectable) : theme(theme), pixel_format(pixel_format), deinterlace(deinterlace), user_connectable(user_connectable) { ImageFormat inout_format; inout_format.color_space = COLORSPACE_sRGB; // Gamma curve depends on the input signal, and we don't really get any // indications. A camera would be expected to do Rec. 709, but // I haven't checked if any do in practice. However, computers _do_ output // in sRGB gamma (ie., they don't convert from sRGB to Rec. 709), and // I wouldn't really be surprised if most non-professional cameras do, too. // So we pick sRGB as the least evil here. inout_format.gamma_curve = GAMMA_sRGB; unsigned num_inputs; if (deinterlace) { deinterlace_effect = new movit::DeinterlaceEffect(); // As per the comments in deinterlace_effect.h, we turn this off. // The most likely interlaced input for us is either a camera // (where it's fine to turn it off) or a laptop (where it _should_ // be turned off). CHECK(deinterlace_effect->set_int("enable_spatial_interlacing_check", 0)); num_inputs = deinterlace_effect->num_inputs(); assert(num_inputs == FRAME_HISTORY_LENGTH); } else { num_inputs = 1; } if (pixel_format == bmusb::PixelFormat_8BitBGRA) { for (unsigned i = 0; i < num_inputs; ++i) { // We upload our textures ourselves, and Movit swaps // R and B in the shader if we specify BGRA, so lie and say RGBA. rgba_inputs.push_back(new sRGBSwitchingFlatInput(inout_format, FORMAT_RGBA_POSTMULTIPLIED_ALPHA, GL_UNSIGNED_BYTE, global_flags.width, global_flags.height)); chain->add_input(rgba_inputs.back()); } if (deinterlace) { vector reverse_inputs(rgba_inputs.rbegin(), rgba_inputs.rend()); chain->add_effect(deinterlace_effect, reverse_inputs); } } else { assert(pixel_format == bmusb::PixelFormat_8BitYCbCr || pixel_format == bmusb::PixelFormat_10BitYCbCr || pixel_format == bmusb::PixelFormat_8BitYCbCrPlanar); // Most of these settings will be overridden later if using PixelFormat_8BitYCbCrPlanar. input_ycbcr_format.chroma_subsampling_x = (pixel_format == bmusb::PixelFormat_10BitYCbCr) ? 1 : 2; input_ycbcr_format.chroma_subsampling_y = 1; input_ycbcr_format.num_levels = (pixel_format == bmusb::PixelFormat_10BitYCbCr) ? 1024 : 256; input_ycbcr_format.cb_x_position = 0.0; input_ycbcr_format.cr_x_position = 0.0; input_ycbcr_format.cb_y_position = 0.5; input_ycbcr_format.cr_y_position = 0.5; input_ycbcr_format.luma_coefficients = YCBCR_REC_709; // Will be overridden later even if not planar. input_ycbcr_format.full_range = false; // Will be overridden later even if not planar. for (unsigned i = 0; i < num_inputs; ++i) { // When using 10-bit input, we're converting to interleaved through v210Converter. YCbCrInputSplitting splitting; if (pixel_format == bmusb::PixelFormat_10BitYCbCr) { splitting = YCBCR_INPUT_INTERLEAVED; } else if (pixel_format == bmusb::PixelFormat_8BitYCbCr) { splitting = YCBCR_INPUT_SPLIT_Y_AND_CBCR; } else { splitting = YCBCR_INPUT_PLANAR; } if (override_bounce) { ycbcr_inputs.push_back(new NonBouncingYCbCrInput(inout_format, input_ycbcr_format, global_flags.width, global_flags.height, splitting)); } else { ycbcr_inputs.push_back(new YCbCrInput(inout_format, input_ycbcr_format, global_flags.width, global_flags.height, splitting)); } chain->add_input(ycbcr_inputs.back()); } if (deinterlace) { vector reverse_inputs(ycbcr_inputs.rbegin(), ycbcr_inputs.rend()); chain->add_effect(deinterlace_effect, reverse_inputs); } } } bool LiveInputWrapper::connect_signal(int signal_num) { if (!user_connectable) { return false; } if (global_mixer == nullptr) { // No data yet. return true; } int card_idx = theme->map_signal_to_card(signal_num); connect_card(card_idx, *theme->input_state); return true; } void LiveInputWrapper::connect_card(int card_idx, const InputState &input_state) { BufferedFrame first_frame = input_state.buffered_frames[card_idx][0]; if (first_frame.frame == nullptr) { // No data yet. return; } unsigned width, height; { const PBOFrameAllocator::Userdata *userdata = (const PBOFrameAllocator::Userdata *)first_frame.frame->userdata; width = userdata->last_width[first_frame.field_number]; height = userdata->last_height[first_frame.field_number]; if (userdata->last_interlaced) { height *= 2; } } movit::YCbCrLumaCoefficients ycbcr_coefficients = input_state.ycbcr_coefficients[card_idx]; bool full_range = input_state.full_range[card_idx]; if (input_state.ycbcr_coefficients_auto[card_idx]) { full_range = false; // The Blackmagic driver docs claim that the device outputs Y'CbCr // according to Rec. 601, but this seems to indicate the subsampling // positions only, as they publish Y'CbCr → RGB formulas that are // different for HD and SD (corresponding to Rec. 709 and 601, respectively), // and a Lenovo X1 gen 3 I used to test definitely outputs Rec. 709 // (at least up to rounding error). Other devices seem to use Rec. 601 // even on HD resolutions. Nevertheless, Rec. 709 _is_ the right choice // for HD, so we default to that if the user hasn't set anything. if (height >= 720) { ycbcr_coefficients = YCBCR_REC_709; } else { ycbcr_coefficients = YCBCR_REC_601; } } // This is a global, but it doesn't really matter. input_ycbcr_format.luma_coefficients = ycbcr_coefficients; input_ycbcr_format.full_range = full_range; BufferedFrame last_good_frame = first_frame; for (unsigned i = 0; i < max(ycbcr_inputs.size(), rgba_inputs.size()); ++i) { BufferedFrame frame = input_state.buffered_frames[card_idx][i]; if (frame.frame == nullptr) { // Not enough data; reuse last frame (well, field). // This is suboptimal, but we have nothing better. frame = last_good_frame; } const PBOFrameAllocator::Userdata *userdata = (const PBOFrameAllocator::Userdata *)frame.frame->userdata; unsigned this_width = userdata->last_width[frame.field_number]; unsigned this_height = userdata->last_height[frame.field_number]; if (this_width != width || this_height != height) { // Resolution changed; reuse last frame/field. frame = last_good_frame; userdata = (const PBOFrameAllocator::Userdata *)frame.frame->userdata; } assert(userdata->pixel_format == pixel_format); switch (pixel_format) { case bmusb::PixelFormat_8BitYCbCr: ycbcr_inputs[i]->set_texture_num(0, userdata->tex_y[frame.field_number]); ycbcr_inputs[i]->set_texture_num(1, userdata->tex_cbcr[frame.field_number]); ycbcr_inputs[i]->change_ycbcr_format(input_ycbcr_format); ycbcr_inputs[i]->set_width(width); ycbcr_inputs[i]->set_height(height); break; case bmusb::PixelFormat_8BitYCbCrPlanar: ycbcr_inputs[i]->set_texture_num(0, userdata->tex_y[frame.field_number]); ycbcr_inputs[i]->set_texture_num(1, userdata->tex_cb[frame.field_number]); ycbcr_inputs[i]->set_texture_num(2, userdata->tex_cr[frame.field_number]); // YCbCrPlanar is used for video streams, where we can have metadata from the mux. // Prefer that if there's no override. (Overrides are only available when using // video as SRT cards.) if (input_state.ycbcr_coefficients_auto[card_idx]) { ycbcr_inputs[i]->change_ycbcr_format(userdata->ycbcr_format); } else { ycbcr_inputs[i]->change_ycbcr_format(input_ycbcr_format); } ycbcr_inputs[i]->set_width(width); ycbcr_inputs[i]->set_height(height); break; case bmusb::PixelFormat_10BitYCbCr: ycbcr_inputs[i]->set_texture_num(0, userdata->tex_444[frame.field_number]); ycbcr_inputs[i]->change_ycbcr_format(input_ycbcr_format); ycbcr_inputs[i]->set_width(width); ycbcr_inputs[i]->set_height(height); break; case bmusb::PixelFormat_8BitBGRA: rgba_inputs[i]->set_texture_num(userdata->tex_rgba[frame.field_number]); rgba_inputs[i]->set_width(width); rgba_inputs[i]->set_height(height); break; default: assert(false); } last_good_frame = frame; } if (deinterlace) { BufferedFrame frame = input_state.buffered_frames[card_idx][0]; CHECK(deinterlace_effect->set_int("current_field_position", frame.field_number)); } } namespace { int call_num_channels(lua_State *L) { lua_getglobal(L, "num_channels"); if (lua_pcall(L, 0, 1, 0) != 0) { fprintf(stderr, "error running function `num_channels': %s\n", lua_tostring(L, -1)); fprintf(stderr, "Try Nageru.set_num_channels(...) at the start of the script instead.\n"); abort(); } int num_channels = luaL_checknumber(L, 1); lua_pop(L, 1); assert(lua_gettop(L) == 0); return num_channels; } } // namespace int Nageru_set_channel_name(lua_State *L) { // NOTE: m is already locked. Theme *theme = get_theme_updata(L); unsigned channel = luaL_checknumber(L, 1); const string text = checkstdstring(L, 2); theme->channel_names[channel] = text; lua_pop(L, 2); return 0; } int Nageru_set_num_channels(lua_State *L) { // NOTE: m is already locked. Theme *theme = get_theme_updata(L); if (theme->startup_finished) { luaL_error(L, "set_num_channels() can only be called at startup."); } theme->num_channels = luaL_checknumber(L, 1); lua_pop(L, 1); return 0; } int Nageru_set_channel_signal(lua_State *L) { // NOTE: m is already locked. Theme *theme = get_theme_updata(L); if (theme->startup_finished) { luaL_error(L, "set_channel_signal() can only be called at startup."); } unsigned channel = luaL_checknumber(L, 1); int signal = luaL_checknumber(L, 2); theme->channel_signals[channel] = signal; lua_pop(L, 2); return 0; } int Nageru_set_supports_wb(lua_State *L) { // NOTE: m is already locked. Theme *theme = get_theme_updata(L); if (theme->startup_finished) { luaL_error(L, "set_supports_wb() can only be called at startup."); } unsigned channel = luaL_checknumber(L, 1); bool supports_wb = checkbool(L, 2); theme->channel_supports_wb[channel] = supports_wb; lua_pop(L, 2); return 0; } // NOTE: There's a race condition in all of the audio functions; if the mapping // is changed by the user underway, you might not be manipulating the bus you // expect. (You should not get crashes, though.) There's not all that much we // can do about it, short of locking the entire mixer while anything from the // theme runs. int Nageru_get_num_audio_buses(lua_State *L) { if (global_audio_mixer == nullptr) { // The audio mixer isn't set up until we know how many FFmpeg inputs we have. luaL_error(L, "Audio functions can not be called before the theme is done initializing."); } lua_pushinteger(L, global_audio_mixer->num_buses()); return 1; } int Nageru_get_audio_bus_name(lua_State *L) { if (global_audio_mixer == nullptr) { // The audio mixer isn't set up until we know how many FFmpeg inputs we have. luaL_error(L, "Audio functions can not be called before the theme is done initializing."); } int bus_index = luaL_checknumber(L, 1); InputMapping input_mapping = global_audio_mixer->get_input_mapping(); if (bus_index < 0 || size_t(bus_index) >= input_mapping.buses.size()) { // Doesn't fix the race, but fixes other out-of-bounds. print_warning(L, "Theme called get_audio_bus_name() on nonexistent bus %d; returning nil.\n", bus_index); lua_pushnil(L); } else { lua_pushstring(L, input_mapping.buses[bus_index].name.c_str()); } return 1; } int Nageru_get_audio_bus_fader_level_db(lua_State *L) { if (global_audio_mixer == nullptr) { // The audio mixer isn't set up until we know how many FFmpeg inputs we have. luaL_error(L, "Audio functions can not be called before the theme is done initializing."); } int bus_index = luaL_checknumber(L, 1); if (bus_index < 0 || size_t(bus_index) >= global_audio_mixer->num_buses()) { // Doesn't fix the race, but fixes other out-of-bounds. print_warning(L, "Theme called get_audio_bus_fader_level_db() on nonexistent bus %d; returning 0.0.\n", bus_index); lua_pushnumber(L, 0.0); } else { lua_pushnumber(L, global_audio_mixer->get_fader_volume(bus_index)); } return 1; } int Nageru_set_audio_bus_fader_level_db(lua_State *L) { if (global_audio_mixer == nullptr || global_mainwindow == nullptr) { // The audio mixer isn't set up until we know how many FFmpeg inputs we have. luaL_error(L, "Audio functions can not be called before the theme is done initializing."); } int bus_index = luaL_checknumber(L, 1); if (bus_index < 0 || size_t(bus_index) >= global_audio_mixer->num_buses()) { // Doesn't fix the race, but fixes other out-of-bounds. print_warning(L, "Theme called set_audio_bus_fader_level_db() on nonexistent bus %d; ignoring.\n", bus_index); return 0; } double level_db = luaL_checknumber(L, 2); // Go through the UI, so that it gets updated. global_mainwindow->set_fader_absolute(bus_index, level_db); return 0; } int Nageru_get_audio_bus_mute(lua_State *L) { if (global_audio_mixer == nullptr) { // The audio mixer isn't set up until we know how many FFmpeg inputs we have. luaL_error(L, "Audio functions can not be called before the theme is done initializing."); } int bus_index = luaL_checknumber(L, 1); if (bus_index < 0 || size_t(bus_index) >= global_audio_mixer->num_buses()) { // Doesn't fix the race, but fixes other out-of-bounds. print_warning(L, "Theme called get_audio_bus_mute() on nonexistent bus %d; returning false.\n", bus_index); lua_pushboolean(L, false); } else { lua_pushboolean(L, global_audio_mixer->get_mute(bus_index)); } return 1; } int Nageru_set_audio_bus_mute(lua_State *L) { if (global_audio_mixer == nullptr || global_mainwindow == nullptr) { // The audio mixer isn't set up until we know how many FFmpeg inputs we have. luaL_error(L, "Audio functions can not be called before the theme is done initializing."); } int bus_index = luaL_checknumber(L, 1); if (bus_index < 0 || size_t(bus_index) >= global_audio_mixer->num_buses()) { // Doesn't fix the race, but fixes other out-of-bounds. print_warning(L, "Theme called set_audio_bus_mute() on nonexistent bus %d; ignoring.\n", bus_index); return 0; } bool mute = checkbool(L, 2); // Go through the UI, so that it gets updated. if (mute != global_audio_mixer->get_mute(bus_index)) { global_mainwindow->toggle_mute(bus_index); } return 0; } int Nageru_get_audio_bus_eq_level_db(lua_State *L) { if (global_audio_mixer == nullptr) { // The audio mixer isn't set up until we know how many FFmpeg inputs we have. luaL_error(L, "Audio functions can not be called before the theme is done initializing."); } int bus_index = luaL_checknumber(L, 1); int band = luaL_checknumber(L, 2); if (bus_index < 0 || size_t(bus_index) >= global_audio_mixer->num_buses()) { // Doesn't fix the race, but fixes other out-of-bounds. print_warning(L, "Theme called get_audio_bus_eq_level_db() on nonexistent bus %d; returning 0.0.\n", bus_index); lua_pushnumber(L, 0.0); } else if (band != EQ_BAND_BASS && band != EQ_BAND_MID && band != EQ_BAND_TREBLE) { print_warning(L, "Theme called get_audio_bus_eq_level_db() on nonexistent band; returning 0.0.\n", bus_index); lua_pushnumber(L, 0.0); } else { lua_pushnumber(L, global_audio_mixer->get_eq(bus_index, EQBand(band))); } return 1; } int Nageru_set_audio_bus_eq_level_db(lua_State *L) { if (global_audio_mixer == nullptr || global_mainwindow == nullptr) { // The audio mixer isn't set up until we know how many FFmpeg inputs we have. luaL_error(L, "Audio functions can not be called before the theme is done initializing."); } int bus_index = luaL_checknumber(L, 1); int band = luaL_checknumber(L, 2); if (bus_index < 0 || size_t(bus_index) >= global_audio_mixer->num_buses()) { // Doesn't fix the race, but fixes other out-of-bounds. print_warning(L, "Theme called set_audio_bus_eq_level_db() on nonexistent bus %d; ignoring.\n", bus_index); return 0; } else if (band != EQ_BAND_BASS && band != EQ_BAND_MID && band != EQ_BAND_TREBLE) { print_warning(L, "Theme called set_audio_bus_eq_level_db() on nonexistent band; returning 0.0.\n", bus_index); return 0; } double level_db = luaL_checknumber(L, 3); // Go through the UI, so that it gets updated. global_mainwindow->set_eq_absolute(bus_index, EQBand(band), level_db); return 0; } Theme::Theme(const string &filename, const vector &search_dirs, ResourcePool *resource_pool) : resource_pool(resource_pool), signal_to_card_mapping(global_flags.default_stream_mapping) { // Defaults. channel_names[0] = "Live"; channel_names[1] = "Preview"; L = luaL_newstate(); luaL_openlibs(L); // Search through all directories until we find a file that will load // (as in, does not return LUA_ERRFILE); then run it. We store load errors // from all the attempts, and show them once we know we can't find any of them. lua_settop(L, 0); vector errors; bool success = false; vector real_search_dirs; if (!filename.empty() && filename[0] == '/') { real_search_dirs.push_back(""); } else { real_search_dirs = search_dirs; } string path; int theme_code_ref; for (const string &dir : real_search_dirs) { if (dir.empty()) { path = filename; } else { path = dir + "/" + filename; } int err = luaL_loadfile(L, path.c_str()); if (err == 0) { // Save the theme for when we're actually going to run it // (we need to set up the right environment below first, // and we couldn't do that before, because we didn't know the // path to put in Nageru.THEME_PATH). theme_code_ref = luaL_ref(L, LUA_REGISTRYINDEX); assert(lua_gettop(L) == 0); success = true; break; } errors.push_back(lua_tostring(L, -1)); lua_pop(L, 1); if (err != LUA_ERRFILE) { // The file actually loaded, but failed to parse somehow. Abort; don't try the next one. break; } } if (!success) { for (const string &error : errors) { fprintf(stderr, "%s\n", error.c_str()); } abort(); } assert(lua_gettop(L) == 0); // Make sure the path exposed to the theme (as Nageru.THEME_PATH; // can be useful for locating files when talking to CEF) is absolute. // In a sense, it would be nice if realpath() had a mode not to // resolve symlinks, but it doesn't, so we only call it if we don't // already have an absolute path (which may leave ../ elements etc.). if (path[0] == '/') { theme_path = path; } else { char *absolute_theme_path = realpath(path.c_str(), nullptr); theme_path = absolute_theme_path; free(absolute_theme_path); } // Set up the API we provide. register_globals(); register_class("Scene", Scene_funcs); register_class("Block", Block_funcs); register_class("EffectBlueprint", EffectBlueprint_funcs); register_class("EffectChain", EffectChain_funcs); register_class("LiveInputWrapper", LiveInputWrapper_funcs); register_class("ImageInput", ImageInput_funcs); register_class("VideoInput", VideoInput_funcs); register_class("HTMLInput", HTMLInput_funcs); register_class("IdentityEffect", IdentityEffect_funcs, IDENTITY_EFFECT); register_class("WhiteBalanceEffect", WhiteBalanceEffect_funcs, WHITE_BALANCE_EFFECT); register_class("ResampleEffect", ResampleEffect_funcs, RESAMPLE_EFFECT); register_class("PaddingEffect", PaddingEffect_funcs, PADDING_EFFECT); register_class("IntegralPaddingEffect", IntegralPaddingEffect_funcs, INTEGRAL_PADDING_EFFECT); register_class("OverlayEffect", OverlayEffect_funcs, OVERLAY_EFFECT); register_class("ResizeEffect", ResizeEffect_funcs, RESIZE_EFFECT); register_class("MultiplyEffect", MultiplyEffect_funcs, MULTIPLY_EFFECT); register_class("MixEffect", MixEffect_funcs, MIX_EFFECT); register_class("BlurEffect", BlurEffect_funcs, BLUR_EFFECT); register_class("UnsharpMaskEffect", UnsharpMaskEffect_funcs, UNSHARP_MASK_EFFECT); register_class("LiftGammaGainEffect", LiftGammaGainEffect_funcs, LIFT_GAMMA_GAIN_EFFECT); register_class("InputStateInfo", InputStateInfo_funcs); register_class("ThemeMenu", ThemeMenu_funcs); // Now actually run the theme to get everything set up. lua_rawgeti(L, LUA_REGISTRYINDEX, theme_code_ref); luaL_unref(L, LUA_REGISTRYINDEX, theme_code_ref); if (lua_pcall(L, 0, 0, 0)) { fprintf(stderr, "Error when running %s: %s\n", path.c_str(), lua_tostring(L, -1)); abort(); } assert(lua_gettop(L) == 0); if (num_channels == -1) { // Ask it for the number of channels. num_channels = call_num_channels(L); } startup_finished = true; } Theme::~Theme() { theme_menu.reset(); lua_close(L); } void Theme::register_globals() { // Set Nageru.VIDEO_FORMAT_BGRA = bmusb::PixelFormat_8BitBGRA, etc. const vector> num_constants = { { "VIDEO_FORMAT_BGRA", bmusb::PixelFormat_8BitBGRA }, { "VIDEO_FORMAT_YCBCR", bmusb::PixelFormat_8BitYCbCrPlanar }, { "CHECKABLE", MenuEntry::CHECKABLE }, { "CHECKED", MenuEntry::CHECKED }, { "EQ_BAND_BASS", EQ_BAND_BASS }, { "EQ_BAND_MID", EQ_BAND_MID }, { "EQ_BAND_TREBLE", EQ_BAND_TREBLE }, }; const vector> str_constants = { { "THEME_PATH", theme_path }, }; lua_newtable(L); // t = {} for (const pair &constant : num_constants) { lua_pushstring(L, constant.first.c_str()); lua_pushinteger(L, constant.second); lua_settable(L, 1); // t[key] = value } for (const pair &constant : str_constants) { lua_pushstring(L, constant.first.c_str()); lua_pushstring(L, constant.second.c_str()); lua_settable(L, 1); // t[key] = value } const luaL_Reg Nageru_funcs[] = { // Channel information. { "set_channel_name", Nageru_set_channel_name }, { "set_num_channels", Nageru_set_num_channels }, { "set_channel_signal", Nageru_set_channel_signal }, { "set_supports_wb", Nageru_set_supports_wb }, // Audio. { "get_num_audio_buses", Nageru_get_num_audio_buses }, { "get_audio_bus_name", Nageru_get_audio_bus_name }, { "get_audio_bus_fader_level_db", Nageru_get_audio_bus_fader_level_db }, { "set_audio_bus_fader_level_db", Nageru_set_audio_bus_fader_level_db }, { "get_audio_bus_eq_level_db", Nageru_get_audio_bus_eq_level_db }, { "set_audio_bus_eq_level_db", Nageru_set_audio_bus_eq_level_db }, { "get_audio_bus_mute", Nageru_get_audio_bus_mute }, { "set_audio_bus_mute", Nageru_set_audio_bus_mute }, { nullptr, nullptr } }; lua_pushlightuserdata(L, this); luaL_setfuncs(L, Nageru_funcs, 1); // for (name,f in funcs) { mt[name] = f, with upvalue {theme} } lua_setglobal(L, "Nageru"); // Nageru = t assert(lua_gettop(L) == 0); } void Theme::register_class(const char *class_name, const luaL_Reg *funcs, EffectType effect_type) { assert(lua_gettop(L) == 0); luaL_newmetatable(L, class_name); // mt = {} lua_pushlightuserdata(L, this); luaL_setfuncs(L, funcs, 1); // for (name,f in funcs) { mt[name] = f, with upvalue {theme} } lua_pushvalue(L, -1); lua_setfield(L, -2, "__index"); // mt.__index = mt if (effect_type != NO_EFFECT_TYPE) { lua_pushnumber(L, effect_type); lua_setfield(L, -2, "__effect_type_id"); // mt.__effect_type_id = effect_type } lua_setglobal(L, class_name); // ClassName = mt assert(lua_gettop(L) == 0); } Theme::Chain Theme::get_chain_from_effect_chain(EffectChain *effect_chain, unsigned num, const InputState &input_state) { if (!lua_isfunction(L, -1)) { fprintf(stderr, "Argument #-1 should be a function\n"); abort(); } lua_pushvalue(L, -1); shared_ptr funcref(new LuaRefWithDeleter(&m, L, luaL_ref(L, LUA_REGISTRYINDEX))); lua_pop(L, 2); Chain chain; chain.chain = effect_chain; chain.setup_chain = [this, funcref, input_state, effect_chain]{ lock_guard lock(m); assert(this->input_state == nullptr); this->input_state = &input_state; // Set up state, including connecting signals. lua_rawgeti(L, LUA_REGISTRYINDEX, funcref->get()); if (lua_pcall(L, 0, 0, 0) != 0) { fprintf(stderr, "error running chain setup callback: %s\n", lua_tostring(L, -1)); abort(); } assert(lua_gettop(L) == 0); // The theme can't (or at least shouldn't!) call connect_signal() on // each FFmpeg or CEF input, so we'll do it here. if (video_signal_connections.count(effect_chain)) { for (const VideoSignalConnection &conn : video_signal_connections[effect_chain]) { conn.wrapper->connect_card(conn.source->get_card_index(), input_state); } } #ifdef HAVE_CEF if (html_signal_connections.count(effect_chain)) { for (const CEFSignalConnection &conn : html_signal_connections[effect_chain]) { conn.wrapper->connect_card(conn.source->get_card_index(), input_state); } } #endif this->input_state = nullptr; }; return chain; } Theme::Chain Theme::get_chain(unsigned num, float t, unsigned width, unsigned height, const InputState &input_state) { const char *func_name = "get_scene"; // For error reporting. Chain chain; lock_guard lock(m); assert(lua_gettop(L) == 0); lua_getglobal(L, "get_scene"); /* function to be called */ if (lua_isnil(L, -1)) { // Try the pre-1.9.0 name for compatibility. lua_pop(L, 1); lua_getglobal(L, "get_chain"); func_name = "get_chain"; } lua_pushnumber(L, num); lua_pushnumber(L, t); lua_pushnumber(L, width); lua_pushnumber(L, height); wrap_lua_object(L, "InputStateInfo", input_state); if (lua_pcall(L, 5, LUA_MULTRET, 0) != 0) { fprintf(stderr, "error running function “%s”: %s\n", func_name, lua_tostring(L, -1)); abort(); } if (luaL_testudata(L, -1, "Scene") != nullptr) { if (lua_gettop(L) != 1) { luaL_error(L, "%s() for chain number %d returned an Scene, but also other items", func_name); } Scene *auto_effect_chain = (Scene *)luaL_testudata(L, -1, "Scene"); auto chain_and_setup = auto_effect_chain->get_chain(this, L, num, input_state); chain.chain = chain_and_setup.first; chain.setup_chain = move(chain_and_setup.second); } else if (luaL_testudata(L, -2, "EffectChain") != nullptr) { // Old-style (pre-Nageru 1.9.0) return of a single chain and prepare function. if (lua_gettop(L) != 2) { luaL_error(L, "%s() for chain number %d returned an EffectChain, but needs to also return a prepare function (or use Scene)", func_name); } EffectChain *effect_chain = (EffectChain *)luaL_testudata(L, -2, "EffectChain"); chain = get_chain_from_effect_chain(effect_chain, num, input_state); } else { luaL_error(L, "%s() for chain number %d did not return an EffectChain or Scene\n", func_name, num); } assert(lua_gettop(L) == 0); // TODO: Can we do better, e.g. by running setup_chain() and seeing what it references? // Actually, setup_chain does maybe hold all the references we need now anyway? chain.input_frames.reserve(MAX_VIDEO_CARDS * FRAME_HISTORY_LENGTH); for (unsigned card_index = 0; card_index < MAX_VIDEO_CARDS; ++card_index) { for (unsigned frame_num = 0; frame_num < FRAME_HISTORY_LENGTH; ++frame_num) { chain.input_frames.push_back(input_state.buffered_frames[card_index][frame_num].frame); } } return chain; } string Theme::get_channel_name(unsigned channel) { lock_guard lock(m); // We never ask the legacy channel_name() about live and preview. // The defaults are set in our constructor. if (channel == 0 || channel == 1) { return channel_names[channel]; } lua_getglobal(L, "channel_name"); if (lua_isnil(L, -1)) { lua_pop(L, 1); if (channel_names.count(channel)) { return channel_names[channel]; } else { return "(no title)"; } } lua_pushnumber(L, channel); if (lua_pcall(L, 1, 1, 0) != 0) { fprintf(stderr, "error running function `channel_name': %s\n", lua_tostring(L, -1)); abort(); } const char *ret = lua_tostring(L, -1); if (ret == nullptr) { fprintf(stderr, "function `channel_name' returned nil for channel %d\n", channel); fprintf(stderr, "Try Nageru.set_channel_name(channel, name) at the start of the script instead.\n"); abort(); } string retstr = ret; lua_pop(L, 1); assert(lua_gettop(L) == 0); return retstr; } int Theme::map_channel_to_signal(unsigned channel) { lock_guard lock(m); lua_getglobal(L, "channel_signal"); if (lua_isnil(L, -1)) { lua_pop(L, 1); if (channel_signals.count(channel)) { return channel_signals[channel]; } else { return -1; } } lua_pushnumber(L, channel); if (lua_pcall(L, 1, 1, 0) != 0) { fprintf(stderr, "error running function `channel_signal': %s\n", lua_tostring(L, -1)); fprintf(stderr, "Try Nageru.set_channel_signal(channel, signal) at the start of the script instead.\n"); abort(); } int ret = luaL_checknumber(L, 1); lua_pop(L, 1); assert(lua_gettop(L) == 0); return ret; } std::string Theme::get_channel_color(unsigned channel) { lock_guard lock(m); lua_getglobal(L, "channel_color"); lua_pushnumber(L, channel); if (lua_pcall(L, 1, 1, 0) != 0) { fprintf(stderr, "error running function `channel_color': %s\n", lua_tostring(L, -1)); abort(); } const char *ret = lua_tostring(L, -1); if (ret == nullptr) { fprintf(stderr, "function `channel_color' returned nil for channel %d\n", channel); abort(); } string retstr = ret; lua_pop(L, 1); assert(lua_gettop(L) == 0); return retstr; } bool Theme::get_supports_set_wb(unsigned channel) { lock_guard lock(m); lua_getglobal(L, "supports_set_wb"); if (lua_isnil(L, -1)) { lua_pop(L, 1); if (channel_supports_wb.count(channel)) { return channel_supports_wb[channel]; } else { return false; } } lua_pushnumber(L, channel); if (lua_pcall(L, 1, 1, 0) != 0) { fprintf(stderr, "error running function `supports_set_wb': %s\n", lua_tostring(L, -1)); fprintf(stderr, "Try Nageru.set_supports_wb(channel, bool) at the start of the script instead.\n"); abort(); } bool ret = checkbool(L, -1); lua_pop(L, 1); assert(lua_gettop(L) == 0); return ret; } void Theme::set_wb(unsigned channel, float r, float g, float b) { int signal = map_channel_to_signal(channel); lock_guard lock(m); if (signal != -1) { int card_idx = map_signal_to_card(signal); white_balance_for_card[card_idx] = RGBTriplet{ r, g, b }; } call_lua_wb_callback(channel, r, g, b); } void Theme::set_wb_for_card(int card_idx, float r, float g, float b) { lock_guard lock(m); white_balance_for_card[card_idx] = RGBTriplet{ r, g, b }; for (const auto &channel_and_signal : channel_signals) { if (map_signal_to_card(channel_and_signal.second) == card_idx) { call_lua_wb_callback(channel_and_signal.first, r, g, b); } } } void Theme::call_lua_wb_callback(unsigned channel, float r, float g, float b) { lua_getglobal(L, "set_wb"); if (lua_isnil(L, -1)) { // The function doesn't exist, to just ignore. We've stored the white balance, // and most likely, it will be picked up by auto white balance instead. lua_pop(L, 1); return; } lua_pushnumber(L, channel); lua_pushnumber(L, r); lua_pushnumber(L, g); lua_pushnumber(L, b); if (lua_pcall(L, 4, 0, 0) != 0) { fprintf(stderr, "error running function `set_wb': %s\n", lua_tostring(L, -1)); abort(); } assert(lua_gettop(L) == 0); } RGBTriplet Theme::get_white_balance_for_card(int card_idx) { if (white_balance_for_card.count(card_idx)) { return white_balance_for_card[card_idx]; } else { return RGBTriplet{ 1.0, 1.0, 1.0 }; } } vector Theme::get_transition_names(float t) { lock_guard lock(m); lua_getglobal(L, "get_transitions"); lua_pushnumber(L, t); if (lua_pcall(L, 1, 1, 0) != 0) { fprintf(stderr, "error running function `get_transitions': %s\n", lua_tostring(L, -1)); abort(); } vector ret; lua_pushnil(L); while (lua_next(L, -2) != 0) { ret.push_back(lua_tostring(L, -1)); lua_pop(L, 1); } lua_pop(L, 1); assert(lua_gettop(L) == 0); return ret; } int Theme::map_signal_to_card(int signal_num) { // Negative numbers map to raw signals. if (signal_num < 0) { return -1 - signal_num; } lock_guard lock(map_m); if (signal_to_card_mapping.count(signal_num)) { return signal_to_card_mapping[signal_num]; } int card_index; if (global_flags.output_card != -1) { // Try to exclude the output card from the default card_index. card_index = signal_num % (global_flags.max_num_cards - 1); if (card_index >= global_flags.output_card) { ++card_index; } if (signal_num >= int(global_flags.max_num_cards - 1)) { print_warning(L, "Theme asked for input %d, but we only have %u input card(s) (card %d is busy with output).\n", signal_num, global_flags.max_num_cards - 1, global_flags.output_card); fprintf(stderr, "Mapping to card %d instead.\n", card_index); } } else { card_index = signal_num % global_flags.max_num_cards; if (signal_num >= int(global_flags.max_num_cards)) { print_warning(L, "Theme asked for input %d, but we only have %u card(s).\n", signal_num, global_flags.max_num_cards); fprintf(stderr, "Mapping to card %d instead.\n", card_index); } } global_mixer->force_card_active(card_index); signal_to_card_mapping[signal_num] = card_index; return card_index; } void Theme::set_signal_mapping(int signal_num, int card_idx) { lock_guard lock(map_m); assert(card_idx < MAX_VIDEO_CARDS); signal_to_card_mapping[signal_num] = card_idx; } void Theme::transition_clicked(int transition_num, float t) { lock_guard lock(m); lua_getglobal(L, "transition_clicked"); lua_pushnumber(L, transition_num); lua_pushnumber(L, t); if (lua_pcall(L, 2, 0, 0) != 0) { fprintf(stderr, "error running function `transition_clicked': %s\n", lua_tostring(L, -1)); abort(); } assert(lua_gettop(L) == 0); } void Theme::channel_clicked(int preview_num) { lock_guard lock(m); lua_getglobal(L, "channel_clicked"); lua_pushnumber(L, preview_num); if (lua_pcall(L, 1, 0, 0) != 0) { fprintf(stderr, "error running function `channel_clicked': %s\n", lua_tostring(L, -1)); abort(); } assert(lua_gettop(L) == 0); } template void destroy(T &ref) { ref.~T(); } Theme::MenuEntry::~MenuEntry() { if (is_submenu) { destroy(submenu); } else { luaL_unref(entry.L, LUA_REGISTRYINDEX, entry.lua_ref); } } namespace { vector> create_recursive_theme_menu(lua_State *L); unique_ptr create_theme_menu_entry(lua_State *L, int index) { unique_ptr entry; lua_rawgeti(L, index, 1); const string text = checkstdstring(L, -1); lua_pop(L, 1); unsigned flags = 0; if (lua_objlen(L, index) > 2) { lua_rawgeti(L, index, 3); flags = luaL_checknumber(L, -1); lua_pop(L, 1); } lua_rawgeti(L, index, 2); if (lua_istable(L, -1)) { vector> submenu = create_recursive_theme_menu(L); entry.reset(new Theme::MenuEntry{ text, move(submenu) }); lua_pop(L, 1); } else { luaL_checktype(L, -1, LUA_TFUNCTION); int ref = luaL_ref(L, LUA_REGISTRYINDEX); entry.reset(new Theme::MenuEntry{ text, L, ref, flags }); } return entry; } vector> create_recursive_theme_menu(lua_State *L) { vector> menu; size_t num_elements = lua_objlen(L, -1); for (size_t i = 1; i <= num_elements; ++i) { lua_rawgeti(L, -1, i); menu.emplace_back(create_theme_menu_entry(L, -1)); lua_pop(L, 1); } return menu; } } // namespace int Theme::set_theme_menu(lua_State *L) { theme_menu.reset(); vector> root_menu; int num_elements = lua_gettop(L); for (int i = 1; i <= num_elements; ++i) { root_menu.emplace_back(create_theme_menu_entry(L, i)); } theme_menu.reset(new MenuEntry("", move(root_menu))); lua_pop(L, num_elements); assert(lua_gettop(L) == 0); if (theme_menu_callback != nullptr) { theme_menu_callback(); } return 0; } void Theme::theme_menu_entry_clicked(int lua_ref) { lock_guard lock(m); lua_rawgeti(L, LUA_REGISTRYINDEX, lua_ref); if (lua_pcall(L, 0, 0, 0) != 0) { fprintf(stderr, "error running menu callback: %s\n", lua_tostring(L, -1)); abort(); } } string Theme::format_status_line(const string &disk_space_left_text, double file_length_seconds) { lock_guard lock(m); lua_getglobal(L, "format_status_line"); if (lua_isnil(L, -1)) { lua_pop(L, 1); return disk_space_left_text; } lua_pushstring(L, disk_space_left_text.c_str()); lua_pushnumber(L, file_length_seconds); if (lua_pcall(L, 2, 1, 0) != 0) { fprintf(stderr, "error running function format_status_line(): %s\n", lua_tostring(L, -1)); abort(); } string text = checkstdstring(L, 1); lua_pop(L, 1); assert(lua_gettop(L) == 0); return text; } void Theme::remove_card(unsigned card_index) { lock_guard lock(map_m); for (auto it = signal_to_card_mapping.begin(); it != signal_to_card_mapping.end(); ) { if (it->second == int(card_index)) { it = signal_to_card_mapping.erase(it); } else { ++it; } } } nageru-2.3.0/nageru/theme.h000066400000000000000000000233661450736322200155470ustar00rootroot00000000000000#ifndef _THEME_H #define _THEME_H 1 #include #include #include #include #include #include #include #include #include #include #include #include "bmusb/bmusb.h" #include "defs.h" #include "ref_counted_frame.h" #include "tweaked_inputs.h" class Scene; class CEFCapture; class FFmpegCapture; class LiveInputWrapper; struct InputState; namespace movit { class Effect; class EffectChain; class ResourcePool; } // namespace movit enum EffectType { // LIVE_INPUT_* also covers CEF and video inputs. LIVE_INPUT_YCBCR, LIVE_INPUT_YCBCR_WITH_DEINTERLACE, LIVE_INPUT_YCBCR_PLANAR, LIVE_INPUT_BGRA, IMAGE_INPUT, IDENTITY_EFFECT, WHITE_BALANCE_EFFECT, AUTO_WHITE_BALANCE_EFFECT, // Same as WHITE_BALANCE_EFFECT, but sets its value automatically. RESAMPLE_EFFECT, PADDING_EFFECT, INTEGRAL_PADDING_EFFECT, OVERLAY_EFFECT, RESIZE_EFFECT, MULTIPLY_EFFECT, MIX_EFFECT, LIFT_GAMMA_GAIN_EFFECT, BLUR_EFFECT, UNSHARP_MASK_EFFECT, NO_EFFECT_TYPE }; // An EffectBlueprint refers to an Effect before it's being added to the graph. // It contains enough information to instantiate the effect, including any // parameters that were set before it was added to the graph. Once it is // instantiated, it forwards its calls on to the real Effect instead. struct EffectBlueprint { EffectBlueprint(EffectType effect_type) : effect_type(effect_type) {} EffectType effect_type; std::map int_parameters; std::map float_parameters; std::map> vec3_parameters; std::map> vec4_parameters; movit::Effect *effect = nullptr; // Gets filled out when it's instantiated. }; // Contains basically the same data as InputState, but does not hold on to // a reference to the frames. This is important so that we can release them // without having to wait for Lua's GC. struct InputStateInfo { explicit InputStateInfo(const InputState& input_state); unsigned last_width[MAX_VIDEO_CARDS], last_height[MAX_VIDEO_CARDS]; bool last_interlaced[MAX_VIDEO_CARDS], last_has_signal[MAX_VIDEO_CARDS], last_is_connected[MAX_VIDEO_CARDS]; unsigned last_frame_rate_nom[MAX_VIDEO_CARDS], last_frame_rate_den[MAX_VIDEO_CARDS]; bmusb::PixelFormat last_pixel_format[MAX_VIDEO_CARDS]; bool has_last_subtitle[MAX_VIDEO_CARDS]; std::string last_subtitle[MAX_VIDEO_CARDS]; }; class Theme { public: Theme(const std::string &filename, const std::vector &search_dirs, movit::ResourcePool *resource_pool); ~Theme(); struct Chain { movit::EffectChain *chain; std::function setup_chain; // FRAME_HISTORY frames for each input, in order. Will contain duplicates // for non-interlaced inputs. std::vector input_frames; }; Chain get_chain(unsigned num, float t, unsigned width, unsigned height, const InputState &input_state); int get_num_channels() const { return num_channels; } int map_signal_to_card(int signal_num); void set_signal_mapping(int signal_num, int card_idx); std::string get_channel_name(unsigned channel); int map_channel_to_signal(unsigned channel); bool get_supports_set_wb(unsigned channel); void set_wb(unsigned channel, float r, float g, float b); void set_wb_for_card(int card_idx, float r, float g, float b); movit::RGBTriplet get_white_balance_for_card(int card_idx); std::string get_channel_color(unsigned channel); std::unordered_map white_balance_for_card; std::vector get_transition_names(float t); void transition_clicked(int transition_num, float t); void channel_clicked(int preview_num); movit::ResourcePool *get_resource_pool() const { return resource_pool; } // Should be called as part of VideoInput.new() only. void register_video_input(FFmpegCapture *capture) { video_inputs.push_back(capture); } std::vector get_video_inputs() const { return video_inputs; } #ifdef HAVE_CEF // Should be called as part of HTMLInput.new() only. void register_html_input(CEFCapture *capture) { html_inputs.push_back(capture); } std::vector get_html_inputs() const { return html_inputs; } #endif void register_video_signal_connection(movit::EffectChain *chain, LiveInputWrapper *live_input, FFmpegCapture *capture) { video_signal_connections[chain].emplace_back(VideoSignalConnection { live_input, capture }); } #ifdef HAVE_CEF void register_html_signal_connection(movit::EffectChain *chain, LiveInputWrapper *live_input, CEFCapture *capture) { html_signal_connections[chain].emplace_back(CEFSignalConnection { live_input, capture }); } #endif struct MenuEntry { MenuEntry(const std::string &text, lua_State *L, int lua_ref, unsigned flags) : text(text), is_submenu(false), entry{L, lua_ref, flags} {} MenuEntry(const std::string &text, std::vector> submenu) : text(text), is_submenu(true), submenu(std::move(submenu)) {} ~MenuEntry(); static constexpr unsigned CHECKABLE = 1; static constexpr unsigned CHECKED = 2; std::string text; bool is_submenu; union { // is_submenu = false. struct { lua_State *L; int lua_ref; unsigned flags; } entry; // is_submenu = true. std::vector> submenu; }; }; MenuEntry *get_theme_menu() { return theme_menu.get(); } // Can be empty for no menu. void theme_menu_entry_clicked(int lua_ref); // Will be invoked every time the theme sets a new menu. // Is not invoked for a menu that exists at the time of the callback. void set_theme_menu_callback(std::function callback) { theme_menu_callback = callback; } std::string format_status_line(const std::string &disk_space_left_text, double file_length_seconds); // Signal that the given card is going away and will not be replaced // with a fake capture card, so remove all connections to it so that // they don't automatically come back on the next frame. void remove_card(unsigned card_index); private: void register_globals(); void register_class(const char *class_name, const luaL_Reg *funcs, EffectType effect_type = NO_EFFECT_TYPE); int set_theme_menu(lua_State *L); Chain get_chain_from_effect_chain(movit::EffectChain *effect_chain, unsigned num, const InputState &input_state); void call_lua_wb_callback(unsigned channel, float r, float g, float b); std::string theme_path; std::mutex m; lua_State *L; // Protected by . const InputState *input_state = nullptr; // Protected by . Only set temporarily, during chain setup. movit::ResourcePool *resource_pool; int num_channels = -1; bool startup_finished = false; std::mutex map_m; std::map signal_to_card_mapping; // Protected by . std::vector video_inputs; struct VideoSignalConnection { LiveInputWrapper *wrapper; FFmpegCapture *source; }; std::unordered_map> video_signal_connections; #ifdef HAVE_CEF std::vector html_inputs; struct CEFSignalConnection { LiveInputWrapper *wrapper; CEFCapture *source; }; std::unordered_map> html_signal_connections; #endif std::unique_ptr theme_menu; std::function theme_menu_callback; std::map channel_names; // Set using Nageru.set_channel_name(). Protected by . std::map channel_signals; // Set using Nageru.set_channel_signal(). Protected by . std::map channel_supports_wb; // Set using Nageru.set_supports_wb(). Protected by . friend class LiveInputWrapper; friend class Scene; friend int ThemeMenu_set(lua_State *L); friend int Nageru_set_channel_name(lua_State *L); friend int Nageru_set_num_channels(lua_State *L); friend int Nageru_set_channel_signal(lua_State *L); friend int Nageru_set_supports_wb(lua_State *L); }; // LiveInputWrapper is a facade on top of an YCbCrInput, exposed to // the Lua code. It contains a function (connect_signal()) intended // to be called during chain setup, that picks out the current frame // (in the form of a set of textures) from the input state given by // the mixer, and communicates that state over to the actual YCbCrInput. class LiveInputWrapper { public: // Note: is irrelevant for PixelFormat_8BitBGRA. LiveInputWrapper(Theme *theme, movit::EffectChain *chain, bmusb::PixelFormat pixel_format, bool override_bounce, bool deinterlace, bool user_connectable); bool connect_signal(int signal_num); // Must be called with the theme's lock held, since it accesses theme->input_state. Returns false on error. void connect_card(int signal_num, const InputState &input_state); movit::Effect *get_effect() const { if (deinterlace) { return deinterlace_effect; } else if (pixel_format == bmusb::PixelFormat_8BitBGRA) { return rgba_inputs[0]; } else { return ycbcr_inputs[0]; } } private: Theme *theme; // Not owned by us. bmusb::PixelFormat pixel_format; movit::YCbCrFormat input_ycbcr_format; std::vector ycbcr_inputs; // Multiple ones if deinterlacing. Owned by the chain. std::vector rgba_inputs; // Multiple ones if deinterlacing. Owned by the chain. movit::Effect *deinterlace_effect = nullptr; // Owned by the chain. bool deinterlace; bool user_connectable; }; // Utility functions used by Scene. void add_outputs_and_finalize(movit::EffectChain *chain, bool is_main_chain); Theme *get_theme_updata(lua_State* L); bool checkbool(lua_State* L, int idx); std::string checkstdstring(lua_State *L, int index); movit::Effect *instantiate_effect(movit::EffectChain *chain, EffectType effect_type); void print_warning(lua_State* L, const char *format, ...); #endif // !defined(_THEME_H) nageru-2.3.0/nageru/theme.lua000066400000000000000000000476741450736322200161110ustar00rootroot00000000000000-- The theme is what decides what's actually shown on screen, what kind of -- transitions are available (if any), and what kind of inputs there are, -- if any. In general, it drives the entire display logic by creating Movit -- chains (called “scenes”), setting their parameters and then deciding which -- to show when. -- -- Themes are written in Lua, which reflects a simplified form of the Movit API -- where all the low-level details (such as texture formats) and alternatives -- (e.g. turning scaling on or off) are handled by the C++ side and you -- generally just build scenes. local state = { transition_start = -2.0, transition_end = -1.0, transition_type = 0, transition_src_signal = 0, transition_dst_signal = 0, live_signal_num = 0, preview_signal_num = 1 } -- Valid values for live_signal_num and preview_signal_num. local INPUT0_SIGNAL_NUM = 0 local INPUT1_SIGNAL_NUM = 1 local SBS_SIGNAL_NUM = 2 local STATIC_SIGNAL_NUM = 3 -- Valid values for transition_type. (Cuts are done directly, so they need no entry.) local NO_TRANSITION = 0 local ZOOM_TRANSITION = 1 -- Also for slides. local FADE_TRANSITION = 2 function make_sbs_input(scene) return { input = scene:add_input(0), -- Live inputs only. resample_effect = scene:add_effect({ResampleEffect.new(), ResizeEffect.new()}), wb_effect = scene:add_white_balance(), padding_effect = scene:add_effect(IntegralPaddingEffect.new()) } end -- The main live scene. function make_sbs_scene() local scene = Scene.new(16, 9) local input0 = make_sbs_input(scene) input0.input:display(0) input0.padding_effect:set_vec4("border_color", 0.0, 0.0, 0.0, 1.0) local input1 = make_sbs_input(scene) input1.input:display(1) input1.padding_effect:set_vec4("border_color", 0.0, 0.0, 0.0, 0.0) scene:add_effect(OverlayEffect.new(), input0.padding_effect, input1.padding_effect) scene:finalize() return { scene = scene, input0 = input0, input1 = input1 } end local sbs_scene = make_sbs_scene() function make_fade_input(scene) return { input = scene:add_input(), resample_effect = scene:add_optional_effect(ResampleEffect.new()), -- Activated if scaling. wb_effect = scene:add_white_balance() -- Activated for video inputs. } end -- A scene to fade between two inputs, of which either can be a picture -- or a live input. Only used live. function make_fade_scene() local scene = Scene.new(16, 9) local input0 = make_fade_input(scene) local input1 = make_fade_input(scene) local mix_effect = scene:add_effect(MixEffect.new(), input0.wb_effect, input1.wb_effect) scene:finalize(true) -- Only used live. return { scene = scene, input0 = input0, input1 = input1, mix_effect = mix_effect } end local fade_scene = make_fade_scene() -- A scene to show a single input on screen. local scene = Scene.new(16, 9) local simple_scene = { scene = scene, input = scene:add_input(), resample_effect = scene:add_effect({ResampleEffect.new(), ResizeEffect.new(), IdentityEffect.new()}), wb_effect = scene:add_white_balance() } scene:finalize() -- A scene to show a single static picture on screen. local static_image = ImageInput.new("bg.jpeg") -- Also used as input to other scenes. local static_scene = Scene.new(16, 9) static_scene:add_input(static_image) -- Note: Locks this input to images only. static_scene:finalize() -- Set some global state. Unless marked otherwise, these can only be set once, -- at the start of the program. Nageru.set_num_channels(4) -- Sets, for each channel, which signal it corresponds to (starting from 0). -- The information is used for whether right-click on the channel should bring up -- an input selector or not. Only call this for channels that actually correspond -- directly to a signal (ie., live inputs, not live (0) or preview (1)). Nageru.set_channel_signal(2, 0) Nageru.set_channel_signal(3, 1) -- Set whether a given channel supports setting white balance. (Default is false.) Nageru.set_supports_wb(2, true) Nageru.set_supports_wb(3, true) -- These can be set at any time. Nageru.set_channel_name(SBS_SIGNAL_NUM + 2, "Side-by-side") Nageru.set_channel_name(STATIC_SIGNAL_NUM + 2, "Static picture") -- API ENTRY POINT -- Called every frame. Returns the color (if any) to paint around the given -- channel. Returns a CSS color (typically to mark live and preview signals); -- "transparent" is allowed. -- Will never be called for live (0) or preview (1). function channel_color(channel) if state.transition_type ~= NO_TRANSITION then if channel_involved_in(channel, state.transition_src_signal) or channel_involved_in(channel, state.transition_dst_signal) then return "#f00" end else if channel_involved_in(channel, state.live_signal_num) then return "#f00" end end if channel_involved_in(channel, state.preview_signal_num) then return "#0f0" end return "transparent" end function is_plain_signal(num) return num == INPUT0_SIGNAL_NUM or num == INPUT1_SIGNAL_NUM end function channel_involved_in(channel, signal_num) if is_plain_signal(signal_num) then return channel == (signal_num + 2) end if signal_num == SBS_SIGNAL_NUM then return (channel == 2 or channel == 3) end if signal_num == STATIC_SIGNAL_NUM then return (channel == 5) end return false end function finish_transitions(t) if state.transition_type ~= NO_TRANSITION and t >= state.transition_end then state.live_signal_num = state.transition_dst_signal state.transition_type = NO_TRANSITION end end function in_transition(t) return t >= state.transition_start and t <= state.transition_end end -- API ENTRY POINT -- Called every frame. function get_transitions(t) if in_transition(t) then -- Transition already in progress, the only thing we can do is really -- cut to the preview. (TODO: Make an “abort” and/or “finish”, too?) return {"Cut"} end finish_transitions(t) if state.live_signal_num == state.preview_signal_num then -- No transitions possible. return {} end if (is_plain_signal(state.live_signal_num) or state.live_signal_num == STATIC_SIGNAL_NUM) and (is_plain_signal(state.preview_signal_num) or state.preview_signal_num == STATIC_SIGNAL_NUM) then return {"Cut", "", "Fade"} end -- Various zooms. if state.live_signal_num == SBS_SIGNAL_NUM and is_plain_signal(state.preview_signal_num) then return {"Cut", "Zoom in"} elseif is_plain_signal(state.live_signal_num) and state.preview_signal_num == SBS_SIGNAL_NUM then return {"Cut", "Zoom out"} end return {"Cut"} end function swap_preview_live() local temp = state.live_signal_num state.live_signal_num = state.preview_signal_num state.preview_signal_num = temp end function start_transition(type_, t, duration) state.transition_start = t state.transition_end = t + duration state.transition_type = type_ state.transition_src_signal = state.live_signal_num state.transition_dst_signal = state.preview_signal_num swap_preview_live() end -- API ENTRY POINT -- Called when the user clicks a transition button. function transition_clicked(num, t) if num == 0 then -- Cut. if in_transition(t) then -- Ongoing transition; finish it immediately before the cut. finish_transitions(state.transition_end) end swap_preview_live() elseif num == 1 then -- Zoom. finish_transitions(t) if state.live_signal_num == state.preview_signal_num then -- Nothing to do. return end if is_plain_signal(state.live_signal_num) and is_plain_signal(state.preview_signal_num) then -- We can't zoom between these. Just make a cut. io.write("Cutting from " .. state.live_signal_num .. " to " .. state.live_signal_num .. "\n") swap_preview_live() return end if (state.live_signal_num == SBS_SIGNAL_NUM and is_plain_signal(state.preview_signal_num)) or (state.preview_signal_num == SBS_SIGNAL_NUM and is_plain_signal(state.live_signal_num)) then start_transition(ZOOM_TRANSITION, t, 1.0) end elseif num == 2 then finish_transitions(t) -- Fade. if (state.live_signal_num ~= state.preview_signal_num) and (is_plain_signal(state.live_signal_num) or state.live_signal_num == STATIC_SIGNAL_NUM) and (is_plain_signal(state.preview_signal_num) or state.preview_signal_num == STATIC_SIGNAL_NUM) then start_transition(FADE_TRANSITION, t, 1.0) else -- Fades involving SBS are ignored (we have no scene for it). end end end -- API ENTRY POINT function channel_clicked(num) state.preview_signal_num = num end function setup_fade_input(state, input, signals, signal_num, width, height) if signal_num == STATIC_SIGNAL_NUM then input.input:display(static_image) input.wb_effect:disable() -- We assume this is already correctly scaled at load time. input.resample_effect:disable() else input.input:display(signal_num) input.wb_effect:enable() if (signals:get_width(signal_num) ~= width or signals:get_height(signal_num) ~= height) then input.resample_effect:enable() input.resample_effect:set_int("width", width) input.resample_effect:set_int("height", height) else input.resample_effect:disable() end end end function needs_scale(signals, signal_num, width, height) if signal_num == STATIC_SIGNAL_NUM then -- We assume this is already correctly scaled at load time. return false end assert(is_plain_signal(signal_num)) return (signals:get_width(signal_num) ~= width or signals:get_height(signal_num) ~= height) end function setup_simple_input(state, signals, signal_num, width, height, hq) simple_scene.input:display(signal_num) if needs_scale(signals, signal_num, width, height) then if hq then simple_scene.resample_effect:choose(ResampleEffect) -- High-quality resampling. else simple_scene.resample_effect:choose(ResizeEffect) -- Low-quality resampling. end simple_scene.resample_effect:set_int("width", width) simple_scene.resample_effect:set_int("height", height) else simple_scene.resample_effect:disable() -- No scaling. end end -- API ENTRY POINT -- Called every frame. Get the scene for displaying at input , -- where 0 is live, 1 is preview, 2 is the first channel to display -- in the bottom bar, and so on up to num_channels()+1. t is the -- current time in seconds. width and height are the dimensions of -- the output, although you can ignore them if you don't need them -- (they're useful if you want to e.g. know what to resample by). -- -- is an object which you can query for information -- about the signals at the point of the current frame. In particular, -- you can call get_frame_width() and get_frame_height() for any -- signal number, and use that to e.g. see if you wish to enable -- a scaler or not. (You can also use get_width() and get_height(), -- which return the _field_ size. This has half the height for -- interlaced signals.) -- -- You should return scene to use, after having set any parameters you -- want to set (through set_int() etc.). The parameters will be snapshot -- at return time and used during rendering. function get_scene(num, t, width, height, signals) local input_resolution = {} for signal_num=0,1 do local res = { width = signals:get_frame_width(signal_num), height = signals:get_frame_height(signal_num), } input_resolution[signal_num] = res local text_res = signals:get_human_readable_resolution(signal_num) Nageru.set_channel_name(signal_num + 2, "Input " .. (signal_num + 1) .. " (" .. text_res .. ")") end if num == 0 then -- Live. finish_transitions(t) if state.transition_type == ZOOM_TRANSITION then -- Transition in or out of SBS. prepare_sbs_scene(state, calc_zoom_progress(state, t), state.transition_type, state.transition_src_signal, state.transition_dst_signal, width, height, input_resolution, true) return sbs_scene.scene elseif state.transition_type == NO_TRANSITION and state.live_signal_num == SBS_SIGNAL_NUM then -- Static SBS view. prepare_sbs_scene(state, 0.0, NO_TRANSITION, 0, SBS_SIGNAL_NUM, width, height, input_resolution, true) return sbs_scene.scene elseif state.transition_type == FADE_TRANSITION then setup_fade_input(state, fade_scene.input0, signals, state.transition_src_signal, width, height) setup_fade_input(state, fade_scene.input1, signals, state.transition_dst_signal, width, height) local tt = calc_fade_progress(t, state.transition_start, state.transition_end) fade_scene.mix_effect:set_float("strength_first", 1.0 - tt) fade_scene.mix_effect:set_float("strength_second", tt) return fade_scene.scene elseif is_plain_signal(state.live_signal_num) then setup_simple_input(state, signals, state.live_signal_num, width, height, true) return simple_scene.scene elseif state.live_signal_num == STATIC_SIGNAL_NUM then -- Static picture. return static_scene else assert(false) end end if num == 1 then -- Preview. num = state.preview_signal_num + 2 end -- Individual preview inputs. if is_plain_signal(num - 2) then setup_simple_input(state, signals, num - 2, width, height, false) return simple_scene.scene end if num == SBS_SIGNAL_NUM + 2 then prepare_sbs_scene(state, 0.0, NO_TRANSITION, 0, SBS_SIGNAL_NUM, width, height, input_resolution, false) return sbs_scene.scene end if num == STATIC_SIGNAL_NUM + 2 then return static_scene end end function place_rectangle(input, x0, y0, x1, y1, screen_width, screen_height, input_width, input_height, hq) input.padding_effect:set_int("width", screen_width) input.padding_effect:set_int("height", screen_height) -- Cull. if x0 > screen_width or x1 < 0.0 or y0 > screen_height or y1 < 0.0 then input.resample_effect:choose(ResizeEffect) -- Low-quality resizing. input.resample_effect:set_int("width", 1) input.resample_effect:set_int("height", 1) input.padding_effect:set_int("left", screen_width + 100) input.padding_effect:set_int("top", screen_height + 100) return end local srcx0 = 0.0 local srcx1 = 1.0 local srcy0 = 0.0 local srcy1 = 1.0 -- Clip. if x0 < 0 then srcx0 = -x0 / (x1 - x0) x0 = 0 end if y0 < 0 then srcy0 = -y0 / (y1 - y0) y0 = 0 end if x1 > screen_width then srcx1 = (screen_width - x0) / (x1 - x0) x1 = screen_width end if y1 > screen_height then srcy1 = (screen_height - y0) / (y1 - y0) y1 = screen_height end if hq then -- High-quality resampling. Go for the actual effect (returned by choose()) -- since we want to set zoom_*, which will give an error if set on ResizeEffect. local resample_effect = input.resample_effect:choose(ResampleEffect) local x_subpixel_offset = x0 - math.floor(x0) local y_subpixel_offset = y0 - math.floor(y0) -- Resampling must be to an integral number of pixels. Round up, -- and then add an extra pixel so we have some leeway for the border. local width = math.ceil(x1 - x0) + 1 local height = math.ceil(y1 - y0) + 1 resample_effect:set_int("width", width) resample_effect:set_int("height", height) -- Correct the discrepancy with zoom. (This will leave a small -- excess edge of pixels and subpixels, which we'll correct for soon.) local zoom_x = (x1 - x0) / (width * (srcx1 - srcx0)) local zoom_y = (y1 - y0) / (height * (srcy1 - srcy0)) resample_effect:set_float("zoom_x", zoom_x) resample_effect:set_float("zoom_y", zoom_y) resample_effect:set_float("zoom_center_x", 0.0) resample_effect:set_float("zoom_center_y", 0.0) -- Padding must also be to a whole-pixel offset. input.padding_effect:set_int("left", math.floor(x0)) input.padding_effect:set_int("top", math.floor(y0)) -- Correct _that_ discrepancy by subpixel offset in the resampling. resample_effect:set_float("left", srcx0 * input_width - x_subpixel_offset / zoom_x) resample_effect:set_float("top", srcy0 * input_height - y_subpixel_offset / zoom_y) -- Finally, adjust the border so it is exactly where we want it. input.padding_effect:set_float("border_offset_left", x_subpixel_offset) input.padding_effect:set_float("border_offset_right", x1 - (math.floor(x0) + width)) input.padding_effect:set_float("border_offset_top", y_subpixel_offset) input.padding_effect:set_float("border_offset_bottom", y1 - (math.floor(y0) + height)) else -- Lower-quality simple resizing. input.resample_effect:choose(ResizeEffect) local width = round(x1 - x0) local height = round(y1 - y0) input.resample_effect:set_int("width", width) input.resample_effect:set_int("height", height) -- Padding must also be to a whole-pixel offset. input.padding_effect:set_int("left", math.floor(x0)) input.padding_effect:set_int("top", math.floor(y0)) -- No subpixel stuff. input.padding_effect:set_float("border_offset_left", 0.0) input.padding_effect:set_float("border_offset_right", 0.0) input.padding_effect:set_float("border_offset_top", 0.0) input.padding_effect:set_float("border_offset_bottom", 0.0) end end -- This is broken, of course (even for positive numbers), but Lua doesn't give us access to real rounding. function round(x) return math.floor(x + 0.5) end function lerp(a, b, t) return a + (b - a) * t end function lerp_pos(a, b, t) return { x0 = lerp(a.x0, b.x0, t), y0 = lerp(a.y0, b.y0, t), x1 = lerp(a.x1, b.x1, t), y1 = lerp(a.y1, b.y1, t) } end function pos_from_top_left(x, y, width, height, screen_width, screen_height) local xs = screen_width / 1280.0 local ys = screen_height / 720.0 return { x0 = round(xs * x), y0 = round(ys * y), x1 = round(xs * (x + width)), y1 = round(ys * (y + height)) } end function prepare_sbs_scene(state, t, transition_type, src_signal, dst_signal, screen_width, screen_height, input_resolution, hq) -- First input is positioned (16,48) from top-left. -- Second input is positioned (16,48) from the bottom-right. local pos0 = pos_from_top_left(16, 48, 848, 477, screen_width, screen_height) local pos1 = pos_from_top_left(1280 - 384 - 16, 720 - 216 - 48, 384, 216, screen_width, screen_height) local pos_fs = { x0 = 0, y0 = 0, x1 = screen_width, y1 = screen_height } local affine_param if transition_type == NO_TRANSITION then -- Static SBS view. affine_param = { sx = 1.0, sy = 1.0, tx = 0.0, ty = 0.0 } -- Identity. else -- Zooming to/from SBS view into or out of a single view. assert(transition_type == ZOOM_TRANSITION) local signal, real_t if src_signal == SBS_SIGNAL_NUM then signal = dst_signal real_t = t else assert(dst_signal == SBS_SIGNAL_NUM) signal = src_signal real_t = 1.0 - t end if signal == INPUT0_SIGNAL_NUM then affine_param = find_affine_param(pos0, lerp_pos(pos0, pos_fs, real_t)) elseif signal == INPUT1_SIGNAL_NUM then affine_param = find_affine_param(pos1, lerp_pos(pos1, pos_fs, real_t)) end end -- NOTE: input_resolution is not 1-indexed, unlike usual Lua arrays. place_rectangle_with_affine(sbs_scene.input0, pos0, affine_param, screen_width, screen_height, input_resolution[0].width, input_resolution[0].height, hq) place_rectangle_with_affine(sbs_scene.input1, pos1, affine_param, screen_width, screen_height, input_resolution[1].width, input_resolution[1].height, hq) end -- Find the transformation that changes the first rectangle to the second one. function find_affine_param(a, b) local sx = (b.x1 - b.x0) / (a.x1 - a.x0) local sy = (b.y1 - b.y0) / (a.y1 - a.y0) return { sx = sx, sy = sy, tx = b.x0 - a.x0 * sx, ty = b.y0 - a.y0 * sy } end function place_rectangle_with_affine(input, pos, aff, screen_width, screen_height, input_width, input_height, hq) local x0 = pos.x0 * aff.sx + aff.tx local x1 = pos.x1 * aff.sx + aff.tx local y0 = pos.y0 * aff.sy + aff.ty local y1 = pos.y1 * aff.sy + aff.ty place_rectangle(input, x0, y0, x1, y1, screen_width, screen_height, input_width, input_height, hq) end function calc_zoom_progress(state, t) if t < state.transition_start then return 0.0 elseif t > state.transition_end then return 1.0 else local tt = (t - state.transition_start) / (state.transition_end - state.transition_start) -- Smooth it a bit. return math.sin(tt * 3.14159265358 * 0.5) end end function calc_fade_progress(t, transition_start, transition_end) local tt = (t - transition_start) / (transition_end - transition_start) if tt < 0.0 then return 0.0 elseif tt > 1.0 then return 1.0 end -- Make the fade look maybe a tad more natural, by pumping it -- through a sigmoid function. tt = 10.0 * tt - 5.0 tt = 1.0 / (1.0 + math.exp(-tt)) return tt end nageru-2.3.0/nageru/timecode.frag000066400000000000000000000004741450736322200167210ustar00rootroot00000000000000#version 130 in vec2 tc0; uniform sampler2D tex; out vec4 Y, CbCr, YCbCr; void main() { vec4 gray = texture(tex, tc0);; gray.r = gray.r * ((235.0-16.0)/255.0) + 16.0/255.0; // Limited-range Y'CbCr. CbCr = vec4(128.0/255.0, 128.0/255.0, 0.0, 1.0);; Y = gray.rrra; YCbCr = vec4(Y.r, CbCr.r, CbCr.g, CbCr.a); } nageru-2.3.0/nageru/timecode.vert000066400000000000000000000006161450736322200167600ustar00rootroot00000000000000#version 130 in vec2 position; in vec2 texcoord; out vec2 tc0; void main() { // The result of glOrtho(0.0, 1.0, 0.0, 1.0, 0.0, 1.0) is: // // 2.000 0.000 0.000 -1.000 // 0.000 2.000 0.000 -1.000 // 0.000 0.000 -2.000 -1.000 // 0.000 0.000 0.000 1.000 gl_Position = vec4(2.0 * position.x - 1.0, 2.0 * position.y - 1.0, -1.0, 1.0); tc0 = texcoord; } nageru-2.3.0/nageru/timecode_10bit.frag000066400000000000000000000005041450736322200177120ustar00rootroot00000000000000#version 130 in vec2 tc0; uniform sampler2D tex; out vec4 Y, CbCr, YCbCr; void main() { vec4 gray = texture(tex, tc0);; gray.r = gray.r * ((940.0-16.0)/65535.0) + 16.0/65535.0; // Limited-range Y'CbCr. CbCr = vec4(512.0/65535.0, 512.0/65535.0, 0.0, 1.0);; Y = gray.rrra; YCbCr = vec4(Y.r, CbCr.r, CbCr.g, CbCr.a); } nageru-2.3.0/nageru/timecode_renderer.cpp000066400000000000000000000121741450736322200204520ustar00rootroot00000000000000#include "timecode_renderer.h" #include #include #include #include #include #include #include #include #include #include #include "flags.h" #include "embedded_files.h" #include "shared/read_file.h" using namespace std; using namespace movit; TimecodeRenderer::TimecodeRenderer(movit::ResourcePool *resource_pool, unsigned display_width, unsigned display_height) : resource_pool(resource_pool), display_width(display_width), display_height(display_height), height(28) { string vert_shader = read_file("timecode.vert", _binary_timecode_vert_data, _binary_timecode_vert_size); string frag_shader; if (global_flags.bit_depth > 8) { frag_shader = read_file("timecode_10bit.frag", _binary_timecode_10bit_frag_data, _binary_timecode_10bit_frag_size); } else { frag_shader = read_file("timecode.frag", _binary_timecode_frag_data, _binary_timecode_frag_size); } vector frag_shader_outputs; program_num = resource_pool->compile_glsl_program(vert_shader, frag_shader, frag_shader_outputs); check_error(); texture_sampler_uniform = glGetUniformLocation(program_num, "tex"); check_error(); position_attribute_index = glGetAttribLocation(program_num, "position"); check_error(); texcoord_attribute_index = glGetAttribLocation(program_num, "texcoord"); check_error(); // Shared between the two. float vertices[] = { 0.0f, 2.0f, 0.0f, 0.0f, 2.0f, 0.0f }; vbo = generate_vbo(2, GL_FLOAT, sizeof(vertices), vertices); check_error(); tex = resource_pool->create_2d_texture(GL_R8, display_width, height); image.reset(new QImage(display_width, height, QImage::Format_Grayscale8)); } TimecodeRenderer::~TimecodeRenderer() { resource_pool->release_2d_texture(tex); check_error(); resource_pool->release_glsl_program(program_num); check_error(); glDeleteBuffers(1, &vbo); check_error(); } string TimecodeRenderer::get_timecode_text(double pts, unsigned frame_num) { // Find the wall time, and round it to the nearest millisecond. timeval now; gettimeofday(&now, nullptr); time_t unixtime = now.tv_sec; unsigned msecs = (now.tv_usec + 500) / 1000; if (msecs >= 1000) { msecs -= 1000; ++unixtime; } tm utc_tm; gmtime_r(&unixtime, &utc_tm); char clock_text[256]; strftime(clock_text, sizeof(clock_text), "%Y-%m-%d %H:%M:%S", &utc_tm); // Make the stream timecode, rounded to the nearest millisecond. long stream_time = lrint(pts * 1e3); assert(stream_time >= 0); unsigned stream_time_ms = stream_time % 1000; stream_time /= 1000; unsigned stream_time_sec = stream_time % 60; stream_time /= 60; unsigned stream_time_min = stream_time % 60; unsigned stream_time_hour = stream_time / 60; char timecode_text[512]; snprintf(timecode_text, sizeof(timecode_text), "Nageru " NAGERU_VERSION " - %s.%03u UTC - Stream time %02u:%02u:%02u.%03u (frame %u)", clock_text, msecs, stream_time_hour, stream_time_min, stream_time_sec, stream_time_ms, frame_num); return timecode_text; } void TimecodeRenderer::render_timecode(GLuint fbo, const string &text) { render_string_to_buffer(text); render_buffer_to_fbo(fbo); } void TimecodeRenderer::render_string_to_buffer(const string &text) { image->fill(0); QPainter painter(image.get()); painter.setPen(Qt::white); QFont font = painter.font(); font.setFamily("Noto Sans"); font.setPointSize(16); painter.setFont(font); painter.drawText(QRectF(0, 0, display_width, height), Qt::AlignCenter, QString::fromStdString(text)); } void TimecodeRenderer::render_buffer_to_fbo(GLuint fbo) { glBindFramebuffer(GL_FRAMEBUFFER, fbo); check_error(); GLuint vao; glGenVertexArrays(1, &vao); check_error(); glBindVertexArray(vao); check_error(); glViewport(0, display_height - height, display_width, height); check_error(); glActiveTexture(GL_TEXTURE0); check_error(); glBindTexture(GL_TEXTURE_2D, tex); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_MIN_FILTER, GL_LINEAR); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_S, GL_CLAMP_TO_EDGE); check_error(); glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_T, GL_CLAMP_TO_EDGE); check_error(); glTexSubImage2D(GL_TEXTURE_2D, 0, 0, 0, display_width, height, GL_RED, GL_UNSIGNED_BYTE, image->bits()); check_error(); glUseProgram(program_num); check_error(); glUniform1i(texture_sampler_uniform, 0); check_error(); glBindBuffer(GL_ARRAY_BUFFER, vbo); check_error(); for (GLint attr_index : { position_attribute_index, texcoord_attribute_index }) { if (attr_index == -1) continue; glEnableVertexAttribArray(attr_index); check_error(); glVertexAttribPointer(attr_index, 2, GL_FLOAT, GL_FALSE, 0, BUFFER_OFFSET(0)); check_error(); } glDrawArrays(GL_TRIANGLES, 0, 3); check_error(); for (GLint attr_index : { position_attribute_index, texcoord_attribute_index }) { if (attr_index == -1) continue; glDisableVertexAttribArray(attr_index); check_error(); } glActiveTexture(GL_TEXTURE0); check_error(); glUseProgram(0); check_error(); glDeleteVertexArrays(1, &vao); check_error(); glBindFramebuffer(GL_FRAMEBUFFER, 0); check_error(); } nageru-2.3.0/nageru/timecode_renderer.h000066400000000000000000000023101450736322200201060ustar00rootroot00000000000000#ifndef _TIMECODE_RENDERER_H #define _TIMECODE_RENDERER_H 1 #include #include #include // A class to render a simple text string onto the picture using Qt and OpenGL. namespace movit { class ResourcePool; } // namespace movit class QImage; class TimecodeRenderer { public: TimecodeRenderer(movit::ResourcePool *resource_pool, unsigned display_width, unsigned display_height); ~TimecodeRenderer(); // Return a string with the current wall clock time and the // logical stream time. static std::string get_timecode_text(double pts, unsigned frame_num); // The FBO is assumed to contain three outputs (Y', Cb/Cr and RGBA). void render_timecode(GLuint fbo, const std::string &text); private: void render_string_to_buffer(const std::string &text); void render_buffer_to_fbo(GLuint fbo); movit::ResourcePool *resource_pool; unsigned display_width, display_height, height; GLuint vbo; // Holds position and texcoord data. GLuint tex; //std::unique_ptr pixel_buffer; std::unique_ptr image; GLuint program_num; // Owned by . GLuint texture_sampler_uniform; GLuint position_attribute_index, texcoord_attribute_index; }; #endif nageru-2.3.0/nageru/tweaked_inputs.cpp000066400000000000000000000027471450736322200200260ustar00rootroot00000000000000#include #include #include #include "tweaked_inputs.h" sRGBSwitchingFlatInput::~sRGBSwitchingFlatInput() { if (sampler_obj != 0) { glDeleteSamplers(1, &sampler_obj); } } void sRGBSwitchingFlatInput::set_gl_state(GLuint glsl_program_num, const std::string &prefix, unsigned *sampler_num) { movit::FlatInput::set_gl_state(glsl_program_num, prefix, sampler_num); texture_unit = *sampler_num - 1; if (sampler_obj == 0) { glGenSamplers(1, &sampler_obj); check_error(); glSamplerParameteri(sampler_obj, GL_TEXTURE_MIN_FILTER, needs_mipmaps ? GL_LINEAR_MIPMAP_NEAREST : GL_LINEAR); check_error(); glSamplerParameteri(sampler_obj, GL_TEXTURE_WRAP_S, GL_CLAMP_TO_EDGE); check_error(); glSamplerParameteri(sampler_obj, GL_TEXTURE_WRAP_T, GL_CLAMP_TO_EDGE); check_error() // This needs to be done on a sampler and not a texture parameter, // because the texture could be used from multiple different // contexts at the same time. This flag is ignored for non-sRGB-uploaded // textures, so we can set it without checking can_output_linear_gamma(). if (output_linear_gamma) { glSamplerParameteri(sampler_obj, GL_TEXTURE_SRGB_DECODE_EXT, GL_DECODE_EXT); } else { glSamplerParameteri(sampler_obj, GL_TEXTURE_SRGB_DECODE_EXT, GL_SKIP_DECODE_EXT); } check_error(); } glBindSampler(texture_unit, sampler_obj); check_error(); } void sRGBSwitchingFlatInput::clear_gl_state() { glBindSampler(texture_unit, 0); check_error(); } nageru-2.3.0/nageru/tweaked_inputs.h000066400000000000000000000041651450736322200174670ustar00rootroot00000000000000#ifndef _TWEAKED_INPUTS_H #define _TWEAKED_INPUTS_H 1 // Some tweaked variations of Movit inputs. #include #include namespace movit { struct ImageFormat; struct YCbCrFormat; } // namespace movit class NonBouncingYCbCrInput : public movit::YCbCrInput { public: NonBouncingYCbCrInput(const movit::ImageFormat &image_format, const movit::YCbCrFormat &ycbcr_format, unsigned width, unsigned height, movit::YCbCrInputSplitting ycbcr_input_splitting = movit::YCBCR_INPUT_PLANAR) : movit::YCbCrInput(image_format, ycbcr_format, width, height, ycbcr_input_splitting) {} bool override_disable_bounce() const override { return true; } }; // We use FlatInput with RGBA inputs a few places where we can't tell when // uploading the texture whether it needs to be converted from sRGB to linear // or not. (FlatInput deals with this if you give it pixels, but we give it // already uploaded textures.) // // Since we require GL_EXT_texture_sRGB_decode (very common, as far as I can tell), // we can just always upload with the sRGB flag turned on (upload your texture with // GL_SRGB8_ALPHA8), and then sRGBSwitchingFlatInput will turn it off if not requested. class sRGBSwitchingFlatInput : public movit::FlatInput { public: sRGBSwitchingFlatInput(movit::ImageFormat format, movit::MovitPixelFormat pixel_format, GLenum type, unsigned width, unsigned height) : movit::FlatInput(format, pixel_format, type, width, height) {} ~sRGBSwitchingFlatInput(); void set_gl_state(GLuint glsl_program_num, const std::string &prefix, unsigned *sampler_num) override; void clear_gl_state() override; bool set_int(const std::string &key, int value) override { if (key == "output_linear_gamma") { output_linear_gamma = value; } if (key == "needs_mipmaps") { needs_mipmaps = value; } return movit::FlatInput::set_int(key, value); } private: bool output_linear_gamma = false; bool needs_mipmaps = false; GLuint sampler_obj = 0; GLuint texture_unit; }; #endif // !defined(_TWEAKED_INPUTS_H) nageru-2.3.0/nageru/uyvy_subsample.frag000066400000000000000000000005651450736322200202200ustar00rootroot00000000000000#version 130 in vec2 y_tc0, y_tc1, cbcr_tc0, cbcr_tc1; uniform sampler2D y_tex, cbcr_tex; out vec4 FragColor; void main() { float y0 = texture(y_tex, y_tc0).r; float y1 = texture(y_tex, y_tc1).r; vec2 cbcr0 = texture(cbcr_tex, cbcr_tc0).rg; vec2 cbcr1 = texture(cbcr_tex, cbcr_tc1).rg; vec2 cbcr = 0.5 * (cbcr0 + cbcr1); FragColor = vec4(cbcr.g, y0, cbcr.r, y1); }; nageru-2.3.0/nageru/uyvy_subsample.vert000066400000000000000000000013221450736322200202510ustar00rootroot00000000000000#version 130 in vec2 position; in vec2 texcoord; out vec2 y_tc0, y_tc1, cbcr_tc0, cbcr_tc1; uniform vec2 foo_luma_offset_0; uniform vec2 foo_luma_offset_1; uniform vec2 foo_chroma_offset_0; uniform vec2 foo_chroma_offset_1; void main() { // The result of glOrtho(0.0, 1.0, 0.0, 1.0, 0.0, 1.0) is: // // 2.000 0.000 0.000 -1.000 // 0.000 2.000 0.000 -1.000 // 0.000 0.000 -2.000 -1.000 // 0.000 0.000 0.000 1.000 gl_Position = vec4(2.0 * position.x - 1.0, 2.0 * position.y - 1.0, -1.0, 1.0); vec2 flipped_tc = texcoord; y_tc0 = flipped_tc + foo_luma_offset_0; y_tc1 = flipped_tc + foo_luma_offset_1; cbcr_tc0 = flipped_tc + foo_chroma_offset_0; cbcr_tc1 = flipped_tc + foo_chroma_offset_1; }; nageru-2.3.0/nageru/v210_converter.cpp000066400000000000000000000110331450736322200175430ustar00rootroot00000000000000#include "v210_converter.h" #include #include using namespace std; v210Converter::~v210Converter() { for (const auto &shader : shaders) { glDeleteProgram(shader.second.glsl_program_num); check_error(); } } bool v210Converter::has_hardware_support() { // We don't have a GLES version of this, although GLSL ES 3.1 supports // compute shaders. Note that GLSL ES has some extra restrictions, // like requiring that the images are allocated with glTexStorage*(), // or that binding= is effectively mandatory. if (!epoxy_is_desktop_gl()) { return false; } if (epoxy_gl_version() >= 43) { // Supports compute shaders natively. return true; } return epoxy_has_gl_extension("GL_ARB_compute_shader") && epoxy_has_gl_extension("GL_ARB_shader_image_load_store"); } void v210Converter::precompile_shader(unsigned width) { unsigned num_local_work_groups = (width + 5) / 6; if (shaders.count(num_local_work_groups)) { // Already exists. return; } char buf[16]; snprintf(buf, sizeof(buf), "%u", num_local_work_groups); string shader_src = R"(#version 150 #extension GL_ARB_compute_shader : enable #extension GL_ARB_shader_image_load_store : enable layout(local_size_x = )" + string(buf) + R"() in; layout(rgb10_a2) uniform restrict readonly image2D inbuf; layout(rgb10_a2) uniform restrict writeonly image2D outbuf; uniform int max_cbcr_x; shared vec2 cbcr[gl_WorkGroupSize.x * 3u]; void main() { int xb = int(gl_LocalInvocationID.x); // X block. int y = int(gl_GlobalInvocationID.y); // Y (actual line). // Load our pixel group, containing data for six pixels. vec3 indata[4]; for (int i = 0; i < 4; ++i) { indata[i] = imageLoad(inbuf, ivec2(xb * 4 + i, y)).xyz; } // Decode Cb and Cr to shared memory, because neighboring blocks need it for interpolation. cbcr[xb * 3 + 0] = indata[0].xz; cbcr[xb * 3 + 1] = vec2(indata[1].y, indata[2].x); cbcr[xb * 3 + 2] = vec2(indata[2].z, indata[3].y); memoryBarrierShared(); float pix_y[6]; pix_y[0] = indata[0].y; pix_y[1] = indata[1].x; pix_y[2] = indata[1].z; pix_y[3] = indata[2].y; pix_y[4] = indata[3].x; pix_y[5] = indata[3].z; barrier(); // Interpolate the missing Cb/Cr pixels, taking care not to read past the end of the screen // for pixels that we use for interpolation. vec2 pix_cbcr[7]; pix_cbcr[0] = indata[0].xz; pix_cbcr[2] = cbcr[min(xb * 3 + 1, max_cbcr_x)]; pix_cbcr[4] = cbcr[min(xb * 3 + 2, max_cbcr_x)]; pix_cbcr[6] = cbcr[min(xb * 3 + 3, max_cbcr_x)]; pix_cbcr[1] = 0.5 * (pix_cbcr[0] + pix_cbcr[2]); pix_cbcr[3] = 0.5 * (pix_cbcr[2] + pix_cbcr[4]); pix_cbcr[5] = 0.5 * (pix_cbcr[4] + pix_cbcr[6]); // Write the decoded pixels to the destination texture. for (int i = 0; i < 6; ++i) { vec4 outdata = vec4(pix_y[i], pix_cbcr[i].x, pix_cbcr[i].y, 1.0f); imageStore(outbuf, ivec2(xb * 6 + i, y), outdata); } } )"; Shader shader; GLuint shader_num = movit::compile_shader(shader_src, GL_COMPUTE_SHADER); check_error(); shader.glsl_program_num = glCreateProgram(); check_error(); glAttachShader(shader.glsl_program_num, shader_num); check_error(); glLinkProgram(shader.glsl_program_num); check_error(); GLint success; glGetProgramiv(shader.glsl_program_num, GL_LINK_STATUS, &success); check_error(); if (success == GL_FALSE) { GLchar error_log[1024] = {0}; glGetProgramInfoLog(shader.glsl_program_num, 1024, nullptr, error_log); fprintf(stderr, "Error linking program: %s\n", error_log); abort(); } shader.max_cbcr_x_pos = glGetUniformLocation(shader.glsl_program_num, "max_cbcr_x"); check_error(); shader.inbuf_pos = glGetUniformLocation(shader.glsl_program_num, "inbuf"); check_error(); shader.outbuf_pos = glGetUniformLocation(shader.glsl_program_num, "outbuf"); check_error(); shaders.emplace(num_local_work_groups, shader); } void v210Converter::convert(GLuint tex_src, GLuint tex_dst, unsigned width, unsigned height) { precompile_shader(width); unsigned num_local_work_groups = (width + 5) / 6; const Shader &shader = shaders[num_local_work_groups]; glUseProgram(shader.glsl_program_num); check_error(); glUniform1i(shader.max_cbcr_x_pos, width / 2 - 1); check_error(); // Bind the textures. glUniform1i(shader.inbuf_pos, 0); check_error(); glUniform1i(shader.outbuf_pos, 1); check_error(); glBindImageTexture(0, tex_src, 0, GL_FALSE, 0, GL_READ_ONLY, GL_RGB10_A2); check_error(); glBindImageTexture(1, tex_dst, 0, GL_FALSE, 0, GL_WRITE_ONLY, GL_RGB10_A2); check_error(); // Actually run the shader. glDispatchCompute(1, height, 1); check_error(); glUseProgram(0); check_error(); } nageru-2.3.0/nageru/v210_converter.h000066400000000000000000000106521450736322200172160ustar00rootroot00000000000000#ifndef _V210CONVERTER_H #define _V210CONVERTER_H 1 // v210 is a 10-bit 4:2:2 interleaved Y'CbCr format, packing three values // into a 32-bit int (leaving two unused bits at the top) with chroma being // sub-sited with the left luma sample. Even though this 2:10:10:10-arrangement // can be sampled from using the GL_RGB10_A2/GL_UNSIGNED_2_10_10_10_REV format, // the placement of the Y', Cb and Cr parts within these ints is rather // complicated, and thus hard to get a single Y'CbCr pixel from efficiently, // especially on a GPU. Six pixels (six Y', three Cb, three Cr) are packed into // four such ints in the following pattern (see e.g. the DeckLink documentation // for reference): // // A B G R // ----------------- // X Cr0 Y0 Cb0 // X Y2 Cb2 Y1 // X Cb4 Y3 Cr2 // X Y5 Cr4 Y4 // // This patterns repeats for as long as needed, with the additional constraint // that stride must be divisible by 128 (or equivalently, 32 four-byte ints, // or eight pixel groups representing 48 pixels in all). // // Thus, v210Converter allows you to convert from v210 to a more regular // 4:4:4 format (upsampling Cb/Cr on the way, using linear interpolation) // that the GPU supports natively, again in the form of GL_RGB10_A2 // (with Y', Cb, Cr packed as R, G and B, respectively -- the “alpha” channel // is always 1). // // It does this fairly efficiently using a compute shader, which means you'll // need compute shader support (GL_ARB_compute_shader + GL_ARB_shader_image_load_store, // or equivalently, OpenGL 4.3 or newer) to use it. There are many possible // strategies for doing this in a compute shader, but I ended up settling // a fairly simple one after some benchmarking; each work unit takes in // a single four-int group and writes six samples, but as the interpolation // needs the leftmost chroma samples from the work unit at the right, each line // is put into a local work group. Cb/Cr is first decoded into shared memory // (OpenGL guarantees at least 32 kB shared memory for the work group, which is // enough for up to 6K video or so), and then the rest of the shuffling and // writing happens. Each line can of course be converted entirely // independently, so we can fire up as many such work groups as we have lines. // // On the Haswell GPU where I developed it (with single-channel memory), // conversion takes about 1.4 ms for a 720p frame, so it should be possible to // keep up multiple inputs at 720p60, although probably a faster machine is // needed if we want to run e.g. heavy scaling filters in the same pipeline. // (1.4 ms equates to about 35% of the theoretical memory bandwidth of // 12.8 GB/sec, which is pretty good.) #include #include class v210Converter { public: ~v210Converter(); // Whether the current hardware and driver supports the compute shader // necessary to do this conversion. static bool has_hardware_support(); // Given an image width, returns the minimum number of 32-bit groups // needed for each line. This can be used to size the input texture properly. static GLuint get_minimum_v210_texture_width(unsigned width) { unsigned num_local_groups = (width + 5) / 6; return 4 * num_local_groups; } // Given an image width, returns the stride (in bytes) for each line. static size_t get_v210_stride(unsigned width) { return (width + 47) / 48 * 128; } // Since work groups need to be determined at shader compile time, // each width needs potentially a different shader. You can call this // function at startup to make sure a shader for the given width // has been compiled, making sure you don't need to start an expensive // compilation job while video is running if a new resolution comes along. // This is not required, but generally recommended. void precompile_shader(unsigned width); // Do the actual conversion. tex_src is assumed to be a GL_RGB10_A2 // texture of at least [get_minimum_v210_texture_width(width), height]. // tex_dst is assumed to be a GL_RGB10_A2 texture of exactly [width, height] // (actually, other sizes will work fine, but be nonsensical). // No textures will be allocated or deleted. void convert(GLuint tex_src, GLuint tex_dst, unsigned width, unsigned height); private: // Key is number of local groups, ie., ceil(width / 6). struct Shader { GLuint glsl_program_num = -1; // Uniform locations. GLuint max_cbcr_x_pos = -1, inbuf_pos = -1, outbuf_pos = -1; }; std::map shaders; }; #endif // !defined(_V210CONVERTER_H) nageru-2.3.0/nageru/v210_subsample.comp000066400000000000000000000030361450736322200177070ustar00rootroot00000000000000#version 150 #extension GL_ARB_compute_shader : enable #extension GL_ARB_shader_image_load_store : enable layout(local_size_x=2, local_size_y=16) in; layout(r16) uniform restrict readonly image2D in_y; uniform sampler2D in_cbcr; // Of type RG16. layout(rgb10_a2) uniform restrict writeonly image2D outbuf; uniform float inv_width, inv_height; void main() { int xb = int(gl_GlobalInvocationID.x); // X block number. int y = int(gl_GlobalInvocationID.y); // Y (actual line). float yf = (gl_GlobalInvocationID.y + 0.5f) * inv_height; // Y float coordinate. // Load and scale CbCr values, sampling in-between the texels to get // to (left/4 + center/2 + right/4). vec2 pix_cbcr[3]; for (int i = 0; i < 3; ++i) { vec2 a = texture(in_cbcr, vec2((xb * 6 + i * 2) * inv_width, yf)).xy; vec2 b = texture(in_cbcr, vec2((xb * 6 + i * 2 + 1) * inv_width, yf)).xy; pix_cbcr[i] = (a + b) * (0.5 * 65535.0 / 1023.0); } // Load and scale the Y values. Note that we use integer coordinates here, // so we don't need to offset by 0.5. float pix_y[6]; for (int i = 0; i < 6; ++i) { pix_y[i] = imageLoad(in_y, ivec2(xb * 6 + i, y)).x * (65535.0 / 1023.0); } imageStore(outbuf, ivec2(xb * 4 + 0, y), vec4(pix_cbcr[0].x, pix_y[0], pix_cbcr[0].y, 1.0)); imageStore(outbuf, ivec2(xb * 4 + 1, y), vec4(pix_y[1], pix_cbcr[1].x, pix_y[2], 1.0)); imageStore(outbuf, ivec2(xb * 4 + 2, y), vec4(pix_cbcr[1].y, pix_y[3], pix_cbcr[2].x, 1.0)); imageStore(outbuf, ivec2(xb * 4 + 3, y), vec4(pix_y[4], pix_cbcr[2].y, pix_y[5], 1.0)); } nageru-2.3.0/nageru/v4l_output.cpp000066400000000000000000000040301450736322200171100ustar00rootroot00000000000000#include "v4l_output.h" #include #include #include #include #include #include #include #include #include "shared/memcpy_interleaved.h" V4LOutput::V4LOutput(const char *device_path, unsigned width, unsigned height) : width(width), height(height), image_size_bytes(width * height + (width / 2) * (height / 2) * 2), yuv420_buf(new uint8_t[image_size_bytes]) { video_fd = open(device_path, O_WRONLY); if (video_fd == -1) { perror(device_path); exit(1); } v4l2_format fmt; memset(&fmt, 0, sizeof(fmt)); fmt.type = V4L2_BUF_TYPE_VIDEO_OUTPUT; fmt.fmt.pix.width = width; fmt.fmt.pix.height = width; fmt.fmt.pix.pixelformat = V4L2_PIX_FMT_YUV420; fmt.fmt.pix.field = V4L2_FIELD_NONE; fmt.fmt.pix.bytesperline = 0; fmt.fmt.pix.sizeimage = image_size_bytes; fmt.fmt.pix.colorspace = V4L2_COLORSPACE_SRGB; int err = ioctl(video_fd, VIDIOC_S_FMT, &fmt); if (err == -1) { perror("ioctl(VIDIOC_S_FMT)"); exit(1); } } V4LOutput::~V4LOutput() { close(video_fd); } void V4LOutput::send_frame(const uint8_t *data) { // Seemingly NV12 isn't a very common format among V4L2 consumers, // so we convert from our usual NV12 to YUV420. We get an unneeded // memcpy() of the luma data, but hopefully, we'll manage. const size_t luma_size = width * height; const size_t chroma_size = (width / 2) * (height / 2); memcpy(yuv420_buf.get(), data, luma_size); memcpy_interleaved( yuv420_buf.get() + luma_size, yuv420_buf.get() + luma_size + chroma_size, data + luma_size, 2 * chroma_size); const uint8_t *ptr = yuv420_buf.get(); size_t bytes_left = image_size_bytes; while (bytes_left > 0) { int err = write(video_fd, ptr, bytes_left); if (err == -1) { perror("V4L write"); exit(1); } if (err == 0) { fprintf(stderr, "WARNING: Short V4L write() (only wrote %zu of %zu bytes), skipping rest of frame.\n", image_size_bytes - bytes_left, image_size_bytes); return; } assert(err > 0); bytes_left -= err; ptr += err; } } nageru-2.3.0/nageru/v4l_output.h000066400000000000000000000020061450736322200165560ustar00rootroot00000000000000#ifndef _V4L_OUTPUT_H #define _V4L_OUTPUT_H 1 // Video-only V4L2 output. The intended use-case is output into // v4l2loopback to get into videoconferencing or the likes: // // sudo apt install v4l2loopback-dkms // sudo modprobe v4l2loopback video_nr=2 card_label='Nageru loopback' max_width=1280 max_height=720 exclusive_caps=1 // nageru --v4l-output /dev/video2 // // Start Nageru before any readers. // // Unlike DecklinkOutput, this output does not own the master clock; // it is entirely unsynchronized, and runs off of the normal master clock. // It comes in addition to any other output, and is not GUI-controlled. #include #include #include class V4LOutput { public: V4LOutput(const char *device_path, unsigned width, unsigned height); ~V4LOutput(); // Expects NV12 data. void send_frame(const uint8_t *data); private: const unsigned width, height; const size_t image_size_bytes; std::unique_ptr yuv420_buf; int video_fd; }; #endif // !defined(_V4L_OUTPUT_H) nageru-2.3.0/nageru/video_codec_interface.h000066400000000000000000000016621450736322200207230ustar00rootroot00000000000000// Common interface for low-level video codecs. Not to be confused // with VideoEncoder (which is a higher-level orchestration class). #ifndef _VIDEO_CODEC_INTERFACE_H #define _VIDEO_CODEC_INTERFACE_H 1 #include #include #include #include "print_latency.h" class Mux; class VideoCodecInterface { public: // Called after the last frame. Will block; once this returns, // the last data is flushed. virtual ~VideoCodecInterface() {} // Must be called before first frame. Does not take ownership. virtual void add_mux(Mux *mux) = 0; // is taken to be raw NV12 data of WIDTHxHEIGHT resolution. // Does not block. virtual void add_frame(int64_t pts, int64_t duration, movit::YCbCrLumaCoefficients ycbcr_coefficients, const uint8_t *data, const ReceivedTimestamps &received_ts) = 0; virtual std::string get_global_headers() const = 0; }; #endif // !defined(_VIDEO_CODEC_INTERFACE_H) nageru-2.3.0/nageru/video_encoder.cpp000066400000000000000000000425131450736322200176000ustar00rootroot00000000000000#include "video_encoder.h" #include #include #include #include #include #include #include #include #include #include extern "C" { #include } #include "audio_encoder.h" #ifdef HAVE_AV1 #include "av1_encoder.h" #endif #include "defs.h" #include "shared/ffmpeg_raii.h" #include "flags.h" #include "shared/httpd.h" #include "shared/mux.h" #include "quicksync_encoder.h" #include "shared/timebase.h" #include "x264_encoder.h" class RefCountedFrame; using namespace std; using namespace std::chrono; using namespace movit; namespace { string generate_local_dump_filename(int frame) { time_t now = time(NULL); tm now_tm; localtime_r(&now, &now_tm); char timestamp[64]; strftime(timestamp, sizeof(timestamp), "%F-%H%M%S%z", &now_tm); // Use the frame number to disambiguate between two cuts starting // on the same second. char filename[256]; snprintf(filename, sizeof(filename), "%s/%s%s-f%02d%s", global_flags.recording_dir.c_str(), LOCAL_DUMP_PREFIX, timestamp, frame % 100, LOCAL_DUMP_SUFFIX); return filename; } } // namespace VideoEncoder::VideoEncoder(ResourcePool *resource_pool, QSurface *surface, const std::string &va_display, int width, int height, HTTPD *httpd, DiskSpaceEstimator *disk_space_estimator) : resource_pool(resource_pool), surface(surface), va_display(va_display), width(width), height(height), httpd(httpd), disk_space_estimator(disk_space_estimator) { // TODO: If we're outputting AV1, we can't use MPEG-TS currently. srt_oformat = av_guess_format("mpegts", nullptr, nullptr); assert(srt_oformat != nullptr); oformat = av_guess_format(global_flags.stream_mux_name.c_str(), nullptr, nullptr); assert(oformat != nullptr); if (global_flags.stream_audio_codec_name.empty()) { stream_audio_encoder.reset(new AudioEncoder(AUDIO_OUTPUT_CODEC_NAME, DEFAULT_AUDIO_OUTPUT_BIT_RATE, oformat)); } else { stream_audio_encoder.reset(new AudioEncoder(global_flags.stream_audio_codec_name, global_flags.stream_audio_codec_bitrate, oformat)); } if (global_flags.x264_video_to_http || global_flags.x264_video_to_disk) { x264_encoder.reset(new X264Encoder(oformat, /*use_separate_disk_params=*/false)); } VideoCodecInterface *http_encoder = x264_encoder.get(); VideoCodecInterface *disk_encoder = x264_encoder.get(); #ifdef HAVE_AV1 if (global_flags.av1_video_to_http) { av1_encoder.reset(new AV1Encoder(oformat)); http_encoder = av1_encoder.get(); } #endif if (global_flags.x264_separate_disk_encode) { x264_disk_encoder.reset(new X264Encoder(oformat, /*use_separate_disk_params=*/true)); disk_encoder = x264_disk_encoder.get(); } string filename = generate_local_dump_filename(/*frame=*/0); quicksync_encoder.reset(new QuickSyncEncoder(filename, resource_pool, surface, va_display, width, height, oformat, http_encoder, disk_encoder, disk_space_estimator)); open_output_streams(); stream_audio_encoder->add_mux(http_mux.get()); if (srt_mux != nullptr) { stream_audio_encoder->add_mux(srt_mux.get()); } quicksync_encoder->set_http_mux(http_mux.get()); if (srt_mux != nullptr) { quicksync_encoder->set_srt_mux(srt_mux.get()); } if (global_flags.x264_video_to_http) { x264_encoder->add_mux(http_mux.get()); if (srt_mux != nullptr) { x264_encoder->add_mux(srt_mux.get()); } } #ifdef HAVE_AV1 if (global_flags.av1_video_to_http) { av1_encoder->add_mux(http_mux.get()); if (srt_mux != nullptr) { av1_encoder->add_mux(srt_mux.get()); } } #endif } VideoEncoder::~VideoEncoder() { should_quit = true; quicksync_encoder->shutdown(); x264_encoder.reset(nullptr); x264_disk_encoder.reset(nullptr); quicksync_encoder->close_file(); quicksync_encoder.reset(nullptr); while (quicksync_encoders_in_shutdown.load() > 0) { usleep(10000); } } void VideoEncoder::do_cut(int frame) { string filename = generate_local_dump_filename(frame); printf("Starting new recording: %s\n", filename.c_str()); // Do the shutdown of the old encoder in a separate thread, since it can // take some time (it needs to wait for all the frames in the queue to be // done encoding, for one) and we are running on the main mixer thread. // However, since this means both encoders could be sending packets at // the same time, it means pts could come out of order to the stream mux, // and we need to plug it until the shutdown is complete. http_mux->plug(); lock(qs_mu, qs_audio_mu); lock_guard lock1(qs_mu, adopt_lock), lock2(qs_audio_mu, adopt_lock); QuickSyncEncoder *old_encoder = quicksync_encoder.release(); // When we go C++14, we can use move capture instead. X264Encoder *old_x264_encoder = nullptr; X264Encoder *old_x264_disk_encoder = nullptr; if (global_flags.x264_video_to_disk) { old_x264_encoder = x264_encoder.release(); } if (global_flags.x264_separate_disk_encode) { old_x264_disk_encoder = x264_disk_encoder.release(); } thread([old_encoder, old_x264_encoder, old_x264_disk_encoder, this]{ old_encoder->shutdown(); delete old_x264_encoder; delete old_x264_disk_encoder; old_encoder->close_file(); http_mux->unplug(); // We cannot delete the encoder here, as this thread has no OpenGL context. // We'll deal with it in begin_frame(). lock_guard lock(qs_mu); qs_needing_cleanup.emplace_back(old_encoder); }).detach(); if (global_flags.x264_video_to_disk) { x264_encoder.reset(new X264Encoder(oformat, /*use_separate_disk_params=*/false)); assert(global_flags.x264_video_to_http); if (global_flags.x264_video_to_http) { x264_encoder->add_mux(http_mux.get()); } if (overriding_bitrate != 0) { x264_encoder->change_bitrate(overriding_bitrate); } } X264Encoder *http_encoder = x264_encoder.get(); X264Encoder *disk_encoder = x264_encoder.get(); if (global_flags.x264_separate_disk_encode) { x264_disk_encoder.reset(new X264Encoder(oformat, /*use_separate_disk_params=*/true)); disk_encoder = x264_disk_encoder.get(); } quicksync_encoder.reset(new QuickSyncEncoder(filename, resource_pool, surface, va_display, width, height, oformat, http_encoder, disk_encoder, disk_space_estimator)); quicksync_encoder->set_http_mux(http_mux.get()); } void VideoEncoder::change_x264_bitrate(unsigned rate_kbit) { overriding_bitrate = rate_kbit; x264_encoder->change_bitrate(rate_kbit); } void VideoEncoder::add_audio(int64_t pts, std::vector audio) { // Take only qs_audio_mu, since add_audio() is thread safe // (we can only conflict with do_cut(), which takes qs_audio_mu) // and we don't want to contend with begin_frame(). { lock_guard lock(qs_audio_mu); quicksync_encoder->add_audio(pts, audio); } stream_audio_encoder->encode_audio(audio, pts + quicksync_encoder->global_delay()); } bool VideoEncoder::is_zerocopy() const { // Explicitly do _not_ take qs_mu; this is called from the mixer, // and qs_mu might be contended. is_zerocopy() is thread safe // and never called in parallel with do_cut() (both happen only // from the mixer thread). return quicksync_encoder->is_zerocopy(); } bool VideoEncoder::begin_frame(int64_t pts, int64_t duration, movit::YCbCrLumaCoefficients ycbcr_coefficients, const std::vector &input_frames, GLuint *y_tex, GLuint *cbcr_tex) { lock_guard lock(qs_mu); qs_needing_cleanup.clear(); // Since we have an OpenGL context here, and are called regularly. return quicksync_encoder->begin_frame(pts, duration, ycbcr_coefficients, input_frames, y_tex, cbcr_tex); } RefCountedGLsync VideoEncoder::end_frame() { want_srt_metric_update = true; lock_guard lock(qs_mu); return quicksync_encoder->end_frame(); } void VideoEncoder::open_output_streams() { for (bool is_srt : {false, true}) { if (is_srt && global_flags.srt_destination_host.empty()) { continue; } AVFormatContext *avctx = avformat_alloc_context(); avctx->oformat = is_srt ? srt_oformat : oformat; uint8_t *buf = (uint8_t *)av_malloc(MUX_BUFFER_SIZE); avctx->pb = avio_alloc_context(buf, MUX_BUFFER_SIZE, 1, this, nullptr, nullptr, nullptr); if (is_srt) { avctx->pb->write_packet = &VideoEncoder::write_srt_packet_thunk; } else { avctx->pb->write_data_type = &VideoEncoder::write_packet2_thunk; avctx->pb->ignore_boundary_point = 1; } Mux::Codec video_codec; if (global_flags.av1_video_to_http) { video_codec = Mux::CODEC_AV1; } else { video_codec = Mux::CODEC_H264; } avctx->flags = AVFMT_FLAG_CUSTOM_IO; string video_extradata; if (global_flags.x264_video_to_http) { video_extradata = x264_encoder->get_global_headers(); #ifdef HAVE_AV1 } else if (global_flags.av1_video_to_http) { video_extradata = av1_encoder->get_global_headers(); #endif } Mux *mux = new Mux(avctx, width, height, video_codec, video_extradata, stream_audio_encoder->get_codec_parameters().get(), get_color_space(global_flags.ycbcr_rec709_coefficients), COARSE_TIMEBASE, /*write_callback=*/nullptr, is_srt ? Mux::WRITE_BACKGROUND : Mux::WRITE_FOREGROUND, { is_srt ? &srt_mux_metrics : &http_mux_metrics }); if (is_srt) { srt_mux.reset(mux); srt_mux_metrics.init({{ "destination", "srt" }}); srt_metrics.init({{ "cardtype", "output" }}); global_metrics.add("srt_num_connection_attempts", {{ "cardtype", "output" }}, &metric_srt_num_connection_attempts); } else { http_mux.reset(mux); http_mux_metrics.init({{ "destination", "http" }}); } } } int VideoEncoder::write_packet2_thunk(void *opaque, uint8_t *buf, int buf_size, AVIODataMarkerType type, int64_t time) { VideoEncoder *video_encoder = (VideoEncoder *)opaque; return video_encoder->write_packet2(buf, buf_size, type, time); } int VideoEncoder::write_packet2(uint8_t *buf, int buf_size, AVIODataMarkerType type, int64_t time) { if (type == AVIO_DATA_MARKER_SYNC_POINT || type == AVIO_DATA_MARKER_BOUNDARY_POINT) { seen_sync_markers = true; } else if (type == AVIO_DATA_MARKER_UNKNOWN && !seen_sync_markers) { // We don't know if this is a keyframe or not (the muxer could // avoid marking it), so we just have to make the best of it. type = AVIO_DATA_MARKER_SYNC_POINT; } if (type == AVIO_DATA_MARKER_HEADER) { http_mux_header.append((char *)buf, buf_size); httpd->set_header(HTTPD::StreamID{ HTTPD::MAIN_STREAM, 0 }, http_mux_header); } else { httpd->add_data(HTTPD::StreamID{ HTTPD::MAIN_STREAM, 0 }, (char *)buf, buf_size, type == AVIO_DATA_MARKER_SYNC_POINT, time, AVRational{ AV_TIME_BASE, 1 }); } return buf_size; } int VideoEncoder::write_srt_packet_thunk(void *opaque, uint8_t *buf, int buf_size) { VideoEncoder *video_encoder = (VideoEncoder *)opaque; return video_encoder->write_srt_packet(buf, buf_size); } static string print_addrinfo(const addrinfo *ai) { char hoststr[NI_MAXHOST], portstr[NI_MAXSERV]; if (getnameinfo(ai->ai_addr, ai->ai_addrlen, hoststr, sizeof(hoststr), portstr, sizeof(portstr), NI_DGRAM | NI_NUMERICHOST | NI_NUMERICSERV) != 0) { return ""; // Should basically never happen, since we're not doing DNS lookups. } if (ai->ai_family == AF_INET6) { return string("[") + hoststr + "]:" + portstr; } else { return string(hoststr) + ":" + portstr; } } int VideoEncoder::open_srt_socket() { int sock = srt_create_socket(); if (sock == -1) { fprintf(stderr, "srt_create_socket(): %s\n", srt_getlasterror_str()); return -1; } SRT_TRANSTYPE live = SRTT_LIVE; if (srt_setsockopt(sock, 0, SRTO_TRANSTYPE, &live, sizeof(live)) < 0) { fprintf(stderr, "srt_setsockopt(SRTO_TRANSTYPE): %s\n", srt_getlasterror_str()); srt_close(sock); return -1; } if (srt_setsockopt(sock, 0, SRTO_LATENCY, &global_flags.srt_output_latency_ms, sizeof(global_flags.srt_output_latency_ms)) < 0) { fprintf(stderr, "srt_setsockopt(SRTO_LATENCY): %s\n", srt_getlasterror_str()); srt_close(sock); return -1; } if (!global_flags.srt_streamid.empty()) { if (srt_setsockopt(sock, 0, SRTO_STREAMID, global_flags.srt_streamid.data(), global_flags.srt_streamid.size()) < 0) { fprintf(stderr, "srt_setsockopt(SRTO_STREAMID): %s\n", srt_getlasterror_str()); srt_close(sock); return -1; } } if (!global_flags.srt_passphrase.empty()) { if (srt_setsockopt(sock, 0, SRTO_PASSPHRASE, global_flags.srt_passphrase.data(), global_flags.srt_passphrase.size()) < 0) { fprintf(stderr, "srt_setsockopt(SRTO_PASSPHRASE): %s\n", srt_getlasterror_str()); srt_close(sock); return -1; } } return sock; } int VideoEncoder::connect_to_srt() { // We need to specify SOCK_DGRAM as a hint, or we'll get all addresses // three times (for each of TCP, UDP, raw). addrinfo hints; memset(&hints, 0, sizeof(hints)); hints.ai_flags = AI_ADDRCONFIG; hints.ai_socktype = SOCK_DGRAM; addrinfo *ai; int ret = getaddrinfo(global_flags.srt_destination_host.c_str(), global_flags.srt_destination_port.c_str(), &hints, &ai); if (ret != 0) { fprintf(stderr, "getaddrinfo(%s:%s): %s\n", global_flags.srt_destination_host.c_str(), global_flags.srt_destination_port.c_str(), gai_strerror(ret)); return -1; } unique_ptr ai_cleanup(ai, &freeaddrinfo); for (const addrinfo *cur = ai; cur != nullptr; cur = cur->ai_next) { // Seemingly, srt_create_socket() isn't universal; once we try to connect, // it gets locked to either IPv4 or IPv6. So we need to create a new one // for every address we try. int sock = open_srt_socket(); if (sock == -1) { // Die immediately. return sock; } ++metric_srt_num_connection_attempts; // We do a non-blocking connect, so that we can check should_quit // every now and then. int blocking = 0; if (srt_setsockopt(sock, 0, SRTO_RCVSYN, &blocking, sizeof(blocking)) < 0) { fprintf(stderr, "srt_setsockopt(SRTO_SNDSYN=0): %s\n", srt_getlasterror_str()); srt_close(sock); continue; } if (srt_connect(sock, cur->ai_addr, cur->ai_addrlen) < 0) { fprintf(stderr, "srt_connect(%s): %s\n", print_addrinfo(cur).c_str(), srt_getlasterror_str()); srt_close(sock); continue; } int eid = srt_epoll_create(); if (eid < 0) { fprintf(stderr, "srt_epoll_create(): %s\n", srt_getlasterror_str()); srt_close(sock); continue; } int modes = SRT_EPOLL_ERR | SRT_EPOLL_OUT; if (srt_epoll_add_usock(eid, sock, &modes) < 0) { fprintf(stderr, "srt_epoll_usock(): %s\n", srt_getlasterror_str()); srt_close(sock); srt_epoll_release(eid); continue; } bool ok; while (!should_quit.load()) { SRTSOCKET errfds[1], writefds[1]; int num_errfds = 1, num_writefds = 1; int poll_time_ms = 100; int ret = srt_epoll_wait(eid, errfds, &num_errfds, writefds, &num_writefds, poll_time_ms, 0, 0, 0, 0); if (ret < 0) { if (srt_getlasterror(nullptr) == SRT_ETIMEOUT) { continue; } else { fprintf(stderr, "srt_epoll_wait(): %s\n", srt_getlasterror_str()); srt_close(sock); srt_epoll_release(eid); return -1; } } else if (ret > 0) { // The SRT epoll framework is pretty odd, but seemingly, // this is the way. Getting the same error code as srt_connect() // would normally return seems to be impossible, though. ok = (num_errfds == 0); break; fprintf(stderr, "num_errfds=%d num_writefds=%d last_err=%s\n", num_errfds, num_writefds, srt_getlasterror_str()); break; } } srt_epoll_release(eid); if (should_quit.load()) { srt_close(sock); return -1; } if (ok) { fprintf(stderr, "Connected to destination SRT endpoint at %s.\n", print_addrinfo(cur).c_str()); return sock; } else { fprintf(stderr, "srt_connect(%s): %s\n", print_addrinfo(cur).c_str(), srt_getlasterror_str()); srt_close(sock); } } // Out of candidates, so give up. return -1; } int VideoEncoder::write_srt_packet(uint8_t *buf, int buf_size) { if (want_srt_metric_update.exchange(false) && srt_sock != -1) { srt_metrics.update_srt_stats(srt_sock); } bool has_drained = false; bool trying_reconnect = false; steady_clock::time_point first_connect_start; while (buf_size > 0 && !should_quit.load()) { if (srt_sock == -1) { if (!trying_reconnect) { first_connect_start = steady_clock::now(); trying_reconnect = true; } srt_sock = connect_to_srt(); if (srt_sock == -1) { usleep(100000); if (!has_drained && duration(steady_clock::now() - first_connect_start).count() >= global_flags.srt_output_latency_ms * 1e-3) { // The entire concept for SRT is to have fixed, low latency. // If we've been out for more than a latency period, we shouldn't // try to send the entire backlog. (But we should be tolerant // of a quick disconnect and reconnect.) Maybe it would be better // to have a sliding window of how much we remove, but it quickly // starts getting esoteric, so juts drop it all. fprintf(stderr, "WARNING: No SRT connection for more than %d ms, dropping data.\n", global_flags.srt_output_latency_ms); srt_mux->drain(); has_drained = true; } continue; } srt_metrics.update_srt_stats(srt_sock); } if (has_drained) { // Now that we're reconnected, we can start accepting data again, // but discard the rest of this write (it is very old by now). srt_mux->undrain(); break; } int to_send = min(buf_size, SRT_LIVE_DEF_PLSIZE); int ret = srt_send(srt_sock, (char *)buf, to_send); if (ret < 0) { fprintf(stderr, "srt_send(): %s\n", srt_getlasterror_str()); srt_close(srt_sock); srt_metrics.metric_srt_uptime_seconds = 0.0 / 0.0; if (!trying_reconnect) { first_connect_start = steady_clock::now(); trying_reconnect = true; } srt_sock = connect_to_srt(); continue; } buf += ret; buf_size -= ret; } return buf_size; } nageru-2.3.0/nageru/video_encoder.h000066400000000000000000000106641450736322200172470ustar00rootroot00000000000000// A class to orchestrate the concept of video encoding. Will keep track of // the muxes to stream and disk, the QuickSyncEncoder, and also the X264Encoder // (for the stream) if there is one. #ifndef _VIDEO_ENCODER_H #define _VIDEO_ENCODER_H #include #include #include #include #include #include #include #include #include #include extern "C" { #include #include } #include #include "shared/mux.h" #include "shared/ref_counted_gl_sync.h" #include "srt_metrics.h" class AudioEncoder; class AV1Encoder; class DiskSpaceEstimator; class HTTPD; class Mux; class QSurface; class QuickSyncEncoder; class RefCountedFrame; class X264Encoder; namespace movit { class ResourcePool; } // namespace movit class VideoEncoder { public: VideoEncoder(movit::ResourcePool *resource_pool, QSurface *surface, const std::string &va_display, int width, int height, HTTPD *httpd, DiskSpaceEstimator *disk_space_estimator); ~VideoEncoder(); void add_audio(int64_t pts, std::vector audio); bool is_zerocopy() const; // Allocate a frame to render into. The returned two textures // are yours to render into (build them into an FBO). // Call end_frame() when you're done. // // The semantics of y_tex and cbcr_tex depend on is_zerocopy(): // // - If false, they are input parameters, ie., the caller // allocates textures. (The contents are not read before // end_frame() is called.) // - If true, they are output parameters, ie., VideoEncoder // allocates textures and borrow them to you for rendering. // In this case, after end_frame(), you are no longer allowed // to use the textures; they are torn down and given to the // H.264 encoder. bool begin_frame(int64_t pts, int64_t duration, movit::YCbCrLumaCoefficients ycbcr_coefficients, const std::vector &input_frames, GLuint *y_tex, GLuint *cbcr_tex); // Call after you are done rendering into the frame; at this point, // y_tex and cbcr_tex will be assumed done, and handed over to the // encoder. The returned fence is purely a convenience; you do not // need to use it for anything, but it's useful if you wanted to set // one anyway. RefCountedGLsync end_frame(); // Does a cut of the disk stream immediately ("frame" is used for the filename only). void do_cut(int frame); void change_x264_bitrate(unsigned rate_kbit); private: void open_output_streams(); static int write_packet2_thunk(void *opaque, uint8_t *buf, int buf_size, AVIODataMarkerType type, int64_t time); int write_packet2(uint8_t *buf, int buf_size, AVIODataMarkerType type, int64_t time); static int write_srt_packet_thunk(void *opaque, uint8_t *buf, int buf_size); int write_srt_packet(uint8_t *buf, int buf_size); int open_srt_socket(); // Returns -1 on error. int connect_to_srt(); // Returns -1 on error. const AVOutputFormat *oformat, *srt_oformat; mutable std::mutex qs_mu, qs_audio_mu; std::unique_ptr quicksync_encoder; // Under _and_ . movit::ResourcePool *resource_pool; QSurface *surface; std::string va_display; int width, height; HTTPD *httpd; DiskSpaceEstimator *disk_space_estimator; bool seen_sync_markers = false; std::unique_ptr http_mux; // To the HTTP server. std::unique_ptr srt_mux; // To the SRT endpoint (if any). std::unique_ptr stream_audio_encoder; std::unique_ptr x264_encoder; // nullptr if not using x264. std::unique_ptr x264_disk_encoder; // nullptr if not using x264, or if not having separate disk encodes. #ifdef HAVE_AV1 std::unique_ptr av1_encoder; // nullptr if not using SVT-AV1. #endif SRTSOCKET srt_sock = -1; std::string http_mux_header; MuxMetrics http_mux_metrics; MuxMetrics srt_mux_metrics; SRTMetrics srt_metrics; std::atomic metric_srt_num_connection_attempts{0}; std::atomic want_srt_metric_update{true}; // Is nominally set every frame. Some racing is OK (this is mainly a rate-limiter). std::atomic quicksync_encoders_in_shutdown{0}; std::atomic overriding_bitrate{0}; std::atomic should_quit{false}; // Encoders that are shutdown, but need to call release_gl_resources() // (or be deleted) from some thread with an OpenGL context. std::vector> qs_needing_cleanup; // Under . }; #endif nageru-2.3.0/nageru/vu_common.cpp000066400000000000000000000043501450736322200167720ustar00rootroot00000000000000#include "vu_common.h" #include #include #include #include using namespace std; double lufs_to_pos(float level_lu, int height, float min_level, float max_level) { // Note: “max” is the loudest level, but y=0 is top of screen. // Handle -inf. if (level_lu < min_level) { return height - 1; } double y = height * (level_lu - max_level) / (min_level - max_level); y = max(y, 0); y = min(y, height - 1); // If we are big enough, snap to pixel grid instead of antialiasing // the edges; the unevenness will be less noticeable than the blurriness. double height_per_level = height / (max_level - min_level) - 2.0; if (height_per_level >= 10.0) { y = round(y); } return y; } void draw_vu_meter(QPainter &painter, int width, int height, int horizontal_margin, double segment_margin, bool is_on, float min_level, float max_level, bool flip, int y_offset) { painter.fillRect(horizontal_margin, y_offset, width - 2 * horizontal_margin, height, Qt::black); for (int y = 0; y < height; ++y) { // Find coverage of “on” rectangles in this pixel row. double coverage = 0.0; for (int level = floor(min_level); level <= ceil(max_level); ++level) { double min_y = lufs_to_pos(level + 1.0, height, min_level, max_level) + segment_margin * 0.5; double max_y = lufs_to_pos(level, height, min_level, max_level) - segment_margin * 0.5; min_y = std::max(min_y, y); min_y = std::min(min_y, y + 1); max_y = std::max(max_y, y); max_y = std::min(max_y, y + 1); coverage += max_y - min_y; } double on_r, on_g, on_b; if (is_on) { double t = double(y) / height; if (t <= 0.5) { on_r = 1.0; on_g = 2.0 * t; on_b = 0.0; } else { on_r = 1.0 - 2.0 * (t - 0.5); on_g = 1.0; on_b = 0.0; } } else { on_r = on_g = on_b = 0.05; } // Correct for coverage and do a simple gamma correction. int r = lrintf(255 * pow(on_r * coverage, 1.0 / 2.2)); int g = lrintf(255 * pow(on_g * coverage, 1.0 / 2.2)); int b = lrintf(255 * pow(on_b * coverage, 1.0 / 2.2)); int draw_y = flip ? (height - y - 1) : y; painter.fillRect(horizontal_margin, draw_y + y_offset, width - 2 * horizontal_margin, 1, QColor(r, g, b)); } } nageru-2.3.0/nageru/vu_common.h000066400000000000000000000005521450736322200164370ustar00rootroot00000000000000#ifndef _VU_COMMON_H #define _VU_COMMON_H 1 class QPainter; double lufs_to_pos(float level_lu, int height, float min_level, float max_level); void draw_vu_meter(QPainter &painter, int width, int height, int horizontal_margin, double segment_margin, bool is_on, float min_level, float max_level, bool flip, int y_offset = 0); #endif // !defined(_VU_COMMON_H) nageru-2.3.0/nageru/vumeter.cpp000066400000000000000000000043271450736322200164630ustar00rootroot00000000000000#include "vumeter.h" #include #include #include "vu_common.h" class QPaintEvent; class QResizeEvent; using namespace std; VUMeter::VUMeter(QWidget *parent) : QWidget(parent) { } void VUMeter::resizeEvent(QResizeEvent *event) { recalculate_pixmaps(); } void VUMeter::paintEvent(QPaintEvent *event) { QPainter painter(this); float level_lufs[2], peak_lufs[2]; { lock_guard lock(level_mutex); level_lufs[0] = this->level_lufs[0]; level_lufs[1] = this->level_lufs[1]; peak_lufs[0] = this->peak_lufs[0]; peak_lufs[1] = this->peak_lufs[1]; } int mid = width() / 2; for (unsigned channel = 0; channel < 2; ++channel) { int left = (channel == 0) ? 0 : mid; int right = (channel == 0) ? mid : width(); float level_lu = level_lufs[channel] - ref_level_lufs; int on_pos = lrint(lufs_to_pos(level_lu, height())); QRect off_rect(left, 0, right - left, on_pos); QRect on_rect(left, on_pos, right - left, height() - on_pos); painter.drawPixmap(off_rect, off_pixmap, off_rect); painter.drawPixmap(on_rect, on_pixmap, on_rect); float peak_lu = peak_lufs[channel] - ref_level_lufs; if (peak_lu >= min_level && peak_lu <= max_level) { int peak_pos = lrint(lufs_to_pos(peak_lu, height())); QRect peak_rect(left, peak_pos - 1, right, 2); painter.drawPixmap(peak_rect, full_on_pixmap, peak_rect); } } } void VUMeter::recalculate_pixmaps() { full_on_pixmap = QPixmap(width(), height()); QPainter full_on_painter(&full_on_pixmap); full_on_painter.fillRect(0, 0, width(), height(), parentWidget()->palette().window()); draw_vu_meter(full_on_painter, width(), height(), 0, 0.0, true, min_level, max_level, /*flip=*/false); float margin = 0.5 * (width() - 20); on_pixmap = QPixmap(width(), height()); QPainter on_painter(&on_pixmap); on_painter.fillRect(0, 0, width(), height(), parentWidget()->palette().window()); draw_vu_meter(on_painter, width(), height(), margin, 2.0, true, min_level, max_level, /*flip=*/false); off_pixmap = QPixmap(width(), height()); QPainter off_painter(&off_pixmap); off_painter.fillRect(0, 0, width(), height(), parentWidget()->palette().window()); draw_vu_meter(off_painter, width(), height(), margin, 2.0, false, min_level, max_level, /*flip=*/false); } nageru-2.3.0/nageru/vumeter.h000066400000000000000000000033371450736322200161300ustar00rootroot00000000000000#ifndef VUMETER_H #define VUMETER_H #include #include #include #include #include #include "vu_common.h" class QObject; class QPaintEvent; class QResizeEvent; class VUMeter : public QWidget { Q_OBJECT public: VUMeter(QWidget *parent); void set_level(float level_lufs) { set_level(level_lufs, level_lufs); } void set_level(float level_lufs_left, float level_lufs_right) { std::lock_guard lock(level_mutex); this->level_lufs[0] = level_lufs_left; this->level_lufs[1] = level_lufs_right; QMetaObject::invokeMethod(this, "update", Qt::AutoConnection); } void set_peak(float peak_lufs) { set_peak(peak_lufs, peak_lufs); } void set_peak(float peak_lufs_left, float peak_lufs_right) { std::lock_guard lock(level_mutex); this->peak_lufs[0] = peak_lufs_left; this->peak_lufs[1] = peak_lufs_right; QMetaObject::invokeMethod(this, "update", Qt::AutoConnection); } double lufs_to_pos(float level_lu, int height) { return ::lufs_to_pos(level_lu, height, min_level, max_level); } void set_min_level(float min_level) { this->min_level = min_level; recalculate_pixmaps(); } void set_max_level(float max_level) { this->max_level = max_level; recalculate_pixmaps(); } void set_ref_level(float ref_level_lufs) { this->ref_level_lufs = ref_level_lufs; } private: void resizeEvent(QResizeEvent *event) override; void paintEvent(QPaintEvent *event) override; void recalculate_pixmaps(); std::mutex level_mutex; float level_lufs[2] { -HUGE_VALF, -HUGE_VALF }; float peak_lufs[2] { -HUGE_VALF, -HUGE_VALF }; float min_level = -18.0f, max_level = 9.0f, ref_level_lufs = -23.0f; QPixmap full_on_pixmap, on_pixmap, off_pixmap; }; #endif nageru-2.3.0/nageru/x264_dynamic.cpp000066400000000000000000000074711450736322200172060ustar00rootroot00000000000000#include "x264_dynamic.h" #include #include #include #include #include #include #include using namespace std; X264Dynamic load_x264_for_bit_depth(unsigned depth) { X264Dynamic dyn; #if defined(X264_BIT_DEPTH) && X264_BIT_DEPTH == 0 bool suitable = true; // x264 compiled to support all bit depths. #elif defined(X264_BIT_DEPTH) bool suitable = X264_BIT_DEPTH >= depth; #else bool suitable = unsigned(x264_bit_depth) >= depth; #endif if (suitable) { // Just use the one we are linked to. dyn.handle = nullptr; dyn.x264_encoder_close = x264_encoder_close; dyn.x264_encoder_delayed_frames = x264_encoder_delayed_frames; dyn.x264_encoder_encode = x264_encoder_encode; dyn.x264_encoder_headers = x264_encoder_headers; dyn.x264_encoder_open = x264_encoder_open; dyn.x264_encoder_parameters = x264_encoder_parameters; dyn.x264_encoder_reconfig = x264_encoder_reconfig; dyn.x264_param_apply_profile = x264_param_apply_profile; dyn.x264_param_default_preset = x264_param_default_preset; dyn.x264_param_parse = x264_param_parse; dyn.x264_picture_init = x264_picture_init; return dyn; } // Uh-oh, our currently loaded library doesn't have the required support. // Let's try to dynamically load a 10-bit version; in particular, Debian // has a version in /usr/lib/x86_64-linux-gnu/x264-10bit/libx264.so., // so we try to figure out where our libx264 comes from, and modify that path. string x264_dir, x264_suffix; void *handle = dlopen(nullptr, RTLD_NOW); link_map *m; int err = dlinfo(handle, RTLD_DI_LINKMAP, &m); assert(err != -1); for ( ; m != nullptr; m = m->l_next) { if (m->l_name == nullptr) { continue; } const char *ptr = strstr(m->l_name, "/libx264.so."); if (ptr != nullptr) { x264_dir = string(m->l_name, ptr - m->l_name); x264_suffix = string(ptr, (m->l_name + strlen(m->l_name)) - ptr); break; } } dlclose(handle); if (x264_dir.empty()) { fprintf(stderr, "ERROR: Requested %d-bit x264, but is not linked to such an x264, and could not find one.\n", depth); abort(); } string x264_10b_string = x264_dir + "/x264-10bit" + x264_suffix; void *x264_dlhandle = dlopen(x264_10b_string.c_str(), RTLD_NOW); if (x264_dlhandle == nullptr) { fprintf(stderr, "ERROR: Requested %d-bit x264, but is not linked to such an x264, and %s would not load.\n", depth, x264_10b_string.c_str()); abort(); } dyn.handle = x264_dlhandle; dyn.x264_encoder_close = (decltype(::x264_encoder_close) *)dlsym(x264_dlhandle, "x264_encoder_close"); dyn.x264_encoder_delayed_frames = (decltype(::x264_encoder_delayed_frames) *)dlsym(x264_dlhandle, "x264_encoder_delayed_frames"); dyn.x264_encoder_encode = (decltype(::x264_encoder_encode) *)dlsym(x264_dlhandle, "x264_encoder_encode"); dyn.x264_encoder_headers = (decltype(::x264_encoder_headers) *)dlsym(x264_dlhandle, "x264_encoder_headers"); char x264_encoder_open_symname[256]; snprintf(x264_encoder_open_symname, sizeof(x264_encoder_open_symname), "x264_encoder_open_%d", X264_BUILD); dyn.x264_encoder_open = (decltype(::x264_encoder_open) *)dlsym(x264_dlhandle, x264_encoder_open_symname); dyn.x264_encoder_parameters = (decltype(::x264_encoder_parameters) *)dlsym(x264_dlhandle, "x264_encoder_parameters"); dyn.x264_encoder_reconfig = (decltype(::x264_encoder_reconfig) *)dlsym(x264_dlhandle, "x264_encoder_reconfig"); dyn.x264_param_apply_profile = (decltype(::x264_param_apply_profile) *)dlsym(x264_dlhandle, "x264_param_apply_profile"); dyn.x264_param_default_preset = (decltype(::x264_param_default_preset) *)dlsym(x264_dlhandle, "x264_param_default_preset"); dyn.x264_param_parse = (decltype(::x264_param_parse) *)dlsym(x264_dlhandle, "x264_param_parse"); dyn.x264_picture_init = (decltype(::x264_picture_init) *)dlsym(x264_dlhandle, "x264_picture_init"); return dyn; } nageru-2.3.0/nageru/x264_dynamic.h000066400000000000000000000017051450736322200166450ustar00rootroot00000000000000#ifndef _X264_DYNAMIC_H #define _X264_DYNAMIC_H 1 // A helper to load 10-bit x264 if needed. #include extern "C" { #include } struct X264Dynamic { void *handle; // If not nullptr, needs to be dlclose()d. decltype(::x264_encoder_close) *x264_encoder_close; decltype(::x264_encoder_delayed_frames) *x264_encoder_delayed_frames; decltype(::x264_encoder_encode) *x264_encoder_encode; decltype(::x264_encoder_headers) *x264_encoder_headers; decltype(::x264_encoder_open) *x264_encoder_open; decltype(::x264_encoder_parameters) *x264_encoder_parameters; decltype(::x264_encoder_reconfig) *x264_encoder_reconfig; decltype(::x264_param_apply_profile) *x264_param_apply_profile; decltype(::x264_param_default_preset) *x264_param_default_preset; decltype(::x264_param_parse) *x264_param_parse; decltype(::x264_picture_init) *x264_picture_init; }; X264Dynamic load_x264_for_bit_depth(unsigned depth); #endif // !defined(_X264_DYNAMIC_H) nageru-2.3.0/nageru/x264_encoder.cpp000066400000000000000000000374721450736322200172050ustar00rootroot00000000000000#include "x264_encoder.h" #include #include #include #include #include #include #include #include #include #include #include #include "defs.h" #include "flags.h" #include "shared/metrics.h" #include "shared/mux.h" #include "print_latency.h" #include "shared/timebase.h" #include "x264_dynamic.h" #include "x264_speed_control.h" extern "C" { #include #include } using namespace movit; using namespace std; using namespace std::chrono; using namespace std::placeholders; namespace { // X264Encoder can be restarted if --record-x264-video is set, so make these // metrics global. atomic metric_x264_queued_frames{0}; atomic metric_x264_max_queued_frames{X264_QUEUE_LENGTH}; atomic metric_x264_dropped_frames{0}; atomic metric_x264_output_frames_i{0}; atomic metric_x264_output_frames_p{0}; atomic metric_x264_output_frames_b{0}; Histogram metric_x264_crf; LatencyHistogram x264_latency_histogram; atomic metric_x264_disk_queued_frames{0}; atomic metric_x264_disk_max_queued_frames{X264_QUEUE_LENGTH}; atomic metric_x264_disk_dropped_frames{0}; atomic metric_x264_disk_output_frames_i{0}; atomic metric_x264_disk_output_frames_p{0}; atomic metric_x264_disk_output_frames_b{0}; Histogram metric_x264_disk_crf; LatencyHistogram x264_disk_latency_histogram; once_flag x264_metrics_inited, x264_disk_metrics_inited; void update_vbv_settings(x264_param_t *param) { if (global_flags.x264_bitrate == -1) { return; } param->rc.i_vbv_buffer_size = param->rc.i_bitrate; // One-second VBV. param->rc.i_vbv_max_bitrate = param->rc.i_bitrate; // CBR. } } // namespace X264Encoder::X264Encoder(const AVOutputFormat *oformat, bool use_separate_disk_params) : wants_global_headers(oformat->flags & AVFMT_GLOBALHEADER), use_separate_disk_params(use_separate_disk_params), dyn(load_x264_for_bit_depth(global_flags.bit_depth)) { if (use_separate_disk_params) { call_once(x264_disk_metrics_inited, []{ global_metrics.add("x264_queued_frames", {{ "encode", "separate_disk" }}, &metric_x264_disk_queued_frames, Metrics::TYPE_GAUGE); global_metrics.add("x264_max_queued_frames", {{ "encode", "separate_disk" }}, &metric_x264_disk_max_queued_frames, Metrics::TYPE_GAUGE); global_metrics.add("x264_dropped_frames", {{ "encode", "separate_disk" }}, &metric_x264_disk_dropped_frames); global_metrics.add("x264_output_frames", {{ "encode", "separate_disk" }, { "type", "i" }}, &metric_x264_disk_output_frames_i); global_metrics.add("x264_output_frames", {{ "encode", "separate_disk" }, { "type", "p" }}, &metric_x264_disk_output_frames_p); global_metrics.add("x264_output_frames", {{ "encode", "separate_disk" }, { "type", "b" }}, &metric_x264_disk_output_frames_b); metric_x264_disk_crf.init_uniform(50); global_metrics.add("x264_crf", {{ "encode", "separate_disk" }}, &metric_x264_disk_crf); x264_disk_latency_histogram.init("x264_disk"); }); } else { call_once(use_separate_disk_params ? x264_disk_metrics_inited : x264_metrics_inited, []{ global_metrics.add("x264_queued_frames", {{ "encode", "regular" }}, &metric_x264_queued_frames, Metrics::TYPE_GAUGE); global_metrics.add("x264_max_queued_frames", {{ "encode", "regular" }}, &metric_x264_max_queued_frames, Metrics::TYPE_GAUGE); global_metrics.add("x264_dropped_frames", {{ "encode", "regular" }}, &metric_x264_dropped_frames); global_metrics.add("x264_output_frames", {{ "encode", "regular" }, { "type", "i" }}, &metric_x264_output_frames_i); global_metrics.add("x264_output_frames", {{ "encode", "regular" }, { "type", "p" }}, &metric_x264_output_frames_p); global_metrics.add("x264_output_frames", {{ "encode", "regular" }, { "type", "b" }}, &metric_x264_output_frames_b); metric_x264_crf.init_uniform(50); global_metrics.add("x264_crf", {{ "encode", "regular" }}, &metric_x264_crf); x264_latency_histogram.init("x264"); }); } size_t bytes_per_pixel = global_flags.bit_depth > 8 ? 2 : 1; frame_pool.reset(new uint8_t[global_flags.width * global_flags.height * 2 * bytes_per_pixel * X264_QUEUE_LENGTH]); for (unsigned i = 0; i < X264_QUEUE_LENGTH; ++i) { free_frames.push(frame_pool.get() + i * (global_flags.width * global_flags.height * 2 * bytes_per_pixel)); } encoder_thread = thread(&X264Encoder::encoder_thread_func, this); } X264Encoder::~X264Encoder() { should_quit = true; queued_frames_nonempty.notify_all(); encoder_thread.join(); if (dyn.handle) { dlclose(dyn.handle); } } void X264Encoder::add_frame(int64_t pts, int64_t duration, YCbCrLumaCoefficients ycbcr_coefficients, const uint8_t *data, const ReceivedTimestamps &received_ts) { assert(!should_quit); QueuedFrame qf; qf.pts = pts; qf.duration = duration; qf.ycbcr_coefficients = ycbcr_coefficients; qf.received_ts = received_ts; { lock_guard lock(mu); if (free_frames.empty()) { if (use_separate_disk_params) { fprintf(stderr, "WARNING: x264 queue full (disk encoder), dropping frame with pts %" PRId64 "\n", pts); ++metric_x264_disk_dropped_frames; } else { fprintf(stderr, "WARNING: x264 queue full, dropping frame with pts %" PRId64 "\n", pts); ++metric_x264_dropped_frames; } return; } qf.data = free_frames.front(); free_frames.pop(); } size_t bytes_per_pixel = global_flags.bit_depth > 8 ? 2 : 1; memcpy(qf.data, data, global_flags.width * global_flags.height * 2 * bytes_per_pixel); { lock_guard lock(mu); queued_frames.push(qf); queued_frames_nonempty.notify_all(); if (use_separate_disk_params) { metric_x264_disk_queued_frames = queued_frames.size(); } else { metric_x264_queued_frames = queued_frames.size(); } } } void X264Encoder::init_x264() { x264_param_t param; if (use_separate_disk_params) { dyn.x264_param_default_preset(¶m, global_flags.x264_separate_disk_preset.c_str(), global_flags.x264_separate_disk_tune.c_str()); } else { dyn.x264_param_default_preset(¶m, global_flags.x264_preset.c_str(), global_flags.x264_tune.c_str()); } param.i_width = global_flags.width; param.i_height = global_flags.height; param.i_csp = X264_CSP_NV12; if (global_flags.bit_depth > 8) { param.i_csp |= X264_CSP_HIGH_DEPTH; } param.b_vfr_input = 1; param.i_timebase_num = 1; param.i_timebase_den = TIMEBASE; param.i_keyint_max = 50; // About one second. if (!use_separate_disk_params && global_flags.x264_speedcontrol) { param.i_frame_reference = 16; // Because speedcontrol is never allowed to change this above what we set at start. } #if X264_BUILD >= 153 param.i_bitdepth = global_flags.bit_depth; #endif // NOTE: These should be in sync with the ones in quicksync_encoder.cpp (sps_rbsp()). param.vui.i_vidformat = 5; // Unspecified. param.vui.b_fullrange = 0; param.vui.i_colorprim = 1; // BT.709. param.vui.i_transfer = 13; // sRGB. if (global_flags.ycbcr_rec709_coefficients) { param.vui.i_colmatrix = 1; // BT.709. } else { param.vui.i_colmatrix = 6; // BT.601/SMPTE 170M. } const double crf = use_separate_disk_params ? global_flags.x264_separate_disk_crf : global_flags.x264_crf; const int bitrate = use_separate_disk_params ? global_flags.x264_separate_disk_bitrate : global_flags.x264_bitrate; if (!isinf(crf)) { param.rc.i_rc_method = X264_RC_CRF; param.rc.f_rf_constant = crf; } else { param.rc.i_rc_method = X264_RC_ABR; param.rc.i_bitrate = bitrate; // If the user wants to cap the max rate, it is also reasonable // to assume that they are fine with the stream constantly // being around that rate even for very low-complexity content; // the obvious and extreme example being a static black picture. // // One would think it's fine to have low-complexity content use // less bitrate, but it seems to cause problems in practice; // e.g. VLC seems to often drop the stream (similar to a buffer // underrun) in such cases, but only when streaming from Nageru, // not when reading a dump of the same stream from disk. // I'm not 100% sure whether it's in VLC (possibly some buffering // in the HTTP layer), in microhttpd or somewhere in Nageru itself, // but it's a typical case of problems that can arise. Similarly, // TCP's congestion control is not always fond of the rate staying // low for a while and then rising quickly -- a variation on the same // problem. // // We solve this by simply asking x264 to fill in dummy bits // in these cases, so that the bitrate stays reasonable constant. // It's a waste of bandwidth, but it makes things go much more // smoothly in these cases. (We don't do it if VBV control is off // in general, not the least because it makes no sense and x264 // thus ignores the parameter.) param.rc.b_filler = 1; } if (!use_separate_disk_params) { update_vbv_settings(¶m); } // Occasionally players have problem with extremely low quantizers; // be on the safe side. Shouldn't affect quality in any meaningful way. param.rc.i_qp_min = 5; const vector &extra_param = use_separate_disk_params ? global_flags.x264_separate_disk_extra_param : global_flags.x264_extra_param; for (const string &str : extra_param) { const size_t pos = str.find(','); if (pos == string::npos) { if (dyn.x264_param_parse(¶m, str.c_str(), nullptr) != 0) { fprintf(stderr, "ERROR: x264 rejected parameter '%s'\n", str.c_str()); } } else { const string key = str.substr(0, pos); const string value = str.substr(pos + 1); if (dyn.x264_param_parse(¶m, key.c_str(), value.c_str()) != 0) { fprintf(stderr, "ERROR: x264 rejected parameter '%s' set to '%s'\n", key.c_str(), value.c_str()); } } } if (global_flags.bit_depth > 8) { dyn.x264_param_apply_profile(¶m, "high10"); } else { dyn.x264_param_apply_profile(¶m, "high"); } param.b_repeat_headers = !wants_global_headers; x264 = dyn.x264_encoder_open(¶m); if (x264 == nullptr) { fprintf(stderr, "ERROR: x264 initialization failed.\n"); abort(); } if (!use_separate_disk_params && global_flags.x264_speedcontrol) { speed_control.reset(new X264SpeedControl(x264, /*f_speed=*/1.0f, X264_QUEUE_LENGTH, /*f_buffer_init=*/1.0f)); } if (wants_global_headers) { x264_nal_t *nal; int num_nal; dyn.x264_encoder_headers(x264, &nal, &num_nal); for (int i = 0; i < num_nal; ++i) { if (nal[i].i_type == NAL_SEI) { // Don't put the SEI in extradata; make it part of the first frame instead. buffered_sei += string((const char *)nal[i].p_payload, nal[i].i_payload); } else { global_headers += string((const char *)nal[i].p_payload, nal[i].i_payload); } } } } void X264Encoder::encoder_thread_func() { if (nice(5) == -1) { // Note that x264 further nices some of its threads. perror("nice()"); // No exit; it's not fatal. } pthread_setname_np(pthread_self(), "x264_encode"); init_x264(); x264_init_done = true; bool frames_left; do { QueuedFrame qf; // Wait for a queued frame, then dequeue it. { unique_lock lock(mu); queued_frames_nonempty.wait(lock, [this]() { return !queued_frames.empty() || should_quit; }); if (!queued_frames.empty()) { qf = queued_frames.front(); queued_frames.pop(); } else { qf.pts = -1; qf.duration = -1; qf.data = nullptr; } if (use_separate_disk_params) { metric_x264_disk_queued_frames = queued_frames.size(); } else { metric_x264_queued_frames = queued_frames.size(); } frames_left = !queued_frames.empty(); } encode_frame(qf); { lock_guard lock(mu); free_frames.push(qf.data); } // We should quit only if the should_quit flag is set _and_ we have nothing // in either queue. } while (!should_quit || frames_left || dyn.x264_encoder_delayed_frames(x264) > 0); dyn.x264_encoder_close(x264); } void X264Encoder::encode_frame(X264Encoder::QueuedFrame qf) { x264_nal_t *nal = nullptr; int num_nal = 0; x264_picture_t pic; x264_picture_t *input_pic = nullptr; if (qf.data) { dyn.x264_picture_init(&pic); pic.i_pts = qf.pts; if (global_flags.bit_depth > 8) { pic.img.i_csp = X264_CSP_NV12 | X264_CSP_HIGH_DEPTH; pic.img.i_plane = 2; pic.img.plane[0] = qf.data; pic.img.i_stride[0] = global_flags.width * sizeof(uint16_t); pic.img.plane[1] = qf.data + global_flags.width * global_flags.height * sizeof(uint16_t); pic.img.i_stride[1] = global_flags.width / 2 * sizeof(uint32_t); } else { pic.img.i_csp = X264_CSP_NV12; pic.img.i_plane = 2; pic.img.plane[0] = qf.data; pic.img.i_stride[0] = global_flags.width; pic.img.plane[1] = qf.data + global_flags.width * global_flags.height; pic.img.i_stride[1] = global_flags.width / 2 * sizeof(uint16_t); } pic.opaque = reinterpret_cast(intptr_t(qf.duration)); input_pic = &pic; frames_being_encoded[qf.pts] = qf.received_ts; } unsigned new_rate = new_bitrate_kbit.load(); // Can be 0 for no change. if (speed_control) { speed_control->set_config_override_function(bind(&speed_control_override_func, new_rate, qf.ycbcr_coefficients, _1)); } else { x264_param_t param; dyn.x264_encoder_parameters(x264, ¶m); speed_control_override_func(new_rate, qf.ycbcr_coefficients, ¶m); dyn.x264_encoder_reconfig(x264, ¶m); } if (speed_control) { float queue_fill_ratio; { lock_guard lock(mu); queue_fill_ratio = float(free_frames.size()) / X264_QUEUE_LENGTH; } speed_control->before_frame(queue_fill_ratio, X264_QUEUE_LENGTH, 1e6 * qf.duration / TIMEBASE); } dyn.x264_encoder_encode(x264, &nal, &num_nal, input_pic, &pic); if (speed_control) { speed_control->after_frame(); } if (num_nal == 0) return; if (use_separate_disk_params) { if (IS_X264_TYPE_I(pic.i_type)) { ++metric_x264_disk_output_frames_i; } else if (IS_X264_TYPE_B(pic.i_type)) { ++metric_x264_disk_output_frames_b; } else { ++metric_x264_disk_output_frames_p; } metric_x264_disk_crf.count_event(pic.prop.f_crf_avg); } else { if (IS_X264_TYPE_I(pic.i_type)) { ++metric_x264_output_frames_i; } else if (IS_X264_TYPE_B(pic.i_type)) { ++metric_x264_output_frames_b; } else { ++metric_x264_output_frames_p; } metric_x264_crf.count_event(pic.prop.f_crf_avg); } if (frames_being_encoded.count(pic.i_pts)) { ReceivedTimestamps received_ts = frames_being_encoded[pic.i_pts]; frames_being_encoded.erase(pic.i_pts); static int frameno = 0; print_latency("Current x264 latency (video inputs → network mux):", received_ts, (pic.i_type == X264_TYPE_B || pic.i_type == X264_TYPE_BREF), &frameno, &x264_latency_histogram); } else { assert(false); } // We really need one AVPacket for the entire frame, it seems, // so combine it all. size_t num_bytes = buffered_sei.size(); for (int i = 0; i < num_nal; ++i) { num_bytes += nal[i].i_payload; } unique_ptr data(new uint8_t[num_bytes]); uint8_t *ptr = data.get(); if (!buffered_sei.empty()) { memcpy(ptr, buffered_sei.data(), buffered_sei.size()); ptr += buffered_sei.size(); buffered_sei.clear(); } for (int i = 0; i < num_nal; ++i) { memcpy(ptr, nal[i].p_payload, nal[i].i_payload); ptr += nal[i].i_payload; } AVPacket pkt; memset(&pkt, 0, sizeof(pkt)); pkt.buf = nullptr; pkt.data = data.get(); pkt.size = num_bytes; pkt.stream_index = 0; if (pic.b_keyframe) { pkt.flags = AV_PKT_FLAG_KEY; } else { pkt.flags = 0; } pkt.duration = reinterpret_cast(pic.opaque); for (Mux *mux : muxes) { mux->add_packet(pkt, pic.i_pts, pic.i_dts); } } void X264Encoder::speed_control_override_func(unsigned bitrate_kbit, movit::YCbCrLumaCoefficients ycbcr_coefficients, x264_param_t *param) { if (bitrate_kbit != 0) { param->rc.i_bitrate = bitrate_kbit; update_vbv_settings(param); } if (ycbcr_coefficients == YCBCR_REC_709) { param->vui.i_colmatrix = 1; // BT.709. } else { assert(ycbcr_coefficients == YCBCR_REC_601); param->vui.i_colmatrix = 6; // BT.601/SMPTE 170M. } } nageru-2.3.0/nageru/x264_encoder.h000066400000000000000000000073111450736322200166370ustar00rootroot00000000000000// A wrapper around x264, to encode video in higher quality than Quick Sync // can give us. We maintain a queue of uncompressed Y'CbCr frames (of 50 frames, // so a little under 100 MB at 720p), then have a separate thread pull out // those threads as fast as we can to give it to x264 for encoding. // // The encoding threads are niced down because mixing is more important than // encoding; if we lose frames in mixing, we'll lose frames to disk _and_ // to the stream, as where if we lose frames in encoding, we'll lose frames // to the stream only, so the latter is strictly better. More importantly, // this allows speedcontrol to do its thing without disturbing the mixer. #ifndef _X264ENCODE_H #define _X264ENCODE_H 1 #include #include #include #include #include #include #include #include #include #include #include #include #include extern "C" { #include } #include #include "defs.h" #include "shared/metrics.h" #include "print_latency.h" #include "video_codec_interface.h" #include "x264_dynamic.h" class Mux; class X264SpeedControl; class X264Encoder : public VideoCodecInterface { public: X264Encoder(const AVOutputFormat *oformat, bool use_separate_disk_params); // Does not take ownership. // Called after the last frame. Will block; once this returns, // the last data is flushed. ~X264Encoder() override; // Must be called before first frame. Does not take ownership. void add_mux(Mux *mux) override { muxes.push_back(mux); } // is taken to be raw NV12 data of WIDTHxHEIGHT resolution. // Does not block. void add_frame(int64_t pts, int64_t duration, movit::YCbCrLumaCoefficients ycbcr_coefficients, const uint8_t *data, const ReceivedTimestamps &received_ts) override; std::string get_global_headers() const override { while (!x264_init_done) { sched_yield(); } return global_headers; } void change_bitrate(unsigned rate_kbit) { new_bitrate_kbit = rate_kbit; } private: struct QueuedFrame { int64_t pts, duration; movit::YCbCrLumaCoefficients ycbcr_coefficients; uint8_t *data; ReceivedTimestamps received_ts; }; void encoder_thread_func(); void init_x264(); void encode_frame(QueuedFrame qf); // bitrate_kbit can be 0 for no change. static void speed_control_override_func(unsigned bitrate_kbit, movit::YCbCrLumaCoefficients coefficients, x264_param_t *param); // One big memory chunk of all 50 (or whatever) frames, allocated in // the constructor. All data functions just use pointers into this // pool. std::unique_ptr frame_pool; std::vector muxes; const bool wants_global_headers; const bool use_separate_disk_params; std::string global_headers; std::string buffered_sei; // Will be output before first frame, if any. std::thread encoder_thread; std::atomic x264_init_done{false}; std::atomic should_quit{false}; X264Dynamic dyn; x264_t *x264; std::unique_ptr speed_control; std::atomic new_bitrate_kbit{0}; // 0 for no change. // Protects everything below it. std::mutex mu; // Frames that are not being encoded or waiting to be encoded, // so that add_frame() can use new ones. std::queue free_frames; // Frames that are waiting to be encoded (ie., add_frame() has been // called, but they are not picked up for encoding yet). std::queue queued_frames; // Whenever the state of changes. std::condition_variable queued_frames_nonempty; // Key is the pts of the frame. std::unordered_map frames_being_encoded; }; #endif // !defined(_X264ENCODE_H) nageru-2.3.0/nageru/x264_speed_control.cpp000066400000000000000000000304141450736322200204130ustar00rootroot00000000000000#include "x264_speed_control.h" #include #include #include #include #include #include #include #include #include #include "flags.h" #include "shared/metrics.h" using namespace std; using namespace std::chrono; #define SC_PRESETS 23 X264SpeedControl::X264SpeedControl(x264_t *x264, float f_speed, int i_buffer_size, float f_buffer_init) : dyn(load_x264_for_bit_depth(global_flags.bit_depth)), x264(x264), f_speed(f_speed) { x264_param_t param; dyn.x264_encoder_parameters(x264, ¶m); float fps = (float)param.i_fps_num / param.i_fps_den; uspf = 1e6 / fps; set_buffer_size(i_buffer_size); buffer_fill = buffer_size * f_buffer_init; buffer_fill = max(buffer_fill, uspf); buffer_fill = min(buffer_fill, buffer_size); timestamp = steady_clock::now(); preset = -1; cplx_num = 3e3; //FIXME estimate initial complexity cplx_den = .1; stat.min_buffer = buffer_size; stat.max_buffer = 0; stat.avg_preset = 0.0; stat.den = 0; metric_x264_speedcontrol_buffer_available_seconds = buffer_fill * 1e-6; metric_x264_speedcontrol_buffer_size_seconds = buffer_size * 1e-6; metric_x264_speedcontrol_preset_used_frames.init_uniform(SC_PRESETS); global_metrics.add("x264_speedcontrol_preset_used_frames", &metric_x264_speedcontrol_preset_used_frames); global_metrics.add("x264_speedcontrol_buffer_available_seconds", &metric_x264_speedcontrol_buffer_available_seconds, Metrics::TYPE_GAUGE); global_metrics.add("x264_speedcontrol_buffer_size_seconds", &metric_x264_speedcontrol_buffer_size_seconds, Metrics::TYPE_GAUGE); global_metrics.add("x264_speedcontrol_idle_frames", &metric_x264_speedcontrol_idle_frames); global_metrics.add("x264_speedcontrol_late_frames", &metric_x264_speedcontrol_late_frames); } X264SpeedControl::~X264SpeedControl() { fprintf(stderr, "speedcontrol: avg preset=%.3f buffer min=%.3f max=%.3f\n", stat.avg_preset / stat.den, (float)stat.min_buffer / buffer_size, (float)stat.max_buffer / buffer_size ); // x264_log( x264, X264_LOG_INFO, "speedcontrol: avg cplx=%.5f\n", cplx_num / cplx_den ); if (dyn.handle) { dlclose(dyn.handle); } } typedef struct { float time; // relative encoding time, compared to the other presets int subme; int me; int refs; int mix; int trellis; int partitions; int direct; int merange; } sc_preset_t; // The actual presets, including the equivalent commandline options. Note that // all presets are benchmarked with --weightp 1 --mbtree --rc-lookahead 20 // --b-adapt 1 --bframes 3 on top of the given settings (equivalent settings to // the "faster" preset). Timings and SSIM measurements were done on a four cores // of a 6-core Coffee Lake i5 2.8 GHz on the first 1000 frames of “Elephants // Dream” in 1080p. See experiments/measure-x264.pl for a way to reproduce. // // Note that the two first and the two last are also used for extrapolation // should the desired time be outside the range. Thus, it is disadvantageous if // they are chosen so that the timings are too close to each other. static const sc_preset_t presets[SC_PRESETS] = { #define I4 X264_ANALYSE_I4x4 #define I8 X264_ANALYSE_I8x8 #define P4 X264_ANALYSE_PSUB8x8 #define P8 X264_ANALYSE_PSUB16x16 #define B8 X264_ANALYSE_BSUB16x16 // Preset 0: 17.386db, --preset superfast { .time= 1.000, .subme=1, .me=X264_ME_DIA, .refs=1, .mix=0, .trellis=0, .partitions=I8|I4, .direct=1, .merange=16 }, // Preset 1: 17.919db, --preset superfast --subme 2 { .time= 1.707, .subme=2, .me=X264_ME_DIA, .refs=1, .mix=0, .trellis=0, .partitions=I8|I4, .direct=1, .merange=16 }, // Preset 2: 18.051db, --preset veryfast { .time= 1.832, .subme=2, .me=X264_ME_HEX, .refs=1, .mix=0, .trellis=0, .partitions=I8|I4|P8|B8, .direct=1, .merange=16 }, // Preset 3: 18.422db, --preset veryfast --subme 3 { .time= 1.853, .subme=3, .me=X264_ME_HEX, .refs=1, .mix=0, .trellis=0, .partitions=I8|I4|P8|B8, .direct=1, .merange=16 }, // Preset 4: 18.514db, --preset veryfast --subme 3 --ref 2 { .time= 1.925, .subme=3, .me=X264_ME_HEX, .refs=2, .mix=0, .trellis=0, .partitions=I8|I4|P8|B8, .direct=1, .merange=16 }, // Preset 5: 18.564db, --preset veryfast --subme 4 --ref 2 { .time= 2.111, .subme=4, .me=X264_ME_HEX, .refs=2, .mix=0, .trellis=0, .partitions=I8|I4|P8|B8, .direct=1, .merange=16 }, // Preset 6: 18.411db, --preset faster { .time= 2.240, .subme=4, .me=X264_ME_HEX, .refs=2, .mix=0, .trellis=1, .partitions=I8|I4|P8|B8, .direct=1, .merange=16 }, // Preset 7: 18.429db, --preset faster --mixed-refs { .time= 2.414, .subme=4, .me=X264_ME_HEX, .refs=2, .mix=1, .trellis=1, .partitions=I8|I4|P8|B8, .direct=1, .merange=16 }, // Preset 8: 18.454db, --preset faster --mixed-refs --subme 5 { .time= 2.888, .subme=5, .me=X264_ME_HEX, .refs=2, .mix=1, .trellis=1, .partitions=I8|I4|P8|B8, .direct=1, .merange=16 }, // Preset 9: 18.528db, --preset fast { .time= 3.570, .subme=6, .me=X264_ME_HEX, .refs=2, .mix=1, .trellis=1, .partitions=I8|I4|P8|B8, .direct=1, .merange=16 }, // Preset 10: 18.762db, --preset fast --subme 7 { .time= 3.698, .subme=7, .me=X264_ME_HEX, .refs=2, .mix=1, .trellis=1, .partitions=I8|I4|P8|B8, .direct=1, .merange=16 }, // Preset 11: 18.819db, --preset medium { .time= 4.174, .subme=7, .me=X264_ME_HEX, .refs=3, .mix=1, .trellis=1, .partitions=I8|I4|P8|B8, .direct=1, .merange=16 }, // Preset 12: 18.889db, --preset medium --subme 8 { .time= 5.155, .subme=8, .me=X264_ME_HEX, .refs=3, .mix=1, .trellis=1, .partitions=I8|I4|P8|B8, .direct=1, .merange=16 }, // Preset 13: 19.127db, --preset medium --subme 8 --trellis 2 { .time= 7.237, .subme=8, .me=X264_ME_HEX, .refs=3, .mix=1, .trellis=2, .partitions=I8|I4|P8|B8, .direct=1, .merange=16 }, // Preset 14: 19.118db, --preset medium --subme 8 --trellis 2 --direct auto { .time= 7.240, .subme=8, .me=X264_ME_HEX, .refs=3, .mix=1, .trellis=2, .partitions=I8|I4|P8|B8, .direct=3, .merange=16 }, // Preset 15: 19.172db, --preset slow { .time= 7.910, .subme=8, .me=X264_ME_HEX, .refs=5, .mix=1, .trellis=2, .partitions=I8|I4|P8|B8, .direct=3, .merange=16 }, // Preset 16: 19.208db, --preset slow --subme 9 { .time= 8.091, .subme=9, .me=X264_ME_HEX, .refs=5, .mix=1, .trellis=2, .partitions=I8|I4|P8|B8, .direct=3, .merange=16 }, // Preset 17: 19.216db, --preset slow --subme 9 --me umh { .time= 9.539, .subme=9, .me=X264_ME_UMH, .refs=5, .mix=1, .trellis=2, .partitions=I8|I4|P8|B8, .direct=3, .merange=16 }, // Preset 18: 19.253db, --preset slow --subme 9 --me umh --ref 6 { .time=10.521, .subme=9, .me=X264_ME_UMH, .refs=6, .mix=1, .trellis=2, .partitions=I8|I4|P8|B8, .direct=3, .merange=16 }, // Preset 19: 19.275db, --preset slow --subme 9 --me umh --ref 7 { .time=11.461, .subme=9, .me=X264_ME_UMH, .refs=7, .mix=1, .trellis=2, .partitions=I8|I4|P8|B8, .direct=3, .merange=16 }, // Preset 20: 19.314db, --preset slower { .time=13.145, .subme=9, .me=X264_ME_UMH, .refs=8, .mix=1, .trellis=2, .partitions=I8|I4|P8|B8|P4, .direct=3, .merange=16 }, // Preset 21: 19.407db, --preset slower --subme 10 { .time=16.386, .subme=10, .me=X264_ME_UMH, .refs=8, .mix=1, .trellis=2, .partitions=I8|I4|P8|B8|P4, .direct=3, .merange=16 }, // Preset 22: 19.483db, --preset veryslow { .time=26.861, .subme=10, .me=X264_ME_UMH, .refs=16, .mix=1, .trellis=2, .partitions=I8|I4|P8|B8|P4, .direct=3, .merange=24 }, #undef I4 #undef I8 #undef P4 #undef P8 #undef B8 }; void X264SpeedControl::before_frame(float new_buffer_fill, int new_buffer_size, float new_uspf) { if (new_uspf > 0.0) { uspf = new_uspf; } if (new_buffer_size) { set_buffer_size(new_buffer_size); } buffer_fill = buffer_size * new_buffer_fill; metric_x264_speedcontrol_buffer_available_seconds = buffer_fill * 1e-6; steady_clock::time_point t; // update buffer state after encoding and outputting the previous frame(s) if (first) { t = timestamp = steady_clock::now(); first = false; } else { t = steady_clock::now(); } auto delta_t = t - timestamp; timestamp = t; // update the time predictor if (preset >= 0) { int cpu_time = duration_cast(cpu_time_last_frame).count(); cplx_num *= cplx_decay; cplx_den *= cplx_decay; cplx_num += cpu_time / presets[preset].time; ++cplx_den; stat.avg_preset += preset; ++stat.den; } stat.min_buffer = min(buffer_fill, stat.min_buffer); stat.max_buffer = max(buffer_fill, stat.max_buffer); if (buffer_fill >= buffer_size) { // oops, cpu was idle // not really an error, but we'll warn for debugging purposes static int64_t idle_t = 0; static steady_clock::time_point print_interval; static bool first = false; idle_t += buffer_fill - buffer_size; if (first || duration(t - print_interval).count() > 0.1) { //fprintf(stderr, "speedcontrol idle (%.6f sec)\n", idle_t/1e6); print_interval = t; idle_t = 0; first = false; } buffer_fill = buffer_size; metric_x264_speedcontrol_buffer_available_seconds = buffer_fill * 1e-6; ++metric_x264_speedcontrol_idle_frames; } else if (buffer_fill <= 0) { // oops, we're late // fprintf(stderr, "speedcontrol underflow (%.6f sec)\n", buffer_fill/1e6); ++metric_x264_speedcontrol_late_frames; } { // Pick the preset that should return the buffer to 3/4-full within a time // specified by compensation_period. // // NOTE: This doesn't actually do that, at least assuming the same target is // chosen for every frame; exactly what it does is unclear to me. It seems // to consistently undershoot a bit, so it needs to be saved by the second // predictor below. However, fixing the formula seems to yield somewhat less // stable results in practice; in particular, once the buffer is half-full // or so, it would give us a negative target. Perhaps increasing // compensation_period would be a good idea, but initial (very brief) tests // did not yield good results. float target = uspf / f_speed * (buffer_fill + compensation_period) / (buffer_size*3/4 + compensation_period); float cplx = cplx_num / cplx_den; float set, t0, t1; float filled = (float) buffer_fill / buffer_size; int i; t0 = presets[0].time * cplx; for (i = 1; ; i++) { t1 = presets[i].time * cplx; if (t1 >= target || i == SC_PRESETS - 1) break; t0 = t1; } // exponential interpolation between states set = i-1 + (log(target) - log(t0)) / (log(t1) - log(t0)); set = max(set, -5); set = min(set, (SC_PRESETS-1) + 5); // Even if our time estimations in the SC_PRESETS array are off // this will push us towards our target fullness float s1 = set; set += (40 * (filled-0.75)); float s2 = (40 * (filled-0.75)); set = min(max(set, 0), SC_PRESETS - 1); apply_preset(dither_preset(set)); if (global_flags.x264_speedcontrol_verbose) { static float cpu, wall, tgt, den; const float decay = 1-1/100.; cpu = cpu*decay + duration_cast(cpu_time_last_frame).count(); wall = wall*decay + duration_cast(delta_t).count(); tgt = tgt*decay + target; den = den*decay + 1; fprintf(stderr, "speed: %.2f+%.2f %d[%.5f] (t/c/w: %6.0f/%6.0f/%6.0f = %.4f) fps=%.2f\r", s1, s2, preset, (float)buffer_fill / buffer_size, tgt/den, cpu/den, wall/den, cpu/wall, 1e6*den/wall ); } } } void X264SpeedControl::after_frame() { cpu_time_last_frame = steady_clock::now() - timestamp; } void X264SpeedControl::set_buffer_size(int new_buffer_size) { new_buffer_size = max(3, new_buffer_size); buffer_size = new_buffer_size * uspf; cplx_decay = 1 - 1./new_buffer_size; compensation_period = buffer_size/4; metric_x264_speedcontrol_buffer_size_seconds = buffer_size * 1e-6; } int X264SpeedControl::dither_preset(float f) { int i = f; if (f < 0) { i--; } dither += f - i; if (dither >= 1.0) { dither--; i++; } return i; } void X264SpeedControl::apply_preset(int new_preset) { new_preset = max(new_preset, 0); new_preset = min(new_preset, SC_PRESETS - 1); const sc_preset_t *s = &presets[new_preset]; x264_param_t p; dyn.x264_encoder_parameters(x264, &p); p.i_frame_reference = s->refs; p.analyse.inter = s->partitions; p.analyse.i_subpel_refine = s->subme; p.analyse.i_me_method = s->me; p.analyse.i_trellis = s->trellis; p.analyse.b_mixed_references = s->mix; p.analyse.i_direct_mv_pred = s->direct; p.analyse.i_me_range = s->merange; if (override_func) { override_func(&p); } dyn.x264_encoder_reconfig(x264, &p); preset = new_preset; metric_x264_speedcontrol_preset_used_frames.count_event(new_preset); } nageru-2.3.0/nageru/x264_speed_control.h000066400000000000000000000152221450736322200200600ustar00rootroot00000000000000#ifndef _X264_SPEED_CONTROL_H #define _X264_SPEED_CONTROL_H 1 // The x264 speed control tries to encode video at maximum possible quality // without skipping frames (at the expense of higher encoding latency and // less even output rates, although VBV is still respected). It does this // by continuously (every frame) changing the x264 quality settings such that // it uses maximum amount of CPU, but no more. // // Speed control works by maintaining a queue of frames, with the confusing // nomenclature “full” meaning that there are no queues in the frame. // (Conversely, if the queue is “empty” and a new frame comes in, we need to // drop that frame.) It tries to keep the buffer 3/4 “full” by using a table // of measured relative speeds for the different presets, and choosing one that it // thinks will return the buffer to that state over time. However, since // different frames take different times to encode regardless of preset, it // also tries to maintain a running average of how long the typical frame will // take to encode at the fastest preset (the so-called “complexity”), by dividing // the actual time by the relative time for the preset used. // // Frame timings is a complex topic in its own sright, since usually, multiple // frames are encoded in parallel. X264SpeedControl only supports the timing // method that the original patch calls “alternate timing”; one simply measures // the time the last x264_encoder_encode() call took. (The other alternative given // is to measure the time between successive x264_encoder_encode() calls.) // Unless using the zerocopy presets (which activate slice threading), the function // actually returns not when the given frame is done encoding, but when one a few // frames back is done encoding. So it doesn't actually measure the time of any // given one frame, but it measures something correlated to it, at least as long as // you are near 100% CPU utilization (ie., the encoded frame doesn't linger in the // buffers already when x264_encoder_encode() is called). // // The code has a long history; it was originally part of Avail Media's x264 // branch, used in their encoder appliances, and then a snapshot of that was // released. (Given that x264 is licensed under GPLv2 or newer, this means that // we can also treat the patch as GPLv2 or newer if we want, which we do. // As far as I know, it is copyright Avail Media, although no specific copyright // notice was posted on the patch.) // // From there, it was incorporated in OBE's x264 tree (x264-obe) and some bugs // were fixed. I started working on it for the purposes of Nageru, fixing various // issues, adding VFR support and redoing the timings entirely based on more // modern presets (the patch was made before several important x264 features, // such as weighted P-frames). Finally, I took it out of x264 and put it into // Nageru (it does not actually use any hooks into the codec itself), so that // one does not need to patch x264 to use it in Nageru. It still could do with // some cleanup, but it's much, much better than just using a static preset. #include #include #include #include extern "C" { #include } #include "shared/metrics.h" #include "x264_dynamic.h" class X264SpeedControl { public: // x264: Encoding object we are using; must be opened. Assumed to be // set to the "faster" preset, and with 16 reference frames. // f_speed: Relative encoding speed, usually 1.0. // i_buffer_size: Number of frames in the buffer. // f_buffer_init: Relative fullness of buffer at start // (0.0 = assumed to be frames in buffer, // 1.0 = no frames in buffer) X264SpeedControl(x264_t *x264, float f_speed, int i_buffer_size, float f_buffer_init); ~X264SpeedControl(); // You need to call before_frame() immediately before each call to // x264_encoder_encode(), and after_frame() immediately after. // // new_buffer_fill: Buffer fullness, in microseconds (_not_ a relative // number, unlike f_buffer_init in the constructor). // new_buffer_size: If > 0, new number of frames in the buffer, // ie. the buffer size has changed. (It is harmless to set this // even if the buffer hasn't actually changed.) // f_uspf: If > 0, new microseconds per frame, ie. the frame rate has // changed. (Of course, with VFR, it can be impossible to truly know // the frame rate of the coming frames, but it is a reasonable // assumption that the next second or so is likely to be the same // frame rate as the last frame.) void before_frame(float new_buffer_fill, int new_buffer_size, float f_uspf); void after_frame(); // x264 seemingly has an issue where x264_encoder_reconfig() is not reflected // immediately in x264_encoder_parameters(). Since speed control keeps calling // those two all the time, any changes you make outside X264SpeedControl // could be overridden. Thus, to make changes to encoder parameters, you should // instead set a function here, which will be called every time parameters // are modified. void set_config_override_function(std::function override_func) { this->override_func = override_func; } private: void set_buffer_size(int new_buffer_size); int dither_preset(float f); void apply_preset(int new_preset); X264Dynamic dyn; // Not owned by us. x264_t *x264; float f_speed; // all times that are not std::chrono::* are in usec std::chrono::steady_clock::time_point timestamp; // when was speedcontrol last invoked std::chrono::steady_clock::duration cpu_time_last_frame{std::chrono::seconds{0}}; // time spent encoding the previous frame int64_t buffer_size; // assumed application-side buffer of frames to be streamed (measured in microseconds), int64_t buffer_fill; // where full = we don't have to hurry int64_t compensation_period; // how quickly we try to return to the target buffer fullness float uspf; // microseconds per frame int preset = -1; // which setting was used in the previous frame float cplx_num = 3e3; // rolling average of estimated spf for preset #0. FIXME estimate initial complexity float cplx_den = .1; float cplx_decay; float dither = 0.0f; bool first = true; struct { int64_t min_buffer, max_buffer; double avg_preset; int den; } stat; std::function override_func = nullptr; // Metrics. Histogram metric_x264_speedcontrol_preset_used_frames; std::atomic metric_x264_speedcontrol_buffer_available_seconds{0.0}; std::atomic metric_x264_speedcontrol_buffer_size_seconds{0.0}; std::atomic metric_x264_speedcontrol_idle_frames{0}; std::atomic metric_x264_speedcontrol_late_frames{0}; }; #endif // !defined(_X264_SPEED_CONTROL_H) nageru-2.3.0/nageru/ycbcr_interpretation.h000066400000000000000000000004731450736322200206700ustar00rootroot00000000000000#ifndef _YCBCR_INTERPRETATION_H #define _YCBCR_INTERPRETATION_H 1 #include struct YCbCrInterpretation { bool ycbcr_coefficients_auto = true; movit::YCbCrLumaCoefficients ycbcr_coefficients = movit::YCBCR_REC_709; bool full_range = false; }; #endif // !defined(_YCBCR_INTERPRETATION_H) nageru-2.3.0/shared/000077500000000000000000000000001450736322200142475ustar00rootroot00000000000000nageru-2.3.0/shared/aboutdialog.cpp000066400000000000000000000010501450736322200172410ustar00rootroot00000000000000#include "aboutdialog.h" #include #include "ui_aboutdialog.h" using namespace std; AboutDialog::AboutDialog(const string &program, const string &subheading) : ui(new Ui::AboutDialog) { ui->setupUi(this); QString str = ui->header->text(); str.replace("@NAGERU_VERSION@", NAGERU_VERSION); str.replace("@PROGRAM@", QString::fromStdString(program)); str.replace("@SUBHEADING@", QString::fromStdString(subheading)); ui->header->setText(str); connect(ui->button_box, &QDialogButtonBox::accepted, [this]{ this->close(); }); } nageru-2.3.0/shared/aboutdialog.h000066400000000000000000000005721450736322200167160ustar00rootroot00000000000000#ifndef _ABOUTDIALOG_H #define _ABOUTDIALOG_H 1 #include #include #include class QObject; namespace Ui { class AboutDialog; } // namespace Ui class AboutDialog : public QDialog { Q_OBJECT public: AboutDialog(const std::string &program, const std::string &subheading); private: Ui::AboutDialog *ui; }; #endif // !defined(_ABOUTDIALOG_H) nageru-2.3.0/shared/aboutdialog.ui000066400000000000000000000172171450736322200171100ustar00rootroot00000000000000 AboutDialog 0 0 684 544 About Nageru <p><b>@PROGRAM@ @NAGERU_VERSION@</b></p> <p>@SUBHEADING@</p> true <!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.0//EN" "http://www.w3.org/TR/REC-html40/strict.dtd"> <html><head><meta name="qrichtext" content="1" /></head><body> <p> Nageru is Copyright (C) 2015 Steinar H. Gunderson &lt;steinar+nageru@gunderson.no&gt;<br /> Portions Copyright (C) 2003 Rune Holm.<br /> Portions Copyright (C) 2010-2011 Fons Adriaensen &lt;fons@linuxaudio.org&gt;<br /> Portions Copyright (C) 2012-2015 Fons Adriaensen &lt;fons@linuxaudio.org&gt;<br /> Portions Copyright (C) 2008-2015 Fons Adriaensen &lt;fons@linuxaudio.org&gt;<br /> Portions Copyright (c) 2007-2013 Intel Corporation. All Rights Reserved.</p> <p>This program is free software: you can redistribute it and/or modify<br /> it under the terms of the GNU General Public License as published by<br /> the Free Software Foundation, either version 3 of the License, or<br /> (at your option) any later version.</p> <p>This program is distributed in the hope that it will be useful,<br /> but WITHOUT ANY WARRANTY; without even the implied warranty of<br /> MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the<br /> GNU General Public License for more details.</p> <p>You should have received a copy of the GNU General Public License<br /> along with this program. If not, see &lt;<a href="http://www.gnu.org/licenses/"><span style=" text-decoration: underline; color:#0000ff;">http://www.gnu.org/licenses/</span></a>&gt;.</p> <p><br />Portions of h264encode.h and h264encode.cpp:</p> <p>Copyright (c) 2007-2013 Intel Corporation. All Rights Reserved.</p> <p>Permission is hereby granted, free of charge, to any person obtaining a<br /> copy of this software and associated documentation files (the<br /> &quot;Software&quot;), to deal in the Software without restriction, including<br /> without limitation the rights to use, copy, modify, merge, publish,<br /> distribute, sub license, and/or sell copies of the Software, and to<br /> permit persons to whom the Software is furnished to do so, subject to<br /> the following conditions:</p> <p>The above copyright notice and this permission notice (including the<br /> next paragraph) shall be included in all copies or substantial portions<br /> of the Software.</p> <p>THE SOFTWARE IS PROVIDED &quot;AS IS&quot;, WITHOUT WARRANTY OF ANY KIND, EXPRESS<br /> OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF<br /> MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NON-INFRINGEMENT.<br /> IN NO EVENT SHALL PRECISION INSIGHT AND/OR ITS SUPPLIERS BE LIABLE FOR<br /> ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,<br /> TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE<br /> SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.</p> <p><br />All files in decklink/:</p> <p>Copyright (c) 2009 Blackmagic Design<br /> Copyright (c) 2015 Blackmagic Design</p> <p>Permission is hereby granted, free of charge, to any person or organization obtaining a copy of the software and accompanying documentation covered by this license (the "Software") to use, reproduce, display, distribute, execute, and transmit the Software, and to prepare derivative works of the Software, and to permit third-parties to whom the Software is furnished to do so, all subject to the following:</p> <p>The copyright notices in the Software and this entire statement, including the above license grant, this restriction and the following disclaimer, must be included in all copies of the Software, in whole or in part, and all derivative works of the Software, unless such copies or derivative works are solely in the form of machine-executable object code generated by a source language processor.</p> <p>THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE, TITLE AND NON-INFRINGEMENT. IN NO EVENT SHALL THE COPYRIGHT HOLDERS OR ANYONE DISTRIBUTING THE SOFTWARE BE LIABLE FOR ANY DAMAGES OR OTHER LIABILITY, WHETHER IN CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.</p> <p>Marked parts of theme.cpp (Lua shims):</p> <p>The MIT License (MIT)</p> <p>Copyright (c) 2013 Hisham Muhammad</p> <p>Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:</p> <p>The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.</p> <p>THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.</p> </body></html> Qt::Horizontal QDialogButtonBox::Ok button_box accepted() AboutDialog accept() 248 254 157 274 button_box rejected() AboutDialog reject() 316 260 286 274 nageru-2.3.0/shared/bin2h.cpp000066400000000000000000000021631450736322200157570ustar00rootroot00000000000000#include #include using namespace std; int main(int argc, char **argv) { if (argc != 4) { fprintf(stderr, "Usage: bin2h INFILE BASENAME OUTFILE\n"); return 1; } string basename = argv[2]; for (char &ch : basename) { if (!isalpha(ch) && !isdigit(ch)) { ch = '_'; } } FILE *infp = fopen(argv[1], "rb"); if (infp == nullptr) { perror(argv[1]); abort(); } FILE *outfp = fopen(argv[3], "w"); if (outfp == nullptr) { perror(argv[3]); abort(); } fprintf(outfp, "// Generated by bin2h.cpp from %s. Do not edit by hand.\n", argv[1]); fprintf(outfp, "#include \n"); fprintf(outfp, "unsigned char _binary_%s[] = {", basename.c_str()); size_t num_bytes = 0; while (!feof(infp)) { if (num_bytes++ % 16 == 0) { fprintf(outfp, "\n\t"); } int ch = getc(infp); if (ch == -1) { break; } fprintf(outfp, "0x%02x, ", ch); } fprintf(outfp, "\n};\n"); fprintf(outfp, "unsigned char *_binary_%s_data = _binary_%s;\n", basename.c_str(), basename.c_str()); fprintf(outfp, "size_t _binary_%s_size = sizeof(_binary_%s);\n", basename.c_str(), basename.c_str()); return 0; } nageru-2.3.0/shared/context.cpp000066400000000000000000000041121450736322200164350ustar00rootroot00000000000000#include #include #include #include #include #include #include QGLWidget *global_share_widget = nullptr; using namespace std; QSurface *create_surface() { QSurfaceFormat fmt; fmt.setDepthBufferSize(0); fmt.setStencilBufferSize(0); fmt.setProfile(QSurfaceFormat::CoreProfile); fmt.setMajorVersion(4); fmt.setMinorVersion(5); fmt.setSwapInterval(0); QOffscreenSurface *surface = new QOffscreenSurface; surface->setFormat(fmt); surface->create(); if (!surface->isValid()) { fprintf(stderr, "ERROR: surface not valid!\n"); abort(); } return surface; } QSurface *create_surface(const QSurfaceFormat &format) { QOffscreenSurface *surface = new QOffscreenSurface; surface->setFormat(format); surface->create(); if (!surface->isValid()) { fprintf(stderr, "ERROR: surface not valid!\n"); abort(); } return surface; } QSurface *create_surface_with_same_format(const QSurface *surface) { return create_surface(surface->format()); } QOpenGLContext *create_context(const QSurface *surface) { QOpenGLContext *context = new QOpenGLContext; context->setShareContext(global_share_widget->context()->contextHandle()); // Qt has a bug (QTBUG-76299) where, when using EGL, the surface ignores // the requested OpenGL context version and just becomes 2.0. Mesa honors // this and gives us a 3.0 compatibility context, but then has a bug related // to its shader cache (Mesa bug #110872) that causes spurious linker failures // when we need to re-link a Movit shader in the same context. However, // the surface itself doesn't use the OpenGL version in its format for anything, // so we can just override it and get a proper context. QSurfaceFormat fmt = surface->format(); fmt.setProfile(QSurfaceFormat::CoreProfile); fmt.setMajorVersion(4); fmt.setMinorVersion(5); context->setFormat(fmt); context->create(); return context; } bool make_current(QOpenGLContext *context, QSurface *surface) { return context->makeCurrent(surface); } void delete_context(QOpenGLContext *context) { delete context; } nageru-2.3.0/shared/context.h000066400000000000000000000010711450736322200161030ustar00rootroot00000000000000 // Needs to be in its own file because Qt and libepoxy seemingly don't coexist well // within the same file. class QSurface; class QOpenGLContext; class QSurfaceFormat; class QGLWidget; extern bool using_egl; extern QGLWidget *global_share_widget; QSurface *create_surface(); QSurface *create_surface(const QSurfaceFormat &format); QSurface *create_surface_with_same_format(const QSurface *surface); QOpenGLContext *create_context(const QSurface *surface); bool make_current(QOpenGLContext *context, QSurface *surface); void delete_context(QOpenGLContext *context); nageru-2.3.0/shared/controller_spin_box.h000066400000000000000000000020621450736322200205040ustar00rootroot00000000000000#ifndef _CONTROLLER_SPIN_BOX_H #define _CONTROLLER_SPIN_BOX_H 1 // ControllerSpinBox is like QSpinBox, except it has a second special value // "PB" (in addition to the standard minimum value of -1, representing blank), // representing the virtual pitch bend controller. #include #include #include "shared/midi_device.h" class ControllerSpinBox : public QSpinBox { Q_OBJECT public: ControllerSpinBox(QWidget *parent) : QSpinBox(parent) {} int valueFromText(const QString &text) const override { if (text == "PB") { return MIDIReceiver::PITCH_BEND_CONTROLLER; } else { return QSpinBox::valueFromText(text); } } QString textFromValue(int value) const override { if (value == MIDIReceiver::PITCH_BEND_CONTROLLER) { return "PB"; } else { return QSpinBox::textFromValue(value); } } QValidator::State validate(QString &input, int &pos) const override { if (input == "PB") { return QValidator::Acceptable; } else { return QSpinBox::validate(input, pos); } } }; #endif // !defined(_CONTROLLER_SPIN_BOX_H) nageru-2.3.0/shared/disk_space_estimator.cpp000066400000000000000000000042141450736322200211500ustar00rootroot00000000000000#include "shared/disk_space_estimator.h" #include #include #include #include #include "shared/metrics.h" #include "shared/timebase.h" using namespace std; DiskSpaceEstimator::DiskSpaceEstimator(DiskSpaceEstimator::callback_t callback) : callback(callback) { global_metrics.add("disk_free_bytes", &metric_disk_free_bytes, Metrics::TYPE_GAUGE); } void DiskSpaceEstimator::report_write(const string &filename, off_t bytes, uint64_t pts) { total_size += bytes; report_write_internal(filename, total_size, pts); } void DiskSpaceEstimator::report_append(const string &filename, uint64_t pts) { if (filename != last_filename) { last_filename = filename; measure_points.clear(); } struct stat st; if (stat(filename.c_str(), &st) == -1) { perror(filename.c_str()); return; } report_write_internal(filename, st.st_size, pts); } void DiskSpaceEstimator::report_write_internal(const string &filename, off_t file_size, uint64_t pts) { if (measure_points.empty()) { first_pts_this_file = pts; } // Reject points that are out-of-order (happens with B-frames). if (!measure_points.empty() && pts <= measure_points.back().pts) { return; } // Remove too old points. while (measure_points.size() > 1 && measure_points.front().pts + window_length < pts) { measure_points.pop_front(); } struct statfs fst; if (statfs(filename.c_str(), &fst) == -1) { perror(filename.c_str()); return; } off_t free_bytes = off_t(fst.f_bavail) * fst.f_frsize; metric_disk_free_bytes = free_bytes; if (!measure_points.empty()) { double bytes_per_second = double(file_size - measure_points.front().size) / (pts - measure_points.front().pts) * TIMEBASE; double seconds_left = free_bytes / bytes_per_second; // Only report every second, since updating the UI can be expensive. if (last_pts_reported == 0 || pts - last_pts_reported >= TIMEBASE) { callback(free_bytes, seconds_left, double(pts - first_pts_this_file) / TIMEBASE); last_pts_reported = pts; } } measure_points.push_back({ pts, file_size }); } DiskSpaceEstimator *global_disk_space_estimator = nullptr; // Created in MainWindow::MainWindow(). nageru-2.3.0/shared/disk_space_estimator.h000066400000000000000000000046311450736322200206200ustar00rootroot00000000000000#ifndef _DISK_SPACE_ESTIMATOR_H #define _DISK_SPACE_ESTIMATOR_H // A class responsible for measuring how much disk there is left when we // store our video to disk, and how much recording time that equates to. // It gets callbacks from the Mux writing the stream to disk (which also // knows which filesystem the file is going to), makes its calculations, // and calls back to the MainWindow, which shows it to the user. // // The bitrate is measured over a simple 30-second sliding window. #include #include #include #include #include #include #include "shared/timebase.h" class DiskSpaceEstimator { public: typedef std::function callback_t; DiskSpaceEstimator(callback_t callback); // Report that a video frame with the given pts and size has just been // written (possibly appended) to the given file. // // is taken to be in TIMEBASE units (see shared/timebase.h). void report_write(const std::string &filename, off_t bytes, uint64_t pts); // Report that a video frame with the given pts has just been written // to the given file, so the estimator should stat the file and see // by how much it grew since last time. Called by the Mux object // responsible for writing to the stream on disk. // // If the filename changed since last time, the estimation is reset. // is taken to be in TIMEBASE units (see shared/timebase.h). // // You should probably not mix this and report_write() on the same // object. Really, report_write() matches Futatabi's controlled writes // to a custom format, and report_append() matches Nageru's use of Mux // (where we don't see the bytes flowing past). void report_append(const std::string &filename, uint64_t pts); private: static constexpr int64_t window_length = 30 * TIMEBASE; void report_write_internal(const std::string &filename, off_t file_size, uint64_t pts); callback_t callback; struct MeasurePoint { uint64_t pts; off_t size; }; std::deque measure_points; uint64_t last_pts_reported = 0; uint64_t first_pts_this_file = 0; off_t total_size = 0; // For report_write(). std::string last_filename; // For report_append(). // Metrics. std::atomic metric_disk_free_bytes{-1}; }; extern DiskSpaceEstimator *global_disk_space_estimator; #endif // !defined(_DISK_SPACE_ESTIMATOR_H) nageru-2.3.0/shared/ffmpeg_raii.cpp000066400000000000000000000056021450736322200172260ustar00rootroot00000000000000#include "ffmpeg_raii.h" extern "C" { #include #include #include #include #include } using namespace std; // AVFormatContext void avformat_close_input_unique::operator() (AVFormatContext *format_ctx) const { avformat_close_input(&format_ctx); } AVFormatContextWithCloser avformat_open_input_unique( const char *pathname, const AVInputFormat *fmt, AVDictionary **options) { return avformat_open_input_unique(pathname, fmt, options, AVIOInterruptCB{ nullptr, nullptr }); } AVFormatContextWithCloser avformat_open_input_unique( const char *pathname, const AVInputFormat *fmt, AVDictionary **options, const AVIOInterruptCB &interrupt_cb) { AVFormatContext *format_ctx = avformat_alloc_context(); format_ctx->interrupt_callback = interrupt_cb; #ifdef ff_const59 if (avformat_open_input(&format_ctx, pathname, const_cast(fmt), options) != 0) { #else if (avformat_open_input(&format_ctx, pathname, fmt, options) != 0) { #endif format_ctx = nullptr; } return AVFormatContextWithCloser(format_ctx); } AVFormatContextWithCloser avformat_open_input_unique( int (*read_packet)(void *opaque, uint8_t *buf, int buf_size), void *opaque, const AVInputFormat *fmt, AVDictionary **options, const AVIOInterruptCB &interrupt_cb) { AVFormatContext *format_ctx = avformat_alloc_context(); format_ctx->interrupt_callback = interrupt_cb; constexpr size_t buf_size = 4096; unsigned char *buf = (unsigned char *)av_malloc(buf_size); format_ctx->pb = avio_alloc_context(buf, buf_size, /*write_flag=*/false, opaque, read_packet, /*write_packet=*/nullptr, /*seek=*/nullptr); #ifdef ff_const59 if (avformat_open_input(&format_ctx, "", const_cast(fmt), options) != 0) { #else if (avformat_open_input(&format_ctx, "", fmt, options) != 0) { #endif format_ctx = nullptr; } return AVFormatContextWithCloser(format_ctx); } // AVCodecContext void avcodec_free_context_unique::operator() (AVCodecContext *codec_ctx) const { avcodec_free_context(&codec_ctx); } AVCodecContextWithDeleter avcodec_alloc_context3_unique(const AVCodec *codec) { return AVCodecContextWithDeleter(avcodec_alloc_context3(codec)); } // AVCodecParameters void avcodec_parameters_free_unique::operator() (AVCodecParameters *codec_par) const { avcodec_parameters_free(&codec_par); } // AVFrame void av_frame_free_unique::operator() (AVFrame *frame) const { av_frame_free(&frame); } AVFrameWithDeleter av_frame_alloc_unique() { return AVFrameWithDeleter(av_frame_alloc()); } // AVPacket void av_packet_free_unique::operator() (AVPacket *packet) const { av_packet_unref(packet); } AVPacketWithDeleter av_packet_alloc_unique() { return AVPacketWithDeleter(av_packet_alloc()); } // SwsContext void sws_free_context_unique::operator() (SwsContext *context) const { sws_freeContext(context); } nageru-2.3.0/shared/ffmpeg_raii.h000066400000000000000000000051411450736322200166710ustar00rootroot00000000000000#ifndef _FFMPEG_RAII_H #define _FFMPEG_RAII_H 1 // Some helpers to make RAII versions of FFmpeg objects. // The cleanup functions don't interact all that well with unique_ptr, // so things get a bit messy and verbose, but overall it's worth it to ensure // we never leak things by accident in error paths. // // This does not cover any of the types that can actually be declared as // a unique_ptr with no helper functions for deleter. #include struct AVCodec; struct AVCodecContext; struct AVCodecParameters; struct AVDictionary; struct AVFormatContext; struct AVFrame; struct AVPacket; struct AVInputFormat; struct SwsContext; typedef struct AVIOInterruptCB AVIOInterruptCB; // AVFormatContext struct avformat_close_input_unique { void operator() (AVFormatContext *format_ctx) const; }; typedef std::unique_ptr AVFormatContextWithCloser; AVFormatContextWithCloser avformat_open_input_unique( const char *pathname, const AVInputFormat *fmt, AVDictionary **options); AVFormatContextWithCloser avformat_open_input_unique( const char *pathname, const AVInputFormat *fmt, AVDictionary **options, const AVIOInterruptCB &interrupt_cb); AVFormatContextWithCloser avformat_open_input_unique( int (*read_packet)(void *opaque, uint8_t *buf, int buf_size), void *opaque, const AVInputFormat *fmt, AVDictionary **options, const AVIOInterruptCB &interrupt_cb); // AVCodecContext struct avcodec_free_context_unique { void operator() (AVCodecContext *ctx) const; }; typedef std::unique_ptr AVCodecContextWithDeleter; AVCodecContextWithDeleter avcodec_alloc_context3_unique(const AVCodec *codec); // AVCodecParameters struct avcodec_parameters_free_unique { void operator() (AVCodecParameters *codec_par) const; }; typedef std::unique_ptr AVCodecParametersWithDeleter; // AVFrame struct av_frame_free_unique { void operator() (AVFrame *frame) const; }; typedef std::unique_ptr AVFrameWithDeleter; AVFrameWithDeleter av_frame_alloc_unique(); // AVPacket (ick!) // Not really unique from FFmpeg's point of view, but it is from ours struct av_packet_free_unique { void operator() (AVPacket *packet) const; }; typedef std::unique_ptr AVPacketWithDeleter; AVPacketWithDeleter av_packet_alloc_unique(); // SwsContext struct sws_free_context_unique { void operator() (SwsContext *context) const; }; typedef std::unique_ptr SwsContextWithDeleter; #endif // !defined(_FFMPEG_RAII_H) nageru-2.3.0/shared/httpd.cpp000066400000000000000000000277031450736322200161070ustar00rootroot00000000000000#include "shared/httpd.h" #include #include #include #include #include #include #include #include #include #include extern "C" { #include } #include "shared/shared_defs.h" #include "shared/metacube2.h" #include "shared/metrics.h" struct MHD_Connection; struct MHD_Response; using namespace std; HTTPD::HTTPD() { global_metrics.add("num_connected_clients", &metric_num_connected_clients, Metrics::TYPE_GAUGE); global_metrics.add("num_connected_multicam_clients", &metric_num_connected_multicam_clients, Metrics::TYPE_GAUGE); for (unsigned stream_idx = 0; stream_idx < MAX_VIDEO_CARDS; ++stream_idx) { global_metrics.add("num_connected_siphon_clients", {{ "card", to_string(stream_idx) }}, &metric_num_connected_siphon_clients[stream_idx], Metrics::TYPE_GAUGE); } } HTTPD::~HTTPD() { stop(); } void HTTPD::start(int port) { mhd = MHD_start_daemon(MHD_USE_THREAD_PER_CONNECTION | MHD_USE_POLL_INTERNALLY | MHD_USE_DUAL_STACK, port, nullptr, nullptr, &answer_to_connection_thunk, this, MHD_OPTION_END); if (mhd == nullptr) { fprintf(stderr, "Warning: Could not open HTTP server. (Port already in use?)\n"); } } void HTTPD::stop() { if (mhd) { MHD_quiesce_daemon(mhd); for (Stream *stream : streams) { stream->stop(); } MHD_stop_daemon(mhd); mhd = nullptr; } } void HTTPD::set_header(StreamID stream_id, const string &data) { lock_guard lock(streams_mutex); header[stream_id] = data; add_data_locked(stream_id, data.data(), data.size(), Stream::DATA_TYPE_HEADER, AV_NOPTS_VALUE, AVRational{ 1, 0 }); } void HTTPD::add_data(StreamID stream_id, const char *buf, size_t size, bool keyframe, int64_t time, AVRational timebase) { lock_guard lock(streams_mutex); add_data_locked(stream_id, buf, size, keyframe ? Stream::DATA_TYPE_KEYFRAME : Stream::DATA_TYPE_OTHER, time, timebase); } void HTTPD::add_data_locked(StreamID stream_id, const char *buf, size_t size, Stream::DataType data_type, int64_t time, AVRational timebase) { for (Stream *stream : streams) { if (stream->get_stream_id() == stream_id) { stream->add_data(buf, size, data_type, time, timebase); } } } HTTPD::MHD_Result HTTPD::answer_to_connection_thunk(void *cls, MHD_Connection *connection, const char *url, const char *method, const char *version, const char *upload_data, size_t *upload_data_size, void **con_cls) { HTTPD *httpd = (HTTPD *)cls; return httpd->answer_to_connection(connection, url, method, version, upload_data, upload_data_size, con_cls); } HTTPD::MHD_Result HTTPD::answer_to_connection(MHD_Connection *connection, const char *url, const char *method, const char *version, const char *upload_data, size_t *upload_data_size, void **con_cls) { // See if the URL ends in “.metacube”. HTTPD::Stream::Framing framing; if (strstr(url, ".metacube") == url + strlen(url) - strlen(".metacube")) { framing = HTTPD::Stream::FRAMING_METACUBE; } else { framing = HTTPD::Stream::FRAMING_RAW; } HTTPD::StreamID stream_id; if (strcmp(url, "/multicam.mp4") == 0) { stream_id.type = HTTPD::StreamType::MULTICAM_STREAM; stream_id.index = 0; } else if (strncmp(url, "/feeds/", 7) == 0) { stream_id.type = HTTPD::StreamType::SIPHON_STREAM; stream_id.index = atoi(url + 7); } else { stream_id.type = HTTPD::StreamType::MAIN_STREAM; stream_id.index = 0; } if (strcmp(url, "/metrics") == 0) { string contents = global_metrics.serialize(); MHD_Response *response = MHD_create_response_from_buffer( contents.size(), &contents[0], MHD_RESPMEM_MUST_COPY); MHD_add_response_header(response, "Content-type", "text/plain"); MHD_Result ret = MHD_queue_response(connection, MHD_HTTP_OK, response); MHD_destroy_response(response); // Only decreases the refcount; actual free is after the request is done. return ret; } if (endpoints.count(url)) { pair contents_and_type = endpoints[url].callback(); MHD_Response *response = MHD_create_response_from_buffer( contents_and_type.first.size(), &contents_and_type.first[0], MHD_RESPMEM_MUST_COPY); MHD_add_response_header(response, "Content-type", contents_and_type.second.c_str()); if (endpoints[url].cors_policy == ALLOW_ALL_ORIGINS) { MHD_add_response_header(response, "Access-Control-Allow-Origin", "*"); } MHD_Result ret = MHD_queue_response(connection, MHD_HTTP_OK, response); MHD_destroy_response(response); // Only decreases the refcount; actual free is after the request is done. return ret; } // Small hack; reject unknown /channels/foo. if (string(url).find("/channels/") == 0) { string contents = "Not found."; MHD_Response *response = MHD_create_response_from_buffer( contents.size(), &contents[0], MHD_RESPMEM_MUST_COPY); MHD_add_response_header(response, "Content-type", "text/plain"); MHD_Result ret = MHD_queue_response(connection, MHD_HTTP_NOT_FOUND, response); MHD_destroy_response(response); // Only decreases the refcount; actual free is after the request is done. return ret; } HTTPD::Stream *stream = new HTTPD::Stream(this, framing, stream_id); const string &hdr = header[stream_id]; stream->add_data(hdr.data(), hdr.size(), Stream::DATA_TYPE_HEADER, AV_NOPTS_VALUE, AVRational{ 1, 0 }); { lock_guard lock(streams_mutex); streams.insert(stream); } ++metric_num_connected_clients; if (stream_id.type == HTTPD::StreamType::MULTICAM_STREAM) { ++metric_num_connected_multicam_clients; } if (stream_id.type == HTTPD::StreamType::SIPHON_STREAM) { ++metric_num_connected_siphon_clients[stream_id.index]; } *con_cls = stream; // Does not strictly have to be equal to MUX_BUFFER_SIZE. MHD_Response *response = MHD_create_response_from_callback( (size_t)-1, MUX_BUFFER_SIZE, &HTTPD::Stream::reader_callback_thunk, stream, &HTTPD::free_stream); // TODO: Content-type? if (framing == HTTPD::Stream::FRAMING_METACUBE) { MHD_add_response_header(response, "Content-encoding", "metacube"); } MHD_Result ret = MHD_queue_response(connection, MHD_HTTP_OK, response); MHD_destroy_response(response); // Only decreases the refcount; actual free is after the request is done. return ret; } void HTTPD::free_stream(void *cls) { HTTPD::Stream *stream = (HTTPD::Stream *)cls; HTTPD *httpd = stream->get_parent(); if (stream->get_stream_id().type == HTTPD::StreamType::MULTICAM_STREAM) { --httpd->metric_num_connected_multicam_clients; } if (stream->get_stream_id().type == HTTPD::StreamType::SIPHON_STREAM) { --httpd->metric_num_connected_siphon_clients[stream->get_stream_id().index]; } { lock_guard lock(httpd->streams_mutex); delete stream; httpd->streams.erase(stream); } --httpd->metric_num_connected_clients; } ssize_t HTTPD::Stream::reader_callback_thunk(void *cls, uint64_t pos, char *buf, size_t max) { HTTPD::Stream *stream = (HTTPD::Stream *)cls; return stream->reader_callback(pos, buf, max); } ssize_t HTTPD::Stream::reader_callback(uint64_t pos, char *buf, size_t max) { unique_lock lock(buffer_mutex); bool has_data = has_buffered_data.wait_for(lock, std::chrono::seconds(60), [this] { return should_quit || !buffered_data.empty(); }); if (should_quit) { return -1; } if (!has_data) { // The wait timed out, so tell microhttpd to clean out the socket; // it's not unlikely that the client has given up anyway. // This is seemingly the only way to actually reap sockets if we // do not get any data; returning 0 does nothing, and // MHD_OPTION_NOTIFY_CONNECTION does not trigger for these cases. // If not, an instance that has no data to send (typically an instance // of kaeru connected to a nonfunctional backend) would get a steadily // increasing amount of sockets in CLOSE_WAIT (ie., the other end has // hung up, but we haven't called close() yet, as our thread is stuck // in this callback). return -1; } ssize_t ret = 0; while (max > 0 && !buffered_data.empty()) { const string &s = buffered_data.front(); assert(s.size() > used_of_buffered_data); size_t len = s.size() - used_of_buffered_data; if (max >= len) { // Consume the entire (rest of the) string. memcpy(buf, s.data() + used_of_buffered_data, len); buf += len; ret += len; max -= len; buffered_data_bytes -= s.size(); buffered_data.pop_front(); used_of_buffered_data = 0; } else { // We don't need the entire string; just use the first part of it. memcpy(buf, s.data() + used_of_buffered_data, max); buf += max; used_of_buffered_data += max; ret += max; max = 0; } } return ret; } void HTTPD::Stream::add_data(const char *buf, size_t buf_size, HTTPD::Stream::DataType data_type, int64_t time, AVRational timebase) { if (buf_size == 0 || should_quit) { return; } if (data_type == DATA_TYPE_KEYFRAME) { seen_keyframe = true; } else if (data_type == DATA_TYPE_OTHER && !seen_keyframe) { // Start sending only once we see a keyframe. return; } lock_guard lock(buffer_mutex); if (buffered_data_bytes + buf_size > (1ULL << 30)) { // More than 1GB of backlog; the client obviously isn't keeping up, // so kill it instead of going out of memory. Note that this // won't kill the client immediately, but will cause the next callback // to kill the client. fprintf(stderr, "HTTP client had more than 1 GB backlog; killing.\n"); should_quit = true; buffered_data.clear(); has_buffered_data.notify_all(); return; } if (framing == FRAMING_METACUBE) { int flags = 0; if (data_type == DATA_TYPE_HEADER) { flags |= METACUBE_FLAGS_HEADER; } else if (data_type == DATA_TYPE_OTHER) { flags |= METACUBE_FLAGS_NOT_SUITABLE_FOR_STREAM_START; } // If we're about to send a keyframe, send a pts metadata block // to mark its time. if ((flags & METACUBE_FLAGS_NOT_SUITABLE_FOR_STREAM_START) == 0 && time != AV_NOPTS_VALUE) { metacube2_pts_packet packet; packet.type = htobe64(METACUBE_METADATA_TYPE_NEXT_BLOCK_PTS); packet.pts = htobe64(time); packet.timebase_num = htobe64(timebase.num); packet.timebase_den = htobe64(timebase.den); metacube2_block_header hdr; memcpy(hdr.sync, METACUBE2_SYNC, sizeof(hdr.sync)); hdr.size = htonl(sizeof(packet)); hdr.flags = htons(METACUBE_FLAGS_METADATA); hdr.csum = htons(metacube2_compute_crc(&hdr)); buffered_data.emplace_back((char *)&hdr, sizeof(hdr)); buffered_data.emplace_back((char *)&packet, sizeof(packet)); buffered_data_bytes += sizeof(hdr) + sizeof(packet); } metacube2_block_header hdr; memcpy(hdr.sync, METACUBE2_SYNC, sizeof(hdr.sync)); hdr.size = htonl(buf_size); hdr.flags = htons(flags); hdr.csum = htons(metacube2_compute_crc(&hdr)); buffered_data.emplace_back((char *)&hdr, sizeof(hdr)); buffered_data_bytes += sizeof(hdr); } buffered_data.emplace_back(buf, buf_size); buffered_data_bytes += buf_size; // Send a Metacube2 timestamp every keyframe. if (framing == FRAMING_METACUBE && data_type == DATA_TYPE_KEYFRAME) { timespec now; clock_gettime(CLOCK_REALTIME, &now); metacube2_timestamp_packet packet; packet.type = htobe64(METACUBE_METADATA_TYPE_ENCODER_TIMESTAMP); packet.tv_sec = htobe64(now.tv_sec); packet.tv_nsec = htobe64(now.tv_nsec); metacube2_block_header hdr; memcpy(hdr.sync, METACUBE2_SYNC, sizeof(hdr.sync)); hdr.size = htonl(sizeof(packet)); hdr.flags = htons(METACUBE_FLAGS_METADATA); hdr.csum = htons(metacube2_compute_crc(&hdr)); buffered_data.emplace_back((char *)&hdr, sizeof(hdr)); buffered_data.emplace_back((char *)&packet, sizeof(packet)); buffered_data_bytes += sizeof(hdr) + sizeof(packet); } has_buffered_data.notify_all(); } void HTTPD::Stream::stop() { lock_guard lock(buffer_mutex); should_quit = true; has_buffered_data.notify_all(); } nageru-2.3.0/shared/httpd.h000066400000000000000000000113121450736322200155410ustar00rootroot00000000000000#ifndef _HTTPD_H #define _HTTPD_H // A class dealing with stream output to HTTP. #include #include #include #include #include #include #include #include #include #include #include #include #include #include extern "C" { #include } #include #include "shared/shared_defs.h" struct MHD_Connection; struct MHD_Daemon; class HTTPD { public: // Returns a pair of content and content-type. using EndpointCallback = std::function()>; HTTPD(); ~HTTPD(); enum StreamType { MAIN_STREAM, MULTICAM_STREAM, SIPHON_STREAM // The only one that can have stream_index != 0. }; struct StreamID { StreamType type; unsigned index; bool operator< (const StreamID &other) const { if (type != other.type) return type < other.type; return index < other.index; } bool operator== (const StreamID &other) const { return (type == other.type && index == other.index); } }; // Should be called before start() (due to threading issues). enum CORSPolicy { NO_CORS_POLICY, ALLOW_ALL_ORIGINS }; void add_endpoint(const std::string &url, const EndpointCallback &callback, CORSPolicy cors_policy) { endpoints[url] = Endpoint{ callback, cors_policy }; } void start(int port); void stop(); void set_header(StreamID stream_id, const std::string &data); void add_data(StreamID stream_id, const char *buf, size_t size, bool keyframe, int64_t time, AVRational timebase); int64_t get_num_connected_clients() const { return metric_num_connected_clients.load(); } int64_t get_num_connected_multicam_clients() const { return metric_num_connected_multicam_clients.load(); } int64_t get_num_connected_siphon_clients(unsigned stream_idx) const { assert(stream_idx < MAX_VIDEO_CARDS); return metric_num_connected_siphon_clients[stream_idx].load(); } private: // libmicrohttpd 0.9.71 broke the type of MHD_YES/MHD_NO, causing // compilation errors for C++ and undefined behavior for C. #if MHD_VERSION >= 0x00097002 using MHD_Result = ::MHD_Result; #else using MHD_Result = int; #endif static MHD_Result answer_to_connection_thunk(void *cls, MHD_Connection *connection, const char *url, const char *method, const char *version, const char *upload_data, size_t *upload_data_size, void **con_cls); MHD_Result answer_to_connection(MHD_Connection *connection, const char *url, const char *method, const char *version, const char *upload_data, size_t *upload_data_size, void **con_cls); static void free_stream(void *cls); class Stream { public: enum Framing { FRAMING_RAW, FRAMING_METACUBE }; Stream(HTTPD *parent, Framing framing, StreamID stream_id) : parent(parent), framing(framing), stream_id(stream_id) {} static ssize_t reader_callback_thunk(void *cls, uint64_t pos, char *buf, size_t max); ssize_t reader_callback(uint64_t pos, char *buf, size_t max); enum DataType { DATA_TYPE_HEADER, DATA_TYPE_KEYFRAME, DATA_TYPE_OTHER }; void add_data(const char *buf, size_t size, DataType data_type, int64_t time, AVRational timebase); void stop(); HTTPD *get_parent() const { return parent; } StreamID get_stream_id() const { return stream_id; } private: HTTPD *parent; Framing framing; std::mutex buffer_mutex; bool should_quit = false; // Under . std::condition_variable has_buffered_data; std::deque buffered_data; // Protected by . size_t used_of_buffered_data = 0; // How many bytes of the first element of that is already used. Protected by . size_t buffered_data_bytes = 0; // The sum of all size() in buffered_data. Protected by . size_t seen_keyframe = false; StreamID stream_id; }; void add_data_locked(StreamID stream_id, const char *buf, size_t size, Stream::DataType data_type, int64_t time, AVRational timebase); MHD_Daemon *mhd = nullptr; std::mutex streams_mutex; std::set streams; // Not owned. struct Endpoint { EndpointCallback callback; CORSPolicy cors_policy; }; std::unordered_map endpoints; std::map header; // Metrics. std::atomic metric_num_connected_clients{0}; std::atomic metric_num_connected_multicam_clients{0}; std::atomic metric_num_connected_siphon_clients[MAX_VIDEO_CARDS] {{0}}; }; #endif // !defined(_HTTPD_H) nageru-2.3.0/shared/memcpy_interleaved.cpp000066400000000000000000000164511450736322200206360ustar00rootroot00000000000000#if (defined(__i386__) || defined(__x86_64__)) && defined(__GNUC__) #define HAS_MULTIVERSIONING 1 #endif #include #include #include #if HAS_MULTIVERSIONING #include #endif using namespace std; // TODO: Support stride. void memcpy_interleaved_slow(uint8_t *dest1, uint8_t *dest2, const uint8_t *src, size_t n) { assert(n % 2 == 0); uint8_t *dptr1 = dest1; uint8_t *dptr2 = dest2; for (size_t i = 0; i < n; i += 2) { *dptr1++ = *src++; *dptr2++ = *src++; } } void memcpy_interleaved_word_slow(uint16_t *dest1, uint16_t *dest2, const uint16_t *src, size_t n) { assert(n % 2 == 0); uint16_t *dptr1 = dest1; uint16_t *dptr2 = dest2; for (size_t i = 0; i < n; i += 2) { *dptr1++ = *src++; *dptr2++ = *src++; } } #if HAS_MULTIVERSIONING // uint8_t version. __attribute__((target("default"))) size_t memcpy_interleaved_fastpath_core(uint8_t *dest1, uint8_t *dest2, const uint8_t *src, const uint8_t *limit); __attribute__((target("avx2"))) size_t memcpy_interleaved_fastpath_core(uint8_t *dest1, uint8_t *dest2, const uint8_t *src, const uint8_t *limit); __attribute__((target("default"))) size_t memcpy_interleaved_fastpath_core(uint8_t *dest1, uint8_t *dest2, const uint8_t *src, const uint8_t *limit) { // No fast path supported unless we have AVX2. return 0; } __attribute__((target("avx2"))) size_t memcpy_interleaved_fastpath_core(uint8_t *dest1, uint8_t *dest2, const uint8_t *src, const uint8_t *limit) { size_t consumed = 0; const __m256i *__restrict in = (const __m256i *)src; __m256i *__restrict out1 = (__m256i *)dest1; __m256i *__restrict out2 = (__m256i *)dest2; __m256i shuffle_cw = _mm256_set_epi8( 15, 13, 11, 9, 7, 5, 3, 1, 14, 12, 10, 8, 6, 4, 2, 0, 15, 13, 11, 9, 7, 5, 3, 1, 14, 12, 10, 8, 6, 4, 2, 0); while (in < (const __m256i *)limit) { // Note: For brevity, comments show lanes as if they were 2x64-bit (they're actually 2x128). __m256i data1 = _mm256_stream_load_si256(in); // AaBbCcDd EeFfGgHh __m256i data2 = _mm256_stream_load_si256(in + 1); // IiJjKkLl MmNnOoPp data1 = _mm256_shuffle_epi8(data1, shuffle_cw); // ABCDabcd EFGHefgh data2 = _mm256_shuffle_epi8(data2, shuffle_cw); // IJKLijkl MNOPmnop data1 = _mm256_permute4x64_epi64(data1, 0b11011000); // ABCDEFGH abcdefgh data2 = _mm256_permute4x64_epi64(data2, 0b11011000); // IJKLMNOP ijklmnop __m256i lo = _mm256_permute2x128_si256(data1, data2, 0b00100000); __m256i hi = _mm256_permute2x128_si256(data1, data2, 0b00110001); _mm256_storeu_si256(out1, lo); _mm256_storeu_si256(out2, hi); in += 2; ++out1; ++out2; consumed += 64; } return consumed; } // Returns the number of bytes consumed. size_t memcpy_interleaved_fastpath(uint8_t *dest1, uint8_t *dest2, const uint8_t *src, size_t n) { const uint8_t *limit = src + n; size_t consumed = 0; // Align end to 32 bytes. limit = (const uint8_t *)(intptr_t(limit) & ~31); if (src >= limit) { return 0; } // Process [0,31] bytes, such that start gets aligned to 32 bytes. const uint8_t *aligned_src = (const uint8_t *)(intptr_t(src + 31) & ~31); if (aligned_src != src) { size_t n2 = aligned_src - src; memcpy_interleaved_slow(dest1, dest2, src, n2); dest1 += n2 / 2; dest2 += n2 / 2; if (n2 % 2) { swap(dest1, dest2); } src = aligned_src; consumed += n2; } // Make the length a multiple of 64. if (((limit - src) % 64) != 0) { limit -= 32; } assert(((limit - src) % 64) == 0); return consumed + memcpy_interleaved_fastpath_core(dest1, dest2, src, limit); } // uint16_t version. __attribute__((target("default"))) size_t memcpy_interleaved_word_fastpath_core(uint16_t *dest1, uint16_t *dest2, const uint16_t *src, const uint16_t *limit); __attribute__((target("avx2"))) size_t memcpy_interleaved_word_fastpath_core(uint16_t *dest1, uint16_t *dest2, const uint16_t *src, const uint16_t *limit); __attribute__((target("default"))) size_t memcpy_interleaved_word_fastpath_core(uint16_t *dest1, uint16_t *dest2, const uint16_t *src, const uint16_t *limit) { // No fast path supported unless we have AVX2. return 0; } __attribute__((target("avx2"))) size_t memcpy_interleaved_word_fastpath_core(uint16_t *dest1, uint16_t *dest2, const uint16_t *src, const uint16_t *limit) { size_t consumed = 0; const __m256i *__restrict in = (const __m256i *)src; __m256i *__restrict out1 = (__m256i *)dest1; __m256i *__restrict out2 = (__m256i *)dest2; __m256i shuffle_cw = _mm256_set_epi8( 15, 14, 11, 10, 7, 6, 3, 2, 13, 12, 9, 8, 5, 4, 1, 0, 15, 14, 11, 10, 7, 6, 3, 2, 13, 12, 9, 8, 5, 4, 1, 0); while (in < (const __m256i *)limit) { // Note: Each element in these comments is 16 bits long (lanes are 2x128 bits). __m256i data1 = _mm256_stream_load_si256(in); // AaBbCcDd EeFfGgHh __m256i data2 = _mm256_stream_load_si256(in + 1); // IiJjKkLl MmNnOoPp data1 = _mm256_shuffle_epi8(data1, shuffle_cw); // ABCDabcd EFGHefgh data2 = _mm256_shuffle_epi8(data2, shuffle_cw); // IJKLijkl MNOPmnop data1 = _mm256_permute4x64_epi64(data1, 0b11011000); // ABCDEFGH abcdefgh data2 = _mm256_permute4x64_epi64(data2, 0b11011000); // IJKLMNOP ijklmnop __m256i lo = _mm256_permute2x128_si256(data1, data2, 0b00100000); __m256i hi = _mm256_permute2x128_si256(data1, data2, 0b00110001); _mm256_storeu_si256(out1, lo); _mm256_storeu_si256(out2, hi); in += 2; ++out1; ++out2; consumed += 32; } return consumed; } // Returns the number of bytes consumed. size_t memcpy_interleaved_word_fastpath(uint16_t *dest1, uint16_t *dest2, const uint16_t *src, size_t n) { // We assume this to generally be the case, but just to be sure, // drop down to the slow path. if (intptr_t(dest1) % 2 != 0 || intptr_t(dest2) % 2 != 0 || intptr_t(src) % 2 != 0) { return 0; } const uint16_t *limit = src + n; size_t consumed = 0; // Align end to 32 bytes. limit = (const uint16_t *)(intptr_t(limit) & ~31); if (src >= limit) { return 0; } // Process [0,15] words, such that start gets aligned to 32 bytes (16 words). const uint16_t *aligned_src = (const uint16_t *)(intptr_t(src + 31) & ~31); if (aligned_src != src) { size_t n2 = aligned_src - src; memcpy_interleaved_word_slow(dest1, dest2, src, n2); dest1 += n2 / 2; dest2 += n2 / 2; if (n2 % 2) { swap(dest1, dest2); } src = aligned_src; consumed += n2; } // Make the length a multiple of 32 words (64 bytes). if (((limit - src) % 32) != 0) { limit -= 16; } assert(((limit - src) % 32) == 0); return consumed + memcpy_interleaved_word_fastpath_core(dest1, dest2, src, limit); } #endif // defined(HAS_MULTIVERSIONING) void memcpy_interleaved(uint8_t *dest1, uint8_t *dest2, const uint8_t *src, size_t n) { #if HAS_MULTIVERSIONING size_t consumed = memcpy_interleaved_fastpath(dest1, dest2, src, n); src += consumed; dest1 += consumed / 2; dest2 += consumed / 2; if (consumed % 2) { swap(dest1, dest2); } n -= consumed; #endif if (n > 0) { memcpy_interleaved_slow(dest1, dest2, src, n); } } void memcpy_interleaved_word(uint16_t *dest1, uint16_t *dest2, const uint16_t *src, size_t n) { #if HAS_MULTIVERSIONING size_t consumed = memcpy_interleaved_word_fastpath(dest1, dest2, src, n); src += consumed; dest1 += consumed / 2; dest2 += consumed / 2; if (consumed % 2) { swap(dest1, dest2); } n -= consumed; #endif if (n > 0) { memcpy_interleaved_word_slow(dest1, dest2, src, n); } } nageru-2.3.0/shared/memcpy_interleaved.h000066400000000000000000000010051450736322200202700ustar00rootroot00000000000000#ifndef _MEMCPY_INTERLEAVED_H #define _MEMCPY_INTERLEAVED_H 1 #include #include // Copies every other byte from src to dest1 and dest2. // TODO: Support stride. void memcpy_interleaved(uint8_t *dest1, uint8_t *dest2, const uint8_t *src, size_t n); // Same, but every other word instead of every other byte. // n is number of words, not number of bytes. void memcpy_interleaved_word(uint16_t *dest1, uint16_t *dest2, const uint16_t *src, size_t n); #endif // !defined(_MEMCPY_INTERLEAVED_H) nageru-2.3.0/shared/meson.build000066400000000000000000000035771450736322200164250ustar00rootroot00000000000000qt5 = import('qt5') shared_qt5deps = dependency('qt5', modules: ['Core', 'Gui', 'Widgets', 'OpenGL']) libavcodecdep = dependency('libavcodec') libavformatdep = dependency('libavformat') libavutildep = dependency('libavutil') libmicrohttpddep = dependency('libmicrohttpd') protobufdep = dependency('protobuf') alsadep = dependency('alsa') movitdep = dependency('movit') vadrmdep = dependency('libva-drm') vax11dep = dependency('libva-x11') # Preprocess Qt as needed. qt_files = qt5.preprocess( moc_headers: ['aboutdialog.h', 'controller_spin_box.h'], ui_files: ['aboutdialog.ui'], dependencies: shared_qt5deps) # Protobuf compilation. gen = generator(protoc, \ output : ['@BASENAME@.pb.cc', '@BASENAME@.pb.h'], arguments : ['--proto_path=@CURRENT_SOURCE_DIR@', '--cpp_out=@BUILD_DIR@', '@INPUT@']) proto_generated = gen.process(['midi_mapping.proto']) protobuf_lib = static_library('protobufs', proto_generated, dependencies: [protobufdep]) protobuf_hdrs = declare_dependency(sources: proto_generated) srcs = ['memcpy_interleaved.cpp', 'metacube2.cpp', 'ffmpeg_raii.cpp', 'mux.cpp', 'metrics.cpp', 'context.cpp', 'httpd.cpp', 'disk_space_estimator.cpp', 'read_file.cpp', 'text_proto.cpp', 'midi_device.cpp', 'ref_counted_texture.cpp', 'va_display.cpp', 'va_resource_pool.cpp'] srcs += proto_generated # Qt objects. srcs += qt_files srcs += ['aboutdialog.cpp'] shared = static_library('shared', srcs, include_directories: top_include, dependencies: [shared_qt5deps, libavcodecdep, libavformatdep, libavutildep, libmicrohttpddep, protobufdep, alsadep, movitdep, vadrmdep, vax11dep]) shareddep = declare_dependency( sources: proto_generated, include_directories: top_include, link_with: [shared, protobuf_lib]) bin2h = executable('bin2h', 'bin2h.cpp', native: true) bin2h_gen = generator(bin2h, \ output : ['@PLAINNAME@.cpp'], arguments : ['@INPUT@', '@PLAINNAME@', '@OUTPUT@']) nageru-2.3.0/shared/metacube2.cpp000066400000000000000000000027111450736322200166230ustar00rootroot00000000000000/* * Implementation of Metacube2 utility functions. * * Note: This file is meant to compile as both C and C++, for easier inclusion * in other projects. */ #include "metacube2.h" #include #include /* * https://www.ece.cmu.edu/~koopman/pubs/KoopmanCRCWebinar9May2012.pdf * recommends this for messages as short as ours (see table at page 34). */ #define METACUBE2_CRC_POLYNOMIAL 0x8FDB /* Semi-random starting value to make sure all-zero won't pass. */ #define METACUBE2_CRC_START 0x1234 /* This code is based on code generated by pycrc. */ uint16_t metacube2_compute_crc(const struct metacube2_block_header *hdr) { static const int data_len = sizeof(hdr->size) + sizeof(hdr->flags); const uint8_t *data = (uint8_t *)&hdr->size; uint16_t crc = METACUBE2_CRC_START; int i, j; for (i = 0; i < data_len; ++i) { uint8_t c = data[i]; for (j = 0; j < 8; j++) { int bit = crc & 0x8000; crc = (crc << 1) | ((c >> (7 - j)) & 0x01); if (bit) { crc ^= METACUBE2_CRC_POLYNOMIAL; } } } /* Finalize. */ for (i = 0; i < 16; i++) { int bit = crc & 0x8000; crc = crc << 1; if (bit) { crc ^= METACUBE2_CRC_POLYNOMIAL; } } /* * Invert the checksum for metadata packets, so that clients that * don't understand metadata will ignore it as broken. There will * probably be logging, but apart from that, it's harmless. */ if (ntohs(hdr->flags) & METACUBE_FLAGS_METADATA) { crc ^= 0xffff; } return crc; } nageru-2.3.0/shared/metacube2.h000066400000000000000000000043301450736322200162670ustar00rootroot00000000000000#ifndef _METACUBE2_H #define _METACUBE2_H /* * Definitions for the Metacube2 protocol, used to communicate with Cubemap. * * Note: This file is meant to compile as both C and C++, for easier inclusion * in other projects. */ #include #define METACUBE2_SYNC "cube!map" /* 8 bytes long. */ #define METACUBE_FLAGS_HEADER 0x1 #define METACUBE_FLAGS_NOT_SUITABLE_FOR_STREAM_START 0x2 /* * Metadata packets; should not be counted as data, but rather * parsed (or ignored if you don't understand them). * * Metadata packets start with a uint64_t (network byte order) * that describe the type; the rest is defined by the type. */ #define METACUBE_FLAGS_METADATA 0x4 struct metacube2_block_header { char sync[8]; /* METACUBE2_SYNC */ uint32_t size; /* Network byte order. Does not include header. */ uint16_t flags; /* Network byte order. METACUBE_FLAGS_*. */ uint16_t csum; /* Network byte order. CRC16 of size and flags. If METACUBE_FLAGS_METADATA is set, inverted so that older clients will ignore it as broken. */ }; uint16_t metacube2_compute_crc(const struct metacube2_block_header *hdr); /* * Set by the encoder, and can be measured for latency purposes (e.g., if the * network can't keep up, the latency will tend to increase. */ #define METACUBE_METADATA_TYPE_ENCODER_TIMESTAMP 0x1 struct metacube2_timestamp_packet { uint64_t type; /* METACUBE_METADATA_TYPE_ENCODER_TIMESTAMP, in network byte order. */ /* * Time since the UTC epoch. Basically a struct timespec. * Both are in network byte order. */ uint64_t tv_sec; uint64_t tv_nsec; }; /* * Sent before a block to mark its presentation timestamp (ie., counts * only for the next Metacube block). Used so that the reflector can know * the length (in seconds) of fragments. */ #define METACUBE_METADATA_TYPE_NEXT_BLOCK_PTS 0x2 struct metacube2_pts_packet { uint64_t type; /* METACUBE_METADATA_TYPE_NEXT_BLOCK_PTS, in network byte order. */ /* The timestamp of the first packet in the next block, in network byte order. */ int64_t pts; /* Timebase "pts" is expressed in, as a fraction. Network byte order. */ uint64_t timebase_num, timebase_den; }; #endif /* !defined(_METACUBE_H) */ nageru-2.3.0/shared/metrics.cpp000066400000000000000000000242551450736322200164310ustar00rootroot00000000000000#include "shared/metrics.h" #include #include #include #include #include #include using namespace std; using namespace std::chrono; Metrics global_metrics; string Metrics::prefix = "nageru"; double get_timestamp_for_metrics() { return duration(system_clock::now().time_since_epoch()).count(); } string Metrics::serialize_name(const string &name, const vector> &labels) { return prefix + "_" + name + serialize_labels(labels); } string Metrics::serialize_labels(const vector> &labels) { if (labels.empty()) { return ""; } string label_str; for (const pair &label : labels) { if (!label_str.empty()) { label_str += ","; } label_str += label.first + "=\"" + label.second + "\""; } return "{" + label_str + "}"; } void Metrics::add(const string &name, const vector> &labels, atomic *location, Metrics::Type type) { Metric metric; metric.data_type = DATA_TYPE_INT64; metric.location_int64 = location; lock_guard lock(mu); metrics.emplace(MetricKey(name, labels), metric); assert(types.count(name) == 0 || types[name] == type); types[name] = type; } void Metrics::add(const string &name, const vector> &labels, atomic *location, Metrics::Type type) { Metric metric; metric.data_type = DATA_TYPE_DOUBLE; metric.location_double = location; lock_guard lock(mu); metrics.emplace(MetricKey(name, labels), metric); assert(types.count(name) == 0 || types[name] == type); types[name] = type; } void Metrics::add(const string &name, const vector> &labels, Histogram *location, Laziness laziness) { Metric metric; metric.data_type = DATA_TYPE_HISTOGRAM; metric.laziness = laziness; metric.location_histogram = location; lock_guard lock(mu); metrics.emplace(MetricKey(name, labels), metric); assert(types.count(name) == 0 || types[name] == TYPE_HISTOGRAM); types[name] = TYPE_HISTOGRAM; } void Metrics::add(const string &name, const vector> &labels, Summary *location, Laziness laziness) { Metric metric; metric.data_type = DATA_TYPE_SUMMARY; metric.laziness = laziness; metric.location_summary = location; lock_guard lock(mu); metrics.emplace(MetricKey(name, labels), metric); assert(types.count(name) == 0 || types[name] == TYPE_SUMMARY); types[name] = TYPE_SUMMARY; } void Metrics::remove(const string &name, const vector> &labels) { lock_guard lock(mu); auto it = metrics.find(MetricKey(name, labels)); assert(it != metrics.end()); // If this is the last metric with this name, remove the type as well. if (!((it != metrics.begin() && prev(it)->first.name == name) || (it != metrics.end() && next(it) != metrics.end() && next(it)->first.name == name))) { types.erase(name); } metrics.erase(it); } void Metrics::remove_if_exists(const string &name, const vector> &labels) { lock_guard lock(mu); auto it = metrics.find(MetricKey(name, labels)); if (it == metrics.end()) { return; } // If this is the last metric with this name, remove the type as well. if (!((it != metrics.begin() && prev(it)->first.name == name) || (it != metrics.end() && next(it) != metrics.end() && next(it)->first.name == name))) { types.erase(name); } metrics.erase(it); } string Metrics::serialize() const { stringstream ss; ss.imbue(locale("C")); ss.precision(20); lock_guard lock(mu); auto type_it = types.cbegin(); for (const auto &key_and_metric : metrics) { string name = prefix + "_" + key_and_metric.first.name + key_and_metric.first.serialized_labels; const Metric &metric = key_and_metric.second; if (type_it != types.cend() && key_and_metric.first.name == type_it->first) { // It's the first time we print out any metric with this name, // so add the type header. if (type_it->second == TYPE_GAUGE) { ss << "# TYPE " + prefix + "_" << type_it->first << " gauge\n"; } else if (type_it->second == TYPE_HISTOGRAM) { ss << "# TYPE " + prefix + "_" << type_it->first << " histogram\n"; } else if (type_it->second == TYPE_SUMMARY) { ss << "# TYPE " + prefix + "_" << type_it->first << " summary\n"; } ++type_it; } if (metric.data_type == DATA_TYPE_INT64) { ss << name << " " << metric.location_int64->load() << "\n"; } else if (metric.data_type == DATA_TYPE_DOUBLE) { double val = metric.location_double->load(); if (isnan(val)) { // Prometheus can't handle “-nan”. ss << name << " NaN\n"; } else { ss << name << " " << val << "\n"; } } else if (metric.data_type == DATA_TYPE_HISTOGRAM) { ss << metric.location_histogram->serialize(metric.laziness, key_and_metric.first.name, key_and_metric.first.labels); } else { ss << metric.location_summary->serialize(metric.laziness, key_and_metric.first.name, key_and_metric.first.labels); } } return ss.str(); } void Histogram::init(const vector &bucket_vals) { this->num_buckets = bucket_vals.size(); buckets.reset(new Bucket[num_buckets]); for (size_t i = 0; i < num_buckets; ++i) { buckets[i].val = bucket_vals[i]; } } void Histogram::init_uniform(size_t num_buckets) { this->num_buckets = num_buckets; buckets.reset(new Bucket[num_buckets]); for (size_t i = 0; i < num_buckets; ++i) { buckets[i].val = i; } } void Histogram::init_geometric(double min, double max, size_t num_buckets) { this->num_buckets = num_buckets; buckets.reset(new Bucket[num_buckets]); for (size_t i = 0; i < num_buckets; ++i) { buckets[i].val = min * pow(max / min, double(i) / (num_buckets - 1)); } } void Histogram::count_event(double val) { Bucket ref_bucket; ref_bucket.val = val; auto it = lower_bound(buckets.get(), buckets.get() + num_buckets, ref_bucket, [](const Bucket &a, const Bucket &b) { return a.val < b.val; }); if (it == buckets.get() + num_buckets) { ++count_after_last_bucket; } else { ++it->count; } // Non-atomic add, but that's fine, since there are no concurrent writers. sum = sum + val; } string Histogram::serialize(Metrics::Laziness laziness, const string &name, const vector> &labels) const { // Check if the histogram is empty and should not be serialized. if (laziness == Metrics::PRINT_WHEN_NONEMPTY && count_after_last_bucket.load() == 0) { bool empty = true; for (size_t bucket_idx = 0; bucket_idx < num_buckets; ++bucket_idx) { if (buckets[bucket_idx].count.load() != 0) { empty = false; break; } } if (empty) { return ""; } } stringstream ss; ss.imbue(locale("C")); ss.precision(20); int64_t count = 0; for (size_t bucket_idx = 0; bucket_idx < num_buckets; ++bucket_idx) { stringstream le_ss; le_ss.imbue(locale("C")); le_ss.precision(20); le_ss << buckets[bucket_idx].val; vector> bucket_labels = labels; bucket_labels.emplace_back("le", le_ss.str()); count += buckets[bucket_idx].count.load(); ss << Metrics::serialize_name(name + "_bucket", bucket_labels) << " " << count << "\n"; } count += count_after_last_bucket.load(); ss << Metrics::serialize_name(name + "_sum", labels) << " " << sum.load() << "\n"; ss << Metrics::serialize_name(name + "_count", labels) << " " << count << "\n"; return ss.str(); } void Summary::init(const vector &quantiles, double window_seconds) { this->quantiles = quantiles; window = duration(window_seconds); } void Summary::count_event(double val) { steady_clock::time_point now = steady_clock::now(); steady_clock::time_point cutoff = now - duration_cast(window); lock_guard lock(mu); values.emplace_back(now, val); while (!values.empty() && values.front().first < cutoff) { values.pop_front(); } // Non-atomic add, but that's fine, since there are no concurrent writers. sum = sum + val; ++count; } string Summary::serialize(Metrics::Laziness laziness, const string &name, const vector> &labels) { steady_clock::time_point now = steady_clock::now(); steady_clock::time_point cutoff = now - duration_cast(window); vector values_copy; { lock_guard lock(mu); while (!values.empty() && values.front().first < cutoff) { values.pop_front(); } values_copy.reserve(values.size()); for (const auto &time_and_value : values) { values_copy.push_back(time_and_value.second); } } vector> answers; if (values_copy.size() == 0) { if (laziness == Metrics::PRINT_WHEN_NONEMPTY) { return ""; } for (double quantile : quantiles) { answers.emplace_back(quantile, 0.0 / 0.0); } } else if (values_copy.size() == 1) { for (double quantile : quantiles) { answers.emplace_back(quantile, values_copy[0]); } } else { // We could probably do repeated nth_element, but the constant factor // gets a bit high, so just sorting probably is about as fast. sort(values_copy.begin(), values_copy.end()); for (double quantile : quantiles) { double idx = quantile * (values_copy.size() - 1); size_t idx_floor = size_t(floor(idx)); const double v0 = values_copy[idx_floor]; if (idx_floor == values_copy.size() - 1) { answers.emplace_back(quantile, values_copy[idx_floor]); } else { // Linear interpolation. double t = idx - idx_floor; const double v1 = values_copy[idx_floor + 1]; answers.emplace_back(quantile, v0 + t * (v1 - v0)); } } } stringstream ss; ss.imbue(locale("C")); ss.precision(20); for (const auto &quantile_and_value : answers) { stringstream quantile_ss; quantile_ss.imbue(locale("C")); quantile_ss.precision(3); quantile_ss << quantile_and_value.first; vector> quantile_labels = labels; quantile_labels.emplace_back("quantile", quantile_ss.str()); double val = quantile_and_value.second;; if (isnan(val)) { // Prometheus can't handle “-nan”. ss << Metrics::serialize_name(name, quantile_labels) << " NaN\n"; } else { ss << Metrics::serialize_name(name, quantile_labels) << " " << val << "\n"; } } ss << Metrics::serialize_name(name + "_sum", labels) << " " << sum.load() << "\n"; ss << Metrics::serialize_name(name + "_count", labels) << " " << count.load() << "\n"; return ss.str(); } nageru-2.3.0/shared/metrics.h000066400000000000000000000125701450736322200160730ustar00rootroot00000000000000#ifndef _METRICS_H #define _METRICS_H 1 // A simple global class to keep track of metrics export in Prometheus format. // It would be better to use a more full-featured Prometheus client library for this, // but it would introduce a dependency that is not commonly packaged in distributions, // which makes it quite unwieldy. Thus, we'll package our own for the time being. #include #include #include #include #include #include #include #include #include class Histogram; class Summary; // Prometheus recommends the use of timestamps instead of “time since event”, // so you can use this to get the number of seconds since the epoch. // Note that this will be wrong if your clock changes, so for non-metric use, // you should use std::chrono::steady_clock instead. double get_timestamp_for_metrics(); class Metrics { public: enum Type { TYPE_COUNTER, TYPE_GAUGE, TYPE_HISTOGRAM, // Internal use only. TYPE_SUMMARY, // Internal use only. }; enum Laziness { PRINT_ALWAYS, PRINT_WHEN_NONEMPTY, }; void set_prefix(const std::string &prefix) // Not thread-safe; must be set before HTTPD starts up. { this->prefix = prefix; } void add(const std::string &name, std::atomic *location, Type type = TYPE_COUNTER) { add(name, {}, location, type); } void add(const std::string &name, std::atomic *location, Type type = TYPE_COUNTER) { add(name, {}, location, type); } void add(const std::string &name, Histogram *location) { add(name, {}, location); } void add(const std::string &name, Summary *location) { add(name, {}, location); } void add(const std::string &name, const std::vector> &labels, std::atomic *location, Type type = TYPE_COUNTER); void add(const std::string &name, const std::vector> &labels, std::atomic *location, Type type = TYPE_COUNTER); void add(const std::string &name, const std::vector> &labels, Histogram *location, Laziness laziness = PRINT_ALWAYS); void add(const std::string &name, const std::vector> &labels, Summary *location, Laziness laziness = PRINT_ALWAYS); void remove(const std::string &name) { remove(name, {}); } void remove(const std::string &name, const std::vector> &labels); void remove_if_exists(const std::string &name, const std::vector> &labels); std::string serialize() const; private: static std::string serialize_name(const std::string &name, const std::vector> &labels); static std::string serialize_labels(const std::vector> &labels); enum DataType { DATA_TYPE_INT64, DATA_TYPE_DOUBLE, DATA_TYPE_HISTOGRAM, DATA_TYPE_SUMMARY, }; struct MetricKey { MetricKey(const std::string &name, const std::vector> labels) : name(name), labels(labels), serialized_labels(serialize_labels(labels)) { } bool operator< (const MetricKey &other) const { if (name != other.name) return name < other.name; return serialized_labels < other.serialized_labels; } const std::string name; const std::vector> labels; const std::string serialized_labels; }; struct Metric { DataType data_type; Laziness laziness; // Only for TYPE_HISTOGRAM. union { std::atomic *location_int64; std::atomic *location_double; Histogram *location_histogram; Summary *location_summary; }; }; mutable std::mutex mu; std::map types; // Ordered the same as metrics. std::map metrics; static std::string prefix; friend class Histogram; friend class Summary; }; class Histogram { public: void init(const std::vector &bucket_vals); void init_uniform(size_t num_buckets); // Sets up buckets 0..(N-1). void init_geometric(double min, double max, size_t num_buckets); void count_event(double val); std::string serialize(Metrics::Laziness laziness, const std::string &name, const std::vector> &labels) const; private: // Bucket counts number of events where val[i - 1] < x <= val[i]. // The end histogram ends up being made into a cumulative one, // but that's not how we store it here. struct Bucket { double val; std::atomic count{0}; }; std::unique_ptr buckets; size_t num_buckets; std::atomic sum{0.0}; std::atomic count_after_last_bucket{0}; }; // This is a pretty dumb streaming quantile class, but it's exact, and we don't have // too many values (typically one per frame, and one-minute interval), so we don't // need anything fancy. class Summary { public: void init(const std::vector &quantiles, double window_seconds); void count_event(double val); std::string serialize(Metrics::Laziness laziness, const std::string &name, const std::vector> &labels); private: std::vector quantiles; std::chrono::duration window; mutable std::mutex mu; std::deque> values; std::atomic sum{0.0}; std::atomic count{0}; }; extern Metrics global_metrics; #endif // !defined(_METRICS_H) nageru-2.3.0/shared/midi_device.cpp000066400000000000000000000223111450736322200172130ustar00rootroot00000000000000#include "midi_device.h" #include #include #include #include #include using namespace std; MIDIDevice::MIDIDevice(MIDIReceiver *receiver) : receiver(receiver) { should_quit_fd = eventfd(/*initval=*/0, /*flags=*/0); assert(should_quit_fd != -1); } MIDIDevice::~MIDIDevice() { should_quit = true; const uint64_t one = 1; if (write(should_quit_fd, &one, sizeof(one)) != sizeof(one)) { perror("write(should_quit_fd)"); abort(); } midi_thread.join(); close(should_quit_fd); } void MIDIDevice::start_thread() { midi_thread = thread(&MIDIDevice::thread_func, this); } #define RETURN_ON_ERROR(msg, expr) do { \ int err = (expr); \ if (err < 0) { \ fprintf(stderr, msg ": %s\n", snd_strerror(err)); \ return; \ } \ } while (false) #define WARN_ON_ERROR(msg, expr) do { \ int err = (expr); \ if (err < 0) { \ fprintf(stderr, msg ": %s\n", snd_strerror(err)); \ } \ } while (false) void MIDIDevice::thread_func() { pthread_setname_np(pthread_self(), "MIDIDevice"); snd_seq_t *seq; int err; RETURN_ON_ERROR("snd_seq_open", snd_seq_open(&seq, "default", SND_SEQ_OPEN_DUPLEX, 0)); RETURN_ON_ERROR("snd_seq_nonblock", snd_seq_nonblock(seq, 1)); RETURN_ON_ERROR("snd_seq_client_name", snd_seq_set_client_name(seq, "nageru")); RETURN_ON_ERROR("snd_seq_create_simple_port", snd_seq_create_simple_port(seq, "nageru", SND_SEQ_PORT_CAP_READ | SND_SEQ_PORT_CAP_SUBS_READ | SND_SEQ_PORT_CAP_WRITE | SND_SEQ_PORT_CAP_SUBS_WRITE, SND_SEQ_PORT_TYPE_MIDI_GENERIC | SND_SEQ_PORT_TYPE_APPLICATION)); int queue_id = snd_seq_alloc_queue(seq); RETURN_ON_ERROR("snd_seq_create_queue", queue_id); RETURN_ON_ERROR("snd_seq_start_queue", snd_seq_start_queue(seq, queue_id, nullptr)); // The sequencer object is now ready to be used from other threads. { lock_guard lock(mu); alsa_seq = seq; alsa_queue_id = queue_id; } // Listen to the announce port (0:1), which will tell us about new ports. RETURN_ON_ERROR("snd_seq_connect_from", snd_seq_connect_from(seq, 0, /*client=*/0, /*port=*/1)); // Now go through all ports and subscribe to them. snd_seq_client_info_t *cinfo; snd_seq_client_info_alloca(&cinfo); snd_seq_client_info_set_client(cinfo, -1); while (snd_seq_query_next_client(seq, cinfo) >= 0) { int client = snd_seq_client_info_get_client(cinfo); snd_seq_port_info_t *pinfo; snd_seq_port_info_alloca(&pinfo); snd_seq_port_info_set_client(pinfo, client); snd_seq_port_info_set_port(pinfo, -1); while (snd_seq_query_next_port(seq, pinfo) >= 0) { constexpr int mask = SND_SEQ_PORT_CAP_READ | SND_SEQ_PORT_CAP_SUBS_READ; if ((snd_seq_port_info_get_capability(pinfo) & mask) == mask) { lock_guard lock(mu); subscribe_to_port_lock_held(seq, *snd_seq_port_info_get_addr(pinfo)); } } } int num_alsa_fds = snd_seq_poll_descriptors_count(seq, POLLIN); unique_ptr fds(new pollfd[num_alsa_fds + 1]); while (!should_quit) { snd_seq_poll_descriptors(seq, fds.get(), num_alsa_fds, POLLIN); fds[num_alsa_fds].fd = should_quit_fd; fds[num_alsa_fds].events = POLLIN; fds[num_alsa_fds].revents = 0; err = poll(fds.get(), num_alsa_fds + 1, -1); if (err == 0 || (err == -1 && errno == EINTR)) { continue; } if (err == -1) { perror("poll"); break; } if (fds[num_alsa_fds].revents) { // Activity on should_quit_fd. break; } // Seemingly we can get multiple events in a single poll, // and if we don't handle them all, poll will _not_ alert us! while (!should_quit) { snd_seq_event_t *event; err = snd_seq_event_input(seq, &event); if (err < 0) { if (err == -EINTR) continue; if (err == -EAGAIN) break; if (err == -ENOSPC) { fprintf(stderr, "snd_seq_event_input: Some events were lost.\n"); continue; } fprintf(stderr, "snd_seq_event_input: %s\n", snd_strerror(err)); return; } if (event) { handle_event(seq, event); } } } } void MIDIDevice::handle_event(snd_seq_t *seq, snd_seq_event_t *event) { if (event->source.client == snd_seq_client_id(seq)) { // Ignore events we sent out ourselves. return; } switch (event->type) { case SND_SEQ_EVENT_CONTROLLER: { receiver->controller_received(event->data.control.param, event->data.control.value); break; } case SND_SEQ_EVENT_PITCHBEND: { // Note, -8192 to 8191 instead of 0 to 127. receiver->controller_received(MIDIReceiver::PITCH_BEND_CONTROLLER, event->data.control.value); break; } case SND_SEQ_EVENT_NOTEON: { receiver->note_on_received(event->data.note.note); break; } case SND_SEQ_EVENT_PORT_START: { lock_guard lock(mu); subscribe_to_port_lock_held(seq, event->data.addr); break; } case SND_SEQ_EVENT_PORT_EXIT: printf("MIDI port %d:%d went away.\n", event->data.addr.client, event->data.addr.port); break; case SND_SEQ_EVENT_PORT_SUBSCRIBED: if (event->data.connect.sender.client != 0 && // Ignore system senders. event->data.connect.sender.client != snd_seq_client_id(seq) && event->data.connect.dest.client == snd_seq_client_id(seq)) { receiver->update_num_subscribers(++num_subscribed_ports); } break; case SND_SEQ_EVENT_PORT_UNSUBSCRIBED: if (event->data.connect.sender.client != 0 && // Ignore system senders. event->data.connect.sender.client != snd_seq_client_id(seq) && event->data.connect.dest.client == snd_seq_client_id(seq)) { receiver->update_num_subscribers(--num_subscribed_ports); } break; case SND_SEQ_EVENT_NOTEOFF: case SND_SEQ_EVENT_CLIENT_START: case SND_SEQ_EVENT_CLIENT_EXIT: case SND_SEQ_EVENT_CLIENT_CHANGE: case SND_SEQ_EVENT_PORT_CHANGE: break; default: printf("Ignoring MIDI event of unknown type %d.\n", event->type); } } void MIDIDevice::subscribe_to_port_lock_held(snd_seq_t *seq, const snd_seq_addr_t &addr) { // Client 0 (SNDRV_SEQ_CLIENT_SYSTEM) is basically the system; ignore it. // MIDI through (SNDRV_SEQ_CLIENT_DUMMY) echoes back what we give it, so ignore that, too. if (addr.client == 0 || addr.client == 14) { return; } // Don't listen to ourselves. if (addr.client == snd_seq_client_id(seq)) { return; } int err = snd_seq_connect_from(seq, 0, addr.client, addr.port); if (err < 0) { // Just print out a warning (i.e., don't die); it could // very well just be e.g. another application. printf("Couldn't subscribe to MIDI port %d:%d (%s).\n", addr.client, addr.port, snd_strerror(err)); } else { printf("Subscribed to MIDI port %d:%d.\n", addr.client, addr.port); } // For sending data back. err = snd_seq_connect_to(seq, 0, addr.client, addr.port); if (err < 0) { printf("Couldn't subscribe MIDI port %d:%d (%s) to us.\n", addr.client, addr.port, snd_strerror(err)); } else { printf("Subscribed MIDI port %d:%d to us.\n", addr.client, addr.port); } // The current status of the device is unknown, so refresh it. map active_lights = move(current_light_status); current_light_status.clear(); update_lights_lock_held(active_lights); } void MIDIDevice::update_lights_lock_held(const map &active_lights) { if (alsa_seq == nullptr) { return; } unsigned num_events = 0; for (auto type : { LightKey::NOTE, LightKey::CONTROLLER }) { for (unsigned num = 1; num <= 127; ++num) { // Note: Pitch bend is ignored. LightKey key{type, num}; const auto it = active_lights.find(key); uint8_t value; // Velocity for notes, controller value for controllers. // Notes have a natural “off”, while controllers don't really. // For some reason, not all devices respond to note off. // Use note-on with value of 0 (which is equivalent) instead. if (it == active_lights.end()) { // Notes have a natural “off”, while controllers don't really, // so just skip them if we have no set value. if (type == LightKey::CONTROLLER) continue; // For some reason, not all devices respond to note off. // Use note-on with value of 0 (which is equivalent) instead. value = 0; } else { value = it->second; } if (current_light_status.count(key) && current_light_status[key] == value) { // Already known to be in the desired state. continue; } snd_seq_event_t ev; snd_seq_ev_clear(&ev); // Some devices drop events if we throw them onto them // too quickly. Add a 1 ms delay for each. snd_seq_real_time_t tm{0, num_events++ * 1000000}; snd_seq_ev_schedule_real(&ev, alsa_queue_id, true, &tm); snd_seq_ev_set_source(&ev, 0); snd_seq_ev_set_subs(&ev); if (type == LightKey::NOTE) { snd_seq_ev_set_noteon(&ev, /*channel=*/0, num, value); current_light_status[key] = value; } else { snd_seq_ev_set_controller(&ev, /*channel=*/0, num, value); current_light_status[key] = value; } WARN_ON_ERROR("snd_seq_event_output", snd_seq_event_output(alsa_seq, &ev)); } } WARN_ON_ERROR("snd_seq_drain_output", snd_seq_drain_output(alsa_seq)); } nageru-2.3.0/shared/midi_device.h000066400000000000000000000042751450736322200166710ustar00rootroot00000000000000#ifndef _MIDI_DEVICE_H #define _MIDI_DEVICE_H 1 // MIDIDevice is a class that pools incoming MIDI messages from // all MIDI devices in the system, decodes them and sends them on. #include #include #include #include typedef struct snd_seq_addr snd_seq_addr_t; typedef struct snd_seq_event snd_seq_event_t; typedef struct _snd_seq snd_seq_t; class MIDIReceiver { public: // Pitch bend events are received as a virtual controller with // range -8192..8191 instead of 0..127 (but see the comment // in map_controller_to_float() in midi_mapper.cpp). static constexpr int PITCH_BEND_CONTROLLER = 128; virtual ~MIDIReceiver() {} virtual void controller_received(int controller, int value) = 0; virtual void note_on_received(int note) = 0; virtual void update_num_subscribers(unsigned num_subscribers) = 0; }; class MIDIDevice { public: struct LightKey { enum { NOTE, CONTROLLER } type; unsigned number; bool operator< (const LightKey& other) const { if (type != other.type) { return type < other.type; } return number < other.number; } }; MIDIDevice(MIDIReceiver *receiver); ~MIDIDevice(); void start_thread(); void update_lights(const std::map &active_lights) { std::lock_guard lock(mu); update_lights_lock_held(active_lights); } private: void thread_func(); void handle_event(snd_seq_t *seq, snd_seq_event_t *event); void subscribe_to_port_lock_held(snd_seq_t *seq, const snd_seq_addr_t &addr); void update_lights_lock_held(const std::map &active_lights); std::atomic should_quit{false}; int should_quit_fd; // Recursive because the MIDI receiver may update_lights() back while we are sending it stuff. // TODO: Do we need this anymore after receiver is not under the lock? mutable std::recursive_mutex mu; MIDIReceiver *receiver; // _Not_ under ; everything on it should be thread-safe. std::thread midi_thread; std::map current_light_status; // Keyed by note number. Under . snd_seq_t *alsa_seq{nullptr}; // Under . int alsa_queue_id{-1}; // Under . std::atomic num_subscribed_ports{0}; }; #endif // !defined(_MIDI_DEVICE_H) nageru-2.3.0/shared/midi_mapper_util.h000066400000000000000000000074141450736322200177510ustar00rootroot00000000000000#ifndef _MIDI_MAPPER_UTIL_H #define _MIDI_MAPPER_UTIL_H 1 #include "midi_mapping.pb.h" #include "shared/midi_device.h" #include template inline int get_controller_mapping_helper(const Proto &msg, int field_number, int default_value) { using namespace google::protobuf; const FieldDescriptor *descriptor = msg.GetDescriptor()->FindFieldByNumber(field_number); const Reflection *reflection = msg.GetReflection(); if (!reflection->HasField(msg, descriptor)) { return default_value; } const MIDIControllerProto &controller_proto = static_cast(reflection->GetMessage(msg, descriptor)); return controller_proto.controller_number(); } template inline bool match_controller_helper(const Proto &msg, int field_number, int controller) { return (get_controller_mapping_helper(msg, field_number, -1) == controller); } template inline int get_button_mapping_helper(const Proto &msg, int field_number, int default_value) { using namespace google::protobuf; const FieldDescriptor *descriptor = msg.GetDescriptor()->FindFieldByNumber(field_number); const Reflection *reflection = msg.GetReflection(); if (!reflection->HasField(msg, descriptor)) { return default_value; } const MIDIButtonProto &button_proto = static_cast(reflection->GetMessage(msg, descriptor)); return button_proto.note_number(); } template inline bool match_button_helper(const Proto &msg, int field_number, int note) { return (get_button_mapping_helper(msg, field_number, -1) == note); } template inline bool match_bank_helper(const Proto &msg, int bank_field_number, int bank) { using namespace google::protobuf; const FieldDescriptor *bank_descriptor = msg.GetDescriptor()->FindFieldByNumber(bank_field_number); const Reflection *reflection = msg.GetReflection(); if (!reflection->HasField(msg, bank_descriptor)) { // No bank set => in all banks. return true; } return reflection->GetInt32(msg, bank_descriptor) == bank; } template inline MIDILightProto get_light_mapping_helper(const Proto &msg, int field_number) { using namespace google::protobuf; const FieldDescriptor *descriptor = msg.GetDescriptor()->FindFieldByNumber(field_number); const Reflection *reflection = msg.GetReflection(); if (!reflection->HasField(msg, descriptor)) { return MIDILightProto(); } return static_cast(reflection->GetMessage(msg, descriptor)); } // Find what MIDI note the given light (as given by field_number) is mapped to, and enable it. template void activate_mapped_light(const Proto &msg, int field_number, std::map *active_lights) { MIDILightProto light_proto = get_light_mapping_helper(msg, field_number); if (!light_proto.has_note_number()) { return; } active_lights->emplace(MIDIDevice::LightKey{MIDIDevice::LightKey::NOTE, unsigned(light_proto.note_number())}, light_proto.velocity()); } inline double map_controller_to_float(int controller, int val) { if (controller == MIDIReceiver::PITCH_BEND_CONTROLLER) { // We supposedly go from -8192 to 8191 (inclusive), but there are // controllers that only have 10-bit precision and do the upconversion // to 14-bit wrong (just padding with zeros), making 8176 the highest // attainable value. We solve this by making the effective range // -8176..8176 (inclusive). if (val <= -8176) { return 0.0; } else if (val >= 8176) { return 1.0; } else { return 0.5 * (double(val) / 8176.0) + 0.5; } } // Slightly hackish mapping so that we can represent exactly 0.0, 0.5 and 1.0. if (val <= 0) { return 0.0; } else if (val >= 127) { return 1.0; } else { return (val + 0.5) / 127.0; } } #endif // !defined(_MIDI_MAPPER_UTIL_H) nageru-2.3.0/shared/midi_mapping.proto000066400000000000000000000010511450736322200177660ustar00rootroot00000000000000// Mappings from MIDI controllers to the UI. (We don't really build // a more complicated data structure than this in Nageru itself either; // we just edit and match directly against the protobuf.) syntax = "proto2"; // A single, given controller mapping. message MIDIControllerProto { required int32 controller_number = 1; // TODO: Add flags like invert here if/when we need them. } message MIDIButtonProto { required int32 note_number = 1; } message MIDILightProto { required int32 note_number = 1; optional int32 velocity = 2 [default=1]; } nageru-2.3.0/shared/mux.cpp000066400000000000000000000242761450736322200155770ustar00rootroot00000000000000#include "shared/mux.h" #include #include #include #include #include #include #include #include #include #include extern "C" { #include #include #include #include #include #include #include } #include "shared/metrics.h" #include "shared/shared_defs.h" #include "shared/timebase.h" using namespace std; struct PacketBefore { PacketBefore(const AVFormatContext *ctx) : ctx(ctx) {} bool operator() (const Mux::QueuedPacket &a_qp, const Mux::QueuedPacket &b_qp) const { const AVPacket *a = a_qp.pkt; const AVPacket *b = b_qp.pkt; int64_t a_dts = (a->dts == AV_NOPTS_VALUE ? a->pts : a->dts); int64_t b_dts = (b->dts == AV_NOPTS_VALUE ? b->pts : b->dts); AVRational a_timebase = ctx->streams[a->stream_index]->time_base; AVRational b_timebase = ctx->streams[b->stream_index]->time_base; if (av_compare_ts(a_dts, a_timebase, b_dts, b_timebase) != 0) { return av_compare_ts(a_dts, a_timebase, b_dts, b_timebase) < 0; } else { return av_compare_ts(a->pts, a_timebase, b->pts, b_timebase) < 0; } } const AVFormatContext * const ctx; }; Mux::Mux(AVFormatContext *avctx, int width, int height, Codec video_codec, const string &video_extradata, const AVCodecParameters *audio_codecpar, AVColorSpace color_space, int time_base, function write_callback, WriteStrategy write_strategy, const vector &metrics, WithSubtitles with_subtitles) : write_strategy(write_strategy), avctx(avctx), write_callback(write_callback), metrics(metrics) { // MPEG-TS ostensibly needs some conversions (e.g. for differing start codes), // so let FFmpeg insert them as needed in case we are muxing to that. // Curiously enough, things actually seem to go quite fine without // (and it also seems FFmpeg's MPEG-TS muxer automatically does stuff like // repeat PPS/SPS before keyframes for us), but it can't hurt. avctx->flags |= AVFMT_FLAG_AUTO_BSF; AVStream *avstream_video = avformat_new_stream(avctx, nullptr); if (avstream_video == nullptr) { fprintf(stderr, "avformat_new_stream() failed\n"); abort(); } avstream_video->time_base = AVRational{1, time_base}; avstream_video->codecpar->codec_type = AVMEDIA_TYPE_VIDEO; if (video_codec == CODEC_H264) { avstream_video->codecpar->codec_id = AV_CODEC_ID_H264; } else if (video_codec == CODEC_AV1) { avstream_video->codecpar->codec_id = AV_CODEC_ID_AV1; } else { assert(video_codec == CODEC_MJPEG); avstream_video->codecpar->codec_id = AV_CODEC_ID_MJPEG; } avstream_video->codecpar->width = width; avstream_video->codecpar->height = height; // Colorspace details. Closely correspond to settings in EffectChain_finalize, // as noted in each comment. // Note that the H.264 stream also contains this information and depending on the // mux, this might simply get ignored. See sps_rbsp(). // Note that there's no way to change this per-frame as the H.264 stream // would like to be able to. avstream_video->codecpar->color_primaries = AVCOL_PRI_BT709; // RGB colorspace (inout_format.color_space). avstream_video->codecpar->color_trc = AVCOL_TRC_IEC61966_2_1; // Gamma curve (inout_format.gamma_curve). // YUV colorspace (output_ycbcr_format.luma_coefficients). avstream_video->codecpar->color_space = color_space; avstream_video->codecpar->color_range = AVCOL_RANGE_MPEG; // Full vs. limited range (output_ycbcr_format.full_range). avstream_video->codecpar->chroma_location = AVCHROMA_LOC_LEFT; // Chroma sample location. See chroma_offset_0[] in Mixer::subsample_chroma(). avstream_video->codecpar->field_order = AV_FIELD_PROGRESSIVE; if (!video_extradata.empty()) { avstream_video->codecpar->extradata = (uint8_t *)av_malloc(video_extradata.size() + AV_INPUT_BUFFER_PADDING_SIZE); avstream_video->codecpar->extradata_size = video_extradata.size(); memcpy(avstream_video->codecpar->extradata, video_extradata.data(), video_extradata.size()); } streams.push_back(avstream_video); if (audio_codecpar != nullptr) { AVStream *avstream_audio = avformat_new_stream(avctx, nullptr); if (avstream_audio == nullptr) { fprintf(stderr, "avformat_new_stream() failed\n"); abort(); } avstream_audio->time_base = AVRational{1, time_base}; if (avcodec_parameters_copy(avstream_audio->codecpar, audio_codecpar) < 0) { fprintf(stderr, "avcodec_parameters_copy() failed\n"); abort(); } streams.push_back(avstream_audio); } if (with_subtitles == WITH_SUBTITLES) { AVStream *avstream_subtitles = avformat_new_stream(avctx, nullptr); if (avstream_subtitles == nullptr) { fprintf(stderr, "avformat_new_stream() failed\n"); abort(); } avstream_subtitles->time_base = AVRational{1, time_base}; avstream_subtitles->codecpar->codec_type = AVMEDIA_TYPE_SUBTITLE; avstream_subtitles->codecpar->codec_id = AV_CODEC_ID_WEBVTT; avstream_subtitles->disposition = AV_DISPOSITION_METADATA; streams.push_back(avstream_subtitles); subtitle_stream_idx = streams.size() - 1; } if (write_strategy == WRITE_BACKGROUND) { writer_thread = thread(&Mux::thread_func, this); } else { write_header(); } } Mux::~Mux() { assert(plug_count == 0); if (write_strategy == WRITE_BACKGROUND) { writer_thread_should_quit = true; packet_queue_ready.notify_all(); writer_thread.join(); } int64_t old_pos = avctx->pb->pos; av_write_trailer(avctx); for (MuxMetrics *metric : metrics) { metric->metric_written_bytes += avctx->pb->pos - old_pos; } if (!(avctx->oformat->flags & AVFMT_NOFILE) && !(avctx->flags & AVFMT_FLAG_CUSTOM_IO)) { avio_closep(&avctx->pb); } avformat_free_context(avctx); } void Mux::add_packet(const AVPacket &pkt, int64_t pts, int64_t dts, AVRational timebase, int stream_index_override) { assert(pts >= dts); AVPacket pkt_copy; if (av_packet_ref(&pkt_copy, &pkt) < 0) { fprintf(stderr, "av_copy_packet() failed\n"); abort(); } if (stream_index_override != -1) { pkt_copy.stream_index = stream_index_override; } assert(size_t(pkt_copy.stream_index) < streams.size()); AVRational time_base = streams[pkt_copy.stream_index]->time_base; pkt_copy.pts = av_rescale_q(pts, timebase, time_base); pkt_copy.dts = av_rescale_q(dts, timebase, time_base); pkt_copy.duration = av_rescale_q(pkt.duration, timebase, time_base); { lock_guard lock(mu); if (drained) { // Just drop the packet on the floor. } else if (write_strategy == WriteStrategy::WRITE_BACKGROUND) { packet_queue.push_back(QueuedPacket{ av_packet_clone(&pkt_copy), pts }); if (plug_count == 0) packet_queue_ready.notify_all(); } else if (plug_count > 0) { packet_queue.push_back(QueuedPacket{ av_packet_clone(&pkt_copy), pts }); } else { write_packet_or_die(pkt_copy, pts); } } av_packet_unref(&pkt_copy); } void Mux::write_packet_or_die(const AVPacket &pkt, int64_t unscaled_pts) { for (MuxMetrics *metric : metrics) { if (pkt.stream_index == 0) { metric->metric_video_bytes += pkt.size; } else if (pkt.stream_index == 1) { metric->metric_audio_bytes += pkt.size; } else { assert(false); } } int64_t old_pos = avctx->pb->pos; int err = av_interleaved_write_frame(avctx, const_cast(&pkt)); if (err < 0) { char errbuf[AV_ERROR_MAX_STRING_SIZE]; av_strerror(err, errbuf, sizeof(errbuf)); fprintf(stderr, "av_interleaved_write_frame() failed: %s\n", errbuf); exit(EXIT_FAILURE); } avio_flush(avctx->pb); for (MuxMetrics *metric : metrics) { metric->metric_written_bytes += avctx->pb->pos - old_pos; } if (pkt.stream_index == 0 && write_callback != nullptr) { write_callback(unscaled_pts); } } void Mux::plug() { lock_guard lock(mu); assert(!drained); ++plug_count; } void Mux::unplug() { lock_guard lock(mu); if (--plug_count > 0) { return; } assert(plug_count >= 0); sort(packet_queue.begin(), packet_queue.end(), PacketBefore(avctx)); if (write_strategy == WRITE_BACKGROUND) { packet_queue_ready.notify_all(); } else { for (QueuedPacket &qp : packet_queue) { write_packet_or_die(*qp.pkt, qp.unscaled_pts); av_packet_free(&qp.pkt); } packet_queue.clear(); } } void Mux::drain() { lock_guard lock(mu); assert(!drained); assert(plug_count == 0); for (QueuedPacket &qp : packet_queue) { av_packet_free(&qp.pkt); } packet_queue.clear(); drained = true; } void Mux::undrain() { lock_guard lock(mu); assert(drained); drained = false; } void Mux::thread_func() { pthread_setname_np(pthread_self(), "Mux"); write_header(); unique_lock lock(mu); for ( ;; ) { packet_queue_ready.wait(lock, [this]() { return writer_thread_should_quit || (!packet_queue.empty() && plug_count == 0); }); if (writer_thread_should_quit && packet_queue.empty()) { // All done. break; } assert(!packet_queue.empty() && plug_count == 0); vector packets; swap(packets, packet_queue); lock.unlock(); for (QueuedPacket &qp : packets) { write_packet_or_die(*qp.pkt, qp.unscaled_pts); av_packet_free(&qp.pkt); } lock.lock(); } } void Mux::write_header() { AVDictionary *options = NULL; vector> opts = MUX_OPTS; for (pair opt : opts) { av_dict_set(&options, opt.first.c_str(), opt.second.c_str(), 0); } int err = avformat_write_header(avctx, &options); if (err < 0) { char errbuf[AV_ERROR_MAX_STRING_SIZE]; av_strerror(err, errbuf, sizeof(errbuf)); fprintf(stderr, "avformat_write_header() failed: %s\n", errbuf); exit(EXIT_FAILURE); } for (MuxMetrics *metric : metrics) { metric->metric_written_bytes += avctx->pb->pos; } // Make sure the header is written before the constructor exits // (assuming we are in WRITE_FOREGROUND mode). avio_flush(avctx->pb); } void MuxMetrics::init(const vector> &labels) { vector> labels_video = labels; labels_video.emplace_back("stream", "video"); global_metrics.add("mux_stream_bytes", labels_video, &metric_video_bytes); vector> labels_audio = labels; labels_audio.emplace_back("stream", "audio"); global_metrics.add("mux_stream_bytes", labels_audio, &metric_audio_bytes); global_metrics.add("mux_written_bytes", labels, &metric_written_bytes); } nageru-2.3.0/shared/mux.h000066400000000000000000000103551450736322200152350ustar00rootroot00000000000000#ifndef _MUX_H #define _MUX_H 1 // Wrapper around an AVFormat mux. extern "C" { #include #include } #include #include #include #include #include #include #include #include #include #include "shared/timebase.h" struct MuxMetrics { // “written” will usually be equal video + audio + mux overhead, // except that there could be buffered packets that count in audio or video // but not yet in written. std::atomic metric_video_bytes{0}, metric_audio_bytes{0}, metric_written_bytes{0}; // Registers in global_metrics. void init(const std::vector> &labels); void reset() { metric_video_bytes = 0; metric_audio_bytes = 0; metric_written_bytes = 0; } }; inline AVColorSpace get_color_space(bool ycbcr_rec709_coefficients) { if (ycbcr_rec709_coefficients) { return AVCOL_SPC_BT709; } else { return AVCOL_SPC_SMPTE170M; } } class Mux { public: enum Codec { CODEC_H264, CODEC_AV1, CODEC_MJPEG }; enum WriteStrategy { // add_packet() will write the packet immediately, unless plugged. WRITE_FOREGROUND, // All writes will happen on a separate thread, so add_packet() // won't block. Use this if writing to a file and you might be // holding a mutex (because blocking I/O with a mutex held is // not good). Note that this will clone every packet, so it has // higher overhead. WRITE_BACKGROUND, }; enum WithSubtitles { WITH_SUBTITLES, WITHOUT_SUBTITLES }; // Takes ownership of avctx. will be called every time // a write has been made to the video stream (id 0), with the pts of // the just-written frame. (write_callback can be nullptr.) // Does not take ownership of ; elements in there, if any, // will be added to. // // If audio_codecpar is nullptr, there will be no audio stream. Mux(AVFormatContext *avctx, int width, int height, Codec video_codec, const std::string &video_extradata, const AVCodecParameters *audio_codecpar, AVColorSpace color_space, int time_base, std::function write_callback, WriteStrategy write_strategy, const std::vector &metrics, WithSubtitles with_subtitles = WITHOUT_SUBTITLES); ~Mux(); void add_packet(const AVPacket &pkt, int64_t pts, int64_t dts, AVRational timebase = { 1, TIMEBASE }, int stream_index_override = -1); int get_subtitle_stream_idx() const { return subtitle_stream_idx; } // As long as the mux is plugged, it will not actually write anything to disk, // just queue the packets. Once it is unplugged, the packets are reordered by pts // and written. This is primarily useful if you might have two different encoders // writing to the mux at the same time (because one is shutting down), so that // pts might otherwise come out-of-order. // // You can plug and unplug multiple times; only when the plug count reaches zero, // something will actually happen. void plug(); void unplug(); // Temporary stop the mux; any packets coming in are discarded, and any existing ones // in the queue will be dropped. Any writes in progress will finish as usual. // Incompatible with plug(). void drain(); void undrain(); private: // If write_strategy == WRITE_FOREGORUND, Must be called with held. void write_packet_or_die(const AVPacket &pkt, int64_t unscaled_pts); void thread_func(); void write_header(); WriteStrategy write_strategy; std::mutex mu; // These are only in use if write_strategy == WRITE_BACKGROUND. std::atomic writer_thread_should_quit{false}; std::thread writer_thread; AVFormatContext *avctx; // Protected by , iff write_strategy == WRITE_BACKGROUND. int plug_count = 0; // Protected by . bool drained = false; // Protected by . // Protected by . If write_strategy == WRITE_FOREGROUND, // this is only in use when plugging. struct QueuedPacket { AVPacket *pkt; int64_t unscaled_pts; }; std::vector packet_queue; std::condition_variable packet_queue_ready; std::vector streams; int subtitle_stream_idx = -1; std::function write_callback; std::vector metrics; friend struct PacketBefore; }; #endif // !defined(_MUX_H) nageru-2.3.0/shared/post_to_main_thread.h000066400000000000000000000013701450736322200204430ustar00rootroot00000000000000#ifndef _POST_TO_MAIN_THREAD_H #define _POST_TO_MAIN_THREAD_H 1 #include #include #include #include // http://stackoverflow.com/questions/21646467/how-to-execute-a-functor-in-a-given-thread-in-qt-gcd-style template static inline void post_to_main_thread(F &&fun) { QObject signalSource; QObject::connect(&signalSource, &QObject::destroyed, qApp, std::move(fun)); } template static inline void post_to_main_thread_and_wait(F &&fun) { std::promise done_promise; std::future done = done_promise.get_future(); post_to_main_thread(std::move(fun)); post_to_main_thread([&done_promise] { done_promise.set_value(); }); done.wait(); } #endif // !defined(_POST_TO_MAIN_THREAD_H) nageru-2.3.0/shared/read_file.cpp000066400000000000000000000021771450736322200166740ustar00rootroot00000000000000#include "shared/read_file.h" #include using namespace std; string read_file(const string &filename, const unsigned char *start, const size_t size) { FILE *fp = fopen(filename.c_str(), "r"); if (fp == nullptr) { // Fall back to the version we compiled in. (We prefer disk if we can, // since that makes it possible to work on shaders without recompiling // all the time.) if (start != nullptr) { return string(reinterpret_cast(start), reinterpret_cast(start) + size); } perror(filename.c_str()); abort(); } int ret = fseek(fp, 0, SEEK_END); if (ret == -1) { perror("fseek(SEEK_END)"); abort(); } int disk_size = ftell(fp); if (disk_size == -1) { perror("ftell"); abort(); } ret = fseek(fp, 0, SEEK_SET); if (ret == -1) { perror("fseek(SEEK_SET)"); abort(); } string str; str.resize(disk_size); ret = fread(&str[0], disk_size, 1, fp); if (ret == -1) { perror("fread"); abort(); } if (ret == 0) { fprintf(stderr, "Short read when trying to read %d bytes from %s\n", disk_size, filename.c_str()); abort(); } fclose(fp); return str; } nageru-2.3.0/shared/read_file.h000066400000000000000000000006341450736322200163350ustar00rootroot00000000000000#ifndef _READ_FILE_H #define _READ_FILE_H 1 #include #include // Read the contents of and return it as a string. // If the file does not exist, which is typical outside of development, // return the given memory area instead (presumably created by bin2h). std::string read_file(const std::string &filename, const unsigned char *start = nullptr, const size_t size = 0); #endif nageru-2.3.0/shared/ref_counted_gl_sync.h000066400000000000000000000017461450736322200204430ustar00rootroot00000000000000#ifndef _REF_COUNTED_GL_SYNC_H #define _REF_COUNTED_GL_SYNC_H 1 // A wrapper around GLsync (OpenGL fences) that is automatically refcounted. // Useful since we sometimes want to use the same fence two entirely different // places. (We could set two fences at the same time, but they are not an // unlimited hardware resource, so it would be a bit wasteful.) #include #include #include typedef std::shared_ptr<__GLsync> RefCountedGLsyncBase; class RefCountedGLsync : public RefCountedGLsyncBase { public: RefCountedGLsync() {} RefCountedGLsync(GLenum condition, GLbitfield flags) : RefCountedGLsyncBase(locked_glFenceSync(condition, flags), glDeleteSync) {} private: // These are to work around apitrace bug #446. static GLsync locked_glFenceSync(GLenum condition, GLbitfield flags) { std::lock_guard lock(fence_lock); return glFenceSync(condition, flags); } static std::mutex fence_lock; }; #endif // !defined(_REF_COUNTED_GL_SYNC_H) nageru-2.3.0/shared/ref_counted_texture.cpp000066400000000000000000000015071450736322200210330ustar00rootroot00000000000000#include "ref_counted_texture.h" #include #include RefCountedTexture create_texture_2d(GLuint width, GLuint height, GLenum internal_format, GLenum format, GLenum type, const GLvoid *pixels) { GLuint tex; glCreateTextures(GL_TEXTURE_2D, 1, &tex); check_error(); glTextureStorage2D(tex, 1, internal_format, width, height); check_error(); glTextureSubImage2D(tex, 0, 0, 0, width, height, format, type, pixels); check_error(); glTextureParameteri(tex, GL_TEXTURE_MIN_FILTER, GL_LINEAR); check_error(); glTextureParameteri(tex, GL_TEXTURE_MAG_FILTER, GL_LINEAR); check_error(); glTextureParameteri(tex, GL_TEXTURE_WRAP_S, GL_CLAMP_TO_EDGE); check_error(); glTextureParameteri(tex, GL_TEXTURE_WRAP_T, GL_CLAMP_TO_EDGE); check_error(); return RefCountedTexture(new GLuint(tex), TextureDeleter()); } nageru-2.3.0/shared/ref_counted_texture.h000066400000000000000000000011401450736322200204710ustar00rootroot00000000000000#ifndef _REF_COUNTED_TEXTURE_H #define _REF_COUNTED_TEXTURE_H 1 // A wrapper around an OpenGL texture that is automatically deleted. #include #include struct TextureDeleter { void operator() (GLuint *tex) { glDeleteTextures(1, tex); delete tex; } }; typedef std::unique_ptr UniqueTexture; typedef std::shared_ptr RefCountedTexture; // TODO: consider mipmaps. RefCountedTexture create_texture_2d(GLuint width, GLuint height, GLenum internal_format, GLenum format, GLenum type, const GLvoid *pixels); #endif // !defined(_REF_COUNTED_TEXTURE) nageru-2.3.0/shared/shared_defs.h000066400000000000000000000016501450736322200166710ustar00rootroot00000000000000#ifndef _SHARED_DEFS_H #define _SHARED_DEFS_H 1 #define OUTPUT_FREQUENCY 48000 // Currently needs to be exactly 48000, since bmusb outputs in that. #define MUX_OPTS { \ /* Make seekable .mov files, and keep MP4 muxer from using unlimited amounts of memory. */ \ { "movflags", "empty_moov+frag_keyframe+default_base_moof+skip_trailer" }, \ \ /* Make for somewhat less bursty stream output when using .mov. */ \ { "frag_duration", "125000" }, \ \ /* Keep nut muxer from using unlimited amounts of memory. */ \ { "write_index", "0" } \ } // In bytes. Beware, if too small, stream clients will start dropping data. // For mov, you want this at 10MB or so (for the reason mentioned above), // but for nut, there's no flushing, so such a large mux buffer would cause // the output to be very uneven. #define MUX_BUFFER_SIZE 10485760 #define MAX_VIDEO_CARDS 16 // Only really used by Nageru. #endif // !defined(_SHARED_DEFS_H) nageru-2.3.0/shared/text_proto.cpp000066400000000000000000000022671450736322200171710ustar00rootroot00000000000000#include #include #include #include #include #include #include using namespace std; using namespace google::protobuf; bool load_proto_from_file(const string &filename, Message *msg) { // Read and parse the protobuf from disk. int fd = open(filename.c_str(), O_RDONLY); if (fd == -1) { perror(filename.c_str()); return false; } io::FileInputStream input(fd); // Takes ownership of fd. if (!TextFormat::Parse(&input, msg)) { input.Close(); return false; } input.Close(); return true; } bool save_proto_to_file(const Message &msg, const string &filename) { // Save to disk. We use the text format because it's friendlier // for a user to look at and edit. int fd = open(filename.c_str(), O_WRONLY | O_TRUNC | O_CREAT, 0666); if (fd == -1) { perror(filename.c_str()); return false; } io::FileOutputStream output(fd); // Takes ownership of fd. if (!TextFormat::Print(msg, &output)) { // TODO: Don't overwrite the old file (if any) on error. output.Close(); return false; } output.Close(); return true; } nageru-2.3.0/shared/text_proto.h000066400000000000000000000010151450736322200166240ustar00rootroot00000000000000#ifndef _TEXT_PROTO_H #define _TEXT_PROTO_H 1 // Utility functions to serialize protobufs on disk. // We use the text format because it's friendlier // for a user to look at and edit. #include namespace google { namespace protobuf { class Message; } // namespace protobuf } // namespace google bool load_proto_from_file(const std::string &filename, google::protobuf::Message *msg); bool save_proto_to_file(const google::protobuf::Message &msg, const std::string &filename); #endif // !defined(_TEXT_PROTO_H) nageru-2.3.0/shared/timebase.h000066400000000000000000000020671450736322200162160ustar00rootroot00000000000000#ifndef _TIMEBASE_H #define _TIMEBASE_H 1 #include #include // Common timebase that allows us to represent one frame exactly in all the // relevant frame rates: // // Timebase: 1/120000 // Frame at 50fps: 2400/120000 // Frame at 60fps: 2000/120000 // Frame at 59.94fps: 2002/120000 // Frame at 23.976fps: 5005/120000 // // If we also wanted to represent one sample at 48000 Hz, we'd need // to go to 300000. Also supporting one sample at 44100 Hz would mean // going to 44100000; probably a bit excessive. constexpr int64_t TIMEBASE = 120000; // Some muxes, like MP4 (or at least avformat's implementation of it), // are not too fond of values above 2^31. At timebase 120000, that's only // about five hours or so, so we define a coarser timebase that doesn't // get 59.94 precisely (so there will be a marginal amount of pts jitter), // but can do at least 50 and 60 precisely, and months of streaming. #define COARSE_TIMEBASE 300 using TimebaseRatio = std::ratio<1, TIMEBASE>; #endif // !defined(_TIMEBASE_H) nageru-2.3.0/shared/va_display.cpp000066400000000000000000000112401450736322200171040ustar00rootroot00000000000000#include "va_display.h" #include #include #include #include #include #include #include #include #include using namespace std; VADisplayWithCleanup::~VADisplayWithCleanup() { if (va_dpy != nullptr) { vaTerminate(va_dpy); } if (x11_display != nullptr) { XCloseDisplay(x11_display); } if (drm_fd != -1) { close(drm_fd); } } unique_ptr va_open_display(const string &va_display) { if (va_display.empty() || va_display[0] != '/') { // An X display. Display *x11_display = XOpenDisplay(va_display.empty() ? nullptr : va_display.c_str()); if (x11_display == nullptr) { fprintf(stderr, "error: can't connect to X server!\n"); return nullptr; } unique_ptr ret(new VADisplayWithCleanup); ret->x11_display = x11_display; ret->can_use_zerocopy = true; ret->va_dpy = vaGetDisplay(x11_display); if (ret->va_dpy == nullptr) { return nullptr; } return ret; } else { // A DRM node on the filesystem (e.g. /dev/dri/renderD128). int drm_fd = open(va_display.c_str(), O_RDWR); if (drm_fd == -1) { perror(va_display.c_str()); return NULL; } unique_ptr ret(new VADisplayWithCleanup); ret->drm_fd = drm_fd; ret->can_use_zerocopy = false; ret->va_dpy = vaGetDisplayDRM(drm_fd); if (ret->va_dpy == nullptr) { return nullptr; } return ret; } } unique_ptr try_open_va( const string &va_display, const vector &desired_profiles, VAEntrypoint entrypoint, const vector &desired_configs, VAProfile *chosen_profile, string *error) { unique_ptr va_dpy = va_open_display(va_display); if (va_dpy == nullptr) { if (error) *error = "Opening VA display failed"; return nullptr; } int major_ver, minor_ver; VAStatus va_status = vaInitialize(va_dpy->va_dpy, &major_ver, &minor_ver); if (va_status != VA_STATUS_SUCCESS) { char buf[256]; snprintf(buf, sizeof(buf), "vaInitialize() failed with status %d\n", va_status); if (error != nullptr) *error = buf; return nullptr; } int num_entrypoints = vaMaxNumEntrypoints(va_dpy->va_dpy); unique_ptr entrypoints(new VAEntrypoint[num_entrypoints]); if (entrypoints == nullptr) { if (error != nullptr) *error = "Failed to allocate memory for VA entry points"; return nullptr; } // Try the profiles from highest to lowest until we find one that can be used. VAProfile found_profile = VAProfileNone; for (VAProfile profile : desired_profiles) { vaQueryConfigEntrypoints(va_dpy->va_dpy, profile, entrypoints.get(), &num_entrypoints); for (int slice_entrypoint = 0; slice_entrypoint < num_entrypoints; slice_entrypoint++) { if (entrypoints[slice_entrypoint] != entrypoint) { continue; } // We found a usable encoder/decoder, so return it. if (chosen_profile != nullptr) { *chosen_profile = profile; } found_profile = profile; break; } if (found_profile != VAProfileNone) { break; } } if (found_profile == VAProfileNone) { if (error != nullptr) *error = "Can't find entry points for suitable codec profile"; return nullptr; } int num_formats = vaMaxNumImageFormats(va_dpy->va_dpy); assert(num_formats > 0); unique_ptr formats(new VAImageFormat[num_formats]); va_status = vaQueryImageFormats(va_dpy->va_dpy, formats.get(), &num_formats); if (va_status != VA_STATUS_SUCCESS) { char buf[256]; snprintf(buf, sizeof(buf), "vaQueryImageFormats() failed with status %d\n", va_status); if (error != nullptr) *error = buf; return nullptr; } for (const ConfigRequest &request : desired_configs) { // Create the config. VAConfigAttrib attr = { VAConfigAttribRTFormat, request.rt_format }; va_status = vaCreateConfig(va_dpy->va_dpy, found_profile, entrypoint, &attr, 1, request.config_id); if (va_status == VA_STATUS_ERROR_UNSUPPORTED_ENTRYPOINT) { if (error != nullptr) *error = "No " + request.name + " hardware support"; return nullptr; } else if (va_status != VA_STATUS_SUCCESS) { char buf[256]; snprintf(buf, sizeof(buf), "vaCreateConfig() for %s failed with status %d\n", request.name.c_str(), va_status); if (error != nullptr) *error = buf; return nullptr; } // Find out which image format we're going to be using. bool format_found = false; for (int i = 0; i < num_formats; ++i) { if (formats[i].fourcc == request.fourcc) { memcpy(request.image_format, &formats[i], sizeof(VAImageFormat)); format_found = true; break; } } if (!format_found) { if (error != nullptr) *error = "Format for " + request.name + " not found"; return nullptr; } } return va_dpy; } nageru-2.3.0/shared/va_display.h000066400000000000000000000015631450736322200165600ustar00rootroot00000000000000#ifndef _VA_DISPLAY_H #define _VA_DISPLAY _H1 #include #include #include #include #include struct VADisplayWithCleanup { ~VADisplayWithCleanup(); VADisplay va_dpy; Display *x11_display = nullptr; bool can_use_zerocopy = true; // For H.264 encoding in Nageru. int drm_fd = -1; }; struct ConfigRequest { std::string name; // For error texts only. uint32_t rt_format, fourcc; // Output. VAConfigID *config_id; VAImageFormat *image_format; }; std::unique_ptr try_open_va( const std::string &va_display, const std::vector &desired_profiles, VAEntrypoint entrypoint, const std::vector &desired_configs, VAProfile *chosen_profile, std::string *error); // Can return nullptr on failure. #endif // !defined(_VA_DISPLAY_H) nageru-2.3.0/shared/va_resource_pool.cpp000066400000000000000000000047531450736322200203320ustar00rootroot00000000000000 #include #include "shared/va_resource_pool.h" using namespace std; VAResourcePool::VAResources VAResourcePool::get_va_resources(unsigned width, unsigned height, uint32_t fourcc) { { lock_guard lock(mu); for (auto it = freelist.begin(); it != freelist.end(); ++it) { if (it->width == width && it->height == height && it->fourcc == fourcc) { VAResources ret = *it; freelist.erase(it); return ret; } } } VAResources ret; ret.width = width; ret.height = height; ret.fourcc = fourcc; VASurfaceAttrib attrib; attrib.flags = VA_SURFACE_ATTRIB_SETTABLE; attrib.type = VASurfaceAttribPixelFormat; attrib.value.type = VAGenericValueTypeInteger; attrib.value.value.i = fourcc; VAStatus va_status; VAConfigID config_id; if (fourcc == VA_FOURCC_UYVY) { va_status = vaCreateSurfaces(va_dpy, VA_RT_FORMAT_YUV422, width, height, &ret.surface, 1, &attrib, 1); config_id = config_id_422; } else { assert(fourcc == VA_FOURCC_NV12); va_status = vaCreateSurfaces(va_dpy, VA_RT_FORMAT_YUV420, width, height, &ret.surface, 1, &attrib, 1); config_id = config_id_420; } va_status = vaCreateContext(va_dpy, config_id, width, height, 0, &ret.surface, 1, &ret.context); CHECK_VASTATUS(va_status, "vaCreateContext"); if (with_data_buffer) { va_status = vaCreateBuffer(va_dpy, ret.context, VAEncCodedBufferType, width * height * 3 + 8192, 1, nullptr, &ret.data_buffer); CHECK_VASTATUS(va_status, "vaCreateBuffer"); } if (fourcc == VA_FOURCC_UYVY) { va_status = vaCreateImage(va_dpy, &uyvy_format, width, height, &ret.image); CHECK_VASTATUS(va_status, "vaCreateImage"); } else { assert(fourcc == VA_FOURCC_NV12); va_status = vaCreateImage(va_dpy, &nv12_format, width, height, &ret.image); CHECK_VASTATUS(va_status, "vaCreateImage"); } return ret; } void VAResourcePool::release_va_resources(VAResourcePool::VAResources resources) { lock_guard lock(mu); if (freelist.size() > 50) { auto it = freelist.end(); --it; VAStatus va_status; if (with_data_buffer) { va_status = vaDestroyBuffer(va_dpy, it->data_buffer); CHECK_VASTATUS(va_status, "vaDestroyBuffer"); } va_status = vaDestroyContext(va_dpy, it->context); CHECK_VASTATUS(va_status, "vaDestroyContext"); va_status = vaDestroySurfaces(va_dpy, &it->surface, 1); CHECK_VASTATUS(va_status, "vaDestroySurfaces"); va_status = vaDestroyImage(va_dpy, it->image.image_id); CHECK_VASTATUS(va_status, "vaDestroyImage"); freelist.erase(it); } freelist.push_front(resources); } nageru-2.3.0/shared/va_resource_pool.h000066400000000000000000000047701450736322200177760ustar00rootroot00000000000000#ifndef _VA_RESOURCE_POOL #define _VA_RESOURCE_POOL 1 #include #include #include #include #include #include #define CHECK_VASTATUS(va_status, func) \ if (va_status != VA_STATUS_SUCCESS) { \ fprintf(stderr, "%s:%d (%s) failed: %s\n", __func__, __LINE__, func, vaErrorStr(va_status)); \ exit(1); \ } #define CHECK_VASTATUS_RET(va_status, func) \ if (va_status != VA_STATUS_SUCCESS) { \ fprintf(stderr, "%s:%d (%s) failed with %d\n", __func__, __LINE__, func, va_status); \ return nullptr; \ } class VAResourcePool { public: struct VAResources { unsigned width, height; uint32_t fourcc; VASurfaceID surface; VAContextID context; VABufferID data_buffer; VAImage image; }; VAResourcePool(VADisplay va_dpy, VAImageFormat uyvy_format, VAImageFormat nv12_format, VAConfigID config_id_422, VAConfigID config_id_420, bool with_data_buffer) : va_dpy(va_dpy), uyvy_format(uyvy_format), nv12_format(nv12_format), config_id_422(config_id_422), config_id_420(config_id_420), with_data_buffer(with_data_buffer) {} VAResources get_va_resources(unsigned width, unsigned height, uint32_t fourcc); void release_va_resources(VAResources resources); private: const VADisplay va_dpy; VAImageFormat uyvy_format, nv12_format; const VAConfigID config_id_422, config_id_420; const bool with_data_buffer; std::mutex mu; std::list freelist; // Under mu. }; // RAII wrapper to release VAResources on return (even on error). class ReleaseVAResources { public: ReleaseVAResources() : committed(true) {} ReleaseVAResources(VAResourcePool *pool, const VAResourcePool::VAResources &resources) : pool(pool), resources(resources) {} ReleaseVAResources(ReleaseVAResources &) = delete; ReleaseVAResources(ReleaseVAResources &&other) : pool(other.pool), resources(other.resources), committed(other.committed) { other.commit(); } ReleaseVAResources &operator= (ReleaseVAResources &) = delete; ReleaseVAResources &operator= (ReleaseVAResources &&other) { if (!committed) { pool->release_va_resources(resources); } pool = other.pool; resources = std::move(other.resources); committed = other.committed; other.commit(); return *this; } ~ReleaseVAResources() { if (!committed) { pool->release_va_resources(resources); } } void commit() { committed = true; } private: VAResourcePool *pool = nullptr; VAResourcePool::VAResources resources; bool committed = false; }; #endif // !defined(_VA_RESOURCE_POOL)